Angene Chemical是中國大型化工製造廠，已生產超過20萬種化學藥品! 另可依您的化學式為您量身訂製高純度的 Customer Chemical Compound 合成服務 ( synthesis service )
歡迎以 CAS no. 搜尋，或來電洽翰新公司產品專員，
Angene is pledged to provide quality chemicals for use in research and development and commercial manufacturing. Angene offers over 100,000 products() including lab reagents, intermediates, bulk commodities, agrochemicals, natural ingredients, and active pharmaceutical ingredients (APIs). In addition to the 100,000+ products, Angene offers custom synthesis of chemicals that are not commercially available.
| CAS_Number | SMILES | Chemical_Name | Catalog_Number | Inventory |
| 100-21-0 | O=C(O)C1=CC=C(C(O)=O)C=C1 | Terephthalic acid | AG00005N | 7500g |
| 100-19-6 | CC(C1=CC=C([N+]([O-])=O)C=C1)=O | 1-(4-Nitrophenyl)ethanone | AG00005P | 8000g |
| 100-18-5 | C(C)(C)c1ccc(cc1)C(C)C | 1,4-Diisopropylbenzene | AG00005Q | 200g |
| 100-13-0 | C=CC1=CC=C([N+]([O-])=O)C=C1 | 4-Nitrostyrene | AG00005V | 200g |
| 100-10-7 | C1=C(N(C)C)C=CC(=C1)C=O | 4-(Dimethylamino)benzaldehyde | AG00005Y | 45925g |
| 100-09-4 | O=C(O)C1=CC=C(OC)C=C1 | 4-Methoxybenzoic acid | AG00005Z | 3500g |
| 100-06-1 | CC(C1=CC=C(OC)C=C1)=O | 4′-Methoxyacetophenone | AG000061 | 5000g |
| 100-49-2 | OCC1CCCCC1 | CYCLOHEXANEMETHANOL | AG000066 | 5500g |
| 100-48-1 | N#CC1=CC=NC=C1 | 4-Cyanopyridine | AG000067 | 975g |
| 100-45-8 | N#CC1CCC=CC1 | 4-Cyano-1-cyclohexene | AG00006A | 10g |
| 100-33-4 | N=C(N)C1=CC=C(OCCCCCOC2=CC=C(C=C2)C(N)=N)C=C1 | 4-{[5-(4-carbamimidoylphenoxy)pentyl]oxy}benzene-1-carboximidamide | AG00006J | 1.25g |
| 100-32-3 | O=[N+](C1=CC=C(SSC2=CC=C([N+]([O-])=O)C=C2)C=C1)[O-] | 4,4′-Dinitrodiphenyl disulfide | AG00006K | 500g |
| 100-31-2 | O=C(O)C1=CC=C(/C=C/C2=CC=C(C=C2)C(O)=O)C=C1 | 4,4′-(Ethene-1,2-diyl)dibenzoic acid | AG00006L | 200g |
| 100-27-6 | O=[N+](C1=CC=C(C=C1)CCO)[O-] | 4-Nitrophenethyl alcohol | AG00006O | 2000g |
| 100-26-5 | OC(=O)C1=CN=C(C=C1)C(O)=O | 2,5-Pyridinedicarboxylic acid | AG00006P | 500g |
| 100-76-5 | N1(CC2)CCC2CC1 | 1-Azabicyclo[2.2.2]octane | AG00006Q | 500g |
| 100-75-4 | O=NN1CCCCC1 | 1-Nitrosopiperidine | AG00006R | 20g |
| 100-72-1 | OCC1CCCCO1 | (Tetrahydro-2H-pyran-2-yl)methanol | AG00006U | 100g |
| 100-70-9 | N#CC1=NC=CC=C1 | 2-Cyanopyridine | AG00006W | 8000g |
| 100-68-5 | CSC1=CC=CC=C1 | Methylphenylsulfide | AG00006Y | 85525g |
| 100-67-4 | [K]OC1=CC=CC=C1 | potassium phenolate | AG00006Z | 300g |
| 100-64-1 | ON=C1CCCCC1 | Cyclohexanone oxime | AG000072 | 4500g |
| 100-55-0 | OCC1=CC=CN=C1 | 3-Pyridinemethanol | AG00007B | 3000g |
| 100-54-9 | N#CC1=CN=CC=C1 | 3-Cyanopyridine | AG00007C | 9000g |
| 100-96-9 | COc1cc(N)cc(c1)N | 5-Methoxybenzene-1,3-diamine | AG00007P | 1.5g |
| 100-94-7 | C([N+](Cc1ccccc1)(C)C)c1ccccc1.[Cl-] | Benzenemethanaminium,N,N-dimethyl-N-(phenylmethyl)-, chloride (1:1) | AG00007Q | 2g |
| 100-90-3 | CC(=O)Nc1ccc(cc1)S(=O)(=O)Nc2nc(C)cc(C)n2 | N-Acetyl Sulfamethazine | AG00007R | 0.05g |
| 100-88-9 | O=S(O)(NC1CCCCC1)=O | Cyclamic acid | AG00007S | 500g |
| 100-84-5 | COC1=CC=CC(C)=C1 | 1-Methoxy-3-methylbenzene | AG00007V | 325g |
| 100-83-4 | O=CC1=CC=CC(O)=C1 | 3-Hydroxybenzaldehyde | AG00007W | 2000g |
| 100-82-3 | NCC1=CC(F)=CC=C1 | 3-Fluorobenzylamine | AG00007X | 250g |
| 100-80-1 | C=CC1=CC(C)=CC=C1 | 3-Methylstyrene | AG00007Z | 100g |
| 1000017-92-4 | CC1=C(Br)C(Cl)=NC=C1Br | 2-Chloro-3,5-dibromo-4-methylpyridine | AG000081 | 7g |
| 1000-86-8 | C(=C(C)C)C(=C)C | 2,4-Dimethyl-1,3-pentadiene | AG000089 | 5g |
| 1000-70-0 | C[Si](C)(C)N=C=N[Si](C)(C)C | BIS(TRIMETHYLSILYL)CARBODIIMIDE | AG00008E | 125g |
| 1000-63-1 | CCCCOC(C)(C)C | 1-(tert-Butoxy)butane | AG00008H | 2g |
| 1000-56-2 | CCCOS(=O)(=O)[O-].[Na+] | Sodium propyl sulfate | AG00008L | 5g |
| 1000029-07-1 | Ic1cnc(s1)c1ccccc1 | 5-Iodo-2-phenyl-1,3-thiazole | AG00008Q | 5g |
| 1000018-58-5 | CC1=C(Br)C=C(Br)C(Cl)=N1 | 3,5-Dibromo-2-chloro-6-methylpyridine | AG00008Y | 225g |
| 1000018-56-3 | O=C(C1=CN2C(C=NC(Br)=C2)=N1)O | 6-Bromoimidazo[1，2-a]pyrazine-2-carboxylic acid | AG00008Z | 1g |
| 1000018-13-2 | O=C(OC)C1=CC(Br)=C(C(C)C)C=C1N | Methyl 2-amino-5-bromo-4-isopropylbenzoate | AG000097 | 50g |
| 1000018-06-3 | [Br]C2(=CC=1(C(=NN(C=1C=C2)C)N)) | 3-Amino-5-bromo-1-methyl-1H-indazole | AG000099 | 200g |
| 1000017-97-9 | N12C(N)=CC=CC1=NC(C(OCC)=O)=C2 | Ethyl 5-aminoimidazo[1,2-a]pyridine-2-carboxylate | AG00009B | 0.5g |
| 1000068-25-6 | FC1=CC=CC2=C1C=C(B(O)O)N2C(OC(C)(C)C)=O | 1-BOC-4-fluoroindole-2-boronic acid | AG00009G | 25g |
| 1000068-23-4 | COC1=CC=CC2=C1C=C(B(O)O)N2C(=O)OC(C)(C)C | 1H-Indole-1-carboxylic acid, 2-borono-4-methoxy-, 1-(1,1-dimethylethyl) est | AG00009I | 3g |
| 1000053-23-5 | O=C(OC(C)(C)C)NC1CCN(CC1)c1ccc(cc1F)N | Carbamic acid, N-[1-(4-amino-2-fluorophenyl)-4-piperidinyl]-, 1,1-dimethylet | AG00009L | 1g |
| 1000045-93-1 | COC(C1=CC2=C(CCC(N2)=O)C=C1)=O | Methyl 2-oxo-1,2,3,4-tetrahydroquinoline-7-carboxylate | AG00009M | 1g |
| 100004-94-2 | O=C(O)C1=CC=NC(C2=CC=CC(C)=C2)=C1 | 2-(3-methylphenyl)isonicotinic acid | AG0000A1 | 0.5g |
| 1000171-05-0 | COc1cc(OC)cc(c1c1ccccc1P(C1CCCCC1)C1CCCCC1)OC | Phosphine, dicyclohexyl(2′,4′,6′-trimethoxy[1,1′-biphenyl]-2-yl)- | AG0000A4 | 5g |
| 1000152-84-0 | FC(C1=CC(Br)=NC(Br)=C1)(F)F | 2,6-Dibromo-4-(trifluoromethyl)pyridine | AG0000A8 | 50g |
| 1000198-80-0 | FC1=CC(CC2CNCC2)=CC=C1 | 3-[(3-fluorophenyl)methyl]pyrrolidine | AG0000AU | 1g |
| 1000198-76-4 | FC(C1=CC=C(C2CNCC2)C=C1)(F)F | 3-[4-(Trifluoromethyl)phenyl]pyrrolidine | AG0000AV | 1g |
| 10002-29-6 | O=C(O)CSC1=NC=CC=C1 | (Pyridin-2-ylthio)acetic acid | AG0000BG | 1g |
| 1000313-01-8 | O=C(C1N(C(OC(C)(C)C)=O)CC(F)(F)C1)O | 1-(tert-Butoxycarbonyl)-4,4-difluoropyrrolidine-2-carboxylic acid | AG0000BJ | 25g |
| 1000279-69-5 | CC1=C(C(CC)=O)C=C(C2=CC=C(Cl)C=C2)N1C3=CC=C(S(N)(=O)=O)C=C3 | A-867744 | AG0000BR | 0.2g |
| 1000269-51-1 | C(C1=CC=CC=C1)OC(=O)C1=CC=C(C=N1)B(O)O | (6-((Benzyloxy)carbonyl)pyridin-3-yl)boronic acid | AG0000BX | 6g |
| 10003-42-6 | O=C(CNC(/C=C/C1=CC=C(C=C1)O)=O)O | (3-(4-Hydroxyphenyl)acryloyl)glycine | AG0000C6 | 0.11g |
| 1000339-55-8 | FC(F)(F)OC1(=CC(=CC(=C1)C)C=O) | 3-Methyl-5-(trifluoromethoxy)benzaldehyde | AG0000C7 | 2.5g |
| 1000339-54-7 | COC1=C(C=CC=C1C=O)C(F)(F)F | 2-Methoxy-3-(trifluoromethyl)benzaldehyde | AG0000C8 | 0.5g |
| 1000339-52-5 | FC1=CC=CC(=C1[N+](=O)[O-])C#N | 3-Fluoro-2-nitrobenzonitrile | AG0000C9 | 50g |
| 1000339-51-4 | FC1=CC=CC(=C1[N+](=O)[O-])C(=O)O | 3-Fluoro-2-nitrobenzoic acid | AG0000CA | 500g |
| 1000339-24-1 | N#CC1=CC=CC(O)=C1F | 2-Fluoro-3-hydroxybenzonitrile | AG0000CO | 3g |
| 1000339-23-0 | NC1=NC=C(C(=C1)C(=O)O)Br | 2-AMino-5-broMoisonicotinic acid | AG0000CP | 50g |
| 100032-79-9 | NNc1ccc(cc1[N+](=O)[O-])Br.Cl | Hydrazine, (4-bromo-2-nitrophenyl)-, hydrochloride (1:1) | AG0000CV | 30g |
| 1000340-19-1 | [O-][N+](=O)c1cc2cc[nH]c2nc1C | 6-Methyl-5-nitro-1H-pyrrolo[2,3-b]pyridine | AG0000D1 | 5g |
| 1000340-18-0 | CC1=C(Cl)C=C2C(NC=C2)=N1 | 5-Chloro-6-methyl-1H-pyrrolo[2,3-b]pyridine | AG0000D2 | 4g |
| 1000340-58-8 | CC1=CC(Br)=C2C(NC=C2)=N1 | 4-Bromo-6-methyl-1H-pyrrolo[2,3-b]pyridine | AG0000EQ | 0.5g |
| 1000340-55-5 | COc1cc(C)c2c(c1)c(C=O)n[nH]2 | 5-Methoxy-7-methyl-1H-indazole-3-carbaldehyde | AG0000ET | 0.5g |
| 1000340-54-4 | N#CC1=C2C(NC=C2Br)=NC=C1 | 3-Bromo-1H-pyrrolo[2,3-b]pyridine-4-carbonitrile | AG0000EU | 5g |
| 1000340-53-3 | O=C(C1=NNC2=C1C=CC=C2C)O | 7-Methyl-1H-indazole-3-carboxylic acid | AG0000EV | 2g |
| 1000340-51-1 | CC1=CC=CC2=C(C=O)NN=C12 | 7-Methyl-1h-indazole-3-carbaldehyde | AG0000EX | 20g |
| 1000340-92-0 | CC1=NC2=C(C=C1C)C=CN2 | 5,6-Dimethyl-1H-pyrrolo[2,3-b]pyridine | AG0000F6 | 5g |
| 1000340-86-2 | N#CC1=C(C)N=C(NC=C2)C2=C1 | 6-Methyl-1H-pyrrolo[2,3-b]pyridine-5-carbonitrile | AG0000FC | 0.75g |
| 1000340-84-0 | CC(N1C=CC2=C(Br)C=CN=C21)=O | 1-(4-Bromo-1H-pyrrolo[2,3-b]pyridin-1-yl)ethanone | AG0000FE | 2g |
| 1000340-82-8 | NC1=CC=CC2=C1NN=C2I | 3-iodo-1H-indazol-7-amine | AG0000FG | 5g |
| 1000340-80-6 | NC1=C2C(NC=C2)=NC(Cl)=C1 | 4-Amino-6-chloro-7-azaindole | AG0000FI | 2g |
| 1000340-76-0 | N#CC1=C2C(NC=C2)=NC(Cl)=C1 | 6-Chloro-1H-pyrrolo[2,3-b]pyridine-4-carbonitrile | AG0000FM | 0.75g |
| 1000341-25-2 | COC1=NC=CC2=C1C(I)=CN2 | 3-Iodo-4-methoxy-1H-pyrrolo[3,2-c]pyridine | AG0000FO | 5g |
| 1000341-24-1 | Clc1n[nH]c2c1ccc(c2)C(F)(F)F | 3-Chloro-6-(trifluoromethyl)-1H-indazole | AG0000FP | 0.75g |
| 1000341-22-9 | COC1=NC=CC2=C1C(Br)=CN2 | 3-Bromo-4-methoxy-1H-pyrrolo[3,2-c]pyridine | AG0000FR | 3g |
| 1000341-21-8 | FC(C1=CC2=C(C=C1)C(Br)=NN2)(F)F | 3-Bromo-6-(trifluoromethyl)-1H-indazole | AG0000FS | 25g |
| 1000341-18-3 | O=C(O)C1=CC(C#N)=CC(N)=C1 | 3-Amino-5-Cyanobenzoic Acid | AG0000FV | 40g |
| 1000341-16-1 | Clc1n[nH]c2c1cc(cc2)C#N | 3-Chloro-1H-indazole-5-carbonitrile | AG0000FX | 2g |
| 1000341-09-2 | COc1ccc2c(n1)c(Br)c[nH]2 | 3-Bromo-5-methoxy-1H-pyrrolo[3,2-b]pyridine | AG0000G4 | 0.15g |
| 1000341-04-7 | CN1CCC(F)(CO)CC1 | 4-Fluoro-1-methyl-4-piperidinemethanol | AG0000G9 | 10g |
| 1000343-58-7 | [Br]C1(=NNC2(=C1C=C([N+](=O)[O-])C(=C2)C)) | 3-Bromo-6-methyl-5-nitro-1H-indazole | AG0000LJ | 55g |
| 1000343-56-5 | IC1=CC2=C(NN=C2)C(Cl)=C1 | 7-Chloro-5-iodo-1H-indazole | AG0000LK | 0.5g |
| 1000343-46-3 | BrC1=C2C(=NNC2=CC=C1)Cl | 4-Bromo-3-chloro-1H-indazole | AG0000LR | 6g |
| 1000343-43-0 | NC1=CC2=C(NN=C2Br)C=C1C | 3-Bromo-6-methyl-1H-Indazol-5-amine | AG0000LT | 3g |
| 1000343-89-4 | CC1=C(Br)C=CC2=C1NC=C2 | 6-Bromo-7-methyl-1H-indole | AG0000M6 | 30g |
| 1000343-82-7 | CC1=C(C=C2C(=CN=C2N1)I)Br | 5-Bromo-3-iodo-6-methyl-1h-pyrrolo[2,3-b]pyridine | AG0000MB | 7g |
| 100037-69-2 | O=S(CCN1CCN(CCS(=O)(O)=O)CC1)(O)=O.O=S(CCN2CCN(CCS(=O)(O)=O)CC2)(O) | Sodium 1,1′-(piperazine-1,4-diyl)diethanesulfonate 1-(4-(1-sulfoethyl)pipera | AG0000MG | 5000g |
| 100036-64-4 | FC(C1=CC(C2=CC=C(C=O)C=C2)=CC=C1)(F)F | 3′-Trifluoromethylbiphenyl-4-carbaldehyde | AG0000ML | 10g |
| 1000413-72-8 | O=C(O)C[C@@H]1COC2=CC(OCC3=CC(C4=C(C)C=C(OCCCS(=O)(C)=O)C=C4C)=CC | [(3S)-6-({3-[4-(3-methanesulfonylpropoxy)-2,6-dimethylphenyl]phenyl}meth | AG0000MM | 1.25g |
| 1000386-01-5 | O=c1c2c(CCN(C2)C(=O)OC(C)(C)C)[nH]c(n1)N | tert-Butyl 2-amino-4-oxo-3,4,7,8-tetrahydropyrido[4,3-d]pyrimidine-6(5H)-ca | AG0000MP | 2g |
| 1000373-79-4 | O=C(C1=CC2=C(C=C1N)C=NN2)OC | Methyl 4-amino-1h-indazole-6-carboxylate | AG0000MQ | 8g |
| 1000370-80-8 | O=C(N1C[C@H](NC2=CC=CC=C2N)CC1)OC(C)(C)C | (R)-tert-Butyl 3-((2-aminophenyl)amino)pyrrolidine-1-carboxylate | AG0000MR | 0.5g |
| 1000370-24-0 | O=Cc1ccc(OCc2cccc(F)c2)c(Cc2cccc(F)c2)c1 | 4-[(3-Fluorophenyl)methoxy]-3-[(3-fluorophenyl)methyl]benzaldehyde | AG0000MT | 1g |
| 100041-05-2 | N1C2=C(C=CC=C2)C2C=C(C(O)=O)N=C(C3=CC=C(CO)O3)C1=2 | Flazin | AG0000MV | 0.005g |
| 10004-45-2 | OC1=NOC(CC)=C1 | 5-Ethylisoxazol-3-ol | AG0000N5 | 2g |
| 10004-17-8 | OCC1(C)OCCO1 | 1,3-DIOXOLANE-2-METHANOL, 2-METHYL- | AG0000N9 | 0.5g |
| 1000415-75-7 | COC1=CC=C([C@@H]2[C@@H](C(O)=O)CN(C(OC(C)(C)C)=O)C2)C=C1 | 1-[(tert-Butyl)oxycarbonyl]-4-(4-methoxyphenyl)pyrrolidine-3-carboxylic aci | AG0000NA | 30g |
| 1000414-38-9 | O=C(OC)C[C@@H]1COC2=CC(O)=CC=C12 | (S)-Methyl 2-(6-hydroxy-2,3-dihydrobenzofuran-3-yl)acetate | AG0000NB | 1g |
| 1000414-37-8 | OC(CC1C2=C(C=C(C=C2)O)OC1)=O | 2-(6-Hydroxy-2,3-dihydrobenzofuran-3-yl)acetic acid | AG0000NC | 20g |
| 100063-22-7 | O=C(C1=C(N)C=C(C2=CC=CC=C2)S1)OC | Methyl 3-amino-5-phenylthiophene-2-carboxylate | AG0000TB | 600g |
| 10007-84-8 | O=C([O-])C1=C(Cl)C=CC=C1Cl.[Na+] | Sodium 2,6-dichlorobenzoate | AG0000TH | 20g |
| 1000773-62-5 | FC(C1=CN=C(CBr)C=C1)(F)F | 2-(Bromomethyl)-5-(trifluoromethyl)pyridine | AG0000TN | 15g |
| 1000796-87-1 | COC1=C(OCC2=CC=CC=C2)C=CC(B2OC(C)(C)C(C)(C)O2)=C1 | 4-(Benzyloxy)-3-methoxyphenylboronic acid, pinacol ester | AG0000U7 | 10g |
| 1000796-62-2 | Cl.CC(OC(N1CC(N)CCC1)=O)(C)C | 3-Amino-1-boc-piperidine HCl | AG0000U8 | 0.5g |
| 1000783-10-7 | CCOC(=O)C1=NC=C(C(=C1)N)[N+](=O)[O-] | Ethyl 4-amino-5-nitropicolinate | AG0000UB | 9g |
| 100079-39-8 | COc1ccccc1C=CC(=O)c1c(OC)cc(O)c(OC)c1O | 2′,4′-Dihydroxy-2,3′,6′-trimethoxychalcone | AG0000UI | 0.005g |
| 10008-73-8 | C=C1CCC(=O)O1 | GAMMA-METHYLENE-GAMMA-BUTYROLACTONE | AG0000UT | 0.2g |
| 1000895-25-9 | OCC1=NNC([N+]([O-])=O)=C1 | (5-Nitro-1H-pyrazol-3-yl)methanol | AG0000UW | 11.3g |
| 1000878-48-7 | C[C@H](N)C1=C(F)C=CC=C1Cl.[H]Cl | (S)-1-(2-Chloro-6-fluorophenyl)ethanamine hydrochloride | AG0000UX | 14g |
| 1000878-44-3 | CC(N)C1=C(F)C=CC=C1Cl | 1-(2-Chloro-6-fluorophenyl)ethanamine | AG0000UY | 5g |
| 1000853-53-1 | C[C@H]1N(C(OC(C)(C)C)=O)CCNC1.[H]Cl | (R)-tert-Butyl 2-methylpiperazine-1-carboxylate hydrochloride | AG0000V0 | 500g |
| 1000843-61-7 | NC1=NC=C(OC)C(OC)=C1 | 4,5-Dimethoxypyridin-2-amine | AG0000V3 | 5g |
| 1000805-94-6 | NNCC1=CC=CC(F)=C1.[H]Cl.[H]Cl | (3-Fluorobenzyl)hydrazine dihydrochloride | AG0000V5 | 50g |
| 1000805-93-5 | Cl.Cl.NNCc1ccc(F)cc1 | (4-Fluorobenzyl)hydrazine dihydrochloride | AG0000V6 | 25g |
| 1000802-75-4 | COC1=NC(C)=CC=C1B(O)O | 2-Methoxy-6-methylpyridine-3-boronic acid | AG0000V7 | 1g |
| 1000802-52-7 | CC1(C)C(C)(C)OB(C2=CN(CCN3CCCC3)N=C2)O1 | 1-(2-(Pyrrolidin-1-yl)ethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1 | AG0000V9 | 5g |
| 10009-20-8 | N[C@@H](CCCCNC(C(F)(F)F)=O)C(O)=O | H-Lys(Tfa)-OH | AG0000W6 | 1000g |
| 1000933-99-2 | CC(C)(C)OC(=O)NC1CC2(CC(O)C2)C1 | 2-(Boc-amino)-6-hydroxyspiro[3.3]heptane | AG0000W8 | 100g |
| 1000932-73-9 | O=C(OC(C)(C)C)NCC1CNC2=C1C=CC=C2 | tert-Butyl 2,3-dihydro-1h-indol-3-ylmethylcarbamate | AG0000W9 | 4g |
| 1000998-59-3 | ClC(C=C1)=CC=C1C2=NC(COC3=CC=CC(CN(C(OC)=O)CC(O)=O)=C3)=C(C)O2 | BMS-687453 | AG0000WV | 0.5g |
| 1000995-48-1 | O=C1CCC(=O)OC/C=C(C)/C(=O)OC[C@]2([C@@H]3CC4=C(CO1)C(=O)O[C@]14C | Chloramultilide C | AG0000WW | 0.005g |
| 1000995-47-0 | O=C1OCC2=C3C[C@H]4[C@](O)(COC(=O)/C=C(COC(=O)CC1)/C)[C@@H]1[C@H] | Chloramultilide B | AG0000WX | 0.005g |
| 1000994-95-5 | CC(F)(F)C1=CC=C(Br)C=C1 | 1-Bromo-4-(1,1-difluoroethyl)benzene | AG0000WY | 125g |
| 1000994-94-4 | CC1(C)C(C)(C)OB(C2=CC=C(C(F)(F)C)C=C2)O1 | 1,3,2-Dioxaborolane, 2-[4-(1,1-difluoroethyl)phenyl]-4,4,5,5-tetramethyl- | AG0000WZ | 10g |
| 1000993-70-3 | CN(C(=O)c1cccc(c1O)N)C.Cl | 3-Amino-2-hydroxy-N,N-dimethylbenzamide Hydrochloride | AG0000X0 | 3g |
| 1000981-74-7 | N1C=2N(CCC1)C(C=CC2)=O | 3,4-Dihydro-1H-pyrido[1,2-a]pyrimidin-6(2H)-one | AG0000X4 | 0.5g |
| 1001-26-9 | O=C(OCC)/C=C/OCC | Ethyl 3-ethoxyprop-2-enoate | AG0000XB | 239g |
| 1001-19-0 | O=C(OCC)[C@H](N)CCC(OCC)=O.[H]Cl | D-Glutamic acid diethyl ester hydrochloride | AG0000XE | 200g |
| 504-33-6 | O=C(O)C(N)CCS(=O)(O)=O | DL-Homocysteic Acid | AG0000XJ | 50g |
| 10010-93-2 | FC(C1=CC(C)=NN1)(F)F | 5-Methyl-3-(trifluoromethyl)-1h-pyrazole | AG0000XN | 1000g |
| 10010-67-0 | O=S(CCN1CCN(CCS(=O)([O-])=O)CC1)(O)=O.[Na+] | Piperazine-1,4-bis(ethanesulfonic acid) monosodium salt hydrate | AG0000XP | 5500g |
| 1001-75-8 | CC(=C)CCC(O)=O | 4-Methylpent-4-enoic acid | AG0000XX | 10g |
| 1001-58-7 | SCCC#N | 3-Mercaptopropanenitrile | AG0000Y1 | 40g |
| 1001754-59-1 | O=C(C1(F)CN(C(OC(C)(C)C)=O)CC1)O | 1-(Tert-Butoxycarbonyl)-3-Fluoropyrrolidine-3-Carboxylic Acid | AG00015G | 25g |
| 100173-92-0 | N(CCN(CCCC)CCCC)CCN(CCCC)CCCC | N,N,N”,N”-Tetrabutyldiethylenetriamine | AG00015H | 8g |
| 10017-53-5 | CC1=CC(OCC(N)=O)=CC=C1 | 2-(3-methylphenoxy)acetamide | AG00015M | 125g |
| 10017-44-4 | C([N+](C)(C)C)[C@@H](O)CC(O)=O.[Cl-] | D-Carnitine (hydrochloride) | AG00015N | 0.25g |
| 10017-39-7 | O=C(O)C1=CC=CC=C1CN.[H]Cl | 2-(AMINOMETHYL)BENZOIC ACID HYDROCHLORIDE | AG00015O | 5g |
| 1001757-50-1 | NC1=NN(CC2=C(Cl)C=C(F)C=C2)C=C1 | 3-Amino-1-(2-chloro-4-fluoro-benzyl)pyrazole | AG00015U | 2g |
| 100185-53-3 | CSC1=NC(=O)CCN1 | 2-(Methylthio)-5,6-dihydropyrimidin-4(1h)-one | AG000162 | 5g |
| 10018-78-7 | O=C(OC1CCCCC1)CCC(O)=O | 4-(Cyclohexyloxy)-4-oxobutanoic acid | AG00016D | 5g |
| 1001907-64-7 | O=C(C1CC2(OCCO2)C1)O | 5,8-Dioxaspiro[3.4]octane-2-carboxylic acid | AG00016H | 100g |
| 1001907-60-3 | CN1N=CC2=C(C=CC=C12)B(O)O | 1-Methylindazole-4-boronic acid | AG00016I | 20g |
| 1001907-59-0 | CN1N=CC2=CC=CC(B(O)O)=C12 | 1-Methylindazole-7-boronic acid | AG00016J | 10g |
| 1001907-58-9 | CN1N=C2C(B(O)O)=CC=CC2=C1 | 2-Methyl-2h-indazole-7-boronic acid | AG00016K | 10g |
| 1001907-57-8 | CN1C=C2C=CC(=CC2=N1)B(O)O | 2-methyl-2H-indazole-6-boronic acid | AG00016L | 25g |
| 1001907-56-7 | CN1N=C2C=CC=C(B(O)O)C2=C1 | 2-Methylindazole-4-boronic acid | AG00016M | 5g |
| 1001907-44-3 | CC(OC(N1CC(C(NN)=O)C1)=O)(C)C | tert-Butyl 3-(hydrazinecarbonyl)azetidine-1-carboxylate | AG00016N | 0.1g |
| 1001907-23-8 | O=C(N1N=CC2=C1C=CC(I)=C2)OC(C)(C)C | tert-Butyl 5-iodo-1H-indazole-1-carboxylate | AG00016O | 3g |
| 1001906-63-3 | CC(=O)C1=CC=C2NN=CC2=C1 | 1-(1H-Indazol-5-yl)ethanone | AG00016P | 25g |
| 1001070-26-3 | CCOC(NC1=C(I)C=CC(F)=N1)=O | Ethyl 6-fluoro-3-iodopyridin-2-ylcarbamate | AG0000YA | 1.5g |
| 1001070-23-0 | BrC1=CC=C2C(=N1)N(C=C2)S(=O)(=O)C2=CC=CC=C2 | 6-Bromo-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine | AG0000YC | 5g |
| 1001067-09-9 | O=C(N1N=C([N+]([O-])=O)N=C1)OCC[Si](C)(C)C | 2-(Trimethylsilyl)ethyl 3-nitro-1H-1,2,4-triazole-1-carboxylate | AG0000YD | 35g |
| 1001056-83-2 | ClC1=CN=CC(Br)=C1Cl | 3-Bromo-4,5-dichloropyridine | AG0000YE | 48g |
| 1001050-24-3 | NNC1=NC=C(Br)N=C1 | 2-Bromo-5-hydrazinopyrazine | AG0000YK | 2g |
| 1001050-21-0 | BrC1=NC=C(N2CCCC2)N=C1 | 2-Bromo-5-(pyrrolidin-1-yl)pyrazine | AG0000YL | 15g |
| 1001020-17-2 | O=CC1=CNN=C1C(C)(C)C | 3-tert-Butyl-1H-pyrazole-4-carbaldehyde | AG0000YN | 7g |
| 1001020-14-9 | O=CC1=CNN=C1C(F)(F)F | 3-(Trifluoromethyl)-1H-pyrazole-4-carbaldehyde | AG0000YO | 25g |
| 1001020-13-8 | C(F)(F)(F)c1c(CO)c[nH]n1 | (3-Trifluoromethyl-1H-pyrazol-4-yl)methanol | AG0000YP | 30g |
| 1001020-08-1 | O=C(N1CCC(C(C(N)=O)=C(N)S2)=C2C1)OC(C)(C)C | tert-Butyl 2-amino-3-carbamoyl-4,5-dihydrothieno[2,3-c]pyridine-6(7H)-carb | AG0000YQ | 150g |
| 1001070-33-2 | O=S(N1C=CC2=CC(Br)=CN=C21)(C3=CC=CC=C3)=O | 1-Benzenesulfonyl-5-bromo-1h-pyrrolo[2,3-b]pyridine | AG0000Z4 | 50g |
| 100114-24-7 | CSc1ncc(C)cn1 | 5-Methyl-2-(methylthio)pyrimidine | AG0000Z6 | 2g |
| 100108-45-0 | C1(CC1)C(=O)OCCl | Chloromethyl cyclopropanecarboxylate | AG0000ZL | 15g |
| 10011-39-9 | C=C(F)C(OCCCC)=O | Butyl 2-fluoroacrylate | AG0000ZM | 2g |
| 1001200-60-7 | CC1(C)C(C)(C)OB(C2=CC=C(F)C(C)=C2)O1 | 4-Fluoro-3-methylphenylboronic acid, pinacol ester | AG0000ZO | 500g |
| 1001185-88-1 | O=S(C1=CC(B2OC(C)(C)C(C)(C)O2)=CC=C1)(C)=O | 3-Methylsulfonylphenylboronic acid pinacol ester | AG0000ZQ | 50g |
| 1001180-21-7 | O=C(N1CCN(C2=C([C@H](C)CC3=O)C3=NC=N2)CC1)OC(C)(C)C | (R)-Tert-Butyl 4-(5-Methyl-7-Oxo-6,7-Dihydro-5H-Cyclopenta[D]Pyrimidin-4- | AG0000ZS | 3g |
| 1000342-87-9 | Clc1ccc2[nH]c(Cl)cc2n1 | 2,5-DICHLORO-1H-PYRROLO[3,2-B]PYRIDINE | AG0000K3 | 5g |
| 1000342-80-2 | O=C(N1)CC2=C1C=C(Cl)N=C2 | 6-Chloro-1,3-dihydro-2H-pyrrolo[3,2-c]pyridin-2-one | AG0000K7 | 25g |
| 1000342-78-8 | CC1=CC(NC=C2I)=C2C=N1 | 3-Iodo-6-methyl-1H-pyrrolo[3,2-c]pyridine | AG0000K8 | 5g |
| 1000342-74-4 | NC1=CC2=C(C=CN2)C=N1 | 1H-Pyrrolo[3,2-c]pyridin-6-amine | AG0000KB | 5g |
| 1000342-73-3 | Brc1cc(O)c2c(c1)NCC2 | 1H-Indol-4-ol, 6-bromo-2,3-dihydro- | AG0000KC | 1.75g |
| 1000342-72-2 | CC1=NC=CC2=C1C(Br)=CN2 | 3-Bromo-4-methyl-1H-pyrrolo[3,2-c]pyridine | AG0000KD | 3g |
| 1000342-71-1 | BrC1=CC2=C(C=CN2)C=N1 | 6-Bromo-5-azaindole | AG0000KE | 50g |
| 1000342-68-6 | BrC1=NC=CC2=C1C=CN2 | 4-Bromo-1H-pyrrolo[3,2-c]pyridine | AG0000KH | 20g |
| 1000343-37-2 | [O-][N+](=O)c1cc(cc(c1C)Br)C(=O)N | Benzamide, 3-bromo-4-methyl-5-nitro- | AG0000KJ | 13.5g |
| 1000343-22-5 | N#CC1=CC2=C(NC=C2)C=C1C | 5-CYANO-6-METHYL INDOLE | AG0000KS | 3g |
| 1000343-16-7 | CC1=CC2=C(C=C1F)C=CN2 | 5-FLUORO-6-METHYL-1H-INDOLE | AG0000KW | 5g |
| 1000343-13-4 | CC1=CC2=C(C=C1Br)C=CN2 | 5-Bromo-6-methyl-1H-indole | AG0000KY | 30g |
| 1000343-06-5 | IC1=CC2=C(C=C1Br)C=CN2 | 5-Bromo-6-iodo-1H-indole | AG0000L3 | 0.75g |
| 1000343-73-6 | CC1=CC=C(NC=C2Br)C2=N1 | 3-Bromo-5-methyl-1H-pyrrolo[3,2-b]pyridine | AG0000L9 | 5g |
| 1000343-70-3 | CC1=CC=C(NC=C2I)C2=N1 | 3-Iodo-5-methyl-1h-pyrrolo[3,2-b]pyridine | AG0000LB | 0.75g |
| 1000343-69-0 | CC1=CC2=C(NN=C2)C=C1Br | 6-Bromo-5-methyl-1H-indazole | AG0000LC | 50g |
| 1000343-62-3 | O=C(C1=CC2=C(C([N+]([O-])=O)=C1)C=CN2)OC | 4-NITRO-6-INDOLECARBOXYLIC ACID METHYL ESTER | AG0000LG | 0.5g |
| 1000343-59-8 | CC1=C2C(C(=NN2)N)=CC=C1 | 3-Amino-7-methyl (1h)indazole | AG0000LI | 40g |
| 1000341-40-1 | CC1=CN=CC2=C1NC=C2Br | 3-Bromo-7-methyl-1H-pyrrolo[3,2-c]pyridine | AG0000GN | 0.75g |
| 1000341-37-6 | CC1=CN=CC2=C1NC=C2I | 3-Iodo-7-methyl-1H-pyrrolo[3,2-c]pyridine | AG0000GQ | 0.75g |
| 1000341-36-5 | N#CC1=CC=CC2=C1C(Br)=NN2 | 3-Bromo-1H-indazole-4-carbonitrile | AG0000GR | 2g |
| 1000341-33-2 | OC(C1C2=C(C=CC=C2C#N)NN=1)=O | 4-cyano-1H-indazole-3-carboxylic acid | AG0000GU | 1g |
| 1000341-29-6 | O=C(C1=CC(I)=CC(C(C)(C)C)=C1)O | 3-(tert-Butyl)-5-iodobenzoic acid | AG0000GY | 24g |
| 1000341-27-4 | FC(C1=CC2=C(C=C1)C(I)=NN2)(F)F | 3-Iodo-6-(trifluoromethyl)-1H-indazole | AG0000H0 | 14g |
| 1000341-72-9 | BrC=1C=CC(=C2C=NNC12)F | 7-Bromo-4-fluoro-1H-indazole | AG0000H6 | 40g |
| 1000341-70-7 | C1=CC(=C2C=NNC2=C1Cl)F | 7-Chloro-4-fluoro-1H-indazole | AG0000H8 | 1g |
| 1000341-69-4 | BrC1=CC(NC=C2Br)=C2C=N1 | 3,6-Dibromo-1H-pyrrolo[3,2-c]pyridine | AG0000H9 | 14g |
| 1000341-67-2 | O=C(C1=CNC2=C1C=NC(Cl)=C2)O | 6-Chloro-1H-pyrrolo[3,2-c]pyridine-3-carboxylic acid | AG0000HB | 8g |
| 1000341-64-9 | ClC1=CC2=C(C=N1)C(C=O)=CN2 | 6-Chloro-1H-pyrrolo[3,2-c]pyridine-3-carbaldehyde | AG0000HE | 25g |
| 1000341-61-6 | ClC1=CC(NC=C2Br)=C2C=N1 | 3-Bromo-6-chloro-5-azaindole | AG0000HH | 25g |
| 1000341-60-5 | Fc1c2c(c(cc1)Cl)[nH]cc2 | 7-Chloro-4-fluoro-1H-indole | AG0000HI | 2g |
| 1000341-55-8 | IC1=CNC2=C1C=NC(Cl)=C2 | 6-Chloro-3-iodo-5-azaindole | AG0000HM | 10g |
| 1000341-53-6 | O=C(C1=NNC2=C1C(F)=CC(Br)=C2)OC | Methyl 6-bromo-4-fluoro-1H-indazole-3-carboxylate | AG0000HO | 15g |
| 1000341-51-4 | BrC2=CC=C1[NH]C=CC1=N2 | 5-Bromo-4-azaindole | AG0000HQ | 50g |
| 1001412-59-4 | ClS(=O)(=O)C1=CNC2=NC=CC=C12 | 1H-Pyrrolo[2,3-b]pyridine-3-sulfonyl chloride | AG00012H | 1.75g |
| 1001412-41-4 | ClC1=NC(Cl)=CC2=C1NC=C2 | 5,7-dichloro-1H-pyrrolo[2,3-c]pyridine | AG00012I | 1g |
| 1001401-62-2 | OC(C1=C(N2N=CC=N2)C=CC=C1)=O | 2-(2H-1,2,3-triazol-2-yl)benzoic acid | AG00012J | 100g |
| 1001401-60-0 | C[C@@H]1CCN(CCN1)C(=O)OCC1=CC=CC=C1 | benzyl (5R)-5-methyl-1,4-diazepane-1-carboxylate | AG00012K | 300g |
| 1001397-43-8 | BrC1CCNCC1.[H]Cl | 4-Bromopiperidine Hydrochloride | AG00012L | 2g |
| 1001397-31-4 | OC1CCN(C2=NC=C(F)C=N2)CC1 | 1-(5-Fluoropyrimidin-2-yl)piperidin-4-ol | AG00012M | 0.5g |
| 1001394-95-1 | O=S(=O)(c1ccccc1)n1ccc2c(Br)cc(F)cc21 | 1-(BENZENESULFONYL)-4-BROMO-6-FLUORO-1H-INDOLE | AG00012P | 1g |
| 100139-54-6 | O=C(NN)C1=CC=C(N(CC)CC)C=C1 | 4-(Diethylamino)benzohydrazide | AG00012Y | 10g |
| 100138-46-3 | O=C(c1ccccc1)N1CCN(CC1)C(=O)N | 4-Benzoylpiperazine-1-carboxamide | AG000131 | 5g |
| 10014-52-5 | CC1=C(CCl)SC=N1 | 5-(Chloromethyl)-4-methyl-1,3-thiazole | AG000133 | 0.3g |
| 1001427-55-9 | COC(=O)CC(Cc1ccccc1)N.Cl | Methyl 3-amino-4-phenylbutanoate hydrochloride | AG000134 | 5g |
| 1001426-31-8 | COC(=O)C(c1ccccn1)NC(=O)OC(C)(C)C | Methyl 2-(Boc-amino)-2-(2-pyridyl)acetate | AG000135 | 8g |
| 1001424-68-5 | CC(C)=CCc1cc2c(oc3c(O)ccc(O)c3c2=O)c(O)c1O | 1,4,5,6-Tetrahydroxy-7-prenylxanthone | AG000136 | 0.005g |
| 1001419-37-9 | CC(C)(C)OC(=O)NC1=NC=C(CO)S1 | tert-Butyl (5-(hydroxymethyl)thiazol-2-yl)carbamate | AG000137 | 15g |
| 1001415-32-2 | O=S(=O)(c1ccccc1)n1ncc2c(Br)cccc21 | 4-Bromo-1-(phenylsulfonyl)-1h-indazole | AG000138 | 25g |
| 1001414-95-4 | Cl.Cl.NCC1=NC=CC(Br)=C1 | (4-Bromopyridin-2-yl)methanamine hydrochloride | AG000139 | 25g |
| 1001414-56-7 | NCC1=CC=C(Br)S1.[H]Cl | (5-bromothiophen-2-yl)methanamine hydrobromide | AG00013A | 75g |
| 1001413-46-2 | NCC1=CN=C(Br)S1.[H]Cl | (2-Bromothiazol-5-yl)methanamine hydrochloride | AG00013F | 4g |
| 1000340-01-1 | CC1=C(Br)C(F)=NC=C1Br | 3,5-Dibromo-2-fluoro-4-methylpyridine | AG0000DA | 80g |
| 1000339-98-9 | FC(F)(F)C1=C2C=NNC2=CC=C1 | 4-(Trifluoromethyl)-1H-indazole | AG0000DB | 8g |
| 1000339-94-5 | ClC1=C(C=CC(=C1)O)OC(F)(F)F | 3-Chloro-4-(Trifluoromethoxy)Phenol | AG0000DC | 200g |
| 1000339-93-4 | FC1(=CC(=C(C#N)C=C1)CO) | 4-Fluoro-2-(hydroxymethyl)benzonitrile | AG0000DD | 10g |
| 1000339-73-0 | Cc1nc(c(CBr)s1)C(F)(F)F | 5-(Bromomethyl)-2-methyl-4-(trifluoromethyl)thiazole | AG0000DF | 3g |
| 1000340-40-8 | IC1=CNC2=NC=CC(=C21)[N+](=O)[O-] | 3-IODO-4-NITRO-1H-PYRROLO[2,3-B]PYRIDINE | AG0000DU | 1g |
| 1000340-39-5 | BrC1=C[NH]C2=NC=CC(=C12)Cl | 3-Bromo-4-chloro-1H-pyrrolo[2,3-b]pyridine | AG0000DV | 600g |
| 1000340-37-3 | OC(=O)C1=CNC2=C1C(Cl)=CC=N2 | 4-chloro-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid | AG0000DX | 40g |
| 1000340-36-2 | O=C(C1=CNC2=NC=CC(Br)=C21)O | 4-Bromo-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid | AG0000DY | 15g |
| 1000340-35-1 | BrC1=CC=NC2=C1C(C=O)=CN2 | 4-Bromo-1H-pyrrolo[2，3-b]pyridine-3-carbaldehyde | AG0000DZ | 15g |
| 1000340-34-0 | BrC1=C2C(=NC=C1)[NH]C=C2I | 4-Bromo-3-iodo-7-azaindole | AG0000E0 | 6g |
| 1000340-33-9 | BrC1=CC=NC2=C1C(Br)=CN2 | 3,4-Dibromo-7-Azaindole | AG0000E1 | 10g |
| 1000340-29-3 | CC1=CC=C2C(NC=C2I)=N1 | 3-Iodo-6-methyl-1H-pyrrolo[2,3-b]pyridine | AG0000E5 | 2g |
| 1000340-27-1 | O=C(C1=CNC2=NC(C)=CC=C21)O | 6-METHYL-1H-PYRROLO[2,3-B]PYRIDINE-3-CARBOXYLIC ACID | AG0000E7 | 0.5g |
| 1000340-66-8 | BrC1=NC2=C(C=CN2)C(Br)=C1 | 4,6-Dibromo-1H-pyrrolo[2,3-b]pyridine | AG0000EI | 5g |
| 1000802-50-5 | OCCCN1N=CC(B2OC(C)(C)C(C)(C)O2)=C1 | 3-[4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazol-1-yl]propan-1- | AG0000VA | 1g |
| 1000801-78-4 | CC1(C)C(C)(C)OB(C2=CN(CC=C)N=C2)O1 | 1-(2-Propen-1-yl)-1H-pyrazole-4-boronic acid pinacol ester | AG0000VC | 20g |
| 1000801-76-2 | COCCCN1C=C(C=N1)B1OC(C)(C)C(C)(C)O1 | 1-(3-Methoxypropyl)-4-(4，4，5，5-tetramethyl-1，3，2-dioxaborolan-2-y | AG0000VD | 75g |
| 1000801-75-1 | CC1(C)C(C)(C)OB(C2=CN(CC3CC3)N=C2)O1 | 1-Cyclopropylmethyl-1H-pyrazole-4-boronic acid, pinacol ester | AG0000VE | 10g |
| 10008-97-6 | OC(=O)C1=CC=CC=C1OC(F)(F)C(F)F | 2-(1,1,2,2-tetrafluoroethoxy)benzoic acid | AG0000VJ | 5g |
| 1000932-09-1 | CN1C(=O)CC(C(O)=O)CC1 | 1-Methyl-2-oxopiperidine-4-carboxylic acid | AG0000VL | 1g |
| 1000931-46-3 | OC(C1=NC(C(F)(F)F)=CC=N1)=O | 4-(TRIFLUOROMETHYL)PYRIMIDINE-2-CARBOXYLIC ACID | AG0000VN | 2g |
| 1000931-10-1 | COC1(OC)C2CN(CC3=CC=CC=C3)CC1CCC2 | 3-BENZYL-9,9-DIMETHOXY-3-AZABICYCLO[3.3.1]NONANE | AG0000VO | 0.75g |
| 1000931-04-3 | CC(C)(C)OC(=O)N1CCC(C(O)C1)C1=CC=CC=C1 | tert-Butyl 3-hydroxy-4-phenylpiperidine-1-carboxylate | AG0000VP | 5g |
| 1000922-53-1 | C[C@H](N)C1=C(F)C=CC=C1Cl | (S)-1-(2-Chloro-6-fluorophenyl)ethanamine | AG0000VQ | 3g |
| 1000896-69-4 | NC1=NNC(C2CCOCC2)=C1 | 5-(tetrahydro-2H-pyran-4-yl)-1H-pyrazol-3-amine | AG0000VR | 1g |
| 1000896-40-1 | NC1=NNC(OCC2=CC=CC=C2)=C1 | 5-(Benzyloxy)-1H-pyrazol-3-amine | AG0000VT | 2g |
| 1000895-54-4 | COc1cc(CCC(=O)CC#N)cc(OC)c1 | 5-(3,5-DIMETHOXYPHENYL)-3-OXOPENTANENITRILE | AG0000VW | 0.5g |
| 1000895-26-0 | NC1=NNC(CO)=C1 | (3-AMINO-1H-PYRAZOL-5-YL)METHANOL | AG0000W0 | 30g |
| 10009-70-8 | C[C@H](C(O)=O)Br | (R)-(+)-2-Bromopropionic acid | AG0000W3 | 579.5g |
| 10009-25-3 | OC(C1=CC=C(OC(C(F)F)(F)F)C=C1)=O | 4-(1,1,2,2-Tetrafluoroethoxy)benzoic Acid | AG0000W5 | 25g |
| 1000577-94-5 | N#CC1=CC=C(I)C(Br)=C1 | 3-Bromo-4-iodobenzonitrile | AG0000RK | 50g |
| 1000577-91-2 | C1=CC(N=C=S)=C(C=C1C#N)Br | 2-Bromo-4-cyanophenylisothiocyanate | AG0000RL | 25g |
| 1000577-81-0 | CC(C)(C)OC(=O)N1CCC2=C(C1)C(Br)=CS2 | tert-Butyl 3-bromo-6,7-dihydrothieno[3,2-c]pyridine-5(4H)-carboxylate | AG0000RP | 5g |
| 1000577-78-5 | O=C(OC(C)(C)C)NC1CN(CC2=CC=CC=C2)C1 | tert-Butyl 1-benzylazetidin-3-ylcarbamate | AG0000RQ | 1g |
| 1000577-71-8 | O=C1CCNCC2CCCN12 | OCTAHYDROPYRROLO[1,2-A][1,4]DIAZEPIN-5-ONE | AG0000RR | 1g |
| 1000577-66-1 | FC1=CC(Br)=C(I)C(Cl)=C1 | 1-Bromo-3-chloro-5-fluoro-2-iodobenzene | AG0000RT | 795g |
| 1000577-63-8 | O=C1CNCC2N1CCC2 | HEXAHYDROPYRROLO[1,2-A]PYRAZIN-4(1H)-ONE | AG0000RV | 2g |
| 1000577-58-1 | FC1=CC(Cl)=C(Cl)C(Br)=C1 | 1-Bromo-2,3-dichloro-5-fluorobenzene | AG0000RX | 50g |
| 100058-61-5 | OC1CC(OCC2=CC=CC=C2)C1 | 3-(Benzyloxy)cyclobutanol | AG0000S1 | 400g |
| 100058-55-7 | C(=O)(O)c1c(CC(C)C)cccc1 | 2-Isobutylbenzoic acid | AG0000S2 | 1.25g |
| 10006-74-3 | NC1=NC=CC=C1OCC | 3-Ethoxypyridin-2-amine | AG0000SQ | 30g |
| 1000698-98-5 | [N+](#[C-])C1CCC(CC1)(F)F | 1,1-DIFLUORO-4-ISOCYANOCYCLOHEXANE | AG0000SU | 10g |
| 1000698-88-3 | O=C(OC(C)(C)C)NC1=CC(F)=C(F)C=C1N | tert-Butyl (2-amino-4，5-difluorophenyl)carbamate | AG0000SV | 3g |
| 1000669-72-6 | O=C(C1=CC=C(C=CC2=NNC3=C2C=CC=C3)C=C1)N4CCNCC4 | KW-2449 | AG0000SX | 0.05g |
| 1000623-98-2 | O=C1N(CC(CCCCCC)CCCCCCCC)C(C2=CC=C(Br)S2)=C3C1=C(C4=CC=C(Br)S4)N(CC( | 3,6-Bis(5-bromo-2-thienyl)-2,5-bis(2-hexyldecyl)pyrrolo[3,4-c]pyrrole-1,4(2H, | AG0000SY | 15g |
| 100068-60-8 | CCCCCCCCCCCCCCCCCC[N+]1=C(/C=C/C=C/C=C/C=C2N(CCCCCCCCCCCCCCCCCC) | 2-(7-(3,3-Dimethyl-1-octadecylindolin-2-ylidene)hepta-1,3,5-trien-1-yl)-3,3-d | AG0000T5 | 0.5g |
| 1000549-37-0 | OCCC1=C(F)C=CC=N1 | 2-(3-Fluoropyridin-2-YL)ethan-1-OL | AG0000QJ | 5g |
| 1000577-24-1 | NC1=C(Br)C(F)=C(F)C(F)=C1 | 2-Bromo-3,4,5-trifluoroaniline | AG0000QS | 100g |
| 1000576-79-3 | O=C(OC(C)(C)C)N(C1=NC(Br)=CS1)C | tert-Butyl (4-bromothiazol-2-yl)methylcarbamate | AG0000QW | 10g |
| 1000576-64-6 | C1(C)=CC(F)=CC(Br)=C1Br | 1,2-Dibromo-5-fluoro-3-methylbenzene | AG0000QZ | 80g |
| 1000576-59-9 | BrC2=C1[N](N=CC1=CC=C2)C | 7-Bromo-1-methylindazole | AG0000R0 | 25g |
| 1000576-51-1 | O=C(C1=CC2=C(C=C1)C(C#N)=CN2)OC | Methyl 3-cyanoindole-6-carboxylate | AG0000R1 | 10g |
| 1000576-38-4 | C(=O)(OC)c1nc(oc1)N | Methyl 2-aminooxazole-4-carboxylate | AG0000R3 | 75g |
| 1000576-28-2 | OC(=O)C1=CC=C2N(N=CC2=C1)C1CCCCO1 | 1-(Tetrahydro-2H-Pyran-2-Yl)-1H-Indazole-5-Carboxylic Acid | AG0000R4 | 5g |
| 1000574-74-2 | OC1=CC(F)=C(I)C(F)=C1 | 3,5-Difluoro-4-iodophenol | AG0000R5 | 25g |
| 1000573-99-8 | NC1=CC=C(Br)C(Cl)=C1[N+]([O-])=O | 4-Bromo-3-chloro-2-nitroaniline | AG0000R6 | 20g |
| 1000573-87-4 | C1(C)=CC(Br)=CC(Cl)=C1I | 5-Bromo-1-chloro-2-iodo-3-methylbenzene | AG0000R7 | 5g |
| 1000573-57-8 | CC1=C(Cl)C(Br)=CC=C1I | 1-Bromo-2-chloro-4-iodo-3-methylbenzene | AG0000R8 | 100g |
| 1000573-15-8 | FC1=C(Cl)C(Br)=CC=C1Cl | 1-Bromo-2,4-dichloro-3-fluorobenzene | AG0000R9 | 200g |
| 1000573-03-4 | FC1=C(I)C=CC(Br)=C1Cl | 1-Bromo-2-chloro-3-fluoro-4-iodobenzene | AG0000RA | 500g |
| 1000572-93-9 | FC1=C(Cl)C(Cl)=CC(Br)=C1 | 1-Bromo-3,4-dichloro-5-fluorobenzene | AG0000RB | 1000g |
| 1000572-78-0 | FC1=CC(Cl)=C(Cl)C=C1Br | 1-Bromo-4,5-dichloro-2-fluorobenzene | AG0000RC | 150g |
| 1000578-10-8 | COC(=O)C1=C2N=CNC(=O)C2=CC=C1 | Methyl 4-oxo-3,4-dihydroquinazoline-8-carboxylate | AG0000RH | 49g |
| 1000341-90-1 | COc1ccc(Cl)c2cn[nH]c12 | 4-Chloro-7-methoxy-1H-indazole | AG0000I2 | 3g |
| 1000341-88-7 | ClC1=C2C(NN=C2)=C(Br)C=C1 | 7-Bromo-4-chloro-1H-indazole | AG0000I4 | 25g |
| 1000341-84-3 | Clc1ccc(c2c1cn[nH]2)F | 1H-Indazole, 4-chloro-7-fluoro- | AG0000I8 | 7.3g |
| 1000341-77-4 | O=C(C1=CNC2=C1C=NC(Br)=C2)O | 6-Bromo-1H-pyrrolo[3,2-c]pyridine-3-carboxylic acid | AG0000IF | 10g |
| 1000342-37-9 | IC1=C(Cl)C2=C(NN=C2)C=C1 | 4-Chloro-5-iodo-1H-indazole | AG0000IH | 2g |
| 1000342-36-8 | N#Cc1cc(Br)cc(c1C)N | 3-Amino-5-bromo-2-methylbenzonitrile | AG0000II | 2g |
| 1000342-34-6 | NC1=CC([N+]([O-])=O)=CC(Br)=C1C | 3-Bromo-2-methyl-5-nitroaniline | AG0000IJ | 20g |
| 1000342-30-2 | COC(=O)C1=C(Br)C=C2C=NNC2=C1 | Methyl 5-bromo-1H-indazole-6-carboxylate | AG0000IM | 200g |
| 1000342-29-9 | OC1=NNC2=C1C=CC=C2F | 7-Fluoro-1H-indazol-3-ol | AG0000IN | 3g |
| 1000342-21-1 | C1=CC(=C2C(=C1)NN=C2Br)C(F)(F)F | 3-Bromo-4-(trifluoromethyl)-1H-indazole | AG0000IP | 10g |
| 1000342-11-9 | O=C(OC)C1=CC(Br)=CC(N)=C1C | 3-Amino-2-methyl-5-bromo benzoic acid methyl ester | AG0000IW | 193g |
| 1000342-09-5 | Fc1ccc(c2c1c(I)n[nH]2)Cl | 7-Chloro-4-fluoro-3-iodo-1H-indazole | AG0000IY | 0.9g |
| 1000342-07-3 | IC1=CNC2=C1C(Cl)=NC=C2Br | 7-Bromo-4-chloro-3-iodo-1H-pyrrolo[3,2-c]pyridine | AG0000J0 | 3g |
| 1000342-04-0 | ClC1=NC=C(Br)C2=C1C=CN2 | 7-bromo-4-chloro-1H-pyrrolo[3,2-c]pyridine | AG0000J2 | 10.2g |
| 1000342-95-9 | FC(F)(F)C1=CC(Br)=C2C=NNC2=C1 | 4-Bromo-6-(trifluoromethyl)-1H-indazole | AG0000JV | 30g |
| 1000342-93-7 | FC(C1=CC2=C(C(Br)=C1)C=CN2)(F)F | 4-Bromo-6-(trifluoromethyl)-1H-indole | AG0000JX | 50g |
| 1000342-90-4 | COC(=O)CC1=CC(C#N)=NC=C1 | methyl 2-(2-cyano-4-pyridyl)acetate | AG0000K0 | 0.5g |
| 1000414-11-8 | [Br]C2(=C(OC1(=CC=CC=C1))C=CC(=C2)C=O) | 3-Bromo-4-phenoxybenzaldehyde | AG0000ND | 25g |
| 1000413-85-3 | CC1=CC(OCCCS(C)(=O)=O)=CC(C)=C1C1=CC=CC(CO)=C1 | (2′,6′-Dimethyl-4′-(3-(methylsulfonyl)propoxy)-[1,1′-biphenyl]-3-yl)methanol | AG0000NE | 5g |
| 100047-52-7 | O=C(C1=CNC(C)=C1)O | 5-Methyl-1H-Pyrrole-3-Carboxylic Acid | AG0000NH | 25g |
| 100047-36-7 | O=C(C1=NC=CC(N)=C1)O | 4-Aminopicolinic acid | AG0000NM | 300g |
| 1000512-60-6 | N#CCC1C(=CC=CN=1)C(F)(F)F | 2-(3-(Trifluoromethyl)pyridin-2-yl)acetonitrile | AG0000NZ | 1g |
| 1000512-48-0 | COC1=NC(CC#N)=CC=C1 | 2-(6-Methoxypyridin-2-yl)acetonitrile | AG0000O0 | 15g |
| 100048-86-0 | CCCCC(CCCC)(CBr)C(O)=O | 2-(Bromomethyl)-2-butylhexanoic acid | AG0000OG | 100g |
| 100047-66-3 | N1N(C)C(=O)C=CC=1C(O)=O | 1-Methyl-6-oxo-1,6-dihydropyridazine-3-carboxylic acid | AG0000OI | 200g |
| 100047-56-1 | OC1=NC=C(Br)N=C1C | 5-Bromo-3-methylpyrazin-2-ol | AG0000OL | 125g |
| 1000524-32-2 | FC=1C(=NC=CC1)CC(=O)O | 2-(3-fluoropyridin-2-yl)acetic acid | AG0000OR | 25g |
| 1000523-07-8 | C(C(=O)O)c1c(Cl)c(F)ccc1 | 2-(2-Chloro-3-fluorophenyl)acetic acid | AG0000OT | 275g |
| 1000522-43-9 | O=C(O)CC1=NC=C(Cl)C=C1 | 2-(5-Chloropyridin-2-yl)acetic acid | AG0000OU | 125g |
| 1000521-27-6 | O=C(O)CC1=NC=CC=C1C(F)(F)F | 2-(3-(Trifluoromethyl)pyridin-2-yl)acetic acid | AG0000OX | 5g |
| 1000520-92-2 | O=C(O)CC1=CC=C(F)C(C)=C1 | 4-Fluoro-3-Methylphenylacetic Acid | AG0000OY | 30g |
| 1001162-89-5 | O=C(N1C(B(O)O)=CC2=C1C=CC=C2)OC | 1-(N-Methoxycarbonyl)indole-2-boronic acid | AG0000ZU | 50g |
| 100117-84-8 | O=C(OC)CC(CC1=CC=C(OC)C=C1)=O | Methyl 4-(4-methoxyphenyl)-3-oxobutanoate | AG0000ZZ | 2g |
| 100117-62-2 | C1(C=C(C)C=C(C)C=1)C(C(OCC)=O)=O | Ethyl 3,5-dimethylbenzoylformate | AG000100 | 6g |
| 100114-63-4 | CCOC(C1SC(N)=CN=1)=O | Ethyl 5-aMinothiazole-2-carboxylate | AG000104 | 5g |
| 100114-58-7 | OCC1=NC=CC(N)=C1 | (4-Aminopyridin-2-yl)methanol | AG000105 | 2g |
| 100114-57-6 | C1(C2CC2)=NNC=C1 | 3-CYCLOPROPYL-1H-PYRAZOLE | AG000106 | 25g |
| 1001264-89-6 | O=C(N1CCN(C2=C([C@H](C)C[C@H]3O)C3=NC=N2)CC1)[C@@H](C4=CC=C(Cl)C= | (2S)-2-(4-Chlorophenyl)-1-[4-[(5R,7R)-6,7-dihydro-7-hydroxy-5-methyl-5H-cy | AG00010C | 0.075g |
| 1001202-16-9 | O=C(NCC(NCC(NCC(O)=O)=O)=O)CNC(OCC1C2=CC=CC=C2C3=CC=CC=C13)=O | Fmoc-Gly-Gly-Gly-Gly | AG00010F | 25g |
| 100125-96-0 | C(OCC)(=O)CC1C=CC(OC)=C(Br)C=1 | ETHYL 3-BROMO-4-METHOXYPHENYLACETATE | AG00010M | 5g |
| 100125-12-0 | BrC3=CC2=CC=C1C=C(C=NC1=C2N=C3)Br | 3,8-Dibromo-1,10-phenanthroline | AG00010O | 150g |
| 100124-07-0 | OB(O)C1=C2OC3=CC=CC=C3SC2=CC=C1 | Phenoxathiin-4-ylboronic acid | AG00010S | 100g |
| 100124-06-9 | OB(C1=C2OC3=CC=CC=C3C2=CC=C1)O | Dibenzofuran-4-Boronic Acid | AG00010T | 2000g |
| 100123-25-9 | O=C(C(N1)=C(C=O)C2=C1C=CC(Br)=C2)OCC | ETHYL 5-BROMO-3-FORMYL-1H-INDOLE-2-CARBOXYLATE | AG00010V | 10g |
| 1001288-58-9 | COC=1C=C(C=CC1OCC#C)/C=C/C(=O)NC1=C(C(=O)O)C=CC=C1 | FT011 | AG000112 | 0.05g |
| 100131-91-7 | CN1CCC(CC1)(O)c1cccs1 | 1-Methyl-4-(thiophen-2-yl)piperidin-4-ol | AG00011B | 38.6g |
| 100130-55-0 | O=Cc1cccc(c1I)C | 2-Iodo-3-methylbenzaldehyde | AG00011D | 2g |
| 100142-87-8 | NC1=CC=C(C2=CC=C(S(N)(=O)=O)C=C2)C=C1 | 4-(4-aminophenyl)benzene-1-sulfonamide | AG00013O | 1g |
| 100142-73-2 | O=C(O)CCC1=CN(C2=CC=CC=C2)N=C1 | 3-(1-Phenyl-1h-pyrazol-4-yl)propanoic acid | AG00013Q | 0.5g |
| 1001500-80-6 | NC1=CN(COC)N=C1 | 1-Methoxymethyl-1H-pyrazol-4-ylamine | AG00013V | 25g |
| 1001500-47-5 | N#CCN1N=CC([N+]([O-])=O)=C1 | (4-Nitro-1h-pyrazol-1-yl)acetonitrile | AG00013W | 20g |
| 1001463-32-6 | ClCC1=NC=CC(Br)=C1 | 4-Bromo-2-(Chloromethyl)Pyridine | AG00013Y | 250g |
| 100157-53-7 | C(OC)(=O)[C@H](NC(OCC1=CC=CC=C1)=O)[C@H](O)C | (2R,3R)-Methyl 2-(((benzyloxy)carbonyl)amino)-3-hydroxybutanoate | AG000144 | 500g |
| 100155-73-5 | CCC(C1=NC=CC=C1)N | (1-Pyridin-2-ylpropyl)amine | AG000148 | 10g |
| 1001665-65-1 | O=C(C1=NN(C2=CC=C(F)C=C2)C(N)=C1C#N)OCC | Ethyl 5-amino-4-cyano-1-(4-fluorophenyl)pyrazole-3-carboxylate | AG00014K | 30g |
| 1001645-58-4 | O=C(NC1=CC=CC=C1C2=CN3C(SC=C3CN4CCNCC4)=N2)C5=NC6=CC=CC=C6N=C5.[ | SRT1720 xHydrochloride | AG00014N | 1.5g |
| 1001635-30-8 | C(#N)c1c(N)cc(cn1)C | 3-Amino-5-methylpicolinonitrile | AG00014O | 36.43g |
| 10016-52-1 | BrC1=CC=C(OC2=CC=C(Br)C=C23)C3=C1 | 2,8-Dibromodibenzo[b,d]furan | AG000151 | 200g |
| 1001756-23-5 | O=C(C1=CC2=CC=C(Br)C=C2N=C1)OC | Methyl 7-bromoquinoline-3-carboxylate | AG000154 | 1.75g |
| 1001756-21-3 | O=CC1=CN=C(Cl)C=C1N | 4-Amino-6-chloronicotinaldehyde | AG000155 | 100g |
| 1001754-82-0 | CC(C)(C)OC(=O)N1CCC(CC1)C2=NC(=NC=C2)Cl | tert-Butyl 4-(2-chloropyrimidin-4-yl)piperidine-1-carboxylate | AG00015C | 3g |
| 100130-32-3 | NC(SCCNC(N)=N)=N.Br.Br | VUF8430 (hydrobromide) | AG00011E | 0.2g |
| 100130-05-0 | NC1=CN=C(N=C1C(=O)O)SC | 5-Amino-2-(methylthio)pyrimidine-4-carboxylic acid | AG00011I | 25g |
| 100129-35-9 | ClC1=C(C2CCNCC2)C=CC=C1 | 4-(2-Chlorophenyl)piperidine | AG00011M | 2g |
| 1001354-51-3 | O=C([C@H]1NC[C@@H](F)C1)O.[H]Cl | (2S,4S)-4-fluoropyrrolidine-2-carboxylic acid hydrochloride | AG00011Q | 25g |
| 1001354-26-2 | O=C(Nc1ncn(c1)C1CC1)OC(C)(C)C | tert-Butyl (1-cyclopropyl-1H-imidazol-4-yl)carbamate | AG00011S | 2g |
| 1001353-92-9 | N[C@H]1CN(C)CCC1 | (R)-3-Amino-1-Methylpiperidine | AG00011T | 100g |
| 1001353-87-2 | C(C)(C)(C)OC(=O)N1CC(C[C@H]1C(=O)O)(C)C | (S)-1-(tert-Butoxycarbonyl)-4,4-dimethylpyrrolidine-2-carboxylic acid | AG00011V | 25g |
| 1001346-91-3 | O=C(O)C1=CC(OC)=C(N)C=C1F | 4-Amino-2-fluoro-5-methoxybenzoic acid | AG00011X | 50g |
| 1001345-80-7 | O=C(O)C1=CC(OC)=C([N+]([O-])=O)C=C1F | 2-FLUORO-5-METHOXY-4-NITROBENZOIC ACID | AG00011Z | 200g |
| 1001322-86-6 | BrC1=C2C(C=CC(N2)=O)=CC=C1F | 8-Bromo-7-fluoroquinolin-2(1H)-one | AG000123 | 1g |
| 100137-47-1 | C(=O)(N)c1cc(N)ccn1 | 4-Aminopicolinamide | AG000124 | 200g |
| 100134-82-5 | CC(C#N)(NC(OCC1=CC=CC=C1)=O)C | Benzyl (1-cyano-1-methylethyl)carbamate | AG000127 | 10g |
| 1001413-01-9 | O=C(C1=CC=CN(CC2=CC=C(F)C(F)=C2)C1=O)O | 1-(3，4-Difluorobenzyl)-2-oxo-1，2-dihydropyridine-3-carboxylic acid | AG00012F | 2g |
| 1000518-77-3 | Cc1cncc(CC(=O)O)c1 | 2-(5-Methylpyridin-3-yl)acetic acid | AG0000P0 | 0.5g |
| 1000517-25-8 | O=C(O)CC1=NC(F)=CC=C1 | 2-(6-Fluoropyridin-2-yl)acetic acid | AG0000P2 | 25g |
| 1000516-02-8 | O=C(O)CC1=CC=C(F)N=C1 | 2-(6-Fluoropyridin-3-yl)acetic acid | AG0000P4 | 6g |
| 1000515-83-2 | O=C(CC1=CC=C(F)C=N1)O | 2-(5-Fluoropyridin-2-yl)acetic acid | AG0000P5 | 40g |
| 1000515-40-1 | ClC1=CC(CC#N)=NC=C1 | 2-(4-Chloropyridin-2-yl)acetonitrile | AG0000P7 | 20g |
| 1000545-64-1 | OC(CC1=CC2=C(C=NC=C2)C=C1)=O | 2-(Isoquinolin-6-yl)acetic acid | AG0000PH | 0.5g |
| 1000544-72-8 | O=C(O)CC1=CC=C(C)C(C(F)(F)F)=C1 | 2-(4-Methyl-3-(trifluoromethyl)phenyl)acetic acid | AG0000PJ | 25g |
| 1000536-10-6 | FC(C1=CC(CC#N)=NC=C1)(F)F | 2-(4-(Trifluoromethyl)pyridin-2-yl)acetonitrile | AG0000PO | 5g |
| 1000530-84-6 | NCCCC1=CC=C(C)S1 | 3-(5-Methylthiophen-2-yl)propan-1-amine | AG0000PS | 1.25g |
| 1000568-14-8 | OC(CC1=C(C(F)(F)F)N=CC=C1)=O | 2-(2-(Trifluoromethyl)pyridin-3-yl)acetic acid | AG0000Q2 | 2g |
| 1000566-45-9 | COC1=C(C=C(CC(O)=O)C=C1)C(F)(F)F | 4-Methoxy-3-(trifluoromethyl)phenylacetic acid | AG0000Q5 | 30g |
| 1000565-45-6 | N#CCc1ccnc(c1)Cl | 2-(2-Chloropyridin-4-yl)acetonitrile | AG0000Q7 | 25g |
| 1000565-32-1 | OC(CC1=NC(C(F)(F)F)=CC=C1)=O | [6-(trifluoromethyl)pyridin-2-yl]acetic acid | AG0000Q9 | 2g |
| 100189-84-2 | CC1=CC(Br)=CC(C)=C1Br | 2,5-Dibromo-m-xylene | AG00016X | 400g |
| 100189-17-1 | OCCC1=CC=C(C)N=C1 | 6-Methyl-3-pyridineethanol | AG00016Z | 2g |
| 100189-16-0 | CC(O)C1=CN=C(C)C=C1 | 5-(1-Hydroxyethyl)-2-methylpyridine | AG000170 | 10g |
| 10019-60-0 | OC[C@H]1O[C@@H](Oc2ccccc2C(=O)OC)[C@@H]([C@H]([C@@H]1O)O)O | 2-Methoxycarbonylphenyl beta-d-glucopyranoside | AG000173 | 5g |
| 10019-24-6 | COC1=CC=C(C(C2=CC=C(OC)C=C2)=C(C3=CC=C(OC)C=C3)C4=CC=C(OC)C=C4)C=C1 | 1,1,2,2-Tetrakis(4-methoxyphenyl)ethene | AG000174 | 20g |
| 1001940-37-9 | COC1=CC(C2OCCNC2)=CC(OC)=C1 | 2-(3,5-Dimethoxyphenyl)morpholine | AG000175 | 1g |
| 1001911-63-2 | OB(O)C1=CC2=C(C=C1)C1=CC=CC=C1N2C1=CC=CC=C1 | (9-Phenyl-9H-carbazol-2-yl)boronic acid | AG000178 | 200g |
| 1001907-71-6 | CC1=C(C=NC=C1C)B(O)O | (4,5-Dimethylpyridin-3-yl)boronic acid | AG000179 | 1.5g |
| 1001907-70-5 | OB(C1C=NC=C(CC)C=1)O | 5-Ethylpyridine-3-boronic acid | AG00017A | 112g |
| 1001907-69-2 | CCC1=CC=C(B(O)O)C=N1 | 6-Ethylpyridine-3-boronic acid | AG00017B | 1g |
| 1002-28-4 | CCC#CCCO | 3-HEXYN-1-OL | AG00017L | 300g |
| 1002-19-3 | O=C(N)CCSSCCC(N)=O | 3-[(3-Amino-3-oxopropyl)dithio]propanamide | AG00017O | 0.5g |
| 1002-18-2 | S(SCCC(=O)Cl)CCC(=O)Cl | 3,3′-Disulfanediyldipropionyl chloride | AG00017P | 10g |
| 1002-84-2 | CCCCCCCCCCCCCCC(O)=O | Pentadecanoic acid | AG00017Y | 309g |
| 1002-70-6 | ClCCCCCCCCC=C | 1-Decene, 10-chloro- | AG000182 | 3g |
| 1002-67-1 | O(C)CCOCCOCC | Ethane, 1-ethoxy-2-(2-methoxyethoxy)- | AG000185 | 10000g |
| 1002-62-6 | CCCCCCCCCC([O-])=O.[Na+] | Decanoic acid, sodium salt (1:1) | AG000188 | 2500g |
| 1003298-72-3 | OC1=C(F)C=C(B(O)O)C=C1Cl | 3-Chloro-5-fluoro-4-hydroxyphenylboronic acid | AG0001MB | 20g |
| 100324-81-0 | O=C(N1CCCC[C@H](O)C)N(C)C2=C(N(C)C=N2)C1=O | (R)-Lisofylline | AG0001MI | 0.3g |
| 10032-13-0 | CCCCCCOC(=O)CC(C)C | Butanoic acid, 3-methyl-, hexyl ester | AG0001MP | 25g |
| 10032-08-3 | CCCCCCCOC(=O)C=Cc1ccccc1 | 2-Propenoic acid, 3-phenyl-, heptyl ester | AG0001MQ | 10g |
| 10032-05-0 | CCCCCCC(OC)OC | 1,1-Dimethoxyheptane | AG0001MR | 350g |
| 1003310-07-3 | O=C(O)CC1=CN(CC2=CC=CC=C2)N=N1 | 2-(1-Benzyl-1H-1,2,3-triazol-4-yl)acetic acid | AG0001MU | 3g |
| 131797-35-8 | FC(C1=NNC(Cl)=C1)(F)F | 5-CHLORO-3-TRIFLUOROMETHYL-1H-PYRAZOLE | AG0001MV | 25g |
| 100331-89-3 | BrCC(C1=C2C=CC(O)=NC2=C(OCC3=CC=CC=C3)C=C1)=O | 8-Benzyloxy-5-(2-bromoacetyl)-2-hydroxyquinoline | AG0001N6 | 300g |
| 100330-50-5 | C#CCCC(CC(OC)=O)=O | METHYL 3-OXOHEPT-6-YNOATE | AG0001NA | 30g |
| 10034-99-8 | O.O.O.O.O.O.O.[Mg+2].[O-]S(=O)(=O)[O-] | Magnesium Sulfate Heptahydrate | AG0001NV | 10000g |
| 10034-88-5 | [O-]S(=O)(O)=O.[H]O[H].[Na+] | Sodium Hydrogen Sulfate Monohydrate | AG0001NZ | 32500g |
| 10034-76-1 | O=S([O-])([O-])=O.[H]O[H].O=S([O-])([O-])=O.[Ca+2].[Ca+2] | Calcium sulfate hemihydrate | AG0001O3 | 11500g |
| 10034-20-5 | N[C@H]1[C@H](OC(C)=O)O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC( | 1,3,4,6-Tetra-o-acetyl-2-amino-2-deoxy-beta-d-glucopyranose, HCl | AG0001O4 | 500g |
| 10034-19-2 | N[C@@H]1[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)O[C@@H]1 | (2R，3R，4R，5S，6R)-6-(Acetoxymethyl)-3-Aminotetrahydro-2H-Pyran-2 | AG0001O5 | 60g |
| 100348-93-4 | O=C1CCCC2=CC(CC[C@@]12C)=O | R(-)-8A-Methyl-3,4,8,8a-tetrahydro-1,6(2h,7h)-naphthalenendione | AG0001O7 | 2g |
| 100343-98-4 | O=C1OC2=C(C=CC(N(CC)CC)=C2)C=C1C(NN)=O | 7-(Diethylamino)-2-oxo-2H-chromene-3-carbohydrazide | AG0001OL | 500g |
| 1002-57-9 | O=C(O)CCCCCCCN | 8-Aminooctanoic acid | AG00018A | 200g |
| 1002-43-3 | CCCCCCCCC(CC)C | 3-Methylundecane | AG00018E | 0.5g |
| 1002-41-1 | ClCCSSCCCl | 1,2-Bis(2-chloroethyl)disulfane | AG00018F | 3g |
| 1002-40-0 | BrCCSSCCBr | 1,2-bis(2-bromoethyl)disulfane | AG00018G | 5g |
| 1002-36-4 | CCCCC#CCO | 2-Heptyn-1-ol | AG00018I | 125g |
| 100202-78-6 | FC1=CC=CC(CBr)=N1 | 2-(Bromomethyl)-6-fluoropyridine | AG00018V | 10g |
| 100202-39-9 | O=C(C1CNC1)OC.[H]Cl | Methyl azetidine-3-carboxylate, HCl | AG00018X | 501g |
| 100201-57-8 | OC(C(O)=O)C(C1=CC=C(O)C=C1)O | 2,3-Dihydroxy-3-(4-hydroxyphenyl)propanoic acid | AG00018Y | 0.005g |
| 100200-70-2 | O=S(C1=CC=C(C)C=C1)(/N=C/C2=CC=CC=C2OC)=O | N-(2-Methoxybenzylidene)-4-methylbenzenesulfonamide | AG000194 | 3g |
| 10020-96-9 | O[C@H](c1ccccc1)C#N | Benzeneacetonitrile, α-hydroxy-, (αR)- | AG000196 | 150g |
| 1002129-33-0 | OB(O)C1=CC=C(N=C1)N1CCCCC1 | 6-(Piperidin-1-yl)pyridine-3-boronic acid | AG000199 | 5g |
| 1002128-86-0 | OB(O)C1=CN=C(N=C1)N1CCCCC1 | 2-Piperidinopyrimidine-5-boronic acid | AG00019A | 15g |
| 1002127-60-7 | OB(O)C1=CCOCC1 | (3,6-Dihydro-2h-pyran-4-yl)-boronic acid | AG00019B | 125g |
| 100211-04-9 | COc1cc2occ(c(=O)c2c(c1OC)OC)c1ccccc1OC | 4H-1-Benzopyran-4-one, 5,6,7-trimethoxy-3-(2-methoxyphenyl)- | AG00019F | 0.005g |
| 100222-98-8 | O=C(O)CCCCCN(C(OC(C)(C)C)=O)C | 6-((tert-Butoxycarbonyl)(methyl)amino)hexanoic acid | AG0001A1 | 5g |
| 10022-13-6 | O=C(C1=C2C=CC=C1)N([C@H]3[C@H](OC(C)=O)O[C@H](COC(C)=O)[C@@H](OC | 1,3,4,6-TETRA-O-ACETYL-2-DEOXY-2-PHTHALIMIDO-BETA-D-GLUCOPYRANOSE | AG0001AJ | 400g |
| 1002334-13-5 | CC1(C)C(C)(C)OB(C2=NN(C3=CC=CC=C3)C=C2)O1 | 1-Phenyl-1H-pyrazole-3-boronic acid pinacol ester | AG0001AK | 8g |
| 1002334-12-4 | CC1(C)C(C)(C)OB(C2=CN(C3=CC=CC=C3)N=C2)O1 | 1-Phenylpyrazole-4-boronic acid, pinacol ester | AG0001AL | 50g |
| 1003043-55-7 | CCOC1=NC=C(B(O)O)C=N1 | 2-Ethoxypyrimidine-5-boronic acid | AG0001JE | 13.4g |
| 1003043-49-9 | CN(CCCOC1=CC=C(B(O)O)C=N1)C | (6-(3-(Dimethylamino)propoxy)pyridin-3-yl)boronic acid | AG0001JF | 5g |
| 1003043-46-6 | CCOC1=NC(OCC)=C(C=C1)B(O)O | (2,6-Diethoxypyridin-3-yl)boronic acid | AG0001JG | 1g |
| 1003043-40-0 | CC1=C(Cl)N=CC(B(O)O)=C1 | 2-Chloro-3-methylpyridine-5-boronic acid | AG0001JI | 500g |
| 1003043-37-5 | OB(C1=CC=C(C(C)C)N=C1Cl)O | 2-Chloro-6-isopropylpyridine-3-boronic acid | AG0001JJ | 2g |
| 1003043-34-2 | OB(C1=CC(C)=C(Br)N=C1)O | 2-Bromo-3-methylpyridine-5-boronic acid | AG0001JK | 500g |
| 1003043-31-9 | OB(O)C1=C(Cl)C(Br)=NC=C1 | 2-Bromo-3-chloropyridine-4-boronic acid | AG0001JL | 5g |
| 1003043-25-1 | OB(C1=CC=CC=C1C(OC(C)(C)C)=O)O | (2-(tert-Butoxycarbonyl)phenyl)boronic acid | AG0001JM | 0.1g |
| 1003042-92-9 | CCOc1ccc(cc1B(O)O)C=O | 2-Ethoxy-5-formylphenylboronic acid | AG0001JN | 2g |
| 1003042-89-4 | O=CC1=CC=C(OCC)C=C1B(O)O | 5-Ethoxy-2-formylphenylboronic acid | AG0001JO | 20g |
| 1003042-59-8 | OCC1=CC(B(O)O)=C(Cl)C=C1 | 2-Chloro-5-hydroxymethylphenylboronic acid | AG0001JP | 100g |
| 1003042-50-9 | CC1=CC=C(N)C=C1B(O)O | (5-Amino-2-methylphenyl)boronic acid | AG0001JQ | 1g |
| 1003042-41-8 | ClC1=CC=C(N)C(B(O)O)=C1 | (2-Amino-5-Chlorophenyl)Boronic Acid | AG0001JR | 7g |
| 100304-88-9 | CC(=O)NC1=NC=C(F)C=C1 | 2-Acetamido-5-fluoropyridine | AG0001JW | 8.95g |
| 1003048-74-5 | O=C1CCC2=C1C(Br)=CC(OC)=C2 | 7-Bromo-5-methoxy-2,3-dihydro-1H-inden-1-one | AG0001K3 | 0.3g |
| 1003048-72-3 | FC1=C2C(=O)CCC2=C(Br)C=C1 | 4-bromo-7-fluoro-2,3-dihydro-1H-inden-1-one | AG0001K4 | 500g |
| 1003048-71-2 | O=C(O)CCC1=CC(F)=CC=C1Br | 3-(2-BROMO-5-FLUOROPHENYL)PROPANOIC ACID | AG0001K5 | 25g |
| 1003048-68-7 | O=C1CCC2=C1C(C(F)(F)F)=CC=C2 | 7-(Trifluoromethyl)-2,3-dihydro-1H-inden-1-one | AG0001K6 | 2g |
| 1003043-73-9 | CC(OC(N1CCN(C2=NC=CC(B(O)O)=C2)CC1)=O)(C)C | 2-(4-(tert-Butoxycarbonyl)piperazin-1-yl)pyridin-4-ylboronic acid | AG0001K7 | 0.37g |
| 1003043-67-1 | OB(C1=CC=C(N2CCNCC2)N=C1)O | 2-Piperazinopyridine-5-boronic acid | AG0001K8 | 25g |
| 1003709-96-3 | CC1=CC(=C(C(=C1)F)F)C(=O)O | 2,3-Difluoro-5-methylbenzoic acid | AG0001RU | 10g |
| 1003709-80-5 | COC1=CC(C(O)=O)=C(F)C(OC)=C1F | 2,4-Difluoro-3,5-dimethoxybenzoic acid | AG0001RV | 2g |
| 1003709-67-8 | COC1=C(F)C(F)=C(C=C1F)C(O)=O | 4-Methoxy-2，3，5-trifluorobenzoic acid | AG0001RX | 10g |
| 1003709-57-6 | O=CC1=CC=C(I)C(F)=C1 | 3-Fluoro-4-iodobenzaldehyde | AG0001RY | 100g |
| 1003709-54-3 | O=C(O)C1=CC(F)=C(C)C=C1Br | 2-Bromo-5-fluoro-4-methylbenzoic acid | AG0001RZ | 100g |
| 1003709-47-4 | CC1=CC(F)=CC(Br)=C1C(O)=O | 2-Bromo-4-fluoro-6-methylbenzoic acid | AG0001S0 | 500g |
| 1003709-39-4 | O=C(O)C1=CC(C)=C(F)C=C1Br | 2-Bromo-4-Fluoro-5-Methylbenzoic Acid | AG0001S1 | 75g |
| 1003709-35-0 | NC1=CC(Br)=C(F)C(Br)=C1 | 3,5-dibromo-4-fluoroaniline | AG0001S2 | 50g |
| 1003708-82-4 | CC1=C(C=C(F)C(F)=C1)C#N | 4,5-Difluoro-2-methylbenzonitrile | AG0001S9 | 700g |
| 1003712-20-6 | N#CC1=CC(F)=CC(C)=C1F | 2,5-Difluoro-3-methylbenzonitrile | AG0001SD | 30g |
| 1003712-18-2 | CC1=CC(=C(C(=C1)F)F)C#N | 2,3-Difluoro-5-methylbenzonitrile | AG0001SE | 2g |
| 1003712-12-6 | CC1=C(F)C(C(N)=O)=CC=C1 | 2-Fluoro-3-methylbenzamide | AG0001SF | 0.1g |
| 1003711-85-0 | CC1=NC=C(Br)C(Cl)=C1 | 5-Bromo-4-chloro-2-methylpyridine | AG0001SG | 36.5g |
| 1003711-65-6 | C1=C(C=NC(=C1O)F)Cl | 5-Chloro-2-fluoro-3-hydroxypyridine | AG0001SJ | 3g |
| 1003711-55-4 | O=[N+](C1=CC(OC)=CN=C1Cl)[O-] | 2-Chloro-5-methoxy-3-nitropyridine | AG0001SL | 10g |
| 1003711-43-0 | CC1=CC(O)=CN=C1Br | 2-Bromo-5-hydroxy-3-picoline | AG0001SN | 50g |
| 1003711-39-4 | N#CC1=CC=C(Br)N=C1C | 2-Bromo-5-cyano-6-picoline | AG0001SO | 30g |
| 1003711-35-0 | CC1=CC(Br)=NC=C1C#N | 2-Bromo-5-cyano-4-picoline | AG0001SP | 15g |
| 1003-21-0 | CN1C=NC=C1Br | 5-BROMO-1-METHYL-1H-IMIDAZOLE | AG0001HO | 48.8g |
| 1003-20-9 | ClCC1(OC1)CCl | 2,2-Bis(Chloromethyl)Oxirane | AG0001HP | 5g |
| 1003-10-7 | O=C1SCCC1 | 4-Butyrothiolactone | AG0001HT | 250g |
| 1003-07-2 | O=C1NSC=C1 | 3(2H)-Isothiazolone | AG0001HV | 200g |
| 1003-04-9 | O=C1CSCC1 | Tetrahydrothiophen-3-one | AG0001HW | 350g |
| 1003-83-4 | CC1(C)OCC=CCO1 | 2,2-Dimethyl-4,7-dihydro-1,3-dioxepine | AG0001I1 | 1000g |
| 1003-73-2 | CC1=C[N+]([O-])=CC=C1 | 3-Picoline-n-oxide | AG0001I6 | 10000g |
| 1003-68-5 | O=C1C=CC(C)=CN1 | 5-Methyl-2(1H)pypridinone | AG0001I7 | 75g |
| 1003-67-4 | CC1=CC=[N+]([O-])C=C1 | 4-Picoline-N-oxide | AG0001I8 | 1500g |
| 1003-61-8 | C1=C(SC(=N1)N)C=O | 2-AMINO-5-FORMYLTHIAZOLE | AG0001IB | 500g |
| 1003-60-7 | O=CC1=CN=C(C)S1 | 2-Methylthiazole-5-carbaldehyde | AG0001IC | 200g |
| 1003-56-1 | CC1=CC=CNC1=O | 3-METHYL-2-PYRIDONE | AG0001IE | 1000g |
| 1003-52-7 | N#CC1=C(C)N=CO1 | 4-METHYL-1,3-OXAZOLE-5-CARBONITRILE | AG0001IG | 15g |
| 1003-51-6 | C1CN(C(=O)C1N)O | 3-Amino-1-hydroxypyrrolidin-2-one | AG0001IH | 0.5g |
| 1003-50-5 | CN1C(Br)=C(Br)N=C1 | 4,5-dibromo-1-methyl-1H-imidazole | AG0001II | 25g |
| 1003-42-5 | O=C1SCCCC1 | thian-2-one | AG0001IM | 25g |
| 1003-40-3 | NC1=CC=NC=C1.[H]Cl | Pyridin-4-amine hydrochloride | AG0001IN | 45.75g |
| 1004-98-4 | O=C1NC2CCC1NC2=O | 2,5-Diazabicyclo[2.2.2]octane-3,6-dione | AG0001XT | 0.5g |
| 1004112-67-7 | FC(F)OC1=CC(Cl)=CC(Br)=C1 | 1-Bromo-3-chloro-5-(difluoromethoxy)benzene | AG0001XV | 10g |
| 100421-52-1 | O=C(C1=C(F)C=CS1)OC | Methyl 3-fluorothiophene-2-carboxylate | AG0001XY | 500g |
| 100418-33-5 | Cc1ccc(NCCO)c(c1)[N+](=O)[O-] | N-(2-Hydroxyethyl) 4-methyl-2-nitroaniline | AG0001Y8 | 400g |
| 10042-71-4 | O=C([O-])COC1=CC=C2C=CC=CC2=C1.[Na+] | SODIUM 2-(NAPHTHALEN-2-YLOXY)ACETATE | AG0001YE | 900g |
| 10042-59-8 | CCCCCC(CCC)CO | 2-Propylheptan-1-ol | AG0001YI | 4000g |
| 1004294-80-7 | O=C1NCC2=C1C=C(B3OC(C)(C)C(C)(C)O3)C=C2 | 6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)isoindolin-1-one | AG0001YK | 29.75g |
| 1004294-79-4 | O=C(OC)C1=CC(B2OC(C)(C)C(C)(C)O2)=CC(O)=C1 | 3-Hydroxy-5-(methoxycarbonyl)phenylboronic acid, pinacol ester | AG0001YL | 2g |
| 1004294-64-7 | O=C(OC)C1=C(Cl)N=C(N)C=C1 | Methyl 6-amino-2-chloronicotinate | AG0001YN | 10g |
| 1004294-58-9 | NC1=NC(Br)=C(Cl)C=C1 | 6-Bromo-5-chloropyridin-2-amine | AG0001YO | 600g |
| 1004284-08-5 | CCC(CC1=C(Cl)C=C(Cl)C=C1)N | 1-(2,4-dichlorophenyl)butan-2-amine | AG0001YP | 1g |
| 100427-26-7 | COC(C1C(C2=CC([N+]([O-])=O)=CC=C2)C(C(OC(CN(CCC(C2=CC=CC=C2)C2=CC=CC | 3-{1-[(3,3-diphenylpropyl)(methyl)amino]-2-methylpropan-2-yl} 5-methyl 2, | AG0001YU | 0.2g |
| 10043-37-5 | C=CC(N1CCCCC1)=O | 1-(Piperidin-1-yl)prop-2-en-1-one | AG0001Z3 | 24g |
| 1004316-88-4 | O=C(OCC1=CN=CS1)N[C@H](CC[C@@H](NC([C@@H](NC(N(CC2=CSC(C(C)C)=N | 1,3-thiazol-5-ylmethyl N-[(2R,5R)-5-[(2S)-2-{[methyl({[2-(propan-2-yl)-1,3-thi | AG0001ZB | 1.25g |
| 1004305-97-8 | CCOC(=O)C(F)(F)C1=CC=C(Br)C=C1 | ethyl 2-(4-bromophenyl)-2，2-difluoroacetate | AG0001ZD | 125g |
| 100442-33-9 | C1(=CC=CC=C1)C(CCN(C)CC(C)(O)C)C2=CC=CC=C2 | 2,N-Dimethyl-N-(3,3-diphenylpropyl)-1-amino-2-propanol | AG0001ZH | 600g |
| 100523-96-4 | BrC1=NC=CC(=C1)I | 2-bromo-4-iodopyridine | AG000298 | 200g |
| 100523-85-1 | O=C(O)C1=CC=C(CC)C(O)=C1 | 4-Ethyl-3-Hydroxybenzoic Acid | AG000299 | 5g |
| 100523-84-0 | BrC1=CC(=CS1)C(=O)O | 5-BROMOTHIOPHENE-3-CARBOXYLIC ACID | AG00029A | 500g |
| 100523-83-9 | BrC1=CC(I)=NC=C1 | 4-Bromo-2-iodopyridine | AG00029B | 60g |
| 1005349-13-2 | NC1=NC=CN=C1C#C | 2-Amino-3-ethynylpyrazine | AG00029E | 10g |
| 1005346-96-2 | COC1=C(OC)C=C(C=O)C(B(O)O)=C1 | 2-Formyl-4,5-dimethoxyphenylboronic acid | AG00029G | 20g |
| 1005342-94-8 | CN(C(=O)c1cc(Br)ccn1)OC | 2-Pyridinecarboxamide, 4-bromo-N-methoxy-N-methyl- | AG00029H | 22.4g |
| 1005342-46-0 | C[C@H](NC)C(N[C@@H](C1CCCCC1)C(N2[C@H](C3=NC(C(C4=CC=C(F)C=C4)=O) | LCL161 | AG00029J | 1.25g |
| 1005326-26-0 | O=C(C1=C(N)C=C(C)N1)OCC | Ethyl 3-amino-5-methyl-1H-pyrrole-2-carboxylate | AG00029M | 2g |
| 1005291-43-9 | O=CC1=C(F)C=NC(Br)=C1 | 2-Bromo-5-fluoro-4-formylpyridine | AG00029S | 200g |
| 1005397-65-8 | O=C(N1C(C)CC(B2OC(C)(C)C(C)(C)O2)=CC1C)OC(C)(C)C | tert-Butyl 2,6-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5,6-di | AG0002A3 | 1g |
| 1005397-64-7 | C[C@H]1CC(=O)C[C@@H](C)N1C(=O)OC(C)(C)C | cis-tert-Butyl 2,6-dimethyl-4-oxopiperidine-1-carboxylate | AG0002A4 | 79g |
| 10054-20-3 | CCCCCCCCCCCCCCCCCCN1CC(CC1=O)C(=O)O | 1-Octadecyl-5-oxopyrrolidine-3-carboxylic acid | AG0002AP | 2g |
| 1005515-26-3 | NCC1=NC=CC(C(F)(F)F)=C1.[H]Cl | C-(4-Trifluoromethyl-pyridin-2-yl)methylamine, HCl | AG0002AR | 15g |
| 1005504-62-0 | ClC1=C(CN2CCC(CC2)COC2=C3C(=NC(=NC3=CC=C2)N)N)C(=CC=C1)Cl | 5-((1-(2,6-Dichlorobenzyl)piperidin-4-yl)methoxy)quinazoline-2,4-diamine | AG0002AS | 0.5g |
| 1005500-75-3 | O=S(C1=CC=C(C=C1)C)(N(C)C#C)=O | N-Ethynyl-N,4-dimethylbenzenesulfonamide | AG0002AT | 500g |
| 1005498-91-8 | NC1CCOCC1.CC(O)=O | Tetrahydro-2H-pyran-4-amine acetate | AG0002AU | 100g |
| 1005474-88-3 | CC1=C(F)C=CC(=N1)C(O)=O | 5-Fluoro-6-methylpyridine-2-carboxylic acid | AG0002AV | 10g |
| 1005450-55-4 | [C@@H](NC(=O)CCc1cc(C(F)(F)F)ccc1)(C)c1c2c(ccc1)cccc2 | (R)-N-(1-(Naphthalen-1-yl)ethyl)-3-(3-(trifluoromethyl)phenyl)propanamide | AG0002AY | 200g |
| 1002334-06-6 | CC1(C)C(C)(C)OB(C2=CN(C)N=C2C3=CC=CC=C3)O1 | 1-Methyl-3-phenyl-4-(4，4，5，5-tetramethyl-1，3，2-dioxaborolan-2-yl)- | AG0001AN | 15g |
| 1002309-52-5 | O=C1C=CC(B2OC(C)(C)C(C)(C)O2)=CN1C | N-Methyl-1H-pyridin-2-one-5-boronic acid, pinacol ester | AG0001AO | 50g |
| 1002309-48-9 | CC1(C)OB(OC1(C)C)c1cn(nc1)C1CCC1 | 1-Cyclobutyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl);-1H-pyrazole | AG0001AP | 20g |
| 1002309-47-8 | CC1(C)OB(OC1(C)C)C1=CC2=C(C=C1)N=CS2 | Benzothiazole-6-boronic acid, pinacol ester | AG0001AQ | 75g |
| 1002309-19-4 | CC1(C)OB(OC1(C)C)c1cc2c(cc1)C(=O)N(C2)C | 2,3-Dihydro-2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-isoi | AG0001AR | 30g |
| 1002304-34-8 | COC1=CC=C2C(OCC3=NN=C4C=CC(C5=CC=CC=C5)=NN43)=CC=NC2=C1 | AMG-208 | AG0001AS | 0.2g |
| 1002243-79-9 | N#CCCN1N=CC([N+]([O-])=O)=C1 | 3-(4-Nitro-1h-pyrazol-1-yl)propanenitrile | AG0001AT | 1g |
| 1002359-91-2 | O=C(N1C[C@H](CBr)CCC1)OC(C)(C)C | (R)-tert-Butyl 3-(bromomethyl)piperidine-1-carboxylate | AG0001BA | 100g |
| 1002359-83-2 | CC(C)(C)OC(=O)N1CCC[C@@H](C(=O)NN)C1 | (R)-1-Boc-piperidine-3-carboxylic acid hydrazide | AG0001BE | 25g |
| 1002355-96-5 | O=C(N1CC(C1)=CC(OCC)=O)OC(C)(C)C | tert-Butyl 3-(2-Ethoxy-2-oxoethylidene)azetidine-1-carboxylate | AG0001BH | 100g |
| 1002355-91-0 | O=C(N1CCC(SC(N)=N2)=C2C1)OC(C)(C)C | 2-Amino-6,7-dihydro-4H-thiazolo[4,5-c]pyridine-5-carboxylic acid tert-butyl e | AG0001BI | 3g |
| 1002345-50-7 | F[B-](F)(F)F.F[B-](F)(F)F.[PH+](CCC[PH+](C1CCCCC1)C2CCCCC2)(C3CCCCC3)C4C | 1,3-Bis(dicyclohexylphosphino)propane bis(tetrafluoroborate) | AG0001BM | 500g |
| 1002344-97-9 | COC1=C(Cl)C=CC(C=O)=C1F | 4-chloro-2-fluoro-3-methoxybenzaldehyde | AG0001BN | 60g |
| 1002339-79-8 | O=C(O)C1=CC=C(C(C2=CC=CC=C2)=C(C3=CC=C(C=C3)C(O)=O)C4=CC=CC=C4)C=C1 | 4,4′-(1,2-Diphenylethene-1,2-diyl)dibenzoic acid | AG0001BO | 125g |
| 100234-59-1 | COc1cnc(C=C)c2[nH]c3c(O)cccc3c12 | Picrasidine I | AG0001BP | 0.005g |
| 1002360-09-9 | O=C(N1C[C@@H](NC(OCC2=CC=CC=C2)=O)CCC1)OC(C)(C)C | (S)-1-Boc-3-(Cbz-amino)-piperidine | AG0001C4 | 11g |
| 10024-70-1 | COC(C)CC(O)=O | 3-Methoxybutanoic acid | AG0001CE | 5g |
| 10027-80-2 | Cl.Cl.N[C@@H]1[C@H](N)CCCC1 | (1R,2S)-Cyclohexane-1,2-diamine dihydrochloride | AG0001FP | 2g |
| 10027-07-3 | O=C(Cl)CCCCCCC(Cl)=O | Suberoyl Chloride | AG0001FW | 550g |
| 100278-74-8 | OC1=CC(Cl)=C(C)C=C1[N+]([O-])=O | 5-Chloro-4-methyl-2-nitrophenol | AG0001G8 | 5g |
| 100277-27-8 | OCC1CCSCC1 | (Tetrahydro-2H-thiopyran-4-yl)methanol | AG0001GD | 25g |
| 10028-70-3 | O=C([O-])C1=CC=C(C([O-])=O)C=C1.[Na+].[Na+] | Sodium Terephthalate | AG0001GF | 2500g |
| 10028-24-7 | O=P([O-])([O-])O.[H]O[H].[H]O[H].[Na+].[Na+] | Sodium hydrogenphosphate dihydrate | AG0001GI | 50g |
| 10028-22-5 | [O-]S(=O)(=O)[O-].[O-]S(=O)(=O)[O-].[O-]S(=O)(=O)[O-].[Fe+3].[Fe+3] | Sulfuric acid, iron(3+) salt (3:2) | AG0001GJ | 575g |
| 100291-86-9 | O=C(C1=CC=C(OC)C=C1OC2OC(COC3OCC(O)(CO)C3O)C(O)C(O)C2O)C | 1-[2-[(6-O-D-Apio-β-D-furanosyl-β-D-glucopyranosyl)oxy]-4-methoxyphenyl] | AG0001GO | 0.14g |
| 100282-49-3 | O=C(OC(C)(C)C)Nc1ccc(c(c1)Cl)C | Carbamic acid, (3-chloro-4-methylphenyl)-, 1,1-dimethylethyl ester | AG0001GY | 14g |
| 10029-09-1 | NC[C@@H]1CC[C@H](CN)CC1 | cis-1,4-Bis(aminomethyl)cyclohexane | AG0001H9 | 1g |
| 10029-04-6 | C=C(CO)C(OCC)=O | Ethyl 2-(hydroxymethyl)acrylate | AG0001HA | 375g |
| 100299-08-9 | O=C1C(C2=N[N-]N=N2)=CN=C3N1C=CC=C3C.[K+] | Pemirolast potassium | AG0001HB | 25g |
| 3232-84-6 | O=C(N1)NNC1=O | Urazole | AG0001HE | 25g |
| 1003-35-6 | NC1=NC(=O)NN1 | 5-Amino-1H-1,2,4-triazol-3(2H)-one | AG0001HF | 25g |
| 1003-32-3 | O=CC1=CN=CS1 | Thiazole-5-Carboxaldehyde | AG0001HH | 200g |
| 1003-31-2 | C1=C(SC=C1)C#N | Thiophene-2-carbonitrile | AG0001HI | 425g |
| 1003-29-8 | O=CC1=CC=CN1 | 1H-Pyrrole-2-carbaldehyde | AG0001HK | 1000g |
| 1003013-77-1 | ICC1COC1 | 3-(iodomethyl)oxetane | AG0001IR | 25g |
| 1003013-76-0 | C1(COCC2=CC=CC=C2)COC1 | 3-((Benzyloxy)methyl)oxetane | AG0001IS | 2g |
| 1003012-96-1 | CN(C)[C@H](C1=C(C=CC=C1)P(C2=CC=CC=C2)C3=CC=CC=C3)C45=C6[Fe+2]4789% | (2Rp)-1-[(R)-α-(Dimethylamino)-2-(diphenylphosphino)benzyl]-2-diphenylp | AG0001IT | 25g |
| 1003011-02-6 | O=C(N1N=CC=C1N)OC(C)(C)C | tert-Butyl 5-amino-1H-pyrazole-1-carboxylate | AG0001IV | 5g |
| 10030-85-0 | C[C@H](O)[C@H](O)[C@@H](O)[C@@H](O)C=O.[H]O[H] | L(+)-Rhamnose Monohydrate | AG0001IZ | 3500g |
| 10030-80-5 | [C@@H]([C@H]([C@H](C=O)O)O)([C@H](CO)O)O | L-mannose | AG0001J0 | 25g |
| 10030-78-1 | O=C1N=C(NC)NC2=C1NC=N2 | 2-(METHYLAMINO)-6,7-DIHYDRO-3H-PURIN-6-ONE | AG0001J1 | 2g |
| 10030-73-6 | CCCCCC/C=C/CCCCCCCC(O)=O | Palmitelaidic Acid | AG0001J3 | 1.25g |
| 10030-67-8 | O([C@@]1(CO)[C@@H](O[C@H]2O[C@H](CO)[C@H]([C@@H]([C@H]2O)O)O)[ | O-α-D-Glucopyranosyl-(1→3)-β-D-fructofuranosyl α-D-glucopyranoside mon | AG0001J4 | 225g |
| 10030-53-2 | OC[C@H]([C@H]([C@@H]([C@H]([C@H](C(=O)[O-])O)O)O)O)O.OC[C@H]([C@ | D-glycero-D-gulo-Heptonic acid, calcium salt (2:1), dihydrate (9CI) | AG0001J5 | 500g |
| 10030-52-1 | O[N+]([O-])=O.O=C(CCN)N[C@H](C(O)=O)Cc1cncn1C | (S)-2-(3-Aminopropanamido)-3-(1-methyl-1H-imidazol-5-yl)propanoic acid co | AG0001J6 | 10g |
| 1003-99-2 | C1=C(C(=CC=C1F)Br)N | 2-Bromo-5-fluoroaniline | AG0001J8 | 1000g |
| 1003-98-1 | C1=C(C(=CC=C1F)N)Br | 2-Bromo-4-fluoroaniline | AG0001J9 | 8500g |
| 1003-91-4 | CN1C(Br)=C(Br)N=C1Br | 2,4,5-Tribromo-1-methyl-1H-imidazole | AG0001JC | 150g |
| 1004-74-6 | NC1=NC(N)=C(N)C(N)=N1 | 2,4,5,6-Tetraaminopyrimidine | AG0001WO | 40g |
| 1004-66-6 | COC1=C(C)C=CC=C1C | 2,6-Dimethylanisole | AG0001WQ | 1222g |
| 1004-65-5 | CC1=NN=C2C=CC=CN12 | 3-Methyl-[1,2,4]triazolo[4,3-a]pyridine | AG0001WR | 40g |
| 1004-64-4 | NC1=NOC2=C1CCCC2 | 1,2-Benzisoxazol-3-amine, 4,5,6,7-tetrahydro- | AG0001WS | 15g |
| 1004-58-6 | C1CCC2(C=C1)OCCO2 | 1,4-Dioxaspiro[4.5]dec-6-ene | AG0001WU | 0.75g |
| 1004-39-3 | NC1=CC(N)=NC(S)=N1 | 4,6-Diamino-2-mercaptopyrimidine | AG0001WX | 200g |
| 1004-38-2 | C1=C(N=C(N=C1N)N)N | 2,4,6-Pyrimidinetriamine | AG0001WY | 3000g |
| 1004-36-0 | O=c1cc(C)oc(c1)C | 2,6-Dimethyl-4H-pyran-4-one | AG0001X0 | 1000g |
| 1004-24-6 | OCC1CCC(CC1)=C | (4-Methylenecyclohexyl)methanol | AG0001X4 | 6g |
| 10041-06-2 | CC(C1=CC=C(N2C=CN=C2)C=C1)=O | 1-(4-Acetylphenyl)imidazole | AG0001XJ | 51.9g |
| 10041-02-8 | OC1=CC=C(N2C=CN=C2)C=C1 | 4-(Imidazol-1-yl)phenol | AG0001XM | 139.9g |
| 10040-98-9 | C(=O)c1ccc(cc1)n1ccnc1 | 4-Imidazol-1-yl-benzaldehyde | AG0001XN | 2000g |
| 10040-96-7 | BrC1=CC=C(N2C=CN=C2)C=C1 | 1-(4-Bromophenyl)imidazole | AG0001XO | 75g |
| 10040-95-6 | COC1=CC=C(C=C1)N1C=CN=C1 | 1-(4-Methoxyphenyl)imidazole | AG0001XP | 25g |
| 10040-45-6 | C(C1N=CC=CC=1)(C1C=CC(OS(O[Na])(=O)=O)=CC=1)C1C=CC(OS(O[Na])(=O)=O)= | Sodium Picosulfate | AG0001XS | 45g |
| 10047-28-6 | CCCCOC(CS)=O | Thioglycolic acid n-butyl ester | AG00022J | 300g |
| 1004775-33-0 | COC1=C(C=CC(=C1)B(O)O)C(F)(F)F | 3-Methoxy-4-(trifluoromethyl)phenylboronic acid | AG00022M | 6g |
| 1004761-68-5 | NC1=C(C)C=C(B2OC(C)(C)C(C)(C)O2)C=C1C | 4-Amino-3,5-dimethylphenylboronic acid, pinacol ester | AG00022N | 50g |
| 100478-25-9 | CSc1nc(OC(F)F)cc(OC(F)F)n1 | 4,6-Bis(difluoromethoxy)-2-(methylthio)pyrimidine | AG00022Z | 10g |
| 100478-04-4 | CCOC(=O)c1cnc2cn[nH]c2c1Cl | Ethyl 7-chloro-1H-pyrazolo[4,3-b]pyridine-6-carboxylate | AG000230 | 1g |
| 10048-98-3 | O=P([O-])([O-])O.[Ba+2] | Barium hydrogen phosphate | AG000235 | 425g |
| 10048-13-2 | OC1=CC=CC=2OC=3C4=C(C=C(C3C(C12)=O)OC)O[C@@H]1[C@H]4C=CO1 | (3aR,12cS)-3a,12c-Dihydro-8-hydroxy-6-methoxy-7H-furo[3′,2′:4,5]furo[2,3-c] | AG000238 | 0.05g |
| 100487-82-9 | COC(=O)CC1=C(C=C(Br)C=C1)[N+]([O-])=O | Methyl 2-(4-bromo-2-nitrophenyl)acetate | AG00023A | 300g |
| 100487-74-9 | O=C1NC2=C(C=C(F)C(Cl)=C2)C1 | 6-Chloro-5-fluoro-2-oxindole | AG00023D | 30g |
| 100486-97-3 | COc1cc(ccc1OC)c1c(nc(n1n1c(nc(c1c1ccccc1)c1ccccc1)c1ccccc1Cl)c1ccccc1Cl)c1ccc | 1,1′-Bi-1H-imidazole, 2,2′,4-tris(2-chlorophenyl)-5-(3,4-dimethoxyphenyl)-4′, | AG00023J | 700g |
| 100488-87-7 | O=C(C)N(C(OCC(OC)COC(NCCCCCCCCCCCCCCCCCC)=O)=O)CC1=CC=CC=[N+]1CC | CV-6209 (chloride) | AG000243 | 0.005g |
| 10049-83-9 | S(CC1=C(CO)C(O)=C(C)N=C1)SCC1=C(CO)C(O)=C(C)N=C1.[H]Cl.[H]Cl | Pyrithioxin Dihydrochloride | AG000245 | 11g |
| 10049-42-0 | CCO[Si](CCCN(CC)CC)(OCC)OCC | N,N-Diethyl-3-(triethoxysilyl)propan-1-amine | AG000246 | 500g |
| 10049-21-5 | O=P(O)([O-])O.[H]O[H].[Na+] | Sodium phosphate monobasic monohydrate | AG000249 | 2000g |
| 10049-08-8 | [Ru+3].[Cl-].[Cl-].[Cl-] | Ruthenium(III) chloride | AG00024G | 300g |
| 10049-07-7 | Cl[Rh](Cl)Cl.Cl[Rh](Cl)Cl.Cl[Rh](Cl)Cl.Cl[Rh](Cl)Cl.Cl[Rh](Cl)Cl | Rhodium(III) chloride | AG00024H | 4g |
| 1004992-44-2 | CCC1=CNC2=NC=NC(Cl)=C21 | 4-Chloro-5-ethyl-7H-pyrrolo[2,3-d]pyrimidine | AG00024N | 2g |
| 100342-30-1 | S(=O)(=O)(NC(C)(C)C)C=1(SC=CC=1) | N-tert-Butyl-2-thiophenesulfonamide | AG0001OP | 125g |
| 1003588-15-5 | Cl.NC(C1CCCCCC1)=N | cycloheptanecarboximidamide hydrochloride | AG0001OY | 0.2g |
| 1003575-43-6 | NC1=CC(B2OC(C)(C)C(C)(C)O2)=CC=C1F | 3-Amino-4-fluorophenylboronic acid, pinacol ester | AG0001P0 | 20g |
| 1003562-01-3 | Cl.O=S(C1=CC=CC=C1)(C1CNCC1)=O | 3-(Phenylsulfonyl)pyrrolidine | AG0001P4 | 20g |
| 10035-16-2 | O=CC1=CC=C(OC=C2)C2=C1 | 1-Benzofuran-5-carbaldehyde | AG0001PK | 50g |
| 100367-37-1 | BrC1=C(C=C(C=C1)O)N | 3-Amino-4-bromophenol | AG0001PL | 200g |
| 100367-36-0 | OC1=CC=CC(N)=C1Br | 3-Amino-2-bromophenol | AG0001PM | 50g |
| 100366-75-4 | IC1=NC=C(C=C1)C(F)(F)F | 2-Iodo-5-trifluoromethylpyridine | AG0001PO | 25g |
| 100366-74-3 | C1=CC(=NC(C(F)(F)F)=C1)I | 2-Iodo-6-(trifluoromethyl)pyridine | AG0001PP | 20g |
| 100364-10-1 | O(CCCN)C(C)(C)C | 3-(tert-Butoxy)propan-1-amine | AG0001PU | 9g |
| 100361-18-0 | C1CC1N2C=C(C(C3=CC(=C(Cl)N=C23)F)=O)C(=O)O | 7-Chloro-1-Cyclopropyl-6-Fluoro-4-Oxo-1,4-Dihydro-1,8-Naphthyridine-3-Car | AG0001Q1 | 300g |
| 10036-64-3 | CC(N[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1O)=O | N-Acetyl-Alpha-D-glucosamine | AG0001Q8 | 10g |
| 100368-98-7 | CCC1NCCOC1C2=CC=CC=C2 | 3-Ethyl-2-phenylmorpholine | AG0001QD | 10g |
| 100368-29-4 | N1C2CCCC1COC2.Cl | 3-Oxa-9-Azabicyclo[3.3.1]Nonane Hydrochloride | AG0001QF | 0.5g |
| 1005009-98-2 | CC1(C)C(C)(C)OB(C2=CN=C(NC)C=C2)O1 | 6-(Methylamino)-3-pyridinyl boronic acid pinacol ester | AG000260 | 75g |
| 1005003-43-9 | FC(F)(F)C1=CC(C(F)(F)F)=CC(NC(NC2=C(C3=C(NC(NC4=CC(C(F)(F)F)=CC(C(F)(F)F | N,N’-(R)-(1,1′-Binaphthalene)-2,2′-diylbis[N’-[3,5-bis(trifluoromethyl)phenyl] | AG000262 | 1g |
| 100501-62-0 | CCOC(=O)c1cn(CC)c2c(F)c(F)c(F)cc2c1=O | Ethyl 1-Ethyl-6,7,8-Trifluoro-1,4-Dihydro-4-Oxoquinoline-3-Carboxylate | AG000263 | 500g |
| 100501-57-3 | O=C(N1CCc2c(C1)cn(n2)C)OC(C)(C)C | tert-Butyl 2-methyl-6,7-dihydro-2H-pyrazolo[4,3-c]pyridine-5(4H)-carboxylat | AG000265 | 2g |
| 1005-93-2 | C(C)C12COP(OC1)(OC2)=O | 4-Ethyl-2,6,7-trioxa-1-phosphabicyclo[2.2.2]octane 1-oxide | AG00026M | 25g |
| 1005077-74-6 | C12N(CC(CC1N)C2)C(=O)OC(C)(C)C | tert-Butyl 6-amino-2-azabicyclo[2.2.1]heptane-2-carboxylate | AG00026O | 5g |
| 100502-66-7 | C(O[N+]([O-])=O)CCO | Abrucomstat | AG000279 | 5g |
| 10051-45-3 | CCCCCCC([O-])=O.[Na+] | Enanthic acid sodium salt | AG00027A | 1200g |
| 10051-44-2 | CCCCCC([O-])=O.[Na+] | Sodium Hexanoate | AG00027B | 2500g |
| 100516-71-0 | N#CC1=NC=C(C)S1 | 5-Methylthiazole-2-carbonitrile | AG00027H | 15g |
| 100516-62-9 | C[Si](C#CC1=C(C#C[Si](C)(C)C)C(C#C[Si](C)(C)C)=C(C#C[Si](C)(C)C)C(C#C[Si](C)( | 1,2,3,4,5,6-Hexakis[2-(trimethylsilyl)ethynyl]benzene | AG00027J | 15g |
| 100516-54-9 | O=C(N1[C@@H](C2=CC=CC=C2)[C@@H](C3=CC=CC=C3)OC(C1)=O)OCC4=CC=CC | Benzyl (2R,3S)-(-)-6-oxo-2,3-diphenyl-4-morpholinecarboxylate | AG00027L | 50g |
| 100511-00-0 | O=C1NC2=C(C=C([N+]([O-])=O)C=C2)C1(C)C | 3,3-Dimethyl-5-nitroindolin-2-one | AG00027V | 2g |
| 100510-65-4 | O=C1NC2=C(C=CC(N)=C2)C1(C)C | 6-Amino-3,3-dimethylindolin-2-one | AG00027Y | 15g |
| 100510-64-3 | O=C1NC2=C(C=CC([N+]([O-])=O)=C2)C1(C)C | 3,3-Dimethyl-6-nitroindolin-2-one | AG00027Z | 10g |
| 100367-77-9 | C1=C(C(OCC)=O)N=C(S1)Br | Ethyl 2-bromothiazole-4-carboxylate | AG0001QJ | 354.9g |
| 100367-74-6 | CC1=CC(Br)=CC=[N+]1[O-] | 4-Bromo-2-methylpyridine 1-oxide | AG0001QL | 4g |
| 100367-55-3 | [N+](=O)([O-])C1=CC=C(N=C1)C#N | 5-nitropyridine-2-carbonitrile | AG0001QQ | 125g |
| 100367-48-4 | OC1=CC(N)=CC=C1F | 5-Amino-2-fluorophenol | AG0001QS | 100g |
| 100367-40-6 | O=[N+](C1=C(C)C(Br)=CN=C1N)[O-] | 2-Amino-5-bromo-4-methyl-3-nitropyridine | AG0001QT | 1000g |
| 100367-39-3 | COC1=NC=CC(Br)=C1 | 4-Bromo-2-methoxypyridine | AG0001QU | 976.8g |
| 100367-38-2 | OC1=CC(Br)=CC(N)=C1 | 3-Amino-5-bromophenol | AG0001QV | 3g |
| 1003708-66-4 | N#CC1=CC(F)=C(C)C=C1F | 2,5-Difluoro-4-methylbenzonitrile | AG0001QZ | 12g |
| 1003708-42-6 | FC1=CC(=CC(=C1)C#N)C=O | 3-Fluoro-5-formylbenzonitrile | AG0001R2 | 400g |
| 1003708-24-4 | FC1=C(C=CC(=C1F)Br)[N+](=O)[O-] | 2,3-Difluoro-4-bromonitrobenzene | AG0001R6 | 300g |
| 1003708-08-4 | O=C(OC)C1=CC(OC(F)(F)F)=CC(Cl)=C1N | Methyl 2-amino-3-chloro-5-(trifluoromethoxy)benzoate | AG0001R9 | 2g |
| 1003706-87-3 | Fc1cncnc1Br | 4-Bromo-5-fluoropyrimidine | AG0001RH | 5g |
| 100370-59-0 | COC1=C(OC)C=C(C2OCCNC2)C=C1 | 2-(3,4-Dimethoxyphenyl)morpholine | AG0001RJ | 2g |
| 1003711-04-3 | OC1=CC(F)=CN=C1N | 2-Amino-5-fluoropyridin-3-ol | AG0001RO | 35g |
| 1003710-06-2 | O=C(O)C1=CC(F)=CC(F)=C1C | 3,5-Difluoro-2-methylbenzoic acid | AG0001RS | 14g |
| 1003710-01-7 | O=C(O)C1=CC(F)=CC(C)=C1F | 2,5-Difluoro-3-methylbenzoic acid | AG0001RT | 3g |
| 10055-39-7 | NC1=CC=C(C=C1)C(=O)C1=C(C=CC=C1)F | (4-Aminophenyl)(2-fluorophenyl)methanone | AG0002BF | 5g |
| 1005584-90-6 | O=C(C1=NNC=C1Cl)OC | METHYL 4-CHLORO-1H-PYRAZOLE-3-CARBOXYLATE | AG0002BG | 50g |
| 1005582-20-6 | CC(N1N=CC(C)=C1)C(O)=O | 2-(4-Methyl-1H-pyrazol-1-yl)propanoic acid | AG0002BH | 8g |
| 100557-26-4 | N#CC1=C(N)SCC1=O | 3-Thiophenecarbonitrile, 2-amino-4,5-dihydro-4-oxo- | AG0002BT | 25g |
| 1005613-94-4 | C1(C=NN(C)C=1C)S(Cl)(=O)=O | 1,5-Dimethyl-1H-pyrazole-4-sulfonyl chloride | AG0002C8 | 5g |
| 1005609-70-0 | CCN1C(C=O)=C(Cl)C=N1 | 4-Chloro-1-ethyl-1H-pyrazole-5-carbaldehyde | AG0002C9 | 0.2g |
| 100564-78-1 | [C@@H](NC(OC(C)(C)C)=O)(C(=O)O)CCC1=CC=CC=C1 | Boc-L-homophenylalanine | AG0002CL | 1000g |
| 1005764-23-7 | C1(Cl)=CC(F)=CC(C(F)(F)F)=C1 | 1-Chloro-3-fluoro-5-(trifluoromethyl)benzene | AG0002CU | 10g |
| 1005738-45-3 | O=C(C1(C(OC)=O)CCN(C(OC(C)(C)C)=O)CC1)O | Piperidine-1,4,4-tricarboxylic acid 1-tert-butyl ester 4-methyl ester | AG0002CX | 25g |
| 100570-24-9 | N[C@@H](C1=CC=C(OC)C(OC)=C1)C | (R)-1-(3,4-Dimethoxyphenyl)ethylamine | AG0002D6 | 165g |
| 10057-46-2 | NC1=NC2=CC=C(C(F)(F)F)C=C2N1 | 6-(Trifluoromethyl)-1h-benzimidazol-2-amine | AG0002DE | 5g |
| 1005786-10-6 | C1=CC2N(C=C(C(=O)OCC)N=2)N=C1I | Ethyl 6-iodoimidazo[1,2-b]pyridazine-2-carboxylate | AG0002DK | 2g |
| 1005785-85-2 | O=C(O)C1=NC=C(C(C)(C)C)C=C1 | 5-(tert-Butyl)picolinic acid | AG0002DL | 2g |
| 1005785-45-4 | NC1=CN2C=C(Cl)C=CC2=N1 | 6-Chloroimidazo[1,2-a]pyridin-2-amine | AG0002DO | 10g |
| 1005771-04-9 | CC(C1=CC2=CC=C3C(Br)=CC(Br)=C(C3=C24)C=CC4=C1)(C)C | 1,3-DIBROMO-7-TERT-BUTYLPYRENE | AG0002DQ | 75g |
| 1007311-98-9 | CCCCC1(C(C=CC=C2)=C2C3=C1C=CC=C3)[PH+](C4CCCCC4)C5CCCCC5.FB(F)F.[F-] | Dicyclohexyl(9-butylfluoren-9-yl)phosphonium tetrafluoroborate | AG0002QW | 0.75g |
| 4522-35-4 | IC1=NNC=C1 | 3-Iodopyrazole | AG0002RA | 500g |
| 1007488-78-9 | N1=CC=CN1CCCNC | N-Methyl-3-(1H-pyrazol-1-yl)propan-1-amine | AG0002RB | 1.25g |
| 1007462-48-7 | CC1=C(CCO)C(C)=NN1C | 2-(1,3,5-Trimethyl-1h-pyrazol-4-yl)-ethanol | AG0002RF | 3g |
| 1007455-31-3 | COc1ccc2c(c1F)C(=O)NC2 | 7-Fluoro-6-methoxyisoindolin-1-one | AG0002RH | 25g |
| 1007455-28-8 | COC1=C(C(=C(C=C1)Br)C(=O)OC)F | Methyl 6-bromo-2-fluoro-3-methoxybenzoate | AG0002RJ | 5g |
| 1007455-25-5 | O=C1NCC2=C1C=C(O)C(F)=C2 | 5-Fluoro-6-hydroxyisoindolin-1-one | AG0002RK | 2g |
| 1007455-22-2 | [Br]C1(=C(C(=O)OC)C=C(OC)C(=C1)F) | Methyl 2-bromo-4-fluoro-5-methoxybenzoate | AG0002RL | 25g |
| 1007455-21-1 | O=C(O)C1=CC(OC)=C(F)C=C1Br | 2-Bromo-4-fluoro-5-methoxybenzoic acid | AG0002RM | 300g |
| 100748-65-0 | O=C1NC2=C(C=CC(Br)=C2)C(O)=C1 | 7-Bromo-4-hydroxyquinolin-2(1H)-one | AG0002RO | 2g |
| 10075-85-1 | C(#Cc1ccccc1)c1c2c(c(c3c1cccc3)C#Cc1ccccc1)cccc2 | 9,10-Bis(phenylethynyl)anthracene | AG0002S5 | 600g |
| 10075-72-6 | S(C)C1C=CC=C2C=CC=CC2=1 | 1-(Methylthio)naphthalene | AG0002S8 | 2.75g |
| 10075-63-5 | COC1=CC=CC2=C(OC)C=CC=C12 | 1,5-Dimethoxynaphthalene | AG0002SC | 200g |
| 10075-62-4 | COC1=C2C=CC=CC2=C(OC)C=C1 | 1,4-Dimethoxynaphthalene | AG0002SD | 50g |
| 10075-61-3 | COC1=CC(=CC2=CC=CC=C12)OC | 1,3-Dimethoxynaphthalene | AG0002SE | 2g |
| 10075-52-2 | CN1C=CC2=C1C=CC(Br)=C2 | 5-Bromo-1-methyl-1H-indole | AG0002SF | 1100g |
| 10075-50-0 | C1=CC(=CC2=C1[NH]C=C2)Br | 5-Bromoindole | AG0002SG | 10000g |
| 10075-49-7 | CC1=CN(C)C2=C1C=C(Br)C=C2 | 5-Bromo-1,3-dimethyl-1H-indole | AG0002SH | 5g |
| 100449-87-4 | O=[N+](C1=CC=C(N)C=C1B(O)O)[O-] | (5-Amino-2-nitrophenyl)boronic acid | AG0001ZX | 1.5g |
| 100445-96-3 | CC1=C(N)C(C)=C(O)C=C1 | 3-Amino-2,4-dimethylphenol | AG000209 | 3g |
| 100445-44-1 | N1=C(C=CC=2CCCCC12)C(=O)OC | Methyl 5,6,7,8-tetrahydroquinoline-2-carboxylate | AG00020D | 81g |
| 10045-25-7 | C1CNCCNCCNCCN1.Cl | 1，4，7，10-Tetraazacyclododecane Tetrahydrochloride | AG00020J | 2500g |
| 10045-89-3 | [O-]S(=O)(=O)[O-].[O-]S(=O)(=O)[O-].[Fe+2].[NH4+].[NH4+] | Sulfuric acid, ammonium iron(2+) salt (2:2:1) | AG00020V | 275g |
| 10045-86-0 | O=P([O-])([O-])[O-].[Fe+3] | Ferricphosphate | AG00020X | 1500g |
| 10045-45-1 | O=C1N(CC)C2=CC=CC=C2N1 | 1-Ethylbenzimidazolinone | AG000217 | 25g |
| 1004618-89-6 | Cl.FC1=CC(C2CCNCC2)=CC(F)=C1 | 4-(3,5-Difluorophenyl)piperidine, HCl | AG00021A | 1g |
| 1004618-85-2 | FC(F)(F)OC1=CC=C(C2CCNCC2)C=C1.[H]Cl | 4-(4-(Trifluoromethoxy)phenyl)piperidine hydrochloride | AG00021B | 75g |
| 1004545-97-4 | O=CC1=CC=CC(O)=C1N | 2-Amino-3-hydroxybenzaldehyde | AG00021E | 2g |
| 1004538-34-4 | O=C(N1C[C@H](N)CC1)OC(C)(C)C.[H]Cl | (R)-tert-Butyl 3-aminopyrrolidine-1-carboxylate hydrochloride | AG00021G | 150g |
| 1004538-33-3 | CN([C@H]1CN(C(OC(C)(C)C)=O)CC1)C | (R)-1-Boc-3-(Dimethylamino)pyrrolidine | AG00021H | 2g |
| 1004643-68-8 | O=C(C1=CC=NN1CCC)O | 1-Propyl-1H-pyrazole-5-carboxylic acid | AG00021X | 10g |
| 1004643-64-4 | N1=C(C(O)=O)C=C(C)N1C(F)F | 1-(Difluoromethyl)-5-methyl-1H-pyrazole-3-carboxylic acid | AG00021Y | 1g |
| 100465-04-1 | O=[N+](C1=CC=C(Cl)C(Cl)=C1F)[O-] | 1,2-Dichloro-3-fluoro-4-nitrobenzene | AG00022B | 25g |
| 100308-67-6 | Cc1ccc(cc1)N(c1ccc(cc1)Br)c1ccc(cc1)Br | 4-Bromo-N-(4-bromophenyl)-N-(p-tolyl)aniline | AG0001K9 | 5g |
| 100306-34-1 | O[C@H](C1=CC=CC=C1)CCCl | (S)-(-)-3-Chloro-1-phenyl-1-propanol | AG0001KC | 1000g |
| 100306-33-0 | O[C@@H](C1=CC=CC=C1)CCCl | (R)-(+)-3-Chloro-1-phenyl-1-propanol | AG0001KD | 1000g |
| 100305-95-1 | NC1=C(SC)C=CC=C1C | 2-Methyl-6-(methylsulfanyl)aniline | AG0001KE | 5g |
| 100305-93-9 | C(C)(C)[N]1C(=CC=N1)C=O | 2-Isopropylpyrazole-3-carbaldehyde | AG0001KF | 5g |
| 10031-26-2 | [Fe+3].[Br-].[Br-].[Br-] | Iron(Iii) Bromide | AG0001KJ | 600g |
| 10031-22-8 | [Br-].[Br-].[Pb+2] | Lead(II) bromide | AG0001KN | 3325g |
| 10031-20-6 | [Mn](Br)Br.O | Manganese(II) Bromide Hexahydrate | AG0001KP | 1500g |
| 10031-93-3 | O=C(OCC)CCCC1=CC=CC=C1 | Ethyl 4-Phenylbutyrate | AG0001KU | 50g |
| 10031-90-0 | O1C(=CC=C1)CCC(=O)OCC | Ethyl 3-(furan-2-yl)propanoate | AG0001KW | 300g |
| 10031-82-0 | C1=C(C=CC(=C1)OCC)C=O | 4-Ethoxybenzaldehyde | AG0001L0 | 4000g |
| 100313-81-3 | O=S(C1=CC=C(Cl)C(N)=C1)(N(C)C)=O | 3-Amino-4-chloro-N,N-dimethylbenzenesulfonamide | AG0001LP | 7g |
| 1003298-87-0 | OC1=C(Cl)C=C(B2OC(C)(C)C(C)(C)O2)C=C1Cl | 2,6-dichloro-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenol | AG0001M5 | 125g |
| 1003298-85-8 | OB(O)C1=CC(Cl)=C(OCC2=CC=CC=C2)C(Cl)=C1 | 4-(Benzyloxy)-3,5-dichlorophenylboronic acid | AG0001M7 | 30g |
| 1003298-73-4 | N#CC1=C(F)C=C(B2OC(C)(C)C(C)(C)O2)C=C1F | 2,6-difluoro-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile | AG0001MA | 30g |
| 1003711-30-5 | OC1=CC(C)=CN=C1Br | 2-bromo-5-methylpyridin-3-ol | AG0001SQ | 15g |
| 100379-00-8 | CC1=C(B(O)O)C(C)=CC=C1 | 2,6-Dimethylphenylboronic acid | AG0001T6 | 467.45g |
| 100377-63-7 | COC1=CC(C(NN)=O)=CC=C1O | 4-Hydroxy-3-methoxybenzohydrazide | AG0001TC | 40g |
| 100377-32-0 | O=C(N(OC)C)C1=CC=NC=C1 | N-Methoxy-N-Methylisonicotinamide | AG0001TD | 300g |
| 100375-03-9 | Brc1ccc(cc1)S(=O)(=O)Cc1ccccc1 | Benzene, 1-bromo-4-[(phenylmethyl)sulfonyl]- | AG0001TN | 10.3g |
| 1003845-06-4 | ClC1=NC=C(C=N1)B(O)O | 2-Chloropyrimidine-5-boronic acid | AG0001TR | 1000g |
| 1003843-30-8 | O=C(N1[C@H](CC)CC(C[C@@H]1CC)=O)OC(C)(C)C | N-Boc-cis-2,6-Diethyl-4-piperidone | AG0001TU | 40g |
| 100382-00-1 | N#CC1=NC=CC(OCC2=CC=CC=C2)=C1 | 4-(Benzyloxy)picolinonitrile | AG0001U1 | 1.25g |
| 10038-40-1 | OCc1ccccc1Oc1ccccc1CO | 2,2′-BIS(HYDROXYMETHYL)DIPHENYL ETHER | AG0001UD | 15g |
| 1003879-02-4 | FC1=C(Br)C=CC(=C1)C(=O)CBr | 2-Bromo-1-(4-bromo-3-fluorophenyl)ethanone | AG0001UG | 50g |
| 1003872-51-2 | O=C(c1ccc(nc1Cl)Cl)NC1CCCCC1 | 3-Pyridinecarboxamide, 2,6-dichloro-N-cyclohexyl- | AG0001UJ | 1g |
| 1003863-36-2 | NCC1OC2C(=CSC=2)OC1 | {2H,3H-thieno[3,4-b][1,4]dioxin-2-yl}methanamine | AG0001UK | 5g |
| 1003858-71-6 | CCc1c(N)ccc2[nH]ccc12 | 4-Ethyl-1H-indol-5-amine | AG0001UO | 0.05g |
| 1003858-69-2 | O=[N+](C1=C(F)C2=C(NC=C2)C=C1)[O-] | 4-Fluoro-5-nitro-1H-indole | AG0001UP | 1.25g |
| 1003858-63-6 | Cc1cc(N)c(cc1[N+]([O-])=O)C#C[Si](C)(C)C | 5-methyl-4-nitro-2-[2-(trimethylsilyl)ethynyl]aniline | AG0001UT | 0.15g |
| 10058-38-5 | O=C(C1=CN=C(C2=CC=CC=C2)S1)O | 2-phenyl-1,3-thiazole-5-carboxylic acid | AG0002E5 | 9g |
| 100592-04-9 | COC1=CC=CN2C=CN=C12 | 8-Methoxyimidazo[1,2-a]pyridine | AG0002E9 | 15g |
| 100590-43-0 | COC(=O)C1=CC=CC2=C1C=CS2 | Methyl benzo[b]thiophene-4-carboxylate | AG0002EB | 15g |
| 1006-68-4 | O1C=NC=C1C1=CC=CC=C1 | 5-Phenyloxazole | AG0002FR | 125g |
| 1006-67-3 | C1(C2=CC=CC=C2)=CC=NO1 | 5-Phenylisoxazole | AG0002FS | 3g |
| 1006-64-0 | C1CNC(C1)C1=CC=CC=C1 | 2-PHENYLPYRROLIDINE | AG0002FU | 25g |
| 1006-59-3 | C1(O)C(CC)=CC=CC=1CC | 2,6-Diethylphenol | AG0002FV | 9g |
| 1006-50-4 | C1=CC(=C2C=CC=NC2=C1)I | 5-Iodoquinoline | AG0002FX | 10g |
| 1006-47-9 | IC1=C2N=CC=CC2=CC=C1 | 8-Iodoquinoline | AG0002FY | 50g |
| 1006-41-3 | O=C(O)C1=CC=C(F)C=C1Br | 2-Bromo-4-fluorobenzoic acid | AG0002G0 | 2000g |
| 1006-39-9 | CC(C1=CC=C(F)C=C1Br)=O | 1-Acetyl-2-bromo-4-fluorobenzene | AG0002G1 | 3500g |
| 1006-34-4 | O=C(N)C1=CC(F)=CC=C1Br | 2-Bromo-5-fluorobenzamide | AG0002G2 | 175g |
| 1006-33-3 | CC(C1=CC(F)=CC=C1Br)=O | 2′-Bromo-5′-fluoroacetophenone | AG0002G3 | 200g |
| 1006-23-1 | N(=O)C=1C(=NC(=NC1N)N)N | 5-Nitroso-2,4,6-triaminopyrimidine | AG0002G7 | 1500g |
| 1006-19-5 | O=C1NN(C)C2=C1C=CC=C2 | 1-Methyl-1H-indazol-3(2H)-one | AG0002G8 | 10g |
| 1006037-03-1 | O=C(OC)C1=CC=C(C2(N)CC2)C=C1 | Methyl 4-(1-aminocyclopropyl)benzoate | AG0002GD | 125g |
| 10060-33-0 | COC(=O)c1cccc2c1c(ccc2)C(=O)OC | 1,8-Naphthalenedicarboxylic acid, 1,8-dimethyl ester | AG0002GP | 50g |
| 10060-13-6 | Cl[Cu-2](Cl)(Cl)Cl.O.O.[NH4+].[NH4+] | Cuprate(2-), tetrachloro-, diammonium, dihydrate (8CI,9CI) | AG0002GS | 400g |
| 1006-99-1 | CC1=NC2=CC(Cl)=CC=C2S1 | 5-Chloro-2-methylbenzothiazole | AG0002GX | 500g |
| 1006-94-6 | COC1=CC2=C(NC=C2)C=C1 | 5-Methoxyindole | AG0002GY | 100g |
| 1006062-27-6 | CCCCc1nc(Cl)c(COC(=O)C)n1Cc2ccc(cc2)c3ccccc3c4nnn[nH]4 | O-Acetyl Losartan | AG0002H0 | 2g |
| 10061-68-4 | CCN(CC)CCCN | (3-aminopropyl)diethylamine | AG0002HJ | 200g |
| 10061-02-6 | ClCC=CCl | trans-1,3-Dichloropropene | AG0002HM | 75g |
| 1006334-34-4 | O=C(C1=NN(C)C=C1N)O | 4-Amino-1-methyl-1H-pyrazole-3-carboxylic acid | AG0002IC | 15g |
| 1006333-32-9 | O=CC1=CN(CC(C)C)N=C1 | 1-Isobutylpyrazole-4-carbaldehyde | AG0002ID | 20g |
| 1006333-08-9 | NC1=CN(CC(F)F)N=C1 | 1-(2,2-Difluoroethyl)-1H-pyrazol-4-amine hydrochloride | AG0002IE | 25g |
| 100245-61-2 | O=C(C1=CSC=C1Br)N | 4-Bromothiophene-3-carboxamide | AG0001CK | 30g |
| 100243-39-8 | O[C@@H]1CNCC1 | (S)-3-HYDROXYPYRROLIDINE | AG0001CT | 106.9g |
| 100241-11-0 | Cl[H].ClC1=NN=C(C=C1)N1CCNCC1 | 3-Chloro-6-piperazinopyridazine, HCl | AG0001CZ | 100.02g |
| 10024-90-5 | CC(C1=CC=C(OC)C(C)=C1)=O | 1-(4-Methoxy-3-methylphenyl)ethanone | AG0001D6 | 100g |
| 100246-69-3 | CCCCCCC(CCCC)C(Cl)=O | 2-Butyloctanoyl Chloride | AG0001DF | 75g |
| 10025-65-7 | [Pt+2].[Cl-].[Cl-] | Platinum(II) chloride | AG0001DV | 30g |
| 10025-64-6 | [O-][Cl](=O)(=O)=O.[O-][Cl](=O)(=O)=O.O.O.O.O.O.O.[Zn+2] | Zinc perchlorate hexahydrate | AG0001DW | 4775g |
| 1002535-21-8 | O=C(O)C1=CC=CC(C2=CNN=C2)=C1 | 3-(1H-Pyrazol-4-Yl)Benzoic Acid | AG0001DY | 25g |
| 10026-24-1 | O.O.O.O.O.O.O.[Co+2].[O-]S(=O)(=O)[O-] | Cobalt Sulphate Heptahydrate | AG0001EX | 100g |
| 1002727-88-9 | CC1(C)C(C)(C)OB(C2=CC(CCCO3)=C3C=C2)O1 | 6-(4,4,5,5-Tetramethyl-1,3,2-Dioxaborolan-2-Yl)Chroman | AG0001FD | 10g |
| 1002726-62-6 | O=C1NC2=NC(N)=CC=C2OC1(C)C | 6-Amino-2,2-dimethyl-2H-pyrido[3,2-b][1,4]oxazin-3(4H)-one | AG0001FG | 39g |
| 1002726-59-1 | O=C1NC2=NC([N+]([O-])=O)=CC=C2OC1(C)C | 2,2-dimethyl-6-nitro-2H-pyrido[3,2-b][1,4]oxazin-3(4H)-one | AG0001FH | 10g |
| 1007605-44-8 | N#CC1=CC(F)=C(OC)C=C1F | 2,5-Difluoro-4-methoxybenzonitrile | AG0002U4 | 75g |
| 1007596-95-3 | O=C(N1C[C@@H](O)[C@H](N)CC1)OC(C)(C)C | (3R,4R)-tert-Butyl 4-amino-3-hydroxypiperidine-1-carboxylate | AG0002U5 | 50g |
| 100779-91-7 | BrCCCn1cccc1 | 1-(3-Bromopropyl)Pyrrole | AG0002U6 | 2g |
| 100777-46-6 | COc1cc(Cl)c(cc1[N+](=O)[O-])C | 1-Chloro-5-Methoxy-2-Methyl-4-Nitrobenzene | AG0002U7 | 2g |
| 100760-04-1 | C[C@H](O)C1=CC=C(Br)C=C1 | (S)-1-(4-Bromophenyl)ethanol | AG0002UJ | 50g |
| 10078-27-0 | CN1CCN(CCCN2c3ccccc3S(=O)c4ccc(Cl)cc24)CC1 | Prochlorperazine Sulfoxide | AG0002UK | 0.3g |
| 10076-48-9 | CC(OC)(OC)C(OC)=O | 2,2-Dimethoxypropionic acid methyl ester | AG0002UN | 200g |
| 1007802-68-7 | FC1=CC=C(C=C1F)C(=O)NC1=CC=C(C=C1)C#N | N-(4-Cyanophenyl)-3，4-difluorobenzamide | AG0002UW | 1.25g |
| 100784-27-8 | COC(=O)C1=C(N(C)N=C1Cl)S(N)(=O)=O | Methyl 3-chloro-1-methyl-5-sulfamoyl-1H-pyrazole-4-carboxylate | AG0002UZ | 50g |
| 1007882-59-8 | O=C(N1[C@H](C2=NC=C(Br)N2)CCC1)OC(C)(C)C | (S)-tert-Butyl 2-(4-bromo-1H-imidazol-2-yl)pyrrolidine-1-carboxylate | AG0002VH | 3500g |
| 1007882-58-7 | CC(C)(C)OC(=O)N1CCC[C@H]1c1ncc[nH]1 | (S)-TERT-BUTYL 2-(1H-IMIDAZOL-2-YL)PYRROLIDINE-1-CARBOXYLATE | AG0002VI | 30g |
| 1007882-23-6 | C(=O)(OC(C)(C)C)N1[C@@H](CCC1)c1[nH]c(cn1)c1ccc(cc1)c1ccc(cc1)c1[nH]c(nc1 | 1,1′-Bis(1,1-dimethylethyl) (2S,2’S)-2,2′-([1,1′-biphenyl]-4,4′-diyldi-1H-imidaz | AG0002VK | 5g |
| 1007882-12-3 | O=C(N1[C@H](C2=NC=C(C3=CC=C(B4OC(C)(C)C(C)(C)O4)C=C3)N2)CCC1)OC(C)(C | (s)-tert-Butyl 2-(5-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)-1h | AG0002VL | 10g |
| 1007882-04-3 | O=C(N1[C@H](C2=NC=C(C3=CC=C(Br)C=C3)N2)CCC1)OC(C)(C)C | (S)-tert-Butyl 2-(5-(4-bromophenyl)-1h-imidazol-2-yl)pyrrolidine-1-carboxyla | AG0002VM | 45g |
| 1007881-98-2 | CC(C)(C)OC(=O)N1CCC[C@H]1C(=O)NCC(=O)C1=CC=C(Br)C=C1 | (S)-tert-Butyl 2-((2-(4-bromophenyl)-2-oxoethyl)carbamoyl)pyrrolidine-1-car | AG0002VN | 1.25g |
| 1007877-68-0 | CC(C1=C2C(C=CN2)=CC=C1)N | 1-(1H-Indol-7-yl)ethanamine | AG0002VQ | 2g |
| 1007873-90-6 | CC(OC(N1[C@H](CN)CC1)=O)(C)C | (S)-2-AMINOMETHYL-1-BOC-AZETIDINE | AG0002VU | 2g |
| 1007869-61-5 | CN(C)C1CCCN(C1)C1=CC=C(N)C=C1 | 1-(4-Aminophenyl)-3-n,n-dimethylamino-piperidine | AG0002VY | 0.5g |
| 1007-42-7 | C([C@@H](C(=O)O)N)c1c[nH]cn1.Cl | L-Histidine xhydrochloride | AG0002OI | 316g |
| 1007126-41-1 | CC1(C)C(C)(C)OB(C2=C3C=CC=CC3=C(N(C)C)C=C2)O1 | N,N-Dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-a | AG0002OJ | 15g |
| 1007113-31-6 | O=C1N[C@H](C(C)C)COC1 | (5R)-5-(1-Methylethyl)-3-morpholinone | AG0002OL | 10g |
| 1007113-04-3 | O=C(O)C1=CC(F)=CC(OC)=C1[N+]([O-])=O | 5-Fluoro-3-methoxy-2-nitrobenzoic acid | AG0002OM | 17g |
| 1007110-53-3 | CC1(C)C(C)(C)OB(C2=CC=NN2CC)O1 | 1-Ethylpyrazole-5-boronic acid, pinacol ester | AG0002OQ | 110.6g |
| 1007089-84-0 | Cl.ClCC1=CC(=CN=C1)C | 3-(Chloromethyl)-5-methylpyridine hydrochloride | AG0002OR | 3000g |
| 100707-54-8 | O=C(C1CCC(N)CC1)OC.[H]Cl | Methyl 4-aminocyclohexanecarboxylate hydrochloride | AG0002OW | 30g |
| 100707-39-9 | CC1=NC=C(C(=N1)C(=O)O)Br | 2-Methyl-5-bromopyrimidine-4-carboxylic acid | AG0002OX | 175g |
| 100704-10-7 | OCC1=CC(Cl)=NC=C1 | (2-Chloropyridin-4-yl)methanol | AG0002P1 | 700g |
| 100703-81-9 | N#CC1=CN=C(C)O1 | 2-Methyloxazole-5-carbonitrile | AG0002P2 | 3g |
| 10071-38-2 | O=C1C=CC(Cl)=NN1C | 6-Chloro-2-methylpyridazin-3(2H)-one | AG0002P6 | 75g |
| 1007207-67-1 | NC1=NC=C(C2=C3C(N(S(=O)(C)=O)CC3)=NC(N4CCOCC4)=N2)C=N1 | CH5132799 | AG0002PA | 0.3g |
| 1007206-54-3 | CC1(OB(C2=CC=C3C(N=CN3)=C2)OC1(C)C)C | 1H-Benzimidazole-5-boronic acid, pinacol ester | AG0002PB | 10g |
| 1007170-59-3 | OB(c1ccc(c(c1)OCc1ccccc1)C(F)(F)F)O | 3-(Benzyloxy)-4-(trifluoromethyl)phenylboronic acid | AG0002PE | 15g |
| 1003846-21-6 | CC1(C)C(C)(C)OB(C2=CN(C3CCCCO3)N=C2)O1 | 1-(2-Tetrahydropyranyl)-1H-pyrazole-4-boronic acid, pinacol ester | AG0001UV | 1000g |
| 1003845-08-6 | CC1(C)OB(OC1(C)C)C1=CN=C(Cl)N=C1 | 2-Chloropyrimidine-5-boronic acid pinacol ester | AG0001UW | 200g |
| 1003887-62-4 | N[C@H]1CCOC2=C(F)C=CC=C12 | (S)-8-Fluorochroman-4-amine | AG0001V6 | 13g |
| 100393-41-7 | O=C(O)CC(N)C1=C2C=CC=CC2=CC=C1 | 3-AMINO-3-(1-NAPHTHYL)PROPANOIC ACID | AG0001V8 | 25g |
| 100393-37-1 | NCC(C1=C2C(C=CC=C2)=CC=C1)C(O)=O | 3-Amino-2-(naphthalen-1-yl)propanoic acid | AG0001V9 | 1g |
| 100390-48-5 | O=C(O)C(C1=CC=CC=C1)N2CCCC2 | Phenyl-pyrrolidin-1-yl-acetic acid | AG0001VJ | 11g |
| 1003944-32-8 | COC1=NC2=CC(F)=CN=C2C=C1 | 7-Fluoro-2-methoxy-1,5-naphthyridine | AG0001VZ | 1g |
| 1004-18-8 | CNC1=CC=NC(N)=N1 | N4-Methylpyrimidine-2,4-diamine | AG0001WC | 5g |
| 1004-17-7 | N1C(=CC=NC=1C)C=O | 2-Methylpyrimidine-4-carbaldehyde | AG0001WD | 25g |
| 1004-15-5 | S1(CCC(NN)C1)(=O)=O.Cl | (1,1-Dioxidotetrahydro-3-thienyl)hydrazine, HCl | AG0001WE | 10g |
| 1004-00-8 | Nc1c(S)ccc(c1)Cl | 2-Amino-4-chlorobenzenethiol | AG0001WH | 300g |
| 1004-96-2 | COC(=O)C1=CC(C)=NO1 | Methyl 3-Methylisoxazole-5-Carboxylate | AG0001WI | 200g |
| 1006876-27-2 | O=C(N(C)C)C1=NC=C(B2OC(C)(C)C(C)(C)O2)C=C1 | N,N-Dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)picolinamide | AG0002MO | 25g |
| 1006875-83-7 | O=C(OC(C)(C)C)CN1N=CC(B2OC(C)(C)C(C)(C)O2)=C1 | tert-butyl 2-[4-(tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]acetate | AG0002MR | 40g |
| 100688-48-0 | COCCOCCOCCCO | 3-[2-(2-methoxyethoxy)ethoxy]propan-1-ol | AG0002N2 | 10g |
| 1007-32-5 | CCC(=O)CC1=CC=CC=C1 | 1-Phenyl-2-butanone | AG0002NI | 50g |
| 1007-26-7 | CC(C)(C)CC1=CC=CC=C1 | Neopentylbenzene | AG0002NJ | 25g |
| 1007-16-5 | O=C(O)C1=CC=C(F)C(Br)=C1 | 3-Bromo-4-fluorobenzoic acid | AG0002NN | 556g |
| 1007-15-4 | C1=C(C(=CC=C1C(C)=O)F)Br | 3′-Bromo-4′-fluoroacetophone | AG0002NO | 8000g |
| 1007-11-0 | NC1=NC(Cl)=CC(N(C)C)=N1 | 6-Chloro-N4,N4-dimethylpyrimidine-2,4-diamine | AG0002NQ | 25g |
| 1007-03-0 | OC(C1CC1)C2=CC=CC=C2 | ALPHA-CYCLOPROPYLBENZYL ALCOHOL | AG0002NT | 200g |
| 1007-01-8 | OC(CC1C2CC(CC2)C1)=O | 2-NORBORNANEACETIC ACID | AG0002NU | 5g |
| 10070-92-5 | N1=CN=CC(=C1)C=O | Pyrimidine-5-carboxaldehyde | AG0002O7 | 200g |
| 1007-55-2 | CC(NC1=NN=C(Cl)C=C1)C | 6-Chloro-N-isopropylpyridazin-3-amine | AG0002OE | 80g |
| 1007-49-4 | CC(OCC1=NC=CC=C1)=O | Pyridin-2-ylmethyl acetate | AG0002OF | 35g |
| 1007-48-3 | CC(=O)OCc1ccncc1 | Pyridin-4-ylmethyl acetate | AG0002OG | 3g |
| 1008138-66-6 | CC1(C)C(C)(C)OB(C2=CC([N+]([O-])=O)=CN=C2C)O1 | 2-METHYL-5-NITRO-PYRIDINE-BORONIC ACID PINACOL ESTER | AG0002XK | 30g |
| 1008130-15-1 | CCOC(C1N(N)C=CN=1)=O | Ethyl 1-amino-1H-imidazole-2-carboxylate | AG0002XM | 2g |
| 1008119-09-2 | C(=O)(N(C)C)c1ccc(cc1)C(=O)C | 4-Acetyl-N，N-dimethylbenzamide | AG0002XP | 30g |
| 1008119-07-0 | CC1(C)OB(OC1(C)C)C1=CC(F)=C(C(O)=O)C(F)=C1 | 3,5-Difluoro-4-carboxyphenylboronic acid, pinacol ester | AG0002XQ | 4g |
| 1008112-03-5 | ClC1=NN2C(Br)=CC=C2C(Cl)=N1 | 7-Bromo-2,4-dichloropyrrolo[2,1-f][1,2,4]triazine | AG0002XS | 10g |
| 1008106-93-1 | BrC1=C(C=C(C=C1)Br)B(O)O | 2,5-Dibromophenylboronic acid | AG0002XT | 900g |
| 1008106-86-2 | OB(C1=CC=CC=C1I)O | 2-Iodophenylboronic acid | AG0002XU | 35g |
| 1008105-17-6 | [Br-][Pb+2]([Br-])[Br-].NC=N.[H+] | Plumbate(1-), tribromo-, hydrogen, compd. with methanimidamide (1:1:1) | AG0002XV | 1g |
| 100806-78-8 | OCC1=CC=C(C2=NC=CC=N2)C=C1 | (4-(Pyrimidin-2-yl)phenyl)methanol | AG0002Y0 | 1.9g |
| 1008140-70-2 | OB(O)C1=CC=C(OC(F)(F)F)N=C1 | 2-(Trifluoromethoxy)pyridine-5-boronic acid | AG0002Y6 | 10g |
| 100823-03-8 | NC=1C=C2C(N(C(C2=CC1)=O)C1=C(C=CC=C1C(C)C)C(C)C)=O | 5-Amino-2-(2,6-diisopropylphenyl)isoindoline-1,3-dione | AG0002YC | 0.5g |
| 100821-50-9 | O=C(C1=CNC2=C1C=CC(Cl)=C2)OCC | Ethyl 6-chloro-1H-indole-3-carboxylate | AG0002YI | 25g |
| 100821-48-5 | CCOC(=O)c1c[nH]c2c1ccc(c2)C | Ethyl 6-methyl-1H-indole-3-carboxylate | AG0002YJ | 0.5g |
| 100820-43-7 | [N+](=O)([O-])C=1C=CC=C2CCNC12 | 2,3-Dihydro-7-nitro-1H-indole | AG0002YL | 30g |
| 1008360-84-6 | FC1=CC2=C(C=C1Br)N=CN2 | 5-Bromo-6-fluoro-1H-benzo[d]imidazole | AG0002YU | 8g |
| 1008304-85-5 | NC1=CC(Cl)=NC(OC)=C1 | 2-Chloro-6-Methoxypyridin-4-Amine | AG0002YV | 50g |
| 100836-85-9 | C[C@@H](OCC1=CC=CC=C1)C(O)=O | (R)-(+)-2-Benzyloxypropionic acid | AG0002YX | 200g |
| 1005205-25-3 | NNC(=O)C1=CC=C2NN=CC2=C1 | 1H-Indazole-5-carbohydrazide | AG000281 | 150g |
| 1005201-59-1 | F[B-](F)(F)/C=C/CC1=CC=CC=C1.[K+] | Potassium (E)-trifluoro(3-phenylprop-1-en-1-yl)borate | AG000282 | 4g |
| 1005196-61-1 | COC(=O)c1cc2c(Cl)ncnn2c1 | Methyl 4-chloropyrrolo[2,1-f][1,2,4]triazine-6-carboxylate | AG000284 | 1g |
| 1005187-65-4 | CC(C)(C)OC(=O)N1C(=O)N(C(=O)OC(C)(C)C)C2(CCN(CC2)C(=O)OCC2=CC=CC=C2) | 8-Benzyl 1,3-di-tert-butyl 2,4-dioxo-1,3,8-triazaspiro[4.5]decane-1,3,8-tricarb | AG000286 | 35g |
| 100516-98-1 | CC1N=C(C#N)SC=1 | 4-METHYLTHIAZOLE-2-CARBONITRILE | AG00028G | 5g |
| 100516-88-9 | C1=C(C=CC2=NC=CC=C12)CO | Quinolin-6-ylmethanol | AG00028K | 50g |
| 10052-47-8 | CC[N+](CC)(CC)C.[Cl-] | Triethylmethylammonium Chloride | AG00028N | 3000g |
| 1005212-02-1 | CC(=O)OC1CC(OC(=O)C)C(C2C1(C)C1CC3OC(=O)C(=C3C3C1(CC2)O3)C)(C)C | Gelomulide N | AG00028Q | 0.005g |
| 1005209-44-8 | CCOC(C1=NN2C(N=CC(=C2)Cl)=C1)=O | Ethyl 6-chloropyrazolo[1,5-a]pyrimidine-2-carboxylate | AG00028R | 1g |
| 1005209-42-6 | CCOC(C1=NN2C(N=CC(=C2)Br)=C1)=O | Ethyl 6-bromopyrazolo[1,5-a]pyrimidine-2-carboxylate | AG00028S | 1.05g |
| 1005207-32-8 | OB(C1=CC=C(SCC2=CC=CC=C2)C=C1)O | (4-(Benzylthio)Phenyl)Boronic Acid | AG00028U | 2.1g |
| 1005206-25-6 | CC1(C)OB(OC1(C)C)C1=CC=C(SC(F)(F)F)C=C1 | 4-Trifluoromethylthiophenylboronic acid pinacol ester | AG00028V | 15g |
| 1005206-17-6 | O=C(C1=C2C(NC=C2)=NC=N1)O | 7H-pyrrolo[2,3-d]pyrimidine-4-carboxylic acid | AG00028W | 35g |
| 100643-27-4 | OC1=CC(N)=NC(N)=N1 | 2，6-Diaminopyrimidin-4-ol | AG0002KB | 193g |
| 100643-25-2 | O=C1NC(=NC=C1)N | 2-Aminopyrimidin-4-Ol | AG0002KC | 400g |
| 100655-27-4 | CN(C1=C(C#N)C=C(C=O)C=C1)C | Benzonitrile, 2-(dimethylamino)-5-formyl- | AG0002KN | 10g |
| 100648-13-3 | O=S(C1=NC2=CC(OC3=CC=CC(Cl)=C3Cl)=C(Cl)C=C2N1)C | Triclabendazole sulfoxide | AG0002KW | 1.65g |
| 10065-79-9 | N=C(NC(OCC1=CC=CC=C1)=O)NC(OCC2=CC=CC=C2)=O | N,N’-Bis(benzyloxycarbonyl)guanidine | AG0002L0 | 15g |
| 1006686-15-2 | O=C(OCC)CC1=NC=C(F)C=C1 | ETHYL 2-(5-FLUOROPYRIDIN-2-YL)ACETATE | AG0002L5 | 15g |
| 100667-52-5 | OC1=CC=C(C=C1)CC/C=C/C(CCC1=CC=CC=C1)=O | (4E)-7-(4-Hydroxyphenyl)-1-phenyl-4-hepten-3-one | AG0002LG | 0.005g |
| 100683-54-3 | CCCC[N+](CCCC)(CCCC)CCCC.[O-]C=CC=O | N,N,N-Tributyl-1-butanaminium Salt with (E)-3-Hydroxy-2-propenal | AG0002LW | 1g |
| 100683-08-7 | O=C(C1(OC)CC1)O | 1-Methoxycyclopropanecarboxylic acid | AG0002LX | 50g |
| 10068-07-2 | COC(=O)C1=CC(NO1)=O | Methyl 3-hydroxyisoxazole-5-carboxylate | AG0002MG | 2000g |
| 10067-92-2 | BrC=1C(NOC1C)=O | 4-Bromo-5-methylisoxazol-3-ol | AG0002MH | 125g |
| 1006899-77-9 | O=C(N1C=NC2=CC=C(Br)C=C12)OC(C)(C)C | tert-Butyl 6-bromo-1H-benzo[d]imidazole-1-carboxylate | AG0002MK | 25g |
| 1006891-33-3 | O=C([C@H]1[C@@H](NC(OC(C)(C)C)=O)COCC1)O | Cis-3-((Tert-Butoxycarbonyl)Amino)Tetrahydro-2H-Pyran-4-Carboxylic Acid | AG0002MM | 5g |
| 1004972-49-9 | CC1=NN=C(CN)C=C1 | 3-Aminomethyl-6-methylpyridazine | AG00024P | 4g |
| 1004959-90-3 | O=C(O)[C@H](CC1=CC(F)=CC=C1F)NC(OCC2C3=CC=CC=C3C4=CC=CC=C24)=O | N-Fmoc-2,5-difluoro-L-phenylalanine | AG00024Q | 5g |
| 1005-02-3 | C1=CC=NC(=C1)C(=N)NN | Picolinimidohydrazide | AG000259 | 40g |
| 1005-85-2 | O=C1NCCC12CCCCC2 | 2-Azaspiro[4.5]decan-1-one | AG00025A | 10g |
| 1005-67-0 | O1(CCN(CCCC)CC1) | 4-Butyl-morpholine | AG00025F | 100g |
| 1005-62-5 | C=COc1ccc(cc1)C | Benzene, 1-(ethenyloxy)-4-methyl- | AG00025I | 15g |
| 1005-56-7 | S=C(Cl)OC1=CC=CC=C1 | Phenyl chlorothionocarbonate | AG00025J | 1000g |
| 1005-40-9 | CC1=CC(OC=C)=CC=C1 | 1-(ethenyloxy)-3-methylbenzene | AG00025L | 40g |
| 1005-39-6 | NC1=NC(SC)=NC(N)=C1 | 4,6-Diamino-2-methylmercaptopyrimidine | AG00025M | 600g |
| 1005-38-5 | NC1=NC(=NC(=C1)Cl)SC | 4-Amino-6-chloro-2-(methylthio)pyrimidine | AG00025N | 1000g |
| 1005-37-4 | NC1=NC(Cl)=CC(NC)=N1 | 6-Chloro-N4-methylpyrimidine-2,4-diamine | AG00025O | 19g |
| 1005-31-8 | C1C=[N+](C=CC=1N(C)C)[O-].O | 4-(Dimethylamino)pyridine n-oxide hydrate | AG00025P | 125g |
| 1005-24-9 | C[N+]1=CC=CC(C(N)=O)=C1.[Cl-] | 3-Carbamoyl-1-methylpyridin-1-ium chloride | AG00025R | 50g |
| 1008-30-6 | O=C1N(C2=CC=CC=C2)C=NN1 | 4-Phenyl-2,4-dihydro-3H-1,2,4-triazol-3-one | AG0002WL | 50g |
| 1008-19-1 | COc1cccc2c1CCCC2 | 1-Methoxy-5,6,7,8-tetrahydronaphthalene | AG0002WN | 1.67g |
| 1008-07-7 | ClC1=CC=CC2=C1NC=C2C=O | 7-CHLORO-3-FORMYLINDOLE | AG0002WR | 175g |
| 1008-95-3 | NC1=CC=C(C=C1)C1=CN=CO1 | 4-(1,3-Oxazol-5-yl)aniline | AG0002X5 | 150g |
| 1008-94-2 | ClC1=CC=C(C2=CN=CO2)C=C1 | 5-(4-Chlorophenyl)oxazole | AG0002X6 | 75g |
| 1008-91-9 | C2=C(N1CCNCC1)C=CN=C2 | 1-(4-Pyridyl)piperazine | AG0002X8 | 475g |
| 1008-89-5 | C1(C2=CC=CC=C2)=NC=CC=C1 | 2-Phenylpyridine | AG0002X9 | 2000g |
| 1008-88-4 | C1=CC=C(C2=CN=CC=C2)C=C1 | 3-Phenylpyridine | AG0002XA | 500g |
| 1008-79-3 | O=C1NN(C2=CC=CC=C2)C=C1 | 1-Phenyl-1H-pyrazol-3(2H)-one | AG0002XB | 30g |
| 1008-75-9 | CC1=NOC(C2=CC=CC=C2)=C1 | 3-Methyl-5-Phenylisoxazole | AG0002XC | 50g |
| 1008-72-6 | O=S(C1=CC=CC=C1C=O)([O-])=O.[Na+] | Sodium 2-formylbenzenesulfonate | AG0002XD | 2000g |
| 1008-65-7 | OC1=C(C2OC=NN=2)C=CC=C1 | 2-(1,3,4-OXADIAZOL-2-YL)PHENOL | AG0002XE | 125g |
| 1008-63-5 | [C@H](C(=O)O)(CN)c1ccccc1 | (R)-3-Amino-2-phenylpropanoic acid | AG0002XF | 0.5g |
| 1008139-25-0 | OB(O)C1=CON=C1 | ISOXAZOLE-4-BORONIC ACID | AG0002XH | 200g |
| 1008138-73-5 | O=C(OCC)C1=CN=C(C)C(N)=C1 | 5-amino-6-methyl-3-Pyridinecarboxylic acid ethyl ester | AG0002XJ | 50g |
| 1007170-24-2 | OB(O)C1=CC(OCC2=CC=CC=C2)=C(Cl)C=C1 | 3-BENZYLOXY-4-CHLOROPHENYLBORONIC ACID | AG0002PF | 25g |
| 100717-32-6 | C1CCC(CC1)C1=CNC2=CC=CC=C12 | 3-Cyclohexyl-1H-indole | AG0002PK | 2g |
| 10072-05-6 | O=C(OC)C1=CC=CC=C1N(C)C | N,N-Dimethylanthranilic acid methyl ester | AG0002PV | 4g |
| 1007308-75-9 | O=[N+](C1=CC2=C(Cl)N=C(Cl)N=C2C=C1F)[O-] | 2,4-Dichloro-7-fluoro-6-nitroquinazoline | AG0002PY | 1g |
| 1007219-73-9 | COC(=O)C1=CC=C2C=NN(C)C2=C1 | 1-METHYL-1H-INDAZOLE-6-CARBOXYLIC ACID METHYL ESTER | AG0002Q4 | 35g |
| 100727-49-9 | O=C(C1=NC=CC(OCC2=CC=CC=C2)=C1)O | 4-(Benzyloxy)pyridine-2-carboxylic acid | AG0002Q8 | 1.75g |
| 100727-07-9 | O=CC1=CC=C(NC2=CC=CC=C2)C=C1 | 4-(Phenylamino)benzaldehyde | AG0002QC | 50g |
| 100723-71-5 | CC1=CC=C(S(NCC(N2[C@H](C(O)=O)CCC2)=O)(=O)=O)C=C1 | (S)-1-(2-(4-Methylphenylsulfonamido)acetyl)pyrrolidine-2-carboxylic acid | AG0002QJ | 8g |
| 100721-33-3 | ClCC(=O)N(C1=CC=CC=C1)C1CCCCC1 | 2-Chloro-N-cyclohexyl-N-phenylacetamide | AG0002QK | 2g |
| 1007398-58-4 | CCCCCCCC[N+]1=C(C)N(C)C=C1.[Cl-] | 1,2-Dimethyl-3-octyl-1H-imidazol-3-ium chloride | AG0002QM | 600g |
| 1007390-44-4 | CCCC[N+]1=CN(C=C1)C=C.C(F)(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F | Butylvinylimidazolium bis(trifluoromethylsulfonyl)imide homopolymer | AG0002QN | 500g |
| 1007387-95-2 | COC(=O)[C@@H](O)[C@H]1[C@@]2(C)C[C@]3(O)[C@@H]4[C@@H](O[C@]56 | 1-O-Deacetylkhayanolide E | AG0002QP | 0.005g |
| 1007386-84-6 | OC(C1SC2=C(NC=C2)C=1)=O | 4H-Thieno[3,2-b]pyrrole-2-carboxylic acid | AG0002QS | 25g |
| 1007386-72-2 | O=C(C(N1)=CC2=C1N=CS2)O | 4H-Pyrrolo[2,3-d]thiazole-5-carboxylic acid | AG0002QT | 25g |
| 1007375-07-6 | COC1=C(C(C)(C)C)C=CC=C1Br | 1-Bromo-3-(tert-butyl)-2-methoxybenzene | AG0002QU | 1.6g |
| 100632-58-4 | O=C(N(CC)CCCCCCC)CCC(C1=CC=C(NS(=O)(C)=O)C=C1)=O | N-Ethyl-N-heptyl-4-(4-(methylsulfonamido)phenyl)-4-oxobutanamide | AG0002IM | 0.5g |
| 100622-34-2 | OB(C1=C2C=CC=CC2=CC3=CC=CC=C13)O | 9-Anthraceneboronic acid | AG0002IU | 1000g |
| 1006376-62-0 | OC1=CC=C2C3=CC=CC=C3C4=C2C1=CC=C4 | (1R,2R)-2-(3,4-DIFLUOROPHENYL)CYCLOPROPANECARBOXAMIDE | AG0002J1 | 0.5g |
| 1006376-61-9 | CCOC(=O)[C@@H]1C[C@H]1c2ccc(F)c(F)c2 | (1R,2R)-Ethyl 2-(3,4-difluorophenyl)cyclopropanecarboxylate | AG0002J2 | 4g |
| 1006376-60-8 | [C@H](CCl)(O)c1cc(F)c(cc1)F | (S)-2-Chloro-1-(3,4-difluorophenyl)ethanol | AG0002J3 | 175g |
| 1006365-26-9 | BrC1=CC(=C(NC1=O)C(=O)OC)C | Methyl 5-bromo-3-methyl-6-oxo-1,6-dihydropyridine-2-carboxylate | AG0002J4 | 5g |
| 1006349-08-1 | NC1=NN(C)C=C1Cl | 4-Chloro-1-methyl-1H-pyrazol-3-amine | AG0002J5 | 5g |
| 1006441-36-6 | S(Cl)(=O)(=O)C1C=NN(C2C=CC(=CN=2)C(F)(F)F)C=1 | 1-[5-(Trifluoromethyl)-2-pyridinyl]-1h-pyrazole-4-sulfonoyl chloride | AG0002JU | 2g |
| 1006436-44-7 | NC1=CN(C)N=C1C(F)(F)F | 1-Methyl-3-(trifluoromethyl)-1H-pyrazol-4-amine | AG0002JW | 100g |
| 100644-66-4 | NC1=NC(Cl)=C2C(N(C)N=C2)=N1 | 4-Chloro-1-Methyl-1H-Pyrazolo[3,4-D]Pyrimidin-6-Amine | AG0002K7 | 1g |
| 100644-65-3 | ClC2=C1C=N[NH]C1=NC(=N2)N | 4-Chloro-1H-pyrazolo[3,4-d]pyrimidin-6-amine | AG0002K8 | 200g |
| 100643-71-8 | ClC=1C=CC2=C(C1)CCC=3C=CC=NC3C2=C4CCNCC4 | 8-Chloro-6,11-dihydro-11-(4-piperdinylidene)-5H-benzo[5,6]cyclohepta[1,2-b | AG0002K9 | 2000g |
| 10083-24-6 | OC1=CC=C(/C=C/C2=CC(O)=CC(O)=C2)C=C1O | Piceatannol | AG0002ZH | 125g |
| 1008451-58-8 | O(C)c1c(C=O)c(Cl)ccn1 | 4-Chloro-2-methoxynicotinaldehyde | AG0002ZI | 200g |
| 1008415-02-8 | OB(O)C1=CC(Cl)=C(C=C1)C#N | 3-Chloro-4-cyanophenylboronic acid | AG0002ZJ | 20g |
| 1008402-79-6 | O=C(ON1C(=O)CCC1=O)CCOCCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)ON1C(=O | 4,7,10,13,16,19,22,25,28-Nonaoxahentriacontanedioic acid, 1,31-bis(2,5-dioxo | AG0002ZK | 1.7g |
| 1008402-47-8 | O=C(CCN1C(=O)C=CC1=O)NCCOCCOCCOCCNC(=O)CCN1C(=O)C=CC1=O | 1H-Pyrrole-1-propanamide, N,N’-[oxybis(2,1-ethanediyloxy-2,1-ethanediyl)] | AG0002ZL | 5g |
| 1008361-80-5 | NC1=CC=C(Br)C(Cl)=C1N | 4-Bromo-3-chlorobenzene-1,2-diamine | AG0002ZM | 50g |
| 1008361-77-0 | CC1=NC(I)=CC=C1Br | 3-Bromo-6-iodo-2-methylpyridine | AG0002ZN | 75g |
| 1008361-72-5 | FC1=C2C(NC=N2)=CC=C1Br | 5-Bromo-4-fluoro-1h-benzimidazole | AG0002ZO | 25g |
| 1008361-65-6 | COC1=C(Br)C=C2C(NC=N2)=C1 | 5-Bromo-6-methoxybenzoimidazole | AG0002ZP | 50g |
| 100846-24-0 | FC(C1=CC2=C(NC=C2)C=C1)(F)F | 5-(Trifluoromethyl)indole | AG0002ZS | 200g |
| 100841-04-1 | NCCCOC1=CC=C([N+]([O-])=O)C=C1 | 3-(4-Nitrophenoxy)propylamine | AG0002ZZ | 0.15g |
| 100841-00-7 | NCCCOC1=CC=C(OC)C=C1 | 3-(4-Methoxy-phenoxy)-propylamine | AG000300 | 8g |
| 1008526-84-8 | NCCN1C=NN=C1 | 2-(4H-1,2,4-Triazol-4-yl)ethanamine | AG000307 | 50g |
| 1008526-71-3 | O=C(N1CC(O)(CN)C1)OC(C)(C)C | 1-BOC-3-HYDROXY-3-(AMINOMETHYL)AZETIDINE | AG000308 | 50g |
| 1008526-70-2 | O=C(N1CC(C[N+]([O-])=O)(O)C1)OC(C)(C)C | 1-BOC-3-HYDROXY-3-(NITROMETHYL)AZETIDINE | AG000309 | 75g |
| 1008517-73-4 | O=C1NN=CC(OCC2=CC=CC=C2)=C1 | 5-(Benzyloxy)pyridazin-3(2h)-one | AG00030C | 10g |
| 101-06-4 | OCCN(CC1=CC=CC=C1)CC1=CC=CC=C1 | N,N-Dibenzylethanolamine | AG0003F4 | 3500g |
| 101-01-9 | N(/C1C=CC=CC=1)=C(/NC1C=CC=CC=1)NC1C=CC=CC=1 | 1,2,3-Triphenylguanidine | AG0003F6 | 5g |
| 101-00-8 | CC1CN2CC(C)OB(O1)OC(C)C2 | 3,7,10-Trimethyl-2,8,9-Trioxa-5-Aza-1-Borabicyclo[3.3.3]Undecane | AG0003F7 | 300g |
| 101-43-9 | CC(C(OC1CCCCC1)=O)=C | Cyclohexyl methacrylate | AG0003FC | 54000g |
| 101-39-3 | O=C/C(C)=C/C1=CC=CC=C1 | 2-Methyl-3-phenylacrylaldehyde | AG0003FF | 12000g |
| 101-32-6 | OCCN(CCO)CC1=CC=CC=C1 | 2,2′-(Benzylimino)diethanol | AG0003FI | 300g |
| 101-31-5 | C1[C@@H]2[N@](C(C[C@H](OC(=O)[C@@H](C3C=CC=CC=3)CO)C2)C1)C | L-Hyoscyamine | AG0003FJ | 0.05g |
| 101-29-1 | O=C1C(I)=CN(CC(O)=O)C=C1I | 3,5-DIIODO-4-PYRIDONE-1-ACETIC ACID | AG0003FK | 50g |
| 101-23-5 | FC(C1=CC(NC2=CC=CC=C2)=CC=C1)(F)F | N-Phenyl-3-(trifluoromethyl)aniline | AG0003FM | 15g |
| 101-20-2 | N(C(=O)Nc1ccc(cc1)Cl)c1cc(Cl)c(cc1)Cl | 1-(4-Chlorophenyl)-3-(3,4-dichlorophenyl)urea | AG0003FO | 1000g |
| 101-18-8 | OC1=CC=CC(NC2=CC=CC=C2)=C1 | 3-Hydroxydiphenylamine | AG0003FP | 771.3g |
| 101-17-7 | ClC1=CC=CC(NC2=CC=CC=C2)=C1 | 3-Chlorodiphenylamine | AG0003FQ | 175g |
| 101-85-9 | CCCCCC(=C/c1ccccc1)CO | Alpha-Amylcinnamyl alcohol, 30-35%, mixture with amyl hydrocinnamyl alco | AG0003FR | 1.25g |
| 101-81-5 | C1(CC2=CC=CC=C2)=CC=CC=C1 | Diphenylmethane | AG0003FV | 23325g |
| 101-79-1 | NC1=CC=C(OC2=CC=C(Cl)C=C2)C=C1 | 4-Amino-4′-chlorodiphenyl Ether | AG0003FW | 1000g |
| 101-75-7 | C1(C=CC(/N=N/C2C=CC=CC=2)=CC=1)NC1C=CC=CC=1 | 4-Phenylazodiphenylamine | AG0003FX | 164.75g |
| 101-70-2 | COC1=CC=C(NC2=CC=C(OC)C=C2)C=C1 | 4,4′-Dimethoxydiphenylamine | AG0003FZ | 2500g |
| 1012057-52-1 | NC1=CC2=C(NC3=CC=CC(C#C)=C3)N=CN=C2C=C1OC | N4-(3-Ethynylphenyl)-7-methoxyquinazoline-4,6-diamine | AG0003Y4 | 2g |
| 1012057-47-4 | O=C1NC=NC2=C1C=C([N+]([O-])=O)C(OC)=C2 | 7-Methoxy-6-nitro-3H-quinazolin-4-one | AG0003Y5 | 10g |
| 1012054-59-9 | O=C(NO)CCCCCCOC1=CC2=C(NC3=CC=CC(C#C)=C3)N=CN=C2C=C1OC | CUDC-101 | AG0003Y9 | 0.2g |
| 1012051-90-9 | S=C(NC1=CC(C(F)(F)F)=CC(C(F)(F)F)=C1)N[C@H](C2=CC=CC=C2)[C@H](NC(NC3= | N,N’-[(1R,2R)-1,2-Diphenyl-1,2-ethanediyl]bis[N’-[3,5-bis(trifluoromethyl)ph | AG0003YA | 0.5g |
| 101203-31-0 | OC1=C(C(C)(C)C)C=C(C)C(C)=C1C2=C(C)C(C)=CC(C(C)(C)C)=C2O | 3,3′-Di-tert-butyl-5,5′,6,6′-tetramethyl-[1,1′-biphenyl]-2,2′-diol | AG0003YJ | 50g |
| 1012085-50-5 | CC1(C)C(C)(C)OB(C2=CN=CC(B3OC(C)(C)C(C)(C)O3)=C2)O1 | 3,5-Bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-pyridine | AG0003YQ | 2g |
| 1012084-56-8 | CC1=NC=CC=C1B1OC(C)(C)C(C)(C)O1 | 2-Methylpyridine-3-boronic acid, pinacol ester | AG0003YS | 100g |
| 1012084-53-5 | OC1=CC(Br)=CN=C1F | 5-Bromo-2-fluoropyridin-3-ol | AG0003YU | 300g |
| 1012067-91-2 | Cl.Cl.N1(=CC=C(C(N)C)C=C1) | (1R)-1-(Pyridin-4-yl)ethan-1-amine DiHCl | AG0003YX | 3g |
| 101209-08-9 | CC(C1C=CC(NC(C)=O)=C(Br)C=1)=O | 4′-Acetamido-3′-bromoacetophenone | AG0003ZA | 125g |
| 10121-91-2 | O=S(C1=C2C=CC=C(N(C)C)C2=CC=C1)(NCCCCCN)=O | N-(5-Aminopentyl)-5-(dimethylamino)naphthalene-1-sulfonamide | AG0003ZC | 30g |
| 101219-73-2 | C[C@H](O)C1=CC=C(F)C=C1 | (S)-1-(4-Fluorophenyl)ethanol | AG0003ZQ | 10g |
| 101219-71-0 | C[C@H](O)C1=CC=C(C=C1)C#N | (S)-4-(1-Hydroxyethyl)benzonitrile | AG0003ZR | 10g |
| 101219-69-6 | N#CC1=CC=C([C@H](O)C)C=C1 | (R)-4-(1-Hydroxyethyl)Benzonitrile | AG0003ZS | 20g |
| 101219-68-5 | C[C@@H](O)C1=CC=C(F)C=C1 | (R)-1-(4-Fluorophenyl)Ethanol | AG0003ZT | 50g |
| 101214-43-1 | O=C1CCC(N1OC([C@H](CC2=CC=CC=C2)NC(OCC3C4=CC=CC=C4C5=CC=CC=C53)= | Fmoc-Phe-OSu | AG0003ZY | 700g |
| 10122-95-9 | Nc1cc2CCc3ccc(CCc1cc2)cc3 | Tricyclo[8.2.2.24,7]Hexadeca-4,6,10,12,13,15-Hexaen-5-Amine | AG000403 | 3g |
| 1012343-72-4 | BrC1=CN=C2C=CC(=N[N]12)N3CCOCC3 | 4-(3-Bromoimidazo[1，2-b]pyridazin-6-yl)morpholine | AG000404 | 10g |
| 1012341-56-8 | [H]N(C(OC(C)(C)C)=O)[C@@H](CC(C=C1)=CC=C1C2=CC=CC=C2)C[C@H](C(O)=O) | (2R,4R)-5-([1,1′-Biphenyl]-4-yl)-4-((tert-butoxycarbonyl)amino)-2-methylpen | AG000406 | 4g |
| 1012341-54-6 | [H]N(C(OC(C)(C)C)=O)[C@@H](CC(C=C1)=CC=C1C2=CC=CC=C2)C[C@@H](C(O)= | (2S，4R)-5-([1，1′-biphenyl]-4-yl)-4-((tert-butoxycarbonyl)amino)-2-methyl | AG000407 | 7.75g |
| 1009376-81-1 | COC([C@@H]1CC[C@@H](NC1)C)=O | (3R,6S)-Methyl 6-methylpiperidine-3-carboxylate | AG00038H | 25g |
| 1009376-79-7 | COC(=O)[C@H]1CC[C@@H](C)NC1 | (3S,6R)-METHYL 6-METHYLPIPERIDINE-3-CARBOXYLATE | AG00038I | 25g |
| 1009376-76-4 | COC(=O)[C@@H]1CC[C@H](C)N(C(=O)OC(C)(C)C)C1 | 1-tert-Butyl 3-methyl (3r,6s)-rel-6-methylpiperidine-1,3-dicarboxylate | AG00038J | 2g |
| 1009376-67-3 | O=C([C@H]1CNCC[C@H]1C)OC.[H]Cl | Methyl (3r,4r)-rel-4-methylpiperidine-3-carboxylate hydrochloride | AG00038L | 2g |
| 1009376-54-8 | COC(=O)[C@@H]1CN(CC[C@H]1C)C(=O)OC(C)(C)C | 1-tert-Butyl 3-methyl (3s,4r)-rel-4-methylpiperidine-1,3-dicarboxylate | AG00038M | 50g |
| 1009376-53-7 | COC(=O)[C@H]1CN(C(=O)OC(C)(C)C)CC[C@H]1C | 1-TERT-BUTYL 3-METHYL (3R,4R)-REL-4-METHYLPIPERIDINE-1,3-DICARBOXYLAT | AG00038N | 1g |
| 1009376-52-6 | CC1C(C(O)=O)CN(C(OC(C)(C)C)=O)CC1 | 1-(TERT-BUTOXYCARBONYL)-4-METHYLPIPERIDINE-3-CARBOXYLIC ACID | AG00038O | 0.5g |
| 1009367-63-8 | O=C(N1CC(C2=NNN=N2)C1)OC(C)(C)C | tert-Butyl 3-(2H-tetrazol-5-yl)azetidine-1-carboxylate | AG00038R | 1g |
| 1009335-43-6 | O=C(OC(C)(C)C)N[C@H]1CN[C@@H](CO)C1 | tert-Butyl ((3R,5R)-5-(hydroxymethyl)pyrrolidin-3-yl)carbamate | AG00038U | 0.1g |
| 1009335-36-7 | OC[C@H]1C[C@H](CN1)O.Cl | (3R,5R)-5-(Hydroxymethyl)pyrrolidin-3-ol hydrochloride | AG00038V | 20g |
| 1009334-04-6 | ClC1=CN=CC(C=O)=C1Cl | 4,5-dichloro-3-Pyridinecarboxaldehyde | AG00038X | 100g |
| 100937-76-6 | O[C@H]1COCCC1 | (R)-Tetrahydro-2H-pyran-3-ol | AG00038Z | 25g |
| 1009378-93-1 | COC(C1=CC2N(C(=CN=2)I)C=C1)=O | Methyl 3-iodoimidazo[1,2-a]pyridine-7-carboxylate | AG000396 | 9g |
| 1009377-06-3 | C[C@H]1CC[C@@H](CO)CN1C(=O)OC(C)(C)C | tert-Butyl (2s,5r)-5-(hydroxymethyl)-2-methylpiperidine-1-carboxylate | AG000398 | 5g |
| 1009376-98-0 | COC([C@H]1CC[C@H](N(C(OC(C)(C)C)=O)C1)C)=O | 1-TERT-BUTYL 3-METHYL (3S,6R)-6-METHYLPIPERIDINE-1,3-DICARBOXYLATE | AG000399 | 5g |
| 1009376-93-5 | C[C@@H]1CC[C@@H](CO)CN1C(=O)OC(C)(C)C | tert-Butyl (2r,5r)-5-(hydroxymethyl)-2-methylpiperidine-1-carboxylate | AG00039A | 1g |
| 1009376-87-7 | COC(=O)[C@@H]1CC[C@@H](C)NC1 | Trans-3-piperidinecarboxylic acid, 6-methyl-, methyl ester | AG00039B | 5g |
| 1009735-22-1 | COC(=O)c1ccc(nc1Br)Br | Methyl 2,6-dibromopyridine-3-carboxylate | AG0003CR | 2g |
| 1009734-33-1 | CC(C)(C)OC1=CC=CC2=C1C(N)=NC(N)=N2 | 5-tert-Butoxyquinazoline-2,4-diamine | AG0003CS | 0.075g |
| 100981-05-3 | O=C(/C1=C(SC)SC)OC(C)(C)OC1=O | 5-(bis(methylthio)methylene)-2,2-dimethyl-1,3-dioxane-4,6-dione | AG0003CU | 3g |
| 100980-82-3 | O=CC1=CC=C(C2=CC=C(O)C=C2)C=C1 | [1,1′-Biphenyl]-4-carboxaldehyde, 4′-hydroxy- | AG0003CX | 5g |
| 100973-67-9 | O=C(C1=CN=C(SC)N=C1NCC2=CC=CC=C2)OCC | Ethyl 4-(benzylamino)-2-(methylthio)pyrimidine-5-carboxylate | AG0003D3 | 2g |
| 10098-39-2 | OC(=O)C(c1ccc(cc1)[N+](=O)[O-])O | 2-Hydroxy-2-(4-nitrophenyl)acetic acid | AG0003D6 | 20g |
| 1009826-93-0 | BrC1=CN=CN=C1C(=O)OC | Methyl 5-bromo-4-pyrimidinecarboxylate | AG0003DC | 125g |
| 100987-89-1 | NC1=NN=C(C2=CC=C(C(C)C)C=C2)S1 | 5-(4-Isopropylphenyl)-1,3,4-thiadiazol-2-amine | AG0003DM | 200g |
| 100987-04-0 | NC1=NN=C(C2=CC=C(C(C)(C)C)C=C2)S1 | 2-Amino-5-(4-tert-butylphenyl)-1,3,4-thiadiazole | AG0003DN | 30g |
| 100986-89-8 | C[C@H]1COC2=C3N1C=C(C(O)=O)C(=O)C3=CC(F)=C2F | Levofloxacin Carboxylic Acid | AG0003DO | 200g |
| 100986-86-5 | FC1=CC2=C3C(OC[C@@H](C)N3C=C(C(O)=O)C2=O)=C1N4CCN(C)CC4 | (R)-Ofloxacin | AG0003DP | 0.5g |
| 100983-10-6 | O=C(OC(C)C)CCBr | Isopropyl 3-bromopropanoate | AG0003DV | 5g |
| 100991-09-1 | OC1=CN=C(C(F)(F)F)N=C1 | 2-(Trifluoromethyl)pyrimidin-5-ol | AG0003E3 | 50g |
| 10099-70-4 | C(C=C/C(=O)OC(C)C)(=O)OC(C)C | Diisopropyl maleate | AG0003EB | 10g |
| 101-16-6 | COC1=CC(NC2=CC=CC=C2)=CC=C1 | 3-Methoxydiphenylamine | AG0003EW | 2000g |
| 101-11-1 | CCN(CC1=CC=CC(=C1)S(O)(=O)=O)C1=CC=CC=C1 | N-Ethyl-N-benzylaniline-3′-sulfonic acid | AG0003F0 | 8000g |
| 1009033-87-7 | CC1(C)OB(OC1(C)C)C1=CC=C(C=C1)C1=CC=NC=C1 | 4-(Pyridin-4-yl)phenylboronic acid, pinacol ester | AG000354 | 75g |
| 100906-93-2 | [Cl-].COC1=CC=C(C=C1)[N+]1=CC=C(C=C1)C1=CC=[N+](C=C1)C1=CC=C(C=C1)OC.[ | 1,1′-Bis(4-methoxyphenyl)-[4,4′-bipyridine]-1,1′-diium chloride | AG000358 | 2g |
| 100900-16-1 | O=C(C1=C2C=CC3=C1C=CC4=CC=CC=C43)C=CC2=O | 1,4-Chrysenequinone | AG00035I | 0.5g |
| 100900-07-0 | O=S(C1=C2C=CC=C(NCCN)C2=CC=C1)([O-])=O.[Na+] | 5-(2-Aminoethylamino)-1-naphthalenesulfonic acid sodium salt hydrate | AG00035K | 4.5g |
| 10090-05-8 | C[Si](C)(C)OS(C)(=O)=O | Silanol, 1,1,1-trimethyl-, 1-methanesulfonate | AG00035N | 175g |
| 1009-93-4 | C[Si]1(C)N[Si](C)(C)N[Si](C)(C)N1 | 2,2,4,4,6,6-Hexamethyl-1,3,5,2,4,6-triazatrisilinane | AG00035O | 500g |
| 1009104-85-1 | COC=1C=C2CCN(CC2=CC1OC)C(C=CC1=C(N(C2=NC=CC=C21)C)C2=CC=CC=C2)=O | 1-(6,7-Dimethoxy-3,4-dihydroisoquinolin-2(1H)-yl)-3-(1-methyl-2-phenyl-1H- | AG00035Q | 0.1g |
| 1009102-44-6 | NC1(C2=CC=C(Cl)C=C2)CC1.[H]Cl | 1-(4-Chlorophenyl)cyclopropanamine, HCl | AG00035R | 10g |
| 1009101-70-5 | NCC1=CN=NN1.[H]Cl | (1H-1,2,3-Triazol-5-yl)methanamine hydrochloride | AG00035S | 25g |
| 1009094-73-8 | CC1(C(C)(C)OB(C2=CC(C(O)=O)=CC(N)=C2)O1)C | 3-amino-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid | AG00035T | 0.5g |
| 1009093-60-0 | O=CC1=CC(F)=CC(Br)=C1OC | 3-Bromo-5-fluoro-2-methoxybenzaldehyde | AG00035U | 9.9g |
| 1009091-82-0 | CCOc1c(Br)cccc1C=O | 3-Bromo-2-ethoxybenzaldehyde | AG00035W | 5g |
| 1009075-48-2 | CC(OC(N1C[C@H](F)[C@H](N)C1)=O)(C)C | tert-butyl (3R,4S)-3-amino-4-fluoropyrrolidine-1-carboxylate | AG00035X | 20g |
| 1009075-44-8 | O=C(OC(C)(C)C)N[C@H]1C[C@H](N)CC1 | tert-butyl n-[(1r,3r)-3-aminocyclopentyl]carbamate | AG00035Y | 50g |
| 1009075-43-7 | CC(C)(C)OC(=O)N1C[C@H](N)[C@@H](F)C1 | (3S,4S)-tert-Butyl 3-amino-4-fluoropyrrolidine-1-carboxylate | AG00035Z | 20g |
| 100910-66-5 | CC1=CC(=CN=C1)C=O | 5-Methylpyridine-3-carboxaldehyde | AG000366 | 125g |
| 100907-37-7 | CCCCc1ccc(nc1)-c1ccccc1 | 5-Butyl-2-phenylpyridine | AG00036D | 0.85g |
| 101-67-7 | CCCCCCCCC1=CC=C(NC2=CC=C(CCCCCCCC)C=C2)C=C1 | Bis(4-octylphenyl)amine | AG0003G1 | 100g |
| 101-63-3 | [O-][N+](C1=CC=C(OC2=CC=C([N+]([O-])=O)C=C2)C=C1)=O | 1-nitro-4-(4-nitrophenoxy)benzene | AG0003G2 | 1000g |
| 101-59-7 | NC1=CC=C(SC2=CC=C([N+]([O-])=O)C=C2)C=C1 | 4-Amino-4′-nitrodiphenyl Sulfide | AG0003G4 | 500g |
| 101-53-1 | OC1=CC=C(CC2=CC=CC=C2)C=C1 | 4-Benzylphenol | AG0003G8 | 300g |
| 1010-68-0 | OC=1C=C2C(C(N(C2=CC1)C)=O)C | 5-Hydroxy-1,3-dimethylindolin-2-one | AG0003GA | 10g |
| 1010-60-2 | O=C1C(Cl)=CC(C2=C1C=CC=C2)=O | 2-Chloro-1,4-Naphthoquinone | AG0003GB | 1000g |
| 1010-54-4 | CC1=NNC(=O)N1C1=CC=CC=C1 | 3-Methyl-4-phenyl-1H-1,2,4-triazol-5(4H)-one | AG0003GF | 0.5g |
| 1010-48-6 | C(CC(=O)O)(C)(C)c1ccccc1 | 3-Methyl-3-Phenylbutanoic Acid | AG0003GI | 200g |
| 1010-26-0 | O=C(O1)CC2(CCCCC2)CC1=O | 1,1-Cyclohexanediacetic anhydride | AG0003GL | 1000g |
| 1010-19-1 | CC[N+](C1C=CC=CC=1)(CC)CC.[I-] | Triethylphenylammonium (iodide) | AG0003GM | 325g |
| 101-99-5 | C1=CC=CC(=C1)NC(=O)OCC | N-Phenylurethane | AG0003GN | 4000g |
| 101-98-4 | CN(CCO)CC1=CC=CC=C1 | 2-(Benzyl(methyl)amino)ethanol | AG0003GO | 10000g |
| 101-94-0 | O=C(OC1=CC=C(C)C=C1)CC2=CC=CC=C2 | P-Tolyl 2-Phenylacetate | AG0003GQ | 5000g |
| 101-92-8 | CC(CC(NC1=CC=C(Cl)C=C1)=O)=O | 4′-Chloroacetoacetanilide | AG0003GR | 2500g |
| 101-91-7 | OC1=CC=C(C=C1)NC(CCC)=O | N-(4-Hydroxyphenyl)butanamide | AG0003GS | 400g |
| 101002-44-2 | CCc1ccc(cc1)c1ccc(cc1)C=O | 4′-Ethyl-[1,1′-biphenyl]-4-carbaldehyde | AG0003GX | 0.2g |
| 101001-73-4 | O=C(OCC(C)(C)C)CBr | Neopentyl 2-bromoacetate | AG0003H4 | 2g |
| 1010120-55-4 | NC1=NN2C(Br)=CC=CC2=N1 | 5-Bromo[1,2,4]triazolo[1,5-a]pyridin-2-amine | AG0003J1 | 75g |
| 1010110-74-3 | CCCc1cc(F)c(c(c1)F)B(O)O | 2,6-Difluoro-4-propylphenylboronic acid | AG0003J4 | 0.2g |
| 101012-43-5 | CC(C1=C(C)SC(N)=N1)C | 5-Methyl-4-(propan-2-yl)-1,3-thiazol-2-amine | AG0003JH | 15g |
| 101012-32-2 | ClC1=NC=CC=C1CC#N | (2-Chloropyridin-3-yl)acetonitrile | AG0003JI | 25g |
| 101012-12-8 | O=C(C1=CN=C(Cl)S1)O | 2-Chloro-1,3-thiazole-5-carboxylic acid | AG0003JK | 300g |
| 101012-11-7 | Brc1c(Cl)nc(nc1N)Cl | 5-Bromo-2,6-dichloropyrimidin-4-amine | AG0003JL | 5.02g |
| 101018-70-6 | CN(C)CC1=C(O)C=CC2=C1N=C(C)N2 | 4-((Dimethylamino)methyl)-2-methyl-1H-benzo[d]imidazol-5-ol | AG0003JT | 75g |
| 10102-68-8 | [Ca+2].[I-].[I-] | Calcium iodide(Granules or Chunks) | AG0003JW | 400g |
| 10102-25-7 | [O-]S(=O)(=O)[O-].[Li+].[Li+].O | Sulfuric acid, lithium salt, hydrate (1:2:1) | AG0003K1 | 5000g |
| 10102-17-7 | O=S([O-])([O-])=S.[H]O[H].[H]O[H].[H]O[H].[H]O[H].[H]O[H].[Na+].[Na+] | Sodium Thiosulfate Pentahydrate | AG0003K6 | 610000g |
| 10102-94-0 | O=CC1=CN(C)C2=C1C=C(Br)C=C2 | 5-Bromo-1-methyl-1H-indole-3-carbaldehyde | AG0003KW | 20g |
| 10102-90-6 | OP(=O)(OP(=O)(O)O)O.[Cu] | Copper pyrophosphate | AG0003KX | 1450g |
| 1010386-62-5 | C1(S(O)(=O)=O)C=CC2N(CCCCCC(=O)NCC#C)/C(=C/C=C/C3C(C)(C)C4C=C(S(O)(= | Cy3-yne | AG0003L0 | 0.01g |
| 101033-03-8 | OC(C1=CC=C(C2SCCS2)C=C1)=O | 4-(1,3-Dithiolan-2-yl)benzoic Acid | AG0003L8 | 20g |
| 10103-06-7 | COC1=CC2=C(C=CC=C2)C=C1OC | 2，3-Dimethoxynaphthalene | AG0003LN | 200g |
| 100894-64-2 | C=CN1C=[N+](CC=C)C=C1.[Cl-] | 1-Allyl-3-vinylimidazolium chloride | AG00033Y | 400g |
| 100888-40-2 | CCCCCCCCCCCCCCB(O)O | n-Tetradecylboronic acid | AG000344 | 0.75g |
| 100884-80-8 | O=C(C12CC3(C(O)=O)CC(C2)(C(O)=O)CC(C3)(C(O)=O)C1)O | ADAMANTANE-1,3,5,7-TETRACARBOXYLIC ACID | AG00034A | 35g |
| 1009-85-4 | ClCCN1CCN(CCCl)CC1 | 1,4-Bis(2-chloroethyl)piperazine | AG00034F | 125g |
| 1009-84-3 | ClC1=NN=C(C=C1)NCCCC | 6-Butylamino-3-chloropyridazine | AG00034G | 125g |
| 1009-75-2 | CC(NC1=CC=C(F)C(Br)=C1)=O | N-Acetyl 3-bromo-4-fluoroaniline | AG00034J | 75g |
| 1009-67-2 | O=C(O)C(C)CC1=CC=CC=C1 | 2-Methyl-3-phenylpropanoic acid | AG00034K | 300g |
| 1009-61-6 | CC(C1=CC=C(C(C)=O)C=C1)=O | 1,4-Diacetylbenzene | AG00034M | 130g |
| 1009-43-4 | C=CC1=CC=C([Si](C)(C)C)C=C1 | Trimethyl(4-Vinylphenyl)Silane | AG00034Q | 200g |
| 1009-36-5 | COC1=C(Cl)C=CC([N+]([O-])=O)=C1 | 1-Chloro-2-methoxy-4-nitrobenzene | AG00034R | 1000g |
| 1009-35-4 | FC1=C(C=C(C#N)C=C1)[N+](=O)[O-] | 4-Fluoro-3-nitrobenzonitrile | AG00034S | 50g |
| 1009-27-4 | CCOC(N1)=CC2=C1C=CC=C2 | 2-Ethoxy-1h-indole | AG00034T | 5g |
| 1009-14-9 | CCCCC(C1=CC=CC=C1)=O | 1-Phenylpentan-1-one | AG00034X | 2500g |
| 1009-11-6 | C(=O)(CCC)c1ccc(cc1)O | 1-(4-Hydroxyphenyl)butan-1-one | AG00034Z | 1500g |
| 1009119-83-8 | Cl.Cl.Cl.Cl.N1[C@@H](CCC1)C=1NC(=CN1)C1=CC=C(C=C1)C1=CC=C(C=C1)C1=CN | 4,4′-Bis(2-((S)-pyrrolidin-2-yl)-1H-imidazol-5-yl)-1,1′-biphenyl tetrahydrochlo | AG00036H | 100g |
| 1009119-65-6 | O=C([C@@H](NC(OC)=O)C(C)C)N1[C@@H](CCC1)C2=NC=C(N2)C3=CC=C(C=C3) | Daclatasvir dihydrochloride | AG00036J | 125g |
| 1009119-64-5 | O=C([C@@H](NC(OC)=O)C(C)C)N1CCC[C@H]1C2=NC=C(N2)C3=CC=C(C=C3)C4= | Methyl ((S)-1-((S)-2-(5-(4′-(2-((S)-1-((methoxycarbonyl)-L-valyl)pyrrolidin-2-y | AG00036K | 3g |
| 100915-02-4 | COC(=O)C1=CC=C(OC2=CC=C(C=O)C=C2)C=C1 | methyl 4-(4-formylphenoxy)benzoate | AG00036N | 3g |
| 100911-49-7 | NCCN1CCCCC1.[H]Cl.[H]Cl | 2-(piperidin-1-yl)ethanamine DiHCl | AG00036X | 23g |
| 100927-10-4 | O=C(OC(C)(C)C)N[C@H](C)CN | (R)-tert-Butyl (1-aminopropan-2-yl)carbamate | AG000376 | 50g |
| 1009307-13-4 | CCOC(=O)C=CB1OC(C)(C)C(C)(C)O1 | (E)-2-Ethoxycarbonylvinylboronic acid pinacol ester | AG00037U | 200g |
| 1009306-52-8 | Cl.CCOC(C1=C(CCl)N=C2C(C=CC=C2)=C1C)=O | Ethyl 2-(chloromethyl)-4-methylquinoline-3-carboxylate hydrochloride | AG00037V | 1g |
| 1009303-77-8 | OCC1=CC(B2OC(C)(C)C(C)(C)O2)=CC=C1OC | 2-Methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-benzenemethano | AG00037X | 1g |
| 1009303-59-6 | CC(OC1=CC=C(B(O)O)C=C1C#N)C | (3-Cyano-4-isopropoxyphenyl)boronic acid | AG00037Y | 6g |
| 1009303-44-9 | C[C@H]1COCCN1C1=NC2=NC(Cl)=CC=C2C(=N1)N1CCOC[C@@H]1C | (3S,3’S)-4,4′-(7-Chloropyrido[2,3-d]pyrimidine-2,4-diyl)bis(3-methylmorpholi | AG000380 | 0.8g |
| 1009298-59-2 | C[C@@H]1N(c2c3c(nc(n2)N2[C@@H](C)COCC2)nc(cc3)c2cc(C(=O)NC)ccc2)CCO | 3-[2,4-Bis[(3S)-3-methyl-4-morpholinyl]pyrido[2,3-d]pyrimidin-7-yl]-N-meth | AG000382 | 0.3g |
| 1009298-09-2 | OCC1=CC(C2=NC3=NC(N4[C@@H](C)COCC4)=NC(N5[C@@H](C)COCC5)=C3C=C | AZD8055 | AG000383 | 2g |
| 100930-12-9 | O=C(OCC[N+](C)(C)C)CCCCCCC(OCC[N+](C)(C)C)=O.[Cl-].[Cl-] | Suberyl dicholine dichloride | AG000385 | 10g |
| 100929-85-9 | [K+].P(=O)(OC1=CC=CC2=CC=CC=C12)([O-])O | 1-Naphthyl phosphate potassium salt | AG00038B | 20g |
| 100929-45-1 | Nc1nc(N)c2nc(CNc3ccc(C(=O)O)cc3)cnc2n1.[NaH] | 4-(N-[2,4-Diamino-6-pteridinylmethyl]-amino)benzoic acid sodium salt | AG00038F | 0.5g |
| 100960-68-7 | N#CC1=CC=C(Cl)C=C1OC | 4-Chloro-2-methoxybenzonitrile | AG0003BH | 20g |
| 100960-16-5 | CCOC(C1SC=C(CCl)N=1)=O | Ethyl 4-(chloromethyl)thiazole-2-carboxylate | AG0003BL | 1.03g |
| 100960-11-0 | OB(C1=CC([N+]([O-])=O)=CC=C1C)O | Boronic acid, B-(2-methyl-5-nitrophenyl)- | AG0003BM | 175g |
| 100960-07-4 | NC2=CN=C1[NH]C=CC1=C2 | 5-Amino-7-azaindole | AG0003BO | 150g |
| 100959-91-9 | O=C(C1=COC(C)=N1)N | 2-Methyloxazole-4-carboxamide | AG0003BR | 0.5g |
| 100959-52-2 | NC1=C2C(C=NN2)=C(Cl)C=C1 | 4-Chloro-1H-indazol-7-amine | AG0003BU | 2g |
| 1009620-97-6 | CCOC(C1N=C(CCl)ON=1)=O | Ethyl 5-(chloromethyl)-1,2,4-oxadiazole-3-carboxylate | AG0003BY | 0.75g |
| 10097-28-6 | [Si]=O | Silicon monoxide | AG0003CE | 4500g |
| 10097-02-6 | CCC(CO)(CO)C(O)=O | 2,2-Bis(hydroxymethyl)butyric acid | AG0003CH | 1500g |
| 2934-97-6 | C12=CC(OC)=C(OC)C=C1CCN1C2CC2=CC=C(OC)C(OC)=C2C1 | Tetrahydropalmatine | AG0003CI | 700g |
| 1009820-21-6 | O=C(C1=CC=C2C(N=C(NC3=CC=CC(Cl)=C3)C4=C2C=NC=C4)=C1)O | 5-[(3-Chlorophenyl)amino]benzo[c]2,6-naphthyridine-8-carboxylic acid | AG0003CJ | 2g |
| 1009817-63-3 | O=C1/C(CN(C(C=C)=O)C/C1=CC2=CC=C([N+]([O-])=O)C=C2)=C/C3=CC=C([N+]([O | b-AP15 | AG0003CL | 0.5g |
| 1009816-48-1 | C(C)NC=1S[C@@H]2[C@H](N1)[C@H]([C@@H]([C@H](O2)CO)O)O | (3aR,5R,6S,7R,7aR)-2-(Ethylamino)-3a,6,7,7a-tetrahydro-5-(hydroxymethyl)-5 | AG0003CM | 0.25g |
| 1009735-25-4 | O=C(O)C1=C(Br)N=C(OC)C=C1 | 2-Bromo-6-methoxynicotinic acid | AG0003CO | 25g |
| 1009735-24-3 | O=C(OC)C1=C(OC)N=C(Br)C=C1 | Methyl 6-bromo-2-methoxynicotinate | AG0003CP | 50g |
| 1009735-23-2 | O=C(OC)C1=C(Br)N=C(OC)C=C1 | Methyl 2-bromo-6-methoxynicotinate | AG0003CQ | 10g |
| 10108-24-4 | CCCCCCCCCCCC(=O)OCCOCCOCCOCCO | DODECANOIC ACID, 2-[2-[2-(2-HYDROXYETHOXY)ETHOXY]ETHOXY]ETHYL ESTE | AG0003P3 | 0.5g |
| 1010836-49-3 | COC1(CCOCC1)C(O)=O | 4-Methoxytetrahydro-2H-pyran-4-carboxylic acid | AG0003P4 | 10g |
| 1010836-19-7 | O=C(C1=CC(B2OC(C)(C)C(C)(C)O2)=CS1)O | 2-Carboxythiophene-4-boronic acid, pinacol ester | AG0003P5 | 2g |
| 1010814-94-4 | O=C(N1CC(CC(OC(C)(C)C)=O)C(CC1)=O)OC(C)(C)C | tert-Butyl 3-(2-(tert-butoxy)-2-oxoethyl)-4-oxopiperidine-1-carboxylate | AG0003P6 | 5g |
| 101084-81-5 | OB(C1=CC([N+]([O-])=O)=CC(C(O)=O)=C1)O | 3-Carboxy-5-nitrophenylboronic acid | AG0003P8 | 160g |
| 101084-76-8 | BrC1=CSC=C1B(O)O | 4-Bromothiophene-3-boronic acid | AG0003PB | 50g |
| 101084-60-0 | O=C1OC2=CC=C([N+]([O-])=O)C=C2N1C | 3-Methyl-5-nitrobenzo[d]oxazol-2(3H)-one | AG0003PC | 0.5g |
| 101084-52-0 | O=C1CC(C2=CC=NC=C2)=NO1 | 2-Isoxazolin-5-one, 3-(4-pyridyl) | AG0003PD | 0.3g |
| 101084-39-3 | O=C(O)C1=CC=CC(Br)=C1OC | 3-Bromo-2-methoxybenzoic acid | AG0003PF | 225g |
| 101084-20-2 | OC1=C(N)C=NC=C1Br | 3-Amino-5-bromopyridin-4-ol | AG0003PG | 9g |
| 101083-92-5 | O=[N+](C1=CN=C(NC=C2)C2=C1)[O-] | 5-nitro-1H-pyrrolo[2,3-b]pyridine | AG0003PJ | 25g |
| 1010840-17-1 | CC1(C)C(C)(C)OB(C#CB2OC(C)(C)C(C)(C)O2)O1 | 1,2-Bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyne | AG0003PU | 5g |
| 101093-56-5 | O=CC1=CC=C(OCC2=CC=CC=C2)C=C1C | 2-METHYL 4-BENZYLOXYBENZALDEHYDE | AG0003PY | 75g |
| 101085-03-4 | O=C(OC)C1=CC=C(O)C=C1Br | Methyl 2-bromo-4-hydroxybenzoate | AG0003QB | 125g |
| 101084-96-2 | COC1=C(C=CC(=C1)[N+]([O-])=O)C#N | 2-METHOXY-4-NITROBENZONITRILE | AG0003QC | 100g |
| 101084-95-1 | N1C2C=C(C=CC=2SC=1N)C(O)=O | 2-Amino-5-benzothiazolecarboxylic acid | AG0003QD | 5g |
| 101084-82-6 | CSC1=C(Cl)C=C(Br)C=C1 | 1-Bromo-3-chloro-4-(methylthio)benzene | AG0003QG | 25g |
| 10109-95-2 | C1(=CC=CC=C1)NC1=C(C(=O)O)C=C(C(=C1)C(=O)O)NC1=CC=CC=C1 | 2,5-Dianilinoterephthalic acid | AG0003QH | 2g |
| 1009376-86-6 | O=C([C@H]1CN[C@H](C)CC1)OC.[H]Cl | trans-Methyl 6-methylpiperidine-3-carboxylate hydrochloride | AG00039C | 35g |
| 100943-46-2 | O=CC1=CC=C(CCCCCC)S1 | 5-Hexylthiophene-2-carboxaldehyde | AG00039E | 50g |
| 100940-12-3 | COC1=CC(C(O)=O)=C(OC)C(Br)=C1 | 3-Bromo-2,5-dimethoxybenzoic acid | AG00039I | 5.4g |
| 100939-91-1 | O=C(C1=CC=CC(C)=C1)N2CCNCC2 | 1-(3-Methyl-benzoyl)-piperazine | AG00039K | 10g |
| 10094-45-8 | C(CCCCCCCCCCCCCCCCC)NC(CCCCCCCCCCC\C=C/CCCCCCCC)=O | (Z)-N-Octadecyldocos-13-enamide | AG00039O | 200g |
| 10094-40-3 | CCCC=CCOC(=O)C | 2-Hexen-1-ol, 1-acetate | AG00039P | 2g |
| 10094-36-7 | O=C(OCC)CCC1CCCCC1 | Ethyl 3-cyclohexylpropanoate | AG00039Q | 8g |
| 10094-34-5 | CCCC(OC(C)(C)CC1=CC=CC=C1)=O | Dimethylbenzylcarbinyl butyrate | AG00039R | 200g |
| 10095-14-4 | C(C=C)(=O)OCCCCCCO | 6-Hydroxyhexyl acrylate | AG0003AG | 50g |
| 10095-06-4 | O=C1N(C2N(C)C(N(C2N1C)C)=O)C | 1,3,4,6-Tetramethyltetrahydroimidazo[4,5-d]imidazole-2,5(1H,3H)-dione | AG0003AH | 125g |
| 1009582-56-2 | C[C@H](N(CC1=N[C@H]([C@@H](N1S(=O)(=O)C1=CC=C(C)C=C1)C1=CC=CC=C1) | 2,4-Dibromo-6-[[[[(4S,5S)-4,5-dihydro-4,5-diphenyl-1-tosyl-1H-imidazol-2-yl] | AG0003AI | 1g |
| 100959-22-6 | O=C(OC)C1=CC=C([N+]([O-])=O)C=C1Br | Methyl 2-Bromo-4-nitrobenzoate | AG0003AM | 1000g |
| 100959-19-1 | NC1CCC(C)CC1.[H]Cl | 4-Methylcyclohexylamine hydrochloride | AG0003AN | 75g |
| 100958-94-9 | O=C(O)C1=CC(Br)=CC(Br)=C1C | 3,5-Dibromo-2-methylbenzoic acid | AG0003AP | 2g |
| 100957-85-5 | O=C(C1=CC(C(C)(C)C)=NN1CC2=CC=CC=C2)O | 1-Benzyl-3-(tert-butyl)-1H-pyrazole-5-carboxylic acid | AG0003AR | 9g |
| 10075-48-6 | CC1=CNC2=C1C=C(Br)C=C2 | 5-Bromo-3-methyl-1H-indole | AG0002SI | 300g |
| 1007538-66-0 | CC1C(CN)=CNN=1 | (3-methyl-1H-pyrazol-4-yl)methanamine | AG0002SP | 5g |
| 100751-63-1 | OCC1=CC2=C(C=C1)C=C(Br)C=C2 | (6-Bromonaphthalen-2-yl)methanol | AG0002T8 | 500g |
| 1007596-63-5 | N[C@H]1CCN(C[C@@H]1O)C(=O)OCc1ccccc1 | (3S,4S)-Benzyl 4-amino-3-hydroxypiperidine-1-carboxylate | AG0002TD | 39g |
| 1007579-67-0 | O=Cc1ccc(cc1C(F)(F)F)I | 4-Iodo-2-(trifluoromethyl)benzaldehyde | AG0002TE | 5g |
| 1007578-86-0 | O=C(N)C1=CC=C(O)C(Cl)=C1 | 3-Chloro-4-hydroxybenzamide | AG0002TF | 30g |
| 1007578-82-6 | Cc1cc(Br)cc(c1)C(=O)N | 3-bromo-5-methylbenzamide | AG0002TG | 2g |
| 1007573-18-3 | FC=1C=C(C=C(F)C1CNC2CC=3C=CC=CC3C2)C4=CC=CC(=C4)C5=NN=CN5 | N-(2,3-Dihydro-1H-inden-2-yl)-3,5-difluoro-3′-(1H-1,2,4-triazol-5-yl)[1,1′-biph | AG0002TH | 0.01g |
| 1007542-22-4 | OCC1=CN(C(C)C)N=C1 | (1-Isopropyl-1H-pyrazol-4-yl)methanol | AG0002TI | 4g |
| 1007542-01-9 | C1(C(O)=O)C(C)=NN(C(C)C)C=1C | 1-Isopropyl-3,5-dimethyl-1H-pyrazole-4-carboxylic acid | AG0002TJ | 1g |
| 1010-95-3 | CC1=CC2=C(NC=C2CCN)C=C1.[H]Cl | 2-(5-Methyl-1H-indol-3-yl)ethanamine hydrochloride | AG0003HG | 45g |
| 1010-93-1 | CC1N(CC(O)=O)C([N+]([O-])=O)=CN=1 | 2-(2-Methyl-5-nitro-1H-imidazol-1-yl)acetic acid | AG0003HH | 2g |
| 1010097-71-8 | FC1=C(OCC)C(B(O)O)=CC=C1 | 2-Ethoxy-3-fluorophenylboronic acid | AG0003HM | 4g |
| 1010086-31-3 | CC(C)(C)OC(=O)C1CCC(CC1)O[Si](C1=CC=CC=C1)(C1=CC=CC=C1)C(C)(C)C | TERT-BUTYL 4-((TERT-BUTYLDIPHENYLSILYL)OXY)CYCLOHEXANECARBOXYLATE | AG0003HR | 10g |
| 1010073-87-6 | O=CC1=NNC2=NC=CC=C12 | 1H-pyrazolo[3,4-b]pyridine-3-carbaldehyde | AG0003HS | 5g |
| 1010068-85-5 | B(O)(O)c1c2oc3c(c2ccc1)cccc3c1ccccc1 | 6-Phenyldibenzofuran-4-boronic acid | AG0003HU | 50g |
| 101003-65-0 | Oc1cc(nc(c1)c1ccccn1)c1ccccn1 | [2,2′:6′,2”-Terpyridin]-4′-ol | AG0003I7 | 40g |
| 1010101-07-1 | CC1=CC(B(OC2(C)C)OC2(C)C)=CN=C1Cl | 2-Chloro-3-methylpyridine-5-boronic acid pinacol ester | AG0003IA | 200g |
| 101010-74-6 | N#CCC1=NC=CS1 | Thiazol-2-yl-acetonitrile | AG0003ID | 9g |
| 10101-68-5 | O.O.O.O.S(=O)(=O)([O-])[O-].[Mn+2] | Manganese(II) Sulfate Tetrahydrate | AG0003IO | 250g |
| 10101-41-4 | O=S([O-])([O-])=O.[H]O[H].[H]O[H].[Ca+2] | Calcium Sulfate Dihydrate | AG0003IW | 2000g |
| 1010133-97-7 | [H]Cl.N1(C2=CC=CN=C2)CCNCC1 | 1-(Pyridin-3-yl)piperazine hydrochloride | AG0003IY | 10g |
| 1010129-08-4 | O=C(O)CC[C@@H](N)C1=CC=CC=C1.[H]Cl | (R)-4-Amino-4-phenylbutanoic acid hydrochloride | AG0003IZ | 4g |
| 1011465-22-7 | Oc1c(c2CCCCc2cc1c1cc2ccccc2c2c1cccc2)c1c2CCCCc2cc(c1O)c1cc2ccccc2c2c1cccc2 | [1,1′-Binaphthalene]-2,2′-diol, 5,5′,6,6′,7,7′,8,8′-octahydro-3,3′-di-9-phenanthr | AG0003U5 | 4g |
| 1011465-21-6 | OC1=C(C2=C3C=CC=CC3=CC4=CC=CC=C24)C=C5CCCCC5=[C@@]1[C@@]6=C7CCC | (1R)-3,3′-Di-9-anthracenyl-5,5′,6,6′,7,7′,8,8′-octahydro-[1,1′-binaphthalene]-2, | AG0003U6 | 15g |
| 1011460-68-6 | C=C(B1OC(C)CC(C)(C)O1)C(F)(F)F | 1-(Trifluoromethyl)vinylboronic acid hexylene glycol ester | AG0003U9 | 200g |
| 101140-06-1 | O=C1C=C(C2=CC=C(O)C=C2)OC3=C1C(O)=CC(O)=C3C4=C(C5=CC=C(O)C=C5)OC6= | 3,8′-Biapigenin | AG0003UJ | 0.005g |
| 10114-58-6 | Nc1ccc(c(c1)N)N=Nc1cccc(c1)N=Nc1ccc(cc1N)N.Cl.Cl | Bismarck Brown Y | AG0003UM | 350g |
| 1011558-18-1 | CC(Oc1ncc(cc1C)C(=O)O)C | 6-Isopropoxy-5-methylnicotinic acid | AG0003UN | 40g |
| 1011557-82-6 | O=C(NC(NC1=CC=C(NC(CCCCN(C)C)=O)C=C1)=S)C2=CC=C(C(C)(C)C)C=C2 | Tenovin-6 | AG0003UO | 0.05g |
| 1011533-24-6 | FC(F)(F)c1ccc2ccc(=O)[nH]c2c1 | 7-(Trifluoromethyl)quinolin-2-ol | AG0003UP | 3g |
| 101155-02-6 | CNC1=C2N=CN(CC3=CC=CC=C3F)C2=NC=N1 | BW-A 78U | AG0003V1 | 0.25g |
| 101152-94-7 | NC[C@H]1C[C@]1(C(N(CC)CC)=O)C2=CC=CC=C2.Cl | Milnacipran HCl | AG0003VA | 100g |
| 1011711-52-6 | ClC1=CC=NC2=C1C(C(C)=O)=CN2 | 3-Acetyl-4-chloro-7-azaindole | AG0003VD | 30g |
| 101167-13-9 | NC1CC2=C(C=CC([N+]([O-])=O)=C2)CC1 | 7-Nitro-1,2,3,4-tetrahydronaphthalen-2-amine | AG0003VI | 3g |
| 101166-73-8 | CC1=C(CC#N)C=CC=N1 | 2-(2-Methylpyridin-3-yl)acetonitrile | AG0003VN | 1.25g |
| 101166-65-8 | C[Si](OCCI)(C(C)(C)C)C | tert-Butyl(2-iodoethoxy)dimethylsilane | AG0003VO | 3500g |
| 10117-10-9 | FCCC(=O)OCC | Ethyl 3-fluoropropanoate | AG0003VW | 2g |
| 1010798-64-7 | O=C(C1CCOCC1)CC#N | 3-Oxo-3-(tetrahydro-2H-pyran-4-yl)propanenitrile | AG0003NQ | 10g |
| 101079-63-4 | NC1=C(N)C=C(Cl)N=C1Cl | 2,6-Dichloropyridine-3,4-diamine | AG0003NX | 1000g |
| 101079-62-3 | ClC1=CC(N(C=N1)C)=O | 6-Chloro-3-methylpyrimidin-4(3H)-one | AG0003NY | 30g |
| 101079-29-2 | [P+5]([F-])([F-])([F-])([F-])([F-])[F-].C(CCCCCCCCCCCCC)CC[N+](C)(C)C | N-hexadecyltrimethylammoniumhexafluorophosphate | AG0003O0 | 125g |
| 101078-75-5 | COc1ccc2nc(sc2c1)-c1ccc(CBr)cc1 | 2-(4-(Bromomethyl)phenyl)-6-methoxybenzo[d]thiazole | AG0003O1 | 9.5g |
| 101078-51-7 | CC1=CC=C(C2=NC3=CC=C(OC)C=C3S2)C=C1 | 6-Methoxy-2-p-tolylbenzo[d]thiazole | AG0003O2 | 0.75g |
| 1010800-27-7 | OC(=O)C(O)=O.CCC1=CNN=C1N | 4-Ethyl-1h-pyrazol-3-amine oxalate | AG0003OG | 3g |
| 101080-58-4 | C1(C(N)=O)C(C)=CC=CC=1Cl | 2-Chloro-6-methylbenzamide | AG0003OK | 75g |
| 101080-22-2 | OC1CCC(C1)C(O)=O | 3-Hydroxycyclopentanecarboxylic Acid | AG0003OP | 10g |
| 101080-17-5 | CN1N=C(C)C(C(N)=O)=C1N | 5-Amino-1,3-dimethyl-1H-pyrazole-4-carboxamide | AG0003OQ | 10g |
| 101080-15-3 | NC1=NC=C(C(C)C)S1 | 2-Amino-5-isopropylthiazole | AG0003OR | 10g |
| 101080-03-9 | COC1=C([N+]([O-])=O)C=C(Cl)C(C)=C1 | 1-Chloro-4-Methoxy-2-Methyl-5-Nitrobenzene | AG0003OT | 10g |
| 10108-91-5 | [Cl-].CCCCCCCCCCCCCC[N+](C)(C)CCCCCCCCCCCCCC | Dimethyldimyristylammonium Chloride | AG0003OU | 3g |
| 10108-87-9 | CCCCCCCCCC[N+](C)(C)C.[Cl-] | Decyltrimethylammonium Chloride | AG0003OV | 1000g |
| 10108-86-8 | CCCCCCCC[N+](C)(C)C.[Cl-] | N-Octyltrimethylammonium chloride | AG0003OW | 2500g |
| 10108-61-9 | CCC(N1C(=O)c2c(C1=O)cccc2)C | 1H-Isoindole-1,3(2H)-dione, 2-(1-methylpropyl)- | AG0003P0 | 10g |
| 1011-27-4 | O=CC1=CC(OC)=C(C)C(OC)=C1 | 3,5-Dimethoxy-4-methylbenzaldehyde | AG0003QX | 6g |
| 1011-24-1 | COC1=NC2=CC=CC=C2C(=N1)O | 2-Methoxyquinazolin-4-ol | AG0003QZ | 10g |
| 1011-17-2 | OC1=C(N2CCNCC2)C=CC=C1 | 1-(2-Hydroxyphenyl)Piperazine | AG0003R1 | 175g |
| 1011-16-1 | FC1=CC=CC=C1N2CCNCC2.[H]Cl | 1-(2-Fluorophenyl)piperazine Hydrochloride | AG0003R2 | 600g |
| 1011-15-0 | FC1=C(N2CCNCC2)C=CC=C1 | 1-(2-Fluorophenyl)piperazine | AG0003R3 | 1500g |
| 1011-13-8 | BrC1=C(N2CCNCC2)C=CC=C1 | 1-(2-BROMOPHENYL)PIPERAZINE | AG0003R4 | 25g |
| 10111-08-7 | O=CC1=NC=CN1 | 2-Formylimidazole | AG0003RA | 1000g |
| 1011-92-3 | O=C(O)/C(C#N)=C/C1=CC=CC=C1 | alpha-Cyanocinnamic Acid | AG0003RC | 200g |
| 1011-85-4 | COC(=O)[C@@H]1CC[C@@H](CC1)C(O)=O | cis-4-(Methoxycarbonyl)cyclohexanecarboxylic acid | AG0003RD | 200g |
| 1011-84-3 | ON=C(C1=CC=C([N+]([O-])=O)C=C1)Cl | Alpha-chloro-4-nitrobenzaldoxime | AG0003RE | 50g |
| 1011-74-1 | Cl.COC1=C(O)C=CC(C(CN)O)=C1 | DL-Normetanephrine hydrochloride | AG0003RF | 1.75g |
| 1011-65-0 | COC(=O)C1=CC2=C(NC=C2)C=C1 | Methyl indole-5-carboxylate | AG0003RH | 200g |
| 1011-60-5 | O=C(O)CCC(N)C1=CC=CC=C1 | 4-Amino-4-phenylbutanoic acid | AG0003RJ | 1.25g |
| 1011-51-4 | COc(cc1)ccc1-c1cnco1 | 5-(4-Methoxyphenyl)oxazole | AG0003RL | 5g |
| 1011-50-3 | OCCC1=NC2=C(C=CC=C2)C=C1 | 2-(2-Hydroxyethyl)Quinoline | AG0003RM | 10g |
| 1011-47-8 | CC(=O)C1=NC2=C(C=CC=C2)C=C1 | 1-(Quinolin-2-Yl)Ethanone | AG0003RP | 20g |
| 1011-46-7 | O=C2(NN=C(C1(=CC=CC=C1))CC2) | 6-Phenyl-4,5-dihydropyridazin-3(2h)-one | AG0003RQ | 35g |
| 1008506-24-8 | O(C)c1c(B(O)O)ccnc1 | 3-METHOXYPYRIDINE-4-BORONIC ACID | AG00030E | 50g |
| 100852-80-0 | CCOC(C1=NN(C)C(C(OCC)=O)=C1)=O | Diethyl 1-Methyl-1H-Pyrazole-3,5-Dicarboxylate | AG00030I | 100g |
| 100849-37-4 | N[13C]1=[13CH][13CH]=[13CH][13CH]=[13CH]1 | Aniline-13C6 | AG00030P | 0.5g |
| 100848-70-2 | CC1=CC(OC)=NC=C1 | 2-Methoxy-4-methylpyridine | AG00030Q | 200g |
| 1008562-87-5 | CC(C)(C)OC(N1C[C@H](CCC1)C=O)=O | (S)-tert-Butyl 3-formylpiperidine-1-carboxylate | AG00030W | 101.25g |
| 100859-84-5 | NC(=O)C1=CC(Cl)=NC=C1 | 4-Pyridinecarboxamide, 2-chloro- | AG00030Y | 50g |
| 100859-32-3 | NC(C1=C(Cl)C=NC=C1)=O | 3-Chloroisonicotinamide | AG000316 | 20.9g |
| 100858-34-2 | O=C(N1C[C@H](O)CCC1)OCC2=CC=CC=C2 | benzyl (3R)-3-hydroxypiperidine-1-carboxylate | AG000319 | 100g |
| 100858-33-1 | O=C(N1C[C@H](O)CC1)OCC2=CC=CC=C2 | Benzyl (R)-3-hydroxypyrrolidine-1-carboxylate | AG00031A | 250g |
| 100858-32-0 | O[C@@H]1CN(C(OCC2=CC=CC=C2)=O)CC1 | (S)-(+)-1-Cbz-3-Pyrrolidinol | AG00031B | 200g |
| 100858-27-3 | C=C(CC[C@H](O[Si](C)(C(C)(C)C)C)C/1)C1=C/CP(C2=CC=CC=C2)(C3=CC=CC=C3)= | (S,Z)-(2-(5-((Tert-butyldimethylsilyl)oxy)-2-methylenecyclohexylidene)ethyl | AG00031C | 10g |
| 100868-46-0 | Cc1c(Cl)cncc1Cl | 3,5-Dichloro-4-Picoline | AG00031O | 200g |
| 1008737-00-5 | O=C(O)CC1=CC(C(F)(F)F)=NC=C1 | 2-(2-(Trifluoromethyl)pyridin-4-yl)acetic acid | AG00032A | 5g |
| 100872-42-2 | C(C1=CC=CC=C1)S(=O)(=O)C1=NC2=C(N1)C=CC=C2 | 2-(Benzylsulfonyl)-1H-benzo[d]imidazole | AG00032K | 5g |
| 100868-78-8 | O=S(C1=NC=CC=C1)(N(C)C)=O | N,N-Dimethylpyridine-2-sulfonamide | AG00032U | 0.5g |
| 10087-65-7 | N2(=C(C=1(NC=CC=1))CCC2) | 2-(3,4-Dihydro-2H-pyrrol-5-yl)-1H-pyrrole | AG00032W | 10g |
| 10087-64-6 | C1(C2=CC=CN2)=CC=CN1 | 1H，1’H-2，2′-Bipyrrole | AG00032X | 6g |
| 1008796-22-2 | CC1=C(CCO)C(=O)N2C=CC=C(OCC3=CC=CC=C3)C2=N1 | 9-(Benzyloxy)-3-(2-hydroxyethyl)-2-methyl-4H-pyrido[1,2-a]pyrimidin-4-one | AG00032Z | 3g |
| 1008779-94-9 | COC(C1(CNCCC1)O)=O | METHYL 3-HYDROXYPIPERIDINE-3-CARBOXYLATE | AG000331 | 0.75g |
| 1008773-79-2 | O=C([C@H]1C[C@@H](NC(OC(C)(C)C)=O)C1)O | cis-3-(tert-Butoxycarbonylamino)cyclobutanecarboxylic acid | AG000335 | 500g |
| 1008773-73-6 | CC(OC(N[C@@H]1C[C@@H](C(O)=O)CCC1)=O)(C)C | (1S,3S)-3-([(tert-Butoxy)carbonyl]amino)cyclohexane-1-carboxylic acid | AG000336 | 10g |
| 100898-63-3 | CC(NC(C=CN1[C@@H]2O[C@H](COC(C3=CC=C(OC)C=C3)(C4=CC=C(OC)C=C4)C5 | 5′-O-(4,4′-Dimethoxytrityl)-n4-acetyl-2′-deoxycytidine | AG00033R | 350g |
| 1012341-52-4 | C[C@H](C(O)=O)C[C@H](NC(OC(C)(C)C)=O)CC1=CC=C(C2=CC=CC=C2)C=C1 | (2S,4S)-5-([1,1′-Biphenyl]-4-yl)-4-((tert-butoxycarbonyl)amino)-2-methylpen | AG000408 | 3g |
| 1012341-50-2 | O=C(O)[C@H](C)C[C@H](NC(OC(C)(C)C)=O)CC1=CC=C(C2=CC=CC=C2)C=C1 | (2R,4S)-5-(Biphenyl-4-yl)-4-[(tert-butoxycarbonyl)amino]-2-methylpentanoic | AG000409 | 167g |
| 101236-50-4 | CC(=CCc1c2O[C@H](c3ccc(cc3O)O)[C@H](C(=O)c2c(c(c1O)CC=C(C)C)O)O)C | Kushenol L | AG00040H | 0.005g |
| 10123-62-3 | N#CCCP(OCC)(OCC)=O | Diethyl (2-cyanoethyl)phosphonate | AG00040S | 16g |
| 10124-78-4 | [C-]#[N+]C1=CC=C2C=CC=CC2=C1 | 2-NAPHTHYL ISOCYANIDE | AG000414 | 35g |
| 10124-65-9 | [K].O=C(O)CCCCCCCCCCC | Potassium Laurate | AG000416 | 9500g |
| 10124-62-6 | CO[Si]([Si](OC)(C)C)(C)C | 1,2-Dimethoxy-1,1,2,2-Tetramethyldisilane | AG000417 | 375g |
| 10124-56-8 | O=P1(OP([O-])(OP([O-])(OP([O-])(OP([O-])(OP([O-])(O1)=O)=O)=O)=O)=O)[O-] | Sodium Hexametaphosphate | AG000418 | 10000g |
| 10124-53-5 | S(=S)(=O)([O-])[O-].[Mg+2] | Magnesium thiosulfate | AG000419 | 75g |
| 10124-27-3 | [Cl-].[Cl-].[Cl-].O.[AlH3+3] | Aluminum chloride(AlCl3), hydrate (9CI) | AG00041G | 50g |
| 7785-87-7 | O=S([O-])([O-])=O.[Mn+2] | Manganese(II) sulfate | AG00041H | 10000g |
| 101251-09-6 | OB(C1=CC=C(NC(C)=O)C=C1)O | 4-Acetylaminophenylboronic Acid | AG00041I | 127g |
| 101250-48-0 | O=C1N[C@@H](CC2=CC=CC=C2)COC1 | (S)-5-Benzylmorpholin-3-one | AG00041N | 2g |
| 101246-66-6 | N1(C)C2=C(C=C(OC(=O)NC3=CC=CC=C3)C=C2)[C@]2(C)CCN(C)[C@]12[H] | Phenserine | AG00041U | 0.01g |
| 10125-07-2 | O=C([C@H](CC1=CC=CC=C1)N2)NCC2=O | Cyclo(-Gly-Phe) | AG000426 | 2g |
| 101253-50-3 | NC1=C(Cl)C=C2N=C(C)SC2=C1 | 5-Chloro-2-methylbenzo[d]thiazol-6-amine | AG00042B | 3g |
| 1011-41-2 | C1(N2CCOCC2)SC(=CN=1)C=O | 2-Morpholino-1,3-thiazole-5-carbaldehyde | AG0003RS | 0.5g |
| 1011-40-1 | C1=C(SC(=N1)C2=CC=CC=C2)C=O | 2-Phenylthiazole-5-carbaldehyde | AG0003RT | 50g |
| 101110-21-8 | C(C1=C2C=CC=C3C2=C(C=C1)CC3)(C(OCC)=O)=O | Ethyl 5-acenaphthoylformate | AG0003SA | 3.8g |
| 10112-15-9 | O=[N+](C1=CC=CC=C1NCC)[O-] | N-Ethyl-2-nitroaniline | AG0003SE | 10g |
| 101125-34-2 | CC(C)n1c(C=O)c(c2ccc(F)cc2)c3ccccc13 | 3-(4-Fluorophenyl)-1-isopropyl-1H-indole-2-carbaldehyde | AG0003T1 | 25g |
| 101125-32-0 | FC1=CC=C(C=C1)C1=CNC2=C1C=CC=C2 | 3-(4-FLUORO-PHENYL)-1H-INDOLE | AG0003T2 | 10g |
| 10113-40-3 | O=CNC1=CC(=CC=C1C)C | N-(2,5-Dimethylphenyl)formamide | AG0003T3 | 500g |
| 10113-38-9 | C1(NC=O)C=CC=CC=1Br | N-(2-Bromophenyl)formamide | AG0003T4 | 40g |
| 1011309-61-7 | C=CCCC[C@](C)(N)C(O)=O | (S)-2-Amino-2-methyl-hept-6-enoic acid | AG0003T9 | 10g |
| 1011301-27-1 | S=C(NC1=CC=C(C=C1)N)NC(C2=CC=C(C=C2)C(C)(C)C)=O | Tenovin-3 | AG0003TD | 0.5g |
| 1011487-94-7 | OCC1=CC=C(Cl)N=N1 | (6-Chloropyridazin-3-yl)methanol | AG0003TY | 80g |
| 1011479-76-7 | CCOC(C1(C(O)=O)CN(C(OC(C)(C)C)=O)C1)=O | Azetidine-1,3,3-tricarboxylic acid 1-tert-butyl ester 3-ethyl ester | AG0003U0 | 10g |
| 1011479-75-6 | C(=O)(OCC)C1(C(=O)OCC)CN(C1)C(=O)OC(C)(C)C | 1-tert-Butyl 3,3-diethyl azetidine-1,3,3-tricarboxylate | AG0003U1 | 25g |
| 1011479-72-3 | CCOC(C1(CN(C(OC(C)(C)C)=O)C1)N)=O | 1-tert-Butyl 3-ethyl 3-aminoazetidine-1,3-dicarboxylate | AG0003U2 | 30g |
| 1011465-29-4 | OP1(OC2=C(C3=C4C=CC=CC4=CC5=CC=CC=C35)C=C6CCCCC6=C2C7=C8CCCCC8=C | (R)-3,3′-Bis(9-anthracenyl)-5,5′,6,6′,7,7′,8,8′-octahydro-1,1′-bi-2-naphthyl Hydr | AG0003U4 | 0.75g |
| 10129-56-3 | OC(C(Cl)(Cl)Cl)CC1=CC=NC=C1 | 1,1,1-Trichloro-3-(pyridin-4-yl)propan-2-ol | AG00045X | 0.2g |
| 1013-25-8 | CC1=CC(N2CCNCC2)=C(C)C=C1 | 1-(2,5-Dimethylphenyl)Piperazine | AG000461 | 200g |
| 1013-23-6 | O=S1C2=CC=CC=C2C3=CC=CC=C31 | Dibenzothiophene-5-oxide | AG000463 | 140.1g |
| 1013-22-5 | CC1=C(C)C(N2CCNCC2)=CC=C1 | 1-(2,3-Dimethylphenyl)piperazine | AG000464 | 5g |
| 1013-04-3 | OC(=O)C1=CC=C(Cl)C2=C1C=CC=C2 | 4-Chloro-1-naphthoic acid | AG000468 | 10g |
| 10130-89-9 | S(=O)(=O)(Cl)c1ccc(cc1)C(=O)O | 4-(Chlorosulfonyl)benzoic acid | AG00046G | 475g |
| 10130-87-7 | O=S(C1=CC=CC=C1OC)(Cl)=O | 2-Methoxybenzenesulfonyl chloride | AG00046H | 75g |
| 10130-74-2 | COC1=CC=CC(=C1)S(Cl)(=O)=O | 3-Methoxybenzene-1-sulfonyl chloride | AG00046I | 115g |
| 1013-96-3 | O=C(O)/C=C/C1=CC=CC=C1[N+]([O-])=O | 2-Nitrocinnamic acid | AG00046K | 400g |
| 1013-92-9 | S=C(N1CCCCC1)N2CCCCC2 | Di(piperidin-1-yl)methanethione | AG00046M | 5g |
| 1013-88-3 | C1(=CC=CC=C1)C(=N)C1=CC=CC=C1 | diphenylmethanimine | AG00046O | 10000g |
| 1013-83-8 | O=C(O)C1=CC=C2C(Br)=CC=CC2=C1 | 5-Bromo-2-naphthoic acid | AG00046Q | 100g |
| 1013-80-5 | O=C(C1=CC(Br)=C2C=CC=CC2=C1)O | 4-Bromo-2-naphthoic acid | AG00046S | 3g |
| 1013-76-9 | CC1=CC(C)=C(N2CCNCC2)C=C1 | 1-(2,4-Dimethylphenyl)Piperazine | AG00046T | 200g |
| 1013112-48-5 | N#CC1=CC(OC)=C(OC)C=C1C=O | 2-Formyl-4,5-dimethoxybenzonitrile | AG00046Y | 10g |
| 1013031-65-6 | OCC1=C(Br)C=CC=C1Br | (2,6-Dibromophenyl)methanol | AG000471 | 200g |
| 101417-40-7 | C(Br)c1c2c(OCO2)ccc1 | 4-Bromomethyl-1,3-benzodioxole | AG0004F6 | 2g |
| 101410-18-8 | O=C(N1[C@H](C(N)=S)CCC1)OC(C)(C)C | N-BOC-(S)-Pyrrolidine-2-thiocarboxamide | AG0004FF | 80g |
| 10141-51-2 | Cl.C(CC(C)C)OC1=CC=C(N)C=C1 | 4-(Isopentyloxy)aniline hydrochloride | AG0004FM | 0.3g |
| 101426-31-7 | CCCCCCCCCC(OCCC1=C(C)N=CS1)=O | 2-(4-Methyl-5-Thiazolyl)Ethyl Decanoate | AG0004GH | 1200g |
| 101421-82-3 | OC(=O)CCCSC(=O)C | 4-(Acetylsulfanyl)butanoic acid | AG0004GK | 25g |
| 101421-74-3 | Nc1c2c(ccc1)cncn2 | Quinazolin-8-amine | AG0004GN | 25g |
| 101421-72-1 | NC1=CC2=C(N=CN=C2)C=C1 | 6-Aminoquinazoline | AG0004GP | 1.5g |
| 101421-62-9 | CC1C=CC([N+]([O-])=O)=C(Br)C=1C | 2-Bromo-3,4-dimethyl-1-nitrobenzene | AG0004GT | 3g |
| 101421-31-2 | O=Cc1ccc(cc1I)[N+](=O)[O-] | 2-Iodo-4-nitrobenzaldehyde | AG0004GU | 41g |
| 101420-98-8 | O=[N+](C1=CC2=C(NN=C2)C=C1Cl)[O-] | 6-chloro-5-nitro-1H-indazole | AG0004GX | 200g |
| 101420-81-9 | O=C(O)C1=CC=C([N+]([O-])=O)C(Br)=C1 | 3-Bromo-4-nitrobenzoic acid | AG0004H1 | 50g |
| 101420-79-5 | [O-][N+](=O)C1=C(I)C=CC(=C1)C#N | 4-Iodo-3-nitrobenzonitrile | AG0004H2 | 50g |
| 101420-67-1 | O=[N+](C1=C(C)C2=C(NN=C2)C=C1)[O-] | 4-Methyl-5-nitro-1H-indazole | AG0004H3 | 3g |
| 101420-62-6 | O=C(C1=C(C(O)=O)C(Cl)=CN=C1)O | 5-Chloropyridine-3,4-dicarboxylic acid | AG0004H4 | 1.25g |
| 101439-76-3 | S=C1S/C(=C/c2ccccc2)/C(=O)N1c1ccc(cc1)C(=O)O | Benzoic acid, 4-[4-oxo-5-(phenylmethylene)-2-thioxo-3-thiazolidinyl]- | AG0004H7 | 0.6g |
| 1013405-79-2 | C(C1=CC=CC=C1)OC=1C=C(C=CC1)C1=CC(=CC=C1)CC(=O)O | 2-(3′-(Benzyloxy)-[1,1′-biphenyl]-3-yl)acetic acid | AG00049P | 2g |
| 1013405-25-8 | C1=CC=CC=2C3=CC=CC=C3N(C12)C=1C=C(C=CC1)C=1C=NC=C(C1)C1=CC(=CC=C1) | 3,5-Bis(3-(9H-carbazol-9-yl)phenyl)pyridine | AG00049Q | 3g |
| 101349-71-7 | CC1=C(Cl)C=CC(C=O)=C1 | 4-Chloro-3-methylbenzaldehyde | AG00049V | 50g |
| 101349-12-6 | FC1=CC2=C(NC=C2CCO)C=C1 | 2-(5-Fluoro-1H-indol-3-yl)ethanol | AG00049Z | 20g |
| 101342-76-1 | CCCCC(OC(=O)CCCC(=O)OCCCCCCCCCCOC(=O)CCCC(=O)OC(CCCC)CCCC)CCCC | O,O’-Decane-1,10-diyl di(nonan-5-yl) diglutarate | AG0004A4 | 5g |
| 10135-00-9 | O=CC1=C(Br)C2=CC=CC=C2S1 | 3-Bromobenzo[b]thiophene-2-carbaldehyde | AG0004AA | 25g |
| 10134-98-2 | O=C(C1=C2C(C=CS2)=CC=C1)O | Benzo[b]thiophene-7-carboxylic acid | AG0004AB | 8g |
| 10134-95-9 | OC(=O)C1=CC=CC2=C1C=CS2 | Benzo[b]Thiophene-4-Carboxylic Acid | AG0004AC | 25g |
| 1013648-04-8 | O=C(OC)C1=C(Cl)N=C(Cl)C=C1C | Methyl 2,6-dichloro-4-methylnicotinate | AG0004AD | 200g |
| 101364-80-1 | O=C(C(=C)C)Oc1c(I)cc(cc1I)I | 2-Propenoic acid, 2-methyl-, 2,4,6-triiodophenyl ester | AG0004AL | 5g |
| 101351-09-1 | O=C1N(CCOC2=CC=C(N)C=C2)C(C3=C1C=CC=C3)=O | 2-[2-(4-Aminophenoxy)ethyl]-2,3-dihydro-1h-isoindole-1,3-dione | AG0004AT | 2g |
| 10135-38-3 | CC1(C)CC(C)(C)[N+]([O-])=C1 | 3,3,5,5-Tetramethyl-1-pyrroline N-Oxide | AG0004B0 | 1g |
| 101366-61-4 | OCc1ccc(OCCC(O)=O)cc1 | 3-(4-Hydroxymethylphenoxy)propionic acid | AG0004BE | 50g |
| 101366-51-2 | CC1=CC=C(C2=CC=C(S(Cl)(=O)=O)C=C2)C=C1 | 4′-Methyl-[1,1′-biphenyl]-4-sulfonyl chloride | AG0004BF | 9g |
| 10126-37-1 | COC1=CC(CN(C)C)=C(Br)C=C1 | 1-(2-Bromo-5-methoxyphenyl)-N,N-dimethylmethanamine | AG00043G | 10g |
| 1012785-51-1 | ClC1=NC2=C(C(I)=CN2)C(Cl)=N1 | 2,4-dichloro-5-iodo-7H-pyrrolo[2,3-d]pyrimidine | AG000446 | 25g |
| 1012785-48-6 | O=C(N1CCN(CC1)Cc1ccccc1B1OC(C(O1)(C)C)(C)C)OC(C)(C)C | 2-(4-Boc-piperazin-1yl)methylphenylboronic acid, pinacol | AG000447 | 25g |
| 1012785-44-2 | CCN(CC)CC1=CC=C(B2OC(C)(C)C(C)(C)O2)C=C1 | 4-(N,N-Diethylaminomethyl)phenylboronic acid, pinacol ester | AG000448 | 5g |
| 101277-90-1 | Oc1ccccc1c1cccc2c1cccc2 | 2-(Naphthalen-1-yl)phenol | AG00044E | 4g |
| 10128-91-3 | C(=O)(OC)c1c(=O)[nH]ccc1 | Methyl 2-oxo-1,2-dihydro-3-pyridinecarboxylate | AG00044M | 500g |
| 10128-73-1 | O=C(N)C1=CC=NC=C1O | 3-Hydroxy-4-pyridinecarboxamide | AG00044N | 2g |
| 10128-72-0 | O=C(OC)C1=CC=NC=C1O | Methyl 3-Hydroxyisonicotinate | AG00044O | 40g |
| 10128-71-9 | O=C(C1=C(O)C=NC=C1)O | 3-Hydroxyisonicotinic acid | AG00044P | 25g |
| 10128-55-9 | O=c1oc(nc2c1cccc2)c1ccccc1NS(=O)(=O)c1ccc2c(c1)cccc2 | N-[2-(4-Oxo-4H-3,1-benzoxazin-2-yl)phenyl]-2-naphthalenesulfonamide | AG00044S | 10g |
| 10128-51-5 | O=S(C1=CC=CC=C1)(NC2=CC=CC=C2C(O3)=NC4=CC=CC=C4C3=O)=O | N-(2-(4-Oxo-4H-benzo[d][1,3]oxazin-2-yl)phenyl)benzenesulfonamide | AG00044T | 5g |
| 1012884-46-6 | ClC4(=CC1(=C(OC=3(C=CC=CC=3(C2(=C1C(=O)N(C)C2))))C=C4)) | 11-Chloro-2,3-dihydro-2-methyl-1H-dibenz[2,3:6,7]oxepino[4,5-c]pyrrol-1-on | AG00044W | 125g |
| 1012880-01-1 | BrC1=CN(C2CCCC2)N=C1 | 4-Bromo-1-cyclopentylpyrazole | AG00044X | 2g |
| 1012868-70-0 | O=CC1=CC=C(F)C([B-](F)(F)F)=C1.[K+] | Potassium 2-fluoro-5-formylphenyltrifluoroborate | AG00044Z | 175g |
| 10129-07-4 | CCOC(=O)c1ccc(cc1)Sc1ccccc1 | Benzoic acid, 4-(phenylthio)-, ethyl ester | AG00045H | 45g |
| 10129-77-8 | O=C(O)CC1=CC(F)=C(Cl)C=C1Cl | 2,4-Dichloro-5-fluorophenylacetic acid | AG00045U | 15g |
| 10137-67-4 | C(=O)(CCC#N)OCC | Propanoic acid, 3-cyano-, ethyl ester | AG0004BP | 10g |
| 1013753-99-5 | COC1=C(CNC([C@@H](NC(C2CCN(S(C3=CC=CC=C3)(=O)=O)CC2)=O)C)=O)C=CC= | (2S)-2-{[1-(benzenesulfonyl)piperidin-4-yl]formamido}-N-[(2-methoxypheny | AG0004BQ | 0.02g |
| 101376-26-5 | OC[C@H]1N(CC2=CC=CC=C2)CCOC1 | (R)-4-BENZYL-3-HYDROXYMETHYLMORPHOLINE | AG0004BX | 20g |
| 101376-25-4 | OC[C@@H]1N(CC2=CC=CC=C2)CCOC1 | 3(S)-Hydroxymethyl-4-benzylmorpholine | AG0004BY | 30g |
| 10138-59-7 | O=C(OCC)C1CCCCC1C(=O)OCC | 1,2-Cyclohexanedicarboxylic acid diethyl ester | AG0004C5 | 5000g |
| 10138-32-6 | O=C(C1C(C2)C=CC2C1)OCC | Ethyl bicyclo[2.2.1]hept-5-ene-2-carboxylate | AG0004CA | 1000g |
| 10138-10-0 | CCOC(CCC=O)=O | Ethyl 4-oxobutanoate | AG0004CD | 2g |
| 1013835-89-6 | COC1=CC=CC(=C1)N1C=C(C=O)C=N1 | 1-(3-Methoxyphenyl)-1H-pyrazole-4-carbaldehyde | AG0004CG | 3g |
| 101385-93-7 | O=C(N1CC(CC1)=O)OC(C)(C)C | N-Boc-3-pyrrolidinone | AG0004CM | 2000g |
| 101385-90-4 | O[C@@H]1CN(CC2=CC=CC=C2)CC1 | (S)-1-Benzyl-3-hydroxypyrrolidine | AG0004CN | 200g |
| 101385-69-7 | C[N+]1=C(Cl)N(C)CC1.F[P-](F)(F)(F)(F)F | 2-Chloro-1,3-dimethylimidazolidinium hexafluorophosphate | AG0004CO | 1500g |
| 101382-55-2 | O=CC1=CC2=CC=C(OC)C=C2N=C1O | 2-Hydroxy-7-methoxyquinoline-3-carbaldehyde | AG0004CW | 3g |
| 101382-53-0 | CC1=CC2=C(NC(=O)C(C=O)=C2)C=C1 | 2-Hydroxy-6-methylquinoline-3-carbaldehyde | AG0004CY | 40g |
| 10138-99-5 | CN(C[C@@H](C(O)=O)N)C | (S)-2-Amino-3-(dimethylamino)propanoic acid | AG0004CZ | 2g |
| 10138-89-3 | C(OC)(OC)CC(OC)C | 1,1,3-Trimethoxybutane | AG0004D2 | 100g |
| 10145-04-7 | NCC(C1=CC(F)=C(F)C=C1)O | 2-amino-1-(3,4-difluorophenyl)ethan-1-ol | AG0004IJ | 5g |
| 1014613-64-9 | CC2=CC1=C(Br)C=CN=C1N2 | 4-Bromo-2-methyl-1H-pyrrolo[2，3-b]pyridine | AG0004IN | 10g |
| 1014613-05-8 | Cc1cc2c(Br)ccnc2n1S(=O)(=O)c1ccccc1 | 4-Bromo-2-methyl-1-(phenylsulfonyl)-1h-pyrrolo[2,3-b]pyridine | AG0004IP | 1g |
| 101460-22-4 | COC1=C(OC)C(C(O)=O)=C(OC)C(Br)=C1 | 3-Bromo-2,5,6-trimethoxybenzoic acid | AG0004IV | 10g |
| 1014691-61-2 | O=C(C1=C(S(=O)(NC2=CC=C(NC3=CC=CC=C3)C=C2OC)=O)C=CS1)OC | GSK0660 | AG0004JA | 2g |
| 1014645-87-4 | Cl.COC(=O)C1=CC=C(C=C1)C1(N)CC1 | Benzoic acid, 4-(1-aminocyclopropyl)-, methyl ester, HCl (1:1) | AG0004JC | 15g |
| 1014632-18-8 | O=C(C1=CN(C2=NC=CC=N2)N=C1)O | 1-(Pyrimidin-2-yl)-1H-pyrazole-4-carboxylic acid | AG0004JF | 2g |
| 1014632-12-2 | CCOC(=O)C1=CN(N=C1)C1=NC=CN=C1 | Ethyl 1-(pyrazin-2-yl)-1H-pyrazole-4-carboxylate | AG0004JG | 20g |
| 1014631-92-5 | O=C(C1=CN(C2=CC=NC=C2)N=C1)OCC | Ethyl 1-(pyridin-4-yl)-1H-pyrazole-4-carboxylate | AG0004JH | 25g |
| 1014631-89-0 | O=C(C1=CN(C2=CC=CN=C2)N=C1)O | 1-(pyridin-3-yl)-1H-pyrazole-4-carboxylic acid | AG0004JI | 7g |
| 1014631-58-3 | O=C(C1=NN(C2=NC=CC=C2)C=C1)O | 1-(Pyridin-2-yl)-1H-pyrazole-3-carboxylic acid | AG0004JJ | 2g |
| 101469-91-4 | O=C([C@@H](O)C1)N(CC2=CC=CC=C2)C1=O | (S)-1-Benzyl-3-hydroxypyrrolidine-2,5-dione | AG0004JL | 25g |
| 101466-85-7 | FC(C1=CC=C(C=C1)C=CC(=O)OCC)(F)F | Ethyl 3-(4-(trifluoromethyl)phenyl)acrylate | AG0004JQ | 30g |
| 1014720-73-0 | NC1=NC(C2=NC=CC=C2)=NC(Cl)=C1 | 6-Chloro-2-(pyridin-2-yl)pyrimidin-4-amine | AG0004JW | 11g |
| 1014717-10-2 | CC12CO[B-](OC2)(C3=NC=CC=C3)OC1.[Li+] | Lithium 4-methyl-1-(pyridin-2-yl)-2,6,7-trioxa-1-borabicyclo[2.2.2]octan-1-ui | AG0004JX | 25g |
| 101306-11-0 | C1(C2=CSC=C2C3=CC=CS3)=CC=CS1 | 2,3′:4′,2”-Terthiophene | AG00047D | 25g |
| 101314-84-5 | OC1CC(=O)N(C(=O)CCBr)C1=O | 3-Bromopropionic Acid N-Hydroxysuccinimide | AG00047X | 15g |
| 10132-07-7 | NC1=NC(Cl)=NC(Cl)=C1 | 4-Amino-2,6-dichloropyrimidine | AG000486 | 4500g |
| 10132-01-1 | ClC1=NN=C(C2=CC=CC=C2)C3=CC=CC=C13 | 1-Chloro-4-phenylphthalazine | AG000489 | 75g |
| 101328-85-2 | O=C1C[C@@H](C)C(C2=CC=C(N)C=C2)=NN1 | (R)-6-(4-Aminophenyl)-4,5-dihydro-5-methyl-3(2H)-pyridazinone | AG00048G | 2g |
| 101327-87-1 | O=CC1=CC=C2C=CC=NC2=C1[N+]([O-])=O | 8-Nitro-7-quinolinecarboxaldehyde | AG00048L | 10g |
| 101327-84-8 | O=CC1=CC=C2C=CC=CC2=C1[N+]([O-])=O | 1-NITRO-2-NAPHTHALDEHYDE | AG00048N | 25g |
| 10133-30-9 | O=CC1=CC=C2C(C=CS2)=C1 | 1-Benzothiophene-5-carbaldehyde | AG00048T | 10g |
| 10133-25-2 | C(=O)c1c2c(scc2)ccc1 | Benzo[b]thiophene-4-carboxaldehyde | AG00048U | 5g |
| 10133-24-1 | BrCC1=C2C(C=CS2)=CC=C1 | 7-(Bromomethyl)benzo[b]thiophene | AG00048V | 1g |
| 10133-22-9 | BrCC1=CC=C2C(C=CS2)=C1 | 5-(Bromomethyl)benzo[b]thiophene | AG00048W | 0.75g |
| 1013333-23-7 | O[C@H]1CNCC[C@@H]1CN.[H]Cl.[H]Cl | trans-4-(Aminomethyl)piperidin-3-ol dihydrochloride | AG000492 | 0.5g |
| 1013333-20-4 | N#C[C@@H]1[C@@H](O)CN(CC2=CC=CC=C2)CC1 | (3R,4R)-Rel-1-Benzyl-3-hydroxypiperidine-4-carbonitrile | AG000493 | 25g |
| 101335-11-9 | IC1=CC=C(F)C=C1Cl | 2-Chloro-4-fluoroiodobenzene | AG00049E | 475g |
| 101330-69-2 | C(C1C=C(C=C(C=1)OC)O)CC1C=CC=C(C=1)OC | 3′-O-Methylbatatasin III | AG00049H | 0.005g |
| 10134-91-5 | O=CC1=C2C(C=CS2)=CC=C1 | Benzo[b]thiophene-7-carbaldehyde | AG00049J | 4g |
| 1011722-07-8 | N#CC1=CC=C(B(O)O)C=N1 | 2-Cyanopyridine-5-boronic acid | AG0003W3 | 150g |
| 101184-73-0 | CC(C)(C1=CC=C(Br)C=C1)C#N | 2-(4-BROMOPHENYL)-2-METHYLPROPANENITRILE | AG0003WA | 50g |
| 101184-51-4 | C(#N)C1=CC(=C(NC1=O)C)C(=O)O | 5-Cyano-2-methyl-6-oxo-1,6-dihydropyridine-3-carboxylic acid | AG0003WB | 2g |
| 101184-08-1 | O=C(OC)C1=CC=C(N2C=CN=C2)C=C1 | Methyl 4-(1h-imidazol-1-yl)benzenecarboxylate | AG0003WE | 150g |
| 101192-30-7 | CCOC(=O)C1=CC=C2C=Cc3ccccc3N2C1=O | Ethyl Benzo[6,7]-4-oxo-4H-quinolizine-3-carboxlate | AG0003WV | 4g |
| 101187-40-0 | O=C(OC(C)(C)C)NCCOCCOCCOCCN | 5,8,11-Trioxa-2-azatridecanoic acid, 13-amino-, 1,1-dimethylethyl ester | AG0003X1 | 200g |
| 101187-39-7 | [N-]=[N+]=NCCOCCOCCOCCN=[N+]=[N-] | Ethane, 1,1′-oxybis[2-(2-azidoethoxy)- | AG0003X2 | 10g |
| 101199-38-6 | O=S(CCCN1C2=C(C=CC=C2)SC3=CC=CC=C13)([O-])=O.[Na+] | SODIUM PHENOTHIAZINE-10-YL-PROPYLSULFONATE | AG0003XE | 35g |
| 1012-72-2 | CC(C)(C)C1=CC=C(C=C1)C(C)(C)C | 1,4-Di-tert-butylbenzene | AG0003XQ | 120g |
| 1012-12-0 | O=CC1=CC=C(O[Si](C)(C)C)C=C1 | 4-(Trimethylsiloxy)benzaldehyde | AG0003XY | 400g |
| 1012-05-1 | O=C(O)C(N)CCC1=CC=CC=C1 | DL-Homophenylalanine | AG0003XZ | 400g |
| 1012059-49-2 | S=C(N1CC2=CC=C(OC)C=C2)NC3=C1C=CN=C3Cl | 4-CHLORO-1-(4-METHOXYBENZYL)-1H-IMIDAZO[4,5-C]PYRIDINE-2(3H)-THIONE | AG0003Y2 | 7g |
| 1012058-77-3 | NC1=CC=C(OC2=CC(C(O)=O)=NC=C2)C=C1 | 4-(4-Aminophenoxy)picolinic acid | AG0003Y3 | 0.5g |
| 10147-41-8 | CCCCCCCCCCCCCCCCCCS(=O)(=O)Cl | 1-Octadecanesulfonyl Chloride | AG0004KD | 2g |
| 10147-40-7 | CCCCCCCCCCCCS(Cl)(=O)=O | dodecane-1-sulfonyl chloride | AG0004KE | 250g |
| 10147-37-2 | CC(S(=O)(Cl)=O)C | Isopropylsulfonyl chloride | AG0004KF | 125g |
| 10147-36-1 | CCCS(=O)(Cl)=O | 1-Propanesulfonyl chloride | AG0004KG | 2625g |
| 10147-11-2 | C#CCC1=CC=CC=C1 | 3-Phenyl-1-propyne | AG0004KH | 125g |
| 101477-54-7 | COC1=CC=C(CN2CCN(C(C3=CC=C(F)C=C3)C4=CC=C(F)C=C4)CC2)C(OC)=C1OC.Cl.C | Lomerizine hydrochloride | AG0004KV | 8g |
| 10148-81-9 | [C@@H](C(=O)O)(CCC(=O)N)NC(=O)CC[C@H](N)C(=O)O | H-GAMMA-GLU-GLN-OH | AG0004L3 | 5g |
| 10148-71-7 | CC(C)[C@@H](O)[C@H](N)C(O)=O | (2S,3R)-2-Amino-3-hydroxy-4-methylpentanoic acid | AG0004L5 | 2g |
| 10148-70-6 | CC(C)[C@H](O)[C@H](N)C(=O)O | (2S,3S)-2-Amino-3-hydroxy-4-methyl-valeric acid | AG0004L6 | 0.5g |
| 101490-85-1 | OC[C@H]1O[C@@H](Oc2ccc3c(c2)oc2-c(n3)ccc(=O)c2)[C@@H]([C@H]([C@@H] | Resorufin beta-d-glucopyranoside | AG0004LH | 0.4g |
| 101488-73-7 | OC1=CC2=CC3=CC=C(O)C=C3C=C2C=C1 | 2,6-Anthracenediol | AG0004LM | 7g |
| 101488-65-7 | C1(=CC=C(C=C1)CCCN)F | 3-(4-Fluorophenyl)propan-1-amine | AG0004LN | 3g |
| 101488-60-2 | NCCCC1=CC=C(C(F)(F)F)C=C1 | 3-(4-(Trifluoromethyl)phenyl)propan-1-amine | AG0004LO | 5g |
| 1014974-98-1 | COc1cc(O[C@@H]2O[C@H](CO[C@@H]3OC[C@]([C@H]3O)(O)COC(=O)c3cc(O | β-D-Glucopyranoside, 3,4,5-trimethoxyphenyl 6-O-[5-O-(4-hydroxy-3,5-dime | AG0004LY | 0.005g |
| 101495-18-5 | Clc1c2c(cc(c1)Cl)[nH]cc2 | 4,6-DICHLORO-1H-INDOLE | AG0004M5 | 10g |
| 101494-95-5 | OC1=C2C=CC=C(Cl)C2=NC=N1 | 8-Chloroquinazolin-4(3h)-one | AG0004M7 | 10g |
| 1010446-31-7 | O=C(N1C[C@@H](N2CCNCC2)CC1)OC(C)(C)C | (S)-tert-Butyl 3-(piperazin-1-yl)pyrrolidine-1-carboxylate | AG0003LO | 0.15g |
| 1010422-92-0 | CCOC(=O)C1=NC(=CC=C1)C(F)(F)F | Ethyl 6-(trifluoromethyl)picolinate | AG0003LP | 20g |
| 1010422-53-3 | CC1=NC(=CC=C1Br)C(F)(F)F | 3-Bromo-2-methyl-6-(trifluoromethyl)pyridine | AG0003LR | 50g |
| 1010422-52-2 | CC1=C(C(F)(F)F)N=CC(Br)=C1 | 5-Bromo-3-methyl-2-(trifluoromethyl)pyridine | AG0003LS | 4.2g |
| 1010422-51-1 | CC1=CC(=NC=C1Br)C(F)(F)F | 5-BROMO-4-METHYL-2-(TRIFLUOROMETHYL)PYRIDINE | AG0003LT | 1.2g |
| 101048-77-5 | N#CC1=C(C=C(C=C1)C=O)Cl | 2-Chloro-4-formylbenzonitrile | AG0003MS | 1.25g |
| 101048-76-4 | N#CC1=CC=C(C=O)C=C1F | 2-Fluoro-4-formylbenzonitrile | AG0003MT | 500g |
| 101046-79-1 | Oc1ccc(cc1)[C@H]1Oc2c(C[C@H]1O)c(O)cc1c2[C@@]2(C(=O)O1)[C@H](Oc1c2c( | Larixinol | AG0003MW | 0.005g |
| 101046-34-8 | COC(=O)C1=CCN(CC2=CC=CC=C2)C1 | 1-Benzyl-2,5-dihydro-1h-pyrrole-3-carboxylic acid methyl ester | AG0003MY | 10g |
| 101072-54-2 | CCC(NC(=O)CCl)C(O)=O | N-Chloroacetyl-dl-2-amino-n-butyric acid | AG0003N1 | 25g |
| 101066-87-9 | N#CC1=CC=C(I)C=C1C(F)(F)F | 4-Iodo-2-(trifluoromethyl)benzonitrile | AG0003NI | 150g |
| 101066-61-9 | C1=NC(=CC(=C1)C=O)Cl | 2-Chloroisonicotinaldehyde | AG0003NK | 30g |
| 101066-58-4 | FC(F)(F)C1=CC(C=O)=CC=C1C#N | 4-Formyl-2-(trifluoromethyl)benzonitrile | AG0003NL | 5g |
| 101066-57-3 | O=CC1=CC=C([N+]([O-])=O)C(C(F)(F)F)=C1 | 4-Nitro-3-(trifluoromethyl)benzaldehyde | AG0003NM | 75g |
| 101252-84-0 | CC1=C(Cl)C=C(Cl)N=C1C | 4,6-DICHLORO-2,3-DIMETHYLPYRIDINE | AG00042E | 10g |
| 101252-73-7 | NCC1=C([N+]([O-])=O)C=CC=C1Cl | (2-Chloro-6-nitrophenyl)methanamine | AG00042F | 2g |
| 101252-66-8 | COC1=CC(CO)=C(Cl)C=C1 | (2-Chloro-5-methoxyphenyl)methanol | AG00042G | 1g |
| 101252-40-8 | Cl.Cl.CNCCC1=CC=NC=C1 | Methyl-(2-pyridin-4-yl-ethyl)-amine DiHCl | AG00042I | 4g |
| 101252-14-6 | NC(NC(NC1=CC=C(Cl)C=C1Cl)=N)=N | 1-(2,4-Dichlorophenyl)biguanide, HCl | AG00042K | 5g |
| 101251-72-3 | N#CC1=C(C)N=C(Cl)C=C1C | 6-Chloro-2,4-dimethylnicotinonitrile | AG00042T | 10g |
| 101258-57-5 | CCCCC(CBr)C | 1-Bromo-2-methylhexane | AG000433 | 2g |
| 101258-16-6 | C1=C(N=C(S1)N)C(=O)C | 1-(2-Aminothiazol-4-yl)ethanone | AG000436 | 75g |
| 101257-89-0 | NC1=C(C)C2=C(NN=C2)C=C1 | 4-Methyl-1H-indazol-5-amine | AG000439 | 3g |
| 101257-87-8 | OC1=CN=CN=C1C | 4-Methylpyrimidin-5-ol | AG00043A | 5g |
| 101257-82-3 | NC1=NC=NC=C1Cl | 4-AMINO-5-CHLOROPYRIMIDINE | AG00043B | 6g |
| 101257-38-9 | O=C(C1=CSC=N1)NN | Thiazole-4-carbohydrazide | AG00043D | 0.5g |
| 101257-37-8 | O=C(C1=CN=CS1)NN | Thiazole-5-carboxylic acid hydrazide | AG00043E | 0.2g |
| 1016241-64-7 | OC(C1NC2=C(C=NC=N2)C=1)=O | 7H-Pyrrolo[2,3-d]pyrimidine-2-carboxylic acid | AG0004ZW | 1g |
| 1016234-89-1 | NC1=C(O)C=C(F)C(Br)=C1 | 2-Amino-4-bromo-5-fluorophenol | AG0004ZX | 50g |
| 1016234-87-9 | OC1=CC(F)=C(Br)C=C1[N+]([O-])=O | 4-Bromo-5-fluoro-2-nitrophenol | AG0004ZY | 200g |
| 1016233-26-3 | CC(C)(C)OC(=O)N1[C@@H](CO)C[C@H]1CO | cis-tert-Butyl 2,4-bis(hydroxymethyl)azetidine-1-carboxylate | AG0004ZZ | 10g |
| 1016233-08-1 | O=C(N1CC(CO)(CO)C1)OC(C)(C)C | tert-Butyl 3,3-bis(hydroxymethyl)azetidine-1-carboxylate | AG000500 | 20g |
| 1016232-92-0 | OCC1(CO)CNC1.[H]Cl | Azetidine-3,3-Diyldimethanol Hydrochloride | AG000501 | 5g |
| 1016231-40-5 | FC1=C(B(O)O)C(F)=C(F)C(Br)=C1F | 4-Bromo-2,3,5,6-tetrafluorophenylboronic acid | AG000502 | 5g |
| 1016231-39-2 | FC1=C(C=CC=C1I)B(O)O | 2-Fluoro-3-iodophenylboronic acid | AG000503 | 250g |
| 1016228-01-5 | CC(C1=NC(Br)=CC=C1F)=O | 1-(6-bromo-3-fluoropyridin-2-yl)ethan-1-one | AG000505 | 30g |
| 101623-69-2 | O=C(OC(Cl)C)OC1=CC=C([N+]([O-])=O)C=C1 | Carbonic acid 4-nitro-phenyl ester 1-chloro-ethyl ester | AG00050A | 650.75g |
| 101623-68-1 | O=C(OC1=CC=C([N+]([O-])=O)C=C1)OC(OC(C)=O)C | 1-(((4-Nitrophenoxy)carbonyl)oxy)ethyl acetate | AG00050B | 90g |
| 1016259-54-3 | CCOC(=O)C1CCN(CC1NC(C)C1=CC=CC=C1)C(=O)OC(C)(C)C | Ethyl 1-Boc-3-(1-phenylethylamino)piperidine-4-carboxylate | AG00050F | 20g |
| 101646-02-0 | [O-][N+](=O)C1=C(F)C(Cl)=CC(=C1)C(F)(F)F | 3-Chloro-4-fluoro-5-nitrobenzotrifluoride | AG00050H | 7g |
| 101630-94-8 | CC(C)(C)C(NC1=NC(NC(C(C)(C)C)=O)=CC=C1)=O | N-[6-(2,2-Dimethyl-Propionylamino)-Pyridin-2-Yl]-2,2-Dimethyl-Propionami | AG00050Q | 2g |
| 101626-70-4 | NC(S1)=NC2=C1CCN(CC=C)CC2 | Talipexole | AG00050T | 0.2g |
| 10163-15-2 | O=P([O-])(F)[O-].[Na+].[Na+] | Sodium monofluorophosphate | AG000512 | 2000g |
| 101650-17-3 | COC(=O)[C@H](CCBr)N | Methyl (s)-2-amino-4-bromobutyrate hbr | AG00051E | 0.5g |
| 101650-14-0 | [C@@H](NC(=O)OC(C)(C)C)(C(=O)OC)CCI | Methyl (S)-2-(Boc-amino)-4-iodobutanoate | AG00051F | 25g |
| 10165-86-3 | C(=O)(OC)c1ccc(nc1)C=O | Methyl 6-formylnicotinate | AG00051M | 200g |
| 1013916-37-4 | CC1=CC(=O)N(C2CCCC2)C2=NC(Cl)=NC=C12 | 2-Chloro-8-cyclopentyl-5-methylpyrido[2,3-d]pyrimidin-7(8H)-one | AG0004D8 | 2500g |
| 10139-84-1 | CC(C1=CC=C(O)C(C)=C1O)=O | 1-(2,4-Dihydroxy-3-methylphenyl)ethanone | AG0004DJ | 300g |
| 10139-47-6 | I[Zn]I | Zinc Iodide | AG0004DM | 650g |
| 10139-04-5 | OC[C@H]1O[C@H](Oc2ccccc2)[C@@H]([C@H]([C@@H]1O)O)NC(=O)C | Phenyl 2-acetamido-2-deoxy-alpha-D-glucopyranoside | AG0004DQ | 2g |
| 10139-02-3 | O(C1C=CC([N+]([O-])=O)=CC=1)[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H | 4-Nitrophenyl N-acetyl-α-D-glucosaminide | AG0004DR | 0.2g |
| 101396-91-2 | C([N+](C)(C)C)[C@@H](CCl)O.[Cl-] | (S)-(-)-(3-Chloro-2-hydroxypropyl)trimethylammonium chloride | AG0004E6 | 75g |
| 101395-71-5 | NCCN1N=CC=C1 | 2-Pyrazol-1-yl-ethylamine | AG0004EB | 50g |
| 10140-70-2 | O=C(CCCCC[C@H](C)O1)C(C(O)=CC(O)=C2)=C2CC1=O | Curvularin | AG0004ER | 0.005g |
| 1014-99-9 | S=C=NCc1ccc(cc1)CN=C=S | P-Xylylene dithiocyanate | AG0004ET | 15g |
| 1014-93-3 | BrCCCCCOCC1=CC=CC=C1 | Benzyl 5-Bromoamyl Ether | AG0004EV | 200g |
| 1014-81-9 | C1=C(C=C(C=C1)OC(F)(F)F)C(=O)O | 3-(Trifluoromethoxy)benzoic acid | AG0004EW | 2500g |
| 1014-60-4 | CC(C1=CC(C(C)(C)C)=CC=C1)(C)C | 1,3-Di-tert-butylbenzene | AG0004EZ | 800g |
| 1014-25-1 | NC1=NN=C(C2=CC=C(OC)C=C2)S1 | 2-Amino-5-(4-Methoxyphenyl)-1,3,4-Thiadiazole | AG0004F0 | 42g |
| 1014-23-9 | O=[N+](C1=CC=C(C2=CN=CO2)C=C1)[O-] | 5-(4-NITROPHENYL)-1,3-OXAZOLE | AG0004F1 | 200g |
| 1016-47-3 | C(CNC(=O)C)c1c2c([nH]c1)cccc2 | N-(2-(1H-Indol-3-yl)ethyl)acetamide | AG0004Y6 | 10g |
| 1016-36-0 | CCOC(=O)C1=NNC2=CC=C(F)C=C12 | Ethyl 5-fluoro-1H-indazole-3-carboxylate | AG0004Y8 | 5g |
| 1016-19-9 | COC1=C(OC)C(OC)=CC(N=C=O)=C1 | 3,4,5-Trimethoxyphenyl isocyanate | AG0004YA | 35g |
| 1016-05-3 | O=S1(C2=CC=CC=C2C3=CC=CC=C31)=O | Dibenzothiophene Sulfone | AG0004YC | 200g |
| 101602-31-7 | Cc1cc(C)c2c(c1)c(Cl)cc(n2)c1ccccc1 | 4-Chloro-6,8-dimethyl-2-phenylquinoline | AG0004YQ | 3g |
| 101601-80-3 | NC1=CC=CN=C1C2=CC=CC=C2 | 3-Amino-2-Phenylpyridine | AG0004YR | 50g |
| 101601-00-7 | O=C(C1=CNC2=C1C=C(OCC3=CC=CC=C3)C=C2)C(O)=O | 5-Benzyloxyindole 3-Glyoxylic Acid | AG0004YU | 0.25g |
| 10161-87-2 | BrCC(=O)NCCCCC1=CC=C(C(=O)O)C=C1 | 4-(4-(2-Bromoacetamido)butyl)benzoic acid | AG0004YX | 1.02g |
| 1016167-99-9 | O=C(OC(C)(C)C)NC[C@@H]1CNCCC1 | (S)-tert-Butyl (piperidin-3-ylmethyl)carbamate | AG0004Z2 | 100g |
| 1016163-89-5 | COC(=O)C1=C(C=O)C=CC(Br)=C1 | Methyl 5-bromo-2-formylbenzoate | AG0004Z4 | 200g |
| 101622-53-1 | CN1C2C(=C(NCC3C=CC=CC=3)N=C(Cl)N=2)N=C1 | CDK2-IN-13 | AG0004Z6 | 20g |
| 101622-51-9 | OCCNc1nc(NCc2ccccc2)c2ncn(C)c2n1 | Olomoucine | AG0004Z8 | 3g |
| 101617-91-8 | N#CC1=CC2=CC(OC)=CC=C2N=C1Cl | 2-Chloro-6-methoxyquinoline-3-carbonitrile | AG0004ZD | 5g |
| 1016258-69-7 | O=C(N1CCC(C(OCC)=O)(CN)CC1)OC(C)(C)C | 1-tert-butyl 4-ethyl 4-(aminomethyl)piperidine-1,4-dicarboxylate | AG0004ZP | 50g |
| 1016258-66-4 | CCOC(C1(C#N)CCN(C(OC(C)(C)C)=O)CC1)=O | 1-tert-Butyl 4-ethyl 4-cyanopiperidine-1,4-dicarboxylate | AG0004ZQ | 155g |
| 1016258-17-5 | O=C(OC)CC1(N)CCCCC1.[H]Cl | (1-Amino-cyclohexyl)-acetic acid methyl ester, HCl | AG0004ZR | 10g |
| 1016241-81-8 | O=C(O)c1cc2c(F)ncnc2[nH]1 | 4-Fluoro-7H-pyrrolo[2,3-d]pyrimidine-6-carboxylic acid | AG0004ZU | 0.5g |
| 1016241-80-7 | ClC1=NC=NC2=C1C=C([NH]2)C(=O)O | 4-Chloro-7H-pyrrolo[2,3-d]pyrimidine-6-carboxylic acid | AG0004ZV | 50g |
| 10154-75-3 | O=S(=O)(CCC#N)C1=CC=CC=C1 | 3-(Phenylsulfonyl)propanenitrile | AG0004R7 | 100g |
| 10154-71-9 | S(=O)(=O)(CCC(=O)O)c1ccccc1 | 3-(phenylsulfonyl)propanoic acid | AG0004R9 | 1505.5g |
| 1015484-22-6 | CN1CCN(C[B-](F)(F)F)CC1.[K+] | Potassium 1-methyl-4-trifluoroboratomethylpiperazine | AG0004RF | 200g |
| 1015480-87-1 | OB(C1=CC(OC)=NN=C1OC)O | 3,6-Dimethoxylpyridazine-4-boronic acid | AG0004RH | 10g |
| 101558-72-9 | [Br]C2(=C(OCCN1(CCOCC1))C=CC=C2) | 4-[2-(2-Bromophenoxy)ethyl]morpholine | AG0004RI | 39.2g |
| 101555-63-9 | O=C(O)[C@@H]1N(C(OCC2C3=CC=CC=C3C4=CC=CC=C24)=O)CCCC1 | Fmoc-D-Pipecolic Acid | AG0004RK | 160g |
| 101555-62-8 | [H][C@@]1(CCCN1C(=O)OCC1C2=CC=CC=C2C2=CC=CC=C12)C(O)=O | Fmoc-D-Pro-OH | AG0004RL | 2000g |
| 101555-61-7 | O=C(O)C[C@H](NC(OC(C)(C)C)=O)CC1=CC=CC=C1 | Boc-D-beta-Homophenylalanine | AG0004RM | 300g |
| 101555-60-6 | C(=O)(OC(C)(C)C)N1[C@@H](CC(=O)O)CCC1 | (R)-2-(1-(tert-Butoxycarbonyl)pyrrolidin-2-yl)acetic acid | AG0004RN | 500g |
| 1015609-75-2 | IC1=CN=C2C(NC=C2)=C1 | 6-Iodo-1H-pyrrolo[3,2-b]pyridine | AG0004S5 | 10g |
| 1015609-51-4 | OCC1=CN=C2C(NC=C2)=C1 | (1H-Pyrrolo[3,2-b]pyridin-6-yl)methanol | AG0004S8 | 2g |
| 1015609-35-4 | OC1=CC2=C(C=CN2)N=C1 | 1H-Pyrrolo[3,2-b]pyridin-6-ol | AG0004S9 | 1.25g |
| 1015609-11-6 | O=C(C1=CN=C2C(NC=C2)=C1)OC | METHYL 1H-PYRROLO[3,2-B]PYRIDINE-6-CARBOXYLATE | AG0004SA | 50g |
| 1015608-87-3 | ClC1=CC2=C(N(S(=O)(C3=CC=CC=C3)=O)C=C2)N=C1 | 1-Benzenesulfonyl-5-chloro-1H-pyrrolo[2,3-b]pyridine | AG0004SC | 25g |
| 1015608-79-3 | FC1C=C2C(=NC=1)N(C=C2)S(=O)(=O)C3=CC=CC=C3 | 1-Benzenesulfonyl-5-fluoro-1h-pyrrolo[2,3-b]pyridine | AG0004SD | 5g |
| 1015610-55-5 | OC(=O)C1=C(Cl)C=NC2=C1C=CN2 | 5-Chloro-1H-pyrrolo[2,3-b]pyridine-4-carboxylic acid | AG0004ST | 10g |
| 1015610-39-5 | ClC1=CN=C2NC=CC2=C1C=O | 5-Chloro-1h-pyrrolo[2,3-b]pyridine-4-carbaldehyde | AG0004SV | 10g |
| 101512-21-4 | O=C(N)C1=CN=CC(O)=C1 | 5-Hydroxynicotinamide | AG0004OC | 2g |
| 10151-46-9 | NNS(C1=CC2=C(C=CC=C2)C=C1)(=O)=O | Naphthalene-2-sulfonohydrazide | AG0004OM | 2g |
| 10151-02-7 | CC(C)(C)CC(C)(C)NC=O | N-(1,1,3,3-Tetramethylbutyl)formamide | AG0004ON | 50g |
| 101513-77-3 | O=C(O)C1=CC(F)=C(F)C(Cl)=C1F | 3-Chloro-2,4,5-trifluorobenzoic acid | AG0004P5 | 300g |
| 1015242-08-6 | CC1(C)C(C)(C)OB(C2=CN=C(N3CCCCC3)N=C2)O1 | 2-Piperidinopyrimidine-5-boronic acid pinacol ester | AG0004PD | 5g |
| 1015242-07-5 | CC1(C)OB(OC1(C)C)C1=CN=C(N=C1)N1CCCC1 | 2-Pyrrolidinopyrimidine-5-boronic acid pinacol ester | AG0004PE | 10g |
| 1015242-03-1 | O1(C(C(C)(C)OB1C4(=CN=C(N3(CCN(CC2(=CC=CC=C2))CC3))C=C4))(C)C) | 1-Benzyl-4-(5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-yl)piper | AG0004PG | 10g |
| 1015229-31-8 | COCCOc1cncc(c1)B(O)O | 5-(2-Methoxyethoxy)pyridine-3-boronic acid | AG0004PJ | 3g |
| 10152-76-8 | C(C=C)SC | Allyl Methyl Sulfide | AG0004PT | 150g |
| 101537-64-8 | O=C(C1=C(NC(OC(C)(C)C)=O)C=CS1)O | Boc-3-aminothiophene-2-carboxylic acid | AG0004Q3 | 75g |
| 101530-10-3 | N#C/C(=C1/SCC(C2=C(Cl)C=CC=C2)S/1)/N1C=NC=C1 | Lanoconazole | AG0004QG | 0.025g |
| 1015460-59-9 | BrC1=CC2=C(C=C1)C(C=NC=C3)=C3N2 | 7-Bromo-5H-pyrido[4,3-b]indole | AG0004QR | 50g |
| 1015433-96-1 | C(=O)(OC)c1c(N(=O)=O)cc(c(c1)F)F | Methyl 4，5-Difluoro-2-nitrobenzoate | AG0004QT | 1500g |
| 1015423-45-6 | O=C(C1=C(Br)SC(Br)=C12)OC2=O | Dibromothieno[3,4-c]furan-1,3-dione | AG0004QU | 35g |
| 101498-88-8 | O=C(OCC)CC(C1=CC=C(C(C)(C)C)C=C1)=O | Ethyl 3-(4-(tert-butyl)phenyl)-3-oxopropanoate | AG0004MP | 10g |
| 1015-89-0 | O=C1NC2=CC=CC=C2C3=C1C=CC=C3 | 6(5H)-Phenanthridinone | AG0004MR | 100g |
| 1015-55-0 | COC1=C2CCCC(=O)C2=C(OC)C=C1 | 5,8-Dimethoxy-3,4-dihydronaphthalen-1(2H)-one | AG0004MW | 2g |
| 1015-38-9 | SP(C1=CC=CC=C1)(C2=CC=CC=C2)=S | Diphenylphosphinodithioic Acid | AG0004N1 | 1.5g |
| 1015070-57-1 | C#CC1=CC2=C(C=C1)C=NC=C2 | 6-Ethynylisoquinoline | AG0004NB | 20g |
| 1015070-56-0 | OC1=CN=CC2=C1C=C(Br)C=C2 | 6-Bromoisoquinolin-4-ol | AG0004NC | 4g |
| 1015068-76-4 | CC1=C2C=C(C=CC2=NN1)C(=O)OC | Methyl 3-methyl-1H-indazole-5-carboxylate | AG0004ND | 10g |
| 10150-93-3 | C(=O)(/C=C/C(=O)C)OCC | Ethyl (E)-4-oxopent-2-enoate | AG0004NT | 11g |
| 10150-87-5 | CC(=O)CCOC(C)=O | 3-Oxobutyl acetate | AG0004NV | 20g |
| 10150-27-3 | C1(CCP(C2=CC=CC=C2)C3=CC=CC=C3)=NC=CC=C1 | 2-(2-(Diphenylphosphino)ethyl)pyridine | AG0004NX | 0.5g |
| 1015082-71-9 | F[B-](F)(F)C1=CC=C(O)C=C1.[K+] | Potassium 4-hydroxyphenyltrifluoroborate | AG0004O2 | 175g |
| 1015078-03-1 | O=Cc1cccc2c1cc(C)cn2 | 3-Methylquinoline-5-carbaldehyde | AG0004O3 | 0.29g |
| 1015071-22-3 | O=Cc1sc(cc1C=O)F | 2,3-Thiophenedicarboxaldehyde, 5-fluoro- | AG0004O4 | 1g |
| 1015070-97-9 | OC(C1=CC2=C(C=NS2)C=C1)=O | Benzo[d]isothiazole-6-carboxylic acid | AG0004O5 | 2g |
| 1018828-40-4 | O=CC1=C(Br)N2C=CC=NC2=N1 | 3-Bromoimidazo[1,2-a]pyrimidine-2-carbaldehyde | AG0005TI | 3g |
| 1018828-16-4 | BrC1=CC2=NC(C=O)=CN2C=C1 | 7-Bromoimidazo[1,2-a]pyridine-2-carbaldehyde | AG0005TJ | 15g |
| 1018818-04-6 | C[C@H]1C[C@H](C(=O)O)N(C(=O)OC(C)(C)C)C1 | (2R,4S)-1-Boc-4-Methylpyrrolidine-2-carboxylic acid | AG0005TM | 1g |
| 1018812-91-3 | O=C1C=CNC2=C(Cl)N=CC=C12 | 8-Chloro-1H-1,7-Naphthyridin-4-one | AG0005TP | 1g |
| 1018946-38-7 | COCCCC1=CC=C2C(C=C(C3=CC(OC)=C(OC)C=C3)O2)=C1 | DWK-1339 | AG0005U5 | 0.05g |
| 1018899-99-4 | CC(C)C[C@H](CNC(OCC1C2=C(C3=C1C=CC=C3)C=CC=C2)=O)C(O)=O | (R)-2-(((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)methyl)-4-methylpenta | AG0005U6 | 25g |
| 1018899-04-1 | O[C@H]1[C@H](C2=CC=C(Cl)C(CC3=CC=C(OCC)C=C3)=C2)O[C@H](SC)[C@@H]( | (2S,3R,4R,5S,6R)-2-(4-Chloro-3-(4-ethoxybenzyl)phenyl)-6-(methylthio)tetra | AG0005U7 | 75g |
| 1018987-47-7 | OC[C@H]1C[C@@H](CN1)O.Cl | (3S,5R)-5-(Hydroxymethyl)pyrrolidin-3-ol hydrochloride | AG0005UU | 30g |
| 1018978-91-0 | N[C@H]1CCOC2=C1C=CC(F)=C2 | (S)-7-Fluorochroman-4-amine | AG0005UV | 2g |
| 1018978-89-6 | N[C@@H]1CCOC2=C1C=C(OC)C=C2 | (R)-6-Methoxychroman-4-amine | AG0005UX | 2g |
| 1018978-87-4 | N[C@H]1CCOC2=C1C=C(Cl)C=C2 | (S)-6-Chlorochroman-4-amine | AG0005UZ | 0.75g |
| 1018978-86-3 | N[C@@H]1CCOC2=C1C=C(Cl)C=C2 | (4R)-6-Chlorochromane-4-ylamine | AG0005V0 | 0.5g |
| 1018978-85-2 | C1=CC2=C(C=C1F)[C@H](CCO2)N | (S)-6-Fluorochroman-4-amine | AG0005V1 | 3g |
| 1018953-88-2 | CC1(C(C)(C)OB(C2SC3=C(C=NC=C3)C=2)O1)C | 2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)thieno[3,2-c]pyridine | AG0005V4 | 2g |
| 1019-57-4 | CC=NNc1ccc(cc1[N+](=O)[O-])[N+](=O)[O-] | Acetaldehyde 2,4-Dinitrophenylhydrazone | AG0005V9 | 50g |
| 1019-52-9 | C1=C(C=C(C(=C1[N+](=O)[O-])O)[N+](=O)[O-])C(=O)O | 4-Hydroxy-3,5-Dinitrobenzoic Acid | AG0005VA | 10g |
| 1019-03-0 | CCCC1=NC2=CC=CC=C2C(=C1)C(=O)O | 2-Propylquinoline-4-carboxylic acid | AG0005VH | 20g |
| 1019016-66-0 | FC1=C2N=CC=C(Cl)C2=CC(Br)=C1 | 6-Bromo-4-chloro-8-fluoroquinoline | AG0005VJ | 10g |
| 1016500-71-2 | OC1=CC=C(Cl)C=C1CNCC | 4-Chloro-2-[(ethylamino)methyl]phenol | AG00051X | 25g |
| 1016519-61-1 | CN(CC(O)=O)C1=NC=CC=C1 | 2-(Methyl-2-pyridylamino)acetic Acid | AG00052P | 0.5g |
| 1016516-68-9 | O=S(C1=CC=C(C=C1F)OC)(Cl)=O | 2-Fluoro-4-methoxybenzenesulfonyl Chloride | AG00052T | 2g |
| 1016535-83-3 | N#CCC1=CC=C(OCC2=CC=C(F)C=C2)C=C1 | 2-(4-((4-Fluorobenzyl)oxy)phenyl)acetonitrile | AG000536 | 0.2g |
| 1016534-59-0 | COCC1=CN=C(Cl)C=C1 | 2-Chloro-5-(methoxymethyl)pyridine | AG000537 | 10g |
| 1016530-98-5 | FC(F)(F)COC1=CN=CC(Cl)=N1 | 2-Chloro-6-(2,2,2-trifluoroethoxy)pyrazine | AG00053D | 20g |
| 1016529-46-6 | FC1=C(C2NCCC2)C(F)=CC=C1 | 2-(2，6-Difluorophenyl)pyrrolidine | AG00053I | 10g |
| 101654-28-8 | OC1=CC(=NC=C1)[N+]([O-])=O | 2-Nitropyridin-4-ol | AG00053N | 2g |
| 1016644-38-4 | O=C1OC2=CC(B(O)O)=CC=C2N1 | 2-Oxo-2,3-dihydrobenzo[d]oxazol-6-yl-boronic acid | AG00053U | 7g |
| 1016642-07-1 | B(O)(O)c1cscn1 | Thiazol-4-ylboronic acid | AG00053V | 5g |
| 1016641-70-5 | CS(=O)C1=CC=C(C=C1)B1OC(C)(C)C(C)(C)O1 | 4-Methylsulfinylphenylboronic acid, pinacol ester | AG00053W | 5g |
| 1016641-53-4 | O=C1OC2=CC(B3OC(C)(C)C(C)(C)O3)=CC=C2N1C | 3-Methyl-6-(4,4,5,5-tetramethyl[1,3,2]dioxaborolan-2-yl)-3h-benzooxazol-2- | AG00053X | 10g |
| 1016636-76-2 | CC1=C(Br)C(=O)N(C2CCCC2)C2=NC(Cl)=NC=C12 | 6-Bromo-2-chloro-8-cyclopentyl-5-methylpyrido[2,3-d]pyrimidin-7(8H)-one | AG00053Y | 1000g |
| 101667-98-5 | CCOC(=O)C1=C(C)C2=C(S1)N=CN=C2Cl | Ethyl 4-chloro-5-methylthieno[2，3-d]pyrimidine-6-carboxylate | AG000540 | 10g |
| 101667-97-4 | C12N=CNC(=O)C=1C(=C(C(O)=O)S2)C | 5-Methyl-4-oxo-3,4-dihydrothieno[2,3-d]pyrimidine-6-carboxylic acid | AG000541 | 2g |
| 101664-59-9 | COC1=C(OC)C(Cl)=NC=C1 | 2-chloro-3,4-dimethoxypyridine | AG000544 | 25g |
| 1016847-66-7 | O=C1N(C2=CC=CC(Br)=C2)CCCC1 | 1-(3-Bromophenyl)piperidin-2-one | AG00057I | 10g |
| 101685-29-4 | N#C/C(C#N)=C(C1=CC=CC=C1)/CC#N | 2-Phenylprop-1-ene-1,1,3-tricarbonitrile | AG00057T | 4g |
| 10169-55-8 | CC(C1=CC=C(SC2=CC=CC=C2)C=C1)=O | 4-Acetyldiphenyl Sulfide | AG00057U | 50g |
| 10169-50-3 | [Br]C1(=CC([N+](=O)[O-])=C(O)C(=C1)C(=O)O) | 5-Bromo-2-hydroxy-3-nitrobenzoic acid | AG00057W | 0.75g |
| 1016979-31-9 | COC(=O)C1=CC(F)=CC(=C1)B1OC(C)(C)C(C)(C)O1 | 3-Fluoro-5-methoxycarbonylphenylboronic acid, pinacol ester | AG00057Z | 0.74g |
| 1016971-66-6 | N[C@H]1[C@H](NC(OC(C)(C)C)=O)CCC1 | tert-Butyl ((1R,2R)-2-aminocyclopentyl)carbamate | AG000583 | 2g |
| 101693-27-0 | C[C@@H](OC(C)=O)C(=O)OC(C)(C)C | Tert-butyl (R)-2-acetoxypropanoate | AG00058F | 1.5g |
| 101691-94-5 | ICC1CCOCC1 | 4-(Iodomethyl)Tetrahydro-2H-Pyran | AG00058L | 100g |
| 101691-65-0 | O=S(C1=CC=C(C)C=C1)(OCC2CCOCC2)=O | (Tetrahydropyran-4-yl)methyl tosylate | AG00058M | 400g |
| 1017035-01-6 | Brc1ccc(c(c1)F)C(=O)N1CCCCC1 | 1-(4-Bromo-2-fluorobenzoyl)piperidine | AG00058P | 5g |
| 1017027-77-8 | NC1=CC2=C(OC(C3CC3)=N2)C=C1 | 2-Cyclopropylbenzo[d]oxazol-5-amine | AG00058Q | 2g |
| 1016983-51-9 | OS(=O)(=O)C[C@H]1[C@@H]2CCC(=C)[C@@H]3CCC(=C)[C@@H]3[C@H]2OC1= | Sulfocostunolide A | AG00058U | 0.005g |
| 10170-69-1 | O=C[Mn](C=O)(C=O)(C=O)([Mn](C=O)(C=O)(C=O)(C=O)C=O)C=O | Manganese Carbonyl | AG00058Y | 25g |
| 1017-88-5 | C[P+](C1=CC=CC=C1)(C)C2=CC=CC=C2.[I-] | Dimethyldiphenylphosphonium iodide | AG000593 | 100g |
| 1017-60-3 | C=1C=C(C=CC1PC2=CC=C(C=C2)C)C | Bis(4-methylphenyl)phosphine | AG000597 | 5g |
| 1017083-37-2 | O=CC1=CC=C(O)C=C1OC(F)(F)F | 4-Hydroxy-2-(trifluoromethoxy)benzaldehyde | AG00059D | 55g |
| 1017608-20-6 | CC(C)c1cc(O)ccc1I | 4-IODO-3-ISOPROPYLPHENOL | AG0005EX | 10g |
| 1017606-58-4 | C[C@H](N)CN1CCN(CC1)C(=O)OC(C)(C)C | (S)-tert-Butyl 4-(2-aminopropyl)piperazine-1-carboxylate | AG0005EY | 10g |
| 1017604-09-9 | O=C(OC)C1=NC=C(N=C1)N2CCOCC2 | Methyl 5-morpholinopyrazine-2-carboxylate | AG0005F0 | 5g |
| 101767-28-6 | O=C(C1=CSC(C)=N1)NN | 2-Methyl-thiazole-4-carboxylic acid hydrazide | AG0005FA | 20g |
| 1017682-73-3 | CC1=C2C=CC=C(C2=NN1)F | 7-Fluoro-3-methyl-1H-indazole | AG0005FO | 8g |
| 10177-79-4 | P(c1c(OC)cccc1)c1c(OC)cccc1 | Bis(2-methoxyphenyl)phosphine | AG0005FR | 1g |
| 10177-32-9 | O=C(OC)C1=CN=CC=C1OC | Methyl 4-Methoxynicotinate | AG0005FY | 28.2g |
| 10177-31-8 | O=C(O)C1=CN=CC=C1OC | 4-Methoxynicotinic acid | AG0005FZ | 19.2g |
| 10177-29-4 | OC(C1=C(Cl)C=CN=C1)=O | 4-Chloronicotinic acid | AG0005G0 | 100g |
| 10177-24-9 | ClCC1=NC=C(Cl)C=C1 | 5-Chloro-2-(chloromethyl)pyridine | AG0005G1 | 80g |
| 10177-21-6 | C1=CN=C(C=C1Cl)CCl | 4-Chloro-2-(chloromethyl)pyridine | AG0005G3 | 20g |
| 10177-13-6 | O=C(OC)C1=CN=CC(C2=CC=CC=C2)=C1 | Methyl 5-phenylnicotinate | AG0005G4 | 25g |
| 10177-12-5 | O=C(O)C1=CN=CC(C2=CC=CC=C2)=C1 | 5-Phenylnicotinic acid | AG0005G5 | 25g |
| 10177-08-9 | O=C(C1=CC(C2=CC=CC=C2)=CNC1=O)O | 2-Hydroxy-5-phenylnicotinic acid | AG0005G8 | 5g |
| 1017777-60-4 | COC1=CC=C(F)C(O)=C1Cl | 2-Chloro-6-fluoro-3-methoxyphenol | AG0005GA | 5g |
| 1017777-58-0 | NC1=C(F)C=CC(OC)=C1Cl | 2-Chloro-6-fluoro-3-methoxyaniline | AG0005GB | 3g |
| 10199-69-6 | CN1N=CC(C2=CC=CC=C2)=C1 | 1-Methyl-4-phenyl-1H-pyrazole | AG00066S | 0.5g |
| 10199-68-5 | C1(C2=CC=CC=C2)=CNN=C1 | 4-Phenyl-1H-pyrazole | AG00066T | 20g |
| 10199-67-4 | C1=CC=C(C=C1)CN2C=CC=N2 | 1-Benzylpyrazole | AG00066U | 125g |
| 10199-63-0 | CC(=O)N1C(C)=CC(C)=N1 | 1-(3,5-Dimethyl-1h-pyrazol-1-yl)-1-ethanone | AG00066X | 2g |
| 10199-61-8 | O=C(OCC)CN1N=CC=C1 | ethyl 2-(pyrazol-1-yl)acetate | AG00066Y | 25g |
| 10199-57-2 | O=C(C1=NN(C2=CC=CC=C2)C(C)=C1)O | 5-Methyl-1-phenylpyrazole-3-carboxylic acid | AG000670 | 30g |
| 10199-53-8 | O=C(C1=NN(C)C(C2=CC=CC=C2)=C1)O | 1-Methyl-5-phenylpyrazole-3-carboxylic acid | AG000671 | 20g |
| 1019929-89-5 | COC1=C(Cl)C=C(Cl)N=C1C | 4,6-Dichloro-3-methoxy-2-methylpyridine | AG000674 | 1g |
| 102-24-9 | B1(OC)OB(OC)OB(OC)O1 | 2,4,6-Trimethoxy-1,3,5,2,4,6-trioxatriborinane | AG00067U | 200g |
| 102-22-7 | O=C(Cc1ccccc1)OC/C=C(/CCC=C(C)C)C | Benzeneacetic acid, (2E)-3,7-dimethyl-2,6-octadien-1-yl ester | AG00067W | 500g |
| 102-20-5 | O=C(OCCC=1C=CC=CC1)CC=2C=CC=CC2 | 2-Phenylethyl 2-phenylacetate | AG00067X | 6500g |
| 102-19-2 | CC(C)CCOC(=O)Cc1ccccc1 | Benzeneacetic acid, 3-methylbutyl ester | AG00067Y | 5500g |
| 102-17-0 | COc1ccc(cc1)COC(=O)Cc1ccccc1 | Benzeneacetic acid, (4-methoxyphenyl)methyl ester | AG00067Z | 50g |
| 102-16-9 | C(C(=O)OCc1ccccc1)c1ccccc1 | Benzyl 2-phenylacetate | AG000680 | 450g |
| 102-14-7 | O=C(O)CCC(NC1=CC=CC=C1)=O | 4-Anilino-4-oxobutanoic Acid | AG000681 | 275g |
| 102-13-6 | CC(C)COC(=O)CC1=CC=CC=C1 | Isobutyl 2-phenylacetate | AG000682 | 300g |
| 102-11-4 | CNCCN(CC1=CC=CC=C1)C | N-Benzyl-N,N’-dimethylethylenediamine | AG000683 | 25g |
| 102-09-0 | O=C(OC1=CC=CC=C1)OC2=CC=CC=C2 | Diphenyl Carbonate | AG000685 | 5000g |
| 1015939-24-8 | O=C(C1CN(C(OC(C)(C)C)=O)CCC1O)O | 1-(tert-Butoxycarbonyl)-4-hydroxypiperidine-3-carboxylic acid | AG0004WZ | 4g |
| 1015937-48-0 | C(C1=CC=CC=C1)NC1COC1 | N-Benzyloxetan-3-amine | AG0004X0 | 15g |
| 101597-25-5 | OC(C1=CC=C(OC)C=C1)(C#C)C2=CC=C(OC)C=C2 | 1,1-BIS(4-METHOXYPHENYL)-2-PROPYN-1-OL | AG0004X5 | 2000g |
| 10159-39-4 | N1(CCN(CC1)C1=CC=C(C=O)C=C1)C1=CC=C(C=O)C=C1 | 4,4′-(Piperazine-1,4-diyl)dibenzaldehyde | AG0004XM | 8g |
| 10160-87-9 | C#CC(OCC)OCC | Propargylaldehyde diethyl acetal | AG0004XO | 200g |
| 10160-28-8 | C#CCCCCCCCO | 8-NONYN-1-OL | AG0004XS | 200g |
| 10160-25-5 | BrCCCCCCCOC1CCCCO1 | 2-(7-Bromoheptyloxy)Tetrahydropyran | AG0004XU | 5g |
| 10160-24-4 | OCCCCCCCBr | 7-Bromo-1-heptanol | AG0004XV | 1000g |
| 1016-78-0 | O=C(C1=CC=CC=C1)C2=CC=CC(Cl)=C2 | 3-Chlorobenzophenone | AG0004Y1 | 1500g |
| 1016-77-9 | O=C(C1=CC=CC(Br)=C1)C2=CC=CC=C2 | 3-Bromobenzophenone | AG0004Y2 | 800g |
| 1016-58-6 | COC1=CC(CO)=C(C=C1OC)[N+]([O-])=O | 4,5-Dimethoxy-2-nitrobenzyl alcohol | AG0004Y4 | 630g |
| 1017777-45-5 | CC(=O)C1=C(F)C=C(Cl)C=C1F | 4′-Chloro-2′,6′-difluoroacetophenone | AG0005GC | 25g |
| 101774-33-8 | OC1=C(Cl)N=CC2=C1C=CC=C2 | 3-Chloroisoquinolin-4-ol | AG0005GH | 2g |
| 101774-27-0 | BrC1=CC=C2C(=C1)[NH]C=C2C(=O)O | 6-Bromo-1H-indole-3-carboxylic acid | AG0005GI | 100g |
| 101773-62-0 | C1CCN2C(C=CC=C12)=O | 2,3-Dihydroindolizin-5(1H)-one | AG0005GL | 0.75g |
| 101772-29-6 | CC(OC(=O)N([C@]([H])(C(O)=O)CO)C)(C)C | Boc-N-Me-Ser-OH | AG0005GT | 200g |
| 1017779-71-3 | NC1=CC(F)=C(F)C=C1OC | 4,5-difluoro-2-methoxyaniline | AG0005H9 | 30g |
| 1017779-69-9 | NC1=CC=C(OC(F)(F)F)C(F)=C1 | 3-Fluoro-4-(trifluoromethoxy)aniline | AG0005HA | 200g |
| 1017779-62-2 | CCOC1=C(F)C(F)=C(CC(O)=O)C=C1 | 4-Ethoxy-2,3-Difluorophenylacetic Acid | AG0005HB | 10g |
| 1017779-51-9 | CCOC1=CC(F)=C(CBr)C(F)=C1 | 2-(Bromomethyl)-5-ethoxy-1,3-difluorobenzene | AG0005HD | 25g |
| 1017779-48-4 | C(C)OC1=CC(=C(C=O)C(=C1)F)F | 4-Ethoxy-2,6-difluorobenzaldehyde | AG0005HE | 25g |
| 1017778-64-1 | O=CC1=CC(C)=C(F)C(F)=C1 | 3,4-Difluoro-5-methylbenzaldehyde | AG0005HH | 10g |
| 1017778-60-7 | O=C(O)C1=CC(C)=C(F)C(F)=C1 | 3,4-Difluoro-5-methylbenzoic acid | AG0005HI | 1g |
| 1017777-83-1 | O=C(O)CC1=C(Cl)C=CC(OC)=C1F | 6-Chloro-2-fluoro-3-methoxyphenylacetic acid | AG0005HM | 30g |
| 1017781-60-0 | BrC1=CSC(N2CCOCC2)=N1 | 4-(4-Bromothiazol-2-yl)morpholine | AG0005HO | 75g |
| 1017781-58-6 | C1CN(CCC1O)C2=NC(=CS2)Br | 4-Bromo-2-(4-hydroxypiperidino)thiazole | AG0005HQ | 40g |
| 10200-21-2 | C(C(C)C)C1(C)OC(=O)CC1 | 2(3H)-Furanone, dihydro-5-methyl-5-(2-methylpropyl)- | AG0006A3 | 0.2g |
| 1020-84-4 | C[Si]1(C)N[Si](C)(C)N[Si](C)(C)N[Si](C)(C)N1 | Cyclotetrasilazane, 2,2,4,4,6,6,8,8-octamethyl- | AG0006A6 | 4g |
| 1020-83-3 | O=C1CCCCCOC(=O)CCCCCO1 | 1,8-Dioxacyclotetradecane-2,9-dione | AG0006A7 | 10g |
| 1020057-92-4 | N#CC1=C(N)N(C2=CC=C(F)C=C2F)N=C1C | 5-Amino-4-cyano-1-(2,4-difluorophenyl)-3-methyl-1H-pyrazole | AG0006AE | 0.75g |
| 1020056-98-7 | OC(=O)C1=CC=NC(Br)=C1Br | 2,3-Dibromopyridine-4-carboxylic acid | AG0006AH | 3g |
| 1020056-77-2 | IC1=C2C(NC=C2)=NC=C1Cl | 5-Chloro-4-Iodo-1H-Pyrrolo[2,3-B]Pyridine | AG0006AK | 1g |
| 1020056-72-7 | COC1=CN=C(NC=C2)C2=C1Cl | 4-Chloro-5-methoxy-1H-pyrrolo[2,3-b]pyridine | AG0006AL | 2g |
| 1020056-56-7 | CC1=CN=C(NC=C2)C2=C1Cl | 4-Chloro-5-Methyl-1H-Pyrrolo[2,3-B]Pyridine | AG0006AM | 50g |
| 1020056-33-0 | O=CC1=CN=C2C(NC=C2)=C1 | 1H-Pyrrolo[3,2-B]Pyridine-6-Carbaldehyde | AG0006AN | 8g |
| 1020046-39-2 | N#CC1=CC(N)=CC=C1OCC | 5-Amino-2-ethoxybenzonitrile | AG0006AP | 6g |
| 1020042-77-6 | O=C1NN=C2C(Cl)=CC=CN21 | 8-Chloro-[1,2,4]triazolo[4,3-a]pyridin-3(2H)-one | AG0006AQ | 50g |
| 1020039-12-6 | ClC1=CC=2N(C=C1)C(NN2)=O | 7-CHLORO-[1,2,4]TRIAZOLO[4,3-A]PYRIDIN-3(2H)-ONE | AG0006AS | 10g |
| 1020038-45-2 | OC(C1N=C2N(C=CC=C2Cl)C=1)=O | 8-Chloroimidazo[1,2-a]pyridine-2-carboxylic acid | AG0006AU | 1g |
| 1020038-42-9 | OC(=O)C1=CN2C=CC(Cl)=CC2=N1 | 7-Chloroimidazo[1,2-A]Pyridine-2-Carboxylic Acid | AG0006AV | 7g |
| 1020035-04-4 | O=C(C1=CN=C2N=CC(C)=CN21)O | 6-Methylimidazo[1,2-a]pyrimidine-3-carboxylic acid | AG0006AW | 2g |
| 1020063-01-7 | N#CC1=CC=C(OC(F)(F)F)C(C#N)=C1 | 4-(Trifluoromethoxy)isophthalonitrile | AG0006B3 | 150g |
| 1020058-47-2 | O=C(OCC)CC(C1=CC(Br)=CC=C1F)=O | Ethyl (5-bromo-2-fluorobenzoyl)acetate | AG0006B5 | 8g |
| 102-28-3 | N(C(=O)C)c1cc(N)ccc1 | N-(3-Aminophenyl);acetamide | AG00068Y | 1000g |
| 1020-31-1 | C(C)(C)(C)C1=C(C(O)=CC(=C1)C(C)(C)C)O | 3,5-Di-tert-butylcatechol | AG000692 | 2500g |
| 102-97-6 | C(NC(C)C)c1ccccc1 | Benzenemethanamine, N-(1-methylethyl)- | AG000695 | 3500g |
| 102-96-5 | O=[N+](/C=C/C1=CC=CC=C1)[O-] | (2-Nitrovinyl)benzene | AG000696 | 400g |
| 102-93-2 | O=C(N)CCC1=CC=CC=C1 | 3-Phenyl-Propionamide | AG000698 | 100g |
| 102-92-1 | C1(=CC=CC=C1)C=CC(=O)Cl | 3-Phenyl-2-propenoyl chloride | AG000699 | 500g |
| 102-87-4 | CCCCCCCCCCCCN(CCCCCCCCCCCC)CCCCCCCCCCCC | Tridodecylamine | AG00069B | 1250g |
| 102-86-3 | CCCCCCN(CCCCCC)CCCCCC | Trihexylamine | AG00069C | 425g |
| 102-84-1 | P(OCC=C)(OCC=C)OCC=C | Triallyl Phosphite | AG00069E | 1.5g |
| 102-83-0 | NCCCN(CCCC)CCCC | N1,N1-Dibutylpropane-1,3-diamine | AG00069F | 125g |
| 102000-73-7 | N#CC1=CC=C([N+]([O-])=O)C(Br)=C1 | 3-Bromo-4-nitrobenzonitrile | AG00069O | 30g |
| 102000-57-7 | Nc1ccnc(C=C)c1 | 2-Vinylpyridin-4-amine | AG00069S | 2g |
| 10200-59-6 | C(=O)c1nccs1 | 2-Thiazolecarboxaldehyde | AG00069X | 2500g |
| 10200-48-3 | OC1COS(=O)(=O)C1 | 1,2-Oxathiolan-4-ol, 2,2-dioxide | AG00069Y | 10g |
| 10200-43-8 | C(=O)(OCC)c1coc(n1)C | Ethyl 2-methyloxazole-4-carboxylate | AG00069Z | 40g |
| 102-07-8 | O=C(NC1=CC=CC=C1)NC2=CC=CC=C2 | 1,3-Diphenylurea | AG000687 | 7000g |
| 102-05-6 | CN(CC1=CC=CC=C1)CC2=CC=CC=C2 | Dibemethine | AG000688 | 50g |
| 102-04-5 | O=C(CC1=CC=CC=C1)CC2=CC=CC=C2 | 1,3-Diphenylacetone | AG000689 | 2500g |
| 102-02-3 | N=C(NC(N)=N)NC1=CC=CC=C1 | Phenylbiguanide | AG00068B | 200g |
| 102-56-7 | NC1=CC(OC)=CC=C1OC | 2,5-Dimethoxyaniline | AG00068G | 3000g |
| 102-54-5 | [CH]12=[CH]3[CH-]4[CH]5=[CH]1[Fe+2]32546789[CH]%10=[CH]6[CH-]7[CH]8=[CH | Ferrocene | AG00068H | 29g |
| 102-53-4 | C(C)N(CN(CC)CC)CC | N,N,N’,N’-Tetraethylmethanediamine | AG00068I | 200g |
| 102-52-3 | COC(OC)CC(OC)OC | 1,1,3,3-Tetramethoxypropane | AG00068J | 268910g |
| 102-51-2 | COC1=CC=C(N)C(N)=C1 | 3,4-Diaminoanisole | AG00068K | 726.4g |
| 102-50-1 | NC1=CC=C(OC)C=C1C | 4-Methoxy-2-methylaniline | AG00068L | 10000g |
| 102-49-8 | NCC1=CC=C(Cl)C(Cl)=C1 | (3,4-Dichlorophenyl)methanamine | AG00068M | 200g |
| 102-48-7 | CC1=C(C)C=C(CN)C=C1 | 3,4-Dimethylbenzylamine | AG00068N | 400g |
| 102-46-5 | CC1=C(C)C=C(CCl)C=C1 | 4-(Chloromethyl)-1,2-dimethylbenzene | AG00068P | 500g |
| 102-41-0 | Cc1cccc(c1)NCCO | N-Hydroxyethyl-m-toluidine | AG00068R | 2000g |
| 102-39-6 | OC(COC1=CC=CC(OCC(O)=O)=C1)=O | 2,2′-(1,3-Phenylenebis(oxy))diacetic acid | AG00068S | 175g |
| 102-37-4 | O=C(OCC)/C=C/C1=CC=C(O)C(O)=C1 | Ethyl Caffeate | AG00068U | 400g |
| 102-32-9 | O=C(O)CC1=CC=C(O)C(O)=C1 | 3,4-Dihydroxyphenylacetic Acid | AG00068W | 700g |
| 10203-58-4 | O=C(OCC)C(CC(C)C)C(OCC)=O | Diethyl Isobutylmalonate | AG0006EV | 400g |
| 10203-33-5 | CCCCCCCC(CCCC)O | 5-Dodecanol | AG0006EY | 2g |
| 10203-28-8 | CCCCCCCCCCC(C)O | 2-Dodecanol | AG0006F1 | 200g |
| 10203-08-4 | O=CC1=CC(Cl)=CC(Cl)=C1 | 3,5-Dichlorobenzaldehyde | AG0006F2 | 19g |
| 1020353-46-1 | C1(NCC(C)C)CC1.Cl | N-Cyclopropyl-n-isobutylamine hydrochloride | AG0006F6 | 25g |
| 1020349-31-8 | Cl.O=C1OCN2CCNCC12 | Tetrahydro-1H-oxazolo[3,4-a]pyrazin-3(5H)-one hydrochloride | AG0006F7 | 55g |
| 1020336-04-2 | FC(C1=CN=C(C=C1)OC2=CC=CC(C=C3CCNCC3)=C2)(F)F | 2-(3-(Piperidin-4-ylidenemethyl)phenoxy)-5-(trifluoromethyl)pyridine | AG0006F8 | 0.75g |
| 102052-39-1 | CC(CC1=C(Cl)C(Cl)=CC=C1)=O | 1-(2,3-Dichlorophenyl)propan-2-one | AG0006FY | 2g |
| 102045-96-5 | O=C(O)[C@H]1OC(C)(OC1)C | (S)-2,2-Dimethyl-1,3-dioxolane-4-carboxylic acid | AG0006G1 | 1g |
| 10205-71-7 | COC1=CC2=C(C=C1)N=C(S2)C1=CC=C(C=C1)N(C)C | 4-(6-Methoxybenzo[d]thiazol-2-yl)-N,N-dimethylaniline | AG0006G9 | 4g |
| 10205-56-8 | CN(C1=CC=C(C2SC3=C(C=CC=C3)N=2)C=C1)C | 4-(1,3-benzothiazol-2-yl)-N,N-dimethylaniline | AG0006GF | 5g |
| 10205-34-2 | COC(=O)C(C)CN(C)C | Methyl 3-(dimethylamino);-2-methylpropanoate | AG0006GG | 5g |
| 1020576-70-8 | CCOC(=O)C1=NC=CC2=C1C=CC(Br)=C2 | Ethyl 6-bromoisoquinoline-1-carboxylate | AG0006GJ | 3g |
| 1020572-61-5 | O=C(C1=NC2=CC=C(Br)C=C2C=C1)OCC | Ethyl 6-bromoquinoline-2-carboxylate | AG0006GM | 2g |
| 1020571-45-2 | CC(C)(C)OC(=O)N1C[C@H](N)[C@@H](N)C1 | (3S,4S)-tert-Butyl 3,4-diaminopyrrolidine-1-carboxylate | AG0006GN | 1g |
| 102054-10-4 | O(C(/C=C\C(OC(COC)C)=O)=O)C(COC)C | bis(1-methoxypropan-2-yl) maleate | AG0006H1 | 10g |
| 102052-95-9 | NC1=NC=CC2=C1N=CN2[C@H]3C=C(CO)[C@@H](O)[C@H]3O | 3-Deazaneplanocin A | AG0006H5 | 0.5g |
| 1019009-68-7 | O=C(C1=C(N)N(C2=CC=CC=C2Br)N=C1)OCC | ethyl 5-amino-1-(2-bromophenyl)-1H-pyrazole-4-carboxylate | AG0005VL | 20g |
| 10190-99-5 | COc1cccc2c1cc([N+](=O)[O-])c1c2c2OCOc2cc1C(=O)[O-].[Na+] | PHENANTHRO[3,4-D]-1,3-DIOXOLE-5-CARBOXYLIC ACID, 8-METHOXY-6-NITRO- | AG0005VT | 0.5g |
| 10190-93-9 | C[C@]12CC[C@H]3[C@@H](CCC4=CC(=NOCC(=O)O)CC[C@]34C)[C@@H]1CC[C | T223455 | AG0005VU | 0.01g |
| 1019-89-2 | Cc1ccc2n(c1)cc(n2)c1ccccc1 | 6-Methyl-2-phenylimidazo[1,2-a]pyridine | AG0005VY | 5g |
| 1019-85-8 | ClC1=CC=C(C2=NC3=CC=CC=C3N2)C=C1 | 2-(4-Chlorophenyl)benzimidazole | AG0005W0 | 10g |
| 1019-71-2 | ClP(c1ccc(cc1)C)c1ccc(cc1)C | Bis(4-methylphenyl)chlorophosphine | AG0005W4 | 5g |
| 1019024-64-6 | N#CC1=CN2C(C=C1)=NN=C2 | [1,2,4]Triazolo[4,3-a]pyridine-6-carbonitrile | AG0005W9 | 7g |
| 1019021-93-2 | O=C(C1=CN=C2C=C(Br)C=CN21)O | 7-Bromoimidazo[1,2-a]pyridine-3-carboxylic acid | AG0005WA | 6g |
| 1019021-85-2 | O=C(C1=CN=C2C=CC(F)=CN21)O | 6-Fluoroimidazo[1，2-a]pyridine-3-carboxylic Acid | AG0005WC | 4g |
| 1019021-78-3 | OC(C1=CN=C2N1C=C(C=C2)C(F)(F)F)=O | 6-(Trifluoromethyl)imidazo[1,2-a]pyridine-3-carboxylic acid | AG0005WD | 1g |
| 1019021-71-6 | OC(C1N2C(C=CC(=C2)C#N)=NC=1)=O | 6-Cyanoimidazo[1,2-a]pyridine-3-carboxylic acid | AG0005WE | 2g |
| 1019020-14-4 | BrC1=CC2=NC=C(C=O)N2C=C1 | 7-Bromoimidazo[1,2-a]pyridine-3-carbaldehyde | AG0005WG | 6g |
| 1019020-06-4 | C(=O)c1n2c(nc1)ccc(c2)F | 6-Fluoroimidazo[1,2-a]pyridine-3-carbaldehyde | AG0005WH | 2g |
| 1019018-46-2 | C1=CN2C=C(C(=O)O)N=C2C=C1Br | 7-Bromoimidazo[1,2-A]Pyridine-2-Carboxylic Acid | AG0005WJ | 50g |
| 101906-05-2 | [H]O[H].FC(F)(F)C1=CC=C(C=C1)C(=O)C=O | 4-Trifluoromethylphenylglyoxal hydrate | AG0005WM | 10g |
| 1019108-35-0 | O=C(OCC)C(CC1)C2=C1SC(N)=N2 | Ethyl 2-Amino-5,6-Dihydro-4H-Cyclopenta[D]Thiazole-4-Carboxylate | AG0005WW | 3g |
| 1017781-52-0 | N#CC1=NC(Br)=CS1 | 4-Bromo-2-cyanothiazole | AG0005HU | 75g |
| 1017781-47-3 | O=C(OCC)CC(C1=CC=CC(NC(OC(C)(C)C)=O)=C1)=O | Ethyl 3-(3-((tert-butoxycarbonyl)amino)phenyl)-3-oxopropanoate | AG0005HZ | 0.5g |
| 1017781-45-1 | O=C(OCC)CC(C1=CC=C(NC(OC(C)(C)C)=O)C=C1)=O | Ethyl 3-(4-((tert-butoxycarbonyl)amino)phenyl)-3-oxopropanoate | AG0005I1 | 3g |
| 1017781-37-1 | NC1=CC(CC)=NN1C2=CC=CC=C2 | 3-Ethyl-1-phenyl-1H-pyrazol-5-amine | AG0005I5 | 3g |
| 1017782-09-0 | NC1=NC(OC)=C(Br)C=C1[N+]([O-])=O | 5-Bromo-6-methoxy-3-nitro-pyridin-2-ylamine | AG0005ID | 4g |
| 1017781-94-0 | FC1=C(F)C=C2C(NN=C2Br)=C1 | 3-Bromo-5,6-difluoro-1H-indazole | AG0005II | 5g |
| 1017783-09-3 | BrC1=CC2=C(NC(=O)OC2)C=C1 | 6-Bromo-1,4-Dihydro-2H-3,1-Benzoxazin-2-One | AG0005JE | 10g |
| 1017783-03-7 | O=C(O)C1=C(N2CCOCC2)N=CC(Br)=C1 | 5-Bromo-2-morpholinonicotinic acid | AG0005JF | 20g |
| 1017782-79-4 | O(C)c1cc(ccc1N(=O)=O)N1CCN(CC1)C(=O)OC(C)(C)C | 5-(4-BOC-piperazino)-2-nitroanisole | AG0005JJ | 50g |
| 1017782-64-7 | ClCC1=CC(Br)=CN=C1Cl | 5-Bromo-2-chloro-3-(chloromethyl)pyridine | AG0005JL | 15g |
| 1017782-15-8 | O=CC1N=C2N(C=CN=C2)C=1 | Imidazo[1,2-a]pyrazine-2-carbaldehyde | AG0005JO | 0.2g |
| 1017793-08-6 | C#CC1=NN=CC=C1 | 3-Ethynylpyridazine | AG0005JQ | 15g |
| 1017051-55-6 | CC1=CC(C(O)=O)=C(NS(C)(=O)=O)C=C1 | 5-Methyl-2-[(methylsulfonyl)amino]benzoic acid | AG00059E | 25g |
| 101711-55-1 | C[Si](OCCN)(C(C)(C)C)C | 2-(tert-Butyldimethylsilyloxy)ethanamine | AG0005AG | 2500g |
| 1017199-00-6 | O=C1OC2=CC(N)=CC=C2N1CC3=CC=CC=C3 | 6-Amino-3-Benzylbenzo[D]Oxazol-2(3H)-One | AG0005AR | 35g |
| 1017183-06-0 | O=C(O)C(C)CC1=NC=CC=C1 | 2-Methyl-3-(pyridin-2-yl)propanoic acid | AG0005AT | 1g |
| 1017146-67-6 | CC(C(O)=O)CC1=CN=CC=C1 | 2-Methyl-3-(pyridin-3-yl)propanoic acid | AG0005AW | 1g |
| 101714-41-4 | O=C(C1=CC=C(O)C(O)=C1)CSC#N | 2-(Cyanosulfanyl)-1-(3,4-dihydroxyphenyl)ethan-1-one | AG0005B6 | 3g |
| 101714-35-6 | IC1=CC=C2OCCC(=O)C2=C1 | 6-Iodochroman-4-one | AG0005B7 | 20g |
| 10172-89-1 | O=C(O)[C@@H](CC1=CC=CC=C1)NC(C)=O | N-Acetyl-D-phenylalanine | AG0005B8 | 2500g |
| 10172-35-7 | NC1=C([N+]([O-])=O)C=C(OC)C=C1Br | 2-Bromo-4-methoxy-6-nitroaniline | AG0005BD | 500g |
| 1017273-59-4 | CC1=C(SC2=NC=C[N]12)C(=O)O | 3-Methylimidazo[2，1-b]thiazole-2-carboxylic acid | AG0005BI | 5g |
| 1017261-83-4 | Brc1ccc(c(c1)OCc1ccccc1)Br | 2-(Benzyloxy)-1,4-dibromobenzene | AG0005BK | 10g |
| 10173-01-0 | COc1cc(ccc1O)-c1oc2cc(O)c(OC)c(O)c2c(=O)c1OC | Jaceidin | AG0005C3 | 0.005g |
| 1017789-66-0 | CN1CC(NC(OC(C)(C)C)=O)C1 | tert-butyl N-(1-methylazetidin-3-yl)carbamate | AG0005JW | 49g |
| 1017789-65-9 | COCNC(=O)C1(CC1)C(F)(F)F | N-(methoxymethyl)-1-(trifluoromethyl)cyclopropane-1-carboxamide | AG0005JX | 2g |
| 1017789-63-7 | COC1=C(C=CC(CO)=C1)N1C=NC(C)=C1 | (3-Methoxy-4-(4-methyl-1H-imidazol-1-yl)phenyl)methanol | AG0005JY | 5g |
| 1017789-38-6 | O=C(OC(C)(C)C)NC1=NC(Cl)=CC(Cl)=C1 | 2-Boc-amino-4,6-dichloropyridine | AG0005K9 | 5g |
| 1017789-34-2 | CC(C)(C)OC(N1CC2NCC2C1)=O | Tert-butyl 3,6-diazabicyclo[3.2.0]heptane-3-carboxylate | AG0005KC | 3g |
| 1017798-34-3 | CC(OC(N1CC(S)CCC1)=O)(C)C | Tert-Butyl 3-Sulfanylpiperidine-1-Carboxylate | AG0005KF | 2g |
| 1017793-59-7 | C1=CN=CC2=CC(=CN=C12)C(=O)O | 1,6-Naphthyridine-3-carboxylic acid | AG0005KH | 1.25g |
| 1017793-21-3 | FC1=NC=CC(Br)=C1Cl | 4-Bromo-3-chloro-2-fluoropyridine | AG0005KI | 200g |
| 1017793-20-2 | FC1=CN=C(F)C=C1I | 2,5-Difluoro-4-iodopyridine | AG0005KJ | 537.8g |
| 10178-55-9 | CC1(C)OC2=C(Cl)C=CC=C2C1 | 7-Chloro-2,2-Dimethyl-2,3-Dihydrobenzofuran | AG0005L1 | 5g |
| 1017969-32-2 | O=C(C1=CC=NC2=CC(O)=CC=C12)O | 7-Hydroxyquinoline-4-carboxylic acid | AG0005L5 | 25g |
| 101798-76-9 | FC1=CC=C(SC2CCNCC2)C=C1.[H]Cl | 4-(4-Fluorophenylsulfanyl)piperidine, HCl | AG0005L7 | 5g |
| 1018-79-7 | N#Cc1c(C#N)c(O)c2c(c1O)cccc2 | 1,4-Dihydroxynaphthalene-2,3-dicarbonitrile | AG0005LK | 10g |
| 1018166-61-4 | CCOC(=O)c1cc(=O)[nH]c2[nH]nc(C)c12 | ethyl 3-methyl-6-oxo-1,7-dihydropyrazolo[3,4-b]pyridine-4-carboxylate | AG0005LT | 0.5g |
| 101803-06-9 | COC1=NC=C(I)C=N1 | 5-Iodo-2-Methoxypyrimidine | AG0005M6 | 25g |
| 101820-69-3 | O=C(OCC)CC1=CN=C2C=CC=CN21 | Ethyl 2-(imidazo[1,2-a]pyridin-3-yl)acetate | AG0005MS | 50g |
| 101819-99-2 | Cl.CCc1c(Cl)cc(N)c(O)c1Cl | 2,4-Dichloro-3-ethyl-6-aminophenol HCl | AG0005MV | 25g |
| 10182-48-6 | OC1=C(O)C=CN=C1 | 3,4-Dihydroxypyridine | AG0005N4 | 15g |
| 1018297-63-6 | CC1=C(CO)C(=NO1)C1=CC=C(F)C=C1 | (3-(4-Fluorophenyl)-5-methylisoxazol-4-yl)methanol | AG0005N7 | 0.5g |
| 101828-21-1 | C(C)(C)(C)C1=CC=C(CN(CC2=CC=CC3=CC=CC=C23)C)C=C1 | N-(4-(tert-Butyl)benzyl)-N-methyl-1-(naphthalen-1-yl)methanamine | AG0005NN | 1g |
| 101827-46-7 | CN(CC1=CC=C(C(C)(C)C)C=C1)CC2=C3C=CC=CC3=CC=C2.[H]Cl | Butenafine HCl | AG0005NO | 1000g |
| 101832-10-4 | [O-][N+](=O)C1=CC=C2NC=C(C(=O)C(F)(F)F)C2=C1 | 2,2,2-Trifluoro-1-(5-nitro-1h-indol-3-yl)ethanone | AG0005OD | 20g |
| 101831-71-4 | N#CC1=CC2=C(NC=C2CCN)C=C1.[H]Cl | 3-(2-Aminoethyl)-1H-indole-5-carbonitrile hydrochloride | AG0005OE | 4g |
| 101831-37-2 | ClC1=C(C(=CC(=C1)N1N=CC(NC1=O)=O)Cl)C(C#N)C1=CC=C(C=C1)Cl | 2,6-Dichloro-α-(4-chlorophenyl)-4-(4,5-dihydro-3,5-dioxo-1,2,4-triazin-2(3H)- | AG0005OI | 200g |
| 1018450-37-7 | NC1=CC=C(Cl)C(F)=C1I | 4-Chloro-3-fluoro-2-iodoaniline | AG0005PE | 25g |
| 1020665-73-9 | O=S(C1=CC(C(F)(F)F)=CC(C(F)(F)F)=C1)(N[C@@H]([C@H](NC(N[C@@H]2CCCC[ | N-((1R,2R)-2-(3-((1R,2R)-2-(DIMETHYLAMINO)CYCLOHEXYL)THIOUREIDO)-1,2- | AG0006H8 | 2g |
| 1020665-67-1 | O=S(C1=CC(C(F)(F)F)=CC(C(F)(F)F)=C1)(N[C@H](C2=CC=CC=C2)[C@H](N)C3=CC | N-((1R,2R)-2-Amino-1,2-diphenylethyl)-3,5-bis(trifluoromethyl)benzenesulf | AG0006H9 | 10g |
| 1020665-66-0 | S=C=N[C@@H]1CCCC[C@H]1N(C)C | Cyclohexanamine, 2-isothiocyanato-N,N-dimethyl-, (1R,2R)- | AG0006HA | 0.03g |
| 1020635-54-4 | O=C(O)C1=C(OC)N=CC([N+]([O-])=O)=C1 | 2-Methoxy-5-nitronicotinic acid | AG0006HB | 10g |
| 102065-94-1 | CC1=CC=CC2=C1OCC(N2)=O | 8-Methyl-2H-benzo[b][1,4]oxazin-3(4H)-one | AG0006HH | 6g |
| 102065-92-9 | CC(NC1CNC1)=O.Cl | N-(Azetidin-3-yl)acetamide hydrochloride | AG0006HI | 10g |
| 102065-89-4 | NC1CNC1.[H]Cl.[H]Cl | Azetidin-3-amine DiHCl | AG0006HJ | 20g |
| 102065-86-1 | NC1CNC1 | 3-Aminoazetidine | AG0006HL | 2.5g |
| 102062-46-4 | NC1=C(C=C(C=C1C)C2=CC(=C(C(=C2)C)NCCC[S](=O)(=O)[O-])C)C.[Na+] | Sodium 3-((4′-amino-3,3′,5,5′-tetramethyl-[1,1′-biphenyl]-4-yl)amino)propan | AG0006HQ | 75g |
| 102062-36-2 | C(S(O)(=O)=O)CCNC1=C(C)C=C(C2=CC(C)=C(N)C(C)=C2)C=C1C | N-(3-Sulfopropyl)-3，3’，5，5′-tetramethylbenzidine sodium salt | AG0006HR | 15g |
| 1020717-99-0 | BrC1=CC(=C(C(=O)O)C=C1F)[N+](=O)[O-] | 4-Bromo-5-fluoro-2-nitrobenzoic acid | AG0006HW | 2000g |
| 1020717-98-9 | ClC1=C(Br)C=CN=C1Cl | 4-Bromo-2,3-dichloropyridine | AG0006HX | 14g |
| 1020718-20-0 | O=C(Cl)C1=C(F)C=CC=C1Br | 2-Bromo-6-fluorobenzoyl chloride | AG0006J7 | 10g |
| 1020718-01-7 | O=[N+](C1=CC(F)=C(F)C(F)=C1Br)[O-] | 2-Bromo-3，4，5-trifluoro-1-nitrobenzene | AG0006J8 | 75g |
| 1020721-61-2 | CN1C(S(Cl)(=O)=O)=CC=N1 | 1-Methyl-1H-pyrazole-5-sulfonyl chloride | AG0006K4 | 25g |
| 102072-84-4 | NC1=C2C(=CC=C1)C=NN=C2 | 5-Aminophthalazine | AG0006KJ | 8g |
| 1015610-31-7 | IC1=CN=C(NC=C2)C2=C1Cl | 4-chloro-5-iodo-1H-pyrrolo[2,3-b]pyridine | AG0004SW | 20g |
| 1015610-23-7 | IC1=C2C(NC=C2)=NC=C1F | 5-Fluoro-4-iodo-1H-pyrrolo[2,3-b]pyridine | AG0004SX | 25g |
| 101574-65-6 | O=C(N/N=C/C1=CC=C(C(C)C)C=C1)C2=CC=C(O)C=C2 | Benzoic acid, 4-hydroxy-, 2-[[4-(1-methylethyl)phenyl]methylene]hydrazide | AG0004TM | 0.77g |
| 1015787-98-0 | COC1=C(S(N)(=O)=O)C=C(OC2=C(N)N=C(N)N=C2)C(C(C)C)=C1 | 5-[(2,4-diaminopyrimidin-5-yl)oxy]-2-methoxy-4-(propan-2-yl)benzene-1-sul | AG0004UD | 5g |
| 1015770-72-5 | OC(=O)C1=NOC2(C1)CCCCC2 | 1-Oxa-2-azaspiro[4.5]dec-2-ene-3-carboxylic acid | AG0004UH | 10g |
| 101581-06-0 | BrC1=C(C(=CC(=C1)[N+](=O)[O-])Br)C | 1,3-dibromo-2-methyl-5-nitrobenzene | AG0004UM | 90g |
| 101580-70-5 | CC1=CC(Br)=C(Br)C=C1[N+]([O-])=O | 1,2-Dibromo-4-methyl-5-nitrobenzene | AG0004UP | 190g |
| 1015845-89-2 | O=CC1=CC=C(N2N=CC=C2)C=C1C | 2-Methyl-4-(1H-pyrazol-1-yl)benzaldehyde | AG0004V1 | 45g |
| 102013-72-9 | COCCOCCOCCOCCOCCOCCOCCOCCOCC(O)=O | 3,6,9,12,15,18,21,24,27-Nonaoxaoctacosanoic acid | AG0006BA | 6g |
| 10201-73-7 | NC1=NC=CC(=C1)OC | 2-Amino-4-methoxypyridine | AG0006BL | 832.6g |
| 10201-71-5 | NC1=NC=CC=C1OC | 2-Amino-3-methoxypyridine | AG0006BM | 200g |
| 1020204-12-9 | O=S(=O)(c1cccc(B(O)O)c1)C1CC1 | 3-(Cyclopropylsulfonyl)phenylboronic acid | AG0006BQ | 0.5g |
| 1020198-58-6 | FC1=CC(Cl)=C(Br)C(F)=C1 | 2-Bromo-1-chloro-3,5-difluorobenzene | AG0006BR | 1000g |
| 1020174-04-2 | CN1C=CC(=N1)B1OC(C)(C)C(C)(C)O1 | 1-Methyl-1H-pyrazole-3-boronic acid pinacol ester | AG0006BS | 100g |
| 1020172-07-9 | O=C(NC)C1=NC=CC(OC2=CC=C(NC(NC3=CC(C(C)(C)C)=NN3C4=CC=C5N=CC=CC5= | N-[3-tert-Butyl-1-(quinolin-6-yl)-1H-pyrazol-5-yl]-N’-[2-fluoro-4-[(2-(methylc | AG0006BU | 0.5g |
| 1020149-73-8 | O=C(NC1=CC=C(NC2=NC(N)=NC(C)=C2)C=C1)C3=CC=C(NC4=CC=NC5=CC=CC=C45 | SGI-1027 | AG0006BW | 0.1g |
| 102016-58-0 | O=C(O)/C=C/C1=CC=C(SC)C=C1 | 3-[4-(Methylsulfanyl)Phenyl]Acrylic Acid | AG0006C1 | 400g |
| 102014-77-7 | CN1CCC(CC(O)=O)C1 | 2-(1-Methylpyrrolidin-3-yl)acetic acid | AG0006C5 | 5g |
| 102014-64-2 | Cl.CCOC(CC(N)C)=O | Ethyl 3-aminobutanoate hydrochloride | AG0006C7 | 1g |
| 102014-58-4 | NC1(C)CCCC1.[H]Cl | 1-Methylcyclopentan-1-amine hydrochloride | AG0006C8 | 25g |
| 10202-75-2 | C=CCC(CC=C)(CC=C)O | 4-Allylhepta-1,6-dien-4-ol | AG0006CC | 150g |
| 1020252-82-7 | CCNC(=O)c1ccc(c(c1)C)Br | N-Ethyl 4-bromo-3-methylbenzamide | AG0006CM | 1.2g |
| 1020252-79-2 | CCCNC(=O)c1ccc(c(c1)C)Br | N-Propyl 4-bromo-3-methylbenzamide | AG0006CP | 4.5g |
| 1020252-77-0 | CC(NC(=O)c1ccc(c(c1)C)Br)C | N-Isopropyl 4-bromo-3-methylbenzamide | AG0006CR | 5g |
| 1020252-76-9 | O=C(NCC1=CC=CC=C1)C2=CC=C(Br)C(C)=C2 | N-Benzyl 4-bromo-3-methylbenzamide | AG0006CS | 10g |
| 1020252-75-8 | BrC1=CC(NC(OCC2=CC=CC=C2)=O)=CC([N+]([O-])=O)=C1 | Benzyl 3-bromo-5-nitrophenylcarbamate | AG0006CT | 1g |
| 1020243-02-0 | Clc1ccc2n[nH]cc2c1Cl | 4,5-Dichloro-1H-indazole | AG0006CY | 4g |
| 1019108-05-4 | OC(=O)C1=NC2=C(C=C1)N=CN2 | 3H-Imidazo[4,5-b]pyridine-5-carboxylic acid | AG0005WX | 100g |
| 101909-42-6 | O=C(C1=CNC2=C1C(Cl)=CC=C2)OC | Methyl 4-chloro-1H-indole-3-carboxylate | AG0005X3 | 20g |
| 10191-61-4 | C(#N)N=C(SC)[S-].[K+] | Potassium methyl N-cyanodithioimidocarbonate | AG0005XC | 250g |
| 10191-24-9 | CCCC(O)CC(O)=O | 3-Hydroxyhexanoic Acid | AG0005XG | 6g |
| 10191-18-1 | OCCN(CCS(=O)(O)=O)CCO | N,N-Bis(2-hydroxyethyl)-2-aminoethanesulphonic acid | AG0005XH | 3000g |
| 1019115-71-9 | CCNCC1=CC=C(N)C=C1 | 4-[(ethylamino)methyl]aniline | AG0005XO | 2g |
| 1019115-53-7 | FC1=CC=C(C=2N=C(SC21)N)C | 7-Fluoro-4-methyl-1,3-benzothiazol-2-amine | AG0005XP | 2g |
| 1019111-64-8 | BrC1=NC2=C(S1)C=CC(=C2)Br | 2,5-Dibromo-benzothiazole | AG0005XT | 1g |
| 1019111-62-6 | CC(C1=NN=C(Br)S1)C | 2-Bromo-5-isopropyl-1,3,4-thiadiazole | AG0005XU | 20g |
| 1019208-04-8 | C1(C23OCCO3)CN(CC4=CC=CC=C4)CC2CC1 | 3-Benzyl-3-azaspiro[bicyclo[3.2.1]octane-8,2′-[1,3]dioxolane] | AG0005Y6 | 20g |
| 1019208-03-7 | N1(CC2=CC=CC=C2)COCCOC1 | 3-Benzyl-1,5,3-dioxazepane | AG0005Y7 | 5g |
| 101927-24-6 | COC1=CC(/C=C/C(OCCCCCCCCCCCCCCCCCCCCCC)=O)=CC=C1O | (E)-Docosyl 3-(4-hydroxy-3-methoxyphenyl)acrylate | AG0005Y8 | 0.05g |
| 10192-85-5 | C=CC([O-])=O.[K+] | Potassium Acrylate | AG0005YN | 3000g |
| 1018656-57-9 | C1COC(CN1)C1=CC=NC=C1 | 2-(Pyridin-4-yl)morpholine | AG0005SD | 5.05g |
| 101861-63-6 | O=C(C(N1)=CC2=C1C=C(Cl)C=C2Cl)O | 4,6-Dichloro-1H-indole-2-carboxylic acid | AG0005SL | 15g |
| 101861-61-4 | OC1=C([N+]([O-])=O)C=NC2=CC=C(Cl)C=C12 | 6-Chloro-3-nitroquinolin-4-ol | AG0005SM | 50g |
| 1018690-17-9 | Cl.NNC(=S)C1=CC(F)=CC=C1F | 2，5-Difluorobenzothiohydrazide Hydrochloride | AG0005SR | 7g |
| 1018681-31-6 | BrC1=CC=C(COCC2CC2)C=C1 | 1-Bromo-4-((cyclopropylmethoxy)methyl)benzene | AG0005SS | 10g |
| 1018680-22-2 | CC(N1CC(N)CCC1)=O | 1-Acetyl-3-aminopiperidine | AG0005ST | 5.18g |
| 1018680-09-5 | CN(C1=CC(B(O)O)=CN=C1)C | 3-Dimethylaminopyridine-5-boronic acid | AG0005SU | 1.75g |
| 1018679-79-2 | O=S(N1CCC2=CC3=C(C=NN3C4=CC=C(F)C=C4)C[C@]2(COCC)C1)(C5=CC=C(C(F)(F | Cort108297 | AG0005SV | 0.01g |
| 101870-78-4 | CC(C)C1=CC=C(O)C=N1 | 6-Isopropylpyridin-3-ol | AG0005SY | 2g |
| 101870-60-4 | ClC1=NC2=CC=CC=C2C=C1Br | 3-bromo-2-chloroquinoline | AG0005SZ | 125g |
| 101870-22-8 | CCCOc1ccccn1 | 2-Propoxypyridine | AG0005T1 | 50g |
| 101869-74-3 | OCC1CCC(OC)CC1 | (4-Methoxycyclohexyl)Methanol | AG0005T5 | 1g |
| 1018828-72-2 | O=C(C1=CN2C=CC=C(C(F)(F)F)C2=N1)O | 8-(Trifluoromethyl)imidazo[1,2-a]pyridine-2-carboxylic acid | AG0005TG | 2g |
| 1018828-69-7 | O=C(C1=CN2C=C(C(F)(F)F)C=CC2=N1)O | 6-(Trifluoromethyl)imidazo[1,2-a]pyridine-2-carboxylic acid | AG0005TH | 15g |
| 1017395-56-0 | CC1=C(C2OCCNC2)C=CC=C1 | 2-(2-Methylphenyl)morpholine | AG0005C4 | 1g |
| 1017356-25-0 | CNCC1CN(C(OC(C)(C)C)=O)CCC1 | 1-Boc-3-((Methylamino)methyl)piperidine | AG0005C6 | 10g |
| 1017336-71-8 | CC1CNC2=C(C=C(Br)C=C2)C1 | 6-Bromo-3-methyl-1,2,3,4-tetrahydroquinoline | AG0005C9 | 5g |
| 1017412-53-1 | Brc1c2c(nc(cc2)C(=O)O)ccc1 | 5-Bromoquinoline-2-carboxylic acid | AG0005D1 | 700g |
| 1017403-71-2 | BrC1=CC=C2C=C(C(=NC2=C1)Cl)CO | (7-Bromo-2-chloroquinolin-3-yl)methanol | AG0005D4 | 2g |
| 1017464-08-2 | OCc1cc2c(C)cc(cc2nc1Cl)C | (2-Chloro-5,7-dimethylquinolin-3-yl)methanol | AG0005DP | 2g |
| 1017464-05-9 | FC(C1=NC=CC(C)=N1)(F)F | 4-Methyl-2-(trifluoromethyl)pyrimidine | AG0005DQ | 25g |
| 1017452-64-0 | OC(C1N=C(C2=C(F)C=CC=C2F)SC=1)=O | 2-(2,6-difluorophenyl)thiazole-4-carboxylic acid | AG0005DR | 5g |
| 1017429-39-8 | ClC1=NC2=C(C=CC=C2C=C1CO)CC | (2-Chloro-8-ethylquinolin-3-yl)methanol | AG0005DU | 2g |
| 1017540-91-8 | O=C(OC)CC(CC1)CCC21CCNCC2.[H]Cl | Methyl 2-(3-azaspiro[5.5]undecan-9-yl)acetate hydrochloride | AG0005EC | 30g |
| 101759-74-4 | CC[C@@H](C(=O)O)N(C)C(=O)OC(C)(C)C | (S)-2-((tert-Butoxycarbonyl)(methyl)amino)butanoic acid | AG0005ED | 10g |
| 1021-91-6 | O/N=C1C2=CC=CC=C2C=CC3=CC=CC=C13 | 5H-DIBENZO[A,D][7]ANNULEN-5-ONE OXIME | AG0006MH | 50g |
| 1021-25-6 | O=C1C2(N(C3=CC=CC=C3)CN1)CCNCC2 | 1-Phenyl-1,3,8-triazaspiro[4.5]decan-4-one | AG0006MM | 10g |
| 1021089-12-2 | O=C(OC)CC1=CC=CC(Cl)=C1Br | 2-Bromo-3-chlorophenylacetic acid methyl ester | AG0006MP | 5g |
| 1021022-66-1 | NC1=C(OCCO)C=C(F)C=C1 | 2-(2-Amino-5-fluorophenoxy)ethan-1-ol | AG0006MS | 1g |
| 1021019-03-3 | BrC1=NN2C=CC=CC2=N1 | 2-Bromo-[1,2,4]triazolo[1,5-a]pyridine | AG0006MT | 5g |
| 1021176-69-1 | N1(C2=C(C3=CC=CC=C3)N(C4=CC=CC=C4)N=C2C5=CC=CC=C5)N=CC=C1P(C6CCCC | 5-(Dicyclohexylphosphino)-1′,3′,5′-triphenyl-[1,4′]-bi-1H-pyrazole | AG0006NF | 50g |
| 102115-79-7 | C[C@@]12[C@](C[C@@]3([H])[C@]2([H])C(C)=C(CC[C@@H](C)CO[C@H]4[C@ | Pseudoprotodioscin | AG0006NY | 0.5g |
| 102113-98-4 | C1(C2=CC=CC=C2)=CC=C(NC3=CC=C(C4=CC=CC=C4)C=C3)C=C1 | Bis(4-biphenylyl)amine | AG0006O1 | 1000g |
| 1021243-16-2 | C1CCN(C1)C2=C(C=C(C=C2)C(=O)O)F | 3-Fluoro-4-pyrrolidinobenzoic Acid | AG0006O4 | 25g |
| 102126-71-6 | BrC=1C=C2C(OC(C2=CC1)=O)O | 5-Bromo-3-hydroxyisobenzofuran-1(3H)-one | AG0006O6 | 25g |
| 102126-70-5 | BrC1OC(=O)C2=CC=C(Br)C=C12 | 3,5-dibromo-1,3-dihydro-2-benzofuran-1-one | AG0006O7 | 4g |
| 102123-74-0 | O=C(OC(C)(C)C)N[C@H](C(CCl)=O)CC1=CC=CC=C1 | (3S)-3-(tert-Butoxycarbonyl)amino-1-chloro-4-phenyl-2-butanone | AG0006OA | 500g |
| 102123-28-4 | COC(C1=C(N)C(C#N)=CS1)=O | METHYL 3-AMINO-4-CYANOTHIOPHENE-2-CARBOXYLATE | AG0006OB | 5g |
| 102121-60-8 | O=C(O)C1=CC=C(NC(C2=CC=C3C(C)(C)CCC(C)(C)C3=C2)=O)C=C1 | AM580 | AG0006OE | 0.75g |
| 102120-96-7 | Cl[H].COC1=CC=CC2=C1CCC(C2)NCCC1=CC=CS1 | 5-Methoxy-N-(2-(thiophen-2-yl)ethyl)-1,2,3,4-tetrahydronaphthalen-2-amin | AG0006OJ | 2g |
| 102120-87-6 | CC(c1ccc(cc1)CC(C)C)c1ccc(cc1)CC(C)C | 4,4′-(Ethane-1,1-diyl)bis(isobutylbenzene) | AG0006OL | 2g |
| 10212-20-1 | OC[C@@H]1[C@H]([C@@H](F)[C@H](N2C(N=C(C=C2)N)=O)O1)O | 2′-Deoxy-2′-fluorocytidine | AG0006OP | 9g |
| 1019852-03-9 | Cl[H].Cl[H].O=C(C1CCNCC1)N1CCN(C)CC1 | (4-Methyl-piperazin-1-yl)-piperidin-4-yl-methanone dihydrochloride | AG00065R | 5g |
| 101987-89-7 | OC(=O)C1=CN(C2CC2)c3c(Cl)c(F)c(F)cc3C1=O | 8-Chloro-1-cyclopropyl-6,7-difluoro-1,4-dihydro-4-oxo-3-quinolinecarboxylic | AG00065V | 0.5g |
| 101987-86-4 | CCOC(=O)CC(=O)C1=CC(F)=C(F)C(Cl)=C1F | Ethyl 3-(3-chloro-2,4,5-trifluorophenyl)-3-oxopropanoate | AG00065W | 600g |
| 101980-41-0 | O=[N+](C1=CC=C(C(C)C)C(Br)=C1)[O-] | 2-Bromo-1-Isopropyl-4-Nitrobenzene | AG000663 | 20g |
| 10199-50-5 | NC1=CC(C2=CC=CC=C2)=NN1C | 2-methyl-5-phenylpyrazol-3-amine | AG000665 | 75g |
| 10199-00-5 | C1(C2=NC=CN=C2)=NC=CN=C1 | 2，2′-Bipyrazine | AG000666 | 20g |
| 10198-89-7 | O=C(C1=NC=CC=C1)CC(C2=NC=CC=C2)=O | 1,3-di(2-Pyridyl)-1,3-propanedione | AG000668 | 500g |
| 1019918-41-2 | NC1=NN=C2C=C(Br)C=CN21 | 7-Bromo-[1,2,4]triazolo[4,3-a]pyridin-3-amine | AG00066D | 0.5g |
| 1019918-39-8 | NNC1=NC=CC(Br)=C1 | 4-Bromo-2-hydrazinylpyridine | AG00066E | 50g |
| 101991-76-8 | CC(OC1=CC=C(Cl)C=C1Cl)C(=O)N1CCCCC1 | 2-(2,4-Dichlorophenoxy)-1-(1-piperidyl)-1-propanone | AG00066F | 0.5g |
| 101990-73-2 | ClCC1=CC(Cl)=NC=C1 | 2-Chloro-4-(chloromethyl)pyridine | AG00066G | 5g |
| 101990-70-9 | COC1=NC=C(CCl)C=C1 | 5-(Chloromethyl)-2-methoxypyridine | AG00066I | 30g |
| 101990-69-6 | ClC1=NC(=CC(=C1)CO)Cl | 2,6-Dichloropyridine-4-methanol | AG00066J | 200g |
| 101990-68-5 | OCC1=CN=C(OC2=CC=CC=C2)C=C1 | (6-Phenoxypyridin-3-yl)methanol | AG00066K | 5g |
| 101990-45-8 | BrCC1=CN=C(Br)C=C1 | 2-Bromo-5-(bromomethyl);pyridine | AG00066M | 50g |
| 10199-89-0 | O=[N+](C1=CC=C(Cl)C2=NON=C21)[O-] | 4-Chloro-7-nitrobenzofurazan | AG00066P | 200g |
| 10192-62-8 | CC(=O)Oc1ccc(cc1)C(c1ccc(cc1)OC(=O)C)(C)C | Bisphenol A diacetate | AG0005YO | 2000g |
| 101930-07-8 | O[C@H]1CN(CC2=CC=CC=C2)CC1 | (R)-(+)-1-Benzyl-3-pyrrolidinol | AG0005Z6 | 25g |
| 1019379-49-7 | CCOC(=O)C(=O)CC(=O)C1=CC=CC2=CC=CC=C21 | Ethyl 4-(1-Naphthyl)-2，4-dioxobutanoate | AG000607 | 2g |
| 1019351-46-2 | O=C(N1CCC(N)CC1)OC | Methyl 4-aminopiperidine-1-carboxylate | AG00060A | 25g |
| 1019345-40-4 | CCOC(=O)c1cnc2c(c1Cl)cc(cc2)CC | 3-Quinolinecarboxylic acid, 4-chloro-6-ethyl-, ethyl ester | AG00060B | 2g |
| 1019331-10-2 | CC(C=C1)=CC=C1CN(C(C2=CC=CC=C2Cl)=O)CC(C=C3)=CC=C3C(C=CC=C4)=C4S(NC | 2-Chloro-N-({4-[2-(cyanosulfamoyl)phenyl]phenyl}methyl)-N-[(4-methylphe | AG00060F | 0.75g |
| 101935-40-4 | N(=O)(=O)c1c(Br)c(O)ccc1 | 2-Bromo-3-nitrophenol | AG00060M | 600g |
| 1019453-85-0 | NC1=CC=CC=C1SC2=CC=C(C)C=C2C | 2-[(2,4-Dimethylphenyl)sulfanyl]aniline | AG00060Y | 300g |
| 1019446-41-3 | Fc1ccc(c(c1)Br)OCc1cccc(c1)F | 2-Bromo-4-fluoro-1-(3-fluorobenzyloxy)benzene | AG000611 | 47.3g |
| 1019442-22-8 | NC1=CC(Br)=CC=C1OC(C)C | 5-Bromo-2-(propan-2-yloxy)aniline | AG000614 | 20g |
| 1019398-93-6 | O=C(NC1=NC=CC(C)=C1)C2=CC=C(C)C(N)=C2 | 3-Amino-4-methyl-N-(4-methyl-2-pyridyl)benzamide | AG000615 | 14g |
| 1019506-73-0 | ClC1=C(CNCC2CC2)C=CC=C1 | [(2-Chlorophenyl)methyl](cyclopropylmethyl)amine | AG00061M | 5g |
| 1019575-98-4 | C1=C(C=CC(=C1)N2CCOCC2)C(=N)N | 4-morpholinobenzimidamide | AG000628 | 125g |
| 10220-23-2 | COCCN1CCOCC1 | 4-(2-Methoxyethyl)Morpholine | AG0006VV | 150g |
| 10220-22-1 | C2=C(N1CCCC1)C=CC(=C2)[N+](=O)[O-] | 1-(4-Nitrophenyl)pyrrolidine | AG0006VW | 34g |
| 1022-79-3 | NC1=NC(=O)N(C=C1Br)[C@H]1C[C@H](O)[C@@H](CO)O1 | 5-Bromo-2′-deoxycytidine | AG0006VZ | 150g |
| 1022-45-3 | OC1=C2C=CC=CC2=NC(C3=CC=CC=C3)=N1 | 2-Phenylquinazolin-4(3h)-one | AG0006W4 | 60g |
| 1022-44-2 | Nc1nc(nc2ccccc12)-c1ccccc1 | 4-Quinazolinamine, 2-phenyl- | AG0006W5 | 2g |
| 1022-31-7 | O=C(O)C(N)CC(C1=CC=CC=C1NC=O)=O | 2-Amino-4-(2-formamidophenyl)-4-oxobutanoic acid | AG0006W6 | 0.05g |
| 1022-13-5 | O=C(C1=CC(Cl)=CC=C1NC)C2=CC=CC=C2 | 5-Chloro-2-(methylamino)benzophenone | AG0006W9 | 5000g |
| 1022024-04-9 | OC1CCN(S(=O)(C2=CC=C(Cl)C=C2Cl)=O)CC1 | 1-((2,4-Dichlorophenyl)sulfonyl)piperidin-4-ol | AG0006WD | 0.5g |
| 1022092-33-6 | CC1(C(OB(O1)C2=C[N](N=C2)CCC#N)(C)C)C | 3-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1h-pyrazol-1-yl)propaneni | AG0006X1 | 7g |
| 1022091-93-5 | C1=CC2=NC=C(C=C2C=C1CC(=O)O)Br | 2-(3-Bromoquinolin-6-yl)acetic acid | AG0006X4 | 0.5g |
| 1022091-89-9 | COC(=O)CC1=CC2=CC(=CN=C2C=C1)Br | Methyl 2-(3-bromoquinolin-6-yl)acetate | AG0006X5 | 0.75g |
| 1022091-49-1 | FC1=C(Br)C(F)=C2C=CC=NC2=C1 | 6-Bromo-5，7-difluoroquinoline | AG0006X7 | 95g |
| 1022150-11-3 | O=C(N1C[C@H](N2N=C(C3=CC=C(OC4=CC=CC=C4)C=C3)C5=C(N)N=CN=C52)CCC | (R)-tert-Butyl 3-(4-amino-3-(4-phenoxyphenyl)-1H-pyrazolo[3,4-d]pyrimidin- | AG0006XQ | 75g |
| 1022147-21-2 | OC(=O)[C@@H](Cc1cccc(c1F)F)NC(=O)OC(C)(C)C | D-Phenylalanine, N-[(1,1-dimethylethoxy)carbonyl]-2,3-difluoro- | AG0006XR | 1g |
| 1022128-98-8 | C1=C(C=NC=C1Br)CCC(=O)O | 3-(5-Bromopyridin-3-yl)propanoic acid | AG0006XT | 15g |
| 1022128-96-6 | O=C(O)C1=C(I)C=CC=C1Br | 2-Bromo-6-iodobenzoic acid | AG0006XU | 300g |
| 1022128-82-0 | NC1=CC=C(C=C1)N1CCNCC1=O | 1-(4-Aminophenyl)piperazin-2-one | AG0006XV | 5g |
| 1022128-80-8 | NC1=CC(=CC=C1)N1CCNCC1=O | 1-(3-Aminophenyl)piperazin-2-one | AG0006XW | 1g |
| 1022128-78-4 | COC1=CC=C(NC2=NC=CN=C2)C=C1 | N-(4-Methoxyphenyl)pyrazin-2-amine | AG0006XX | 3g |
| 1021298-68-9 | N#CC1=CC(CC2=NNC(C3=C2C=CC=C3)=O)=CC=C1F | 2-Fluoro-5-((4-oxo-3,4-dihydrophthalazin-1-yl)methyl)benzonitrile | AG0006OR | 50g |
| 1021298-67-8 | O=C(C1CC1)N2CCNCC2.[H]Cl | 1-(Cyclopropylcarbonyl)piperazine hydrochloride | AG0006OS | 200g |
| 102127-34-4 | OC1=CC=C(Br)C(OC)=C1 | 4-Bromo-3-methoxyphenol | AG0006PF | 200g |
| 1021393-00-9 | N#CC1(N(Cc2ccccc2)Cc2ccccc2)COC1 | 3-(Dibenzylamino)oxetane-3-carbonitrile | AG0006PG | 35g |
| 1021392-84-6 | NCC1(N(Cc2ccccc2)Cc2ccccc2)COC1 | 3-Aminomethyl-3-[bis(phenylmethyl)amino]oxetane | AG0006PH | 50g |
| 1021392-83-5 | NCC1(NCc2ccccc2)COC1 | 3-[(Phenylmethyl)amino]-3-oxetanemethanamine | AG0006PI | 5g |
| 1021339-19-4 | ClC1=CN=C2C(NC=C2)=C1 | 6-CHLORO-1H-PYRROLO[3,2-B]PYRIDINE | AG0006PM | 50g |
| 102137-46-2 | NC1=CC=C(OCC2=NC=CC=C2)C=C1 | 4-(Pyridin-2-ylmethoxy)aniline | AG0006PS | 15g |
| 10214-39-8 | O[BH]=O.[Pb].O | Boric acid (HBO2), lead(2+) salt, monohydrate (8CI,9CI) | AG0006PV | 1000g |
| 1021439-57-5 | CN([C@H](C)C1=CC=CC=C1)P2OC3=[C@]([C@]4=C(C=CC=C5)C5=CC=C4O2)C6=C( | (11bR)-N-Methyl-N-[(R)-1-phenylethyl]-dinaphtho[2,1-d:1′,2′-f][1,3,2]dioxap | AG0006Q4 | 4g |
| 1021426-42-5 | C(C)(=O)N1CCN(CC1)C1=CC(=C(C=C1)N)OC | 1-Acetyl-4-(4-amino-3-methoxyphenyl)piperazine | AG0006Q7 | 200g |
| 102146-07-6 | O=C(C(N=C(C1CCCC1)N2)=C2N3CCC)N(CCC)C3=O | DPCPX | AG0006QF | 0.15g |
| 1021493-52-6 | O=Cc1cc(OC)c(c(c1)[N+](=O)[O-])OS(=O)(=O)C(F)(F)F | Trifluoro-methanesulfonic acid 2-methoxy-4-formyl-6-nitro-phenyl ester | AG0006QV | 5g |
| 102153-63-9 | ClC1=CC=C2C=C(C=CC2=C1)S(Cl)(=O)=O | 6-Chloro-2-naphthylsulfonylchloride | AG0006QX | 10g |
| 102153-48-0 | O=[N+](C1=C2C=CC(Br)=CC2=CC=C1)[O-] | 6-Bromo-1-nitronaphthalene | AG0006R0 | 9g |
| 102153-44-6 | IC1=C(Br)C=C2C=CC=CC2=C1 | 2-Bromo-3-iodonaphthalene | AG0006R1 | 75g |
| 101953-61-1 | O=C1N(CCOCC)C2=CC=CC=C2N1 | 1-(2-Ethoxyethyl)-1H-benzo[d]imidazol-2(3H)-one | AG00062I | 0.01g |
| 101952-65-2 | C(=O)(OCCCO)c1cccnc1 | 3-Hydroxypropyl nicotinate | AG00062S | 4.45g |
| 10196-26-6 | OCCN(C(=O)C=C)CCO | 2-Propenamide, N,N-bis(2-hydroxyethyl)- | AG00063J | 50g |
| 1019619-83-0 | N#Cc1ccc(cc1)OCC1CC1 | 4-(Cyclopropylmethoxy)benzonitrile | AG00063P | 48.1g |
| 1019607-55-6 | N#CC1=CC=C(NC2CC2)C=C1 | 4-(Cyclopropylamino)benzonitrile | AG00063T | 30g |
| 101968-85-8 | CC(C)(C)[C@H](NC(NC(C)(C)C)=O)C(O)=O | (S)-2-(3-(Tert-Butyl)ureido)-3,3-dimethylbutanoic acid | AG00063V | 100g |
| 101967-39-9 | NC1=NC(C2=CC(C)=CC=C2C)=CS1 | 4-(2,5-Dimethylphenyl)thiazol-2-ylamine | AG000641 | 2g |
| 101975-23-9 | CC(C1=CC=CC(OC(F)F)=C1)=O | 3′-(Difluoromethoxy)acetophenone | AG00064G | 75g |
| 101975-10-4 | O=C1C=CC(C2=CC=C(OC(F)F)C(OC)=C2)=NN1 | Zardaverine | AG00064I | 2g |
| 101974-69-0 | OCC#CC1CC1 | 3-Cyclopropylprop-2-yn-1-ol | AG00064K | 100g |
| 1019779-04-4 | O=C(CNC1=CC=C(C(F)=C1)F)NC2=CC(CN3CCNCC3)=CC=C2C.Cl.Cl | GW 791343 | AG00064Z | 0.05g |
| 1019770-99-0 | [O-]C(=O)c1nc2c(o1)cccc2.[Na+] | Sodium benzo[d]oxazole-2-carboxylate | AG000651 | 5g |
| 1019767-63-5 | BrC1=C(OCC2=CC=CC=C2)C=CN=C1 | 4-(benzyloxy)-3-bromopyridine | AG000652 | 25g |
| 101979-45-7 | C(C)(C)[C@@H]1N(C(=O)C)C(=S)SC1 | (S)-3-Acetyl-4-isopropylthiazolidine-2-thione | AG000653 | 15g |
| 1018446-95-1 | C(=O)(OC(C)(C)C)n1ncc(c1)N | tert-Butyl 4-amino-1H-pyrazole-1-carboxylate | AG0005PF | 100g |
| 1018446-60-0 | O=C(C1=NNC(O)=C1)OC | METHYL 5-HYDROXY-PYRAZOLE-3-CARBOXYLATE | AG0005PG | 75g |
| 1018441-16-1 | CNC1=CC=C2C(NC=C2)=N1 | N-methyl-1H-Pyrrolo[2,3-b]pyridin-6-amine | AG0005PK | 20g |
| 10185-62-3 | CC1ON=C(C2=CC(S(Cl)(=O)=O)=CC=C2)N=1 | 3-(5-Methyl-1,2,4-oxadiazol-3-yl)benzenesulfonyl chloride | AG0005PU | 5g |
| 1018505-59-3 | NC1=NC=C(N2CCN(CC)CC2)C=C1 | 5-(4-Ethylpiperazin-1-yl)pyridin-2-amine | AG0005Q3 | 1.25g |
| 101854-42-6 | C1CCC(CC1)NC1CCCCC1.CC(C)(C)OC(=O)N[C@H](CCNC(=O)OCC1=CC=CC=C1)C( | Boc-D-Dab(Z)-Oh DCHA | AG0005RA | 20g |
| 101860-97-3 | NC1=NC=CC=C1CC(O)=O | 2-(2-Aminopyridin-3-yl)acetic acid | AG0005RI | 55g |
| 1018678-50-6 | O=CC1=CC=CC=C1C(F)F | 2-(Difluoromethyl)benzaldehyde | AG0005S2 | 15g |
| 1018678-39-1 | O=C(O)C1=C(C(F)(F)F)N=CC=C1Cl | 4-Chloro-2-(trifluoroMethyl)nicotinic acid | AG0005S4 | 2g |
| 1018678-38-0 | O=C(O)C1=C(Cl)N=CC=C1N | 4-Amino-2-chloronicotinic acid | AG0005S5 | 125g |
| 1018678-37-9 | O=C(OC)C1=C(Cl)N=CC=C1N | Methyl 4-amino-2-chloronicotinate | AG0005S6 | 35g |
| 1018665-73-0 | COC1=C(CC(CO)N)C=CC=C1 | 2-Amino-3-(2-methoxyphenyl)propan-1-ol | AG0005S8 | 1g |
| 1018663-45-0 | O=CC1C2=C(CCC2)NN=1 | 1,4,5,6-Tetrahydrocyclopenta[c]pyrazole-3-carbaldehyde | AG0005S9 | 142g |
| 10166-39-9 | ClC1=C(C=CC=C1)NC1=C(C(=O)O)C=CC=C1 | 2-((2-Chlorophenyl)amino)benzoic acid | AG00054F | 0.2g |
| 10167-97-2 | NC1=NC=C(C=C1)OC | 2-Amino-5-methoxypyridine | AG000550 | 200g |
| 1016715-95-9 | CNC(=O)c1cccc(c1)S(=O)(=O)Cl | 3-(Methylcarbamoyl)benzenesulfonyl chloride | AG00055A | 2g |
| 1016769-81-5 | O=C1CCN(C2=CC=CC(Br)=C2)CC1 | 1-(3-Bromophenyl)piperidin-4-one | AG00055W | 1g |
| 1016731-24-0 | O=C(N1CC(CN)C1)OCC2=CC=CC=C2 | Benzyl 3-(aminomethyl)azetidine-1-carboxylate | AG00056D | 5g |
| 101682-68-2 | O=CC1=CC=C([N+]([O-])=O)C(Br)=C1 | 3-Bromo-4-nitrobenzaldehyde | AG000572 | 175g |
| 10168-00-0 | Brc1c(C)cncc1 | 4-Bromo-3-methylpyridine | AG000579 | 10g |
| 1016889-72-7 | C1(Br)C(OCCC)=CC=C(F)C=1 | 2-Bromo-4-fluoro-1-propoxybenzene | AG00057A | 40g |
| 1016878-52-6 | BrC1=CC2=C(NCC(N2)=O)C=C1 | 7-Bromo-3,4-dihydro-1H-quinoxalin-2-one | AG00057C | 40g |
| 1020743-95-6 | Cl.COC(CN)(C)C | 2-METHOXY-2-METHYLPROPAN-1-AMINE HYDROCHLORIDE | AG0006KN | 1g |
| 1020743-28-5 | N#CC1=C2N=CC=C(Br)C2=CC=C1 | 4-Bromoquinoline-8-carbonitrile | AG0006KO | 5g |
| 102074-60-2 | OCC1=C(OC)C=NC=C1 | (3-Methoxypyridin-4-yl)methanol | AG0006L3 | 10g |
| 102074-19-1 | C(O)c1cc(C)cnc1 | (5-Methylpyridin-3-yl)methanol | AG0006L6 | 100.7g |
| 102089-75-8 | O=S(OC[C@H](NC(OC(C)(C)C)=O)C1=CC=CC=C1)(C)=O | (R)-2-((tert-Butoxycarbonyl)amino)-2-phenylethyl methanesulfonate | AG0006LQ | 1100g |
| 102089-74-7 | [C@@H](NC(OC(C)(C)C)=O)(C1=CC=CC=C1)CO | Boc-D-phenylglycinol | AG0006LR | 2000g |
| 102088-39-1 | Oc1c2Cc3cc(cc(Cc4cc(cc(Cc5cc(cc(Cc6cc(cc(Cc7cc(cc(Cc1cc(c2)S(O)(=O)=O)c7O)S( | 4-Sulfocalix[6]arene | AG0006LU | 2g |
| 102082-89-3 | O=C(O)/C=C/C1=C(F)C=CC=C1F | 2,6-Difluorocinnamic Acid | AG0006LW | 150g |
| 1021002-43-6 | COC1=CC(OC)=CC(NCCO)=C1 | 2-((3,5-Dimethoxyphenyl)amino)ethanol | AG0006M0 | 0.75g |
| 1020997-14-1 | C1=C(C=C(C=C1Cl)Cl)C2=NOC(=C2)N | 3-(3,5-Dichlorophenyl)-1,2-oxazol-5-amine | AG0006M2 | 3g |
| 1020966-78-2 | BrC1=C2C(=O)COC2=CC=C1 | 4-Bromobenzofuran-3(2H)-one | AG0006M5 | 15g |
| 10210-32-9 | C(C)(=O)C1=CC2=CC3=CC=CC=C3C=C2C=C1 | 2-Acetylanthracene | AG0006ME | 25g |
| 10210-28-3 | C1=C(C(=CC2=CC3=CC=CC=C3C=C12)C(=O)O)C(=O)O | Anthracene-2,3-dicarboxylic acid | AG0006MF | 2g |
| 10210-17-0 | OCCCC1=CC=C(O)C=C1 | 3-(4-Hydroxyphenyl)-1-propanol | AG0006MG | 25g |
| 1020253-15-9 | COC1=CN=C(Cl)C=C1Br | 4-Bromo-2-chloro-5-methoxypyridine | AG0006D3 | 75g |
| 1020253-14-8 | N#CC1=CN=C(Cl)C(F)=C1 | 6-Chloro-5-fluoronicotinonitrile | AG0006D4 | 125g |
| 1020253-13-7 | BrC1=CCC(CC1)(C)C | 1-Bromo-4,4-dimethylcyclohex-1-ene | AG0006D5 | 95g |
| 1020253-06-8 | O=S(C1=CC=C(Br)C(C(F)(F)F)=C1)(NC(C)(C)C)=O | 4-Bromo-N-tert-butyl-3-(trifluoromethyl)benzenesulfonamide | AG0006DC | 1.25g |
| 1020253-00-2 | O=S(C1=CC=C(Br)C(C(F)(F)F)=C1)(NCCC)=O | N-Propyl 4-Bromo-3-trifluoromethylbenzenesulfonamide | AG0006DI | 10g |
| 1020253-85-3 | COC1=C(Br)N=CC(N)=C1 | 6-Bromo-5-methoxypyridin-3-amine | AG0006DX | 10g |
| 1020253-25-1 | FC(F)(F)OC1=CC(Br)=C2N=CC=CC2=C1 | 8-Bromo-6-trifluoromethoxyquinoline | AG0006E0 | 3g |
| 1020253-19-3 | Clc1cnc(c(c1)F)N(C)C | 5-Chloro-2-(N,N-dimethylamino)-3-fluoropyridine | AG0006E6 | 3.5g |
| 1020253-18-2 | Clc1cnc(c(c1)F)N1CCCC1 | 5-Chloro-3-fluoro-2-(pyrrolidin-1-yl)pyridine | AG0006E7 | 22.1g |
| 1020253-17-1 | Clc1cnc(c(c1)F)N1CCOCC1 | 4-(5-Chloro-3-fluoro-2-pyridinyl)morpholine | AG0006E8 | 16.2g |
| 1020253-16-0 | OC1=C(Br)N=C(Cl)C=C1 | 2-Bromo-6-chloro-3-hydroxypyridine | AG0006E9 | 48.8g |
| 102029-44-7 | [C@H]2(CC1=CC=CC=C1)NC(OC2)=O | (R)-4-BENZYL-2-OXAZOLIDINONE | AG0006EE | 2000g |
| 1020329-80-9 | CC(C)(C)OC(=O)N1CCC(CC1)=CBr | tert-Butyl 4-(bromomethylene)piperidine-1-carboxylate | AG0006EH | 10g |
| 1020315-31-4 | O=C(N(CC1)CCC1=CC2=CC(OC3=CC=C(C=N3)C(F)(F)F)=CC=C2)NC4=CC=CN=N4 | Redafamdastat | AG0006EM | 0.5g |
| 102029-92-5 | NC(=N)NCCC[C@@H](C(=O)N[C@H](C(=O)O)Cc1ccccc1)N.CC(=O)O | L-Phenylalanine, L-arginyl-, diacetate (9CI) | AG0006EO | 0.8g |
| 102029-88-9 | [NaH].CC(=O)NC1C(O)OC(COP(O)(O)=O)C(O)C1O | N-Acetyl-D-glucosamine-6-phosphate disodium salt | AG0006EP | 0.15g |
| 102029-87-8 | O[C@@H]1[C@@H](COP(=O)(OP(=O)(O)[O-])[O-])O[C@H]([C@@H]1O)n1cnc2 | Adp di(monocyclohexylammonium) salt | AG0006EQ | 7g |
| 102029-80-1 | Br.C[C@H](N)C(N)=O | H-ALA-NH2 HBR | AG0006ER | 20g |
| 102170-56-9 | NC1=C(C)C=C([N+]([O-])=O)C=C1Br | 2-Bromo-6-methyl-4-nitroaniline | AG0006TC | 200g |
| 102170-53-6 | NC1=CC(Cl)=C(Br)C=C1OC | 4-Bromo-5-chloro-2-methoxyaniline | AG0006TD | 500g |
| 102170-52-5 | NC1=CC(Cl)=C(C)C=C1Br | 2-Bromo-5-chloro-4-methylaniline | AG0006TE | 125g |
| 1021868-92-7 | O=C(C1=CC=C2C=CC=CC2=C1)CCN(CC3=CC=CC=C3)C(C)C.[H]Cl | ZM39923 hydrochloride | AG0006TM | 2.25g |
| 1021868-08-5 | CC1(C)C(C)(C)OB(C2=C3C=CC=NC3=CC=C2)O1 | 5-(tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline | AG0006TO | 2g |
| 1021860-94-5 | FC(C1=CC(C)=CC=C1B(O)O)(F)F | 4-Methyl-2-(trifluoromethyl)phenylboronic acid | AG0006TP | 30g |
| 1021859-29-9 | CN1N=C(C(O)=O)C2=C1C=C(Br)C=C2 | 6-Bromo-1-methyl-1h-indazole-3-carboxylic acid | AG0006TT | 5g |
| 169870-82-0 | CC(C)(C(NC(OC(C)(C)C)=O)C(O)=O)C | BOC-DL-TLE-OH | AG0006TV | 75g |
| 102185-49-9 | Clc1c(Br)ccc2c1c(c[nH]2)OP(=O)([O-])[O-].[K+].[K+] | Potassium 5-bromo-4-chloro-1h-indol-3-yl phosphate | AG0006U1 | 1g |
| 102185-48-8 | CC(OC1=CNC2=C1C=C(Br)C(Cl)=C2)=O | 5-Bromo-6-chloro-1H-indol-3-yl acetate | AG0006U2 | 1g |
| 102185-45-5 | C1CCC(CC1)NC1CCCCC1.CN([C@H](CC1=CC=CC=C1)C(O)=O)C(=O)OC(C)(C)C | Boc-D-N-Me-Phe DCHA | AG0006U4 | 20g |
| 102185-38-6 | CC(C)(C)OC(N[C@H](C(O)=O)CCCNC(NS(C1=C(C)C(C)=C(C=C1C)OC)(=O)=O)=N)= | Boc-Arg(Mtr)-OH | AG0006U7 | 5g |
| 102185-34-2 | O=C(N1[C@@H](C(ON2C(CCC2=O)=O)=O)CCC1)OC(C)(C)C | Boc-D-Pro-OSu | AG0006U9 | 50g |
| 1021919-08-3 | Cl.NC[C@@H]1CC[C@@H](O)CC1 | trans-4-(aminomethyl)cyclohexanol hydrochloride | AG0006UA | 1g |
| 1021918-86-4 | O=C(N1C=NC2=CC(B3OC(C)(C)C(C)(C)O3)=CC=C12)OC(C)(C)C | tert-Butyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzo[d]imidaz | AG0006UB | 5g |
| 1015845-83-6 | CC(C)c1ccc(cc1)n2cc(C=O)cn2 | 1-(4-Isopropylphenyl)-1H-pyrazole-4-carbaldehyde | AG0004V5 | 1g |
| 1015845-71-2 | CC1=CN(C2=CC(Cl)=NC=N2)N=C1 | 4-Chloro-6-(4-methyl-1H-pyrazol-1-yl)pyrimidine | AG0004VE | 5g |
| 1015846-32-8 | ClC1(=NC=NC=C1C(C)C) | 4-CHLORO-5-ISOPROPYLPYRIMIDINE | AG0004VQ | 10g |
| CAS_Number | SMILES | Chemical_Name | Catalog_Number | Inventory |
| 1015846-76-0 | Cc1cnc2c(Cl)c(nn2c1)C(O)=O | 3-Chloro-6-methylpyrazolo[1,5-a]pyrimidine-2-carboxylic acid | AG0004WO | 8g |
| 1022128-75-1 | CCOC(=O)C1(CCN(CC1)C(=O)OC(C)(C)C)C(C)C | Ethyl 1-Boc-4-isopropyl-4-piperidinecarboxylate | AG0006XY | 3g |
| 1022094-03-6 | C[C@@H]1NCCOC1.[H]Cl | (S)-3-Methylmorpholine hydrochloride | AG0006Y2 | 170g |
| 1022094-01-4 | C(=O)(OC(C)(C)C)N1CCOC[C@@H]1C | (S)-N-Boc-3-Methylmorpholine | AG0006Y3 | 30g |
| 102212-98-6 | CC(N(C(C)C)P(O[C@@H]1[C@@H](COC(C2=CC=C(OC)C=C2)(C3=CC=C(OC)C=C3) | DMT-dC(bz) Phosphoramidite | AG0006Y6 | 30g |
| 10221-57-5 | CCOCC(C)OCC | Propane, 1,2-diethoxy- | AG0006YB | 200g |
| 1022158-35-5 | BrC1=CC=CC2=C1C=NN2C1CCCCO1 | 4-BROMO-1-(TETRAHYDRO-2H-PYRAN-2-YL)-1H-INDAZOLE | AG0006YH | 25g |
| 1022150-12-4 | NC1=C2C(N([C@H]3CNCCC3)N=C2C4=CC=C(OC5=CC=CC=C5)C=C4)=NC=N1 | (R)-3-(4-Phenoxyphenyl)-1-(piperidin-3-yl)-1H-pyrazolo[3,4-d]pyrimidin-4-a | AG0006YL | 10g |
| 10222-62-5 | O=C(C1=CC(OC)=NC2=CC=CC=C12)O | 2-Methoxyquinoline-4-Carboxylic Acid | AG0006YX | 50g |
| 10222-61-4 | O=C(C1=CC(OCCCC)=NC2=CC=CC=C12)O | 2-Butoxyquinoline-4-carboxylic Acid | AG0006YY | 10g |
| 10222-49-8 | CC1=NC2=CC=CC=C2C=C1Cl | 3-Chloro-2-methylquinoline | AG0006Z0 | 0.4g |
| 10222-01-2 | NC(=O)C(Br)(Br)C#N | Dibromocyanoacetamide | AG0006Z3 | 100g |
| 102229-10-7 | C[Si](OCCO)(C(C)(C)C)C | Ethanol, 2-[[(1,1-dimethylethyl)dimethylsilyl]oxy]- | AG0006ZG | 413g |
| 102226-40-4 | O=C1NC(C=NC=C2)=C2OC1 | 2H-Pyrido[4,3-b][1,4]oxazin-3(4H)-one | AG0006ZJ | 2g |
| 102236-22-6 | CCOC1=C(C=CC(=C1)[N+](=O)[O-])Cl | 1-Chloro-2-ethoxy-4-nitrobenzene | AG000708 | 50g |
| 102151-33-7 | COC1=C(Cl)C=C(C=C1)C#N | 3-Chloro-4-Methoxybenzonitrile | AG0006R7 | 25g |
| 10215-33-5 | C(CCC)OCCCO | 3-Butoxypropan-1-ol | AG0006RF | 75g |
| 10215-25-5 | NC1=CC2=C(C=C1)CC3=C(C=C(N)C=C3)S2(=O)=O | 3,6-THIOXANTHENEDIAMINE-10,10-DIOXIDE | AG0006RH | 10g |
| 102154-41-6 | OC(=O)CS(=O)(=O)C=Cc1ccccc1 | Acetic acid, 2-[(2-phenylethenyl)sulfonyl]- | AG0006RW | 0.3g |
| 102170-51-4 | O=[N+](C1=CC(C(N)=O)=CC(B(O)O)=C1)[O-] | 3-Aminocarbonyl-5-nitrophenylboronic acid | AG0006S8 | 10g |
| 102170-39-8 | O=CC1=CC=C(N)C=C1[N+]([O-])=O | 4-Amino-2-nitrobenzaldehyde | AG0006SB | 2g |
| 102169-99-3 | CC1=CC(Br)=C(N)C=C1[N+]([O-])=O | 2-Bromo-4-Methyl-5-Nitroaniline | AG0006SG | 200g |
| 102169-88-0 | OC1=C(Cl)C2=C(C=C(C=C2)Br)C=C1 | 6-Bromo-1-chloronaphthalen-2-ol | AG0006SI | 465g |
| 102169-54-0 | C#CCCCCN.[H]Cl | Hex-5-yn-1-amine hydrochloride | AG0006SL | 2g |
| 102169-52-8 | NNC(=O)c1ccccc1S(=O)(=O)N | 2-(Hydrazinecarbonyl)benzenesulfonamide | AG0006SM | 3g |
| 102169-44-8 | NC1=CC(C)=C(Br)C=C1N | 4-Bromo-5-methylbenzene-1,2-diamine | AG0006SN | 300g |
| 10217-34-2 | CCO[Si](OCC)(CCC1CC2OC2CC1)OCC | (2-(7-Oxabicyclo[4.1.0]heptan-3-yl)ethyl)triethoxysilane | AG0006SU | 4000g |
| 102185-33-1 | O=P([O-])([O-])OC1=CNC2=C1C(Cl)=C(Br)C=C2.[Na+].[Na+] | 5-Bromo-4-chloro-3-indolyl phosphate disodium salt 1.5-hydrate | AG0006SX | 10g |
| 1021910-91-7 | OCCCCC1CNCCC1 | 4-(Piperidin-3-yl)butan-1-ol | AG0006UE | 20g |
| 1021878-40-9 | N1[C@@H]2[C@H](CC1)CNC2=O | (3aR,6aR)-rel-Hexahydropyrrolo[3,4-b]pyrrol-6(2H)-one | AG0006UF | 3g |
| 1021874-48-5 | O=C1NCC2=C1C=CC=C2C(C)=O | 4-Acetylisoindolin-1-one | AG0006UH | 0.75g |
| 1021871-37-3 | BrCc1cc(C#N)ccc1Cl | 3-(Bromomethyl)-4-chlorobenzonitrile | AG0006UK | 0.75g |
| 1021871-35-1 | N#CC1=CC(CO)=CC(Cl)=C1 | 3-Chloro-5-(hydroxymethyl)benzonitrile | AG0006UL | 2g |
| 1021871-34-0 | OCC1=CC(C#N)=CC(F)=C1 | 3-Fluoro-5-(hydroxymethyl)benzonitrile | AG0006UM | 0.2g |
| 102191-92-4 | O=CCO[Si](C)(C(C)(C)C)C | (Tert-Butyldimethylsilyloxy)Acetaldehyde | AG0006UO | 200g |
| 102187-19-9 | CCN(CC)C1=CC(C)=C(C=C1)N=C1/C=C(C(=O)NC2=CC=CC=C2)C(=O)C2=C1C=CC=C2 | 2-Phenylcarbamoyl-1,4-Naphthoquinone-4-(4-Diethylamino-2-Methylphenyl | AG0006UQ | 3g |
| 10219-26-8 | CC(NC1=CC(C)=CC=C1)C | 3-methyl-N-(propan-2-yl)aniline | AG0006UV | 10g |
| 1021949-47-2 | C=C(C1=CN=CN1)C2=CC=CC(C)=C2C | 5-[1-(2,3-Dimethylphenyl)ethenyl]-1H-imidazole | AG0006UZ | 125g |
| 1021919-65-2 | CC(C)(C)OC(=O)N1C(=O)NC2=C1N=CC(Br)=C2 | tert-Butyl 6-bromo-2-oxo-1H-imidazo[4,5-b]pyridine-3(2H)-carboxylate | AG0006V5 | 3g |
| 1021919-24-3 | CC1=NN(C=C1Br)C(=O)OC(C)(C)C | tert-Butyl 4-bromo-3-methyl-1H-pyrazole-1-carboxylate | AG0006V9 | 60.5g |
| 102195-80-2 | O=C(N1[C@H](C(OC)=O)CC(C1)=O)OC(C)(C)C | N-Boc-4-oxo-L-proline methyl ester | AG0006VG | 5000g |
| 102195-79-9 | O=C(N1[C@H](C(OC)=O)C[C@H](O)C1)OC(C)(C)C | N-Boc-cis-4-hydroxy-L-proline methyl ester | AG0006VH | 1500g |
| 1023357-66-5 | F[B-](F)(CCC(OC(C)(C)C)=O)F.[K+] | Potassium 3-trifluoroboratopropionate tert-butyl ester | AG00077E | 200g |
| 1023357-64-3 | F[B-](F)(CCC(OCC)=O)F.[K+] | Potassium (3-ethoxy-3-oxopropyl)trifluoroborate | AG00077F | 75g |
| 1023357-63-2 | O=C(OC)CC[B-](F)(F)F.[K+] | Potassium 3-Trifluoroboratopropionate Methyl Ester | AG00077G | 50g |
| 1023305-87-4 | Cl.CC1(F)CCNCC1 | 4-Fluoro-4-methylpiperidine hydrochloride | AG00077J | 15g |
| 1023301-88-3 | O=C(N1CC2(CCNCC2)CCC1)OC(C)(C)C.[H]Cl | TERT-BUTYL 2,9-DIAZASPIRO[5.5]UNDECANE-2-CARBOXYLATE HYDROCHLORID | AG00077K | 5g |
| 1023301-84-9 | Cl.C1C2(CN1)CCN(CC2)C(=O)OC(C)(C)C | tert-Butyl 2,7-diazaspiro[3.5]nonane-7-carboxylate, HCl | AG00077L | 500g |
| 1023301-73-6 | O=C(N1[C@@H](COC)CNCC1)OC(C)(C)C | (R)-1-N-BOC-2-METHOXYMETHYLPIPERAZINE | AG00077M | 8g |
| 102331-61-3 | CCC(N1C(=O)C=CC1=O)C | 1-(butan-2-yl)-2,5-dihydro-1H-pyrrole-2,5-dione | AG00077W | 2g |
| 102331-54-4 | CC1=NC=2C3=NC(=CC=C3C(C(C2C=C1)=O)=O)C | 2,9-Dimethyl-1,10-phenanthroline-5,6-dione | AG00077X | 5g |
| 1023531-08-9 | O=C(C1=C2N=C(N)SC2=CC(Cl)=C1)OC | Methyl 2-amino-6-chlorobenzo[d]thiazole-4-carboxylate | AG000783 | 5g |
| 102353-42-4 | S=C(N)NCCOC | 1-(2-Methoxyethyl)thiourea | AG000786 | 10g |
| 10235-65-1 | ClC1=CC(Cl)=NC(C2=NC=CC=C2)=N1 | 4,6-Dichloro-2-(2-pyridinyl)pyrimidine | AG00078L | 125g |
| 10234-66-9 | O=C1CC=NN1C | 1-Methyl-1H-pyrazol-5(4H)-one | AG00078Q | 300g |
| 1023595-19-8 | O=C(N(CC1)CCC21CCCNC2)OC(C)(C)C | tert-Butyl 2,9-diazaspiro[5.5]undecane-9-carboxylate | AG00078S | 100g |
| 1023595-17-6 | OB(C1=CC=CC2=C1C=NN2)O | Indazole-4-boronic acid | AG00078T | 45.7g |
| 1022980-69-3 | O=C(OC)C1=C(C#N)C=CC=C1CBr | Methyl 2-(bromomethyl)-6-cyanobenzoate | AG00075E | 16g |
| 10230-61-2 | SCC1=CC(C)=C(C)C=C1CS | 4,5-Bis(mercaptomethyl)-o-xylene | AG00075K | 9g |
| 10230-26-9 | Br[C@H]1[C@@H](CCC1)Br | trans-1,2-dibromocyclopentane | AG00075N | 200g |
| 1023-17-2 | COC1=CC=C(C=C1)C(=O)CC1=CC=CC=C1 | 4′-Methoxy-2-phenylacetophenone | AG00075Z | 200g |
| 1023-01-4 | CC1=CN2C(C=C1)=NC(C3=CC=C(Br)C=C3)=C2 | 2-(4-Bromophenyl)-6-methylimidazo[1,2-a]pyridine | AG000760 | 75g |
| 102308-97-4 | NC1=CC2=C(N(C)C=C2)C=C1 | 5-Amino-1-N-methylindole | AG000761 | 125g |
| 102308-92-9 | CN(C)CCC1CCNCC1.[H]Cl.[H]Cl | N,N-Dimethyl-2-(piperidin-4-yl)ethanamine dihydrochloride | AG000762 | 25g |
| 102308-62-3 | NC(CC(O)=O)C1=CC=C(C=C1)[N+]([O-])=O | 3-Amino-3-(4-nitro-phenyl)-propionic acid | AG000765 | 500g |
| 102308-53-2 | NC1=CC2=C(C=C1)C=C(C)N2 | 2-methyl-1H-Indol-6-amine | AG000767 | 8g |
| 102308-43-0 | BrC1=CC=CC2=C1COC2=O | 4-BROMO-2-BENZOFURAN-1(3H)-ONE | AG000769 | 200g |
| 102301-81-5 | C#CC1=CC=CC2=C1C=CN2 | 4-Ethynyl-1H-indole | AG00076J | 1g |
| 1023290-12-1 | O=CC1=CC(O)=CC(F)=C1 | 3-Fluoro-5-hydroxybenzaldehyde | AG00076Q | 150g |
| 10233-87-1 | [O-]P(=O)([O-])[O-].[O-]P(=O)([O-])[O-].[Mg+2].[Mg+2].[Mg+2].O.O.O.O.O | Phosphoric acid, magnesium salt (2:3), pentahydrate (8CI,9CI) | AG000775 | 13000g |
| 10233-13-3 | C(CCCCCCCCCC)C(=O)OC(C)C | Isopropyl dodecanoate | AG000776 | 3000g |
| 10231-84-2 | C[C@@H]1O[C@@H](Oc2ccc(cc2)[N+](=O)[O-])[C@@H](O)[C@H](O)[C@@H]1 | 4-Nitrophenyl-Alpha-L-Fucopyranoside | AG00077B | 6g |
| 10250-64-3 | O=C(C1=CC(C2=CC=CC=C2)=NN1C)O | 1-Methyl-3-phenyl-1H-pyrazole-5-carboxylic acid | AG0007LC | 20g |
| 10250-63-2 | O=C(C1=CC(C2=CC=CC=C2)=NN1C)OCC | Ethyl 1-methyl-3-phenyl-1H-pyrazole-5-carboxylate | AG0007LD | 20g |
| 10250-61-0 | O=C(C1=NN(C)C(C)=C1)OC | Methyl 1,5-dimethyl-1H-pyrazole-3-carboxylate | AG0007LE | 14g |
| 10250-59-6 | O=C(C1=CC(C)=NN1C)OC | Methyl 1,3-dimethyl-1H-pyrazole-5-carboxylate | AG0007LG | 175g |
| 10250-48-3 | O=C(OC)CC(C)(C)C | Methyl Tert-Butylacetate | AG0007LI | 25g |
| 10250-27-8 | CC(NCC1=CC=CC=C1)(CO)C | 2-(Benzylamino)-2-Methylpropan-1-Ol | AG0007LL | 30g |
| 1025065-69-3 | FC(F)(F)OC1=CC(C2=CN=C3C=CC(NCC4CCN(C)CC4)=NN32)=CC=C1 | SGI-1776 | AG0007LT | 2g |
| 1025029-60-0 | CCOC(CC(C1CN(C(OC(C)(C)C)=O)C1)=O)=O | 1-Boc-3-(3-ethoxy-3-oxopropanoyl)azetidine | AG0007LX | 1g |
| 102508-03-2 | COC(=O)[C@@H]1CC[C@@H](N1Cc1ccccc1)C(=O)OC | 2,5-Pyrrolidinedicarboxylic acid, 1-(phenylmethyl)-, 2,5-dimethyl ester, (2R,5 | AG0007M0 | 15g |
| 102507-49-3 | O=S(O)(ON1C(C)(C)[C@H](N)C1=O)=O | (S)-3-Amino-2,2-dimethyl-4-oxoazetidin-1-yl hydrogen sulfate | AG0007M2 | 15g |
| 102507-18-6 | O=C(OC(C)(C)C)N[C@H]([C@H](c1ccccc1)O)C(=O)O | (2R, 3S)/(2S, 3R)-Racemic boc-beta-hydroxyphenylalanine | AG0007M5 | 5g |
| 102507-13-1 | CC(C)(O)[C@H](NC(OC(C)(C)C)=O)C(O)=O | N-Boc-(S)-2-amino-3-hydroxy-3-methylbutanoic acid | AG0007M6 | 125g |
| 102503-23-1 | C(NC)c1c(OC)cc(cc1)OC | 1-(2,4-Dimethoxyphenyl);-N-methylmethanamine | AG0007MH | 100g |
| 1025113-78-3 | O=CC1=CC=C([B-](F)(F)F)S1.[K+] | Potassium 5-formylthiophene-2-trifluoroborate | AG0007MJ | 125g |
| 102519-34-6 | O[C@H]1[C@@]([C@@H]2CC[C@]3([C@@]4(CC[C@]5(CCC(C[C@H]5C4=CC[C | (2α,3α,4α)-2,3,23-Trihydroxyolean-12-en-28-oic acid | AG0007MN | 0.005g |
| 10251-17-9 | CCCCCCCC(=O)Oc1ccc2ccccc2c1 | 2-Naphthyl caprylate | AG0007N5 | 25g |
| 102522-32-7 | O=C(OC(C)(C)C)CCCCCCCN | Tert-butyl 8-aminooctanoate | AG0007NA | 50g |
| 102520-97-8 | O=C(OC(C)(C)C)NC(C)(C)CO | N-Boc-2-amino-2-methyl-1-propanol | AG0007NC | 199g |
| 1022920-59-7 | CCOC(=O)c1cnc2ccnn2c1 | Ethyl Pyrazolo[1,5-a]Pyrimidine-6-Carboxylate | AG00073Y | 20g |
| 1022915-31-6 | O[C@@H]1CN(CC2=CC=CC=C2)CCOC1 | (R)-4-Benzyl-1,4-oxazepan-6-ol | AG000741 | 0.75g |
| 102292-50-2 | C1(=C(C=CC=C1Cl)Cl)CN1CCNCC1 | 1-(2,6-Dichlorobenzyl)piperazine | AG000746 | 40g |
| 10229-11-5 | OCCC#CC1=CC=CC=C1 | 4-PHENYLBUT-3-YN-1-OL | AG00074K | 25g |
| 10229-10-4 | CC#CCCO | Pent-3-Yn-1-Ol | AG00074L | 125g |
| 1022961-12-1 | O=C(O)C1=CC(F)=CC(Cl)=C1N | 2-Amino-3-chloro-5-fluorobenzoic acid | AG00074P | 10g |
| 1022931-73-2 | C(F)(F)(F)c1c2c([nH]n1)CCN(C2)C(=O)OC(C)(C)C | 5-tert-Butoxycarbonyl-3-(trifluoromethyl)-4,5,6,7-tetrahydro-1H-pyrazolo[4,3 | AG00074R | 25g |
| 1022931-45-8 | FC(C1=NNC2=C1COCC2)(F)F | 1,4,6,7-Tetrahydro-3-(trifluoromethyl)pyrano-[4,3-c]-pyrazole | AG00074S | 0.75g |
| 1022922-17-3 | OB(c1cc(ccc1Cl)C(=O)C)O | 5-Acetyl-2-chlorophenylboronic acid | AG00074T | 75g |
| 1022922-16-2 | FC(F)(F)OC1=CC=C(Cl)C(B(O)O)=C1 | 2-Chloro-5-(trifluoromethoxy)phenylboronic acid | AG00074U | 50g |
| 102297-71-2 | CCOC(=O)c1cc(O)ccc1Br | Ethyl 2-bromo-5-hydroxybenzoate | AG00074V | 15g |
| 102297-41-6 | O=C(OC(C)(C)C)NCC1=CC=CN=C1 | N-Boc-3-(aminomethyl)pyridine | AG00074X | 350g |
| 102296-82-2 | O=C1CCC2=C1C=C3C(C)(C)CCC(C)(C)C3=C2 | 5,5,8,8-Tetramethyl-2,3,5,6,7,8-hexahydro-1H-cyclopenta[b]naphthalen-1-on | AG000750 | 1.25g |
| 102293-80-1 | CC1(C)OCC2=CC(C(CBr)=O)=CC=C2O1 | 2-BROMO-1-(2,2-DIMETHYL-4H-1,3-BENZODIOXIN-6-YL)ETHANONE | AG000759 | 10g |
| 1022983-50-1 | CC1=C(C(O)=O)C=C(I)C=C1Br | 3-Bromo-5-iodo-2-methyl benzoic acid | AG00075D | 160g |
| 102567-19-1 | N[C@H](C(=O)N[C@H](C(=O)N[C@@H](CC(=O)O)C(N[C@@H](CO)C(=O)O)=O) | (3S)-3-[(2S)-2-[(2S)-2-amino-5-carbamimidamidopentanamido]-3-phenylpro | AG0007QD | 3g |
| 102562-86-7 | NCC1=CC(C(N)=O)=CC=C1 | 3-(Aminomethyl)benzamide | AG0007QJ | 10g |
| 90217-02-0 | [Cl-].Cc1ccc(cc1)[n+]2nc(nn2c3ccc(C)cc3)C#N | 5-Cyano-2,3-di-p-tolyltetrazolium Chloride | AG0007QN | 0.05g |
| 1025707-98-5 | CC1(C)C(C)(C)OB(C2=C(F)C=CC(F)=C2C)O1 | 2-(3,6-Difluoro-2-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane | AG0007QP | 2g |
| 1025707-97-4 | CC1=C(F)C(F)=CC=C1B2OC(C)(C(C)(O2)C)C | 3,4-Difluoro-2-methylphenylboronic acid pinacol ester | AG0007QQ | 15g |
| 1025707-93-0 | CC1(C)C(C)(C)OB(C2=CCCCO2)O1 | 3,4-Dihydro-2H-pyran-6-boronic acid pinacol ester | AG0007QR | 30g |
| 1025707-92-9 | O=C(N1C=C(C=O)C2=C1C=CC(B3OC(C)(C)C(C)(C)O3)=C2)OC(C)(C)C | tert-Butyl 3-formyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole | AG0007QS | 75g |
| 1025700-49-5 | C(C)(C)c1nc(sc1Br)N | 5-Bromo-4-isopropylthiazol-2-amine | AG0007QT | 50g |
| 1025700-46-2 | CC(C)C1=C(Br)SC=N1 | 5-Bromo-4-isopropylthiazole | AG0007QU | 0.5g |
| 10257-28-0 | OC[C@@H]1[C@H](O)[C@H](O)[C@@H](O)C(O)O1 | D-Galactose | AG0007RA | 200g |
| 1025718-78-8 | O=C(OC)C1=CC(B2OC(C)(C)C(C)(C)O2)=CC(Br)=C1 | Methyl 3-bromo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate | AG0007RC | 25g |
| 1025708-31-9 | N#CC1=NC=C(B2OC(C)(C)C(C)(C)O2)C=N1 | 2-Cyanopyrimidine-5-boronic Acid Pinacol Ester | AG0007RE | 50g |
| 1025736-43-9 | ClC1=CC=C(C2=CC=C(B(O)O)C=C2)C=C1Cl | 3′,4′-Dichloro-4-biphenylboronic acid | AG0007S1 | 5g |
| 1025735-47-0 | COC1=C2N=CC=CC2=C(B(O)O)C=C1 | 8-Methoxyquinoline-5-boronic acid | AG0007S2 | 6g |
| 1025735-46-9 | OB(C1=CC=CC(N2N=C(C)C=C2C)=C1)O | 3-(3,5-Dimethyl-1H-pyrazol-1-yl)phenylboronic acid | AG0007S3 | 50g |
| 1025720-99-3 | C=1(C(=C(C=CN1)Cl)Cl)C(=O)N | 3,4-Dichloropicolinamide | AG0007S4 | 5g |
| 1025720-94-8 | O=C(C1=C(OCC)C=CN(C2=CC=C(F)C=C2)C1=O)NC3=CC=C(OC4=C(Cl)C(N)=NC=C4) | BMS-777607 | AG0007S5 | 1.25g |
| 1025719-26-9 | CC(C)C1=CC(=CC(=C1)B1OC(C)(C)C(C)(C)O1)C(C)C | 2-(3,5-Diisopropylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane | AG0007S6 | 25g |
| 1025719-23-6 | FC(C1=NN(C)C(B2OC(C)(C)C(C)(C)O2)=C1)(F)F | 1-Methyl-3-(trifluoromethyl)pyrazole-5-boronic acid pinacol ester | AG0007S7 | 50g |
| 1025719-20-3 | CC1OC2=C(C=CC=C2B2OC(C)(C)C(C)(C)O2)N=1 | 2-Methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[d]oxazole | AG0007S8 | 1g |
| 1025719-14-5 | O=C(N1C=C(B2OC(C)(C)C(C)(C)O2)C3=CC(Br)=CN=C31)OC(C)(C)C | 1-BOC-5-bromopyrrolo[2,3-b]pyridine-3-boronic acid, pinacol ester | AG0007SA | 30g |
| 1025719-08-7 | CCOC(=O)c1coc(c1)B1OC(C(O1)(C)C)(C)C | 3-Furancarboxylic acid, 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, ethy | AG0007SC | 0.5g |
| 1025718-96-0 | CC1(C)C(C)(C)OB(C2=C(C)OC(C)=C2)O1 | 2,5-Dimethylfuran-3-boronic acid, pinacol ester | AG0007SG | 5g |
| 1025718-91-5 | O=C(OC)C1=CN=CC(B2OC(C)(C)C(C)(C)O2)=C1 | 3-(Methoxycarbonyl)pyridine-5-boronic acid, pinacol ester | AG0007SI | 45g |
| 1025718-84-6 | OC1=CC(C(F)(F)F)=CC(Br)=C1 | 3-Bromo-5-(trifluoromethyl)phenol | AG0007SL | 2500g |
| 168471-40-7 | N[C@@H]1C=C[C@H](C(O)=O)C1 | (1R,4S)-rel-4-Aminocyclopent-2-enecarboxylic acid | AG0007SX | 0.75g |
| 10258-54-5 | O(C(=O)CC#N)CCOC | 2-Methoxyethyl 2-cyanoacetate | AG0007TB | 20g |
| 1025967-78-5 | O=C(O)[C@H](CC1=CC=CC(S(=O)(C)=O)=C1)NC(C2=C(Cl)C3=C(CN(C(C4=CC=C5C= | (S)-2-(2-(benzofuran-6-carbonyl)-5,7-dichloro-1,2,3,4-tetrahydroisoquinoline | AG0007UU | 10g |
| 1025936-09-7 | OCC1=C(Cl)N=CS1 | (4-Chlorothiazol-5-yl)methanol | AG0007UW | 0.5g |
| 102593-74-8 | OC1=C(C(C2=CC=CC=C2)=O)C=C(C(C3=CC=CC=C3)=O)C(O)=C1CC=C | (5-Allyl-4,6-dihydroxy-1,3-phenylene)bis(phenylmethanone) | AG0007V3 | 700g |
| 102587-98-4 | BrC1=CC2=CC=C3C=C(Br)C=C(C3=C24)C=CC4=C1 | 2,7-Dibromopyrene | AG0007VA | 25g |
| 10259-22-0 | O=C(OCC)C1=CC=CC(OC)=C1 | Ethyl 3-methoxybenzoate | AG0007VF | 660g |
| 1026016-83-0 | COC1=C(OC)C=C2C(CCN3[C@@H]2CC(=O)[C@H](CC(C)C)C3)=C1 | Tetrabenazine (+)- | AG0007VL | 3g |
| 1023595-11-0 | C(=O)(OC(C)(C)C)N1CC2(OCC1)CCNCC2 | 4-Boc-1-Oxa-4,9-diazaspiro[5.5]undecane | AG00078U | 150g |
| 1023595-06-3 | Cl.C1CC(CCN1)N1C=CN=C1 | 4-(1H-Imidazol-1-yl)piperidine, HCl | AG00078V | 5g |
| 102359-00-2 | O=C(C1=CC2=C(NC(C2)=O)C=C1)O | 5-Carboxyoxindole | AG00078Z | 200g |
| 10236-60-9 | O=C(O)CC1=CC=CC(Cl)=C1Cl | 2,3-Dichlorophenylacetic acid | AG000797 | 300g |
| 10236-58-5 | N[C@@H](C[SeH])C(O)=O | (R)-2-Amino-3-hydroselenopropanoic acid | AG000798 | 0.125g |
| 102362-98-1 | CC1(C)NS(=O)(=O)c2ccccc21 | 2,3-Dihydro-3,3-dimethyl-1,2-benzisothiazole 1,1-dioxide | AG00079X | 0.5g |
| 102362-49-2 | OC1CC[C@]2(C(C1)CC([C@@H]1[C@@H]2CC(O)[C@]2([C@H]1CC[C@@H]2[C@ | Cholan-24-oic acid, 3,7,12-trihydroxy-7-methyl-, (3α,5β,7α,12α)- | AG00079Z | 2g |
| 102362-02-7 | N#CC1=CC=C(C(C)=O)C=C1OC | 4-Acetyl-2-methoxybenzonitrile | AG0007A1 | 75g |
| 102362-00-5 | O=C(O)C1=CC=C(C#N)C(OC)=C1 | 4-Cyano-3-methoxybenzoic acid | AG0007A2 | 10g |
| 1023742-13-3 | NOCCOC(C)(C)C | O-[2-(tert-Butoxy)ethyl]hydroxylamine | AG0007A6 | 75g |
| 1023674-80-7 | BrC1=CC(C2=C3C=CC=CC3=C(C4=CC=CC=C4)C5=CC=CC=C25)=CC=C1 | 9-(3-Bromophenyl)-10-phenylanthracene | AG0007A9 | 30g |
| 102368-13-8 | S=C(N1C=CC=CC1=O)N2C=CC=CC2=O | 1,1′-Thiocarbonyldi-2(1H)-pyridone | AG0007AH | 1000g |
| 10237-77-1 | C(CC(=O)O)(CC)O | 3-Hydroxypentanoic acid | AG0007AO | 25g |
| 1023815-99-7 | FC(C=1C=CC=C2C=CC(=NC12)C(=O)O)(F)F | 8-(Trifluoromethyl)quinoline-2-carboxylic acid | AG0007AY | 4g |
| 102601-58-1 | ClC1=CC(=O)C=C(O1)N2CCOCC2 | Z-Gly-gly-arg-amc hcl | AG0007VN | 0.4g |
| 102601-34-3 | O=S(CC(O)CNC1CCCCC1)([O-])=O.[Na+] | CAPSO sodium salt | AG0007VQ | 11000g |
| 1026-92-2 | C=CCOC(=O)C1=CC=C(C=C1)C(=O)OCC=C | Diallyl terephthalate | AG0007VU | 5000g |
| 1026-78-4 | O1C(=CC=C1)C=C1C(C(CC1)=CC=1OC=CC1)=O | 2,5-Bis(furan-2-ylmethylene)cyclopentanone | AG0007VW | 2g |
| 1026-05-7 | CC1NC2=C(C=CC=C2)C(NC3=CC=CC=C3)C1 | 2-Methyl-N-phenyl-1,2,3,4-tetrahydroquinolin-4-amine | AG0007W5 | 2g |
| 1026089-09-7 | O=C(O)CC1=CC=C(Br)C=C1OC | 2-(4-Bromo-2-methoxyphenyl)acetic acid | AG0007W7 | 155g |
| 10261-94-6 | C(=O)c1c(N(=O)=O)cccn1 | 2-Pyridinecarboxaldehyde, 3-nitro- | AG0007WR | 150g |
| 10261-82-2 | O=C1NC2=CC=CN=C2C=C1 | 1,5-Naphthyridin-2(1H)-one | AG0007WT | 18g |
| 102619-05-6 | O=CC1=CC=CN1S(=O)(C2=CC=C(C)C=C2)=O | 1-(P-Toluenesulfonyl)pyrrole-2-aldehyde | AG0007XM | 50g |
| 10262-69-8 | CNCCCC12C3=C(C(C4=C1C=CC=C4)CC2)C=CC=C3 | methyl(3-{tetracyclo[6.6.2.0^{2,7}.0^{9,14}]hexadeca-2(7),3,5,9(14),10,12-hex | AG0007Y8 | 2g |
| 10262-65-4 | COC1=CC2=CC=C(C=C2C=C1)C(=O)CBr | 2-Bromoacetyl-6-methoxynaphtalene | AG0007Y9 | 75g |
| 1026230-99-8 | CC1=CC([C@H](N)CO)=CC=C1 | (2S)-2-Amino-2-(3-methylphenyl)ethan-1-ol | AG0007YB | 2g |
| 1026201-95-5 | OCC1=CC(OC(F)(F)F)=CC(Br)=C1 | [3-bromo-5-(trifluoromethoxy)phenyl]methanol | AG0007YD | 30g |
| 1026201-52-4 | OC(=O)C1=CN2C(C=CC=C2Br)=N1 | 5-Bromoimidazo[1,2-a]pyridine-2-carboxylic acid | AG0007YE | 20g |
| 1026201-45-5 | OC(=O)C1=CN2C=CC=C(Br)C2=N1 | 8-Bromoimidazo[1,2-a]pyridine-2-carboxylic acid | AG0007YF | 50g |
| 102625-98-9 | COc1ccnc(c1C)COC(=O)C | 2-Pyridinemethanol, 4-methoxy-3-methyl-, 2-acetate | AG0007YJ | 0.4g |
| 102625-96-7 | COc1cc[n+](c(c1C)C)[O-] | Pyridine, 4-methoxy-2,3-dimethyl-, 1-oxide | AG0007YK | 5g |
| 102625-64-9 | COC1=C(OC)C(CSC2=NC3=CC(OC(F)F)=CC=C3N2)=NC=C1 | 5-Difluoromethoxy-2-[(3,4-Dimethoxy-2-Pyridinyl)Methyl]Thio-1H-Benzimid | AG0007YM | 1000g |
| 1024010-90-9 | Cl.Cl.C(C1=CC=CC=C1)N1[C@H]2CN[C@H](C2)C1 | (1R,4R)-2-Benzyl-2,5-diazabicyclo[2.2.1]heptane dihydrochloride | AG0007CZ | 0.5g |
| 1024006-03-8 | Cl.NNC1=C(F)C=C(F)C(F)=C1 | (2,4,5-Trifluorophenyl)hydrazine hydrochloride | AG0007D0 | 5g |
| 10240-08-1 | Oc1ccc(c2c1cccc2)C | 4-Methyl-1-naphthalenol | AG0007D9 | 20g |
| 1024-99-3 | OC[C@@H]1[C@H]([C@H]([C@H](N2C(NC(C(I)=C2)=O)=O)O1)O)O | 5-Iodouridine | AG0007DA | 800g |
| 1024054-68-9 | O=C(C1=C2N=C(N)SC2=CC=C1)OC | Methyl 2-aminobenzo[d]thiazole-4-carboxylate | AG0007DJ | 100g |
| 1024038-33-2 | O=C(OC)C[C@H]1CNCC1.[H]Cl | Methyl (s)-pyrrolidin-3-yl-acetate HCl | AG0007DL | 15g |
| 1024038-31-0 | O=C(OC)C[C@@H]1CNCC1.[H]Cl | METHYL (R)-PYRROLIDINE-3-ACETATE HCL | AG0007DM | 25g |
| 10241-98-2 | O=C(C1NC2=C(C=C(Cl)C=C2)C1)O | 5-Chloroindoline-2-carboxylic acid | AG0007E3 | 4g |
| 10241-97-1 | C(=O)(O)c1[nH]c2c(c1)cc(cc2)C | 5-Methyl-1H-indole-2-carboxylic acid | AG0007E4 | 200g |
| 1024120-52-2 | CC(N1N=CC(Br)=C1)OCC | 4-Bromo-1-(1-ethoxyethyl)-1H-pyrazole | AG0007E8 | 20g |
| 102418-74-6 | [O-]C(C1=CC=C(NC(CCCC[C@@H]2SC[C@@]3([H])[C@]2([H])NC(N3)=O)=O)C=C | (+)-Biotin 4-Amidobenzoic Acid (sodium salt) | AG0007EA | 0.1g |
| 102417-94-7 | CN(C)c1cccc2c(cccc12)S(=O)(=O)Nc3ccc(cc3)N=C=S | Dansylamino-PITC | AG0007EB | 0.025g |
| 102410-65-1 | O=C(O)[C@@H](NC(OCC1C2=C(C3=C1C=CC=C3)C=CC=C2)=O)C4=CC=CC=C4 | Fmoc-Phg-OH | AG0007ES | 3000g |
| 10242-01-0 | O=C(C1=CNC2=C1C=C(OC)C=C2)O | 5-Methoxyindole-3-carboxylic Acid | AG0007EV | 75g |
| 10242-00-9 | O=C(C(N1)=CC2=C1C=C([N+]([O-])=O)C=C2)O | 6-NITRO-1H-INDOLE-2-CARBOXYLIC ACID | AG0007EW | 10g |
| 102421-43-2 | O=C(OC(C)(C)C)NC1=CC=C(OC)C(OC)=C1 | tert-Butyl (3,4-dimethoxyphenyl)carbamate | AG0007F0 | 2g |
| 1023815-74-8 | COC1(OC)CC(COS(=O)(=O)c2ccc(C)cc2)(COS(=O)(=O)c2ccc(C)cc2)C1 | (3,3-Dimethoxy-1-([(4-methylbenzenesulfonyl)oxy]methyl)cyclobutyl)methy | AG0007B0 | 10g |
| 1023815-26-0 | OC1=CC2=C(NC=N2)N=C1 | 3H-Imidazo[4,5-b]pyridin-6-ol | AG0007B2 | 2g |
| 1023814-35-8 | CC1=CN=C(N)C(C=O)=C1 | 2-Amino-5-methylnicotinaldehyde | AG0007B5 | 10g |
| 1023813-80-0 | BrC1=CC2=C(NCCC2)N=C1 | 6-Bromo-1,2,3,4-tetrahydro-1,8-naphthyridine | AG0007B6 | 8.65g |
| 1023813-21-9 | NC(C1=C(Cl)N=CC(Cl)=N1)=O | 3,6-DICHLOROPYRAZINE-2-CARBOXAMIDE | AG0007B7 | 5g |
| 1023812-90-9 | O=CC1=CC(C(C)(C)C)=NC=C1 | 2-(tert-Butyl)isonicotinaldehyde | AG0007B8 | 15g |
| 102387-48-4 | CC(NC1=C/C(C(C)=C(Cl)C1=O)=NC2=CC=C(N(CC)CC)C=C2C)=O | N-(5-Chloro-3-((4-(diethylamino)-2-methylphenyl)imino)-4-methyl-6-oxocyc | AG0007BD | 25g |
| 10238-28-5 | O[C@H]([C@H]([C@@H](CO1)O)O)[C@H]1OC2=CC=C([N+]([O-])=O)C=C2 | P-Nitrophenyl alpha-d-xylopyranoside | AG0007BG | 1.25g |
| 10238-27-4 | O[C@@H]1CO[C@@H](Oc2ccccc2[N+](=O)[O-])[C@H](O)[C@H]1O | 2-Nitrophenyl-Beta-D-Xylopyranoside | AG0007BH | 0.6g |
| 102394-31-0 | O=C1NC(C=CC=N2)=C2N(C(CN3CCCCC3CN(CC)CC)=O)C4=C1C=CC=C4 | 11-(2-(2-((Diethylamino)methyl)piperidin-1-yl)acetyl)-5H-benzo[e]pyrido[3, | AG0007BO | 0.005g |
| 102393-82-8 | Clc1c2c(nc(n1)Cl)ccc(c2)Br | 6-Bromo-2,4-dichloroquinazoline | AG0007BQ | 200g |
| 10239-34-6 | C(NCCCNCc1ccccc1)c1ccccc1 | N1,N3-Dibenzylpropane-1,3-diamine | AG0007C6 | 300g |
| 1024-30-2 | O=S(=O)(c1ccc(cc1)[N+](=O)[O-])N1CCOCC1 | 4-[(4-Nitrophenyl)Sulfonyl]Morpholine | AG0007CS | 10g |
| 1024033-43-9 | N1(C2=NC(SCCC)=C(C(NC3CCCCC3)=O)C=C2)CCC[C@@H](CC(O)=O)C1 | AZD4017 | AG0007CW | 0.025g |
| 1024017-53-5 | CC(C)(C)OCC1=CC=C(C=C1)B(O)O | 4-tert-Butoxymethylphenylboronic acid | AG0007CX | 4g |
| 102236-18-0 | CCNCC1=CC=C(Cl)C=C1.[H]Cl | N-(4-Chlorobenzyl)ethanamine hydrochloride | AG000709 | 0.3g |
| 10224-72-3 | O=C(C1(C(OC)=O)CCC1)OC | Dimethyl cyclobutane-1,1-dicarboxylate | AG00070B | 125g |
| 10224-18-7 | O=C=Nc1ccc(cc1)C(C(F)(F)F)(C(F)(F)F)c1ccc(cc1)N=C=O | 2,2-Bis(4-isocyanatophenyl)hexafluoropropane | AG00070D | 1g |
| 102249-45-6 | NC1=C(Br)C=CN=C1Br | 3-Amino-2,4-dibromopyridine | AG00070N | 9.75g |
| 102245-65-8 | O=C(O)C#CCO[Si](C)(C(C)(C)C)C | 4-(tert-Butyl-dimethyl-silanyloxy)-but-2-ynoic acid | AG00070V | 8g |
| 102268-15-5 | O=C(O)C1=NC=C(C=C1C(O)=O)CC | 5-Ethylpyridine-2,3-dicarboxylic acid | AG00071Y | 425g |
| 102266-15-9 | O=[N+]([O-])C2(=C(N=C(C1(=CC=CC=C1))C=C2)N) | 2-Amino-3-nitro-6-phenylpyridine | AG000726 | 9g |
| 102262-55-5 | Clc1ccc(Nc2cc3nc4ccccc4n(-c4ccc(Cl)cc4)c3cc2=N)cc1 | N,5-Bis(4-chlorophenyl)-3-imino-3,5-dihydrophenazin-2-amine | AG000727 | 10g |
| 10226-30-9 | CC(CCCCCl)=O | 6-Chlorohexan-2-one | AG00072H | 300g |
| 10226-29-6 | CC(CCCCBr)=O | 6-bromohexan-2-one | AG00072I | 500g |
| 10227-17-5 | O(C(C)=O)[C@@H]1[C@@]2([C@](O[C@@]1([C@@H](COC(C)=O)SC(C)=O)[H]) | 3,6-Di-o-acetyl-5-deoxy-5-s-acetyl-1,2-o-isopropylidene-a-d-glucofuranose | AG000738 | 0.75g |
| 102281-45-8 | O=C(O)[C@H](N)CC1=CC=C(N)C=C1 | (R)-2-Amino-3-(4-aminophenyl)propanoic acid | AG000739 | 50g |
| 102276-52-8 | COC(=O)N(Cc1ccccc1)Cc1ccccc1 | methyl N,N-dibenzylcarbamate | AG00073L | 13.3g |
| 10242-12-3 | O=C(C1=CC2=CC([N+]([O-])=O)=CC=C2O1)O | 5-Nitrobenzofuran-2-carboxylic acid | AG0007FE | 32g |
| 10242-11-2 | O=C(C1=CC2=CC(Br)=CC=C2O1)O | 5-Bromobenzofuran-2-carboxylic acid | AG0007FF | 25g |
| 10242-10-1 | C(=O)(O)c1oc2c(c1)cc(cc2)Cl | 5-CHLOROBENZOFURAN-2-CARBOXYLIC ACID | AG0007FG | 25g |
| 10242-09-8 | CC1=CC2=C(OC(=C2)C(O)=O)C=C1 | 5-Methylbenzofuran-2-carboxylic acid | AG0007FH | 20g |
| 10242-08-7 | O=C(C1=CC2=CC(OC)=CC=C2O1)O | 5-Methoxybenzofuran-2-carboxylic acid | AG0007FI | 10g |
| 10242-05-4 | O=C(O)CNC1=CC=CC(Cl)=C1 | 2-[(3-Chlorophenyl)amino]acetic acid | AG0007FJ | 4g |
| 10242-03-2 | O=C(C1=CNC2=C1C=CC([N+]([O-])=O)=C2)O | 6-Nitro-1H-indole-3-carboxylic acid | AG0007FK | 200g |
| 10242-02-1 | O=C(C1=CNC2=C1C=C(C)C=C2)O | 5-Methyl-1H-indole-3-carboxylic acid | AG0007FL | 150g |
| 102429-07-2 | FC1=CC=C(C(CBr)=O)C(F)=C1 | 2-Bromo-2′,4′-difluoroacetophenone | AG0007FX | 250g |
| 102422-56-0 | FC1=CC(CN=C=O)=CC=C1 | 3-Fluorobenzyl Isocyanate | AG0007G4 | 9g |
| 102422-55-9 | FC(C1=CC=C(C=C1)CN=C=O)(F)F | 4-(Trifluoromethyl)benzyl isocyanate | AG0007G5 | 300g |
| 10243-15-9 | CC1=C(Br)C2=CC=CC=C2S1 | 3-Bromo-2-methylbenzo[b]thiophene | AG0007GA | 30g |
| 102438-99-3 | NC1=C(OC)C=C(OC)C=C1OC.[H]Cl | 2,4,6-TRIMETHOXYANILINE HYDROCHLORIDE | AG0007HU | 10g |
| 10244-24-3 | ClC1(=NC(=NC(=C1)N2(CCOCC2))N3(CCOCC3)) | 4,4′-(6-chloropyrimidine-2,4-diyl)dimorpholine | AG0007IB | 12g |
| 1024583-33-2 | O=C(C1=CC=C2N=C(Br)SC2=C1)OC | Methyl 2-bromobenzo[d]thiazole-6-carboxylate | AG0007IE | 500g |
| 102440-39-1 | N#CCCNCCCN1CCOCC1 | 3-(3-Morpholinopropylamino)propanenitrile | AG0007IZ | 0.75g |
| 1024677-85-7 | CC(C)(C)OC(=O)N1C=C(B2OC(C)(C)C(C)(C)O2)C2=CC(Br)=CC=C12 | 1-Boc-5-bromoindole-3-boronic acid pinacol ester | AG0007J3 | 2.1g |
| 1024613-61-3 | O=C(O)C(N)C1=CC=C(OC)C(C)=C1 | Amino(4-methoxy-3-methylphenyl)acetic acid | AG0007J8 | 35g |
| 1024598-06-8 | C1(NC2=C3C=CC=C2)=C3C=CC4=C1N(C5=CC=CC=C5)C6=C4C=CC=C6 | 11，12-Dihydro-11-phenylindolo[2，3-a]carbazole | AG0007JC | 125g |
| 1024598-01-3 | c1ccc(cc1)-c1nc(nc(n1)-n1c2ccccc2c2ccc3c4ccccc4n(-c4ccccc4)c3c12)-c1ccccc1 | 2,4-diphenyl-6-{12-phenyl-11H,12H-indolo[2,3-a]carbazol-11-yl}-1,3,5-triazin | AG0007JD | 2g |
| 1024594-86-2 | O=C(C1=CC2=C(Br)SC(Br)=C2S1)O | 4,6-Dibromothieno[3,4-b]thiophene-2-carboxylic acid | AG0007JE | 5g |
| 1024590-32-6 | CC(C)(C)OC(=O)N1CCC(C1)C1=CC=NC=C1 | 1-Pyrrolidinecarboxylic acid, 3-(4-pyridinyl)-, 1,1-dimethylethyl ester | AG0007JF | 0.2g |
| 1024589-68-1 | Cl.Cl.N1CC(C1)N1CCCC1 | 1-(azetidin-3-yl)pyrrolidine dihydrochloride | AG0007JG | 10g |
| 10247-90-2 | CCCCCCC[N+](CCCCCCC)(CCCCCCC)CCCCCCC.[Cl-] | 1-Heptanaminium, N,N,N-triheptyl-, chloride (1:1) | AG0007KE | 23g |
| 102491-80-5 | COC1=CC=C2C(=CC1=O)[C@H](CCc3cc(OC)c(O)c(OC)c23)NC(=O)C | 2-Demethyl Colchicine | AG0007KR | 0.06g |
| 102490-65-3 | O=C1[C@@H](O)[C@@H](C2=CC=C(O)C=C2O)OC3=C1C(OC)=CC(O)=C3C[C@H]( | Kushenol N | AG0007KT | 0.015g |
| 1025023-04-4 | CO[C@@H]1C(=O)C[C@]23CCN(C)[C@@]22C[C@H](O[C@]12OC)c1cc2OCOc2cc | Periglaucine A | AG0007L5 | 0.005g |
| 1025010-58-5 | CC1=C2N=CC=CC2=C(B(O)O)C=C1 | 8-Methylquinoline-5-boronic acid | AG0007L6 | 10g |
| 102502-64-7 | O=C(O)[C@H](C12CC3CC(C2)CC(C3)C1)N.[H]Cl | (S)-2-(Adamantan-1-yl)-2-aminoacetic acid hydrochloride | AG0007L8 | 2g |
| 10268-78-7 | C1(NC(=O)C)=CC=CC(NC(=O)C)=C1 | N,N’-(1,3-Phenylene)diacetamide | AG00084A | 8g |
| 10268-71-0 | O=C(OC1=CC=CC=C1)C2=CC=CC=C2OC | Phenyl 2-Methoxybenzoate | AG00084C | 10g |
| 10268-69-6 | Nc1ccccc1C(=O)Oc1ccccc1 | Phenyl 2-Aminobenzoate | AG00084E | 9g |
| 102691-93-0 | CO[C@](C)(C(O)=O)C1=C2C=CC=CC2=CC=C1 | (S)-(+)-2-Methoxy-2-(1-naphthyl)propionic Acid | AG00084K | 0.1g |
| 102691-36-1 | N#CCCOP(N(C(C)C)C(C)C)N(C(C)C)C(C)C | 2-Cyanoethyl N,N,N’,N’-tetraisopropylphosphorodiamidite | AG00084L | 2000g |
| 10269-01-9 | NCC1=CC=CC(Br)=C1 | 3-Bromobenzylamine | AG000853 | 90.28g |
| 1026987-94-9 | O=C(O)CC[C@H](NC(N[C@@H](CCC(OC(C)(C)C)=O)C(OC(C)(C)C)=O)=O)C(OC(C | DUPA(OtBu)-OH | AG000855 | 10g |
| 1026962-68-4 | O=C(O)C1=C(Br)C=CC(C(F)(F)F)=C1F | 6-Bromo-2-fluoro-3-(trifluoromethyl)benzoic acid | AG000856 | 500g |
| 102696-71-9 | O=C(O)/C=C/C1=CSC=C1 | (E)-3-(Thiophen-3-yl)acrylic acid | AG00085C | 100g |
| 102696-70-8 | CC1=C(SC=C1)/C=C/C(=O)O | (E)-3-(3-Methylthiophen-2-yl)acrylic acid | AG00085D | 50g |
| 102696-21-9 | O=C(O)CCC(ON1C(CCC1=O)=O)=O | 4-((2,5-Dioxopyrrolidin-1-yl)oxy)-4-oxobutanoic acid | AG00085E | 1g |
| 1027-35-6 | CCOC(=O)C1CN(CC2=CC=CC=C2)CC1=O | ethyl 1-benzyl-4-oxo-pyrrolidine-3-carboxylate | AG00085M | 500g |
| 1027-28-7 | [H][C@@](CC1=CC(I)=C(O)C(I)=C1)(NC(C)=O)C(O)=O | N-Acetyl-3,5-diiodo-L-tyrosine | AG00085O | 200g |
| 1027-14-1 | Cl.CCN(CC)CC(=O)Nc1c(C)cc(C)cc1C | 2-(Diethylamino)-N-mesitylacetamide hydrochloride | AG00085Q | 2500g |
| 1027045-31-3 | CC1=CC(Cl)=CC(C)=C1B(O)O | 2,6-Dimethyl-4-chlorophenylboronic acid | AG00085Y | 15g |
| 10270-94-7 | O=C(O)[C@@H](N)CCNC(OC(C)(C)C)=O | H-Dab(Boc)-OH | AG000866 | 200g |
| 10270-29-8 | CCCCCc1ccc(cc1)C#N | 4-Pentylbenzonitrile | AG00086A | 20g |
| 10252-83-2 | O=C(O)C1=CC=C(S(=O)(N2CCCCC2)=O)C=C1 | 4-(Piperidine-1-sulfonyl)-benzoic acid | AG0007NJ | 15g |
| 10252-82-1 | O=C(O)C1=CC=C(S(=O)(N2CCOCC2)=O)C=C1 | 4-(Morpholine-4-sulfonyl)-benzoic acid | AG0007NK | 25g |
| 10252-63-8 | CNS(C1=CC=C(C(O)=O)C=C1)(=O)=O | 4-[(MethylaMino)sulfonyl]benzoic acid | AG0007NQ | 7g |
| 10252-29-6 | O=C(Cl)C1=CC=C(/N=N/C2=CC=C(C(Cl)=O)C=C2)C=C1 | 4,4′-Azodibenzoyl dichloride | AG0007NU | 15g |
| 1025351-41-0 | OCC1=NC=NC(Cl)=C1 | 6-Chloro-4-hydroxymethylpyrimidine | AG0007NW | 75g |
| 102540-15-8 | COC(=O)C=Cc1ccccc1Br | 2-Propenoic acid, 3-(2-bromophenyl)-, methyl ester | AG0007NZ | 0.8g |
| 102539-79-7 | O=C(C1=CC2=CC=C(OC)C=C2S1)O | 6-Methoxybenzo[b]thiophene-2-carboxylic acid | AG0007O1 | 8g |
| 102539-71-9 | C(O)(CC1CCCOC1)=O | Tetrahydro-2H-pyran-3-ylacetic acid | AG0007O2 | 25g |
| 102539-53-7 | O=C1CC(C)C2=C1C=CC=C2Br | 4-Bromo-3-methyl-2,3-dihydro-1H-inden-1-one | AG0007O4 | 5g |
| 10254-07-6 | O=C(NC(C1=CC=CC=C1)C2=CC=CC=C2)CCl | 2-Chloro-n-(diphenylmethyl)acetamide | AG0007OJ | 2g |
| 1025496-32-5 | ClC=1C=C(C=CC1)C1=CC=C(C=C1)B(O)O | (3′-Chloro-[1,1′-biphenyl]-4-yl)boronic acid | AG0007OL | 25g |
| 1025496-16-5 | O=C(NC(C1=CC=C(C=C1F)F)C(O)=O)OC(C)(C)C | 2-((tert-Butoxycarbonyl)amino)-2-(2,4-difluorophenyl)acetic acid | AG0007OM | 50g |
| 1025495-85-5 | CC1=CC(C)=NN1C2=CC=C(B(O)O)C=C2 | 4-(3,5-Dimethyl-1H-pyrazol-1-yl)phenylboronic acid | AG0007ON | 7g |
| 1025468-33-0 | O=C(C1=COC(Cl)=N1)N | 2-Chlorooxazole-4-carboxamide | AG0007OO | 3g |
| 1025468-06-7 | O=C(C1=NC(Br)=CS1)OC | Methyl 4-bromothiazole-2-carboxylate | AG0007OR | 10g |
| 10264-29-6 | C(=O)(NCCCCCC)CCCCC | Hexanamide, N-hexyl- | AG00080V | 0.2g |
| 1026706-70-6 | OC1=CC2=CC(F)=C(F)C=C2N=C1 | 6,7-Difluoroquinolin-3-ol | AG00081Q | 5g |
| 1026692-54-5 | COC1=CC=C(C=C1)C1CC(=O)CCO1 | 2-(4-Methoxyphenyl)dihydro-2H-pyran-4(3H)-one | AG00081R | 0.2g |
| 1026661-43-7 | Cl.NC([C@@H]1CNCCC1)=O | (S)-Piperidine-3-carboxamide hydrochloride | AG00081T | 1g |
| 1026622-90-1 | OC1=CC2=CC=C(F)C=C2N=C1 | 7-FLUOROQUINOLIN-3-OL | AG00081W | 1.25g |
| 1026587-36-9 | FC(C1=CC=CC(Cl)=N1)F | 2-Chloro-6-(difluoromethyl)pyridine | AG00081Y | 10g |
| 1026582-88-6 | NC1=NC=C(CC2=CC(OC)=C(OC)C=C2C(C)C)C(N)=N1 | RO-3 | AG000820 | 5g |
| 102664-66-4 | C1(NC2=CC=CC=C2)=CC(NC3=CC=CC=C3)=CC(NC4=CC=CC=C4)=C1 | N,N’,N”-Triphenyl-1,3,5-benzenetriamine | AG000824 | 50g |
| 10267-94-4 | O=C(C1=CCCC1)OCC | Ethyl 1-cyclopentene-1-carboxylate | AG000827 | 30g |
| 10266-42-9 | N#CCc1ccc(cc1)C(=O)C | Benzeneacetonitrile, 4-acetyl- | AG00082B | 3g |
| 102677-73-6 | Cl.Cl.COC1=C(CN)C=C(N)C=C1 | 3-(Aminomethyl)-4-methoxyaniline dihydrochloride | AG00082H | 17g |
| 102677-62-3 | ClCC(=O)NCc1ccc(cc1)NC(=O)C | N-[4-(Acetylamino)benzyl]-2-chloroacetamide | AG00082I | 7g |
| 102676-60-8 | COC(=O)CCc1cn(cn1)C(c2ccccc2)(c3ccccc3)c4ccccc4 | Methyl 3-(1-tritylimidazol-4-yl) propionate | AG00082P | 5g |
| 102676-47-1 | N#CC1=CC=C(C2CCCC3=CN=CN23)C=C1 | 4-(5,6,7,8-Tetrahydroimidazo[1,5-a]pyridin-5-yl)benzonitrile | AG00082Q | 0.2g |
| 102676-31-3 | N#CC1=CC=C(C2CCCC3=CN=CN23)C=C1.[H]Cl | Fadrozole Hydrochloride | AG00082S | 0.75g |
| 1027511-90-5 | FC1=CC(Br)=C(Br)C(=C1)C(F)(F)F | 1,2-Dibromo-5-fluoro-3-(trifluoromethyl)benzene | AG0008AC | 35g |
| 1027511-76-7 | CC(C)(C)OC(=O)NC1(CCN(C1)C(=O)OCc1ccccc1)C([O-])=O | 1-((Benzyloxy)carbonyl)-3-((tert-butoxycarbonyl)amino)pyrrolidine-3-carbox | AG0008AD | 2g |
| 1027511-74-5 | CC(OC(NC1(C(O)=O)CN(CC2=CC=CC=C2)CC1)=O)(C)C | 1-Benzyl-3-(tert-butoxycarbonylamino)pyrrolidine-3-carboxylic acid | AG0008AE | 25g |
| 1027511-67-6 | O=C(N1C(CCC)CNCC1)OC(C)(C)C | tert-Butyl 2-propylpiperazine-1-carboxylate | AG0008AH | 2g |
| 1027511-41-6 | O=C(C1=C2N=CC(Br)=CN2N=C1)OCC | Ethyl 6-Bromopyrazolo[1,5-a]pyrimidine-3-carboxylate | AG0008AI | 10g |
| 10275-58-8 | CC(C)(C)c1ccc2ccc(cc2c1)C(C)(C)C | 2,7-Di-tert-butylnaphthalene | AG0008AL | 5g |
| 10275-21-5 | Cl.C=1C=CC(=CC1)CCN(C)C | N,N-Dimethylphenethylamine hydrochloride | AG0008AM | 700g |
| 1027617-86-2 | FC(C1=NNC(C2CC2)=C1)(F)F | 5-Cyclopropyl-3-(trifluoromethyl)-1H-pyrazole | AG0008AO | 2g |
| 1027545-48-7 | FC(C1=NC=CC(CCl)=C1)(F)F | 4-(Chloromethyl)-2-(trifluoromethyl)pyridine | AG0008AR | 5g |
| 1027534-43-5 | O=C1N=C2N(NC=C2)C=C1 | PYRAZOLO[1,5-A]PYRIMIDIN-5(1H)-ONE | AG0008AS | 10g |
| 10276-85-4 | CCCCCCCC(=O)OCC1=CC=CC=C1 | Benzyl Octanoate | AG0008B7 | 400g |
| 10276-09-2 | CC(C)(C=C)C(O)=O | 2，2-Dimethylbut-3-enoic acid | AG0008BA | 32.4g |
| 1027642-31-4 | F[B-](F)(COC1CCCC1)F.[K+] | Potassium cyclopentoxymethyltrifluoroborate | AG0008BE | 5g |
| 1027642-28-9 | F[B-](COCC[Si](C)(C)C)(F)F.[K+] | Potassium (2-Trimethylsilyl)-ethoxymethyl trifluoroborate | AG0008BF | 50g |
| 1027642-26-7 | COC1=CC=C(C=C1)COC[B-](F)(F)F.[K+] | POTASSIUM (4-METHOXY)BENZYLOXYMETHYLTRIFLUOROBORATE | AG0008BG | 150g |
| 1134-00-5 | O=C(O)C1=C(C)C2=CC(Cl)=CC=C2O1 | 5-Chloro-3-methyl-1-benzofuran-2-carboxylic acid | AG0008FI | 20g |
| 113400-36-5 | CC(C)(C)OC(=O)N1[C@@H](CCC1=O)C(=O)OCC1=CC=CC=C1 | Boc-L-Pyroglutamic acid benzyl ester | AG0008FP | 1000g |
| 5071-61-4 | O=C(C1=CC(C2=CC=CC=C2)=NN1)O | 3-Phenylpyrazole-5-carboxylic acid | AG0008FQ | 50g |
| 1134-94-7 | NC1=CC=CC=C1SC2=CC=CC=C2 | 2-(Phenylthio)aniline | AG0008FR | 150g |
| 1134-82-3 | N1(CC2C=CC=CC=2)N=C(C=C1N)C | 1-Benzyl-3-methyl-1h-pyrazol-5-amine hydrochloride | AG0008FT | 50g |
| 1134-76-5 | CN(CCCOc1ccccc1N)C | 2-[3-(Dimethylamino)propoxy]aniline | AG0008FU | 15g |
| 1134-62-9 | C(CCC)C1=CC2=CC=CC=C2C=C1 | 2-Butylnaphthalene | AG0008FV | 2g |
| 1134-50-5 | O=C(C1=CN(C2=CC=CC=C2)N=C1)O | 1-Phenyl-1H-pyrazole-4-carboxylic acid | AG0008FZ | 75g |
| 1134-36-7 | OC1=CC=C(C2=CC=CC=C2)C=C1N | 2-Amino-4-phenylphenol | AG0008G3 | 50g |
| 1134-35-6 | CC1=CC(C2=NC=CC(C)=C2)=NC=C1 | 4,4′-Dimethyl-2,2′-dipyridyl | AG0008G4 | 2000g |
| 113402-89-4 | CC1=NN=C(C1)N | 4H-Pyrazol-3-amine, 5-methyl- | AG0008GF | 600g |
| 1134156-31-2 | N#CC1=CC=C(COC[C@H]2O[C@@H](N3C(NCC4=CC=C(Cl)C(Cl)=C4)=NC5=C(N)N | 5′-O-[(4-Cyanophenyl)methyl]-8-[[(3,4-dichlorophenyl)methyl]amino]-aden | AG0008HL | 0.5g |
| 113423-51-1 | BrC1(Br)C(=O)NC2=NC=CC=C12 | 3,3-Dibromo-1H-pyrrolo[2,3-b]pyridin-2(3H)-one | AG0008JE | 10g |
| 113421-98-0 | NC1=CC(OC(F)(F)F)=C(F)C=C1 | 4-Fluoro-3-(trifluoromethoxy)aniline | AG0008JL | 175g |
| 1134310-63-6 | O=C(C1=CN(C2=CC=CC=C2F)N=C1)O | 1-(2-Fluorophenyl)-1H-pyrazole-4-carboxylic acid | AG0008JQ | 10g |
| 1134307-94-0 | NC1=C2C(NC=C2)=NC=C1.[H]Cl | 4-Amino-7-azaindole hydrochloride | AG0008JR | 1g |
| 1027642-25-6 | F[B-](F)(COCC1=CC=CC=C1)F.[K+] | Potassium benzyloxymethyltrifluoroborate | AG0008BH | 200g |
| 102767-31-7 | NC([C@H](CC)NC(CCCCl)=O)=O | (S)-N-(1-Amino-1-oxobutan-2-yl)-4-chlorobutanamide | AG0008BQ | 8g |
| 102767-28-2 | CC[C@H](N1CCCC1=O)C(N)=O | (2S)-2-(2-oxopyrrolidin-1-yl)butanamide | AG0008BR | 1650g |
| 10277-74-4 | N[C@H]1C2=C(C=CC=C2)CC1 | (R)-(-)-1-Aminoindan | AG0008BX | 50g |
| 10277-04-0 | CCCCCCCCC=CCCCCCCCC(=O)OCCN(CCO)CCO | 9-Octadecenoic acid (9Z)-, 2-[bis(2-hydroxyethyl)amino]ethyl ester | AG0008C1 | 3000g |
| 1027785-21-2 | O=CC1=CC(Br)=C(N)N=C1 | 6-Amino-5-bromo-pyridine-3-carbaldehyde | AG0008C2 | 20g |
| 1027785-19-8 | OCC1=CC(Br)=C(N)N=C1 | 6-Amino-5-bromopyridine-3-methanol | AG0008C3 | 10g |
| 1027775-28-5 | O=C(N1[C@H](C)CC(C1)=O)OC(C)(C)C | (R)-tert-Butyl 2-methyl-4-oxopyrrolidine-1-carboxylate | AG0008C4 | 100g |
| 1027757-13-6 | CC1(C)OB(OC1(C)C)C1=C(OCC2=CC=CC=C2)C=CC=C1 | 2-Benzyloxyphenylboronic acid, pinacol ester | AG0008C6 | 50g |
| 1027710-05-9 | CCOC(=O)[C@H]1CCN(C[C@H]1c1ccccc1)C(=O)OC(C)(C)C | Cis-1-Tert-Butyl 4-Ethyl 3-Phenylpiperidine-1,4-Dicarboxylate | AG0008CA | 40g |
| 102774-92-5 | O=C1NC[C@H](O)CC1 | (R)-5-Hydroxypiperidin-2-one | AG0008CE | 2g |
| 102771-66-4 | O=C(O)C1=NC=C(OC(F)(F)F)C=C1 | 5-(Trifluoromethoxy)pyridine-2-carboxylic acid | AG0008CM | 10g |
| 102771-00-6 | OC1=C(I)C=CC(C(F)(F)F)=C1 | 2-Iodo-5-(trifluoromethyl)phenol | AG0008CO | 0.4g |
| 1133879-69-2 | FC1=CN=CC(C=C)=C1 | 3-Ethenyl-5-fluoropyridine | AG0008DG | 1.25g |
| 1133879-66-9 | FC1=NC=C(C=C)C=C1 | 2-Fluoro-5-vinylpyridine | AG0008DH | 25g |
| 1133930-99-0 | Brc1ccno1 | 5-Bromoisoxazole | AG0008E7 | 1g |
| 1134-01-6 | CNCCC1=CNC2=CC=C(C=C12)O | 3-(2-Methylaminoethyl)-1H-indol-5-ol | AG0008FH | 0.25g |
| 1134328-18-9 | COC1=CC=C2C(NN=C2Br)=C1 | 3-Bromo-6-methoxy-1H-indazole | AG0008KD | 3g |
| 1134328-15-6 | O=C(C1=NNC2=C1C=C(Br)C(OC)=C2)OC | Methyl 5-bromo-6-methoxy-1H-indazole-3-carboxylate | AG0008KE | 6g |
| 1134328-09-8 | O=C(OC(C)(C)C)NC1=CC=CC(NC)=C1 | tert-Butyl (3-(methylamino)phenyl)carbamate | AG0008KG | 25g |
| 1134328-01-0 | C(Oc1ccc2n[nH]cc2n1)c1ccccc1 | 5-(Benzyloxy)-1H-pyrazolo[4,3-b]pyridine | AG0008KI | 2g |
| 1134327-98-2 | CCOC(=O)C1=CN=C2C=C(Br)C=CN12 | Ethyl 7-bromoimidazo[1,2-a]pyridine-3-carboxylate | AG0008KK | 200g |
| 1134327-96-0 | N#CC1=CN=C2C=CC(F)=CN21 | 6-Fluoroimidazo[1,2-a]pyridine-3-carbonitrile | AG0008KL | 3g |
| 1134327-93-7 | BrC1=CN=C(N=C1)CC(=O)O | 2-(5-Bromopyrimidin-2-yl)acetic acid | AG0008KM | 100g |
| 1134327-91-5 | C(C)OC(CC1=NC=C(C=N1)Br)=O | Ethyl 2-(5-bromopyrimidin-2-yl)acetate | AG0008KN | 500g |
| 1134327-89-1 | CC(C)(C)OC(=O)N1CC(=O)C2=C(C1)C=CC=C2 | tert-Butyl 4-oxo-3,4-dihydroisoquinoline-2(1H)-carboxylate | AG0008KO | 75g |
| 113439-90-0 | CC(C)(C)C#CCN | 4,4-Dimethyl-2-pentyn-1-amine | AG0008LE | 15g |
| 113439-83-1 | CC#CCN1C(C2=CC=CC=C2C1=O)=O | 4-Phthalimido-2-butyne | AG0008LF | 25g |
| 113438-59-8 | O=C(C1=CC2=C(NC=C2CC#N)C=C1)OC | METHYL 3-(CYANOMETHYL)-1H-INDOLE-5-CARBOXYLATE | AG0008LK | 23g |
| 113444-43-2 | BrC=1N(C(=C(N1)C)C(=O)OCC)C | Ethyl 2-bromo-1,4-dimethyl-1H-imidazole-5-carboxylate | AG0008M6 | 5g |
| 1134529-25-1 | N#CC1=CC=CC=C1CN.[H]Cl | 2-(Aminomethyl)benzonitrile, HCl | AG0008N6 | 10g |
| 1134524-25-6 | NC1(C2=CC=C(F)C=C2)CC1.[H]Cl | 1-(4-fluorophenyl)cyclopropan-1-amine hydrochloride | AG0008N7 | 20g |
| 113458-95-0 | C(=O)(O)c1cc2c(cc1)cc(c(c2)O)O | 2-Naphthalenecarboxylic acid, 6,7-dihydroxy- | AG0008NB | 0.7g |
| 1026797-07-8 | FC(F)(F)CSC1=CC(B2OC(C)(C)C(C)(C)O2)=CC=C1 | 4,4,5,5-Tetramethyl-2-(3-((2,2,2-trifluoroethyl)thio)phenyl)-1,3,2-dioxaborol | AG000833 | 15g |
| 1026796-81-5 | CC(=O)NC1=NC=CC(Br)=C1 | N-(4-Bromopyridin-2-yl)acetamide | AG000834 | 10g |
| 1026796-78-0 | O=C(N1CC(C=C)C1)OC(C)(C)C | 3-Ethenylazetidine-1-carboxylic acid tert-butyl ester | AG000835 | 30g |
| 1026796-70-2 | CCOc1cc(O)cc(c1)Br | 3-Bromo-5-ethoxyphenol | AG000837 | 2g |
| 1026796-51-9 | OC1=CC(C)=CC(Br)=C1F | 3-Bromo-2-fluoro-5-methylphenol | AG000838 | 10g |
| 1026796-50-8 | COc1c(Br)ccc(c1O)F | 3-Bromo-6-fluoro-2-methoxyphenol | AG000839 | 870g |
| 1026796-39-3 | OCC1=CC=C(B2OC(C)(C)C(C)(C)O2)S1 | (5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl)methanol | AG00083B | 40g |
| 1026796-35-9 | C(C)OC=1C=C(C=CC1C(F)(F)F)B(O)O | 3-Ethoxy-4-(trifluoromethyl)phenylboronic acid | AG00083C | 10g |
| 1026796-02-0 | B(O)(O)c1cn(nc1)C.Cl | (1-Methyl-1H-pyrazol-4-yl)boronic acid hydrochloride | AG00083D | 10g |
| 1026785-12-5 | N[C@@H]([C@@H](c1ccccc1)NS(=O)(=O)c1c(F)c(F)c(c(c1F)F)F)c1ccccc1 | N-((1R,2R)-2-Amino-1,2-diphenylethyl)-2,3,4,5,6-pentafluorobenzenesulfona | AG00083F | 20g |
| 10268-27-6 | COc1cc2c(cc1OC)CCNC2c1ccc(cc1)Cl.Cl | 1-(4-Chlorophenyl)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline hydrochlor | AG00083O | 10g |
| 10268-12-9 | COC(=O)CC1=CC(=CC=C1)[N+]([O-])=O | Methyl 3-Nitrophenylacetate | AG00083P | 500g |
| 10268-06-1 | O=C(N)CC1=CC=CC=C1Cl | 2-(2-Chlorophenyl)acetamide | AG00083Q | 25g |
| 1026853-23-5 | O=C(C1=NNC2=C1CN(C(OC(C)(C)C)=O)C2)OCC | 5-TERT-BUTYL 3-ETHYL 4,6-DIHYDROPYRROLO[3,4-C]PYRAZOLE-3,5(1H)-DICARB | AG00083R | 10g |
| 102684-91-3 | BrC1=C(C=O)C=C(C=C1)C(F)(F)F | 2-Bromo-5-(trifluoromethyl)benzaldehyde | AG00083Y | 425g |
| 102681-71-0 | O=C(OC)C1=CC=C([C@@H](O)C)C=C1 | Methyl 4-[(1S)-1-hydroxyethyl]benzoate | AG000847 | 200g |
| 113486-29-6 | CCCCCC(=O)C(C)C(=O)C | 3-Methylnonane-2,4-dione | AG0008R8 | 50g |
| 113496-14-3 | O=C(O)C1=CC=CC(CC(OC)=O)=C1 | 3-(2-Methoxy-2-oxoethyl)benzoic acid | AG0008RD | 30g |
| 1135-58-6 | O=C(N)NC1=CC=CC(=C1)NC(=O)N | [3-(Carbamoylamino)phenyl]urea | AG0008S7 | 0.5g |
| 1135-40-6 | OS(=O)(=O)CCCNC1CCCCC1 | CAPS | AG0008SA | 4000g |
| 1135-24-6 | C1=C(C=CC(O)=O)C=CC(=C1OC)O | 3-(4-Hydroxy-3-methoxyphenyl)acrylic acid | AG0008SF | 2000g |
| 1135-14-4 | NC1=CC=C(SC2=CC=CC=C2)C=C1 | 4-(Phenylthio)aniline | AG0008SI | 75g |
| 1135-12-2 | C2=C(CC1=CC=CC=C1)C=CC(=C2)N | 4-Benzylaniline | AG0008SJ | 600g |
| 113502-52-6 | O=C(c1ccccc1)c2ccc3C(=O)CCn23 | 1-Keto Ketorolac | AG0008SW | 0.2g |
| 113501-27-2 | FC1=NN2C=CN=C2C=C1 | 6-Fluoroimidazo[1,2-b]pyridazine | AG0008T7 | 9g |
| 113508-12-6 | NC1=NC2=CC(C(F)(F)F)=CC=C2C=C1 | 7-(Trifluoromethyl)quinolin-2-amine | AG0008TD | 0.5g |
| 113504-93-1 | N(=C=S)c1cc2c(cc1)OCO2 | 5-Isothiocyanatobenzo[d][1,3]Dioxole | AG0008TQ | 250g |
| 113503-65-4 | CC(OC1=CC=CN=C1Br)C | 2-Bromo-3-isopropoxypyridine | AG0008TW | 15g |
| 1762-95-4 | [NH4+].[S-]C#N | Ammonium thiocyanate | AG0008TZ | 4000g |
| 113512-71-3 | OC1=CC(N)=C(F)C=C1F | 5-Amino-2,4-difluorophenol | AG0008U7 | 275g |
| 113559-13-0 | CS(=O)(NC1=CC=C(C(C2CCN(CCC3=NC(C)=CC=C3)CC2)=O)C=C1)=O.[H]Cl.[H]Cl | E-4031 | AG0008YW | 0.07g |
| 113558-15-9 | OC1=CC(O)=C(C/C=C(C)/C)C(OC(C2=CC=C(OC)C=C2)=C3O[C@H]4[C@H](O)[C@ | Baohuoside I | AG0008Z1 | 1g |
| 113558-03-5 | [C@@H]1(O)[C@@H](O)[C@]2(C)[C@@]3([H])CC=C4[C@]5([H])[C@](C)(O)[C | 1,2,3,19-Tetrahydroxy-12-ursen-28-oic acid | AG0008Z3 | 0.005g |
| 1135616-49-7 | O=C(O)[C@H](CCCN/C(NS(=O)(C1=C(C)C(C)=C(OC(C)(C)C2)C2=C1C)=O)=N/C)NC | Fmoc-Arg(Me,pbf)-OH | AG0008ZK | 50g |
| 113570-68-6 | N12CCCCC1CNCC2.Cl.Cl | Octahydro-1H-Pyrido[1,2-A]Pyrazine Dihydrochloride | AG000909 | 0.4g |
| 113571-15-6 | NC1=C(Br)C=C(Br)C(Cl)=C1Cl | 4,6-Dibromo-2,3-dichloroaniline | AG00091K | 375g |
| 1135871-91-8 | CC1(OB(C2=CC3=C(C=C2)CCCC3=O)OC1(C)C)C | 7-(Tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-2H-naphthalen-1-one | AG00091N | 5g |
| 1135821-47-4 | OC(C1NN=C(C2=CC(Br)=CC=C2)C=1)=O | 3-(3-bromophenyl)-1H-pyrazole-5-carboxylic acid | AG00091O | 1g |
| 1135818-89-1 | OC(=O)C(c1ccc(cc1)c1ccccn1)N.Cl | 2-Amino-2-(4-(pyridin-2-yl)phenyl)acetic acid hydrochloride | AG00091P | 5g |
| 113583-35-0 | C1=C(N=C([S](C)(=O)=O)N=C1OC)OC | 4,6-Dimethoxy-2-(methylsulfonyl)pyrimidine | AG00091U | 3000g |
| 1135916-78-7 | Cl.CC1=CC=C(C)C(=C1)C(N)C(O)=O | 2-Amino-2-(2,5-dimethylphenyl)acetic acid, HCl | AG00092C | 10g |
| 1135916-70-9 | COC(=O)C(N)C1CCN(C(=O)OC(C)(C)C)C1 | tert-butyl 3-(1-amino-2-methoxy-2-oxoethyl)pyrrolidine-1-carboxylate | AG00092D | 1g |
| 113589-26-7 | CC1=C(C(=C(C(=O)OC)S1)O)Br | Methyl 4-Bromo-3-Hydroxy-5-Methylthiophene-2-Carboxylate | AG00092V | 9g |
| 1135992-31-2 | COCOc1ccc(c(c1)Cl)B(O)O | (2-Chloro-4-(methoxymethoxy)phenyl)boronic acid | AG000931 | 60g |
| 113602-62-3 | O=C(C1=C(O)C=CN1C)OC | Methyl 3-hydroxy-1-methyl-1H-pyrrole-2-carboxylate | AG00093U | 20g |
| 1136-89-6 | OP(O)(=O)Oc1cccc2ccccc12 | 1-Naphthyl phosphate | AG000941 | 500g |
| 1027345-08-9 | O=S(C1=CC=C(F)C(S(=O)(C(F)(F)F)=O)=C1)(N)=O | 4-Fluoro-3-((trifluoromethyl)sulfonyl)benzenesulfonamide | AG00088P | 200g |
| 1027345-07-8 | O=S(C1=CC=C(F)C(S(=O)(C(F)(F)F)=O)=C1)(Cl)=O | 4-fluoro-3-((trifluoromethyl)sulfonyl)benzene-1-sulfonyl chloride | AG00088Q | 70g |
| 1027338-34-6 | O=C(OC(C)(C)C)NC1(CN)CC1 | tert-butyl 1-(aminomethyl)cyclopropylcarbamate | AG00088U | 50g |
| 1027338-06-2 | OC1CC2=CC=CC=C2C#CC3=CC=CC=C31 | 3-Hydroxy-1,2:5,6-dibenzocyclooct-7-yne | AG00088V | 5g |
| 102735-90-0 | OCC1C2=C(C=CC(=C2)Cl)NN=1 | (5-Chloro-1H-indazol-3-yl)methanol | AG00088Y | 2g |
| 102735-84-2 | ClC1=CC=C2NN=C(C=O)C2=C1 | 5-Chloro-1H-Indazole-3-Carbaldehyde | AG000892 | 55g |
| 102735-53-5 | O=C(O)[C@@H](N)CC1CC1 | L-Cyclopropylalanine | AG000894 | 50g |
| 102732-63-8 | O=C(O)CC1=NNC=C1 | 2-(1H-Pyrazol-3-yl)acetic acid | AG000898 | 25g |
| 1027476-96-5 | S=C(NC1=CC(C(F)(F)F)=CC(C(F)(F)F)=C1)N[C@H]2CCCC[C@@H]2N | N-[(1S,2S)-2-Aminocyclohexyl]-N’-[3,5-bis(trifluoromethyl)phenyl]thiourea | AG00089B | 1.75g |
| 102747-84-2 | O=C(O)[C@@H](N)CCC(NC(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3)=O | H-Gln(Trt)-OH | AG00089E | 1000g |
| 1027513-46-7 | O=C(OC)C1=CC=C(I)C(F)=C1 | METHYL 3-FLUORO-4-IODOBENZOATE | AG0008A1 | 34g |
| 1027513-40-1 | N#CC1=NN=C(Br)C=C1 | 6-Bromopyridazine-3-carbonitrile | AG0008A2 | 15g |
| 1027513-14-9 | C1=C(C=C(C=C1F)I)C(F)(F)F | 3-Fluoro-5-iodobenzotrifluoride | AG0008A3 | 10g |
| 1027512-23-7 | O(C(C)(C)C)C(N1CCCC(C)(C(O)=O)CC1)=O | 1-Boc-4-methylazepane-4-carboxylic acid | AG0008A7 | 1g |
| 10271-85-9 | O=C(C1=CC=NS1)O | Isothiazole-5-carboxylic acid | AG00086X | 125g |
| 1027155-76-5 | Nc1ccc2c(c1)[nH]c(n2)c1ccc(cc1)NC(=O)c1ccccc1 | N-(4-(5-Amino-1H-benzo[d]imidazol-2-yl)phenyl)benzamide | AG00087C | 10g |
| 102714-93-2 | CCC[C@H]1CC[C@H](C2=CC=C(C3=CC=C([C@H]4CC[C@H](CCC)CC4)C=C3F)C=C2 | 2-Fluoro-4,4′-bis(trans-4-propylcyclohexyl)biphenyl | AG00087M | 200g |
| 102714-71-6 | COC1=CC(C#N)=C(C=C1OC)[N+]([O-])=O | 4,5-Dimethoxy-2-nitrobenzonitrile | AG00087O | 400g |
| 10272-49-8 | [H]Cl.C1(C2=CC=CC=C2)CCNCC1 | 4-Phenylpiperidine Hydrochloride | AG00087R | 50g |
| 10272-07-8 | NC1=CC(OC)=CC(OC)=C1 | 3,5-Dimethoxyaniline | AG00087T | 7000g |
| 10272-06-7 | NC1=CC(OC)=CC(Cl)=C1 | 3-Chloro-5-methoxyaniline | AG00087U | 200g |
| 1027259-01-3 | NC1=NNC2=CC(=CC=C12)[N+]([O-])=O | 6-Nitro-1H-indazol-3-amine | AG00087W | 1g |
| 102728-64-3 | CC(OCCOCN1C=NC2=C1NC(NC2=O)=N)=O | 2-((2-Amino-6-oxo-1H-purin-9(6H)-yl)methoxy)ethyl acetate | AG000885 | 20g |
| 10273-90-2 | CC1=CC=CN=C1C2=CC=CC=C2 | 3-Methyl-2-phenylpyridine | AG00088B | 100g |
| 10273-89-9 | CC1C(C2C=CC=CN=2)=CC=CC=1 | 2-(o-tolyl)pyridine | AG00088C | 10g |
| 10273-85-5 | OCC1=C2C=CC=CC2=C(CO)C3=CC=CC=C13 | Anthracene-9,10-Diyldimethanol | AG00088E | 200g |
| 10273-84-4 | CC(OCC1=C2C=CC=CC2=C(COC(C)=O)C3=CC=CC=C13)=O | Anthracene-9,10-diylbis(methylene) diacetate | AG00088F | 2g |
| 10273-40-2 | O=CC1=C2C=CN=CC2=CN=C1 | 2,7-naphthyridine-4-carbaldehyde | AG00088J | 0.5g |
| 1025452-30-5 | O=CC1=CC=C2N=C(Br)SC2=C1 | 2-bromobenzo[d]thiazole-6-carbaldehyde | AG0007OS | 25g |
| 1025447-55-5 | Cl.NC1=CC(=NN1)C1=CC(Cl)=C(Cl)C=C1 | 5-Amino-3-(3，4-dichlorophenyl)pyrazole Hydrochloride | AG0007OT | 30g |
| 1025424-03-6 | O=S(N1CC2=C(C(OC)=CC=C2)C1)(C3=CC=C(C)C=C3)=O | 4-Methoxy-2-tosylisoindoline | AG0007OX | 0.75g |
| 1025423-95-3 | OC1=CC=C(CNC)C=C1O.[H]Br | 4-[(Methylamino)methyl]pyrocatechol Hydrobromide | AG0007OY | 50g |
| 1025509-81-2 | N(=O)(=O)c1c(F)cc(cc1)SC | (3-Fluoro-4-nitrophenyl)(methyl)sulfane | AG0007PA | 1.25g |
| 1025504-45-3 | COC1=C(OC)C=C(CCN2[C@]3([H])C[C@@H](OC([C@@H](N)C(C)C)=O)[C@H](C | Valbenazine | AG0007PE | 5g |
| 10256-83-4 | Cc1ccc(cc1)[Si](c1ccc(C)cc1)(c1ccc(C)cc1)c1ccc(C)cc1 | tetrakis(4-methylphenyl)silane | AG0007PN | 5g |
| 10256-43-6 | NCC[N+](C)(C)C.[Cl-] | Ethanaminium, 2-amino-N,N,N-trimethyl-, chloride (1:1) | AG0007PQ | 2g |
| 10255-95-5 | NC(=O)C(C(N)=O)c1ccccc1 | 2-phenylpropanediamide | AG0007PW | 800g |
| 10255-67-1 | [Na+].[O-]C(C(CS)=O)=O | sodium 2-oxo-3-sulfanylpropanoate | AG0007PY | 15g |
| 113756-89-1 | O=C(O)[C@@H](NC(OC(C)(C)C)=O)CCCC1=CC=CC=C1.C2(NC3CCCCC3)CCCCC2 | Boc-L-2-amino-5-phenyl-pentanoic acid dcha salt | AG0009LK | 5g |
| 1137721-06-2 | O=C1C=CC(N)=CN1C.[H]Cl | 5-Amino-1-methyl-1,2-dihydropyridin-2-one HCl | AG0009MB | 125g |
| 113772-16-0 | S1CC(=CC1)C=O | 2,5-Dihydrothiophene-3-carbaldehyde | AG0009ME | 10g |
| 113771-75-8 | NCC1COC2=C(C=CC=C2)C1.[H]Cl | 1-(3,4-Dihydro-2h-chromen-3-yl)methanamine, HCl | AG0009MI | 3g |
| 113771-58-7 | O=C(C1CCC2=C(O1)C=CC=C2)OC | Methyl chroman-2-carboxylate | AG0009MJ | 15g |
| 113770-88-0 | FC1=C(C=CN=C1)C#N | 3-Fluoro-4-cyanopyridine | AG0009MM | 50g |
| 113770-87-9 | FC1=C(C(F)(F)F)C=CN=C1 | 3-Fluoro-4-(trifluoromethyl)pyridine | AG0009MN | 2.5g |
| 113770-42-6 | Fc1cc(ccc1c1ccccc1)c1ccccc1 | 1,1′:4′,1”-Terphenyl, 2′-fluoro- | AG0009MS | 1000g |
| 113770-21-1 | Clc1cc2c(cc1)NCCO2 | 2H-1,4-Benzoxazine, 7-chloro-3,4-dihydro- | AG0009MV | 35g |
| 113778-69-1 | CC(C)C(N(OC)C)=O | N-Methoxy-N,2-Dimethylpropanamide | AG0009NE | 175g |
| 113775-47-6 | [C@H](C)(c1c(C)c(C)ccc1)c1cnc[nH]1 | 1H-Imidazole, 5-[(1S)-1-(2,3-dimethylphenyl)ethyl]- | AG0009NM | 1g |
| 113775-22-7 | O=C(N1[C@]2([H])C(O[C@](C2)([H])C1)=O)OC(C)(C)C | (1S,4S)-tert-Butyl 3-oxo-2-oxa-5-azabicyclo[2.2.1]heptane-5-carboxylate | AG0009NN | 10g |
| 1137870-15-5 | CC(N1CC(N)C1)=O | 1-(3-Aminoazetidin-1-yl)ethanone | AG0009NP | 15g |
| 1137869-95-4 | BrC1=CC=C(N)C(OC)=C1F | 4-Bromo-3-fluoro-2-methoxyaniline | AG0009NQ | 35g |
| 1137869-92-1 | N#CC1=CC(OC)=C([N+]([O-])=O)C(F)=C1 | 3-Fluoro-5-methoxy-4-nitrobenzonitrile | AG0009NR | 135g |
| 1137869-91-0 | O=[N+](C1=C(OC)C=C(Br)C=C1F)[O-] | 5-Bromo-1-fluoro-3-methoxy-2-nitrobenzene | AG0009NS | 200g |
| 1137868-52-0 | O=C(NC1CCN(C)CC1)C2=CC(OC)=C(NC3=NC=C(N4C)C(N(C5CCCC5)CC(F)(F)C4=O) | TAK-960 | AG0009NT | 0.1g |
| 1137826-05-1 | OC(C1=CC2=C(C=CC(=C2)O)N=C1)=O | 6-Hydroxyquinoline-3-carboxylic acid | AG0009NU | 1g |
| 113512-57-5 | OC1=CC([N+]([O-])=O)=C(F)C=C1F | 2,4-Difluoro-5-nitrophenol | AG0008U8 | 200g |
| 113520-43-7 | C(C(=O)O)c1cc(CN)ccc1 | 3-Aminomethylphenylacetic acid | AG0008VN | 2g |
| 1135283-10-1 | O=[N+](C1=CC=C(C#C)C(OC)=C1)[O-] | 1-Ethynyl-2-methoxy-4-nitrobenzene | AG0008W4 | 35g |
| 1135283-08-7 | BrC1=CN=C(N=C1)C#C | 5-Bromo-2-ethynylpyrimidine | AG0008W5 | 3g |
| 1135253-08-5 | OCC1=CC=C(F)C(CC)=C1 | (3-Ethyl-4-fluorophenyl)methanol | AG0008W6 | 0.75g |
| 1135243-19-4 | O=S(C1=CC=CC2=NSN=C21)(NCCC(N3CCN(C4=CC=NC=C4)CC3)=O)=O | VU 0255035 | AG0008W7 | 0.5g |
| 113526-01-5 | CCCCC(CC)COC(=O)CCOCC | Propanoic acid, 3-ethoxy-, 2-ethylhexyl ester | AG0008WG | 10g |
| 113525-87-4 | O=C(OC)C(O)CNC(OC(C)(C)C)=O | Methyl N-Boc-3-amino-2-hydroxypropanoate | AG0008WJ | 5g |
| 1135288-77-5 | OC1=CC=C(C(N)CC)C=C1.[H]Cl | 4-(1-Aminopropyl)phenol hydrochloride | AG0008WV | 0.5g |
| 1135283-53-2 | O=CC1=CNC2=NC=C(C(F)(F)F)C=C21 | 5-(Trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine-3-carbaldehyde | AG0008WX | 15g |
| 1135283-39-4 | CCOC(=O)C1=CN2C=C(C=C(C2=N1)I)C(F)(F)F | Ethyl 8-iodo-6-(trifluoromethyl)imidazo[1,2-a]pyridine-2-carboxylate | AG0008WY | 24g |
| 113534-13-7 | [Si](C)(C)(C(C)(C)C)OC[C@H](C)O | (S)-1-((tert-Butyldimethylsilyl)oxy)propan-2-ol | AG0008X8 | 25g |
| 113534-02-4 | O=C(N1CCN(C#N)CC1)OC(C)(C)C | tert-Butyl 4-cyanopiperazine-1-carboxylate | AG0008X9 | 50g |
| 1135531-73-5 | O=CC1=C(F)C=C(Cl)C=C1Br | 2-Bromo-4-chloro-6-fluorobenzaldehyde | AG0008YV | 200g |
| 113451-52-8 | [N-]=[N+]=NC1CCN(C1)C(=O)OC(C)(C)C | tert-Butyl 3-azidopyrrolidine-1-carboxylate | AG0008NQ | 1g |
| 113465-94-4 | COC(=O)Cc1cc(C)[nH]n1 | Methyl 2-(5-methyl-1H-pyrazol-3-yl)acetate | AG0008NZ | 7g |
| 1134699-45-8 | C1(N)(CC1)C1=CC=CC=C1Cl.Cl | [1-(2-chlorophenyl)cyclopropyl]amine hydrochloride | AG0008OK | 20g |
| 113474-25-2 | COC(C1CC(C(OC)=O)CC(O)C1)=O | Dimethyl 5-hydroxycyclohexane-1,3-dicarboxylate | AG0008OO | 10g |
| 113473-30-6 | OC(=O)[C@@]1(N)CNCC1 | (S)-3-Aminopyrrolidine-3-carboxylic acid | AG0008OQ | 1g |
| 1134777-51-7 | O=C(OC)C1=CC=C(C(Br)Br)C(F)=C1 | METHYL 4-(DIBROMOMETHYL)-3-FLUOROBENZOATE | AG0008P7 | 2g |
| 1134776-39-8 | O=C(O)C1=CC=C([C@H](N)C)C=C1.[H]Cl | (R)-4-(1-Aminoethyl)benzoic acid hydrochloride | AG0008P8 | 1.8g |
| 1134776-30-9 | [C@@H](NC(=O)OC(C)(C)C)(C)c1ccc(cc1)C(=O)O | Benzoic acid, 4-[(1R)-1-[[(1,1-dimethylethoxy)carbonyl]amino]ethyl]- | AG0008P9 | 6g |
| 1134753-48-2 | Cl.Nc1cc(Br)c2cc[nH]c2c1 | 4-Bromo-1H-indol-6-amine hydrochloride | AG0008PB | 0.5g |
| 113484-74-5 | O=C(OCC1C2=C(C3=C1C=CC=C3)C=CC=C2)NCC(ON4C(CCC4=O)=O)=O | Fmoc-Gly-OSu | AG0008Q8 | 900g |
| 113479-11-1 | CC(C)(NCC1=CC=CC=C1)CC(O)=O | 3-(Benzylamino)-3-methylbutanoic Acid | AG0008QH | 300g |
| 1134915-25-5 | Cl.NC(C1=CC(C(F)(F)F)=CC=C1)C(O)=O | 2-Amino-2-(3-(trifluoromethyl)phenyl)acetic acid hydrochloride | AG0008QN | 5g |
| 113490-76-9 | COC(=O)[C@@H]1C[C@H](CN1)OCc1ccccc1 | (4R)-4-Benzyloxy-L-Proline methyl ester | AG0008QT | 0.5g |
| 1136-86-3 | CC(C1=CC(OC)=C(OC)C(OC)=C1)=O | 3′,4′,5′-Trimethoxyacetophenone | AG000943 | 200g |
| 1136-76-1 | O=C(C1=CC(C)=NN1C2=CC=CC=C2)O | 5-Methyl-2-phenylpyrazole-3-carboxylic acid | AG000946 | 5g |
| 1136-45-4 | O=C(C1=C(C)ON=C1C2=CC=CC=C2)O | 5-Methyl-3-phenylisoxazole-4-carboxylic acid | AG00094B | 1500g |
| 159002-17-2 | O=C(O)C(CN)NC(OC(C)(C)C)=O | N-Alpha-boc-(+/-)-2,3-diaminopropionic acid | AG00095S | 600g |
| 113626-30-5 | C1(=CC=CC=C1)COC1=CC=C2NC=C(C[C@H](N)C(=O)O)C2=C1 | 5-(Phenylmethoxy)-L-tryptophan | AG00095V | 2g |
| 113617-63-3 | O=C(C1=CN(C2CC2)C3=C(C(F)=C(F)C(N4C[C@H](C)N[C@H](C)C4)=C3F)C1=O)O | 1-Cyclopropyl-7-(cis-3,5-dimethylpiperazin-1-yl)-5,6,8-trifluoro-4-oxo-1,4-dih | AG00096D | 10g |
| 113642-05-0 | COC(=O)c1ccc(c(c1)Br)CC | Methyl 3-bromo-4-ethylbenzoate | AG00097C | 5g |
| 113665-84-2 | O=C(OC)[C@H](C1=CC=CC=C1Cl)N2CCC3=C(C=CS3)C2 | Clopidogrel | AG00099Q | 10g |
| 1136813-84-7 | CC1=CC=CC(NS(=O)(=O)C2=CC=CC=C2F)=N1 | 2-Fluoro-N-(6-methyl-2-pyridyl)benzenesulfonamide | AG0009AN | 1.25g |
| 113682-56-7 | C1(C2=CC=NC=C2)=CC=C(C3=CC=NC=C3)C=C1 | 1,4-Di(pyridin-4-yl)benzene | AG0009AY | 20g |
| 7303-50-6 | O=C(O)C(N)CC1=CN=C2C1=CC=CN2 | 7-Azatryptophan | AG0009D5 | 5g |
| 1137-42-4 | OC1=CC=C(C=C1)C(=O)C1=CC=CC=C1 | 4-Hydroxybenzophenone | AG0009D7 | 2500g |
| 1137-41-3 | O=C(C1=CC=C(N)C=C1)C2=CC=CC=C2 | 4-Aminobenzophenone | AG0009D8 | 3000g |
| 1137014-87-9 | Cl[H].NC(C(O)=O)C1=CC(Cl)=CC(Cl)=C1 | 2-Amino-(3,5-dichloro-phenyl)-acetic acid, HCl | AG0009DF | 5g |
| 114132-26-2 | O=S(CC1CC1)(Cl)=O | Cyclopropylmethanesulfonyl chloride | AG000AMY | 20g |
| 114144-22-8 | ClC1=CC=CC2=C1NCC2 | 7-chloroindoline | AG000ANK | 1.25g |
| 114144-17-1 | O=CC1=CNC2=C1C=C(I)C=C2 | 5-Iodo-1H-indole-3-carbaldehyde | AG000ANL | 25g |
| 1141478-88-7 | O[C@H](CC1=CC=C(Br)C=C1)C(O)=O | (R)-3-(4-Bromophenyl)-2-hydroxypropionic Acid | AG000AO2 | 7g |
| 114153-09-2 | CC1=C(N)C=CC(F)=C1F | 3,4-Difluoro-2-methylaniline | AG000AO7 | 25g |
| 114152-23-7 | O=C(O)CC1=C(F)C=CC(F)=C1F | 2,3,6-Trifluorophenylacetic Acid | AG000AO8 | 125g |
| 114152-21-5 | N#CCC1=C(F)C=CC(F)=C1F | 2-(2,3,6-Trifluorophenyl)acetonitrile | AG000AO9 | 175g |
| 114152-20-4 | FC1=CC=C(F)C(CCl)=C1F | 2-(Chloromethyl)-1,3,4-trifluorobenzene | AG000AOA | 10g |
| 114152-19-1 | OCC1=C(F)C(F)=CC=C1F | 2,3,6-Trifluorobenzyl alcohol | AG000AOB | 50g |
| 1141669-45-5 | C1=CC(=CC(=C1C=O)Cl)N2C=CN=C2 | 2-Chloro-4-(1H-imidazol-1-yl)benzaldehyde | AG000AOT | 1.5g |
| 1141669-41-1 | CC1=C(N)C=C(F)C(N)=C1 | 2-Fluoro-5-methylbenzene-1,4-diamine | AG000AOU | 10g |
| 114162-64-0 | NC1CCCCC1.O([C@H]1[C@@H]([C@@H](O)[C@H](O)[C@@H](C(=O)O)O1)O)C | X-Beta-d-glcua dcha h2o | AG000AP2 | 5g |
| 1141669-88-6 | CCN1CC2C(C1)CCCN2 | 6-Ethyloctahydropyrrolo[3,4-B]pyridine | AG000API | 25g |
| 1141669-81-9 | CCOC1=CC=C(C(C)O)C(OCC)=C1 | 1-(2,4-Diethoxyphenyl)ethanol | AG000APK | 50g |
| 1141669-77-3 | [O-][N+](=O)c1ccccc1c1csc(n1)C(=O)O | 4-(2-Nitrophenyl)-1,3-thiazole-2-carboxylic acid | AG000APL | 1g |
| 1141669-69-3 | NC1=NC2=C(CN(CC2)C(=O)OCC2=CC=CC=C2)S1 | 2-Amino-5-Cbz-4,5,6,7-Tetrahydro-1,3-Thiazolo[5,4-c]Pyridine | AG000APM | 50g |
| 1141669-65-9 | OC(=O)C1=CC(N2C=CN=C2)=C(F)C=C1[N+]([O-])=O | 4-Fluoro-5-(1h-imidazol-1-yl)-2-nitrobenzoic acid | AG000APN | 1.25g |
| 1141669-63-7 | OC(C1OCCCN(C(OCC2=CC=CC=C2)=O)C1)=O | 4-Cbz-2-homomorpholinecarboxylic Acid | AG000APO | 3g |
| 1141669-61-5 | O=C(C1OCCCN(C(OC(C)(C)C)=O)C1)O | 4-Boc-2-homomorpholinecarboxylic acid | AG000APP | 3g |
| 113721-87-2 | O=C(ON1C(CCC1=O)=O)CC2=C(C)C3=CC=C(N)C=C3OC2=O | 2,5-Dioxopyrrolidin-1-yl 2-(7-amino-4-methyl-2-oxo-2H-chromen-3-yl)acetat | AG0009GC | 0.5g |
| 1137278-42-2 | Clc1nc(N2CCOCC2)c2c(n1)ncs2 | 4-(5-Chlorothiazolo[4,5-d]pyrimidin-7-yl)morpholine | AG0009GT | 2g |
| 1137278-39-7 | Clc1nc(Cl)c2scnc2n1 | 5,7-Dichlorothiazolo[4,5-d]pyrimidine | AG0009GU | 10g |
| 113732-84-6 | C(=O)c1nc(oc1)C | 2-METHYLOXAZOLE-4-CARBALDEHYDE | AG0009GW | 50g |
| 113732-62-0 | Cc1oc(nc1C(=O)CBr)C | Ethanone, 2-bromo-1-(2,5-dimethyl-4-oxazolyl)- | AG0009GX | 0.75g |
| 113728-71-5 | c1csc(c1)-c1ccc(s1)-c1ccc(s1)-c1ccc(s1)-c1ccc(s1)-c1ccc(s1)-c1ccc(s1)-c1cccs1 | 2,2′:5′,2”:5”,2”’:5”’,2””:5””,2””’:5””’,2”””:5”””,2”””’-Octithiophene | AG0009HB | 0.1g |
| 113728-13-5 | O=C(NC1=CC(O2)=C(C=C1)C(C)=CC2=O)CN.Br | H-Gly-Amc HBr | AG0009HC | 0.75g |
| 1137359-47-7 | OC[C@@H](O1)[C@@H](OC(NC2=CC=C(C(OCC)=O)C=C2)=O)[C@H](OC(NC3=CC | BRD7552 | AG0009HH | 0.15g |
| 1137339-94-6 | COC1=C(C=C(CO)C=C1)B(O)O | (5-(Hydroxymethyl)-2-methoxyphenyl)boronic acid | AG0009HI | 75g |
| 1137475-57-0 | O=[N+](C1=CN=C(Br)C=C1Cl)[O-] | 2-Bromo-4-chloro-5-nitropyridine | AG0009JV | 15g |
| 1137606-74-6 | N#CC1=NC(F)=CNC1=O.C2(NC3CCCCC3)CCCCC2 | 6-Fluoro-3-oxo-3,4-dihydropyrazine-2-carbonitrile compound with dicyclohe | AG0009KZ | 62g |
| 1137576-61-4 | ClC1=NC(Cl)=C(I)C(Cl)=N1 | 2,4,6-Trichloro-5-iodopyrimidine | AG0009L0 | 1g |
| 1137576-38-5 | ClC1=NC=NC(=C1I)Cl | 4,6-Dichloro-5-iodopyrimidine | AG0009L2 | 200g |
| 113763-37-4 | COC(=O)c1c(O)cccc1Br | Methyl 2-bromo-6-hydroxybenzoate | AG0009L6 | 20g |
| 113760-29-5 | O1C2CC(C)(C)CC(=O)C=2S/C/1=NC1=CC=CC=C1 | BOT-64 | AG0009LE | 0.308g |
| 113759-96-9 | O=C1CCN(C2=CC=C(Cl)C=C2)CC1 | 1-(4-Chlorophenyl)piperidin-4-one | AG0009LH | 10g |
| 1137-96-8 | [O-][N+](=Cc1ccccc1)c1ccccc1 | N,1-diphenylmethanimine oxide | AG0009DP | 6g |
| 1137-77-5 | NC1=CC=C(C2=CC=C(OC)C=C2)C=C1 | 4-(4-Methoxyphenyl)aniline | AG0009DT | 125g |
| 1137-73-1 | OC(CN(C1=CC=CC=C1)CC(O)=O)=O | N-Phenyliminodiacetic Acid | AG0009DV | 25g |
| 1137-71-9 | CC(C1=CC=C(OCC)C(OCC)=C1)=O | 1-(3,4-Diethoxyphenyl)ethanone | AG0009DW | 5g |
| 1137-68-4 | c1(nc2c([nH]1)cccc2)c1ccccn1 | 1H-Benzimidazole, 2-(2-pyridinyl)- | AG0009DX | 500g |
| 1137-67-3 | N1C2=C(C=CC=C2)N=C1C1=CC=CN=C1 | 2-(3-Pyridyl)benzimidazole | AG0009DY | 200g |
| 1137026-67-5 | COC(=O)C1=CC(CN([C@@H](C)C2=NC=C(N2)C2=CC=CC=C2)C(=O)[C@H](CC2=C( | Methyl 5-(((S)-2-((tert-butoxycarbonyl)amino)-3-(4-carbamoyl-2,6-dimethylp | AG0009E3 | 3.25g |
| 113703-66-5 | ClC1=CC=C(C=C1)N(C1=CC=CC=C1)C1=CC=C(C=C1)N(C1=CC=CC=C1)C1=CC=C(Cl)C | N,N’-Bis(4-chlorophenyl)-N,N’-diphenyl-1,4-phenylenediamine | AG0009EN | 4g |
| 1137109-21-7 | O=C(ON1C(CCC1=O)=O)CCOCCOCCOCCOCCOCCOCCNC(CCN2C(C=CC2=O)=O)=O | 3-(2-Maleimidoethylcarbonyl)amino(peg6)propionic acid N-Hydroxysuccinim | AG0009ER | 30g |
| 113710-83-1 | CC1(C)OC(c2c1cccc2)(C)C | 1,1,3,3-Tetramethyl-2-benzofuran | AG0009EU | 0.2g |
| 1137142-58-5 | BrC2=N[N]1C=CN=C1S2 | 2-Bromoimidazo[2,1-b][1,3,4]thiadiazole | AG0009FG | 50g |
| 113713-60-3 | COC2=CC=C1N=C([NH]C1=N2)S | 2-Mercapto-5-methoxyimidazole-[4,5-b]pyridine | AG0009FV | 75g |
| 113712-06-4 | CC(C)(OC(N[C@@H](C(O)=O)CCCNC(N)=N)=O)C.Cl | N-Boc-d-arginine hydrochloride | AG0009G0 | 500g |
| 113712-05-3 | N=C(N)NCCC[C@H](C(O)=O)NC(OCC1=CC=CC=C1)=O.[H]Cl | Z-D-Arg-OH HCl | AG0009G1 | 900g |
| 114214-69-6 | CC(C)(C)OC(=O)N1CCC(CO)C1 | 1-Boc-3-hydroxymethylpyrrolidine | AG000ASZ | 500g |
| 114214-49-2 | C(C)(C)(C)OC(=O)N2CC1OC1C2 | tert-Butyl 6-oxa-3-azabicyclo[3.1.0]hexane-3-carboxylate | AG000AT0 | 100g |
| 114215-40-6 | OC(C#CC1=C(C=O)C=CC=C1)(C)C | 2-(3-Hydroxy-3-methylbut-1-yn-1-yl)benzaldehyde | AG000ATX | 2g |
| 1142197-19-0 | CC(C1=CN=C(Br)C=C1)(C)C | 2-Bromo-5-(tert-butyl)pyridine | AG000AU9 | 5g |
| 1142197-14-5 | BrC1=NC=C(C2CC2)C=C1 | 2-broMo-5-cyclopropylpyridine | AG000AUA | 2g |
| 1142194-24-8 | CC(OC1=NC=CC(Br)=C1)C | 4-Bromo-2-isopropoxypyridine | AG000AUI | 20g |
| 1142192-61-7 | ClC1=CN=C2C=COC2=C1 | 6-Chlorofuro[3,2-b]pyridine | AG000AUJ | 0.8g |
| 1142192-58-2 | ClC1=C(Cl)C2=C(NC=C2)N=C1 | 4,5-Dichloro-1H-pyrrolo[2,3-b]pyridine | AG000AUK | 20g |
| 1142192-57-1 | FC(F)(F)C1=CC2=C(NC=C2I)N=C1 | 3-Iodo-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine | AG000AUL | 0.5g |
| 1142192-55-9 | O=C(OC)C1=NC=C(Br)C=C1OC | Methyl 5-bromo-3-methoxypicolinate | AG000AUM | 125g |
| 1142192-03-7 | O=C(OC)C1=C(Cl)N=C(Br)C=C1 | Methyl 6-bromo-2-chloronicotinate | AG000AUN | 1g |
| 1142191-66-9 | O=C(O)C1=NC=C(Br)C=C1OC | 5-Bromo-3-methoxypicolinic acid | AG000AUS | 50g |
| 1142189-49-8 | CC1=C2C=CC(Br)=CC2=NN1C | 6-bromo-2,3-dimethyl-2H-indazole | AG000AUU | 50g |
| 1142188-60-0 | O=C(N1CCC2=C(O)N=CN=C2C1)OC(C)(C)C | tert-Butyl 4-hydroxy-5,6-dihydropyrido[3,4-d]pyrimidine-7(8H)-carboxylate | AG000AUV | 25g |
| 1142234-38-5 | COC(=O)CC(C)C1=CC=CC(O)=C1 | Methyl 3-(3-hydroxyphenyl)butanoate | AG000AUY | 15g |
| 1142234-16-9 | CCC(CC(=O)OC)C1=CC=CC(O)=C1 | Methyl 3-(3-Hydroxyphenyl)pentanoate | AG000AUZ | 25g |
| 1142224-62-1 | COC(=O)CC(C1CC1)C1=CC=CC(O)=C1 | Methyl 3-Cyclopropyl-3-(3-hydroxyphenyl)propanoate | AG000AV1 | 25g |
| 1142224-26-7 | COC(=O)CC(C(C)C)C1=CC=CC(O)=C1 | Methyl 3-(3-Hydroxyphenyl)-4-methylpentanoate | AG000AV3 | 5g |
| 102624-96-4 | Cl.OC(=O)C1CNC1 | Azetidine-3-carboxylic acid, HCl | AG0007YP | 50g |
| 1026265-04-2 | OC1=CC2=C(F)C=CC=C2N=C1 | 5-Fluoroquinolin-3-ol | AG0007YZ | 1.25g |
| 1026355-57-6 | O=C(OC)C1=CC(C(F)(F)F)=CC=C1Br | Methyl 2-bromo-5-(trifluoromethyl)benzoate | AG0007ZN | 50g |
| 102638-45-9 | O=C(OC(C)(C)C)C1=CC=CC(CN)=C1 | tert-Butyl 3-(aminomethyl)benzoate | AG0007ZR | 25g |
| 102636-82-8 | C([N+](C)(C)C)[C@H](OC(=O)CCCC(O)=O)CC([O-])=O | Glutarylcarnitine | AG0007ZU | 0.01g |
| 10264-16-1 | N(C(=O)CCC)CCCC | N-Butylbutanamide | AG000805 | 0.2g |
| 102649-79-6 | O=S(C1=C2C=CC=C(Cl)C2=CC=C1)(NCCCCCCC)=O | 5-Chloro-N-heptylnaphthalene-1-sulfonamide | AG00080F | 0.43g |
| 102645-35-2 | ClC1=NC=C(Cl)C(=C1)C#N | 2,5-Dichloroisonicotinonitrile | AG00080K | 15g |
| 102645-33-0 | O=CC1=C(Cl)C=NC(Cl)=C1 | 2,5-Dichloro-4-formylpyridine | AG00080L | 200g |
| 113825-16-4 | N1C(C)=CNC=1C=O | 4-Methyl-1h-imidazole-2-carbaldehyde | AG0009TR | 9g |
| 1138331-90-4 | O=C(N1CC(C(O)C)C1)OC(C)(C)C | tert-Butyl 3-(1-hydroxyethyl)azetidine-1-carboxylate | AG0009TY | 25g |
| 1138324-48-7 | O=C(N1[C@H](CO)C[C@@H](F)C1)OC(C)(C)C | (2S,4R)-1-(tert-Butoxycarbonyl)-4-fluoro-2-hydroxymethylpyrrolidine | AG0009TZ | 15g |
| 1138324-46-5 | CC(C)(C)OC(=O)N1C[C@H](F)C[C@H]1CN | tert-butyl (2S,4R)-2-(aMinoMethyl)-4-fluoro-1-pyrrolidinecarboxylate | AG0009U0 | 3g |
| 1138323-75-7 | CC(C)[C@H](CNC(OCC1=CC=CC=C1)=O)C(O)=O | (R)-2-((((Benzyloxy)carbonyl)amino)methyl)-3-methylbutanoic acid | AG0009U1 | 2g |
| 1138444-17-3 | IC1=CC=C(Br)N=C1Cl | 6-Bromo-2-chloro-3-iodopyridine | AG0009UM | 275g |
| 1138444-15-1 | CN1C=NC2=CC(I)=CN=C21 | 6-Iodo-3-methyl-3H-imidazo[4,5-b]pyridine | AG0009UN | 6g |
| 1138443-83-0 | CC1=CC2=C(NC=C2I)N=C1 | 3-Iodo-5-methyl-1H-pyrrolo[2,3-b]pyridine | AG0009US | 5.7g |
| 113841-59-1 | CC1=NOC(=C1CBr)C1=CC=CC=C1 | 4-(Bromomethyl)-3-methyl-5-phenylisoxazole | AG0009V9 | 0.25g |
| 1138450-30-2 | FC(C1=NN(C)C=C1B(O)O)(F)F | 1-Methyl-3-trifluoromethylpyrazole-4-boronic acid | AG0009VA | 43.55g |
| 1138445-14-3 | C(C)(F)(F)c1c(F)cccc1 | 1-(1,1-Difluoroethyl)-2-fluorobenzene | AG0009VG | 10g |
| 113845-68-4 | FC(C1=CC=C(N2CCCC2)C=C1)(F)F | 1-(4-(Trifluoromethyl)phenyl)pyrrolidine | AG0009VR | 5g |
| 1138480-98-4 | COC(=O)C1CC2(C1)CC(=O)C2 | Methyl 6-oxospiro[3.3]heptane-2-carboxylate | AG0009VX | 100g |
| 113850-96-7 | O=C(C1=CC(C2=CC=C(Br)C=C2O1)=O)O | 7-Bromo-4-oxo-4H-chromene-2-carboxylic acid | AG0009WQ | 7g |
| 113850-76-3 | O=C(OC)[C@@H](NC(OC(C)(C)C)=O)CC1=CC=C(I)C=C1 | Boc-Phe(4-I)-Ome | AG0009WU | 25g |
| 113853-16-0 | O=C(C1=CN=C(N)O1)OCC | Ethyl 2-aminooxazole-5-carboxylate | AG0009XT | 200g |
| 113867-24-6 | O=C([C@H](C1)CC2=C(C=CC=C2)C1=O)O | (S)-4-Oxo-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid | AG0009Y1 | 1g |
| 113880-81-2 | O=C1C2C(=CNC=2)CCCC1 | 5,6,7,8-Tetrahydrocyclohepta[c]pyrrol-4(2H)-one | AG0009YU | 5g |
| 113886-71-8 | OC[C@@H]1[C@H]([C@H]([C@H](N2C(N=C(C=C2)NC(C)=O)=O)O1)OC)O | N4-Acetyl-2′-O-methyl-cytidine | AG0009ZI | 125g |
| 113886-70-7 | OC[C@@H]1[C@H]([C@H]([C@H](N2C(N=C(C(C)=C2)N)=O)O1)OC)O | 5-methyl-2′-O-Methylcytidine | AG0009ZJ | 100g |
| 113884-66-5 | NC1=NC(C2=CC=CC=C2)=CO1.[H]Cl | 4-Phenyloxazol-2-amine hydrochloride | AG0009ZO | 3g |
| 113882-48-7 | C(CCC=C)(=O)OCC1=CC=CC=C1 | benzyl pent-4-enoate | AG0009ZY | 10g |
| 113882-33-0 | O=C(O)C1=CC([N+]([O-])=O)=CC(C)=C1 | 3-Methyl-5-nitrobenzoic acid | AG000A00 | 172.25g |
| 113893-08-6 | OB(O)C1=CSC2=C1C=CC=C2 | Benzo[b]thiophen-3-ylboronic acid | AG000A0A | 200g |
| 113893-02-0 | C1(C#N)=C(C)C(Br)=C(N=C1OC)C | 5-bromo-2-methoxy-4,6-dimethylnicotinonitrile | AG000A0B | 20g |
| 113899-55-1 | NC(C1=CC=CC=C1Br)C | 1-(2-Bromophenyl)ethylamine | AG000A0W | 50g |
| 113899-36-8 | COC(=O)C1=C(C=C([N+](=O)[O-])S1)N | Methyl 3-amino-5-nitrothiophene-2-carboxylate | AG000A0X | 2g |
| 113898-56-9 | O=C(OCC)C1=C(F)N=CC=C1 | Ethyl 2-fluoropyridine-3-carboxylate | AG000A0Z | 10g |
| 1954-45-6 | CC1=C2C(NC=C2CC(C(O)=O)N)=CC=C1 | 4-Methyl-DL-tryptophan | AG000A16 | 5.05g |
| 1139-83-9 | O=C1C2=CC=CC=C2C3=CC=C(O)C=C3O1 | 3-Hydroxy-6H-benzo[c]chromen-6-one | AG000A17 | 500g |
| 1139-52-2 | OC1=C(C(C)(C)C)C=C(Br)C=C1C(C)(C)C | 4-Bromo-2,6-di-tert-butylphenol | AG000A19 | 200g |
| 1139-13-5 | O=C(C1(C(OCC)=O)CCCCC1)OCC | Diethyl 1,1-Cyclohexanedicarboxylate | AG000A1C | 100g |
| 1160861-60-8 | COC1=C(C2=C(C(C)C)C=C(C(C)C)C=C2C(C)C)C(P(C3=CC(C(F)(F)F)=CC(C(F)(F)F)=C | JackiePhos | AG000BL4 | 25g |
| 1160949-99-4 | OC1=CC=C2C=C(Br)C=NC2=C1 | 3-Bromoquinolin-7-ol | AG000BLT | 20g |
| 1160936-52-6 | CC(C1=NC=C(Br)C=C1F)=O | 1-(5-Bromo-3-fluoropyridin-2-yl)ethanone | AG000BLU | 20g |
| 1160936-51-5 | BrC=1C=C(C(=NC1)C#N)O | 5-Bromo-3-hydroxypicolinonitrile | AG000BLV | 10g |
| 1160923-98-7 | N#CC1=CN=CC(Br)=C1Cl | 5-Bromo-4-chloronicotinonitrile | AG000BLX | 3g |
| 1160923-97-6 | N#CC1=CN=CC(Br)=C1O | 5-Bromo-4-hydroxynicotinonitrile | AG000BLY | 2g |
| 1160923-86-3 | O=C(N1CCN(CC2=CC=C(Br)N=C2)CC1)OC(C)(C)C | Tert-Butyl 4-((6-Bromopyridin-3-Yl)Methyl)Piperazine-1-Carboxylate | AG000BM0 | 50g |
| 116096-91-4 | O=CC1=CC(Br)=C(O)C(Br)=C1O | 3,5-Dibromo-2,4-Dihydroxybenzaldehyde | AG000BM4 | 10g |
| 116096-90-3 | C1=C(C(=CC(=C1Br)O)O)C=O | 5-Bromo-2,4-Dihydroxybenzaldehyde | AG000BM5 | 25g |
| 116091-63-5 | O=S(C1=CC(CC(C)=O)=CC=C1OC)(N)=O | 5-Acetonyl-2-methoxybenzene sulfonamide | AG000BMD | 200g |
| 1160995-48-1 | C1=CN=C(C#N)N=C1Br | 4-Bromopyrimidine-2-carbonitrile | AG000BMI | 3g |
| 1160995-45-8 | O=[N+](C1=CN2N=C(Cl)N=C(Cl)C2=C1)[O-] | 2,4-DICHLORO-6-NITROPYRROLO[1,2-F][1,2,4]TRIAZINE | AG000BMJ | 0.5g |
| 1160995-23-2 | ClC1=NC(Cl)=NN2C1=CC(Br)=C2 | 6-Bromo-2,4-dichloropyrrolo[2,1-f][1,2,4]triazine | AG000BMK | 25g |
| 1160995-19-6 | O=C(N1CC2=NC(C)=NC=C2C1)OC(C)(C)C | tert-Butyl 2-methyl-5H-pyrrolo[3,4-d]pyrimidine-6(7H)-carboxylate | AG000BML | 2g |
| 1160995-04-9 | CCOC(=O)C1=C(NC2=CC=CC=C21)NC(=O)OC(C)(C)C | Ethyl 2-((tert-butoxycarbonyl)amino)-1H-indole-3-carboxylate | AG000BMN | 9g |
| 1160994-94-4 | O=C(C1=CN2C(C(N)=C1)=NC=C2)OC | 8-Aminoimidazo[1,2-a]pyridine-6-carboxylic acid methyl ester | AG000BMQ | 5g |
| 1160994-90-0 | OC(C1=C(O)C=C(Br)C=N1)=O | 5-Bromo-3-hydroxypicolinic acid | AG000BMR | 0.15g |
| 1160994-87-5 | FC(F)(F)OC1=CC2=NC=NC(Cl)=C2C=C1 | 4-Chloro-7-(trifluoromethoxy)quinazoline | AG000BMS | 1.25g |
| 1160994-79-5 | Clc1nc(Cl)c2c(n1)occ2C | 2,4-Dichloro-5-methylfuro[2,3-d]pyrimidine | AG000BMU | 1g |
| 1160994-71-7 | NC1=NC(=NC=C1)Br | 4-Amino-2-bromopyrimidine | AG000BMW | 50g |
| 1140240-46-5 | CC1=NC=CC2=C1C=NN2 | 4-Methyl-1H-pyrazolo[4,3-c]pyridine | AG000ABM | 1g |
| 1140240-20-5 | NC1=NC=CC2=C1OC=C2 | Furo[2,3-c]pyridin-7-amine | AG000ABO | 5g |
| 1140239-98-0 | O=C(C1=NC=CC2=C1NN=C2)O | 1H-pyrazolo[3，4-c]pyridine-7-carboxylic acid | AG000ABP | 5g |
| 1140239-96-8 | COC(=O)c1nccc2[nH]ncc12 | Methyl 1h-pyrazolo[4,3-c]pyridine-4-carboxylate | AG000ABQ | 0.5g |
| 114031-67-3 | CC(C)(C)C(OC1=CC=C(C(C2=CC=C(O)C=C2)=O)C=C1)=O | 4-(4-Hydroxybenzoyl)phenyl pivalate | AG000ACP | 2g |
| 114026-76-5 | O1[C@H]([C@@H](OC12CCCCC2)C(O)(C2=CC=CC=C2)C2=CC=CC=C2)C(O)(C2=CC | (2R,3R)-1,4-dioxaspiro[4.5]decane-2,3-diylbis(diphenylmethanol) | AG000ACW | 20g |
| 114042-02-3 | O=[N+](C1=NC=C(Br)C=C1C)[O-] | 5-broMo-3-Methyl-2-nitropyridine | AG000AD2 | 175g |
| 114041-16-6 | COC1=CC2=C(C=C1OC)CNC2 | 5,6-Dimethoxyisoindoline | AG000AD8 | 18g |
| 114040-06-1 | ClC1=CC(Cl)=NC2=C(Br)C=NN12 | 3-Bromo-5,7-dichloropyrazolo[1,5-a]pyrimidine | AG000ADN | 500g |
| 114045-96-4 | O=C(O)C1=CC=C(OCC2=CC=CC=C2)C=C1F | 4-(Benzyloxy)-2-fluorobenzoic acid | AG000ADV | 200g |
| 1140512-59-9 | COC(=O)c1cc2cnc(Cl)cc2[nH]1 | methyl 6-chloro-1H-pyrrolo[3,2-c]pyridine-2-carboxylate | AG000AF2 | 10g |
| 1140512-58-8 | COC(=O)C1=CC2=CC=C(Cl)N=C2N1 | methyl 6-chloro-1H-pyrrolo[2,3-b]pyridine-2-carboxylate | AG000AF3 | 25g |
| 1140510-99-1 | CC(C)(C)OC(=O)N1CCC1=O | 1-Boc-2-Azetidinone | AG000AF4 | 10g |
| 1140502-97-1 | O=C(N1CC(OCC1)=O)OC(C)(C)C | tert-butyl 2-oxoMorpholine-4-carboxylate | AG000AF5 | 50g |
| 114058-79-6 | N=1(C2(=C(C(C)=CC=1)C=CC(=C2)N)) | 4-Methylquinolin-7-amine | AG000AF7 | 3g |
| 114058-74-1 | NC1=CC=C2C(C)=CC(Cl)=NC2=C1 | 2-Chloro-4-methylquinolin-7-amine | AG000AF8 | 2g |
| 113981-44-5 | [Cl-].NC1=NC(=NS1)/C(/C(=O)N[C@H]1[C@H]2SCC(=C(N2C1=O)C(=O)O)C[N+]=1 | Cefozopran monohydrochloride | AG000A8R | 0.1g |
| 113978-91-9 | CCCC[PH+](CCCC)CCCC.F[B-](F)(F)F | Tributylphosphonium tetrafluoroborate | AG000A8X | 200g |
| 114-38-5 | NC(=O)Nc1ccccc1Cl | N-(2-Chlorophenyl)urea | AG000A9F | 175g |
| 114-33-0 | O=C(NC)C1=CN=CC=C1 | N-Methylnicotinamide | AG000A9G | 174g |
| 114-21-6 | OC(C1=CC=CC=C1)C([O-])=O.[Na+] | Dl-mandelic acid sodium salt | AG000A9J | 275g |
| 56-69-9 | NC(C(O)=O)CC1=CNC2=CC=C(C=C12)O | H-DL-Trp(5-OH)-OH | AG000A9K | 3g |
| 1140-38-1 | O=C(C1=C(Cl)N(C2=CC=CC=C2)N=C1C)O | 5-Chloro-3-Methyl-1-Phenyl-1H-Pyrazole-4-Carboxylic Acid | AG000A9S | 15g |
| 1140-17-6 | O=C(C1=CC=C(Br)C=C1)C2=CC=CC=C2N | 2-Amino-4′-bromobenzophenone | AG000A9Y | 225g |
| 1140-14-3 | CC1=CC(C)=C(C(C2=CC=CC=C2)=O)C=C1 | 2,4-Dimethylbenzophenone | AG000AA0 | 50g |
| 114-86-3 | N=C(NC(N)=N)NCCC1=CC=CC=C1 | N-Phenethylbiguanide | AG000AA2 | 15g |
| 114-83-0 | CC(NNC1=CC=CC=C1)=O | 1-Acetyl-2-phenylhydrazine | AG000AA3 | 2175g |
| 114-63-6 | O=C([O-])C1=CC=C(O)C=C1.[Na+] | Sodium 4-Hydroxybenzoate | AG000AA7 | 2500g |
| 114012-43-0 | OCC1(c2ccccc2)COC1 | (3-Phenyloxetan-3-yl)methanol | AG000AAA | 0.5g |
| 114012-42-9 | O=C(C1(C2=CC=CC=C2)COC1)O | 3-Phenyloxetane-3-carboxylic acid | AG000AAB | 2g |
| 114012-41-8 | O=C(C1COC1)O | Oxetane-3-carboxylic acid | AG000AAC | 2.5g |
| 114012-12-3 | C(P(=O)(O)O)C(C1=CC=C(Cl)C=C1)CN | Phaclofen | AG000AAH | 0.005g |
| 114058-72-9 | NC1=CC=C2C=CC(N)=NC2=C1 | Quinoline-2,7-diamine | AG000AF9 | 15g |
| 114067-97-9 | O=C(C1=CN(C2=CC=C(F)C=C2)C=N1)O | 1-(4-Fluorophenyl)-1H-imidazole-4-carboxylic acid | AG000AH2 | 6g |
| 1140737-02-5 | N[C@H](C(=O)O)CCCCC=C | (S)-2-Aminooct-7-enoic acid | AG000AH5 | 2g |
| 114077-82-6 | O=CC1=CN=CC=C1Cl | 4-Chloropyridine-3-carboxaldehyde | AG000AH8 | 2000g |
| 114077-42-8 | CO/C=C(c1ccccc1O)/C(=O)OC | (E)-Methyl 2-(2-hydroxyphenyl)-3-methoxyacrylate | AG000AHA | 3g |
| 114076-35-6 | NC1=CC=C(F)C(F)=C1OC | 3,4-Difluoro-2-methoxyaniline | AG000AHK | 10g |
| 114084-78-5 | CCCCCN(CCC(P(O)(O)=O)(P(O)(O)=O)O)C | {1-hydroxy-3-[methyl(pentyl)amino]-1-phosphonopropyl}phosphonic acid | AG000AHY | 1g |
| 114080-95-4 | O=C(N)C1=NC=CC=C1Cl | 3-Chloropicolinamide | AG000AI8 | 20g |
| 114080-94-3 | NC1=NOC2=C1C=CN=C2 | Isoxazolo[5，4-c]pyridin-3-amine | AG000AI9 | 3g |
| 114080-93-2 | NC1=NOC2=CC=CN=C21 | Isoxazolo[4，5-b]pyridin-3-amine | AG000AIA | 15g |
| 114078-88-5 | BrC1=CN=NN=C1 | 5-Bromo-1,2,3-triazine | AG000AIF | 10g |
| 114086-30-5 | O=C(C1=CC2=C(C=C1)C(Br)=NN2)O | 3-Bromo-1H-indazole-6-carboxylic acid | AG000AIW | 25g |
| 114086-15-6 | CN1C(C2)CNC2C1.[H]Br.[H]Br | 2-Methyl-2，5-diazabicyclo[2.2.1]heptane dihydrobromide | AG000AIX | 10g |
| 1140909-48-3 | O=C(O)[C@@H](O)CC(O)=O.O=C(C1(C(NC2=CC=C(F)C=C2)=O)CC1)NC3=CC=C(O | Cabozantinib S-malate | AG000AJ8 | 11.9g |
| 114094-45-0 | CCOC(OCC)CCCNC | 4,4-Diethoxy-N-methylbutan-1-amine | AG000AJF | 10g |
| 1140972-31-1 | CCOC(=O)[C@H]1CCC[C@H]1NC(=O)OC(C)(C)C | Ethyl (1S,2R)-2-(Boc-amino)cyclopentanecarboxylate | AG000AJY | 2g |
| 1140972-27-5 | CCOC(=O)[C@@H]1CCC[C@@H]1NC(=O)OCC1=CC=CC=C1 | Ethyl (1R，2S)-2-(Cbz-amino)cyclopentanecarboxylate | AG000AK0 | 3g |
| 1140969-69-2 | S=C(NC1=CC(C(F)(F)F)=CC(C(F)(F)F)=C1)NC2C(NC(NC3=CC(C(F)(F)F)=CC(C(F)(F) | N,N’-(1S,2S)-1,2-Cyclohexanediylbis[N’-[3,5-bis(trifluoromethyl)phenyl]thio | AG000AK2 | 1.5g |
| 1140964-99-3 | C1N(CC2=CC=CC=C12)CC1=NC=2C=CC=C3C2C(=N1)NNC3=O | E 7449 | AG000AK3 | 0.5g |
| 114099-96-6 | CCCC(=O)OC1=C(C)OC(C)C1=O | 2,5-dimethyl-4-oxo-4,5-dihydrofuran-3-yl butanoate | AG000AK4 | 2000g |
| 1141-38-4 | C(=O)(O)c1cc2c(cc1)cc(cc2)C(=O)O | 2,6-Naphthalenedicarboxylic acid | AG000AKC | 2000g |
| 1141-35-1 | ClC1=CC=C(C2=NC3=CC=CC=C3O2)C=C1 | 2-(4-Chlorophenyl)benzo[d]oxazole | AG000AKD | 2g |
| 1141-24-8 | O=C(O)CC(C1=CC=C(Br)C=C1)CC(O)=O | 3-(4-Bromophenyl)pentanedioic acid | AG000AKG | 2g |
| 1141-23-7 | NC(=O)CC(CC(O)=O)C1=CC=C(Cl)C=C1 | 3-(4-Chlorophenyl)glutaramic Acid | AG000AKH | 200g |
| 1141-06-6 | OC(C1=NC=CC=C1)C(C2=NC=CC=C2)=O | 2-Hydroxy-1,2-di(pyridin-2-yl)ethan-1-one | AG000AKK | 2g |
| 114106-84-2 | COC(=O)CCN1CCC[C@H]1CO | methyl 3-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]propanoate | AG000AKP | 5g |
| 1141-88-4 | Nc1ccccc1SSc1ccccc1N | 2-Aminophenyl disulfide | AG000AL4 | 125g |
| 1141-59-9 | Oc1ccc(N=Nc2ccccn2)c(O)c1 | 4-(2-Pyridylazo)resorcinol | AG000AL6 | 400g |
| 114113-99-4 | COC1=C(Br)C=C(CO)C=C1Br | (3,5-Dibromo-4-methoxyphenyl)methanol | AG000ALE | 10g |
| 114117-42-9 | O=C(O)[C@@H](NC(OC(C)(C)C)=O)CC1=CC=C(NC(C)=O)C=C1 | Boc-phe(4-nhac)-oh | AG000AMD | 40g |
| 114133-37-8 | CNCC[C@H](O)C1=CC=CC=C1 | (S)-3-(Methylamino)-1-phenylpropan-1-ol | AG000AMU | 2g |
| 1142223-08-2 | O=C(OC)C[C@@H](C1CC1)C2=CC=CC(O)=C2 | Benzenepropanoic acid, beta-cyclopropyl-3-hydroxy-, methyl ester, (betas)- | AG000AV4 | 10g |
| 1142211-17-3 | O=C(OC(C)(C)C)NC1(CO)CCC1 | N-Boc-1-amino-cyclobutyl-methanol | AG000AV6 | 200g |
| 114223-89-1 | NCC1=CC=C2N=CC=CC2=C1.[H]Cl | 6-Aminomethylquinoline, HCl | AG000AVG | 1g |
| 1142363-56-1 | CC1(C)C=C(B2OC(C)(C)C(C)(C)O2)CC(C)(C)O1 | 4,4,5,5-Tetramethyl-2-(2,2,6,6-tetramethyl-3,6-dihydro-2H-pyran-4-yl)-1,3,2- | AG000AVN | 45g |
| 1142400-61-0 | CC(C)(C)OC(=O)N1CCCC1CCl | 1-Boc-2-Chloromethylpyrrolidine | AG000AWC | 30g |
| 1142382-25-9 | NC1=CC(Br)=C([N+]([O-])=O)C=C1C | 5-Bromo-2-methyl-4-nitroaniline | AG000AWD | 0.5g |
| 114248-23-6 | O=C1NC(C=CN1[C@@H]2O[C@H](CO)[C@@H](O)C2(F)F)=O | 2′,2′-Difluoro-2′-deoxyuridine | AG000AWJ | 2g |
| 114247-09-5 | Cl.CNCC[C@@H](Oc1ccc(cc1)C(F)(F)F)c2ccccc2 | (R)-Fluoxetine Hydrochloride | AG000AWL | 0.015g |
| 114247-06-2 | Cl.CNCC[C@H](Oc1ccc(cc1)C(F)(F)F)c2ccccc2 | (S)-Fluoxetine hydrochloride | AG000AWM | 0.025g |
| 114244-83-6 | Clc1nc(Cl)c2c(c1)n(C)cc2 | 4,6-Dichloro-1-methyl-1H-pyrrolo[3,2-c]pyridine | AG000AWX | 1g |
| 114274-39-4 | O=C(O)C1=CC(OCC2=CC=CC=C2)=CC(C(O)=O)=C1 | 5-(Benzyloxy)isophthalic acid | AG000AXR | 5g |
| 114289-77-9 | OC1=CC=C(OCCCO)C=C1C(C)(C)C | 2-(tert-Butyl)-4-(3-hydroxypropoxy)phenol | AG000AZI | 2g |
| 114289-47-3 | COC1=C(NC(C(C)(C)CCCCCCCCCC)=O)C(OC)=CC(OC)=C1 | CI-976 | AG000AZK | 0.1g |
| 1142946-81-3 | N#CC1=CC=C2C(C=C(B(O)O)S2)=C1 | (5-Cyanobenzo[b]thiophen-2-yl)boronic acid | AG000AZV | 3g |
| 1142944-78-2 | COC1=CN=C(B(O)O)C=C1 | (5-Methoxypyridin-2-yl)boronic acid | AG000B03 | 0.75g |
| 1142927-95-4 | N#CCC1=CC=NN=C1 | 2-(Pyridazin-4-yl)acetonitrile | AG000B06 | 10g |
| 1142924-89-7 | CC(C1=CC=C(I)C=C1)(F)F | 1-(1,1-difluoroethyl)-4-iodobenzene | AG000B0A | 0.4g |
| 113906-27-7 | CC1=CC=C(O1)C=NNC(C1=C(C=CC=C1)OC1=CC=CC=C1)=O | PNU-74654 | AG000A1K | 0.75g |
| 113904-76-0 | C/C(/C)=C/C1C(C)(C)C1C(NN)=O | 2,2-Dimethyl-3-(2-methyl-propenyl)-cyclopropanecarboxylic acid hydrazide | AG000A1N | 125g |
| 113928-90-8 | COC1=C(N)C=C(CO)C=C1 | (3-Amino-4-methoxyphenyl)methanol | AG000A32 | 8g |
| 113939-45-0 | FC(F)(Br)C(F)(F)OC1=CC=C(Br)C=C1 | 1-Bromo-4-(2-bromo-1,1,2,2-tetrafluoro-ethoxy)benzene | AG000A3M | 25g |
| 1139453-98-7 | CN(C(=O)CN1CCN(C)CC1)C1=CC=C(C=C1)[N+]([O-])=O | N-methyl-2-(4-methylpiperazin-1-yl)-N-(4-nitrophenyl)acetamide | AG000A46 | 200g |
| 113942-30-6 | CN1N=NC2=C(N=CN2C1=O)C(O)=O | Temozolomide Acid | AG000A4I | 20g |
| 113963-68-1 | CN1C(=O)C(C2=CNC3=C2C=CC=C3)=C(C1=O)C1=CNC2=C1C=CC=C2 | Bisindolylmaleimide V | AG000A5M | 20g |
| 1139634-75-5 | Cl.Cl.CN1CC(N)C1 | 3-Amino-1-N-methyl-azetidine DiHCl | AG000A69 | 10g |
| 113967-71-8 | S(C1(=NN2(C(N)=C(C(=O)O)C=NC2(=N1))))C | 7-Amino-2-(methylsulfanyl)[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylic acid | AG000A7E | 0.5g |
| 1139717-76-2 | B(O)(O)c1cc(ccc1)N1CCN(CC1)C | 3-(4-Methyl-1-piperazinyl)phenylboronic Acid | AG000A7N | 5g |
| 113975-23-8 | IC=1C(=NC=CC1)NC | 3-Iodo-N-methylpyridin-2-amine | AG000A83 | 10g |
| 113975-22-7 | IC1=CC=CN=C1F | 2-Fluoro-3-Iodopyridine | AG000A84 | 302.3g |
| 113974-24-6 | C[C@@H](N)C1=CC=CC=C1Br | (R)-1-(2-Bromophenyl)Ethanamine | AG000A86 | 25g |
| 113981-49-0 | COc1c(OC)cc(c2c1O[C@@H](CC2=O)c1ccccc1)O | 5-Hydroxy-7,8-dimethoxyflavanone | AG000A8Q | 0.005g |
| 1142953-55-6 | BrC[C@H]1COC2=CC=CC=C2O1 | (R)-2-(BROMOMETHYL)-2,3-DIHYDROBENZO[B][1,4]DIOXINE | AG000B0H | 1.75g |
| 1143-82-4 | CCOC(=O)c1c(C)onc1c1ccccc1 | Ethyl 5-methyl-3-phenylisoxazole-4-carboxylate | AG000B0S | 20g |
| 1143-72-2 | O=C(C1=CC=CC=C1)C2=CC=C(O)C(O)=C2O | 2,3,4-Trihydroxybenzophenone | AG000B0V | 4500g |
| 1143-70-0 | O=C1C2=CC(O)=CC=C2C3=C(O1)C=C(O)C=C3 | 3,8-Dihydroxy-6H-benzo[c]chromen-6-one | AG000B0X | 200g |
| 1143-50-6 | O=C(NC1=CC=CC=C12)C3=CC=CC=C3C2=O | 5H-Dibenzo[b,e]azepine-6,11-dione | AG000B0Z | 2g |
| 1143-38-0 | O=C1C2=C(C=CC=C2O)CC3=CC=CC(O)=C13 | Dithranol | AG000B10 | 50g |
| 1143-20-0 | O=C(C1C2=C(C=CC=C2)CC3=CC=CC=C13)O | 9,10-Dihydroanthracene-9-carboxylic acid | AG000B12 | 5g |
| 1143026-45-2 | COC(=O)C1=C(Cl)C=C(C)C(=C1)[N+]([O-])=O | 2-Chloro-4-methyl-5-nitrobenzoic acid methyl ester | AG000B15 | 25g |
| 114306-17-1 | CC(=O)OC1=CNC2=C1C=CC(Br)=C2 | 6-Bromo-1H-indol-3-yl acetate | AG000B1H | 25g |
| 114312-57-1 | CCOC(=O)C1=C(C)C(F)=CC=C1 | 3-Fluoro-2-methylbenzoic acid ethyl ester | AG000B21 | 25g |
| 114312-48-0 | O=C1C2=CC=C(F)C=C2OCC3=CC=CC=C13 | 3-Fluorodibenzo[b,e]oxepin-11(6H)-one | AG000B22 | 10g |
| 114322-14-4 | ClS(C1C2C(=NON=2)C=CC=1)(=O)=O | 2,1,3-Benzoxadiazole-4-sulfonyl chloride | AG000B2K | 30g |
| 114333-03-8 | O=C1C=C(OC)C(Cl)=NN1 | 6-Chloro-5-methoxypyridazin-3(2H)-one | AG000B39 | 1g |
| 114326-14-6 | O=C(OC(C)(C)C)N(CCCCl)C | tert-Butyl (3-chloropropyl)(methyl)carbamate | AG000B3P | 75g |
| 114326-10-2 | CC(=O)SCCNC(=O)OC(C)(C)C | N-Boc-s-acetyl-cysteamine | AG000B3Q | 5g |
| 114335-54-5 | BrC1=C(O)C(N)=NC=C1 | 2-Amino-4-bromopyridin-3-ol | AG000B4B | 9g |
| 1143534-62-6 | N[C@@H](CCO)C1=CC=C(C=C1)Br | (S)-3-Amino-3-(4-Bromophenyl)Propan-1-Ol | AG000B4M | 7g |
| 1160993-95-2 | O=CC1=C(F)N=CC(C)=C1 | 2-Fluoro-5-methylpyridine-3-carbaldehyde | AG000BMY | 10g |
| 1161009-89-7 | CC1(C)C(C)(C)OB(C2=CC=CC(C34C5=C(C6=C4C=CC=C6)C=CC=C5)=C2C7=C3C=CC= | 2-(9,9′-Spirobi[fluoren]-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane | AG000BN8 | 50g |
| 1161009-88-6 | BrC1=CC=CC(C23C4=C(C5=C3C=CC=C5)C=CC=C4)=C1C6=C2C=CC=C6 | 4-Bromo-9,9′-spirobi[9H-fluorene] | AG000BN9 | 600g |
| 1161002-05-6 | Brc1cc2OCOc2cc1[C@@H]1Nc2ccccc2[C@@H]2[C@H]1CC=C2 | G-15 | AG000BND | 0.5g |
| 116106-16-2 | CC1=C(Br)C=C2C(NC=N2)=C1 | 5-Bromo-6-methyl-1H-benzo[d]imidazole | AG000BNO | 35g |
| 1161-94-0 | ClC1=C(N)N=C(N)C(C(NC(NC2=CC=CC=C2)=N)=O)=N1.CS(=O)(O)=O | 3,5-Diamino-6-chloro-N-(N-phenylcarbamimidoyl)pyrazine-2-carboxamide m | AG000BNS | 0.75g |
| 1161233-85-7 | C[C@@H]1OC2(OC1)CCN(CC2)C=2SC1=C(C(N2)=O)C=C(C=C1[N+](=O)[O-])C(F)(F | BTZ 043 | AG000BOK | 0.05g |
| 1161205-04-4 | O=C(C1=NC=CC=C1)NC2=CC=C(Cl)C(OC)=C2 | N-(4-Chloro-3-methoxyphenyl)pyridine-2-carboxamide | AG000BOL | 2g |
| 116122-36-2 | C1=CC(=CC=C1C2=CC(=O)C3=C(C(=C(C=C3O2)OC4C(C(C(C(O4)C(=O)O)O)O)O)O) | Breviscapine | AG000BOO | 125g |
| 116119-01-8 | O=C(C1=CC(O)=C(OCO2)C2=C1)OC | Methyl 7-hydroxybenzo[d][1,3]dioxole-5-carboxylate | AG000BP5 | 3g |
| 116118-99-1 | O=C(C(S1)=CC2=C1CCNC2)O.[H]Cl | 4,5,6,7-Tetrahydrothieno[3,2-c]pyridine-2-carboxylic acid hydrochloride | AG000BP7 | 6g |
| 1161362-35-1 | O=C(N1C2=CC(B3OC(C)(C)C(C)(C)O3)=CC=C2OCC1)OC(C)(C)C | tert-Butyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-benzo[b][1,4]o | AG000BP9 | 15g |
| 1161362-01-1 | OC(CC1=CC(C(F)(F)F)=CC(Br)=C1)=O | 3-Bromo-5-(Trifluoromethyl)Phenylacetic Acid | AG000BPA | 600g |
| 116131-44-3 | O1CCCC(CBr)C1 | 3-(Bromomethyl)tetrahydro-2H-pyran | AG000BPM | 10g |
| 116130-33-7 | OC1=CC=C(I)C=C1Cl | 2-Chloro-4-iodophenol | AG000BPN | 150g |
| 116129-34-1 | SCCCCCCCCCCCBr | 11-Bromoundecane-1-thiol | AG000BPQ | 1g |
| 116129-07-8 | Cl.OC([C@]12NC[C@H](C1)C2)=O | 2-Azabicyclo[2.1.1]hexane-1-carboxylic acid hydrochloride | AG000BPR | 0.5g |
| 116140-22-8 | O=C(C1(C)CNCCC1)O.[H]Cl | 3-Methylpiperidine-3-carboxylic acid hydrochloride | AG000BQ7 | 75g |
| 113798-74-6 | OC1=C(F)C=CC(F)=C1F | 2,3,6-TRIFLUOROPHENOL | AG0009PA | 60g |
| 1138-52-9 | OC1=CC(C(C)(C)C)=CC(C(C)(C)C)=C1 | 3,5-Di-tert-butylphenol | AG0009PL | 3000g |
| 1138-14-3 | O=C(C1=CC=CS1)CC(C2=CC=CS2)=O | 1,3-Di(Thiophen-2-Yl)Propane-1,3-Dione | AG0009PP | 10g |
| 1138011-17-2 | NCC1=NC=NC=C1.[H]Cl | Pyrimidin-4-ylmethanamine hydrochloride | AG0009PT | 28.5g |
| 1138-80-3 | O=C(O)CNC(OCC1=CC=CC=C1)=O | Z-Gly-OH | AG0009QA | 2000g |
| 1138-60-9 | CC(C)OC(=O)C1=CC(O)=C(O)C(O)=C1 | Isopropylgallate | AG0009QC | 25g |
| 1138-56-3 | O=S(C1=CC=C(OCCCC)C=C1)(Cl)=O | 4-(n-Butoxy)benzenesulfonyl chloride | AG0009QE | 75g |
| 1138036-54-0 | NNC1=CC=CC(F)=C1Cl.[H]Cl | (2-Chloro-3-fluorophenyl)hydrazine hydrochloride | AG0009QH | 50g |
| 1138011-22-9 | FC(F)(F)C(N)C1=CC=CN=C1.[H]Cl | 2,2,2-Trifluoro-1-(pyridin-3-yl)ethanamine hydrochloride | AG0009QK | 9g |
| 113808-86-9 | O=C(C1=C(C)NN=C1C)O | 3,5-Dimethyl-1H-pyrazole-4-carboxylic acid | AG0009QO | 200g |
| 1138156-77-0 | Oc1ccc(C=CC(=O)NCCCCNC(=O)C=Cc2ccc(O)c(O)c2)cc1 | N-p-Coumaroyl-N’-caffeoylputrescine | AG0009RU | 0.005g |
| 1138220-77-5 | COC(=O)c1cc(OC)c(cc1Br)Cl | Methyl 2-bromo-4-chloro-5-methoxybenzoate | AG0009SL | 2g |
| 113826-06-5 | [C@H]2(CO[S](C1=CC=C(C=C1)C)(=O)=O)CO2 | (2R)-(-)-Glycidyl Tosylate | AG0009TL | 867g |
| 1144037-37-5 | Clc1cc(Cl)cc(COC(=O)N2CCNCC2)c1 | 3,5-DICHLOROBENZYL PIPERAZINE-1-CARBOXYLATE | AG000B8S | 0.5g |
| 1144035-53-9 | Clc1cc(COC(=O)N2CCN(CC2)CCC(=O)c2ccc3c(c2)oc(=O)[nH]3)cc(c1)Cl | 3,5-Dichlorobenzyl 4-(3-oxo-3-(2-oxo-2,3-dihydrobenzo[d]oxazol-6-yl)propyl | AG000B8V | 0.2g |
| 114402-11-8 | O=C(C1=CN=C2C(CCC2)=C1)O | 6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxylic acid | AG000B9C | 3g |
| 1144-74-7 | O=C(C1=CC=C([N+]([O-])=O)C=C1)C2=CC=CC=C2 | 4-Nitrobenzophenone | AG000B9F | 1500g |
| 1144102-34-0 | O=C(O)CC1=CNC2=C1C=C(C3CC3)C=C2 | 2-(5-Cyclopropyl-1H-indol-3-yl)acetic acid | AG000B9H | 1.5g |
| 1144068-46-1 | C12CN(CC(CC1)O2)C2=C1C(=NC(=N2)C2=CC=C(C=C2)NC(=O)NC)N(N=C1)C1CCC2 | 1-(4-(4-(8-Oxa-3-azabicyclo[3.2.1]octan-3-yl)-1-(1,4-dioxaspiro[4.5]decan-8-yl | AG000B9J | 0.075g |
| 114414-17-4 | Br.NC1=NC=CC(Br)=C1O | 2-Amino-4-bromo-3-hydroxypyridine hbr | AG000B9R | 32.45g |
| 114413-77-3 | C1CCC(C1)NCc1ccc2c(c1)OCO2 | N-(Benzo[d][1,3]dioxol-5-ylmethyl)cyclopentanamine | AG000B9W | 5g |
| 114417-34-4 | O=C1CCNC2=C1C=CC(Br)=C2 | 7-Bromo-2,3-Dihydroquinolin-4(1H)-One | AG000BA9 | 25g |
| 114414-86-7 | O=C(CCCCCCCCCCCCC)N[C@H](C)C(=O)O | N-(1-Oxotetradecyl)-D-alanine | AG000BAU | 2g |
| 114419-45-3 | NC(C(O)=O)CN1N=CN=C1 | 2-Amino-3-(1H-1,2,4-triazol-1-yl)propanoic acid | AG000BBI | 5g |
| 114435-86-8 | O=S(C1=CC=C(C)C=C1)(OCF)=O | Fluoromethyl 4-methylbenzenesulfonate | AG000BBL | 50g |
| 114435-12-0 | O=C(C(=O)C1=CC=C(OCCCC)C=C1)C2=CC=C(OCCCC)C=C2 | 1,2-Bis(4-butoxyphenyl)-1,2-ethanedione | AG000BBM | 2g |
| 114435-02-8 | FC1COC(=O)O1 | 4-Fluoro-1,3-dioxolan-2-one | AG000BBP | 2500g |
| 116-82-5 | O=C1C2=C(C=CC=C2)C(C3=C(O)C=C(Br)C(N)=C13)=O | 1-Amino-2-bromo-4-hydroxy anthraquinone | AG000BC9 | 500g |
| 116-81-4 | NC1=C(C=C(Br)C2=C1C(=O)C1=CC=CC=C1C2=O)S(O)(=O)=O | Bromaminic acid | AG000BCA | 1000g |
| 116-69-8 | O=C(O)C1=CC=CC(Br)=C1C(O)=O | 3-Bromophthalic acid | AG000BCF | 145.8g |
| 116-66-5 | [O-][N+](=O)c1c(C)c(cc2c1C(C)(C)CC2(C)C)[N+](=O)[O-] | 1,1,3,3,5-Pentamethyl-4,6-dinitroindane | AG000BCG | 0.3g |
| 116-63-2 | O=S(C1=C2C=CC=CC2=C(N)C(O)=C1)(O)=O | 1-Amino-2-naphthol-4-sulfonic acid | AG000BCI | 12000g |
| 116-53-0 | CCC(C)C(O)=O | 2-Methylbutyric acid | AG000BCK | 500g |
| 116-45-0 | O=S(C1=CC=C(N)C=C1)(NC2=NC(C)=C(Br)C(C)=N2)=O | Sulfabrom | AG000BCO | 0.01g |
| 116-43-8 | O=C(O)CCC(NC1=CC=C(S(=O)(NC2=NC=CS2)=O)C=C1)=O | Succinylsulfathiazole | AG000BCQ | 500g |
| 116-42-7 | C(NS(C1=CC=C(N)C=C1)(=O)=O)(=O)C1=CC=C(OC(C)C)C=C1 | Sulfaproxiline | AG000BCR | 0.75g |
| 116-38-1 | C[N+](C)(CC)C1=CC=CC(O)=C1.[Cl-] | Edrophonium chloride | AG000BCS | 5g |
| 116008-52-7 | O=C(C1=C(N)C=NN1)O | 4-Amino-1H-pyrazole-3-carboxylic acid | AG000BCW | 8g |
| 1160-54-9 | O=C(O)[C@H]1N(C(CNC(OCC2=CC=CC=C2)=O)=O)CCC1 | Z-Gly-Pro-OH | AG000BDC | 300g |
| 1160-35-6 | CCCCCCCCCCCCOC(=O)c1ccccc1O | Dodecyl 2-hydroxybenzoate | AG000BDD | 11.4g |
| 1160186-73-1 | F[B-](F)(C1=CC=CC(N)=C1)F.[K+] | Potassium (3-aminophenyl)trifluoroborate | AG000BDI | 20g |
| 1160184-14-4 | BrC1=CC(I)=CC(Br)=N1 | 2,6-DIBROMO-4-IODOPYRIDINE | AG000BDK | 25g |
| 1160112-78-6 | O=C1Cc2cc(I)cnc2N1 | 5-Iodo-1H-pyrrolo[2,3-b]pyridin-2(3H)-one | AG000BDL | 1g |
| 1160106-14-8 | CCCCCCCC[Si]1(CCCCCCCC)C2=C(SC(Br)=C2)C2=C1C=C(Br)S2 | 2,6-Dibromo-4,4-dioctyl-4H-silolo[3,2-b:4,5-b’]dithiophene | AG000BDN | 1g |
| 1160106-12-6 | CCCCCCCC[Si]1(CCCCCCCC)C2=C(C3=C1C=CS3)SC=C2 | 4,4-Dioctyl-4H-silolo[3,2-b:4,5-b’]dithiophene | AG000BDO | 25g |
| 1160102-28-2 | Brc1cc2NCCOc2cc1F | 6-Bromo-7-fluoro-3,4-dihydro-2H-1,4-benzoxazine | AG000BDP | 3g |
| 116016-57-0 | OC(=O)c1ccc(s1)c2ccc(O)cc2 | 5-(4-Hydroxyphenyl)thiophene-2-carboxylic Acid | AG000BDT | 30g |
| 1141669-59-1 | OC(=O)C1CN(Cc2ccccc2)CCCO1 | 4-Benzyl-2-homomorpholinecarboxylic Acid | AG000APQ | 0.5g |
| 1141669-57-9 | COC(C1OCCCNC1)=O | Methyl 1,4-oxazepane-2-carboxylate | AG000APR | 0.5g |
| 1141669-55-7 | CC(C1=CC(Br)=C(N2C=NC=C2)C=C1)=O | 3′-Bromo-4′-(1H-imidazol-1-yl)acetophenone | AG000APS | 2g |
| 1141669-53-5 | OC(=O)c1ccc(c(Br)c1)-n1ccnc1 | 3-Bromo-4-(1-imidazolyl)benzoic Acid | AG000APT | 25g |
| 1141886-36-3 | OB(O)C1=CC(F)=C(O)N=C1 | 5-Fluoro-1,6-dihydro-6-oxopyridine-3-boronic acid | AG000AR0 | 15g |
| 1141878-45-6 | OB(O)C1=CC(=NN1C1CCCCO1)C(F)(F)F | 1-(Tetrahydropyran-2-yl)-3-(trifluoromethyl)pyrazole-5-boronic acid | AG000AR1 | 10g |
| 1141934-97-5 | O[C@@H](C1=CC=CC(OCC2CCCCC2)=C1)CCN.[H]Cl | Emixustat HCl | AG000ARJ | 0.1g |
| 114205-89-9 | Cc1cc(ccc1OCC1OC1)C1(c2ccc(c(c2)C)OCC2OC2)c2ccccc2-c2c1cccc2 | 9,9-Bis(4-hydroxy-3-methylphenyl)fluorene diglycidyl ether | AG000AS9 | 175g |
| 1142-39-8 | CCCCCCOC1=CC=C(C=C1)C(O)=O | 4-(Hexyloxy)benzoic Acid | AG000ASL | 400g |
| 1142-19-4 | Clc1ccc(SSc2ccc(Cl)cc2)cc1 | 4,4′-Dichlorodiphenyl Disulfide | AG000ASP | 500g |
| 1142-18-3 | CNc1ccc(cc1)OCc1ccccc1 | Benzenamine, N-methyl-4-(phenylmethoxy)- | AG000ASQ | 4g |
| 1142-15-0 | COC1=CC=C(C=C1)/C=C/C2=CC=CC=C2 | 1-Methoxy-4-styrylbenzene | AG000ASR | 10g |
| 114214-73-2 | O=C(N1CC(O)(CN)CC1)OC(C)(C)C | 1-Boc-3-(aMinoMethyl)-3-hydroxypyrrolidine | AG000ASW | 25g |
| 114214-71-0 | CC(C)(C)OC(=O)N1CCC(=C)C1 | tert-Butyl 3-methylidenepyrrolidine-1-carboxylate | AG000ASX | 200g |
| 114214-70-9 | CC1=CC=C(S(OCC2CN(C(OC(C)(C)C)=O)CC2)(=O)=O)C=C1 | tert-Butyl 3-((tosyloxy)methyl)pyrrolidine-1-carboxylate | AG000ASY | 5.6g |
| 1160247-92-6 | O=C1N(CC2=CC=C(OC)C=C2)C3=C(C=C(OC(F)(F)F)C=C3)C1=O | VU 0238429 | AG000BF3 | 0.3g |
| 1160247-75-5 | CC(C)(C)OC(=O)N1CCC2(CC1)C=C(C3=C(C=CC=C3)O2)C(=O)O | 1′-(tert-Butoxycarbonyl)spiro[chromene-2,4′-piperidine]-4-carboxylic acid | AG000BF5 | 5g |
| 1160247-73-3 | O=C(N1CCC2(CC1)CC(N)C3=CC=CC=C3O2)OC(C)(C)C | tert-butyl 4-aminospiro[chroman-2,4′-piperidine]-1′-carboxylate | AG000BF6 | 1.75g |
| 1160247-29-9 | CC(C)(C)OC(=O)N1CCC2(CC1)C3=CC=C(C=C3NC2=O)Br | tert-Butyl 6-bromo-2-oxospiro[indoline-3,4′-piperidine]-1′-carboxylate | AG000BF7 | 2g |
| 1160247-17-5 | CC(C)(C)OC(=O)N1CCC2(CCC(C2)C(=O)O)CC1 | 8-(tert-Butoxycarbonyl)-8-azaspiro[4.5]decane-2-carboxylic acid | AG000BFA | 10g |
| 1160247-15-3 | CC(C)(C)OC(=O)N1CCC2(CC(CN)C2)CC1 | 2-Aminomethyl-7-azaspiro[3.5]nonane-7-carboxylic acid tert-butyl ester | AG000BFC | 1g |
| 1160247-07-3 | CC(C)(C)OC(=O)N1CCC2(CC1)CNC(=O)CO2 | Tert-Butyl 3-Oxo-1-Oxa-4,9-Diazaspiro[5.5]Undecane-9-Carboxylate | AG000BFD | 4g |
| 1160247-05-1 | CC(OC(N1CC2(OCCNC2)CCC1)=O)(C)C | 1-Oxa-4,8-diazaspiro[5.5]undecane-8-carboxylic acid tert-butyl ester | AG000BFE | 0.5g |
| 116026-99-4 | O=C(OC(C)(C)C)NC1=CC=CN=C1C=O | (2-Formyl-pyridin-3-yl)-carbamic acid tert-butyl ester | AG000BFF | 50g |
| 116026-98-3 | CC(C)(C)OC(=O)NC1=CC=CN=C1Br | tert-Butyl 2-bromopyridin-3-ylcarbamate | AG000BFG | 3g |
| 116026-95-0 | O=C(OC(C)(C)C)NC1=C(C=O)C=CN=C1 | tert-Butyl 4-formylpyridin-3-ylcarbamate | AG000BFH | 10g |
| 116026-93-8 | O=C(OC(C)(C)C)NC1=C(C=O)C=NC=C1 | TERT-BUTYL 3-FORMYLPYRIDIN-4-YLCARBAMATE | AG000BFJ | 50g |
| 1160294-96-1 | C1(C2=CC=CC=C2)=CC=C(NC3=CC=C(C4=CC5=C(C=C4)N(C6=CC=CC=C6)C7=C5C=C | N-(4-(9-Phenyl-9H-carbazol-3-yl)phenyl)-[1,1′-biphenyl]-4-amine | AG000BFN | 50g |
| 1160294-93-8 | BrC1=CC=C(NC2=CC=C(C3=CC=CC=C3)C=C2)C=C1 | N-(4-Bromophenyl)-4-biphenylamine | AG000BFO | 50g |
| 1160294-85-8 | BrC1=CC2=C(C=C1)N(C3=CC=CC=C3)C4=C2C=C(C5=CC=CC=C5)C=C4 | 3-Bromo-6,9-diphenyl-9H-carbazole | AG000BFP | 75g |
| 1160293-58-2 | C1(F)C=CC=CC=1OC(C)C | 1-Fluoro-2-isopropoxybenzene | AG000BFQ | 90g |
| 1160293-27-5 | COC(=O)C(C(=O)OC)c1ccc(cc1[N+](=O)[O-])C(=O)OC | 1,3-Dimethyl 2-[4-(methoxycarbonyl)-2-nitrophenyl]propanedioate | AG000BFR | 10g |
| 116041-19-1 | C(C1=CC=CC=C1)N1CC(CC1=O)C(=O)N | 1-Benzyl-5-oxopyrrolidine-3-carboxamide | AG000BFU | 45g |
| 116035-73-5 | O=C1NC2=CC(Br)=C(C)N=C2N1 | 6-Bromo-5-methyl-1H-imidazo[4,5-b]pyridin-2-ol | AG000BG3 | 15g |
| 116027-10-2 | O=C(NC1=CC=C(I)C=C12)OC2=O | 6-Iodo-2H-3,1-benzoxazine-2,4(1H)-dione | AG000BG9 | 40g |
| 1160436-95-2 | O=C(OC(C)(C)C)NC1=CC=CC(N(C)C)=C1 | tert-Butyl (3-(dimethylamino)phenyl)carbamate | AG000BGA | 25g |
| 1160430-87-4 | CC1=CC(=CC=C1CO)B2OC(C)(C)C(C)(C)O2 | (2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)methanol | AG000BGB | 2g |
| 116044-30-5 | N1=C(C=CC=C1)CNC(=O)C1=NC(=CC=C1)C(=O)NCC1=NC=CC=C1 | N2,N6-Bis(pyridin-2-ylmethyl)pyridine-2,6-dicarboxamide | AG000BGR | 0.45g |
| 1160514-60-2 | CCOC(=O)c1cnn(c1C(F)(F)F)c1ccc(cc1)NC(=O)C(=C(Cl)Cl)Cl | Ethyl 1-(4-(2,3,3-trichloroacrylamido)phenyl)-5-(trifluoromethyl)-1H-pyrazol | AG000BGZ | 0.4g |
| 1160490-11-8 | O=C(C1=CC=C2N=C(SC)OC2=C1)OC | Methyl 2-(methylthio)benzo[d]oxazole-6-carboxylate | AG000BH0 | 1.25g |
| 1160474-68-9 | OCC1=C(F)C=C(C(F)=C1)[N+]([O-])=O | (2,5-Difluoro-4-nitrophenyl)methanol | AG000BH1 | 25g |
| 116049-57-1 | CC(=O)OC[C@H]1OC(OC(=O)C)[C@@H]([C@H]([C@@H]1F)OC(=O)C)NC(=O)C | D-GLUCOPYRANOSE, 2-(ACETYLAMINO)-2,4-DIDEOXY-4-FLUORO-, 1,3,6-TRIAC | AG000BHF | 0.2g |
| 116049-23-1 | Cl.OC(=O)[C@@H]1CC(=O)CCN1 | (S)-4-Oxopiperidine-2-carboxylic acid hydrochloride | AG000BHG | 1g |
| 116047-42-8 | CCO[Si](CCCCCCCCCCC=O)(OCC)OCC | 11-(Triethoxysilyl)undecanal | AG000BHH | 25g |
| 116047-26-8 | O=C(C(C=C12)=CC=C2CCCC1=O)OC | Methyl 8-oxo-5,6,7,8-tetrahydronaphthalene-2-carboxylate | AG000BHK | 3g |
| 1160574-62-8 | O=C(OC)C1=CC(F)=C(Cl)C(Br)=C1 | Methyl 3-bromo-4-chloro-5-fluorobenzoate | AG000BHO | 50g |
| 1160573-87-4 | BrC1=CC=C(C=C1CC)I | 1-Bromo-2-ethyl-4-iodobenzene | AG000BHP | 10g |
| 1160573-72-7 | C1=C(C(Br)=CC(=C1I)Cl)Cl | 1-Bromo-2,5-dichloro-4-iodobenzene | AG000BHQ | 20g |
| 1160573-67-0 | FC1=CC(Cl)=C(F)C(Br)=C1 | 1-Bromo-3-chloro-2,5-difluorobenzene | AG000BHR | 75g |
| 1160573-64-7 | FC1=C(Cl)C=C(Cl)C=C1Br | 1-Bromo-3,5-dichloro-2-fluorobenzene | AG000BHS | 50g |
| 1160573-43-2 | Cc1c(C)c(I)ccc1Br | 3-Bromo-6-iodo-o-xylene | AG000BHT | 200g |
| 1160573-23-8 | FC1=C(Cl)C=CC(C=O)=C1F | 4-Chloro-2,3-difluorobenzaldehyde | AG000BHU | 35g |
| 1160573-22-7 | O=CC1=C(Br)C=C(F)C(Cl)=C1F | 6-Bromo-3-chloro-2,4-difluorobenzaldehyde | AG000BHV | 2g |
| 1160573-20-5 | O=CC1=CC(F)=C(Cl)C(F)=C1 | 4-Chloro-3,5-difluorobenzaldehyde | AG000BHW | 150g |
| 1160573-19-2 | O=C(O)C1=CC(F)=C(Cl)C(F)=C1 | 4-Chloro-3,5-difluorobenzoic acid | AG000BHX | 50g |
| 1160573-10-3 | O=CC1=C(F)C=C(I)C=C1F | 2,6-difluoro-4-iodobenzaldehyde | AG000BHY | 3g |
| 1160561-31-8 | OB(O)C1=CC(Cl)=CC(=C1)C(F)(F)F | 3-Chloro-5-(trifluoromethyl)phenylboronic acid | AG000BHZ | 50g |
| 1160561-24-9 | CC1=C(B(O)O)C(C)=CC(Br)=C1 | 4-Bromo-2,6-dimethylphenylboronic acid | AG000BI0 | 25g |
| 1160556-64-8 | CN(C)C1=C(C2=CC=CC=C2P(C3CCCCC3)C4CCCCC4)C(N(C)C)=CC=C1 | CPhos | AG000BI1 | 50g |
| 116057-75-1 | N1(CCOC2=CC=C(/C(/C3=CC=C(I)C=C3)=C(C3=CC=CC=C3)/CC)C=C2)CCCC1 | (E)-1-(2-(4-(1-(4-Iodophenyl)-2-phenylbut-1-en-1-yl)phenoxy)ethyl)pyrrolidi | AG000BI7 | 0.2g |
| 1160591-75-2 | NC(C12CCC(C(O)=O)(CC1)CC2)=O | 4-Carbamoylbicyclo[2.2.2]octane-1-carboxylic acid | AG000BID | 1g |
| 1160575-02-9 | CC(C1=CC(C(O)=O)=C(Cl)C=C1)C | 2-Chloro-5-isopropylbenzoic acid | AG000BIE | 10g |
| 1160574-85-5 | CCOC(=O)C1=CC(Br)=C(Cl)C(Cl)=C1 | Ethyl 3-bromo-4,5-dichlorobenzoate | AG000BIF | 16.5g |
| 1160574-77-5 | O=C(OC)C1=CC(Cl)=C(Cl)C(Br)=C1 | Methyl 3-bromo-4,5-dichlorobenzoate | AG000BIG | 30g |
| 1160574-71-9 | C(OCC)(=O)C1=CC(Br)=C(Cl)C(F)=C1 | Ethyl 3-bromo-4-chloro-5-fluorobenzoate | AG000BIH | 0.1g |
| 1160574-68-4 | N#CC1=CC=C(Br)C(Cl)=C1F | 4-Bromo-3-chloro-2-fluorobenzonitrile | AG000BII | 100g |
| 941685-37-6 | C1(C2C=NN([C@@H](CC#N)C3CCCC3)C=2)C2C=CNC=2N=CN=1 | S-Ruxolitinib | AG000BIK | 0.5g |
| 116010-06-1 | CC(NC1=C(Br)C=C(C)C(Cl)=C1)=O | N-Acetyl 2-bromo-5-chloro-4-methylaniline | AG000BE6 | 0.75g |
| 1160247-04-0 | CC(C)(C)OC(=O)N1CCC2(CC1)COCCN2 | tert-butyl 4-oxa-1,9-diazaspiro[5.5]undecane-9-carboxylate | AG000BE7 | 10g |
| 1160247-03-9 | CC(C)(C)OC(=O)N1CCC2(CC1)COCC(=O)N2 | Tert-Butyl 2-Oxo-4-Oxa-1,9-Diazaspiro[5.5]Undecane-9-Carboxylate | AG000BE8 | 15g |
| 1160247-02-8 | CC(C)(C)OC(=O)N1CCC2(CC(=NO2)C(=O)O)C1 | 7-(Tert-Butoxycarbonyl)-1-Oxa-2,7-Diazaspiro[4.4]Non-2-Ene-3-Carboxylic Ac | AG000BE9 | 5g |
| 1160246-91-2 | NC1COC2(CCN(C(OC(C)(C)C)=O)CC2)C1 | Tert-Butyl 3-Amino-1-Oxa-8-Azaspiro[4.5]Decane-8-Carboxylate | AG000BEB | 20g |
| 1160246-89-8 | O=C(OC(C)(C)C)N(CCC1)CC1(C2)OCC2=O | 3-Oxo-1-oxa-7-aza-spiro[4.5]decane-7-carboxylic acid tert-butyl ester | AG000BED | 20g |
| 1160246-85-4 | O=C(N(CC1)CC1(OC2)CC2=O)OC(C)(C)C | Tert-Butyl 3-Oxo-1-Oxa-7-Azaspiro[4.4]Nonane-7-Carboxylate | AG000BEF | 25g |
| 1160246-76-3 | CC(C)(C)OC(=O)N1CCCC2(CC(=O)NC2=O)C1 | Tert-Butyl 1,3-Dioxo-2,7-Diazaspiro[4.5]Decane-7-Carboxylate | AG000BEH | 1g |
| 1160246-75-2 | O=C(N(CCCC1)C1(CN2)CC2=O)OC(C)(C)C | Tert-Butyl 3-Oxo-2,6-Diazaspiro[4.5]Decane-6-Carboxylate | AG000BEI | 3g |
| 1160246-72-9 | CC(C)(C)OC(=O)N1CCC2(CCC(=O)N2)C1 | Tert-Butyl 2-Oxo-1,7-Diazaspiro[4.4]Nonane-7-Carboxylate | AG000BEK | 0.5g |
| 1160221-25-9 | O=C(OC(C)(C)C)C1=CC=CC(C2=NC(NC(C3(C4=CC=C(OC(F)(F)O5)C5=C4)CC3)=O)= | tert-Butyl 3-(6-(1-(2,2-difluorobenzo[d][1,3]dioxol-5-yl)cyclopropanecarboxa | AG000BEN | 2g |
| 116022-18-5 | C(=O)(OC)c1cc(OC)c(cc1)Cl | Methyl 4-chloro-3-methoxybenzoate | AG000BEQ | 600g |
| 116020-44-1 | C=C[C@H]1CC[C@H]([C@H]2CC[C@H](CCC)CC2)CC1 | TRANS,TRANS-4-PROPYL-4′-VINYL-BICYCLOHEXYL | AG000BEV | 900g |
| 1160248-48-5 | O=C1NC2=C(C=CC(Br)=C2)C13CCNCC3 | 6-Bromospiro[Indoline-3,4′-Piperidin]-2-One | AG000BEX | 3g |
| 1160248-35-0 | CC(OC(N1CC2=C(NN=C2C(O)=O)C1)=O)(C)C | 5-(TERT-BUTOXYCARBONYL)-1,4,5,6-TETRAHYDROPYRROLO[3,4-C]PYRAZOLE-3 | AG000BEY | 1g |
| 1160248-14-5 | ClC1=NC2=C(CN(C(OCC3=CC=CC=C3)=O)CC2)C(Cl)=N1 | Benzyl 2,4-Dichloro-7,8-Dihydropyrido[4,3-D]Pyrimidine-6(5H)-Carboxylate | AG000BEZ | 10g |
| 1143532-39-1 | C(=O)(N[C@@H](CCO)c1ccc(cc1)Cl)C1(N)CCN(CC1)c1c2c(ncn1)[nH]cc2 | AZD5363 | AG000B4O | 25g |
| 1143502-75-3 | CC1=C(F)C(F)=CC(Br)=C1 | 5-BroMo-1,2-difluoro-3-Methylbenzene | AG000B4Q | 0.5g |
| 1143502-70-8 | C1(C=O)C=C(F)C(F)=C(Br)C=1 | 3-Bromo-4,5-difluorobenzaldehyde | AG000B4R | 20g |
| 114346-31-5 | O=C(O)[C@@H](NC(OC(C)(C)C)=O)CC1=CC=C(NC(OCC2C3=C(C4=C2C=CC=C4)C= | Boc-L-(4-Fmoc)Aminophenylalanine | AG000B55 | 50g |
| 114344-67-1 | N#CC1=CC=CC(I)=C1N | 2-Amino-3-iodobenzonitrile | AG000B57 | 30g |
| 114344-60-4 | C(#N)c1c(N)c(Br)ccc1 | 2-Amino-3-bromobenzonitrile | AG000B58 | 200g |
| 114362-20-8 | NC1=NC(C(C)(C)C)=NC=C1 | 2-Tert-butylpyrimidin-4-amine | AG000B5M | 25g |
| 114362-19-5 | NC1=NC(C(C)C)=NC=C1 | 2-Isopropylpyrimidin-4-amine | AG000B5N | 2g |
| 114360-56-4 | O=C(O)[C@H](NC(OCC1C2=C(C3=C1C=CC=C3)C=CC=C2)=O)CCNC(OC(C)(C)C)=O | Fmoc-D-Dab(Boc)-OH | AG000B5V | 200g |
| 114360-54-2 | [H][C@](CC(C)C)(NC(=O)OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)C(O)=O | Fmoc-D-Leu-OH | AG000B5W | 676g |
| 114365-07-0 | O=C(N)C1=CC=C(CC#N)C=C1 | 4-(Cyanomethyl)benzamide | AG000B6F | 0.1g |
| 114365-04-7 | NCC1=CC=C(N2CCCC2)C=C1 | [4-(1-Pyrrolidinyl)phenyl]methanamine | AG000B6G | 5g |
| 114396-70-2 | O=C(O)[C@@](C)(NC(OCC1=CC=CC=C1)=O)CO | (S)-2-(((Benzyloxy)carbonyl)amino)-3-hydroxy-2-methylpropanoic acid | AG000B84 | 1.65g |
| 114395-69-6 | [K+].FC(F)(F)S(=O)(=O)[C-](S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F | [tris(trifluoromethane)sulfonylmethyl]potassium | AG000B87 | 4g |
| 1144-36-1 | CC(C1=CC(Br)(Br)C=C(C(C)(C)C)C1=O)(C)C | 4,4-Dibromo-2,6-di-tert-butylcyclohexa-2,5-dienone | AG000B8P | 5g |
| 1160653-94-0 | O=CC1=C(OC)C=CC(Br)=C1F | 3-Bromo-2-fluoro-6-methoxybenzaldehyde | AG000BJ2 | 25g |
| 1160614-73-2 | CC1(C)OB(OC1(C)C)C1=C2CCCCN2N=C1 | 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4H,5H,6H,7H-pyrazolo[1,5-a]p | AG000BJ5 | 25g |
| 116070-31-6 | O=CC1=C(Cl)C=C(C)C=C1Cl | 2,6-Dichloro-4-methylbenzaldehyde | AG000BJ7 | 10g |
| 1160756-75-1 | N[C@H](C1CC1)C(F)(F)F.[H]Cl | (1R)-1-cyclopropyl-2,2,2-trifluoroethylamine hydrochloride | AG000BJS | 2g |
| 1160861-59-5 | CC(C1=C(C2=C(OC)C=CC(OC)=C2P(C34CC5CC(C4)CC(C5)C3)C67CC8CC(C7)CC(C8) | AdBrettPhos | AG000BKG | 10g |
| 1160861-53-9 | COC1=C(C2=C(C(C)C)C=C(C(C)C)C=C2C(C)C)C(P(C(C)(C)C)C(C)(C)C)=C(OC)C=C1 | 2-(Di-tert-butylphosphino)-2′,4′,6′-triisopropyl-3,6-dimethoxy-1,1′-biphenyl | AG000BKH | 200g |
| 1160823-77-7 | CCCCC(CC)COC1=C2C(C=CS2)=C(OCC(CC)CCCC)C3=C1C=CS3 | 4,8-Bis((2-ethylhexyl)oxy)benzo[1,2-b:4,5-b’]dithiophene | AG000BKK | 7g |
| 1160822-72-9 | NC1=NNC(OC(F)F)=C1 | 5-(DIFLUOROMETHOXY)-1H-PYRAZOL-3-AMINE | AG000BKM | 50g |
| 1160791-13-8 | NC1SC2=C(C=C(C=N2)Br)N=1 | 2-Amino-6-bromothiazolo[5,4-b]pyridine | AG000BKN | 10g |
| 1160790-92-0 | CC1(C)OB(OC1(C)C)C1=CN=C(CN2CCOCC2)C=C1 | 2-(Morpholinomethyl)pyridine-5-boronic acid pinacol ester | AG000BKO | 4g |
| 1160790-84-0 | O=C1C=C(B2OC(C)(C)C(C)(C)O2)C=CN1C | 1-Methyl-2-oxo-1,2-dihydropyridin-4-ylboronic acid pinacol ester | AG000BKP | 10g |
| 1160790-50-0 | O=C(C1CCN(C2=NC=C(B3OC(C)(C)C(C)(C)O3)C=N2)CC1)OC | Methyl 1-(5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl)pipe | AG000BKQ | 10g |
| 1160790-18-0 | CC1(C)C(C)(C)OB(C2=CN3C(C=C2)=NC=N3)O1 | 6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-[1,2,4]triazolo[1,5-a]pyridine | AG000BKS | 7g |
| 116081-74-4 | Nc1ccc2C(=O)C(=O)Nc2c1 | 6-Aminoindoline-2,3-dione | AG000BKY | 1g |
| 116081-18-6 | CC1=NC2=CC(Br)=CN=C2O1 | 6-Bromo-2-methyloxazolo[5,4-b]pyridine | AG000BL1 | 8g |
| 116081-17-5 | CC1=NC2=C(O1)C(Br)=CN=C2 | 7-Bromo-2-Methyloxazolo[4,5-C]Pyridine | AG000BL2 | 5g |
| 116140-19-3 | C(=O)(O)C1c2c(CNC1)cccc2 | 4-Isoquinolinecarboxylic acid, 1,2,3,4-tetrahydro- | AG000BQ8 | 6.05g |
| 1161426-63-6 | CC1=C(C(=CC=C1F)N)N.Cl | 4-Fluoro-3-methylbenzene-1,2-diamine hydrochloride | AG000BQO | 9g |
| 116143-27-2 | NCC1CNCCO1 | (Morpholin-2-ylmethyl)amine dihydrochloride | AG000BR3 | 5.75g |
| 1161602-22-7 | O=C(C1N(C(OC2=CC=CC=C2)=O)CCC1)O | 1-(Phenoxycarbonyl)pyrrolidine-2-carboxylic acid | AG000BRB | 20g |
| 1161497-23-9 | BrC1=C(C=CC(=C1)OC)F | 2-Bromo-1-fluoro-4-methoxybenzene | AG000BRC | 482g |
| 116153-81-2 | O=C(C1=NNC(C2=CC=CO2)=C1)O | 5-(2-Furyl)-1h-pyrazole-3-carboxylic acid | AG000BRS | 20g |
| 116170-90-2 | CCOC(=O)C1=C(N)C(C#N)=C(SC)S1 | Ethyl 3-amino-4-cyano-5-(methylthio)thiophene-2-carboxylate | AG000BSV | 2g |
| 116170-85-5 | CSc1sc(cc1C#N)C(=O)O | 4-Cyano-5-methylsulfanylthiophene-2-carboxylicacid | AG000BSW | 0.2g |
| 116170-84-4 | O=C(C1=CC(C#N)=C(SC)S1)OCC | Ethyl 4-cyano-5-(methylthio)thiophene-2-carboxylate | AG000BSX | 12.5g |
| 116169-90-5 | O=C(O)[C@@H](N[C@@H](CCC1=CC=CC=C1)C(OCC)=O)CCCCNC(C(F)(F)F)=O | N2-(1S-Ethoxycarbonyl-3-phenylpropyl)-n6-trifluoroacetyl-l-lysine | AG000BT2 | 600g |
| 1161776-13-1 | CC(C1=CN=C(Br)S1)=O | 1-(2-BROMOTHIAZOL-5-YL)ETHANONE | AG000BTE | 8g |
| 1161763-15-0 | Brc1cc(N)nc(n1)C | 4-Amino-6-bromo-2-methylpyrimidine | AG000BTF | 10g |
| 1161737-33-2 | O=C1C=CC(C2CC2)=NN1 | 6-Cyclopropyl-2,3-dihydropyridazin-3-one | AG000BTI | 25g |
| 116178-39-3 | CCOc1ccc(cn1)O | 6-Ethoxypyridin-3-ol | AG000BTN | 0.9g |
| 1161847-33-1 | CCOC(=O)c1cc(Cl)nn2ccnc12 | Imidazo[1,2-b]pyridazine-8-carboxylic acid, 6-chloro-, ethyl ester | AG000BU3 | 0.5g |
| 1161847-28-4 | Clc1c(N)nnc(c1)Cl | 4,6-Dichloropyridazin-3-amine | AG000BU4 | 1g |
| 1161787-84-3 | O(C(C)(C)C)C(N1C[C@H](C(O)=O)[C@H](C1)C1=CC=CC=C1C#N)=O | Trans-1-Boc-4-(2-Cyanophenyl)pyrrolidine-3-carboxylic acid | AG000BU9 | 0.5g |
| 116499-73-1 | CC([C@@]12CC[C@@]3(OO1)C(=C2)CC[C@@H]1[C@]3(C)CCC[C@@]1(C)C(=O) | 3H-3,10b-Ethanonaphtho[1,2-c]-1,2-dioxin-7-carboxylic acid, 5,6,6a,7,8,9,10,1 | AG000CNH | 0.005g |
| 1165-91-9 | O=C(OC1=C(Cl)C=C(Cl)C=C1Cl)C(OC2=C(Cl)C=C(Cl)C=C2Cl)=O | Bis(2,4,6-trichlorophenyl)ethanedioate | AG000CNK | 200g |
| 116515-48-1 | O=C(O)C1=C(CCC2)N2C=C1 | 2,3-Dihydro-1h-pyrrolizine-7-carboxylic acid | AG000CNU | 5g |
| 116513-20-3 | ClC=1C(=NC=C(N1)C)C(C)C | 3-CHLORO-2-ISOPROPYL-5-METHYLPYRAZINE | AG000CNX | 0.5g |
| 116511-28-5 | O=C(C1=CCCN(C)C1)OCC#C.[H]Br | Prop-2-yn-1-yl 1-methyl-1,2,5,6-tetrahydropyridine-3-carboxylate hydrobrom | AG000CO3 | 2g |
| 116509-98-9 | OCC#CC1=CC=CC=C1Br | 3-(2-Bromophenyl)prop-2-yn-1-ol | AG000CO9 | 15g |
| 116526-34-2 | O=C1CC(C2=CC=C(OC)C=C2)CC1 | 3-(4-Methoxyphenyl)cyclopentanone | AG000CON | 0.75g |
| 116519-00-7 | OC1=CC=C(/C=C/C2=CC(OC)=C(OC)C(OC)=C2)C=C1 | (E)-4-(3,4,5-Trimethoxystyryl)phenol | AG000CP3 | 25g |
| 116530-60-0 | O=C1CC2=C(C=C([N+]([O-])=O)C=C2)C1 | 5-Nitro-2-Indanone | AG000CP5 | 50g |
| 116530-22-4 | NC1=C2C=CC(C)=CC2=CC=C1 | 6-Methylnaphthalen-1-amine | AG000CPB | 25g |
| 116529-90-9 | O=C(C1=NC2=CC(Cl)=CC=C2C=C1)OCC | Ethyl 7-chloroquinoline-2-carboxylate | AG000CPD | 11g |
| 116529-84-1 | OC1=C2C=CC=NC2=CC=C1C | 6-Methylquinolin-5-ol | AG000CPF | 1.5g |
| 116529-78-3 | NC1=C2N=C(C3=CC=CC=C3)C=CC2=CC=C1 | 2-Phenylquinolin-8-amine | AG000CPG | 2g |
| 116529-62-5 | O=C(O)C1=CC=C(I)C=C1[N+]([O-])=O | 4-iodo-2-nitrobenzoic acid | AG000CPI | 0.3g |
| 116529-61-4 | O=C(O)C1=CC=CC(Br)=C1[N+]([O-])=O | 3-Bromo-2-nitrobenzoic acid | AG000CPJ | 20g |
| 116529-60-3 | O=C(O)C1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1Br | 2-Bromo-3,5-dinitrobenzoic acid | AG000CPK | 200g |
| 116529-31-8 | Cl.NC1CC[S](CC1)(=O)=O | 4-Aminotetrahydro-2H-thiopyran 1,1-dioxide, HCl | AG000CPN | 5g |
| 116539-59-4 | CNCC[C@@H](C=1SC=CC1)OC1=CC=CC2=CC=CC=C12 | (S)-N-Methyl-3-(naphthalen-1-yloxy)-3-(thiophen-2-yl)propan-1-amine | AG000CPW | 0.6g |
| 116539-57-2 | O[C@@H](C1=CC=CS1)CCNC | (R)-3-(Methylamino)-1-(thiophen-2-yl)propan-1-ol | AG000CPX | 5g |
| 116247-03-1 | C1=CC(=CN=C1)C2=NC(CS2)C(=O)O | 2-(Pyridin-3-yl)-4,5-dihydrothiazole-4-carboxylic acid | AG000C1D | 14g |
| 116258-17-4 | Br.Br.C(C1=CC=CC=C1)N1[C@@H]2CN[C@@H](C2)C1 | (1S,4S)-(+)-2-Benzyl-2,5-diazabicyclo[2.2.1]heptane dihydrobromide | AG000C1V | 100g |
| 116250-44-3 | C1=C(C=CC=C1SCC)F | ETHYL 3-FLUOROPHENYL SULFIDE | AG000C2A | 160g |
| 1162681-06-2 | CC1=CC=C(C=C1)S(=O)(=O)NC2=CN=CC(=C2)B3OC(C)(C)C(C)(C)O3 | 4-Methyl-N-(5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-yl)ben | AG000C2E | 3g |
| 1162676-00-7 | O=C(OC)C1=CC(F)=C(N)C(F)=C1 | Methyl 4-amino-3,5-difluorobenzoate | AG000C2F | 25g |
| 1162674-74-9 | CC1=NC=C(Br)C=C1F | 5-Bromo-3-fluoro-2-methylpyridine | AG000C2G | 50g |
| 1162656-22-5 | O=C1/C(=C/C2C=NC=CC=2)/CC(CC)C/C/1=CC1C=NC=CC=1 | MCB-613 | AG000C2K | 2g |
| 116270-38-3 | Cl.CCOC(=O)c1c(C)nc2ccccc2c1C | ethyl 2,4-dimethylquinoline-3-carboxylate hydrochloride | AG000C2M | 5g |
| 116269-53-5 | C1CCN(CC1)C1CCN(CC1)Cc1ccccc1 | 1′-Benzyl-1,4′-bipiperidine | AG000C2T | 1.8g |
| 116275-39-9 | ClC1=CC(C(NCC2=CC=CC=C2)=O)=NC=C1 | N-Benzyl 4-chloropicolinamide | AG000C33 | 0.75g |
| 116272-42-5 | IC1=CC(Cl)=CC=C1F | 5-Chloro-2-fluoroiodobenzene | AG000C3K | 175g |
| 116272-41-4 | IC1=CC(Br)=CC=C1F | 4-Bromo-1-fluoro-2-iodobenzene | AG000C3L | 200g |
| 116271-35-3 | OCC1(O)COC(C1O)OCC1OC(Oc2cc(O)c3c(c2)OC(CC3=O)c2ccc(cc2)O)C(C(C1O)O) | Pyrroside B | AG000C3O | 0.005g |
| 116285-77-9 | OC[C@H]1O[C@H]([C@H](O)[C@@H]1O)n1c(Cl)nc2c1[nH]cnc2=O | 8-Chloroinosine | AG000C40 | 0.75g |
| 116279-08-4 | C#CCC1CCCC1 | 3-Cyclopentyl-1-propyne | AG000C48 | 0.15g |
| 116278-69-4 | OC1=C(N)C=CC(Cl)=C1Cl | 6-Amino-2，3-dichlorophenol | AG000C4A | 2g |
| 116295-90-0 | O.O.[Na+].[Na+].[Na+].O[C@H]1[C@@H](O)[C@@H](O[C@@H]1COP(=O)(O)O | Uridine-5′-triphosphate Trisodium Salt Dihydrate (>90%) | AG000C4H | 100g |
| 116293-90-4 | C(=O)(O)c1cc2c(nc1)ccc(c2)F | 6-Fluoroquinoline-3-carboxylic acid | AG000C4J | 20g |
| 116290-73-4 | NC(C1=CC=C(N2CCNCC2)C=C1)=O | 4-(piperazin-1-yl)benzamide | AG000C4S | 0.75g |
| 116308-35-1 | O=CC1=C(C(F)(F)F)N=CC=C1 | 2-(Trifluoromethyl)nicotinaldehyde | AG000C54 | 15g |
| 1163-67-3 | CC(=O)OC1=C(C=C2C=CC=CC2=C1)C(=O)NC1=CC=CC=C1 | Naphthol as acetate | AG000C5N | 300g |
| 1163-36-6 | ClC(C=C1)=CC=C1CN2C(CN3CCCC3)=NC4=CC=CC=C42.Cl | Clemizole Hydrochloride | AG000C5Q | 0.25g |
| 1163123-39-4 | FC1=C2N=C(OC2=CC=C1)Cl | 2-Chloro-4-fluorobenzo[d]oxazole | AG000C5V | 24g |
| 116308-38-4 | O=CC1=NC=CC(=C1)C#N | 2-Formylisonicotinonitrile | AG000C6F | 20g |
| 1163141-57-8 | O=C(O)C1=CC(O)=CC(C#N)=C1 | 3-Cyano-5-hydroxybenzoic acid | AG000C6H | 6g |
| 130929-57-6 | O=C(N(CC)CC)/C(C#N)=C/C1=CC([N+]([O-])=O)=C(O)C(O)=C1 | (2E)-2-cyano-3-(3,4-dihydroxy-5-nitrophenyl)-N,N-diethylprop-2-enamide | AG000C6I | 75g |
| 116313-94-1 | OC1=C([N+]([O-])=O)C=C(/C=C(C(C)=O)/C(C)=O)C=C1O | 3-(3,4-Dihydroxy-5-nitrobenzylidene)pentane-2,4-dione | AG000C73 | 2g |
| 116313-85-0 | N(=O)(=O)c1c(O)c(O)cc(c1)C=O | Benzaldehyde, 3,4-dihydroxy-5-nitro- | AG000C74 | 500g |
| 1163287-01-1 | O=C(OC)C1=CC([N+]([O-])=O)=C(F)C=C1C | Methyl 4-fluoro-2-methyl-5-nitrobenzoate | AG000C77 | 700g |
| 1163248-54-1 | CC1=CC(=NN1)B(O)O | (3-Methyl-1h-pyrazol-5-yl)boronic acid | AG000C79 | 50g |
| 116319-25-6 | N1CCSCCSCCSCCSCC1 | 1,4,7,10-Tetrathia-13-azacyclopentadecane | AG000C7T | 2g |
| 116332-64-0 | O=C(C1=CC=C(C#N)C=C1)N(OC)C | 4-Cyano-N-methoxy-N-methylbenzamide | AG000C86 | 10g |
| 116332-61-7 | CON(C)C(=O)C1=CC=C(C=C1)C(F)(F)F | N-Methoxy-N-Methyl-4-(trifluoroMethyl)Benzamide | AG000C89 | 900g |
| 1167056-17-8 | O=C(C1=C2C(Cl)=CC=CN2N=C1)O | 4-Chloropyrazolo[1,5-a]pyridine-3-carboxylic acid | AG000D2B | 5g |
| 1167056-12-3 | O=[N+](C1=CC=C(F)C2=C1NCC2)[O-] | 4-Fluoro-7-nitroindoline | AG000D2F | 2g |
| 1167056-03-2 | OC1=CC2=CC(F)=CC=C2N=C1 | 6-Fluoroquinolin-3-ol | AG000D2O | 10g |
| 1167056-02-1 | FC=1C=C2C=NNC2=C(C1)[N+](=O)[O-] | 5-Fluoro-7-Nitro 1H-Indazole | AG000D2P | 5g |
| 1167056-00-9 | O=C(C1=CC2=C(C=C1C)C=CN2)O | 5-Methyl-1H-indole-6-carboxylic acid | AG000D2R | 2g |
| 1167055-96-0 | FC(F)(F)C1=CC=C(Cl)C2=C1C=CN2 | 7-Chloro-4-(trifluoromethyl)-1H-indole | AG000D2T | 4g |
| 1167055-94-8 | COC1=CC=C(C2=C1NC=C2)C(F)(F)F | 7-Methoxy-4-(trifluoromethyl)-1H-indole | AG000D2V | 1g |
| 1167056-36-1 | O=C(C1=NC=CC2=C1C=CN2)OCC | Ethyl 1H-pyrrolo[3,2-c]pyridine-4-carboxylate | AG000D36 | 2g |
| 1167056-71-4 | O=C(C1=NNC2=C1C=CC([N+]([O-])=O)=C2)OC | Methyl 6-nitro-1H-indazole-3-carboxylate | AG000D3O | 5g |
| 1167056-69-0 | Cc1cc2cc[nH]c2cc1C#N | 5-Methyl-1H-indole-6-carbonitrile | AG000D3Q | 5g |
| 1167056-67-8 | O=C(O)C1=C([N+]([O-])=O)C=C(Br)C=C1N | 2-Amino-4-bromo-6-nitrobenzoic acid | AG000D3R | 0.2g |
| 1167056-59-8 | O=C1CC2=C(N1)C=CC(=N2)C#N | 2-Oxo-2,3-dihydro-1H-pyrrolo[3,2-b]pyridine-5-carbonitrile | AG000D3Z | 0.75g |
| 1167056-58-7 | COC1=CC(=CC(=C1)I)F | 1-Fluoro-3-iodo-5-methoxybenzene | AG000D40 | 20g |
| 1167056-55-4 | NC1=NNC2=C1C=CC(OCC3=CC=CC=C3)=C2 | 3-Amino-6-benzyloxy-1h-indazole | AG000D43 | 10g |
| 1167056-53-2 | CC1=CC(C)=C(Br)C2=C1NC=C2 | 4-BROMO-5,7-DIMETHYLINDOLE | AG000D45 | 25g |
| 1167056-96-3 | ClC1=CC2=C(NC=C2Br)C=N1 | 3-Bromo-5-Chloro-1H-Pyrrolo[2,3-c]Pyridine | AG000D4C | 20g |
| 1167056-95-2 | O=[N+](C1=CC=C(F)C2=C1NC=C2)[O-] | 4-Fluoro-7-nitro-1H-indole | AG000D4D | 25g |
| 1167056-94-1 | O=C(C1=CC=CC2=C1C(N)=NN2)OC | Methyl 3-amino-1H-indazole-4-carboxylate | AG000D4E | 2g |
| 1164100-84-8 | COC1=C(C#N)C(B(O)O)=CC=C1 | 2-Cyano-3-methoxyphenylboronic acid | AG000CET | 10g |
| 1164100-82-6 | NC(C1=CC=C(B(O)O)C=N1)=O | 6-(Aminocarbonyl)pyridine-3-boronic acid | AG000CEV | 3g |
| 1164100-81-5 | N#CC1=NC=C(B(O)O)C=N1 | (2-Cyanopyrimidin-5-yl)boronic acid | AG000CEW | 15g |
| 116412-83-0 | COC1=C(OC)C=C(C=C1)C(=O)C1=CC=C(Cl)C=C1 | (4-Chlorophenyl)(3,4-dimethoxyphenyl)methanone | AG000CF0 | 50g |
| 116409-31-5 | O=C(O)c1cccc2ccnc(O)c12 | 1-Hydroxyisoquinoline-8-carboxylic acid | AG000CFB | 36g |
| 116423-58-6 | N#CC1=CC(O)=CC=C1N | 2-Amino-5-hydroxybenzonitrile | AG000CGA | 2g |
| 116423-07-5 | C1(CCC(O)=O)C(C)=NOC=1C | 3-(3,5-Dimethylisoxazol-4-yl)propanoic acid | AG000CGE | 20g |
| 116422-39-0 | C[C@H](OC)CO | (S)-(+)-2-Methoxypropanol | AG000CGJ | 100g |
| 116419-94-4 | O=C(OC)C1=CC=C(C)C(C(F)(F)F)=C1 | Methyl 4-methyl-3-(trifluoromethyl)benzoate | AG000CGU | 25g |
| 116424-70-5 | C=CC[C@H]1C(=O)C=C([C@@]2([C@H]1O[C@@H]([C@H]2C)c1ccc2c(c1)OCO2) | Fargesone B | AG000CHG | 0.005g |
| 116424-69-2 | C=CC[C@@H]1C(=O)C=C([C@]2([C@@H]1O[C@H]([C@@H]2C)c1ccc2c(c1)OCO2 | Fargesone A | AG000CHH | 0.005g |
| 116437-41-3 | O=C(OC(C)(C)C)NCCCC(C1=CC=CC=C1)=O | tert-Butyl (4-oxo-4-phenylbutyl)carbamate | AG000CHO | 150g |
| 116436-10-3 | BrC=1C=CC(=C(C1)NC(C)=O)C | N-(5-Bromo-2-methylphenyl)acetamide | AG000CHT | 75g |
| 116436-03-4 | CCOC1=CC(N)=NC(N)=N1 | 2,4-Diamino-6-ethoxypyrimidine | AG000CHU | 50g |
| 116435-82-6 | O=C(O)CC1=CC=C(N)C([N+]([O-])=O)=C1 | 2-(4-Amino-3-nitrophenyl)acetic acid | AG000CHV | 1.25g |
| 116435-77-9 | OC1=CC=CC(Br)=C1N | 2-Amino-3-bromophenol | AG000CHW | 100g |
| 116435-75-7 | CCOC1=C([N+]([O-])=O)C=CC(N)=C1 | 3-Ethoxy-4-nitroaniline | AG000CHX | 5g |
| 116753-50-5 | NCCCOC1=CC(Cl)=CC=C1 | 3-(3-Chlorophenoxy)propan-1-amine HCl | AG000D6V | 4g |
| 116753-49-2 | NCCCOC1=CC(F)=CC=C1 | 3-(3-Fluorophenoxy)propan-1-amine, HCl | AG000D6W | 3g |
| 116751-24-7 | O=C(O)C1=CC(F)=C(F)C(O)=C1F | 3-Hydroxy-2,4,5-trifluorobenzoic acid | AG000D6Z | 500g |
| 88336-88-3 | COC(=O)CC(C)CCCCCCCCCCCCc1ccccc1 | Methyl 3-methyl-15-phenylpentadecanoate | AG000D71 | 0.05g |
| 1167991-21-0 | O=C(N1CCC(B2OCC(C)(C)CO2)=CC1)OC(C)(C)C | 3,6-Dihydro-2h-pyridine-1-n-boc-4-boronic acid neopentylglycol ester | AG000D7R | 0.5g |
| 116797-51-4 | O=C(O)C(N)CS.[H]Cl.[H]O[H] | Dl-cysteine HCl monohydrate | AG000D7V | 3000g |
| 116797-02-5 | CC1CCN(C2CCNCC2)CC1 | 4-Methyl-[1,4′]bipiperidinyl | AG000D7W | 10g |
| 116795-55-2 | CC(=O)C1=CN(C=N1)C(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 | 1-(1-Trityl-1H-imidazol-4-yl)ethanone | AG000D7Y | 1.75g |
| 116784-97-5 | BrCCCCCCNC(=O)OCC1C=CC=CC=1 | N-Cbz-6-bromo-hexylamine | AG000D87 | 15g |
| 116783-35-8 | C[C@@H](O[C@@H]1[C@H](NC(C)=O)[C@H]([C@H]([C@@H](COC(C)=O)O1)O | Fmoc-thr(galnac(ac)3-alpha-d)-oh | AG000D89 | 1.5g |
| 116783-26-7 | CCCCCC[C@H](N)C(O)=O | (S)-2-Aminooctanoic acid | AG000D8A | 125g |
| 116782-73-1 | COC1=C[C@@H](C)O[C@H](C1=O)O[C@H]1CC[C@]2(C(=CC[C@@H]3[C@@H]2 | 2H-Pyran-3(6H)-one, 2-[[(3β,20S)-20-[(2,6-dideoxy-β-D-arabino-hexopyranos | AG000D8B | 0.005g |
| 1168139-41-0 | Cl.CC[C@H](C1=CC(F)=CC=C1)N | (R)-1-(3-Fluorophenyl)propan-1-amine hydrochloride | AG000D8G | 0.1g |
| 1168135-03-2 | CC1(C)C(C)(C)OB(C2=CC3=NSN=C3C=C2)O1 | Benzo[c][1,2,5]thiadiazole-5-boronic acid, pinacol ester | AG000D8J | 10g |
| 1168090-92-3 | COC(=O)C1=C(Cl)N2C=NC=C2C=C1 | methyl 5-chloroimidazo[1,5-a]pyridine-6-carboxylate | AG000D8L | 3g |
| 116802-97-2 | O=C(O)C1=C(Cl)C=C(C(O)=O)C=C1Cl | 2,6-Dichloroterephthalic acid | AG000D8Z | 10g |
| 1168139-52-3 | CC[C@H](C1=CC=CC(Cl)=C1)N | (R)-1-(3-Chlorophenyl)propan-1-amine | AG000D94 | 2g |
| 1168139-51-2 | NCC1=NC=C(Cl)C=C1Cl.[H]Cl.[H]Cl | (3,5-Dichloropyridin-2-yl)methanamine dihydrochloride | AG000D95 | 0.75g |
| 116369-25-6 | NC1=CC(OC(F)(F)F)=C(Br)C=C1 | 4-Bromo-3-(trifluoromethoxy)aniline | AG000CBZ | 9g |
| 116369-24-5 | NC1=CC(Cl)=C(Br)C=C1F | 4-Bromo-5-chloro-2-fluoroaniline | AG000CC0 | 200g |
| 1163732-89-5 | C(CCCC(NCCOCCOCCOCCOCCOCCN=[N+]=[N-])=O)[C@H]1[C@@]2([C@](CS1)( | 1H-Thieno[3,4-d]imidazole-4-pentanamide, N-(17-azido-3,6,9,12,15-pentaox | AG000CC1 | 6g |
| 1163729-53-0 | CC(OC(N1CCC2(C(CN)C2)CC1)=O)(C)C | tert-Butyl 1-(aminomethyl)-6-azaspiro[2.5]octane-6-carboxylate | AG000CC2 | 15g |
| 1163729-49-4 | O=C(C1CC(C(F)(F)F)(O)C1)O | 3-Hydroxy-3-(trifluoromethyl)cyclobutanecarboxylic acid | AG000CC3 | 15g |
| 116378-40-6 | O=C(O)C1=CC(B(O)O)=CC(N)=C1 | 3-Amino-5-carboxylphenylboronic acid | AG000CCG | 30g |
| 116373-36-5 | C(C)(C)C1=CC=C(C=C1)/C=C/C(=O)O | (E)-3-(4-Isopropylphenyl)acrylic acid | AG000CCO | 3g |
| 116387-40-7 | O=C(C1=CC(I)=CNC1=O)OC | 2-Hydroxy-5-iodo-nicotinic acid methyl ester | AG000CCS | 200g |
| 116384-53-3 | CCOP(=O)(COCCn1cnc2c(N)ncnc12)OCC | [[2-(6-Amino-9h-purin-9-yl)ethoxy]methyl]phosphonic acid diethyl ester | AG000CD9 | 300g |
| 116384-26-0 | COc1ccc2c(c1)O[C@@H](CC2)c1ccc(c(c1)OC)OC | 3′,4′,7-Trimethoxyflavan | AG000CDB | 0.005g |
| 116383-98-3 | ClC1=C(N=CC=C1)C(=O)OC | Methyl 3-chloropicolinate | AG000CDD | 50g |
| 99409-34-4 | CCS[C@H]1O[C@@H](C)[C@H]([C@H]([C@@H]1OCc1ccccc1)OCc1ccccc1)OCc1c | Ethyl 2,3,4-tri-o-benzyl-1-thio-beta-l-fucopyranoside | AG000CE3 | 2g |
| 116405-43-7 | [O-]C(=O)C(F)(F)F.c1ccc(cc1)P(=[N+]=P(c1ccccc1)(c1ccccc1)c1ccccc1)(c1ccccc1)c1 | Bis(triphenylphosphine)iminium trifluoroacetate | AG000CE7 | 25g |
| 1164-16-5 | OC(C=C1)=CC=C1C[C@@H](C(O)=O)NC(OCC2=CC=CC=C2)=O | z-tyr-oh | AG000CER | 1500g |
| 1164100-85-9 | OB(C1=C(OC)C=CC=C1C#N)O | 2-Cyano-6-methoxyphenylboronic acid | AG000CES | 15g |
| 116539-56-1 | OC(C1=CC=CS1)CCNC | 3-(Methylamino)-1-(thiophen-2-yl)propan-1-ol | AG000CPY | 3g |
| 116539-55-0 | CNCC[C@H](O)C1=CC=CS1 | (S)-(-)-3-(N-Methylamino)-1-(2-thienyl)-1-propanol | AG000CPZ | 1200g |
| 116530-98-4 | CC1CCCC1CC(=O)O | 2-(2-Methylcyclopentyl)acetic acid | AG000CQF | 3g |
| 116546-04-4 | O=CC1=CC=C(O)C(CN(C)C)=C1 | 3-[(Dimethylamino)methyl]-4-hydroxybenzaldehyde | AG000CQJ | 3g |
| 116548-08-4 | N#CC1=C(C)C=C(C(F)(F)F)NC1=O | 2-Hydroxy-4-methyl-6-(trifluoromethyl)nicotinonitrile | AG000CRE | 1.5g |
| 116548-07-3 | O=C(C1=C(C)C=C(C(F)(F)F)NC1=O)N | 2-Hydroxy-4-methyl-6-(trifluoromethyl)nicotinamide | AG000CRF | 8g |
| 116548-05-1 | CC(C1=CC=C(C(F)(F)F)N=C1O)=O | 1-(2-Hydroxy-6-(trifluoromethyl)pyridin-3-yl)ethanone | AG000CRG | 1g |
| 116548-03-9 | NC(C1C(=O)NC(C(F)(F)F)=CC=1)=O | 2-hydroxy-6-(trifluoromethyl)pyridine-3-carboxamide | AG000CRI | 25g |
| 116548-02-8 | CCOC(=O)C1=CC=C(NC1=O)C(F)(F)F | 1,2-Dihydro-2-oxo-6-(trifluoromethyl)-3-pyridinecarboxylic acid ethyl ester | AG000CRJ | 15g |
| 116569-08-5 | OC1=CC2=C(C(C(N2)=O)=O)C=C1 | 6-Hydroxy-2,3-dihydro-1h-indole-2,3-dione | AG000CRW | 0.025g |
| 116569-00-7 | COC(C1CC(C(O)=O)C1)=O | 3-(Methoxycarbonyl)cyclobutane-1-carboxylic acid | AG000CRY | 25g |
| 116568-17-3 | O=C(C1=CC=C2C(NC=N2)=C1)N | 1H-Benzo[d]imidazole-6-carboxamide | AG000CS0 | 75g |
| 116567-17-0 | NNC(NC1=CC(Br)=CC=C1)=S | N-(3-Bromophenyl)hydrazinecarbothioamide | AG000CS1 | 5g |
| 116557-46-1 | BrC=1C(=C(N)C=CC1)OC | 3-Bromo-2-methoxyaniline | AG000CS8 | 275g |
| 116574-75-5 | FC1CNCCC1 | 3-Fluoropiperidine | AG000CST | 3g |
| 116574-72-2 | COCC1CCCNC1 | 3-(Methoxymethyl)piperidine | AG000CSV | 6g |
| 116332-54-8 | O=C(N(OC)C)C1=CC=C(F)C=C1 | 4-fluoro-N-methoxy-N-methylbenzamide | AG000C8A | 3000g |
| 116343-89-6 | O=C(C1=CN(C2=CC=CC=C2)C=N1)OC | Methyl 1-phenyl-1H-imidazole-4-carboxylate | AG000C8K | 50g |
| 116340-67-1 | O=S(C1=CC=C(Br)C=C1C)(N)=O | 4-Bromo-2-methylbenzenesulfonamide | AG000C8Y | 15g |
| 116339-45-8 | CC(C)(C)OC(=O)NC1CCN(C1=O)CC(=O)O | 2-(3-(tert-Butoxycarbonylamino)-2-oxopyrrolidin-1-yl)acetic acid | AG000C93 | 1g |
| 116350-38-0 | O=C(OC)C1=CC2=CC=C(O)C=C2N1 | Methyl 6-hydroxy-1h-indole-2-carboxylate | AG000C9I | 25g |
| 116345-47-2 | OCC1=NC2=C(O)C=CC=C2N1 | 4-Hydroxy-2-(hydroxymethyl)benzimidazole | AG000C9N | 10g |
| 116355-84-1 | C[C@H](N)[C@@H](O)C[C@H](O)CCCCCC[C@H](C)C[C@H](OC(C[C@H](C(O)= | Fumonisin B2 | AG000CAC | 0.02g |
| 116355-19-2 | CC1=C(Br)C=CC2=NC=CN12 | 6-Bromo-5-methylimidazo[1,2-a]pyridine | AG000CAJ | 25g |
| 116355-18-1 | CC1=CC2=NC=CN2C=C1Br | 6-Bromo-7-methylimidazo[1,2-a]pyridine | AG000CAK | 50g |
| 116355-16-9 | C(=O)c1cn2c(cc1)ncc2 | Imidazo[1,2-a]pyridine-6-carbaldehyde | AG000CAL | 25g |
| 116369-23-4 | NC1=CC(OC(F)(F)F)=CC=C1F | 2-Fluoro-5-(trifluoromethoxy)aniline | AG000CAO | 175g |
| 1163706-77-1 | CC1(C)C(C)(C)OB(C2=CC=CC(N3C=CN=C3)=N2)O1 | 2-(1H-Imidazol-1-yl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine | AG000CBI | 6g |
| 1163693-01-3 | COC1=C(I)C(Cl)=NC=C1 | 2-Chloro-3-iodo-4-methoxypyridine | AG000CBK | 75g |
| 116371-67-6 | [H][C@]1(N2C(N=C(N)C=C2)=O)C(F)(F)[C@H](O)[C@@H](COP(O)(O)=O)O1 | Gemcitabine Monophosphate | AG000CBP | 1.25g |
| 1162261-97-3 | O=C(N1N=C(B(O)O)C=C1)OC(C)(C)C | (1-(tert-Butoxycarbonyl)-1H-pyrazol-3-yl)boronic acid | AG000BYZ | 2g |
| 1162257-61-5 | OB(O)C1=NC(=CC=C1)C(F)(F)F | 6-(Trifluoromethyl)pyridine-2-boronic acid | AG000BZ1 | 3g |
| 1162257-58-0 | FC(C1=CN=C(B(O)O)C=C1)(F)F | 5-(Trifluoromethyl)pyridine-2-boronic acid | AG000BZ2 | 125g |
| 1162257-52-4 | Cl.NCC1=C(C#C)C=CC=C1 | (2-ethynylphenyl)methanamine hydrochloride | AG000BZ3 | 1g |
| 1162257-45-5 | CCCOC1=C(C=C(C=C1)B(O)O)C(F)(F)F | 4-Propoxy-3-(trifluoromethyl)phenylboronic acid | AG000BZ4 | 200g |
| 1162256-87-2 | CCOc1ncc(cc1B(O)O)C | 2-Ethoxy-5-methylpyridine-3-boronic acid | AG000BZ6 | 2.8g |
| 116228-41-2 | O=S(N1N=CC(Br)=C1)(C2=CC=C(C)C=C2)=O | 4-Bromo-1-[(4-methylbenzene)sulfonyl]pyrazole | AG000BZ9 | 10g |
| 116230-30-9 | BrC1=CC=C2C(=C1)C=C(C=C2)O | 2-Bromo-7-Hydroxynaphthalene | AG000C02 | 200g |
| 116229-43-7 | CCO[Si](CCCN=C(C)CC(C)C)(OCC)OCC | N-(1,3-Dimethylbutylidene)-3-(triethoxysilyl)-1-propanamine | AG000C09 | 100g |
| 116241-62-4 | Fc1cc(ccn1)c1ccccc1 | 2-Fluoro-4-phenylpyridine | AG000C0C | 1g |
| 116241-61-3 | COC1=CC=CC(F)=N1 | 2-Fluoro-6-methoxypyridine | AG000C0D | 200g |
| 116241-59-9 | CCOC(=O)c1ccc(nc1)F | ethyl 6-fluoronicotinate | AG000C0E | 25g |
| 116248-09-0 | CCc1ccc(cc1)c1nc2c(o1)ccc(c2)N | 2-(4-Ethylphenyl)-5-benzoxazolamine | AG000C16 | 0.5g |
| 116248-07-8 | N#Cc1ccc(N2CCC(=O)CC2)nc1 | 6-(4-OXOPIPERIDIN-1-YL)PYRIDINE-3-CARBONITRILE | AG000C17 | 0.5g |
| 116247-92-8 | C1=CN=C(N=C1)N2CCC(=O)CC2 | 1-Pyrimidin-2-yl-piperidin-4-one | AG000C19 | 1.75g |
| 1167055-30-2 | OC1=CC=C(Cl)C2=C1C=CN2 | 7-CHLORO-4-HYDROXY INDOLE | AG000D06 | 2g |
| 1167055-29-9 | O=C(C1=C2C=CC(Cl)=CN2N=C1)O | 6-Chloropyrazolo[1,5-a]pyridine-3-carboxylic acid | AG000D07 | 150g |
| 1167055-27-7 | COC1=CC=CC2=C1C(Br)=NN2 | 3-Bromo-4-methoxy-1H-indazole | AG000D08 | 6g |
| 1167055-25-5 | O=C(OC)C1=C2C=C(C=CN2N=C1)C | methyl 5-Methylpyrazolo[1,5-a]pyridine-3-carboxylate | AG000D0A | 9g |
| 1166988-09-5 | N#CC1=CC=CC(N)=C1Br | 3-Amino-2-bromobenzonitrile | AG000D0B | 150g |
| 116700-73-3 | [Si](C(C)(C)C)(OCC(=C)CO)(C)C | 2-[[tert-Butyl(dimethyl)silyl]oxymethyl]prop-2-en-1-ol | AG000D0I | 200g |
| 1167055-55-1 | N#CC1=NNC2=C1C(Br)=CC=C2 | 4-Bromo-1H-indazole-3-carbonitrile | AG000D0W | 25g |
| 1167055-46-0 | N#CC1=CC=C(Br)C2=C1NC=C2 | 4-Bromo-1H-indole-7-carbonitrile | AG000D14 | 4g |
| 1167055-41-5 | O=C(C1=CNC2=C1C=CN=C2Cl)O | 7-Chloro-1H-pyrrolo[2,3-c]pyridine-3-carboxylic acid | AG000D19 | 3g |
| 1167055-37-9 | O=CC1=CC=C(Cl)C2=C1C=CN2 | 7-Chloro-1H-indole-4-carbaldehyde | AG000D1D | 0.75g |
| 1167055-35-7 | OCc1ccc(c2c1cc[nH]2)Cl | (7-Chloro-1H-indol-4-yl)methanol | AG000D1F | 0.5g |
| 1167055-33-5 | Fc1c2c(cc(c1)N(=O)=O)cc[nH]2 | 7-Fluoro-5-nitro-1H-indole | AG000D1H | 10g |
| 1167055-92-6 | NC=1C=C(C=C(C1)F)O | 3-Amino-5-fluorophenol | AG000D1J | 5g |
| 1167055-86-8 | O=C(C1=C2C=CC(Cl)=CN2N=C1)OC | methyl 6-chloropyrazolo[1,5-a]pyridine-3-carboxylate | AG000D1P | 5g |
| 1167055-73-3 | O=C(C1=COC(Br)=N1)O | 2-Bromooxazole-4-carboxylic acid | AG000D1Y | 8.9g |
| 1167055-67-5 | O=C(C1=CC2=C(C(OC)=C1)C=NN2)O | 4-METHOXY-1H-INDAZOLE-6-CARBOXYLIC ACID | AG000D22 | 0.5g |
| 1167055-65-3 | COc1cc(F)cc(c1C)[N+]([O-])=O | 5-Fluoro-1-methoxy-2-methyl-3-nitrobenzene | AG000D24 | 0.85g |
| 117-37-3 | O=C1C(C2=CC=C(OC)C=C2)C(C3=C1C=CC=C3)=O | Anisindione | AG000DHN | 3g |
| 117-34-0 | O=C(O)C(C1=CC=CC=C1)C2=CC=CC=C2 | Diphenylacetic Acid | AG000DHO | 2000g |
| 117-22-6 | S(=O)(=O)(O)C=2(C1(=C(O)C=CC=C1C=CC=2)) | 1-Naphthol-8-sulfonic acid | AG000DHQ | 0.3g |
| 117-21-5 | O=C(C1=CC=CC(Cl)=C12)OC2=O | 3-Chlorophthalic anhydride, tech grade | AG000DHR | 1040g |
| 117-10-2 | O=C(C1=C2C(O)=CC=C1)C3=CC=CC(O)=C3C2=O | 1,8-Dihydroxyanthraquinone | AG000DHW | 450g |
| 117-02-2 | O=C1C2=C(O)C(C)=C(O)C=C2C(C3=C1C=CC=C3)=O | Rubiadin | AG000DI1 | 0.05g |
| 117-83-9 | CCCCOCCOC(=O)c1ccccc1C(=O)OCCOCCCC | Bis(2-butoxyethyl) Phthalate (~85%) | AG000DI5 | 800g |
| 117-82-8 | O=C(OCCOC)C1=CC=CC=C1C(OCCOC)=O | Bis(2-methoxyethyl) phthalate | AG000DI6 | 5000g |
| 117-79-3 | NC1=CC2=C(C=C1)C(=O)C1=C(C=CC=C1)C2=O | 2-Aminoanthraquinone | AG000DI8 | 200g |
| 117-78-2 | O=C(C(C=C1C2=O)=CC=C1C(C3=C2C=CC=C3)=O)O | Anthraquinone-2-carboxylic acid | AG000DI9 | 600g |
| 117-77-1 | Nc1cc2C(=O)c3ccccc3C(=O)c2cc1O | 2-Amino-3-Hydroxyanthraquinone | AG000DIA | 250g |
| 117-61-3 | O=S(C1=CC(N)=CC=C1C2=CC=C(N)C=C2S(=O)(O)=O)(O)=O | 4,4′-Diaminobiphenyl-2,2′-disulfonic acid hydrate | AG000DIH | 1500g |
| 117-59-9 | O=S(C1=C2C=CC=C(O)C2=CC=C1)(O)=O | 1-Naphthol-5-sulfonic acid | AG000DII | 4000g |
| 117-57-7 | O=C(C1=C(O)C(C)=NC2=CC=CC=C12)O | 3-Hydroxy-2-methyl-4-quinolinecarboxylic acid | AG000DIJ | 3500g |
| 117-47-5 | CCCC(C)C(C(=O)OCC)C(=O)OCC | Diethyl 2-(pentan-2-yl)malonate | AG000DIN | 25g |
| 1170054-42-8 | O=C(N1CCC(CC1)=C(C#N)C2=CC=CC=C2)OC(C)(C)C | tert-Butyl 4-(cyano(phenyl)methylene)piperidine-1-carboxylate | AG000DIR | 0.75g |
| 116183-83-6 | N[C@@H]1CNCC1.[H]Cl.[H]Cl | (S)-(+)-3-Aminopyrrolidine DiHCl | AG000BUI | 50g |
| 116183-82-5 | N[C@H]1CNCC1 | (R)-3-Aminopyrrolidine | AG000BUJ | 10g |
| 116183-81-4 | N[C@H]1CNCC1.[H]Cl.[H]Cl | (R)-Pyrrolidin-3-amine DiHCl | AG000BUK | 25g |
| 116183-66-5 | OC1=C2C(C(=C(OC2=CC(=C1)OC)C1=CC=C(C=C1)O[C@@H]1O[C@@H]([C@H]([C | 5-Hydroxy-7-methoxy-3-(((2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethy | AG000BUM | 0.5g |
| 116183-64-3 | OC[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@](O[C@H]2[C@H](O)[C@@H | N-Dodecyl alpha-d-maltoside | AG000BUN | 25g |
| 1161932-04-2 | O=C(N1C[C@H](O)[C@@H](N)CC1)OC(C)(C)C | (3S,4S)-tert-Butyl 4-amino-3-hydroxypiperidine-1-carboxylate | AG000BUS | 25g |
| 116195-81-4 | IC1=CN=C(I)C=C1 | 2,5-Diiodopyridine | AG000BUY | 43g |
| 116194-21-9 | CC[C@@H]([C@@H](C(=O)O)NC(=O)OC(C)(C)C)C | Boc-DL-Ile-OH | AG000BV9 | 10g |
| 116193-72-7 | CC(C1OCC(CO1)C(=O)O)C | 1,3-Dioxane-5-carboxylic acid, 2-(1-methylethyl)- | AG000BVB | 1000g |
| 1162-56-7 | C[C@@]12[C@@H]3[C@H]([C@H]4[C@@](CC3)(C)[C@H](CC4)C(=O)C)C=CC1=C | Pregna-4,6-diene-3,20-dione | AG000BW1 | 500g |
| 1162-54-5 | C[C@@]12[C@@]3([C@]([C@]4([C@](C)(CC3)[C@@H](C(C)=O)CC4)[H])(CCC1= | 1,2-Dehydroprogesterone | AG000BW2 | 0.01g |
| 1162-53-4 | CC(=O)C1=CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12 | Pregna-5,16-dien-20-one, 3-hydroxy-, (3b)- | AG000BW3 | 0.4g |
| 1162120-35-5 | CN1CC(=O)C(C1=O)C1=C(OC2=CC=CC=C2)C=CC(Cl)=C1 | 3-(5-chloro-2-phenoxyphenyl)-1-methylpyrrolidine-2,4-dione | AG000BXJ | 6395g |
| 116209-55-3 | CC(C)NC[C@H](O)COC1=CC=C(C=C1)CCOCC2CC2.Cl | Levobetaxolol (hydrochloride) | AG000BXY | 0.5g |
| 116631-94-8 | COC(=O)C(Br)=C(/Br)C(=O)OC | Dimethyl trans-2,3-dibromobutenedioate | AG000CW1 | 5g |
| 116622-38-9 | O=C(O)[C@@H](N)CCC1CCCCC1 | (S)-2-AMINO-4-CYCLOHEXYL BUTANOIC ACID | AG000CWE | 100g |
| 116640-11-0 | OC1=CC(F)=C(C(F)(F)F)C(F)=C1 | 3,5-Difluoro-4-(trifluoromethyl)phenol | AG000CWT | 3g |
| 116632-58-7 | NC1=CC=C(Br)C2=C1C=CC=N2 | 5-Amino-8-bromoquinoline | AG000CWY | 50g |
| 116632-57-6 | NC1=C2C=C(Br)C=NC2=CC=C1 | 3-BROMOQUINOLIN-5-AMINE | AG000CWZ | 75g |
| 116632-54-3 | NC1=C(Cl)N=C2C(C=CC=C2)=C1 | 2-Chloroquinolin-3-amine | AG000CX0 | 3g |
| 116632-53-2 | NC1=NC2=CC(Br)=CC=C2C=C1 | 7-Bromoquinolin-2-amine | AG000CX1 | 5.5g |
| 116632-42-9 | CC1=CC(Cl)=C(I)C=C1 | 3-Chloro-4-iodotoluene | AG000CX3 | 375g |
| 116632-41-8 | ClC1=C(C=C(C=C1)I)C | 2-Chloro-5-iodotoluene | AG000CX4 | 900g |
| 116632-40-7 | CC1=CC=CC(I)=C1Cl | 2-Chloro-1-iodo-3-methylbenzene | AG000CX5 | 10g |
| 116632-39-4 | Cc1c(I)ccc(c1)Br | Benzene, 4-bromo-1-iodo-2-methyl- | AG000CX6 | 2000g |
| 116632-38-3 | BrC1=CC(=CC(=C1)C)I | 1-Bromo-3-Iodo-5-Methylbenzene | AG000CX7 | 50g |
| 116632-33-8 | O=[N+](C1=C2C=C(Br)C=NC2=CC=C1)[O-] | 3-Bromo-5-nitroquinoline | AG000CX9 | 50g |
| 116632-24-7 | NC1=NC(=CC(=C1)Cl)Cl | 2-Amino-4,6-dichloropyridine | AG000CXA | 1500g |
| 116632-23-6 | OC1=CC(Br)=CC(=C1)[N+]([O-])=O | 3-Bromo-5-nitrophenol | AG000CXB | 200g |
| 116650-34-1 | N[C@H]1CCC(NC2=C3C=CC=C2)=C3C1 | (S)-2,3,4,9-Tetrahydro-1H-carbazol-3-amine | AG000CXP | 3g |
| 116650-33-0 | N[C@@H]1CCC(NC2=C3C=CC=C2)=C3C1 | (R)-2,3,4,9-Tetrahydro-1H-carbazol-3-amine | AG000CXQ | 175g |
| 116650-26-1 | OC1CC(CN)CCC1 | 3-(Aminomethyl)cyclohexanol | AG000CXR | 0.5g |
| 116649-85-5 | O=C(O)CCN1C2=C(C3=C1C=CC=C3)C[C@H](NS(=O)(C4=CC=C(F)C=C4)=O)CC2 | (R)-3-(3-(4-Fluorophenylsulfonamido)-3,4-dihydro-1H-carbazol-9(2H)-yl)prop | AG000CXU | 20g |
| 116668-74-7 | OC1=C(Cl)C=CC(Br)=C1Cl | 3-Bromo-2,6-dichlorophenol | AG000CY5 | 1.25g |
| 116668-47-4 | O=C(O)C1=CC=C2C=C(N)C=CC2=C1 | 6-Amino-2-naphthoic acid | AG000CYA | 500g |
| 116666-63-8 | O=C(O[C@@]1(CCN(CCCC2=NC3=CC=CC=C3N2)C)[C@@H](C(C)C)C4=C(C=C(F)C | Mibefradil dihydrochloride | AG000CYC | 0.5g |
| 1166756-97-3 | CS(=O)(=O)C1=CC=C(C(F)=C1)[N+]([O-])=O | 2-fluoro-4-(methylsulfonyl)nitrobenzene | AG000CYQ | 20g |
| 1166756-82-6 | COC(=O)c1ccc(cc1)-c1noc(n1)C(C)C | Methyl 4-(5-isopropyl-1,2,4-oxadiazol-3-yl)benzoate | AG000CYV | 50g |
| 1166756-72-4 | NC1=CC(Cl)=CC(Br)=C1C | 3-Bromo-5-chloro-2-methylaniline | AG000CZ0 | 125g |
| 1166842-56-3 | CN(C[C@@H]1NCCC1)C | (R)-2-(Dimethylamino)methylpyrrolidine | AG000CZG | 10g |
| 1166831-45-3 | O=C(C1=NC(Cl)=CN=C1C)OC | Methyl 6-chloro-3-methylpyrazine-2-carboxylate | AG000CZH | 20g |
| 1166828-19-8 | CC1=NC(C)=C(N=C1Cl)C(N)=O | 6-Chloro-3,5-dimethylpyrazine-2-carboxamide | AG000CZJ | 3g |
| 1166828-13-2 | O=C(C1=NC(Cl)=C(C)C=C1)O | 6-Chloro-5-methylpyridine-2-carboxylic acid | AG000CZK | 100g |
| 1166820-07-0 | C(=O)(OC(C)(C)C)N1CC(F)(F)CNCC1 | tert-butyl 6,6-difluoro-1,4-diazepane-1-carboxylate | AG000CZL | 2g |
| 1166819-53-9 | FC(C1=NN=C2C=CC(Br)=CN21)(F)F | 6-Bromo-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridine | AG000CZM | 15g |
| 116686-84-1 | CC(C1=CC(Cl)=C([N+]([O-])=O)C=C1)=O | 1-(3-Chloro-4-nitrophenyl)ethanone | AG000CZV | 25g |
| 116686-15-8 | O=C(C1=CC=C(NS(=O)(=O)C)C(OC2=CC=C(F)C=C2F)=C1)C | N-[4-Acetyl-2-(2,4-difluorophenoxy)phenyl]methanesulfonamide | AG000CZW | 0.1g |
| 1167056-92-9 | O=C(O)C1=C2C(NC=C2)=NC(Cl)=C1 | 6-CHLORO-1H-PYRROLO[2,3-B]PYRIDINE-4-CARBOXYLIC ACID | AG000D4F | 7g |
| 1167437-28-6 | OB(C1=CC(Cl)=NC=C1C(F)(F)F)O | (2-Chloro-5-(trifluoromethyl)pyridin-4-yl)boronic acid | AG000D5Q | 15g |
| 1167418-13-4 | CC1(C)C(C)(C)OB(C2=CC=C3N=CC=NC3=C2)O1 | Quinoxaline-6-boronic acid, pinacol ester | AG000D5S | 30g |
| 1167414-92-7 | C[C@@H](N)C1=CC=CC=C1Cl.[H]Cl | (R)-1-(2-Chlorophenyl)ethanamine hydrochloride | AG000D5U | 3g |
| 1167414-89-2 | C[C@@H](N)C1=CC=CC(OC)=C1.[H]Cl | (R)-1-(3-Methoxyphenyl)ethanamine hydrochloride | AG000D5V | 1.25g |
| 1167414-88-1 | CC1=CC(=CC=C1)[C@@H](C)N.Cl | (R)-1-M-Tolylethanamine-hcl | AG000D5W | 40g |
| 1167414-87-0 | C[C@@H](N)C1=CC=C(Cl)C=C1.[H]Cl | (R)-1-(4-Chlorophenyl)ethanamine hydrochloride | AG000D5X | 25g |
| 116748-66-4 | FC1=CC=C(C2=CC=C(S(Cl)(=O)=O)C=C2)C=C1 | 4′-Fluoro-[1,1′-biphenyl]-4-sulfonyl chloride | AG000D61 | 41g |
| 116747-54-7 | O=C(OCC1C=2C=CC=CC2C=3C=CC=CC31)NC(C(=O)NCC(=O)O)C | (S)-2-(2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)propanamido)acetic ac | AG000D63 | 100g |
| 116759-33-2 | NC1=CC(C)=C(Cl)C=C1F | 4-Chloro-2-fluoro-5-methylaniline | AG000D6E | 10g |
| 116758-01-1 | O=CC1=NC(C)=CN=C1 | 6-Methylpyrazine-2-carboxaldehyde | AG000D6I | 4g |
| 116757-66-5 | C1(C=O)C=C2OCCOC2=CC=1OC | 7-Methoxy-2,3-dihydro-1,4-benzodioxine-6-carbaldehyde | AG000D6J | 35g |
| 116754-87-1 | O=C(O)CC(C)CCCCCCCCCCCCC1=CC=C(I)C=C1 | Iodofiltic acid | AG000D6N | 0.001g |
| 116754-58-6 | OCCCCCCCCCCCCCBr | 13-Bromo-1-tridecanol | AG000D6P | 15g |
| 116753-54-9 | NCCCOC1=CC=C(F)C=C1 | 3-(4-Fluorophenoxy)propan-1-amine | AG000D6T | 50g |
| 116753-51-6 | NCCCOC1=CC([N+]([O-])=O)=CC=C1 | 3-(3-Nitrophenoxy)propan-1-amine | AG000D6U | 0.75g |
| 116963-80-5 | C(CCCC)[C@H]1CC[C@@H](CC1)c1ccc(cc1)I | 1-Iodo-4-(trans-4-pentylcyclohexyl);benzene | AG000DEX | 50g |
| 1169789-29-0 | O=C(N1N=CC2=C1C=C(Br)C=C2OC)OC(C)(C)C | 1-N-Boc-6-bromo-4-methoxy-1h-indazole | AG000DFC | 9g |
| 1169762-18-8 | CC(C)(C)OC(=O)N[C@]1(C)CCCNC1 | (3R)-3-(Boc-amino)-3-methylpiperidine | AG000DFE | 5g |
| 1169748-84-8 | NC1=CN=CC(B(O)O)=C1 | (5-Aminopyridin-3-yl)boronic acid | AG000DFF | 2g |
| 1169690-88-3 | CC1(C)C(C)(C)OB(C2=C3N=CC=CN3N=C2)O1 | Pyrazolo[1,5-a]pyrimidine-3-boronic acid pinacol ester | AG000DFL | 50g |
| 116971-11-0 | CCCCCCC1=C(Br)SC(Br)=C1 | 2,5-Dibromo-3-hexylthiophene | AG000DFS | 100g |
| 116971-10-9 | CCCCC1=C(Br)SC(Br)=C1 | 2,5-Dibromo-3-Butylthiophene | AG000DFT | 200g |
| 116965-16-3 | OC(=O)C1=CC(=C(C=C1)C(F)(F)F)[N+]([O-])=O | 3-Nitro-4-(trifluoromethyl)benzoic Acid | AG000DFZ | 16.9g |
| 116965-13-0 | N#CC1=CC=CC(OC2=CC=C(C)C=C2)=C1C#N | 3-(4-Methylphenoxy)-1,2-benzenedicarbonitrile | AG000DG0 | 0.75g |
| 1169870-80-7 | O=C(O)C1=CC=C(Cl)C(OC)=C1F | 4-Chloro-2-fluoro-3-methoxybenzoic acid | AG000DG1 | 25g |
| 116986-13-1 | N#CC1=NC=CC=C1CBr | 3-(Bromomethyl)picolinonitrile | AG000DGE | 10g |
| 116986-12-0 | C1=CN=C(CBr)C(=C1)C#N | 2-(Bromomethyl)nicotinonitrile | AG000DGF | 0.35g |
| 116986-09-5 | O=C(OC)C1=NC=CC=C1CBr | methyl 3-(bromomethyl)pyridine-2-carboxylate | AG000DGH | 125g |
| 116986-08-4 | O=C(OC)C1=C(CBr)N=CC=C1 | Methyl 2-(bromomethyl)nicotinate | AG000DGI | 5g |
| 116985-92-3 | O=C(C1=C(C)C=NC=C1)OC | Methyl 3-methyl-4-pyridinecarboxylate | AG000DGJ | 150g |
| 1169930-49-7 | NC(C(O)=O)C1COCC1 | 2-Amino-2-(tetrahydrofuran-3-yl)acetic acid | AG000DGV | 1g |
| 116990-44-4 | SC(S1)=NC2=C1C=NC=C2 | Thiazolo[5,4-c]pyridine-2-thiol | AG000DH3 | 2g |
| 1174020-40-6 | O=C(N1C[C@H](F)[C@H](O)CC1)OC(C)(C)C | (3S,4R)-tert-Butyl 3-fluoro-4-hydroxypiperidine-1-carboxylate | AG000E8H | 100g |
| 1174020-39-3 | O=C(N1CC[C@H](O)CCC1)OC(C)(C)C | (R)-tert-butyl 4-hydroxyazepane-1-carboxylate | AG000E8I | 25g |
| 1174020-38-2 | O=C(N1CC[C@@H](O)CCC1)OC(C)(C)C | (S)-tert-butyl 4-hydroxyazepane-1-carboxylate | AG000E8J | 100g |
| 1174020-30-4 | O=C(N1C[C@H](N)[C@H](F)C1)OC(C)(C)C | (3S,4R)-tert-Butyl 3-amino-4-fluoropyrrolidine-1-carboxylate | AG000E8K | 25g |
| 1174020-29-1 | O=C(N1C[C@@H](N)[C@@H](O)C1)OC(C)(C)C | 1-Pyrrolidinecarboxylic acid, 3-amino-4-hydroxy-, 1,1-dimethylethyl ester, (3 | AG000E8L | 10g |
| 1174020-26-8 | CC(C)(C)OC(=O)N1CCC[C@@H](N)CC1 | (R)-tert-butyl 4-aMinoazepane-1-carboxylate | AG000E8M | 10g |
| 1174020-25-7 | O=C([C@H](CC[C@@]1([H])N2OCC3=CC=CC=C3)[N@@](C1)C2=O)O | (2S,5R)-6-(benzyloxy)-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboxylic acid | AG000E8N | 100g |
| 117402-88-7 | O=C(O)[C@@H](CC1=CC=C([N+]([O-])=O)C=C1)NC(OCC2=CC=CC=C2)=O | Z-D-Phe(4-NO2)-OH | AG000E8P | 950g |
| 1174064-63-1 | O=CC1=CC=C(N2N=CC(Br)=C2)C=C1 | 4-(4-Bromopyrazol-1-yl)benzaldehyde | AG000E8T | 5g |
| 1174047-06-3 | OC1=C(Cl)C(Cl)=NC=C1 | 2,3-Dichloropyridin-4-ol | AG000E8Y | 20g |
| 1174046-90-2 | O=C(C1=C(OCC)C=CN(C2=CC=C(F)C=C2)C1=O)O | 4-Ethoxy-1-(4-fluorophenyl)-2-oxo-1，2-dihydropyridine-3-carboxylic acid | AG000E8Z | 1g |
| 1174046-84-4 | O=C(C1=C(OCC)C=CNC1=O)OCC | Ethyl 4-ethoxy-2-oxo-1,2-dihydropyridine-3-carboxylate | AG000E90 | 25g |
| 1174046-72-0 | O=C(C1=CNC=C(C2=CC=C(F)C=C2)C1=O)NC3=CC=C(OC4=C(Cl)C(N)=NC=C4)C(F)= | BMS-794833 | AG000E92 | 0.1g |
| 1174044-78-0 | Cl.CC(OC1CCNCC1)(C)C | 4-(tert-Butoxy)cyclohexanamine hydrochloride | AG000E93 | 0.5g |
| 1174044-71-3 | COc1cccc2c(=O)[nH]nc(Cc3ccc(F)c(C(=O)O)c3)c12 | 2-Fluoro-5-((8-methoxy-4-oxo-3,4-dihydrophthalazin-1-yl)methyl)benzoic aci | AG000E94 | 1g |
| 1174038-67-5 | O=C(N1C=C(B2OC(C)(C)C(C)(C)O2)C3=C1C=NC=C3)OC(C)(C)C | tert-Butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-c]p | AG000E96 | 1g |
| 1174038-65-3 | CC1(C)C(C)(C)OB(C2=CN(S(=O)(C3=CC=CC=C3)=O)C4=C2C=CN=C4)O1 | 1-(Phenylsulfonyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrol | AG000E97 | 100g |
| 1174038-59-5 | O=C(N1C=C(I)C2=C1C=NC=C2)OC(C)(C)C | Tert-butyl 3-iodo-1H-pyrrolo[2,3-c]pyridine-1-carboxylate | AG000E99 | 100g |
| 1174032-81-5 | BrC1=CC2=C(N3C4=C2C=CC=C4)C(C5=C3C=CC=C5)=C1 | 2-broMoindolo[3,2,1-jk]carbazole | AG000E9A | 500g |
| 116435-35-9 | C(C(=O)O)(N)c1c(OC)c(OC)ccc1 | Benzeneacetic acid, α-amino-2,3-dimethoxy- | AG000CHY | 2g |
| 116434-95-8 | Fc1cccc2c1CCC(=O)N2 | 5-Fluoro-3,4-dihydro-2(1h)-quinolinone | AG000CI0 | 5g |
| 1164470-53-4 | ClC(C(NC(=S)NC1=CC=C(C=C1)Cl)NC(C=CC1=CC=CC=C1)=O)(Cl)Cl | (2E)-3-Phenyl-N-[2,2,2-trichloro-1-[[[(4-chlorophenyl)amino]thioxomethyl]a | AG000CI7 | 2g |
| 116450-56-7 | [O-]C(=O)c1ccccc1c1c2cc3CCCN4c3c(c2[o+]c2c1cc1CCCN3c1c2CCC3)CCC4 | 9-(2-Carboxyphenyl)-2,3,6,7,12,13,16,17-octahydro-1H,5H,11H,15H-Xantheno[ | AG000CJJ | 1g |
| 116475-68-4 | COC1=CC(Cl)=C(C=O)C(O)=C1 | 2-Chloro-6-hydroxy-4-methoxybenzaldehyde | AG000CKB | 25g |
| 116470-66-7 | [O-][N+](=O)C1=CN=C(C=C1)C(F)(F)F | 5-NITRO-2-(TRIFLUOROMETHYL)PYRIDINE | AG000CKO | 5g |
| 116470-54-3 | O=CC1=CC(C2=CC=C(C)C=C2)=CC=C1 | 3-(4-Methylphenyl)benzaldehyde | AG000CKP | 5g |
| 116465-48-6 | O=C(O)C1=CC(F)=C([N+]([O-])=O)C=C1F | 2,5-Difluoro-4-nitrobenzoic Acid | AG000CKX | 109.12g |
| 116476-98-3 | n1cnn(c1)CCn1ncnc1 | 1H-1,2,4-Triazole, 1,1′-(1,2-ethanediyl)bis- | AG000CLK | 10g |
| 116484-93-6 | CCOC(=O)C(CC#CC)C | Ethyl 2-methyl-4-hexynoate | AG000CM8 | 19.75g |
| 116496-76-5 | CC(NC1=CC=C([N+]([O-])=O)C=C1OCC)=O | 4-Acetamido-3-ethoxynitrobenzene | AG000CMH | 25g |
| 116496-01-6 | OC(c1cc2c(s1)cccc2)c1ccccc1 | Benzo[b]thiophen-2-yl(phenyl)methanol | AG000CMJ | 4.5g |
| 116569-09-6 | O=C1NC2=CC=C(C=C2C1=O)O | 5-Hydroxy-2,3-dihydro-1h-indole-2,3-dione | AG000CT7 | 15g |
| 1165892-60-3 | N#Cc1cccc2c1C(=O)C(=O)N2 | 2,3-Dioxoindoline-4-carbonitrile | AG000CT9 | 2g |
| 1165876-20-9 | O=C(N1CC2=C(C(C#N)=CC=C2)C1)OC(C)(C)C | tert-Butyl 4-cyanoisoindoline-2-carboxylate | AG000CTA | 2g |
| 1165936-00-4 | CC1(C)C(C)(C)OB(C2=CC=CC(OC)=C2F)O1 | 2-Fluoro-3-methoxyphenylboronic acid pinacol ester | AG000CU0 | 1000g |
| 1165935-85-2 | CC1(C(C)(C)OB(C2=C(C(F)(F)F)C=C(Cl)C=C2)O1)C | 2-(4-Chloro-2-(trifluoromethyl)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborol | AG000CU1 | 40g |
| 116598-69-7 | C1CCC2=NN=C(CC#N)N2CC1 | (6,7,8,9-Tetrahydro-5h-[1,2,4]triazolo[4,3-a]azepin-3-yl)-acetonitrile | AG000CUA | 0.4g |
| 116605-69-7 | CC1=C(C=NC2=C1N=CC=N2)Br | 7-BROMO-8-METHYLPYRIDO[2,3-B]PYRAZINE | AG000CV2 | 1.5g |
| 1166-52-5 | O=C(OCCCCCCCCCCCC)C1=CC(O)=C(O)C(O)=C1 | Lauryl gallate | AG000CV5 | 6500g |
| 116613-81-1 | O=C(N[C@H](CO)CC=C)OC(C)(C)C | tert-Butyl (S)-(1-hydroxypent-4-en-2-yl)carbamate | AG000CVG | 200g |
| 116611-64-4 | O=C(O)[C@H](CC1=CNC=N1)NC(OCC2C3=CC=CC=C3C4=CC=CC=C24)=O | Fmoc-His-OH | AG000CVI | 500g |
| 1166227-08-2 | O=C(N1[C@H](C(N)=O)CCC1)NC2=NC(C)=C(C3=CSC(C(C)(C)C)=N3)S2 | A66 | AG000CVY | 0.15g |
| 116632-14-5 | IC1=C(N)C=C2C=CC=CC2=C1 | 2-Amino-3-iodonaphthalene | AG000CW0 | 5g |
| 1171197-20-8 | O=C(N1C[C@H](C2=CC=C(N)C=C2)CCC1)OC(C)(C)C | (S)-tert-Butyl 3-(4-aminophenyl)piperidine-1-carboxylate | AG000DQY | 125g |
| 1171172-85-2 | ClCCN1CCC1.[H]Cl | 1-(2-chloroethyl)azetidine hydrochloride | AG000DR3 | 10g |
| 1171138-69-4 | C(c1cc(Cl)c(cc1)Cl)C1CCNCC1.Cl | 4-(3,4-Dichlorobenzyl)piperidine hydrochloride | AG000DR5 | 15g |
| 1171126-87-6 | O=C(C1=COC(C2=CC=C([N+]([O-])=O)C=C2)=N1)OC | Methyl 2-(4-nitrophenyl)oxazole-4-carboxylate | AG000DR7 | 10g |
| 1171125-92-0 | CO[C@H]1CN(CC[C@H]1N)C(=O)OC(C)(C)C | (3S,4R)-tert-Butyl 4-amino-3-methoxypiperidine-1-carboxylate | AG000DR8 | 25g |
| 1171124-68-7 | CO[C@H]1[C@@H](N)CCN(C(OC(C)(C)C)=O)C1 | cis-4-Amino-1-Boc-3-methoxy-piperidine | AG000DR9 | 38.75g |
| 1171124-65-4 | O=C(C1=NC=C(CC)N1)OCC | Ethyl 5-ethyl-1H-imidazole-2-carboxylate | AG000DRA | 2g |
| 1171334-07-8 | Cl.O=C1C2=C(CNCC2)N=CN1 | 5,6,7,8-Tetrahydropyrido[3,4-d]pyrimidin-4(3h)-one hcl | AG000DRM | 2g |
| 1171331-39-7 | O=C(NCC(F)(F)F)CN.[H]Cl | 2-Amino-N-(2,2,2-trifluoroethyl)acetamide hydrochloride | AG000DRN | 200g |
| 1171236-13-7 | NCc1nnc2n1CCC2.Cl.Cl.Cl | 6,7-Dihydropyrrolo[2,1-c][1,2,4]triazole-3-methylamine 3HCl | AG000DRQ | 2g |
| 1171493-85-8 | O=C1OC2(C3=C1C=CC(C(O)=O)=C3)C4=C(OC5=CC(O)=CC=C25)C=C(O)C=C4.O=C6 | 3′,6′-Dihydroxy-3-oxo-3H-spiro[isobenzofuran-1,9′-xanthene]-5(6)-carboxylic | AG000DSA | 3g |
| 1171417-47-2 | Cl.O=C1CCCC2(CCNCC2)N1 | 1,9-Diazaspiro[5.5]undecan-2-one HCl | AG000DSK | 10g |
| 1171381-90-0 | CCC1=CC=C(C=C1)C(=O)C=O.O | 4-Ethylphenylglyoxal hydrate | AG000DSL | 7g |
| 117142-26-4 | CC(C)(C)OC(=O)N[C@@H](CC1=CN=CC=C1)C(O)=O | Boc-L-3-pyridylalanine | AG000DST | 150g |
| 117140-77-9 | O=C(C(N1)=CC2=C1C=CC(C(O)=O)=C2)O | INDOLE-2,5-DICARBOXYLIC ACID | AG000DSU | 250g |
| 1168139-46-5 | CC[C@@H](C1=CC=C(C)C=C1)N.[H]Cl | (S)-1-P-TOLYLPROPAN-1-AMINE HCL | AG000D96 | 4g |
| 1168139-43-2 | N[C@@H](C1=CC=CC=C1F)C.[H]Cl | (R)-1-(2-Fluorophenyl)ethylamine hydrochloride | AG000D98 | 20g |
| 116821-47-7 | OC(=O)CCCNC(=O)OCC1C2=CC=CC=C2C2=C1C=CC=C2 | Fmoc-gamma-Abu-OH | AG000D9E | 1500g |
| 116850-28-3 | CC1=CC=CC(F)=C1Cl | 2-Chloro-3-fluorotoluene | AG000D9S | 125g |
| 116834-96-9 | CC2=C1C=CC=NC1=N[NH]2 | 3-Methyl-1H-pyrazolo[3,4-b]pyridine | AG000DA1 | 400g |
| 116834-64-1 | OC(C1=CC=C(NS(C2=C3C(C=CC=N3)=CC=C2)(=O)=O)C=C1)=O | 4-(Quinoline-8-sulfonamido)benzoic acid | AG000DA2 | 15g |
| 116827-40-8 | FC(OC1=C(CCl)C=CC=C1)(F)F | 1-(chloromethyl)-2-(trifluoromethoxy)benzene | AG000DAG | 75g |
| 116856-18-9 | O=COCCN1N=CC=C1NC=O | 5-Formamide-1-(2-formyloxyethl)pyrazole | AG000DB9 | 2000g |
| 116855-09-5 | CN1N=C(C(O)=O)C2=CC=CN=C12 | 1-Methyl-1H-pyrazolo[3,4-b]pyridine-3-carboxylic acid | AG000DBE | 25g |
| 116855-08-4 | [NH]2C1=NC=CC=C1C(=N2)C(=O)O | 1H-pyrazolo[3,4-b]pyridine-3-carboxylic acid | AG000DBF | 10g |
| 116855-03-9 | CN1N=C(Br)C2=CC=CN=C21 | 3-Bromo-1-Methyl-1H-Pyrazolo[3,4-B]Pyridine | AG000DBH | 30g |
| 116855-00-6 | O=[N+](C1=NNC2=NC=CC=C21)[O-] | 3-Nitro-1H-pyrazolo[3,4-B]pyridine | AG000DBI | 1g |
| 116854-10-5 | COC1=CC2=C(C(C(O)=O)CC2)C=C1 | 5-Methoxy-2,3-Dihydro-1H-Indene-1-Carboxylic Acid | AG000DBO | 20g |
| 1168721-41-2 | BrC1=C2C(NN=C2)=CC(C=O)=C1 | 4-bromo-1H-indazole-6-carbaldehyde | AG000DBV | 1g |
| 1173699-31-4 | O=C1C2=C(N=CC(OCCOC)=C2)C=CN1[C@@H](C3=NN=C4C(F)=CC(C5=CN(C)N=C5 | AMG-337 | AG000E62 | 0.1g |
| 117375-15-2 | O=C(C12CCCN1CCC2)OC | METHYL HEXAHYDRO-1H-PYRROLIZINE-7A-CARBOXYLATE | AG000E65 | 5g |
| 117362-51-3 | ClC1=CC=CC(=N1)N1CCCC1 | 2-Chloro-6-(pyrrolidin-1-yl)pyridine | AG000E6G | 23.7g |
| 117360-45-9 | OCC1=C(Br)CCCC1 | 1-Cyclohexene-1-methanol, 2-bromo- | AG000E6I | 25g |
| 117358-52-8 | CCc1cc(F)cc(c1)F | 1-Ethyl-3,5-difluorobenzene | AG000E6K | 175g |
| 117358-51-7 | Cc1cc(F)cc(c1)F | 1,3-Difluoro-5-methylbenzene | AG000E6L | 175g |
| 1173824-58-2 | OC1O[C@H](COC(=O)C2=CC=CC=C2)[C@@H](OC(=O)C2=CC=CC=C2)C1(F)F | ((2R,3R)-3-(Benzoyloxy)-4,4-difluoro-5-hydroxytetrahydrofuran-2-yl)methyl | AG000E6Q | 5g |
| 117384-46-0 | O[C@@H]([C@@H](C(=O)OC(C)(C)C)O)C(=O)OC(C)(C)C | (-)-Di-tert-butyl d-tartrate | AG000E6U | 0.75g |
| 117384-45-9 | O[C@H]([C@H](C(OC(C)(C)C)=O)O)C(OC(C)(C)C)=O | (+)-Di-tert-butyl l-tartrate | AG000E6V | 75g |
| 1173900-37-2 | C[C@H](NC1=C(C=CC=C1)C(O)=O)C1=CC(C)=CN2C(=O)C=C(N=C12)N1CCOCC1 | 2-((S)-1-(7-Methyl-2-morpholino-4-oxo-4h-pyrido[1,2-a]pyrimidin-9-yl)ethyl | AG000E7F | 0.025g |
| 1173900-33-8 | O=C(O)C1=CC=CC=C1N[C@@H](C2=CC(C)=CN(C2=NC(N3CCOCC3)=C4)C4=O)C | 2-{[(1R)-1-[7-methyl-2-(morpholin-4-yl)-4-oxopyrido[1,2-a]pyrimidin-9-yl]et | AG000E7G | 0.1g |
| 1173897-86-3 | N#CC1=NC(C)=C(Br)C=C1 | 5-Bromo-6-methylpicolinonitrile | AG000E7H | 1000g |
| 1173897-84-1 | FC(F)(F)C1=NN=C(C=C1)C | 3-Methyl-6-(trifluoromethyl)pyridazine | AG000E7I | 0.5g |
| 117391-57-8 | O=C(O)CC(N)C1=CC=C(Cl)C(Cl)=C1 | 3-Amino-3-(3,4-dichloro-phenyl)-propionic acid | AG000E7P | 3g |
| 117391-56-7 | O=C(O)CC(N)C1=CC=CC(Cl)=C1Cl | 3-Amino-3-(2,3-dichlorophenyl)propanoic acid | AG000E7Q | 2g |
| 117391-53-4 | O=C(O)CC(N)C1=CC=C(C(C)C)C=C1 | 3-AMINO-3-(4-ISOPROPYLPHENYL)PROPANOIC ACID | AG000E7T | 50g |
| 117391-52-3 | C(C(N)C1=CC=C(C=C1)CC)C(O)=O | 3-AMINO-3-(4-ETHYLPHENYL)PROPANOIC ACID | AG000E7U | 10g |
| 117391-51-2 | O=C(O)CC(N)C1=CC=CC(F)=C1 | 3-Amino-3-(3-Fluorophenyl)Propanoic Acid | AG000E7V | 50g |
| 117391-50-1 | O=C(O)CC(N)C1=CC=CC(Br)=C1 | 3-Amino-3-(3-bromophenyl)propanoic acid | AG000E7W | 125g |
| 117391-49-8 | O=C(O)CC(N)C1=CC=CC=C1F | 3-Amino-3-(2-fluorophenyl)propanoic acid | AG000E7X | 50g |
| 117391-48-7 | [Br]C1(=C(C=CC=C1)C(N)CC(=O)O) | 3-Amino-3-(2-bromophenyl)propanoic acid | AG000E7Y | 25g |
| 117390-39-3 | O=C(C1=CN=C(C=CS2)C2=C1)O | Thieno[3,2-b]pyridine-6-carboxylic acid | AG000E80 | 15g |
| 117390-38-2 | O=C(C1=CN=C2C(C=CS2)=C1)O | Thieno[2,3-b]pyridine-5-carboxylic acid | AG000E81 | 2g |
| 1174028-20-6 | O=Cc1cnc(c(c1)Br)C | 5-Bromo-6-methyl-3-pyridinecarboxaldehyde | AG000E83 | 4g |
| 1174028-18-2 | COC(=O)c1cnc(C)c(C)c1 | Methyl 5,6-dimethylnicotinate | AG000E84 | 2g |
| 1174028-17-1 | CC1=C(C)N=CC(C=O)=C1 | 5,6-Dimethylnicotinaldehyde | AG000E85 | 5g |
| 1174020-64-4 | [H][C@]12CN([C@@H](CC1)C(=O)NC1CCN(CC1)C(=O)OC(C)(C)C)C(=O)N2O | tert-Butyl 4-((1R，2S，5R)-6-hydroxy-7-oxo-1，6-diazabicyclo[3.2.1]octane- | AG000E86 | 0.5g |
| 1174020-63-3 | CC(C)(C)OC(=O)N1CCC(CC1)NC(=O)[C@@H]1CC[C@@H]2CN1C(=O)N2OCc1cccc | 1-Piperidinecarboxylic acid, 4-[[[(1R,2S,5R)-7-oxo-6-(phenylmethoxy)-1,6-dia | AG000E87 | 0.09g |
| 1174020-52-0 | CC(C)(C)OC(=O)N1CCCOC(CO)C1 | 4-Boc-2-(hydroxymethyl)homomorpholine | AG000E88 | 35g |
| 1174020-51-9 | O=C(N1C[C@H](F)[C@@H](O)C1)OC(C)(C)C | (3S,4S)-tert-Butyl 3-fluoro-4-hydroxypyrrolidine-1-carboxylate | AG000E89 | 20g |
| 1174020-50-8 | O=C(N1C[C@@H](F)[C@H](O)C1)OC(C)(C)C | tert-butyl (3R,4R)-3-fluoro-4-hydroxypyrrolidine-1-carboxylate | AG000E8A | 100g |
| 1174020-49-5 | O[C@@H]1[C@H](F)CN(C(OC(C)(C)C)=O)C1 | (3R,4S)-1-BOC-3-FLUORO-4-HYDROXYPYRROLIDINE | AG000E8B | 25g |
| 1174020-48-4 | CC(C)(C)OC(=O)N1C[C@@H](O)[C@@H](F)C1 | (3S,4R)-1-Boc-3-fluoro-4-hydroxypyrrolidine | AG000E8C | 4g |
| 1174020-46-2 | O=C(N1C[C@H](O)[C@H](F)CC1)OC(C)(C)C | Cis-tert-butyl 4-fluoro-3-hydroxypiperidine-1-carboxylate | AG000E8D | 2g |
| 1174020-44-0 | O=C(N1C[C@H](F)[C@@H](O)CC1)OC(C)(C)C | tert-butyl (3S,4S)-3-fluoro-4-hydroxypiperidine-1-carboxylate | AG000E8E | 100g |
| 1174020-43-9 | O=C(N1C[C@@H](F)[C@H](O)CC1)OC(C)(C)C | tert-Butyl-(3R,4R)-3-fluoro-4-hydroxy-piperidine-1-carboxylate | AG000E8F | 25g |
| 1174020-42-8 | O=C(N1C[C@@H](F)[C@@H](O)CC1)OC(C)(C)C | tert-Butyl (3r,4s)-3-fluoro-4-hydroxypiperidine-1-carboxylate | AG000E8G | 200g |
| 1171892-42-4 | CC1(C)C(C)(C)OB(C2=CN=CC(OC(C)C)=C2)O1 | 5-Isopropoxypyridin-3-ylboronic acid pinacol ester | AG000DV2 | 8g |
| 1171892-40-2 | CC1(C)C(C)(C)OB(C2=CN=CC(OCC)=C2)O1 | 3-Ethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine | AG000DV3 | 2g |
| 1171891-42-1 | CC1=CC(=CN=C1)B1OC(C)(C)C(C)(C)O1 | 5-Methylpyridine-3-boronic acid pinacol ester | AG000DV4 | 100g |
| 1171891-40-9 | CSC1=CC(=CN=C1)B1OC(C)(C)C(C)(C)O1 | 3-(Methylthio)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine | AG000DV5 | 5g |
| 1171891-35-2 | CC1(C)OB(OC1(C)C)C1=CN=CC(O)=C1 | 5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-ol | AG000DV6 | 30g |
| 1171891-31-8 | CC1(C)C(C)(C)OB(C2=C(C)C=CN=C2)O1 | 4-Methylpyridine-3-boronic acid pinacol ester | AG000DV7 | 10g |
| 1171891-07-8 | CC1(C)C(C)(C)OB(C2=CN=CC(C3=CC=CC=C3)=C2)O1 | 5-Phenylpyridin-3-ylboronic acid pinacol ester | AG000DV9 | 25g |
| 117186-03-5 | OC(=O)c1cc(cc(c1)C(F)(F)F)C(=O)O | 5-(Trifluoromethyl)benzene-1,3-dicarboxylic acid | AG000DVN | 30g |
| 117186-02-4 | CC1=CC(=CC(=C1)C(O)=O)C(F)(F)F | 3-Methyl-5-(Trifluoromethyl)Benzoic Acid | AG000DVO | 75g |
| 1171926-64-9 | OCC1=CC2=CC=CC(Br)=C2S1 | (7-Bromo-1-benzothiophen-2-yl)methanol | AG000DVS | 8g |
| 1171920-70-9 | OC1=CN=C(N(C)C=N2)C2=C1 | 3-Methyl-3H-imidazo[4,5-b]pyridin-6-ol | AG000DVU | 15g |
| 1171920-17-4 | C1=C2C(=CNC2=NC=C1F)C=O | 5-Fluoro-1h-pyrrolo[2,3-b]pyridine-3-carbaldehyde | AG000DVW | 10g |
| 1171920-15-2 | O=C(C1=CNC2=NC=C(C(F)(F)F)C=C21)O | 5-(Trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid | AG000DVX | 1g |
| 1171919-86-0 | COc1cc(CNC(=O)OC(C)(C)C)cnc1OC | tert-Butyl (5,6-dimethoxypyridin-3-yl)-methylcarbamate | AG000DW0 | 1g |
| 1171919-75-7 | N#CC1=C(Cl)N=CC=C1I | 2-Chloro-4-Iodonicotinonitrile | AG000DW1 | 350g |
| 1170024-19-7 | COC(=O)C1=CN2C=CC(Br)=CC2=N1 | 7-Bromoimidazo[1,2-a]pyridine-2-carboxylic acid methyl ester | AG000DIT | 10g |
| 1170019-97-2 | CN(CC1CNC1)C(=O)OC(C)(C)C.Cl | 3-(N-Boc-methylaminomethyl)azetidine HCl | AG000DIV | 5g |
| 117007-51-9 | ClC1=NNC2=NC=CC=C21 | 3-Chloro-1H-pyrazolo[3,4-b]pyridine | AG000DIY | 15g |
| 117-99-7 | C(=O)(c1c(O)cccc1)c1ccccc1 | (2-Hydroxyphenyl)(phenyl)methanone | AG000DJ5 | 200g |
| 117-96-4 | O=C(O)C1=C(I)C(NC(C)=O)=C(I)C(NC(C)=O)=C1I | 3,5-Diacetamido-2,4,6-triiodobenzoic acid | AG000DJ7 | 700g |
| 117-92-0 | CC[N+]1=C2C=CC=CC2=CC=C1/C=C/C3=CC=C(N(C)C)C=C3.[I-] | Quinaldine Red | AG000DJ8 | 125g |
| 117-89-5 | CN1CCN(CCCN2C3=C(C=CC(C(F)(F)F)=C3)SC3=C2C=CC=C3)CC1 | 10-[3-(4-methylpiperazin-1-yl)propyl]-2-(trifluoromethyl)-10H-phenothiazin | AG000DJ9 | 0.3g |
| 1170108-38-9 | O=C(OC(C)(C)C)NCC1CNC1.[H]Cl | tert-Butyl (azetidin-3-ylmethyl);carbamate hydrochloride | AG000DJI | 100g |
| 117014-32-1 | O=C(O)[C@@H](NC(OC(C)(C)C)=O)CC(OCC1C2=C(C3=C1C=CC=C3)C=CC=C2)=O | Boc-Asp(OFm)-OH | AG000DJM | 125g |
| 117011-70-8 | CC(C)(OC1=CC=C(N)C=C1)C(O)=O | 2-(4-Aminophenoxy)-2-methylpropionic acid | AG000DJT | 20g |
| 117009-97-9 | O=C(N1CCNCCC1)OCC2=CC=CC=C2 | Benzyl 1,4-diazepane-1-carboxylate | AG000DJV | 50g |
| 117007-77-9 | O=CC1=C(Cl)N(C)N=C1 | 5-Chloro-1-methyl-1H-pyrazole-4-carbaldehyde | AG000DJZ | 8g |
| 117007-52-0 | IC1=NNC2=NC=CC=C21 | 3-Iodo-1H-pyrazolo[3,4-b]pyridine | AG000DK1 | 200g |
| 117018-99-2 | BrCCN1CCCC1=O | 1-(2-Bromoethyl)pyrrolidin-2-one | AG000DKN | 125g |
| 116862-22-7 | O=C1COC2=CC([N+]([O-])=O)=C(Cl)C=C2N1 | 6-Chloro-7-nitro-2H-1,4-benzoxazin-3(4H)-one | AG000DCB | 20g |
| 116861-31-5 | CC(C)(C)OC(=O)NCCCCl | tert-Butyl (3-chloropropyl)carbamate | AG000DCG | 500g |
| 116861-26-8 | [H][C@](CO)(NC(=O)OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)C(O)=O | Fmoc-D-Ser-OH | AG000DCH | 200g |
| 116922-60-2 | BrC1=C(C=CN=C1)F | 3-Bromo-4-fluoropyridine | AG000DDG | 200g |
| 116922-22-6 | N(=O)(=O)c1cc(ccc1)N1CCOCC1 | 4-(3-Nitrophenyl)morpholine | AG000DDH | 200g |
| 116920-04-8 | OC(=O)CCCC(=O)ON1C(=O)CCC1=O | 5-((2，5-Dioxopyrrolidin-1-yl)oxy)-5-oxopentanoic acid | AG000DDL | 4g |
| 1169402-51-0 | O=C(N)C1=CN=CC(B2OC(C)(C)C(C)(C)O2)=C1 | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)nicotinamide | AG000DDY | 15g |
| 116941-52-7 | BrC1=CC=C(C2=CC(C3=CC=CC=C3)=CC(C4=CC=CC=C4)=C2)C=C1 | 4-Bromo-5′-phenyl-1,1′:3′,1”-terphenyl | AG000DE9 | 20g |
| 116934-87-3 | O=C(O)C1=CC=C(C(OC)=O)C(C)=C1 | 4-(Methoxycarbonyl)-3-methylbenzoic acid | AG000DEI | 10g |
| 1169576-97-9 | Cl.N1=CC(=CC=C1)[C@@H](C)N | (R)-1-(Pyridin-3-Yl)Ethanamine Hydrochloride | AG000DEN | 2g |
| 1169576-95-7 | N[C@@H](C1=CC=C(F)C=C1)CC.[H]Cl | (R)-1-(4-Fluorophenyl)propan-1-amine hydrochloride | AG000DEO | 0.25g |
| 1169563-99-8 | O=C(N1CCC(C2=NNC(N)=C2)CC1)OC(C)(C)C | tert-butyl 4-(3-amino-1H-pyrazol-5-yl)piperidine-1-carboxylate | AG000DEP | 10g |
| 117309-46-3 | COC1=CC=C(C=C1)S(=O)(=O)NC(C(O)=O)C1=CC=CC=C1 | 2-{[(4-Methoxyphenyl)sulfonyl]amino}-2-phenyl acetic acid | AG000E3T | 0.25g |
| 1173206-71-7 | Cl.CC(C)(C)OC(=O)N1CC(CN)C1 | tert-Butyl 3-(aminomethyl)azetidine-1-carboxylate hydrochloride | AG000E3X | 0.5g |
| 1173168-18-7 | CCC(COC(C)=O)OC | 2-Methoxybutyl acetate | AG000E3Z | 25g |
| 117324-05-7 | CCOC(C1=C(N)C=C(F)C=C1)=O | Ethyl 2-amino-4-fluorobenzoate | AG000E42 | 35g |
| 117322-30-2 | O=C(C1(NC(OCC2C3=C(C4=C2C=CC=C4)C=CC=C3)=O)CCCC1)O | Fmoc-Cycloleucine | AG000E44 | 800g |
| 117311-84-9 | O=C(CN(C)C1)OB(C2CCCC2)OC1=O | 2-Cyclopentyl-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione | AG000E4I | 5g |
| 1173246-76-8 | CN1C(=CC(=N1)C(=O)O)Cl | 5-Chloro-1-methyl-1H-pyrazole-3-carboxylic acid | AG000E4S | 1g |
| 117330-40-2 | O=C(C1=CC(C2=NC(C)=CC(C(OC)=O)=C2)=NC(C)=C1)OC | Dimethyl 6,6′-dimethyl-[2,2′-bipyridine]-4,4′-dicarboxylate | AG000E54 | 0.5g |
| 117324-58-0 | COC(C1=C(C=CC(=C1)C(F)(F)F)N)=O | Methyl 2-amino-5-(trifluoromethyl)benzoate | AG000E58 | 200g |
| 117354-64-0 | C1(C(CN)(O)CS(O)(=O)=O)=CC=C(Cl)C=C1 | 2-Hydroxysaclofen | AG000E5E | 0.1g |
| 117344-32-8 | OCCOC1=CC=C(C2(C3=CC=C(OCCO)C=C3)C4=C(C5=C2C=CC=C5)C=CC=C4)C=C1 | Bisphenoxyethanolfluorene | AG000E5N | 3000g |
| 117342-20-8 | O=[N+](C1=CC(C(OC)=O)=CC(B(O)O)=C1)[O-] | 3-Methoxycarbonyl-5-nitrophenylboronic acid | AG000E5Q | 61g |
| 117338-43-9 | O=CC=CC1=C(F)C=CC=C1F | 2,6-Difluorocinnamic aldehyde | AG000E5V | 15g |
| 1173721-45-3 | CN1C(=O)C(=O)C2=C1N=CC(Br)=C2 | 5-Bromo-1-methyl-1H-pyrrolo[2,3-b]pyridine-2,3-dione | AG000E60 | 9g |
| 1173707-01-1 | CC(NC1=CC(F)=CC=C1I)=O | N-(5-Fluoro-2-iodophenyl)acetamide | AG000E61 | 10g |
| 1172623-99-2 | O=C(OC(C)(C)C)N[C@@H]1[C@@H](C2=CC(F)=CC=C2F)OCC(O)C1 | tert-Butyl ((2R,3S)-2-(2,5-difluorophenyl)-5-hydroxytetrahydro-2H-pyran-3-yl | AG000DZV | 3g |
| 1172623-98-1 | CC(C)(C)OC(=O)N[C@H]1CC=CO[C@@H]1C1=CC(F)=CC=C1F | Tert-butyl [(2R,3S)-2-(2,5-difluorophenyl)-3,4-dihydro-2H-pyran-3-yl]carbam | AG000DZW | 10g |
| 1172623-96-9 | CC(C)(C)OC(=O)NC(CC#C)C(=O)C1=CC(F)=CC=C1F | tert-butyl (1-(2,5-difluorophenyl)-1-oxopent-4-yn-2-yl)carbamate | AG000DZX | 50g |
| 1172623-95-8 | CON(C)C(=O)C(CC#C)NC(=O)OC(C)(C)C | tert-butyl (1-(methoxy(methyl)amino)-1-oxopent-4-yn-2-yl)carbamate | AG000DZY | 2g |
| 1172617-14-9 | COc1ccc(OC)c(c1)-c1nnc2SCC(=Nn12)c1ccc(OC)c(OCC2CC2)c1 | 6-[3-(cyclopropylmethoxy)-4-methoxyphenyl]-3-(2,5-dimethoxyphenyl)-7H-[ | AG000DZZ | 0.5g |
| 1172579-62-2 | CC(C)(C)[C@H](N(C(OCC1C2=C(C3=C1C=CC=C3)C=CC=C2)=O)C)C(O)=O | (S)-2-((((9H-FLUOREN-9-YL)METHOXY)CARBONYL)(METHYL)AMINO)-3,3-DIME | AG000E00 | 7.02g |
| 1172534-83-6 | CC1=CC2=NC=NN2C=C1Br | 6-Bromo-7-methyl-[1,2,4]triazolo[1,5-a]pyridine | AG000E04 | 0.2g |
| 117259-23-1 | NC1(C(O)=O)CCC(C2=CC=CC=C2)CC1 | 1-Amino-4-phenylcyclohexanecarboxylic acid | AG000E0A | 1g |
| 117252-05-8 | COC(=O)C1(CC1)c1ccc(cc1)Cl | Methyl 1-(4-chlorophenyl)cyclopropanecarboxylate | AG000E0I | 5g |
| 1172813-04-5 | O=C(C1=COC2=C1C(N)CCC2)OC.[H]Cl | Methyl 4-amino-4,5,6,7-tetrahydrobenzofuran-3-carboxylate hydrochloride | AG000E0J | 10g |
| 1172802-41-3 | Cl.OC([C@]12NCC[C@H](C1)C2)=O | 2-azabicyclo[3.1.1]heptane-1-carboxylic acid hydrochloride | AG000E0K | 1g |
| 1172717-60-0 | Cl.CC1(C)OC2(CCNCC2)c2ccccc12 | 3,3-Dimethyl-3H-spiro[benzo[c]furan-1,4′-piperidine] HCl | AG000E0T | 0.5g |
| 1172897-29-8 | C1(CC2=CC=CC=C2)NCCOC1.[H]Cl | (S)-3-Benzylmorpholine hydrochloride | AG000E17 | 2g |
| 1172889-96-1 | O=C(OC)C1=CC=C(C(N)=N)C=C1.CC(O)=O | 4-Methoxycarbonyl-benzamidine hoac | AG000E1A | 50g |
| 1146616-03-6 | CC1=NN(C)C=C1B(O)O | 1,3-Dimethylpyrazole-4-boronic acid | AG000EZ9 | 50g |
| 1146699-67-3 | O=C(N)[C@H](NS(=O)(C1=CC=C(Cl)C=C1)=O)CCC(F)(F)F | (R)-2-(4-chlorophenylsulfonamido)-5,5,5-trifluoropentanamide | AG000EZV | 1.25g |
| 1146699-66-2 | O=C(N)[C@H](N(CC1=CC=C(C2=NOC=N2)C=C1F)S(=O)(C3=CC=C(Cl)C=C3)=O)CCC | BMS-708163 | AG000EZW | 1.25g |
| 1146699-63-9 | FC1(=C(C=CC(=C1)C2(=NOC=N2))C) | 3-(3-Fluoro-4-methylphenyl)-1,2,4-oxadiazole | AG000EZZ | 10g |
| 1146699-58-2 | Cl.N[C@H](CCC(F)(F)F)C(N)=O | (R)-2-Amino-5,5,5-trifluoropentanamide hydrochloride | AG000F01 | 2g |
| 114672-02-5 | OC(C1(CCC1)CC1=CC=CC=C1)=O | 1-Benzylcyclobutanecarboxylic acid | AG000F05 | 1g |
| 114670-75-6 | CC(C)(C)CC(OCCl)=O | Chloromethyl 3,3-Dimethylbutanoate | AG000F09 | 25g |
| 6318-41-8 | O1COC2=C1C=CC(=C2)C=C2C(NC(S2)=O)=O | 5-(Benzo[d][1,3]dioxol-5-ylmethylene)thiazolidine-2,4-dione | AG000F0F | 0.5g |
| 114684-69-4 | O=C(OC)C(NC(OCC1=CC=CC=C1)=O)P(OCC)(OCC)=O | METHYL CBZ-AMINO(DIETHOXYPHOSPHORYL)ACETATE | AG000F0L | 200g |
| 114676-97-0 | CC(C)(C)OC(=O)N1C[C@H](O)C[C@@H]1CF | (2R,4R)-tert-Butyl 2-(fluoromethyl)-4-hydroxypyrrolidine-1-carboxylate | AG000F0S | 5g |
| 114676-93-6 | C[C@H]1N(C(OC(C)(C)C)=O)C[C@H](O)C1 | (2R,4R)-N-Boc-4-hydroxy-2-methylpyrrolidine | AG000F0T | 25g |
| 114676-79-8 | O=C(N1[C@@]2([H])CO[C@@](C2)([H])C1)OC(C)(C)C | tert-Butyl 2-oxa-5-azabicyclo[2.2.1]heptane-5-carboxylate | AG000F0X | 47g |
| 114676-69-6 | O=C(N1[C@@H](C(OC)=O)C[C@@H](O)C1)OC(C)(C)C | Methyl cis-1-Boc-4-hydroxy-D-prolinate | AG000F0Y | 2000g |
| 114676-61-8 | O=C(N1[C@@H](C)C[C@@H](O)C1)OC(C)(C)C | (2S,4R)-tert-Butyl 4-hydroxy-2-methylpyrrolidine-1-carboxylate | AG000F0Z | 25g |
| 114676-59-4 | O=C([C@@H]1NC[C@H](O)C1)OC.[H]Cl | (2R,4R)-Methyl 4-hydroxypyrrolidine-2-carboxylate HCl | AG000F10 | 750g |
| 114686-85-0 | ClC1=C(Cl)C(CCO)=CC=C1 | 2-(2,3-Dichlorophenyl)ethanol | AG000F1O | 75g |
| 114686-67-8 | ICCc1cccc(c1)C | Benzene, 1-(2-iodoethyl)-3-methyl- | AG000F1Q | 10g |
| 1146970-26-4 | ClC1=CN=C(NCC2)C2=C1 | 5-Chloro-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine | AG000F1T | 10g |
| 1146963-51-0 | O=C(N(C1=CC=C(C)C=C1C)/N=C/C2=CC=CC(OC)=C2)C(F)(F)F | N-(2,4-Dimethylphenyl)-2,2,2-trifluoro-N’-[(1E)-(3-methoxyphenyl)methylid | AG000F1U | 30g |
| 1172862-88-2 | NCC1=CNN=C1.[H]Cl.[H]Cl | 1H-Pyrazol-4-ylmethylamine dihydrochloride | AG000E1E | 25g |
| 1172851-61-4 | COC1=CC2=NC=NC(Cl)=C2C=C1I | 4-Chloro-6-Iodo-7-Methoxyquinazoline | AG000E1F | 10g |
| 1172846-34-2 | OC1CC(O2)CCC2C1 | 8-oxabicyclo[3.2.1]octan-3-ol | AG000E1H | 5g |
| 117284-59-0 | C1(F)(F)C(C1)CCO | 2-(2,2-Difluorocyclopropyl)ethanol | AG000E1T | 0.5g |
| 1172965-47-7 | O=C(C1=CC=CC(OC)=C1)C=O.[H]O[H] | 2-(3-Methoxyphenyl)-2-Oxoacetaldehyde Hydrate | AG000E1W | 50g |
| 1172938-55-4 | NC(=O)C1=NC=CC(F)=C1 | 4-Fluoropicolinamide | AG000E21 | 5g |
| 1172902-07-6 | O=C(C1(CN)CCC1)OC.[H]Cl | Methyl 1-(aminomethyl)cyclobutanecarboxylate hydrochloride | AG000E26 | 30g |
| 117294-21-0 | O=C1CC2=C(C=CC=C2Br)CC1 | 8-BROMO-2-TETRALONE | AG000E2A | 6.75g |
| 117292-80-5 | O=C(OCCC1=CC=CC=C1)/C=C/C2=CC=C(OC)C(O)=C2 | (E)-phenethyl 3-(3-hydroxy-4-methoxyphenyl)acrylate | AG000E2B | 2.25g |
| 1173003-61-6 | O=C(C1=C2OCCCN2N=C1)O | 6,7-Dihydro-5H-pyrazolo[5,1-b][1,3]oxazine-3-carboxylic acid | AG000E2T | 3g |
| 1172986-17-2 | BrC1=CC(C(N)CCS2(=O)=O)=C2C=C1.[H]Cl | 6-Bromo-3,4-dihydro-2h-s,s-di-oxo-thiochromen-4-amine, HCl | AG000E2V | 1.5g |
| 3326-32-7 | O=C1OC2(C3=C(OC4=C2C=CC(O)=C4)C=C(O)C=C3)C5=C1C=C(N=C=S)C=C5 | Fluorescein isothiocyanate isomer I, tech grade | AG000E31 | 15g |
| 1173-26-8 | CC(=O)OCC(=O)[C@H]1CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3[C | 2-((8S,9S,10R,11S,13S,14S,17S)-11-Hydroxy-10,13-dimethyl-3-oxo-2,3,6,7,8,9,1 | AG000E36 | 3g |
| 1173081-96-3 | Cl.CC1=CC(C)=C(CN)C(=O)N1 | 3-(Aminomethyl)-4,6-dimethylpyridin-2(1H)-one Hydrochloride | AG000E38 | 100g |
| 1173022-16-6 | O=C1NC2=CC=CC=C2C3(CCN(CCC4=CC=C(C(F)(F)F)C=C4)CC3)O1.Cl | RS 102895 (hydrochloride) | AG000E3K | 0.03g |
| 1171919-03-1 | IC1=C(Cl)N=CC2=C1NC=C2 | 6-Chloro-7-iodo-1h-pyrrolo[3,2-c]pyridine | AG000DW4 | 2g |
| 1171919-00-8 | NC1=C(I)C(Cl)=NC=C1I | 2-Chloro-3,5-diiodo-4-pyridinamine | AG000DW6 | 64g |
| 1171918-85-6 | COC(C1=CC(Cl)=C(F)N=C1)=O | Methyl 5-chloro-6-fluoronicotinate | AG000DW7 | 3g |
| 1171918-06-1 | COc1ncc(F)cc1F | 3,5-Difluoro-2-methoxypyridine | AG000DW8 | 1g |
| 1171897-39-4 | CC(C)(C)OC(=O)NC1=CC(=CN=C1)B1OC(C)(C)C(C)(C)O1 | 3-Boc-aminopyridine-5-boronic acid pinacol ester | AG000DWB | 15g |
| 1171981-10-4 | NCC1=CSC(C(C)C)=N1.[H]Cl.[H]Cl | 4-(Aminomethyl)-2-isopropylthiazole 2hcl | AG000DWI | 75g |
| 1171938-74-1 | [O-][N+](=O)C1=CC=C(F)C(=C1)C1=NNN=N1 | 5-(2-Fluoro-5-nitrophenyl)-2H-tetrazole | AG000DWN | 10g |
| 117196-73-3 | P(=O)(CN)(OCC)OCC.C(=O)(O)C(=O)O | Diethyl (aminomethyl)phosphonate oxalate | AG000DWS | 1g |
| 117194-77-1 | N[C@H]1[C@H](O)[C@@H]2O[C@H](CO)[C@H]1O[C@H]3O[C@H](CO)[C@@H | 3A-Amino-3A-deoxy-(2AS,3AS)-β-cyclodextrin | AG000DWV | 0.2g |
| 1172-76-5 | C[Si](C1=CC=CC=C1)(C2=CC=CC=C2)[Si](C3=CC=CC=C3)(C)C4=CC=CC=C4 | 1,2-Dimethyl-1,1,2,2-tetraphenyldisilane | AG000DWY | 15g |
| 1172097-47-0 | Cl.NC12CC(C1)(C2)C(O)=O | 3-AMINOBICYCLO[1.1.1]PENTANE-1-CARBOXYLIC ACID HYDROCHLORIDE | AG000DX3 | 125g |
| 1172087-81-8 | Brc1c2ccccc2c(-c2c3ccccc3c(-c3ccc4ccccc4c3)c3ccccc23)c2ccccc12 | 10-bromo-10′-(naphthalen-2-yl)-9,9′-bianthracene | AG000DX5 | 4g |
| 1172085-67-4 | BrC1=CC=CC2=NN=CN12 | 5-bromo-[1,2,4]triazolo[4,3-a]pyridine | AG000DX7 | 10g |
| 1172072-62-6 | NC1C(C(F)(F)F)C1.[H]Cl | 2-(Trifluoromethyl)cyclopropanamine hydrochloride | AG000DX9 | 122g |
| 1174304-97-2 | COCCCNS(=O)(=O)C1=C(C=C(Cl)S1)C(=O)CBr | 3-(2-Bromoacetyl)-5-chloro-N-(3-methoxypropyl)thiophene-2-sulfonamide | AG000EB3 | 0.75g |
| 117433-12-2 | C(CCCCCC)C1=CC=C(C=C1)C1=CC=C(C=C1)C1=NC=C(C=N1)CCCCCCCC | 2-(4′-Heptyl-[1,1′-biphenyl]-4-yl)-5-octylpyrimidine | AG000EB9 | 2g |
| 117423-75-3 | O=C(O)C1=CC=CC(OC2=CC=C(OC)C=C2)=C1 | 3-(4-Methoxyphenoxy)benzoic acid | AG000EBJ | 3g |
| 1174626-28-8 | NC1=NC(OCC2=CC=CC=C2)=CC=C1 | 2-Amino-6-benzyloxypyridine | AG000EBK | 1.5g |
| 117449-75-9 | O=C(O)C1=C(O)N=C(C)C(Cl)=C1 | 5-Chloro-2-hydroxy-6-methylnicotinic acid | AG000EC0 | 125g |
| 117445-22-4 | O=C(O)C1=CC=CC(CNC(OC(C)(C)C)=O)=C1 | 3-(((tert-Butoxycarbonyl)amino)methyl)benzoic acid | AG000EC3 | 50g |
| 1174764-48-7 | CCOC(=O)C1=CC(O)=C2C=C(OC)C(OC)=C(C(C)C)C2=C1 | Ethyl 4-hydroxy-8-isopropyl-6,7-dimethoxy-2-naphthoate | AG000ECA | 0.5g |
| 117482-84-5 | C1=C(C#N)C=CC(=C1Cl)F | 3-Chloro-4-fluorobenzonitrile | AG000ECG | 100g |
| 117479-87-5 | C1=C(C(OC)=O)[C@@]2(O)[C@H](O)[C@@H]3O[C@]3(C)[C@@]2([H])[C@H](O | Sesamoside | AG000ECM | 0.5g |
| 1175015-76-5 | CC1=CN=C2C(NC=C2)=C1 | 6-METHYL-1H-PYRROLO[3,2-B]PYRIDINE | AG000ECX | 15g |
| 1174913-80-4 | NC[C@@H]1CN(CCO1)C(=O)OC(C)(C)C | (R)-2-Aminomethyl-4-Boc-morpholine | AG000ED1 | 75g |
| 117500-61-5 | O=C(Cl)C1=CC=CC(N(C)C)=C1.[H]Cl | 3-Dimethylaminobenzoyl chloride | AG000ED5 | 2g |
| 117500-15-9 | O=C(OCC)C(CCC#C)C(OCC)=O | Diethyl 2-(but-3-yn-1-yl)malonate | AG000ED7 | 4g |
| 117499-16-8 | CC(C)(C)OC(=O)NCCNCCNC(=O)OC(C)(C)C | Di-tert-butyl (azanediylbis(ethane-2,1-diyl))dicarbamate | AG000ED9 | 124g |
| 114870-03-0 | [O-]S(N[C@H]([C@@H](OS([O-])(=O)=O)[C@@H]1O[C@@H]2O[C@@H]([C@H | Fondaparinux Sodium | AG000FCU | 0.5g |
| 114861-22-2 | O[C@@H]1[C@H](CO)O[C@@]2([H])OC(C)(C)O[C@]21[H] | (3aS,5S,6R,6aS)-5-(Hydroxymethyl)-2,2-dimethyltetrahydrofuro[2,3-d][1,3]di | AG000FDC | 700g |
| 114861-14-2 | [Si](OC[C@@H]1[C@H](O)[C@@]2([C@](O1)(OC(C)(C)O2)[H])[H])(C(C)(C)C)(C | (3aR,5R,6S,6aR)-5-(((tert-Butyldiphenylsilyl)oxy)methyl)-2,2-dimethyltetrahy | AG000FDD | 2g |
| 114859-23-3 | CC(=C)C(=O)OCC1=C(F)C(F)=C(F)C(F)=C1F | Pentafluorobenzylmethacrylate | AG000FDF | 250g |
| 114858-56-9 | NC2=CC=C1C=CC=CC1=C2C4=C3C=CC=CC3=CC=C4 | [1,1′-Binaphthalen]-2-amine | AG000FDG | 75g |
| 114874-99-6 | Nc1cc(O)c(O)cc1C(O)=O | 2-Amino-4,5-dihydroxybenzoic Acid | AG000FDK | 20g |
| 114873-52-8 | CCOC(=O)CN1CCNCCN(CC(=O)OCC)CCN(CC(=O)OCC)CC1 | Triethyl 2,2′,2”-(1,4,7,10-tetraazacyclododecane-1,4,7-triyl)triacetate | AG000FDM | 5g |
| 114873-37-9 | OC(=O)CN1CCN(CCNCCN(CC1)CC(=O)O)CC(=O)O | 1,4,7,10-Tetraazacyclododecane-1,4,7-Triacetic Acid | AG000FDN | 20g |
| 114873-14-2 | O=C(O)[C@H](NC(OC(C)(C)C)=O)CC1=CC=CC(C)=C1 | Boc-D-3-Methylphenylalanine | AG000FDO | 40g |
| 114873-13-1 | O=C(O)[C@H](NC(OC(C)(C)C)=O)CC1=CC=C(Cl)C(Cl)=C1 | Boc-3,4-dichloro-D-phenylalanine | AG000FDP | 175g |
| 114873-12-0 | O=C(O)[C@H](NC(OC(C)(C)C)=O)CC1=CC=C(Cl)C=C1Cl | Boc-R-2,4-dichlorophenylalanine | AG000FDQ | 50g |
| 114873-11-9 | O=C(O)[C@@H](CC1=CC=CC(F)=C1)NC(OC(C)(C)C)=O | Boc-D-Phe(3-F)-OH | AG000FDR | 50g |
| 114873-10-8 | O=C(O)[C@H](NC(OC(C)(C)C)=O)CC1=CC=CC=C1F | Boc-D-2-fluorophenylalanine | AG000FDS | 175g |
| 114873-08-4 | CC(OC(N[C@H](C(O)=O)CC1C2=C(C=CC(=C2)Cl)NC=1)=O)(C)C | L-N-Boc-5-chlorotryptophan | AG000FDT | 1.25g |
| 114873-07-3 | O=C(O)[C@@H](NC(OC(C)(C)C)=O)CC1=CC=C(C(F)(F)F)C=C1 | Boc-L-4-trifluoromethylphenylalanine | AG000FDU | 125g |
| 114873-06-2 | O=C(O)[C@@H](NC(OC(C)(C)C)=O)CC1=CC=CC(C)=C1 | Boc-3-Methyl-L-phenylalanine | AG000FDV | 50g |
| 114873-05-1 | O=C(O)[C@@H](NC(OC(C)(C)C)=O)CC1=CC=CC=C1C | Boc-L-2-methylphenylalanine | AG000FDW | 50g |
| 114873-04-0 | O=C(O)[C@@H](NC(OC(C)(C)C)=O)CC1=CC=C(Cl)C=C1Cl | (S)-Boc-2,4-dichlorophenylalanine | AG000FDX | 50g |
| 114873-03-9 | O=C(O)[C@H](CC1=CC=CC(Cl)=C1)NC(OC(C)(C)C)=O | Boc-L-3-chlorophenylalanine | AG000FDY | 300g |
| 117048-59-6 | OC1=CC(/C=CC2=CC(OC)=C(OC)C(OC)=C2)=CC=C1OC | Combretastatin A4 | AG000DMO | 65g |
| 1170613-55-4 | FC1=CC=C(/C=C(C)/C(CC)=N/O)C=C1 | (1E，3E)-1-(4-Fluorophenyl)-2-methyl-1-penten-3-one Oxime | AG000DMY | 0.5g |
| 1170568-70-3 | CCOC(=O)C1=C(Br)N2CCNCC2=N1.Cl | Ethyl 3-bromo-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine-2-carboxylate, HCl | AG000DN7 | 10g |
| 117054-76-9 | NC(=O)c1cccc(c1Cl)[N+](=O)[O-] | 2-Chloro-3-nitrobenzamide | AG000DNE | 20g |
| 1170782-90-7 | O=C(C1(CN)CC1)OC.[H]Cl | Methyl 1-(aminomethyl)cyclopropanecarboxylate hydrochloride | AG000DNH | 25g |
| 1170735-10-0 | CC1N=CN(C2=C(C#N)C=C(C=O)C=C2)C=1 | 5-formyl-2-(4-methyl-1H-imidazol-1-yl)benzonitrile | AG000DNL | 104g |
| 117077-93-7 | CN(C)C1=NC(Cl)=NC(Cl)=C1 | 2,6-Dichloro-N,N-dimethylpyrimidin-4-amine | AG000DNS | 10g |
| 117068-71-0 | BrC1=CC=CC(OCC2=CC=CC=C2)=N1 | 2-Benzyloxy-6-bromopyridine | AG000DNX | 150g |
| 1170856-93-5 | OC1=C(CN(CC(OCC)=O)CC(OCC)=O)C2=C(C=C1)C3(C(C=CC=C4)=C4C(O3)=O)C5=C | Tetraethyl 2,2′,2”,2”’-(((3′,6′-dihydroxy-3-oxo-3h-spiro[isobenzofuran-1,9′-xa | AG000DO6 | 0.1g |
| 1170830-85-9 | O=C1NC=CC2=C1CCNC2 | 5,6,7,8-Tetrahydro-2,6-naphthyridin-1(2H)-one | AG000DOA | 1g |
| 1170937-23-1 | N=C(C1CCNCC1)N.[H]Cl.[H]Cl | Piperidine-4-carboximidamide dihydrochloride | AG000DOV | 10g |
| 1170905-43-7 | O=C(OC(C)(C)C)NCCC1CNC1.[H]Cl | 3-(2-N-Boc-Aminoethyl)azetidine, HCl | AG000DP2 | 5g |
| 117088-31-0 | C[C@@H](OC(C)(C)C)[C@@H](C(OC1=C(F)C(F)=C(F)C(F)=C1F)=O)NC(OCC2C3=C | Fmoc-Thr(tBu)-OPfp | AG000DPD | 125g |
| 117087-45-3 | NNC1=C(Cl)N=CC=C1 | 2-Chloro-3-hydrazinylpyridine | AG000DPF | 5g |
| 117087-18-0 | OCC(COCC1=CC=CC=C1)CO | 2-[(Benzyloxy)methyl]propane-1,3-diol | AG000DPG | 50g |
| 1170979-26-6 | O=C(C1=CC2=CC(N)=CC=C2N=C1)OC | Methyl 6-aminoquinoline-3-carboxylate | AG000DPO | 1g |
| 117098-94-9 | NC1=CC2=C(COB2O)C=C1 | 6-Amino-3H-2,1-benzoxaborol-1-ol | AG000DPZ | 75g |
| 117098-93-8 | OB1OCC2=CC=C(N)C=C12.[H]Cl | 5-Amino-2-hydroxymethylphenylboronic acid, HCl, dehydrate | AG000DQ0 | 20g |
| 1171080-45-7 | O=C([C@H]1NC[C@H](NOCC2=CC=CC=C2)CC1)OCC3=CC=CC=C3.O=C(O)C(O)=O | (2S,5R)-Benzyl 5-((Benzyloxy)Amino)Piperidine-2-Carboxylate Oxalate | AG000DQ9 | 500g |
| 1171044-16-8 | CN1CCN(CC1)CC2=CC(=CC=C2)B(O)O | 3-((4-methylpiperazin-1-yl)methyl)phenylboronic acid | AG000DQJ | 3g |
| 117106-21-5 | O=C(O)[C@@H](NC(OC(C)(C)C)=O)CCNC(OCC1C2=C(C3=C1C=CC=C3)C=CC=C2)= | BOC-DAB(FMOC)-OH | AG000DQQ | 200g |
| 117106-20-4 | C[C@@H](OC(C)(C)C)[C@H](N(C(OCC1C2=C(C3=C1C=CC=C3)C=CC=C2)=O)C)C(O | (2S,3R)-3-(tert-butoxy)-2-{[(9H-fluoren-9-ylmethoxy)carbonyl](methyl)amin | AG000DQR | 125g |
| 117103-53-4 | O=[N+](C1=CN=C(Br)C=N1)[O-] | 2-Bromo-5-nitropyrazine | AG000DQV | 10g |
| 114744-50-2 | BrC1=CC=CC2=C1CCCN2 | 5-Bromo-1,2,3,4-tetrahydroquinoline | AG000F53 | 50g |
| 114741-22-9 | O=C(C1=CC(C2=C(O1)C=C(Cl)C=C2)=O)O | 7-CHLORO-4-OXO-4H-CHROMENE-2-CARBOXYLIC ACID | AG000F57 | 3g |
| 114748-70-8 | Nc1ncnc2n(cc(I)c12)[C@H]1CC[C@@H](CO)O1 | 7-Iodo-2′,3′-dideoxy-7-deazaadenosine | AG000F5M | 0.1g |
| 114748-67-3 | IC1=CN(C2=C1C(=O)N=C(N)N2)[C@@H]3O[C@H](CO)CC3 | 7-Iodo-7-deaza-dideoxyguanosine | AG000F5O | 5g |
| 114748-57-1 | Nc1nc(=O)n(cc1I)[C@H]1CC[C@H](O1)CO | Cytidine, 2′,3′-dideoxy-5-iodo- | AG000F5P | 0.75g |
| 114746-70-2 | CC1(C)OC[C@@H](O1)C(O)=O | (r)-2,2-Dimethyl-1,3-dioxolane-4-carboxylic acid | AG000F5R | 1g |
| 1147558-43-7 | N#CC1=CC(F)=C(N)C(Cl)=C1 | 4-Amino-3-chloro-5-fluorobenzonitrile | AG000F5X | 75g |
| 1147558-40-4 | O=C(N1[C@@H]2C[C@H](C#N)C[C@H]1CC2)OC(C)(C)C | Exo-8-boc-3-cyano-8-azabicyclo[3.2.1]octane | AG000F5Y | 10g |
| 1147558-13-1 | NC1=CC=C(S(=O)(C2CC2)=O)C=C1 | 4-(Cyclopropylsulfonyl)aniline | AG000F5Z | 15g |
| 1147557-97-8 | O=C(N1CC2(CC(O)C2)C1)OC(C)(C)C | tert-butyl 6-hydroxy-2-azaspiro[3.3]heptane-2-carboxylate | AG000F60 | 172.5g |
| 1147557-74-1 | CS(=O)(=O)C1=CC(F)=C(N)C(F)=C1 | 2，6-Difluoro-4-(methylsulfonyl)aniline | AG000F62 | 25g |
| 1147548-82-0 | O=C1CCC2=C1C=C(Br)C(C)=C2 | 6-Bromo-5-methyl-1-indanone | AG000F63 | 25g |
| 114766-05-1 | NC1=CC=C(OCC)C=C1C | 4-Ethoxy-2-methylaniline | AG000F6A | 5g |
| 1147753-38-5 | CN1C=CC2=C1N=CC=C2C(O)=O | 1-Methyl-7-azaindole-4-carboxylic acid | AG000F6L | 2g |
| 114778-50-6 | NOC[C@H]1COC(O1)(C)C | (R)-O-((2,2-Dimethyl-1,3-dioxolan-4-yl)methyl)hydroxylamine | AG000F6N | 3g |
| 114776-15-7 | C(=O)(O)c1cc(N(=O)=O)c(cc1Cl)F | Benzoic acid, 2-chloro-4-fluoro-5-nitro- | AG000F6P | 2000g |
| 114772-78-0 | OCC2(=C(C1(=CC=C(C)C=C1))C=CC=C2) | (4′-Methyl-[1,1′-biphenyl]-2-yl)methanol | AG000F6V | 10g |
| 114772-55-3 | N#CC1=CC=CC=C1C2=CC=C(CN3C(CO)=C(Cl)N=C3CCCC)C=C2 | 4′-[(2-Butyl-4-chloro-5-hydroxymethyl-1h-imidazol-1-yl)methyl]-1,1′-biphen | AG000F6W | 3g |
| 114772-54-2 | C1=CC=CC(=C1C2=CC=C(C=C2)CBr)C#N | 4′-Bromomethyl-2-cyanobiphenyl | AG000F6X | 5400g |
| 1172067-98-9 | O=S(N1C=CC2=C(F)C(Br)=CN=C21)(C3=CC=CC=C3)=O | 5-Bromo-4-Fluoro-1-(Phenylsulfonyl)-1H-Pyrrolo[2,3-B]Pyridine | AG000DXA | 20g |
| 1172067-95-6 | FC1=C2C(NC=C2)=NC=C1Br | 5-Bromo-4-fluoro-1H-pyrrolo[2,3-b]pyridine | AG000DXB | 160g |
| 1172057-73-6 | Cl.BrC1N2C(CNCC2)=NN=1 | 3-Bromo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine, HCl | AG000DXE | 25g |
| 117205-07-9 | FC(C(F)(F)F)(OC(C(S(=O)(=O)[O-])(F)F)(F)F)F.[K+] | Ethanesulfonic acid, 1,1,2,2-tetrafluoro-2-(1,1,2,2,2-pentafluoroethoxy)-, pot | AG000DXO | 100g |
| 1172229-72-9 | O=C(C1=NN(C)C(Cl)=C1)OCC | Ethyl 5-chloro-1-methyl-1H-pyrazole-3-carboxylate | AG000DXX | 3g |
| 1172127-44-4 | O=C(O)[C@@](C)(NC(OCC1C2=C(C3=C1C=CC=C3)C=CC=C2)=O)CC4=CC=CC=C4F | (S)-N-FMOC-ALPHA-METHYL-2-FLUOROPHENYLALANINE | AG000DY2 | 1g |
| 1172341-29-5 | CC1=CC=C(Br)C2=NC=NN12 | 8-Bromo-5-methyl-[1,2,4]triazolo[1,5-a]pyridine | AG000DYK | 2g |
| 117241-31-3 | CCCCCCCCCCCCOc1c(OCCCCCCCCCCCC)cc(cc1OCCCCCCCCCCCC)C(=O)O | 3,4,5-Tris(dodecyloxy)benzoic acid | AG000DYS | 20g |
| 117238-61-6 | BrC=1C(=C(C=O)C=C(C1OC)Br)O | 3,5-Dibromo-2-hydroxy-4-methoxybenzaldehyde | AG000DYY | 2g |
| 117235-10-6 | SCCC(=O)ON1C(=O)CCC1=O | 1-(3-Mercapto-1-oxopropoxy)-2,5-pyrrolidinedione | AG000DZ3 | 40g |
| 1172505-99-5 | CCN1C(=CC(=N1)C2CC2)N | 3-Cyclopropyl-1-ethyl-1H-pyrazol-5-amine | AG000DZ7 | 61g |
| 114873-02-8 | O=C(O)[C@H](CC1=CC=CC=C1Cl)NC(OC(C)(C)C)=O | Boc-L-2-chlorophenylalanine | AG000FDZ | 50g |
| 114873-01-7 | O=C(O)[C@H](CC1=CC=CC(F)=C1)NC(OC(C)(C)C)=O | Boc-l-3-fluorophenylalanine | AG000FE0 | 400g |
| 114873-00-6 | [H][C@@](CC1=C(F)C=CC=C1)(NC(=O)OC(C)(C)C)C(O)=O | Boc-L-2-fluorophenylalanine | AG000FE1 | 50g |
| 114872-99-0 | O=C(O)[C@H](N)CC1=CC=C(C(F)(F)F)C=C1 | D-4-Trifluoromethylphenylalanine | AG000FE2 | 20g |
| 114872-98-9 | ClC1=C(C[C@@H](N)C(=O)O)C=CC(=C1)Cl | D-2,4-Dichlorophenylalanine | AG000FE3 | 175g |
| 114872-81-0 | COC(=O)[C@@H](Cc1c[nH]c2ccc(Cl)cc12)NC(C)=O | (R)-N-Acetyl-5-chloro-trp-ome | AG000FE4 | 1g |
| 114872-80-9 | COC(=O)[C@@H](Cc1c[nH]c2ccc(F)cc12)NC(C)=O | (R)-N-Acetyl-5-Fluoro-Trp-OMe | AG000FE5 | 0.75g |
| 114897-92-6 | O=C(O)CC1=CC=C(Br)C=C1F | 4-Bromo-2-fluorophenylacetic acid | AG000FE8 | 1272.5g |
| 114897-91-5 | N#CCC1=CC=C(Br)C=C1F | 4-BROMO-2-FLUOROBENZYL CYANIDE | AG000FE9 | 100g |
| 114896-32-1 | SCCCCCCCCCCCCCCCCO | 16-Mercapto-1-hexadecanol | AG000FEB | 2g |
| 114883-82-8 | O=C([C@@H]1N(C)CCC1)OC | (R)-Methyl 1-methylpyrrolidine-2-carboxylate | AG000FEN | 2g |
| 114878-60-3 | ClC1=C(C=CC(=C1)[N+](=O)[O-])N1CCNCC1 | 1-(2-Chloro-4-nitrophenyl)piperazine | AG000FET | 125g |
| 114908-93-9 | CC(C)(C)C1=C(O)COC1=O | 3-tert-Butyl-4-hydroxyfuran-2(5H)-one | AG000FEW | 3g |
| 114903-30-9 | COc1ccc2c(c1)c(c[nH]2)C[C@@H](C(=O)O)NC(=O)OC(C)(C)C | (S)-2-((tert-Butoxycarbonyl)amino)-3-(5-methoxy-1H-indol-3-yl)propanoic ac | AG000FF4 | 1g |
| 114902-16-8 | [C@H]1(O)CO[C@](O[C@H]2CC[C@]3(C)[C@]4(CC=C5[C@]6([H])CC(=C)CC[C@] | Ciwujianoside B | AG000FF6 | 0.05g |
| 1149-26-4 | CC(C)[C@@H](C(O)=O)NC(OCC1=CC=CC=C1)=O | Z-Val-OH | AG000FFD | 6000g |
| 1149-24-2 | O=C(C1=CC(C(OCC)=O)=C(C)N=C1C)OCC | Diethyl 2,6-dimethyl-3,5-pyridinedicarboxylate | AG000FFE | 125g |
| 1149-16-2 | OC1=CC=CC=C1/N=C/C=N/C2=CC=CC=C2O | Glyoxalbis(2-hydroxyanil) | AG000FFG | 1000g |
| 114916-05-1 | O=C(NCCCNCCCCNC(/C=C/C1=CC=C(O)C=C1)=O)/C=C/C2=CC=C(O)C=C2 | N1,N10-Bis(p-coumaroyl)spermidine | AG000FFO | 0.2g |
| 1146290-07-4 | N#CC1=CC([N+]([O-])=O)=C(C)C(F)=C1 | 3-FLUORO-4-METHYL-5-NITROBENZONITRILE | AG000EVP | 0.75g |
| 114636-37-2 | O=C(N1C[C@@H](NC(C)=O)CC1)OC(C)(C)C | (S)-tert-Butyl 3-acetamidopyrrolidine-1-carboxylate | AG000EVT | 50g |
| 114636-33-8 | CC(N[C@H]1CN(CC2=CC=CC=C2)CC1)=O | (R)-N-(1-Benzylpyrrolidin-3-yl)acetamide | AG000EVU | 4g |
| 114636-31-6 | CC(=O)N[C@H]1CCNC1 | N-[(3S)-pyrrolidin-3-yl]acetamide | AG000EVV | 5g |
| 114648-66-7 | C1(CC(N2)=CC3=C2C=CC=C3)=CNC4=C1C=CC=C4 | 3-((1H-indol-2-yl)methyl)-1H-indole | AG000EX0 | 5g |
| 114650-46-3 | COc1ccc(c(c1)C(C)C)N | 2-Isopropyl-4-methoxyaniline | AG000EXW | 1g |
| 1146615-89-5 | CC1(C)C(C)(C)OB(C2=CC(Cl)=NC(F)=C2)O1 | 2-Chloro-6-fluoropyridine-4-boronic acid, pinacol ester | AG000EYD | 20g |
| 1146615-86-2 | FC(C1=CN2C(C=C1)=NC=C2Br)(F)F | 3-Bromo-6-(trifluoromethyl)imidazo[1,2-a]pyridine | AG000EYE | 38.9g |
| 1146614-40-5 | OB(C1=CC(CO)=CC(F)=C1)O | 3-Fluoro-5-(hydroxymethyl)phenylboronic acid | AG000EYG | 2g |
| 1146614-39-2 | CNCC1=CC(B(O)O)=CC=C1 | (3-((Methylamino)methyl)phenyl)boronic acid | AG000EYH | 0.45g |
| 114661-01-7 | OCC(C(C1OC(OCC2OC(OCC(C(=O)O)N)C(C(C2O)O)NC(=O)C)(CC(C1NC(=O)C)O)C | L-Serine, O-[2-(acetylamino)-6-O-(N-acetyl-α-neuraminosyl)-2-deoxy-α-D-ga | AG000EYK | 0.005g |
| 1146637-10-6 | CC1=CC(Br)=CC2=CN(C)N=C12 | 5-bromo-2,7-dimethyl-2H-indazole | AG000EZ2 | 10g |
| 1146629-84-6 | N#CC[C@H](C1CCCC1)N2N=CC(B3OC(C)(C)C(C)(C)O3)=C2 | 1H-Pyrazole-1-propanenitrile, beta-cyclopentyl-4-(4,4,5,5-tetramethyl-1,3,2- | AG000EZ3 | 45g |
| 1146629-83-5 | N#CC[C@@H](N1N=CC(Br)=C1)C2CCCC2 | (R)-3-(4-Bromo-1H-pyrazol-1-yl)-3-cyclopentylpropanenitrile | AG000EZ4 | 50g |
| 1146629-77-7 | CC(C)(C)C(OCN1C=CC2=C(C3=CNN=C3)N=CN=C21)=O | (4-(1H-Pyrazol-4-yl)-7H-pyrrolo[2,3-d]pyrimidin-7-yl)methyl pivalate | AG000EZ5 | 75g |
| 1146629-75-5 | CC(C)(C)C(=O)OCN1C=CC2=C(Cl)N=CN=C12 | (4-Chloro-7H-pyrrolo[2,3-d]pyrimidin-7-yl)methyl pivalate | AG000EZ6 | 1000g |
| 1146629-74-4 | C[Si](C)(C(C)(C)C)OC(C1=CC(C(F)(F)F)=CC(C(F)(F)F)=C1)([C@@H]2NCCC2)C3=CC | (2R)-2-[Bis[3，5-bis(trifluoromethyl)phenyl]-[(tert-butyldimethylsilyl)oxy]m | AG000EZ7 | 15g |
| 1146618-41-8 | O=C(NC1=NC=C(CCNC2=C3C(C=CS3)=NC=N2)S1)NC4=CC=CC(Cl)=C4.CS(=O)(O)= | SNS-314 Mesylate | AG000EZ8 | 0.2g |
| 1175-41-3 | O=C(O)C=1C=C(C=2C=CC=CC2C1O)CC3=CC(C(=O)O)=C(O)C=4C=CC=CC43 | 4,4′-Methylenebis[1-hydroxy-2-naphthalenecarboxylic acid] | AG000EDI | 2g |
| 1175-06-0 | C[C@]12CC[C@H](O)C[C@]1([H])C(=O)C[C@@]1([H])[C@]3([H])CC[C@]([H])([ | 6-Ketocholestanol | AG000EDK | 0.01g |
| 114438-33-4 | Cc1onc(NS(=O)(=O)c2ccc(NO)cc2)c1 | N-Hydroxy Sulfamethoxazole | AG000EE7 | 0.15g |
| 1144509-75-0 | O=C(OC(C)(C)C)NCCNC1=NC2=CC(Cl)=CC=C2O1 | tert-Butyl 2-(5-chlorobenzo[d]oxazol-2-ylamino)ethylcarbamate | AG000EEA | 3g |
| 114446-57-0 | ClC1=CC=C(C(Cl)=C1)[C@@H](O)CCl | (1R)-2-Chloro-1-(2,4-dichlorophenyl)ethanol | AG000EEO | 400g |
| 114446-55-8 | C[C@H](O)C1=CC=CC=C1Br | (S)-1-(2-Bromophenyl)ethanol | AG000EEQ | 200g |
| 114458-03-6 | OC(=O)CC1OC(OC1=O)(C)C | 1,3-Dioxolane-4-acetic acid, 2,2-dimethyl-5-oxo- | AG000EF9 | 10g |
| 114457-94-2 | O=C(O)[C@@H](NC(C1=NC=CN=C1)=O)CC2=CC=CC=C2 | (S)-3-PHENYL-2-[(PYRAZIN-2-YLCARBONYL)AMINO] PROPANOIC ACID | AG000EFA | 200g |
| 114460-21-8 | CC(=O)O[Ca]OC(=O)C | Acetic acid, calcium salt, hydrate (9CI) | AG000EGA | 12000g |
| 114468-05-2 | FC(C1=C(Br)C=NC=C1)F | 3-Bromo-4-(difluoromethyl)pyridine | AG000EGG | 20g |
| 114468-04-1 | FC(C1=CN=CC(Br)=C1)F | 3-Bromo-5-(difluoromethyl)pyridine | AG000EGH | 5g |
| 114468-01-8 | FC(C1=NC=CC=C1)F | 2-(Difluoromethyl)pyridine | AG000EGI | 25g |
| 114474-28-1 | NC1=CC=C(C2=CNN=C2)C=C1 | 4-(1H-Pyrazol-4-yl)aniline | AG000EHK | 30g |
| 114474-26-9 | [O-][N+](=O)C1=CC=C(C=C1)C1=CNN=C1 | 4-(4-Nitrophenyl)-1H-pyrazole | AG000EHM | 300g |
| 114471-18-0 | CC[C@H](C)[C@@H]1NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CC(=O)O)NC(= | BNP (1-32), human | AG000EHQ | 0.2g |
| 114484-31-0 | OCC1=CC=C(N)C(O)=C1 | 2-Amino-5-(hydroxymethyl)phenol | AG000EIS | 0.2g |
| 114482-57-4 | C=CCCOc1ccc(cc1)C(=O)Oc1ccc(cc1)C#N | 4-(3-Butenyloxy)benzoic acid 4-cyanophenyl ester | AG000EIY | 10g |
| 1170238-67-1 | CN1C(C2CC2)=CC(N)=N1 | 5-Cyclopropyl-1-methyl-1H-pyrazol-3-amine | AG000DKV | 1g |
| 117032-51-6 | O=C(ON1C(=O)CCC1=O)CCCCCNC(=O)C(F)(F)F | 6-(N-Trifluoroacetyl)aminocaproic acid N-succinimidyl ester | AG000DL1 | 6g |
| 117027-34-6 | C[C@H]([C@H](NC(=O)[C@H]1CCCN1C(=O)[C@@H](N)CCCCN)C(=O)O)O | Lys-D-Pro-Thr | AG000DL9 | 0.025g |
| 1170419-33-6 | Cc1ccc(c(c1)C)c1cccc(c1)C(=O)O | 2′,4′-Dimethylbiphenyl-3-carboxylic acid | AG000DLI | 5g |
| 1170390-54-1 | CC(OC(N1CC(N)COCC1)=O)(C)C | 4-Boc-6-amino-1,4-oxazepane | AG000DLK | 25g |
| 1170321-92-2 | C(N1[C@@]2([H])CC[C@]1([H])C[C@@H](C2)S(C1N=CC=CC=1)(=O)=O)(=O)NC1 | 3-(Pyridin-2-ylsulfonyl)-N-(4-(trifluoromethyl)phenyl)-8-azabicyclo[3.2.1]oct | AG000DLS | 0.75g |
| 117043-87-5 | Cl.NNC1=NN=CC=C1 | 3-Hydrazinylpyridazine hydrochloride | AG000DLT | 0.5g |
| 117043-86-4 | NCC1=CSC=N1.Cl | C-Thiazol-4-yl-methylamine hydrochloride | AG000DLU | 10g |
| 117043-46-6 | O=C(OCC)CN(C(NC1)=O)C1=O | Ethyl 2-(2,5-Dioxoimidazolidin-1-Yl)Acetate | AG000DLV | 0.5g |
| 1170470-60-6 | BrC1=CC(C(N)CCS2)=C2C=C1.Cl | 6-BROMO-3,4-DIHYDRO-2H-THIOCHROMEN-4-AMINE HCL | AG000DM9 | 15g |
| 1170469-44-9 | O=C(C1=CC(C2=CC=CC(N)=C2)=CC=C1)O.[H]Cl | 3′-Amino-[1,1′-biphenyl]-3-carboxylic acid, HCl | AG000DMA | 3g |
| 117049-14-6 | O=C(OC(C)(C)C)N[C@@H](C1=CC=CC=C1)CO | Boc-L-phenylglycinol | AG000DMK | 1000g |
| 114772-53-1 | N#CC1=CC=CC=C1C2=CC=C(C)C=C2 | 2-(4-Methylphenyl)benzonitrile | AG000F6Y | 1500g |
| 114772-38-2 | O=C(C1=CC=CC=C1C2=CC=C(CBr)C=C2)OC | Methyl 4′-(bromomethyl)-[1,1′-biphenyl]-2-carboxylate | AG000F70 | 1500g |
| 114772-34-8 | O=C(C1=CC=CC=C1C2=CC=C(C)C=C2)OC | 4′-Methylbiphenyl-2-carboxylic acid methyl ester | AG000F72 | 2000g |
| 114772-33-7 | O=C(OC)C2(=CC(C1(=CC=C(C)C=C1))=CC=C2) | Methyl 3-(4-methylphenyl)benzoate | AG000F73 | 175g |
| 1147858-83-0 | CC(=O)OCc1c(Br)cccc1Br | 2,6-Dibromobenzyl Acetate | AG000F7B | 50g |
| 114790-39-5 | O=C(OCC1=CC=CC=C1)NCC(OC)OC | 2-(Cbz-amino)acetaldehyde dimethyl acetal | AG000F7D | 600g |
| 114787-91-6 | OCC1=CC=C(OC)C(C)=C1 | (4-Methoxy-3-methylphenyl)methanol | AG000F7J | 2g |
| 114780-06-2 | O=C(N(C)C)C1=NC=CC(Cl)=C1 | 4-Chloro-N,N-dimethylpicolinamide | AG000F7V | 15g |
| 1147979-40-5 | COC1=C(Cl)C(C(O)=O)=C(Cl)C=N1 | 3,5-Dichloro-2-methoxyisonicotinic acid | AG000F80 | 2g |
| 114798-36-6 | N1N=NN=C1C1=C(C=CC=C1)C1=CC=C(C=C1)CN1C(=NC(=C1C=O)Cl)CCCC | 1-((2′-(1H-tetrazol-5-yl)-[1,1′-biphenyl]-4-yl)methyl)-2-butyl-4-chloro-1H-imi | AG000F82 | 2g |
| 114798-26-4 | C(n1c(CCCC)nc(c1CO)Cl)c1ccc(cc1)c1c(cccc1)c1[nH]nnn1 | 2-Butyl-4-chloro-1-[[2′-(2H-tetrazol-5-yl)[1,1′-biphenyl]-4-yl]methyl]-1H-imid | AG000F85 | 1000g |
| 114797-97-6 | O=c1[nH]c2c(n1Cc1ccncc1)cccc2 | 1-(Pyridin-4-ylmethyl)-1H-benzo[d]imidazol-2(3H)-one | AG000F86 | 5g |
| 1148-79-4 | C1=CN=C(C=C1)C1=CC=CC(=N1)C1=NC=CC=C1 | 2,2′:6′,2”-Terpyridine | AG000F8F | 23g |
| 1148-49-8 | CC1=CC=C2N=C(C3=CC=CC=C3)C=C(O)C2=C1 | 6-Methyl-2-phenylquinolin-4-ol | AG000F8I | 5g |
| 1148044-31-8 | O=C(N1CCC12CNCC2)OC(C)(C)C | 1-Boc-1,6-diazaspiro[3.4]octane | AG000F8M | 10g |
| 1148006-31-8 | C(OC(C)(C)C)(=O)N1[C@@]2(C[C@@H](O)C[C@]1(COC2)[H])[H] | endo-tert-Butyl 7-hydroxy-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate | AG000F8T | 10g |
| 1148004-02-7 | Fc1ccc2c(c1B1OC(C(O1)(C)C)(C)C)ccn2[Si](C(C)(C)C)(C)C | 1H-Indole, 1-[(1,1-dimethylethyl)dimethylsilyl]-5-fluoro-4-(4,4,5,5-tetrameth | AG000F8U | 2g |
| 1146955-35-2 | CC1(C)OB(OC1(C)C)C1=CC=CC2=NN(C=C12)C1CCCCO1 | 2-(Tetrahydro-2H-pyran-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl) | AG000F1X | 19g |
| 1146954-88-2 | O=C(OCC)[C@H](NC(OC(C)(C)C)=O)CO | (R)-Ethyl 2-((tert-butoxycarbonyl)amino)-3-hydroxypropanoate | AG000F1Y | 150g |
| 114691-92-8 | O=C(C1=CC=C(C2=CC=C(C(C)=O)C=C2)C=C1)O | 4-(4-Acetylphenyl)benzoic acid | AG000F24 | 10g |
| 1147-56-4 | OC1=C(/N=N/C2=NC=CS2)C(C=CC=C3)=C3C=C1 | 1-(2-Thiazolylazo)-2-Naphthol | AG000F2D | 10g |
| 1147-43-9 | C1=CC=C(C(=C1)C(=O)C2=CC=CC=C2N)C(=O)O | 2-Aminobenzophenone-2′-carboxylic acid | AG000F2F | 100g |
| 1147-23-5 | O[C@H]1[C@@H](O[C@@H]([C@H]1O)CO)n1c(=O)nc(c(c1)I)N | 5-Iodo-Cytidine | AG000F2H | 50g |
| 1147112-66-0 | O=C(OCc1ccccc1)N1CC[C@H](O)[C@H](F)C1 | (3R,4S)-Benzyl 3-fluoro-4-hydroxypiperidine-1-carboxylate | AG000F2I | 0.5g |
| 1147109-97-4 | NC1=C(C(=O)OC)C(=CC=C1)C#N | Methyl 2-amino-6-cyanobenzoate | AG000F2K | 5g |
| 1147108-99-3 | C[C@H]1CNCCO1.[H]Cl | (S)-2-METHYLMORPHOLINE HYDROCHLORIDE | AG000F2L | 50g |
| 1147107-15-0 | O=C(OCC)C1=C(F)C=C(F)C=C1N | Ethyl 2-amino-4,6-difluorobenzoate | AG000F2O | 40g |
| 1147103-48-7 | FC(F)(F)C(C1=NC=CN=C1)=O | 2,2,2-Trifluoro-1-(pyrazin-2-yl)ethanone | AG000F2P | 2g |
| 1147103-42-1 | O=C([C@H]1NC[C@@]2([H])[C@]1([H])CCC2)OCC.[H]Cl | (1S,3aR,6aS)-Ethyl octahydrocyclopenta[c]pyrrole-1-carboxylate hydrochlorid | AG000F2Q | 500g |
| 1147014-44-5 | C#CC1=C2C(NC=C2)=NC=N1 | 4-Ethynyl-7H-pyrrolo[2,3-d]pyrimidine | AG000F2V | 0.5g |
| 114703-12-7 | OC1=NC(O)=C2C=CC(Br)=CC2=N1 | 7-Bromoquinazoline-2,4(1H,3H)-dione | AG000F32 | 50g |
| 1147-98-4 | OC1=C(C(NC2=CC=C(Cl)C=C2)=O)C=C(Cl)C=C1 | 5-Chloro-N-(4-chlorophenyl)-2-hydroxybenzamide | AG000F36 | 1g |
| 1147211-80-0 | N1=CC(=C(C)N1C)N.Cl.Cl | 1,5-Dimethyl-1H-pyrazol-4-amine dihydrochloride | AG000F37 | 0.5g |
| 115-76-4 | CCC(CO)(CO)CC | 2,2-Diethyl-1,3-propanediol | AG000FKJ | 10g |
| 115-70-8 | OCC(CC)(N)CO | 2-Amino-2-ethylpropane-1,3-diol | AG000FKM | 2000g |
| 115-69-5 | OCC(C)(N)CO | 2-Amino-2-methyl-1,3-propanediol | AG000FKN | 250g |
| 115010-10-1 | O=S(C1=CC=C(OCO2)C2=C1)(Cl)=O | 1,3-Benzodioxole-5-sulfonyl chloride | AG000FKU | 20g |
| 115007-14-2 | ClC(N1CCCC1)=[N+]2CCCC2.F[B-](F)(F)F | 1-(Chloro-1-pyrrolidinylmethylene)pyrrolidinium Tetrafluoroborate | AG000FL5 | 50g |
| 115005-78-2 | CC(C)c1cc(O[C@@H]2O[C@@H]([C@@H](O)[C@H](O)[C@H]2O)C(=O)O)cc(C(C | 4-Hydroxy Propofol 4-O-b-D-Glucuronide | AG000FL6 | 0.25g |
| 1150-90-9 | C[C@]12CC[C@H]3[C@@H](CCc4cc(O)ccc34)[C@@H]1CC=C2 | Estratetraenol | AG000FL8 | 2g |
| 1150-62-5 | N1(C2=CC=CC=C2)C3=C(C4=C1C=CC=C4)C=CC=C3 | 9-Phenylcarbazole | AG000FL9 | 1000g |
| 1150-59-0 | O=C1C(O)=C(C=2C=CC=CC2)C(=O)C=3C=CC=CC13 | 2-Hydroxy-3-phenylnaphthalene-1,4-dione | AG000FLA | 0.1g |
| 115-99-1 | O=COC(CCC=C(C)C)(C=C)C | 1,6-OCTADIEN-3-OL, 3,7-DIMETHYL-, 3-FORMATE | AG000FLF | 1000g |
| 115-96-8 | ClCCOP(OCCCl)(OCCCl)=O | Tris(2-chloroethyl) phosphate | AG000FLH | 446.6g |
| 1150114-44-5 | O=C(C1=CC=C(B(O)O)O1)OCC | (5-(Ethoxycarbonyl)furan-2-yl)boronic acid | AG000FLJ | 50g |
| 1150114-42-3 | CC(C)OC1=NC=CC=C1B(O)O | 2-Isopropoxypyridine-3-boronic acid | AG000FLL | 40g |
| 1150114-41-2 | C=C(B1OCCN(CCO1)C)C2=CC=CC=C2 | 6-Methyl-2-(1-phenylvinyl)-1,3,6,2-dioxazaborocane | AG000FLM | 3g |
| 1150114-39-8 | BrC1=CC(B(O)O)=C2OCOC2=C1 | 5-Bromo-2,3-methylenedioxyphenylboronic acid | AG000FLN | 0.5g |
| 1150114-35-4 | OB(c1cc(ccc1Cl)C(=O)N)O | 5-Carbamoyl-2-chlorophenylboronic acid | AG000FLP | 5g |
| 1147199-25-4 | COC(=O)C1=C(C)N(N=N1)C1=CC=C(Cl)C=C1 | Methyl 1-(4-Chlorophenyl)-5-methyl-1，2，3-triazole-4-carboxylate | AG000F39 | 25g |
| 1147124-23-9 | O=C1N(CC(CC)CCCC)C2=C(C=CC(Br)=C2)/C1=C3C(N(CC(CC)CCCC)C4=C/3C=CC(Br | 6，6′-Dibromo-1，1′-bis(2-ethylhexyl)-[3，3′-biindolinylidene]-2，2′-dione | AG000F3B | 15g |
| 114715-38-7 | N[C@@H]1CN(CC2=CC=CC=C2)CC1 | (S)-(+)-1-Benzyl-3-aminopyrrolidine | AG000F3R | 150g |
| 374-35-6 | O=C(O)C(C)(O)C(F)(F)F | 3,3,3-Trifluoro-2-Hydroxy-2-Methylpropanoic Acid | AG000F3U | 200g |
| 1147350-75-1 | O=C(OC)[C@H](C1=CC=CC=C1Cl)N2CCC3C(C2)=CC(S3)=O | Methyl (2S)-2-(2-chlorophenyl)-2-(2-oxo-2,6,7,7a-tetrahydrothieno[3,2-c]pyri | AG000F3W | 0.05g |
| 114736-25-3 | O=C(OCC)/C=C/C(OC)OC | (E)-Ethyl 4,4-dimethoxybut-2-enoate | AG000F42 | 42500g |
| 114725-00-7 | O=C(C1(C)CN(C)CC1)OC | Methyl 1,3-dimethylpyrrolidine-3-carboxylate | AG000F4C | 0.75g |
| 114724-98-0 | COC(=O)C1CCN(C)C1=O | Methyl 1-Methyl-2-oxopyrrolidine-3-carboxylate | AG000F4D | 10g |
| 1147423-20-8 | CC(C)(C)OC(=O)N1CCC2(CCNC2)C1.Cl | tert-Butyl 2,7-diazaspiro[4.4]nonane-2-carboxylate hydrochloride | AG000F4J | 1g |
| 1147423-04-8 | N1(C2CCNCC2)CC(C1)O | 1-(Piperidin-4-yl)azetidin-3-ol dihydrochloride | AG000F4M | 20g |
| 1147423-01-5 | O=C(OC(C)(C)C)N(C1)CC21CCN(C(C)=O)CC2 | tert-Butyl 7-acetyl-2，7-diazaspiro[3.5]nonane-2-carboxylate | AG000F4N | 10g |
| 1147422-00-1 | CC(C)(C)OC(=O)N1CCC2CNCCC12 | Tert-Butyl Octahydro-1H-Pyrrolo[3,2-C]Pyridine-1-Carboxylate | AG000F4U | 25g |
| 114745-46-9 | CCOC([C@H]1[C@H](N)CCC1)=O | (1R,2R)-Ethyl 2-aminocyclopentanecarboxylate | AG000F4V | 1.25g |
| 114745-26-5 | CO[C@@H]1[C@H](O)[C@@H](COC(C2=CC=CC=C2)(C2=CC=C(OC)C=C2)C2=CC= | 5′-O-DMT-N2-Isobutyryl-2′-O-methyl-D-guanosine | AG000F4X | 100g |
| 114744-83-1 | CON(C([C@@H](NC(OCC1=CC=CC=C1)=O)C)=O)C | benzyl N-[(1S)-1-[methoxy(methyl)carbamoyl]ethyl]carbamate | AG000F4Z | 10g |
| 114744-51-3 | BrC1=CC2=C(C=C1)CCCN2 | 7-Bromo-1,2,3,4-tetrahydroquinoline | AG000F52 | 200g |
| 114498-55-4 | NC1=NC2=C(O1)C=CN=C2 | Oxazolo[4,5-c]pyridin-2-amine | AG000EK3 | 20g |
| 1145-98-8 | C[Si](C1=CC=CC=C1)(C)[Si](C)(C)C2=CC=CC=C2 | 1,1,2,2-Tetramethyl-1,2-Diphenyldisilane | AG000EKQ | 75g |
| 1145-93-3 | O=P(CC1=CC=C(OC)C=C1)(OCC)OCC | Diethyl 4-methoxybenzylphosphonate | AG000EKR | 300g |
| 1145-81-9 | O=C(OCC)CNC(OCC1=CC=CC=C1)=O | N-Cbz-glycine Ethyl Ester | AG000EKS | 600g |
| 1145-80-8 | OC[C@@H](C(O)=O)NC(OCC1=CC=CC=C1)=O | Z-Ser-OH | AG000EKT | 4500g |
| 1145-76-2 | O=[N+](C1=CC=C(OCC2=CC=CC=C2)C=C1)[O-] | 1-Benzyloxy-4-nitrobenzene | AG000EKU | 200g |
| 1145-73-9 | CN(C)c1ccc(C=Cc2ccccc2)cc1 | 4-(Dimethylamino)Stilbene | AG000EKW | 10g |
| 1145-56-8 | OC1=CC=C(C[C@H](NC(CCl)=O)C(O)=O)C=C1 | Chloroacetyl-l-Tyrosine | AG000EKZ | 0.75g |
| 1145-32-0 | OC(=O)CNC(=O)CNC(=O)c1ccccc1 | Benzoyl-glycyl-glycine | AG000EL3 | 0.27g |
| 1145-01-3 | C1(C2=CC=CC=C2)=NNC(C3=CC=CC=C3)=C1 | 3,5-Diphenylpyrazole | AG000EL7 | 964g |
| 114501-02-9 | O=C(C1=CC=CN=C1NC2=CC=CC=C2OC)O | 2-[(2-Methoxyphenyl)amino]nicotinic acid | AG000ELT | 0.5g |
| 114527-54-7 | OC(C1=C2C(NCCC2)=CC=C1)=O | 1,2,3,4-Tetrahydroquinoline-5-carboxylic acid | AG000EMP | 5g |
| 114527-53-6 | OC(=O)C1CNC2=CC=CC=C2C1 | 1,2,3,4-Tetrahydroquinoline-3-carboxylic acid | AG000EMQ | 10g |
| 114527-28-5 | O=C(O)CCCC1=CC(C2=NC=CC(C)=C2)=NC=C1 | 4-Methyl-4′-(3-carboxypropyl)-2,2′-bipyridine | AG000EMR | 1g |
| 114525-81-4 | O=C([C@H]1N(C(OC(C)(C)C)=O)CCSC1)O | (R)-4-(tert-Butoxycarbonyl)thiomorpholine-3-carboxylic acid | AG000EMX | 25g |
| 114605-42-4 | COc1ccc(c(c1OC(C)C)OC)Br | Benzene, 1-bromo-2,4-dimethoxy-3-(1-methylethoxy)- | AG000ESF | 9.4g |
| 1146-99-2 | C1(=O)C2=C(C=CC=C2)C(=O)C1C1=CC=C(Cl)C=C1 | Chlorindione | AG000ESP | 0.3g |
| 1146-98-1 | C1(=O)C2=C(C=CC=C2)C(=O)C1C1=CC=C(Br)C=C1 | Bromindione | AG000ESQ | 0.1g |
| 1146080-74-1 | N#CC1=C(N2C(N3CC(CO)CCC3)=NC4=CC=CC=C24)N=CC=C1 | 2-(2-(3-(Hydroxymethyl)piperidin-1-yl)-1H-benzo[d]imidazol-1-yl)nicotinonit | AG000ESV | 0.75g |
| 1146080-35-4 | ClC1=NC(C2=CNC3=C2C=CC=C3)=NC=C1 | 3-(4-Chloropyrimidin-2-yl)-1H-indole | AG000ET2 | 1.34g |
| 1146080-31-0 | O=[N+](C1=CN=C(N2C(Cl)=NC3=CC=CC=C23)C=C1)[O-] | 2-Chloro-1-(5-nitropyridin-2-yl)-1H-benzo[d]imidazole | AG000ET3 | 0.3g |
| 114607-46-4 | C(O)(=O)C(=O)NC1=CC=CC(C2NN=NN=2)=C1 | Acitazanolast | AG000ETH | 0.15g |
| 1146089-80-6 | BrC1=CC=C(OC2CN(C(OC(C)(C)C)=O)C2)C=N1 | 1-BOC-3-((6-BROMOPYRIDIN-3-YL)OXY)AZETIDINE | AG000ETM | 3g |
| 114615-82-6 | CCC[N+](CCC)(CCC)CCC.O=[Ru](=O)([O-])=O | Tetrapropylammonium perruthenate | AG000ETO | 250g |
| 1146214-95-0 | CC1(C)C(C)(C)OB(C2=C(C=CC(=C2)C(F)(F)F)Cl)O1 | 2-Chloro-5-(trifluoromethyl)phenylboronic acid pinacol ester | AG000EUB | 5g |
| 1146169-44-9 | COCCOCC1=CC=C(B(O)O)C=C1 | 4-[(2-methoxyethoxy)methyl]phenylboronic acid | AG000EUF | 6g |
| 1146162-54-0 | C[Si](CCOCN1N=C(B2OC(C)(C)C(C)(C)O2)C=C1)(C)C | 3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1-((2-(trimethylsilyl)ethoxy) | AG000EUG | 8g |
| 114622-81-0 | N=C(N)NCCC[C@@H](C(O)=O)NC(OC(C)(C)C)=O.[H]Cl.[H]O[H] | Boc-Arg-OH HCl H2O | AG000EUK | 500g |
| 1146298-61-4 | CC1=C(Br)C2=C(C=C1)C=NC=C2 | 5-Bromo-6-methylisoquinoline | AG000EVM | 10g |
| 1146290-36-9 | O=S(C1=CC=C([N+]([O-])=O)C=C1F)(Cl)=O | 2-Fluoro-4-nitrobenzene-1-sulfonyl chloride | AG000EVO | 175g |
| 1150271-44-5 | O=C1NC2=C(C(B3OC(C)(C)C(C)(C)O3)=CC=C2)C1 | Oxindole-4-boronic acid, pinacol ester | AG000FQ1 | 30g |
| 1150271-42-3 | O=C(C1=CC=CC2=C1NC(B3OC(C)(C)C(C)(C)O3)=C2)OC | 7-(Methoxycarbonyl)indole-2-boronic acid, pinacol ester | AG000FQ2 | 25g |
| 1150271-36-5 | FC(F)(F)OC=1C=C(O[Si](C)(C)C(C)(C)C)C=C(C1)B2OC(C)(C)C(O2)(C)C | 3-(t-Butyldimethysilyloxy)-5-trifluoromethoxyphenylboronic acid, pinacol es | AG000FQ4 | 20g |
| 1150271-35-4 | O=C(N(CC)CC)C1=CC=CC(B2OC(C)(C)C(C)(C)O2)=C1F | 3-(Diethylcarbamoyl)-2-fluorophenylboronic acid, pinacol ester | AG000FQ5 | 20g |
| 1150271-34-3 | Br.O=Cc1cnccc1Br | 4-Bromo-3-formylpyridine, HBr | AG000FQ6 | 25g |
| 1150271-33-2 | O=C(N1CCN(C2=CC=C(Br)C=C2)CC1)OCC3=CC=CC=C3 | Benzyl 4-(4-bromophenyl)piperazine-1-carboxylate | AG000FQ7 | 10g |
| 1150271-76-3 | COc1cc(B2OC(C(O2)(C)C)(C)C)c(cc1OC)F | 2-Fluoro-4,5-dimethoxyphenylboronic acid, pinacol ester | AG000FQD | 0.5g |
| 1150271-75-2 | Fc1cc(C)c(cc1B1OC(C(O1)(C)C)(C)C)C | 2-Fluoro-4,5-dimethylphenylboronic acid, pinacol ester | AG000FQE | 2g |
| 1150271-74-1 | CC1(C)C(C)(C)OB(C2=CC=C(CBr)C(F)=C2)O1 | 4-Bromomethyl-3-fluorophenylboronic acid, pinacol ester | AG000FQF | 50g |
| 1150271-63-8 | O=C(OCC)C1=CC(B2OC(C)(C)C(C)(C)O2)=CC(C)=C1 | 3-(Ethoxycarbonyl)-5-methylphenylboronic acid, pinacol ester | AG000FQP | 10g |
| 1150271-62-7 | CC1(C)C(C)(C)OB(C2=CC(O[Si](C)(C(C)(C)C)C)=CC(F)=C2F)O1 | 5-(t-Butyldimethylsilyloxy)-2,3-difluorophenylboronic acid, pinacol ester | AG000FQQ | 20g |
| 1150271-61-6 | O=C(OC)C1=CC(C(F)(F)F)=CC(B2OC(C)(C)C(C)(C)O2)=C1 | 3-(Methoxycarbonyl)-5-trifluoromethylphenylboronic acid, pinacol ester | AG000FQR | 10g |
| 115029-24-8 | OC(=O)C1=C(F)C=C(C=C1)C(F)(F)F | 2-Fluoro-4-(trifluoromethyl)benzoic acid | AG000FQX | 100g |
| 115029-23-7 | O=C(O)C1=CC(C(F)(F)F)=CC=C1F | 2-Fluoro-5-(trifluoromethyl)benzoic acid | AG000FQY | 572g |
| 115029-22-6 | OC(=O)C1=C(F)C(=CC=C1)C(F)(F)F | 2-Fluoro-3-(trifluoromethyl)benzoic Acid | AG000FQZ | 500g |
| 115028-67-6 | OC[C@@]1(C)CCC[C@@]2([C@@H]1CC[C@@]13[C@H]2CC[C@H](C3)C(=C1)C( | Pseudolaric acid D | AG000FR1 | 0.005g |
| 115035-46-6 | CC(C1=CC=C(NC([C@H]2N(C(CN)=O)CCC2)=O)C=C1O3)=CC3=O.Br | Glycyl-l-proline 7-amido-4-methylcoumarin hydrobromide | AG000FRI | 1g |
| 1150561-61-7 | FC(C1=CC(B2OC(C)(C)C(C)(C)O2)=CN=C1OC)(F)F | 2-Methoxy-3-(trifluoromethyl)pyridine-5-boronic acid, pinacol ester | AG000FRR | 25g |
| 1174029-29-8 | NC1=CC=C(Br)C=C1F.[H]Cl | 4-Bromo-2-fluoroaniline hydrochloride | AG000E9B | 100g |
| 1174028-22-8 | O=C(OC)C1=CN=C(C)C(Br)=C1 | Methyl 5-bromo-6-methylnicotinate | AG000E9C | 20g |
| 117406-91-4 | O[C@@H](C(=O)OC)[C@H](C)O | Methyl (2R,3S)-2,3-dihydroxybutanoate | AG000E9D | 0.2g |
| 117405-51-3 | O([C@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1)C2=C(OC)C=C(/C=C/C | (E)-Ferulic acid 4-O-β-D-glucoside | AG000E9G | 0.25g |
| 1174157-65-3 | O=C(ON1C(CCC1=O)=O)CCOCC#C | 2,5-Dioxopyrrolidin-1-yl 3-(prop-2-ynyloxy)propanoate | AG000E9H | 425g |
| 1174122-54-3 | C(=O)(OC)c1c2n(c(n1)C(F)(F)F)CCN(C2)C(=O)C[C@@H](Cc1c(F)cc(c(c1)F)F)N | Methyl 7-[(3R)-3-amino-1-oxo-4-(2,4,5-trifluorophenyl)butyl]-5,6,7,8-tetrahy | AG000E9J | 0.05g |
| 117408-99-8 | [C@@H]1(N=C(OC1)c1ccccn1)c1ccccc1 | Pyridine, 2-[(4R)-4,5-dihydro-4-phenyl-2-oxazolyl]- | AG000E9Y | 32g |
| 117408-98-7 | CC([C@@H]1N=C(C2=NC=CC=C2)OC1)(C)C | (S)-4-TERT-BUTYL-2-(2-PYRIDYL)OXAZOLINE | AG000E9Z | 75g |
| 1174229-72-1 | O=C(OCC)CC1=CC=C(N)N=C1 | 3-Pyridineacetic acid, 6-amino-, ethyl ester | AG000EA6 | 35g |
| 117423-74-2 | COc1ccc(/C=CCCCCOc2ccc(cc2CCC(=O)O)C(=O)c2cccc(c2)C(=O)O)cc1 | LY223982 | AG000EA9 | 0.05g |
| 1174322-66-7 | OC(C1=NC=C(C2CC2)C=C1)=O | 5-Cyclopropylpicolinic acid | AG000EAZ | 1g |
| 1174321-06-2 | O=C(C1=NC=C(C(F)F)N=C1)O | 5-(difluoromethyl)pyrazine-2-carboxylic acid | AG000EB0 | 100g |
| 1174309-16-0 | NC1=CN(C(F)F)N=C1 | 1-(Difluoromethyl)-1H-pyrazol-4-amine | AG000EB1 | 45g |
| 1150114-30-9 | O=C(C1=NC=CC(B(O)O)=C1)OC | 2-(Methoxycarbonyl)pyridine-4-boronic acid | AG000FLT | 1.25g |
| 1150114-29-6 | OB(C1=C(F)C([N+]([O-])=O)=CC=C1)O | 2-Fluoro-3-nitrophenylboronic acid | AG000FLU | 1.25g |
| 1150114-28-5 | OB(O)C1=C(F)C(=CC=C1F)[N+]([O-])=O | 2,6-Difluoro-3-nitrophenylboronic acid | AG000FLV | 0.2g |
| 1150114-27-4 | O=C(OC(C)(C)C)NC1=CC(Br)=CC(F)=C1F | N-BOC 5-bromo-2,3-difluoroaniline | AG000FLW | 1.25g |
| 1150103-22-2 | N#CC1=C(CC)N=C(Cl)C=C1 | 6-Chloro-2-ethylnicotinonitrile | AG000FM0 | 0.1g |
| 1150102-47-8 | NC1=CC=CC(Br)=C1NC | 6-Bromo-N1-methylbenzene-1，2-diamine | AG000FM3 | 10g |
| 115010-11-2 | O=S(C1=CC=C(OCC2)C2=C1)(Cl)=O | 2,3-Dihydro-1-benzofuran-5-sulfonyl chloride | AG000FM6 | 200g |
| 1150114-69-4 | ClC1C=C(B(O)O)C=NC=1OC(C)C | 5-Chloro-6-isopropoxypyridine-3-boronic acid | AG000FM8 | 15g |
| 1150114-66-1 | Cc1cc(cc(c1)C(O)=O)B(O)O | 3-Carboxy-5-methylphenylboronic acid | AG000FMB | 5g |
| 1150114-63-8 | FC(C1=CC=C(B(O)O)C(F)=N1)(F)F | 2-Fluoro-6-(trifluoromethyl)pyridine-3-boronic acid | AG000FME | 5g |
| 1150114-62-7 | O=C(C1=C(B(O)O)C=CO1)OCC | 2-(Ethoxycarbonyl)furan-3-boronic acid | AG000FMF | 6g |
| 1150114-60-5 | O=[N+](C1=C(F)C=C(F)C=C1B(O)O)[O-] | 3,5-Difluoro-2-nitrophenylboronic acid | AG000FMH | 0.6g |
| 1150114-56-9 | FC1=CC(F)=CC(B(O)O)=C1OCC2=CC=CC=C2 | 2-(Benzyloxy)-3,5-difluorophenylboronic acid | AG000FML | 0.2g |
| 1150114-54-7 | OB(C1=CC(O[Si](C)(C(C)(C)C)C)=CC=C1OC)O | 5-(t-Butyldimethylsilyloxy)-2-methoxyphenylboronic acid | AG000FMN | 2g |
| 1150114-53-6 | FC1=CC=C(O[Si](C)(C(C)(C)C)C)C=C1B(O)O | 5-(t-Butyldimethylsilyloxy)-2-fluorophenylboronic acid | AG000FMO | 0.5g |
| 1150114-52-5 | OC1=CC=C(F)C(B(O)O)=C1 | 2-Fluoro-5-hydroxyphenylboronic acid | AG000FMP | 125g |
| 1150114-51-4 | OC1=C(F)C=C(F)C=C1B(O)O | 3,5-Difluoro-2-hydroxyphenylboronic acid | AG000FMQ | 50g |
| 1150114-50-3 | CCCOC1=CC=C(C=N1)B(O)O | 2-Propoxypyridine-5-boronic acid | AG000FMR | 2g |
| 1150114-47-8 | O=C(C1=CC2=C(C=C1)C=C(B(O)O)N2)OC | 6-(Methoxycarbonyl)indole-2-boronic acid | AG000FMU | 25g |
| 1150114-81-0 | O=C(OC)C1=CC(OC(F)(F)F)=CC=C1Br | Methyl 2-bromo-5-(trifluoromethoxy)benzoate | AG000FMY | 10g |
| 1150114-80-9 | C[N]2C1=CC(=CC=C1C=N2)B(O)O | 1-Methylindazole-6-boronic acid | AG000FMZ | 125g |
| 1150114-78-5 | OB(O)C1=C(Cl)C=CC(C=O)=C1 | 2-Chloro-5-formylphenylboronic acid | AG000FN1 | 25g |
| 1150114-77-4 | OB(O)C1=C(F)C=C(C=C1)C#N | 4-Cyano-2-fluorophenylboronic acid | AG000FN2 | 15g |
| 1150114-76-3 | O=C(C1=CC=C(B(O)O)C=C1)N2CCN(C(OC(C)(C)C)=O)CC2 | 4-(4-BOC-Piperazine-1-carbonyl)phenylboronic acid | AG000FN3 | 75g |
| 1150114-75-2 | B(O)(O)c1ccc(nc1)N1CCCC1 | Boronic acid, B-[6-(1-pyrrolidinyl)-3-pyridinyl]- | AG000FN4 | 20g |
| 1150114-74-1 | O=C(C1=CC=C(B(O)O)C=C1)N2CC(C(OCC)=O)CCC2 | 4-(3-(Ethoxycarbonyl)piperidine-1-carbonyl)phenylboronic acid | AG000FN5 | 4g |
| 1150114-73-0 | Cl.CN(C)C1=CC=C(C=C1)B(O)O | 4-(Dimethylamino)phenylboronic acid, HCl | AG000FN6 | 500g |
| 1150114-72-9 | ClC1=C(Br)C=C(B(O)O)S1 | 4-Bromo-5-chlorothiophene-2-boronic acid | AG000FN7 | 10g |
| 115016-95-0 | O[C@H](C(=O)O)CCC1=CC=CC=C1 | (S)-2-Hydroxy-4-phenylbutyric acid | AG000FN9 | 150g |
| 1150164-05-8 | O=C(C1=C(C2CC2)NN=C1)OC | Methyl 5-cyclopropylpyrazole-4-carboxylate | AG000FNY | 25g |
| 1150163-69-1 | COC(=O)C1=C(F)C(F)=CC(Br)=C1 | Methyl 5-bromo-2,3-difluorobenzoate | AG000FO9 | 20g |
| 1150164-92-3 | CC1=CC(C)=NN1C2=NC=C(Br)C=C2 | 5-Bromo-2-(3,5-dimethylpyrazol-1-yl)pyridine | AG000FOB | 0.5g |
| 1150164-88-7 | COC(=O)c1cc(=O)c2c([nH]1)c(F)c(cc2)Cl | Methyl 7-chloro-8-fluoro-4-hydroxyquinoline-2-carboxylate | AG000FOD | 15g |
| 1150164-82-1 | O=C(C1=NC2=C(F)C(Cl)=CC=C2C(Cl)=C1)OC | Methyl 4,7-dichloro-8-fluoroquinoline-2-carboxylate | AG000FOG | 25g |
| 1150164-80-9 | CCOC(=O)C(F)(F)C1=C(OC)C=CC=C1 | Ethyl 2,2-Difluoro-2-(2-Methoxyphenyl)Acetate | AG000FOH | 25g |
| 114804-77-2 | C(C1=CC=CC=C1)OC=1C=C2C=CC(=CC2=CC1)C(=O)O | 6-(Benzyloxy)-2-naphthoic acid | AG000F91 | 15g |
| 1148048-39-8 | O=C([C@@H]1N(C(OC(C)(C)C)=O)[C@]2([H])C[C@]2([H])C1)O | (1R,3R,5R)-2-BOC-2-AZABICYCLO[3.1.0]HEXANE-3-CARBOXYLIC ACID | AG000F9E | 15g |
| 1148130-30-6 | COC(CC1CC(=O)C1)=O | methyl 2-(3-oxocyclobutyl)acetate | AG000FA2 | 50g |
| 1148115-99-4 | CNC1CN(C1)c1nc(N)nc2c3CCCc3oc12 | 9-[3-(methylamino)azetidin-1-yl]-7-oxa-10,12-diazatricyclo[6.4.0.0²,⁶]dodeca- | AG000FA7 | 0.05g |
| 1148110-16-0 | COC1=CC(CBr)=CC=C1Br | 1-Bromo-4-(bromomethyl)-2-methoxybenzene | AG000FA9 | 30g |
| 114812-34-9 | CCN1CCC[C@H]1C(N)=O | (S)-(-)-1-Ethyl-2-pyrrolidinecarboxamide | AG000FAC | 75g |
| 114828-90-9 | C1(O)=CC=C(/C(/C2=CC=C(OCCNC)C=C2)=C(C2=CC=CC=C2)/CC)C=C1 | Endoxifen (E-isomer) | AG000FAS | 0.05g |
| 114821-24-8 | C(#N)C1=CC(=NC=C1)I | 4-Cyano-2-iodopyridine | AG000FB5 | 20g |
| 114834-79-6 | IC1=CC=C([C@H]2CC[C@H](CCCC)CC2)C=C1 | 1-(Trans-4-n-butylcyclohexyl)-4-iodobenzene | AG000FBL | 20g |
| 114834-02-5 | ClC1=NC=NC(N2C=CN=C2)=C1 | 4-chloro-6-(imidazol-1-yl)pyrimidine | AG000FBN | 20g |
| 114833-96-4 | COc1cc(C)nc(n1)-n1cccn1 | 4-Methoxy-6-methyl-2-(1H-pyrazol-1-yl)pyrimidine | AG000FBO | 0.5g |
| 114833-06-6 | CCOC(=O)/C=C/c1ccc2c(c1)cccc2 | 2-Propenoic acid, 3-(2-naphthalenyl)-, ethyl ester, (2E)- | AG000FBT | 5g |
| 114857-00-0 | CC(NC(=O)OC(C)(C)C)C=O | (1-Methyl-2-oxoethyl)carbamic acid tert-butyl ester | AG000FC7 | 25g |
| 114856-91-6 | C(N)(OC(C(C=O)(C)C)C1=CC=CC=C1)=O | 2,2-Dimethyl-3-oxo-1-phenylpropyl carbamate | AG000FC8 | 1g |
| 114853-62-2 | CC[C@@H](C1=CC=C(Cl)C=C1)N | (S)-1-(4-Chlorophenyl)propan-1-amine | AG000FCA | 25g |
| 114853-61-1 | CC[C@H](C1=CC=C(C=C1)Cl)N | (R)-1-(4-Chlorophenyl)propan-1-amine hydrochloride | AG000FCB | 2g |
| 114971-53-8 | CC1=CC(I)=C(C)C=C1O | 2,5-Dimethyl-4-iodophenol | AG000FIR | 50g |
| 114971-52-7 | C[N+](C)(CC1=CC=CC=C1)C.Cl[I-]Cl | Benzyltrimethylammonium dichloroiodate | AG000FIS | 500g |
| 114969-94-7 | COC1=NC=NC=C1Cl | 5-Chloro-4-methoxypyrimidine | AG000FIU | 2g |
| 114997-91-0 | FC(C1=CC=C(OC(Cl)=N2)C2=C1)(F)F | 2-Chloro-5-(trifluoromethyl)benzo[d]oxazole | AG000FIY | 10g |
| 114991-26-3 | C(C)(C)C1=C(O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)C(=O)O)O)O)O)C(=C | (2S,3S,4S,5R,6S)-6-(2,6-Diisopropylphenoxy)-3,4,5-trihydroxytetrahydro-2H-p | AG000FJA | 0.005g |
| 115-46-8 | OC(C1=CC=CC=C1)(C2=CC=CC=C2)C3CCNCC3 | alpha,alpha-Diphenyl-4-piperidinomethanol | AG000FJN | 11000g |
| 115-22-0 | CC(C(C)(O)C)=O | 3-Hydroxy-3-methyl-2-butanone | AG000FJU | 335g |
| 115-20-8 | ClC(Cl)(Cl)CO | 2,2,2-Trichloroethanol | AG000FJW | 10000g |
| 115-18-4 | CC(C=C)(O)C | 2-methylbut-3-en-2-ol | AG000FJX | 175g |
| 115-02-6 | O(C[C@@H](C(O)=O)N)C(C=[N+]=[N-])=O | (2S)-2-Amino-3-[(2-diazoacetyl)oxy]propanoic acid | AG000FK4 | 0.4g |
| 115-95-7 | O=C(OC(C=C)(C)CCC=C(C)C)C | Linalyl Acetate | AG000FK5 | 225g |
| 115-89-9 | COP(=O)(Oc1ccccc1)Oc2ccccc2 | Diphenyl Methyl Phosphate | AG000FK9 | 2g |
| 115-87-7 | CC(C)(C)c1ccc(OP(=O)(Oc2ccccc2)Oc3ccc(cc3)C(C)(C)C)cc1 | Phenyl Di-p-tert-butylphenyl Phosphate | AG000FKB | 2.5g |
| 114524-80-0 | COC(=O)C(C)(N)Cc1c[nH]c2ccccc12 | Methyl 2-amino-3-(1H-indol-3-yl)-2-methylpropanoate | AG000EMZ | 3g |
| 114531-28-1 | C[C@@]12[C@@]3([C@]4([C@]5([C@]6([C@@](C3)(O[C@@]4(N7[C@]1(OCC7 | (15α,19S)-23-Deoxy-19,23-epoxyajaconine acetate | AG000ENX | 0.005g |
| 114559-25-0 | O=C(OC)[C@@H](N)CNC(OC(C)(C)C)=O.[H]Cl | H-DAP(BOC)-OME HCL | AG000EO4 | 100g |
| 114567-47-4 | C[C@]1(CC[C@]2([H])[C@H](C)CC/C=C(CO)/CO)C(C3=CC[C@@]12C)=CC[C@](C | Ganoderiol F | AG000EOP | 0.01g |
| 114567-34-9 | C12C(O)OC3=CC=CC=C3C=1C(=O)C1=C(O)C(C)=C(O)C=C1O2 | Boeravinone B | AG000EOS | 0.005g |
| 1145678-74-5 | CC1=CC=C(C=C1)S(=O)(=O)N1C=CC2=C1C=CC=C2CN | (1-Tosyl-1H-indol-4-yl)methanamine | AG000EPG | 0.5g |
| 1145671-38-0 | O=C(C(C)(C)C)Oc1cc2c(Cl)ncnc2cc1O | 4-Chloro-7-hydroxyquinazolin-6-yl pivalate | AG000EPI | 2g |
| 1145671-36-8 | OC1=CC2=C(Cl)N=CN=C2C=C1O | 4-Chloroquinazoline-6,7-diol | AG000EPJ | 1g |
| 1145753-88-3 | O=C(N1CC2=C(C=CC=C2)C(N)C1)OC(C)(C)C | tert-Butyl 4-amino-3,4-dihydroisoquinoline-2(1H)-carboxylate | AG000EQ3 | 15g |
| 114578-70-0 | O=C(C1=NC(C(C)=O)=CC=C1)OCC | Ethyl 6-acetylpyridine-2-carboxylate | AG000EQ5 | 2g |
| 114569-84-5 | C[N+]1=CN(CCCCCCCCCCCC)C=C1.[Cl-] | 1-Dodecyl-3-methylimidazolium chloride | AG000EQR | 1500g |
| 1145786-74-8 | N[C@H](C1=CC=C(F)C=C1)CC.[H]Cl | (1S)-1-(4-Fluorophenyl)propylamine hydrochloride | AG000EQU | 8g |
| 114590-73-7 | CC(C1=CC=CC(OC(C)C)=C1)=O | 1-(3-Isopropoxyphenyl)Ethanone | AG000ERP | 50g |
| 1146045-40-0 | OC[C@H]1O[C@@H](Oc2c(O[C@@H]3O[C@H](C(=O)O)[C@H]([C@@H]([C@H] | β-D-Glucopyranosiduronic acid, 6-(β-D-glucopyranosyloxy)-5-hydroxy-2-(4-hy | AG000ES5 | 0.005g |
| 114606-56-3 | N1(CCOC)C2=C(N(C)C(=O)N(C)C2=O)N=C1N[C@H](C1=CC=C(OC)C(OC)=C1)CO | SDZ-MKS 492 | AG000ESA | 0.01g |
| 114605-75-3 | COC1=C(OC)C(O)=C(Br)C=C1 | 6-Bromo-2,3-dimethoxyphenol | AG000ESD | 35g |
| 1150561-58-2 | O=C(OCC)C1=C(C)N=CC(B2OC(C)(C)C(C)(C)O2)=C1 | 5-(Ethoxycarbonyl)-6-methylpyridine-3-boronic acid, pinacol ester | AG000FRT | 3g |
| 1150561-57-1 | CC1(C)C(C)(C)OB(C2=CC(OC)=C(F)C=C2F)O1 | 2,4-Difluoro-5-methoxyphenylboronic acid, pinacol ester | AG000FRU | 5g |
| 1150560-59-0 | O=C1NC(C(C2=CC=CC(OC)=C2F)=C(C)N1CC3=C(C(F)(F)F)C=CC=C3F)=O | 5-(2-Fluoro-3-methoxyphenyl)-1-(2-fluoro-6-(trifluoromethyl)benzyl)-6-met | AG000FRY | 300g |
| 1150560-54-5 | O=C1NC(C(I)=C(C)N1CC2=C(C(F)(F)F)C=CC=C2F)=O | 1-(2-Fluoro-6-(trifluoromethyl)benzyl)-5-iodo-6-methylpyrimidine-2,4(1H,3H | AG000FRZ | 400g |
| 1150566-27-0 | O=C(C1=CN=C2C=CC(Cl)=NN21)OCC | Ethyl 6-chloroimidazo[1,2-b]pyridazine-3-carboxylate | AG000FSG | 300g |
| 1150561-84-4 | BrC1=C(N2CCCC2)N=CC=C1 | 3-Bromo-2-pyrrolidinopyridine | AG000FSH | 14.4g |
| 1150561-81-1 | O=C(O)C1=C(Br)N=CC=C1O | 2-Bromo-4-hydroxynicotinic acid | AG000FSK | 3g |
| 1150561-77-5 | C(CC(=O)OC)B1OC(C(O1)(C)C)(C)C | Methyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate | AG000FSO | 50g |
| 1150561-76-4 | CC(N1N=CC(B2OC(C)(C)C(C)(C)O2)=C1)=O | 1-Acetyl-1H-pyrazole-4-boronic acid, pinacol ester | AG000FSP | 100g |
| 1150561-71-9 | CC1=CC(=CN=C1F)B1OC(C)(C)C(C)(C)O1 | 2-Fluoro-3-methylpyridine-5-boronic acid, pinacol ester | AG000FSU | 15g |
| 1150561-70-8 | N#CC1=NC=C(B2OC(C)(C)C(C)(C)O2)C=C1C | 2-Cyano-3-methylpyridine-5-boronic acid, pinacol ester | AG000FSV | 125g |
| 1150561-68-4 | O=C(N1CCN(C2=CC=C(B3OC(C)(C)C(C)(C)O3)C=C2)CC1)OCC4=CC=CC=C4 | 4-(4-Cbz-piperazinyl)phenylboronic acid, pinacol ester | AG000FSX | 1.25g |
| 1150561-67-3 | O=C(O)C1=CC(B2OC(C)(C)C(C)(C)O2)=CC(C)=C1 | 3-Carboxy-5-methylphenylboronic acid, pinacol ester | AG000FSY | 10g |
| 1150561-66-2 | COc1cc(cc(n1)C(F)(F)F)B1OC(C(O1)(C)C)(C)C | 2-Methoxy-6-trifluoromethylpyridine-4-boronic acid, pinacol ester | AG000FSZ | 2g |
| 1150561-64-0 | Cl.CC(=O)NC1=NC=C(C=C1)B1OC(C)(C)C(C)(C)O1 | 2-Acetamidopyridine-5-boronic acid, pinacol ester, HCl | AG000FT1 | 0.2g |
| 1150561-63-9 | O=C(OC)C1=CC(OC(F)(F)F)=CC(B2OC(C)(C)C(C)(C)O2)=C1 | 3-Methoxycarbonyl-5-trifluoromethoxylphenylboronic acid, pinacol ester | AG000FT2 | 1g |
| 1150618-05-5 | O=C(C1=CN=C(NN=C2C)C2=C1)OC | METHYL 3-METHYL-1H-PYRAZOLO[3,4-B]PYRIDINE-5-CARBOXYLATE | AG000FT6 | 25g |
| 1150618-04-4 | NC1=NC=C(Br)C(C)=C1I | 5-Bromo-3-iodo-4-methylpyridin-2-amine | AG000FT7 | 60g |
| 1154740-87-0 | Nc1c2c(ccc1OC)CCC2=O | 7-Amino-6-methoxy-2,3-dihydro-1H-inden-1-one | AG000G0T | 10g |
| 115473-15-9 | O=C1C=C2CNCCC2S1.[H]Cl | 5,6,7,7A-Tetrahydrothieno[3,2-c]pyridine-2(4h)-one, HCl | AG000G0Z | 300g |
| 115467-08-8 | CCOC1=C(F)C=C(Br)C=C1 | 4-BROMO-1-ETHOXY-2-FLUOROBENZENE | AG000G10 | 75g |
| 115467-07-7 | FC1=C(C(=CC(=C1)Br)F)OC(F)(F)F | 3,5-Difluoro-4-(trifluoromethoxy)bromobenzene | AG000G11 | 300g |
| 115467-04-4 | C1(OCC)C(F)=CC(Br)=CC=1F | 5-Bromo-2-ethoxy-1,3-difluorobenzene | AG000G12 | 20g |
| 1154870-59-3 | N(C(=O)OC(C)(C)C)C1CC(CC1)O | tert-Butyl (3-hydroxycyclopentyl);carbamate | AG000G1H | 175g |
| 1154762-01-2 | CC(OC1=CC=C(B(O)O)C(F)=C1F)C | 2,3-Difluoro-4-isopropoxyphenylboronic acid | AG000G1J | 2g |
| 1154743-11-9 | COC(=O)C1=CC=C2N=C(C=CC2=C1)C(F)(F)F | Methyl 2-(trifluoromethyl)quinoline-6-carboxylate | AG000G1M | 15g |
| 1154742-51-4 | FC1=C(Br)C(F)=C2C(NC=C2)=C1 | 5-Bromo-4,6-difluoro-1H-indole | AG000G1N | 25g |
| 115478-59-6 | CCCOc1ccc(cc1)C(=O)OC | 4-Propoxy-benzoic acid methyl ester | AG000G22 | 2g |
| 1154970-04-3 | O=C(C1=C2C(OCCO2)=CC=C1)N3C(CO)CCCC3 | (2,3-Dihydrobenzo[b][1,4]dioxin-5-yl)(2-(hydroxymethyl)piperidin-1-yl)meth | AG000G24 | 0.5g |
| 1154969-99-9 | O=C(C1=C2C(OCCO2)=CC=C1)N3CCC(O)CC3 | (2,3-Dihydrobenzo[b][1,4]dioxin-5-yl)(4-hydroxypiperidin-1-yl)methanone | AG000G25 | 0.3g |
| 1154890-42-2 | O1CCC(CC1)NC1=C(C(=O)OC)C=CC=C1 | Methyl 2-((tetrahydro-2H-pyran-4-yl)amino)benzoate | AG000G28 | 2g |
| 115491-96-8 | C=CCOC(=O)N[C@H](C(=O)O)C(C)C | N-[(2-Propenyloxy)carbonyl]-L-valine | AG000G2H | 10g |
| 115491-93-5 | C=CCOC(=O)OC(=O)OCC=C | Diallyl Dicarbonate | AG000G2I | 5g |
| 1155-51-7 | O=C(O)C1=CC=C(SSC2=CC=C(C=C2)C(O)=O)C=C1 | 4,4′-Dithiobisbenzoic Acid | AG000G2O | 125g |
| 1155-40-4 | OC(CC1=CC(I)=C(OC2=CC=C(O)C=C2)C(I)=C1)=O | 2-(4-(4-Hydroxyphenoxy)-3,5-diiodophenyl)acetic acid | AG000G2Q | 0.2g |
| 1155-00-6 | S(C1C=CC=CC=1[N+]([O-])=O)SC1C=CC=CC=1[N+]([O-])=O | Bis(2-nitrophenyl) disulfide | AG000G2S | 6000g |
| 1171511-34-4 | O=C(C1CNCC(O)C1)O.[H]Cl | 5-Hydroxypiperidine-3-carboxylic acid, HCl | AG000DTC | 1.25g |
| 1171506-89-0 | N(CCC12CCNCC1)(CC2)CC3=CC=CC=C3.Cl.Cl | 3-Benzyl-3,9-diazaspiro[5.5]undecane dihydrochloride | AG000DTD | 50g |
| 1171697-10-1 | NCC1=CC(Br)=CS1.[H]Cl | (4-Bromothiophen-2-yl)methanamine, HCl | AG000DTT | 47g |
| 117169-30-9 | OCC1(CCCCC1)F | (1-Fluorocyclohexyl)methanol | AG000DUA | 1g |
| 117176-16-6 | O=C(C[C@@H](C(=O)OCc1ccccc1)NCc1ccccc1)OCc1ccccc1 | L-Aspartic acid, N-(phenylmethyl)-, 1,4-bis(phenylmethyl) ester | AG000DUP | 60g |
| 117174-84-2 | S=C(N)NC1=CC=C(C)C(Cl)=C1 | 1-(3-Chloro-4-methylphenyl)thiourea | AG000DUU | 0.75g |
| 117174-70-6 | NC1=CC(C)=C(OC)C=C1C | 4-Methoxy-2,5-dimethylaniline | AG000DUV | 15g |
| 1149352-55-5 | CC1=CC(C(O)=O)=C(C=C1)N1C=CN=N1 | 5-Methyl-2-(1H-1,2,3-triazol-1-yl)benzoic acid | AG000FG9 | 10g |
| 114935-92-1 | O=C(C1=NC2=CC=CC=C2C(Cl)=C1)OC | Methyl 4-chloroquinoline-2-carboxylate | AG000FGG | 20g |
| 114932-60-4 | O=C(ON5C(CCC5=O)=O)CCCC1=C(C2=C34)C=CC4=CC=CC3=CC=C2C=C1 | 1-Pyrenebutyric acid N-hydroxysuccinimide ester | AG000FGK | 125g |
| 114926-39-5 | C([C@H](C(=O)O)N)c1cc(C)ccc1 | (R)-2-Amino-3-(m-Tolyl)Propanoic Acid | AG000FGR | 50g |
| 114926-38-4 | O=C(O)[C@@H](N)CC1=CC=C(C(F)(F)F)C=C1 | 4-(Trifluoromethyl)-L-phenylalanine | AG000FGS | 10g |
| 114926-37-3 | N[C@@H](CC1=CC=CC(C)=C1)C(O)=O | L-3-Methylphenylalanine | AG000FGT | 100g |
| 1149587-02-9 | O=CC1=CC=NC(F)=C1Cl | 3-Chloro-2-fluoropyridine-4-carbaldehyde | AG000FGV | 50g |
| 1149388-51-1 | O=C(OC)C1=CC([N+]([O-])=O)=C(C#N)C=C1F | Methyl 4-cyano-2-fluoro-5-nitrobenzoate | AG000FGX | 15g |
| 1149383-12-9 | C[C@H](N)C1=CC=C(OC)C=C1F.[H]Cl | (S)-1-(2-Fluoro-4-methoxyphenyl)ethanamine hydrochloride | AG000FH1 | 3g |
| 114953-81-0 | O=C(NN)CC1=CC=CC=C1[N+]([O-])=O | 2-(2-Nitrophenyl)acetohydrazide | AG000FH5 | 25g |
| 114969-66-3 | N#CC1=NC=NC=C1Br | 4-Cyano-5-bromopyrimidine | AG000FHN | 10g |
| 114969-64-1 | N#CC1=NC=NC=C1OC | 5-Methoxypyrimidine-4-carbonitrile | AG000FHO | 0.2g |
| 1149705-71-4 | N(C(=O)C1=CC(N[C@@H](CC)C)=C(C(N)=O)C=C1C)[C@H]2C[C@@H]3N([C@H]( | XL888 | AG000FIA | 0.035g |
| 114973-22-7 | NC1=CC(F)=C(C=C1F)C(F)(F)F | 4-Amino-2,5-difluorobenzotrifluoride | AG000FIM | 25g |
| 1150618-36-2 | FC(C1=CNC2=NC=C(Br)C=C21)(F)F | 5-Bromo-3-(trifluoromethyl)-1H-pyrrolo[2，3-b]pyridine | AG000FU1 | 15g |
| 1150618-23-7 | CC(=O)C1=CC2=C(C=C1)N=CC(Br)=C2 | 1-(3-Bromoquinolin-6-yl)ethanone | AG000FU5 | 2g |
| 1150618-22-6 | N1C2C(=CC=C(C(O)=O)C=2)C(O)=CC=1 | 4-Hydroxyquinoline-7-carboxylic acid | AG000FU6 | 0.5g |
| 1150618-20-4 | Cc1cc(Cl)c2ccc(cc2n1)C(O)=O | 4-CHLORO-2-METHYLQUINOLINE-7-CARBOXYLIC ACID | AG000FU8 | 3g |
| 1150697-96-3 | C=CCCC[C@H](C(=O)O)NC(=O)OC(C)(C)C | 6-Heptenoic acid, 2-[[(1,1-dimethylethoxy)carbonyl]amino]-, (2R)- | AG000FUK | 2g |
| 1150655-12-1 | F[B-](F)(C1=CC=C(C(F)(F)F)C=C1F)F.[K+] | Potassium 2-fluoro-4-(trifluoromethyl)phenyltrifluoroborate | AG000FUL | 3g |
| 1150655-04-1 | F[B-](F)(CN(C)C)F.[K+] | Potassium dimethylaminomethyltrifluoroboronate | AG000FUM | 75g |
| 1150655-02-9 | CC(C)(C)C[B-](F)(F)F.[K+] | 2,2-Dimethylpropyl trifluoroborate potassium salt | AG000FUN | 175g |
| 1150654-80-0 | F[B-](F)(F)CN1CCSCC1.[K+] | Potassium 4-trifluoroboratomethylthiomorpholine | AG000FUP | 5.25g |
| 1150654-57-1 | F[B-](F)(C1=CC=C(OCC(OCC)=O)C=C1)F.[K+] | Ethyl phenoxyacetate-4-trifluoroborate potassium salt | AG000FUS | 5g |
| 1150633-16-1 | N#CC1=CN=CN=C1C | 4-Methylpyrimidine-5-carbonitrile | AG000FUW | 2g |
| 1150632-93-1 | CC1(C)C(C)(C)OB(C2=CN=C(C(OC)OC)C=C2)O1 | 2-(dimethoxymethyl)pyridine-5-boronic acid pinacol ester | AG000FUX | 75g |
| 115074-43-6 | O.O.O[C@H]1[C@@H](OC[C@@H]([C@H]1O)C[C@@H]1O[C@H]1[C@@H](C)[ | Calcium 9-(((E)-4-((2S,3R,4R,5S)-3,4-dihydroxy-5-(((2S,3S)-3-((2S,3S)-3-hydrox | AG000FUY | 30g |
| 115066-14-3 | [O-][N+](=O)C1=C(C=C2NC(=O)C(=O)NC2=C1)C#N | 7-Nitro-2,3-dioxo-1,2,3,4-tetrahydroquinoxaline-6-carbonitrile | AG000FV3 | 2g |
| 115065-79-7 | O=C(O)/C(C1=CSC(NC(OCC2=CC=CC=C2)=O)=N1)=C/CC(OC/C=C(C)/C)=O | (E,Z)-2-(2-Benzyloxycarbonylamino-4-thiazol)-4-(3-methyl-2-butenyloxycarb | AG000FV5 | 0.75g |
| 115063-93-9 | S2(C1(=C(N=CC(=C1)O)C=C2)) | Thieno[3,2-b]pyridin-6-ol | AG000FV7 | 0.05g |
| 115091-29-7 | CC(C1=CC(C2=CC(C(C)(C)C)=CC(C3=NC=CC(C(C)(C)C)=C3)=N2)=NC=C1)(C)C | 4,4′,4”-Tri-tert-butyl-2,2′:6′,2”-terpyridine | AG000FV9 | 25g |
| 115088-06-7 | O=C(ON1C(CCC1=O)=O)CCCSSC2=NC=CC=C2 | N-Succinimidyl 4-(2-pyridyldithio)butanoate | AG000FVD | 0.5g |
| 1150164-78-5 | OC(C(C1=C(Cl)C=CC=C1)(F)F)=O | 2-(2-Chlorophenyl)-2,2-difluoroacetic acid | AG000FOI | 6g |
| 1150271-26-3 | O=C(C1=C(Br)OC(Br)=C1)OC | Methyl 2,5-dibromofuran-3-carboxylate | AG000FOZ | 0.75g |
| 1150271-25-2 | O=C(C1=CNC(O1)=O)OCC | Ethyl 2-oxo-2,3-dihydrooxazole-5-carboxylate | AG000FP0 | 3g |
| 1150271-24-1 | Brc1cnn(c1)CC1CCCCC1 | 4-Bromo-1-(cyclohexylmethyl)pyrazole | AG000FP1 | 9g |
| 1150271-23-0 | C(C)(C)(C)OC(=O)[N]1C=C(C=N1)Br | 1-BOC-4-bromopyrazole | AG000FP2 | 1000g |
| 1150271-14-9 | CC1=C2C(=CC(=C1)F)C=CC=N2 | 6-Fluoro-8-methylquinoline | AG000FPA | 30g |
| 115021-39-1 | O=CC1=CC=CC(=C1)C#CC1=CC=CC=C1 | 3-(Phenylethynyl)benzaldehyde | AG000FPM | 6g |
| 1150271-60-5 | CCOC(C1SC(B2OC(C)(C)C(C)(C)O2)=CC=1)=O | 5-(Ethoxycarbonyl)thiophene-2-boronic acid, pinacol ester | AG000FPO | 10g |
| 1150271-57-0 | CC(NC1=CC(C(F)(F)F)=CC=C1B2OC(C)(C)C(C)(C)O2)=O | 2-Acetamido-4-(trifluoromethyl)phenylboronic acid, pinacol ester | AG000FPR | 10g |
| 1150271-55-8 | CC(=O)Nc1ccc(F)cc1B2OC(C)(C)C(C)(C)O2 | 2-Acetamido-5-fluorophenylboronic acid, pinacol ester | AG000FPT | 3g |
| 1150271-54-7 | CC1(C)C(C)(C)OB(C2=C3OCOC3=CC(Br)=C2)O1 | 5-Bromo-2,3-methylenedioxyphenylboronic acid pinacol ester | AG000FPU | 2g |
| 1150271-53-6 | CC1(C)C(C)(C)OB(C2=CC=CC=C2CNCC3=CC=CC=C3)O1 | 2-(N-Benzylaminomethyl)phenylboronic acid, pinacol ester | AG000FPV | 25g |
| 1150271-52-5 | CC1(C)C(C)(C)OB(C2=CC=CC=C2CNC3CC3)O1 | 2-(N-Cyclopropylaminomethyl)phenylboronic acid, pinacol ester | AG000FPW | 2g |
| 1150271-51-4 | COCCNCC1=CC=CC=C1B2OC(C)(C)C(C)(C)O2 | 2-(2-Methoxyethyl)aminomethylphenylboronic acid, pinacol ester | AG000FPX | 1g |
| 1150271-47-8 | CC1(C)C(C)(C)OB(C2=CC=CC=C2CNC)O1 | 2-(N-Methylaminomethyl)phenylboronic acid, pinacol ester | AG000FPZ | 10g |
| 1150271-45-6 | CC1(C)OB(OC1(C)C)C1=CC=CC2=CC(=O)N=C12 | 7-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)indolin-2-one | AG000FQ0 | 10g |
| 1155080-09-3 | ClC1=NC=C(C=N1)S(=O)(=O)N | 2-Chloropyrimidine-5-sulfonamide | AG000G2T | 2g |
| 115509-13-2 | O=C1C=C[C@]2([H])[C@@]1([H])OC(C)(C)O2 | (-)-(3aR,6aR)-3a,6a-Dihydro-2,2-dimethyl-4h-cyclopenta-1,3-dioxol-4-one | AG000G30 | 125g |
| 1155-62-0 | C(OC(=O)N[C@@H](CCC(=O)O)C(=O)O)c1ccccc1 | N-[(Phenylmethoxy)carbonyl]-L-glutamic acid | AG000G3D | 2000g |
| 1155287-27-6 | O=C(C1=CC(Br)=C2N=C(N)SC2=C1)OC | Methyl 2-amino-4-bromobenzo[d]thiazole-6-carboxylate | AG000G3I | 0.2g |
| 1155264-46-2 | CC1(C)C(C)(C)OB(C2=CC=C3OCCNC3=C2)O1 | 6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-2H-benzo[b][1,4 | AG000G3J | 2g |
| 1155146-72-7 | CC(NC1=CC=CC(F)=C1C#N)=O | N-(2-Cyano-3-fluorophenyl)acetamide | AG000G3M | 40g |
| 115520-21-3 | C(SC[C@H](NC(=O)OCC1C2=CC=CC=C2C2=CC=CC=C12)C(=O)OC1=C(F)C(=C(F)C(F | Fmoc-Cys(Trt)-OPfp | AG000G3R | 200g |
| 115514-77-7 | NCC1=CC=C(OC)C(Cl)=C1 | 3-Chloro-4-methoxybenzenemethanamine | AG000G3W | 50g |
| 1253-84-5 | C[C@H](CCCC(C)C)[C@@]1([H])CC[C@@]2([H])[C@]3([H])C[C@@H](O)[C@@] | (3S,5R,6R,8S,9S,10R,13R,14S,17R)-10,13-Dimethyl-17-((R)-6-methylheptan-2-y | AG000G45 | 0.25g |
| 1155306-28-7 | O=C(N1CCN(C2=NC(Cl)=NC(Cl)=C2)CC1)OC(C)(C)C | tert-Butyl 4-(2,6-dichloropyrimidin-4-yl)piperazine-1-carboxylate | AG000G4A | 1.25g |
| 115532-52-0 | O=C(OCC)C(C=CC=C1)=C1C2=C3C=CC(N(C)C)=CC3=[O+]C4=C2C=CC(N(C)C)=C4.O | Tetramethylrhodamine ethyl ester perchlorate | AG000G4R | 0.5g |
| 1155505-48-8 | N#CC1=CC=C(CN2CC(CO)CCC2)C=C1 | 4-((3-(Hydroxymethyl)piperidin-1-yl)methyl)benzonitrile | AG000G51 | 0.2g |
| 115551-46-7 | O=C(OCC1=CC=CC=C1)NC2CNCC2 | 3-N-Cbz-aminopyrrolidine | AG000G58 | 30g |
| 115551-33-2 | NC1=CC=C(F)C(F)=C1O | 3,4-Difluoro-2-hydroxyaniline | AG000G59 | 50g |
| 115550-35-1 | O=C(O)C1=CN2C3=C(C1=O)C=C(C(N4CCN(CC4)C)=C3OCN2C)F | Marbofloxacin | AG000G5G | 300g |
| 115560-38-8 | O=CC1=CC(Cl)=CC=C1OCOC | 5-chloro-2-(methoxymethoxy)benzaldehyde | AG000G68 | 9g |
| 115081-94-2 | C1=CC2=C(C=C1I)NC(=O)OC2=O | 7-Iodo-1H-benzo[d][1,3]oxazine-2,4-dione | AG000FVS | 15g |
| 115074-93-6 | CCCCCCCCCCCCCC[C@@H](O)C(NC([C@H](O)/C=C/CC/C=C/CCCCCCCCC)CO[C | Soyacerebroside II | AG000FVV | 0.005g |
| 115093-90-8 | ClC1=NC=NC2=C1C(=C[NH]2)Cl | 4，5-Dichloro-7H-pyrrolo[2，3-d]pyrimidine | AG000FW7 | 100g |
| 115092-85-8 | C(C1=CNC2C=CC(C(=O)O)=CC1=2)CCCN1CC=C(C2C=CC=CC=2)CC1.[H]Cl | Carmoxirole (hydrochloride) | AG000FWC | 0.01g |
| 1151-98-0 | OC1=CC(O)=C(C=CC(C2=CC=C(O)C=C2)=[O+]3)C3=C1.[Cl-] | Apigeninidin (chloride) | AG000FWF | 0.01g |
| 1151-97-9 | [O-][N+](=O)c1cc(ccc1Cc1ccccn1)[N+](=O)[O-] | Pyridine, 2-[(2,4-dinitrophenyl)methyl]- | AG000FWG | 40g |
| 1151-94-6 | O=C(C1=CC=C([N+]([O-])=O)C=C1)C2=CC=C(OC)C=C2 | 4-Methoxy-4′-nitrobenzophenone | AG000FWH | 25g |
| 1153950-54-9 | N#C[C@H]1CNCC1.[H]Cl | (R)-Pyrrolidine-3-Carbonitrile Hydrochloride | AG000FWM | 5g |
| 1153950-49-2 | N#C[C@@H]1CNCC1.[H]Cl | (S)-Pyrrolidine-3-carbonitrile hydrochloride | AG000FWN | 30g |
| 1153949-38-2 | CC1(C)OB(OC1(C)C)C1=CN(N=C1)C(CC#N)C1CCCC1 | 3-Cyclopentyl-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazol- | AG000FWO | 75g |
| 1153949-11-1 | CC(C)(C)OC(=O)N1CC(C1)=CC#N | tert-butyl 3-(cyanomethylene)azetidine-1-carboxylate | AG000FWP | 500g |
| 1153907-60-8 | O=C(OCC1=CC=CC=C1)N2CCN(CC(O)=O)CC2 | 2-(4-(Benzyloxycarbonyl)Piperazin-1-Yl)Acetic Acid | AG000FWQ | 6g |
| 1153905-13-5 | CN1C(=CC=C1C1=CC=C(C=C1)C(F)(F)F)C(O)=O | 1-Methyl-5-[4-(trifluoromethyl)phenyl]pyrrole-2-carboxylic Acid | AG000FWR | 0.2g |
| 1153885-37-0 | O=C1CC2=CC(Br)=C(Cl)C=C2N1 | 5-Bromo-6-Chloro-2,3-Dihydro-1H-Indol-2-One | AG000FWS | 7g |
| 115393-77-6 | CC(C)(C)OC(=O)N1CCC[C@H]1C=C | (S)-tert-butyl 2-vinylpyrrolidine-1-carboxylate | AG000FWY | 150g |
| 1153974-98-1 | O=C(O)C1=C(Br)C=CC(F)=C1N | 2-amino-6-bromo-3-fluorobenzoic acid | AG000FXB | 30g |
| 30536-19-7 | NC1=C(Cl)C=CC2=NSN=C21 | 4-Amino-5-chloro-2,1,3-benzothiadiazole | AG000FXS | 250g |
| 1154-25-2 | O=C(C1=NC(Cl)=C(N(CC)C(C)C)N=C1N)NC(N)=N | 5-(N-Ethyl-n-isopropyl)amiloride | AG000FXV | 0.2g |
| 115173-73-4 | COCc1cn([C@H]2C[C@@H]([C@H](O2)COC(c2ccc(cc2)OC)(c2ccc(cc2)OC)c2ccccc | Thymidine, 5′-O-[bis(4-methoxyphenyl)phenylmethyl]-α-methoxy- | AG000GDJ | 25g |
| 115171-04-5 | NNC1=CC=C(OCC(F)(F)F)C=C1.[H]Cl | 4-(2,2,2-Trifluoroethoxy)phenyl hydrazine, HCl | AG000GDO | 2g |
| 115170-40-6 | BrC1=CN=C(NCC2)C2=C1 | 5-Bromo-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine | AG000GDP | 75g |
| 1151816-79-3 | ClC1=CC=C(N2C3=C(C4=C2C=CC=C4)C=C(Br)C=C3)C=C1 | 3-Bromo-9-(4-chlorophenyl)-9H-carbazole | AG000GDT | 3g |
| 1151814-36-6 | C1CC1N1C=CC=N1 | 1-Cyclopropyl-1H-pyrazole | AG000GDU | 5g |
| 1151802-23-1 | BrC1=CN(N=C1)C1CC1 | 4-Bromo-1-cyclopropyl-1H-pyrazole | AG000GDW | 200g |
| 1151802-22-0 | CC1(C)C(C)(C)OB(C2=CN(C3CC3)N=C2)O1 | 1-Cyclopropyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl);-1H-pyrazole | AG000GDX | 500g |
| 1151802-02-6 | C1=CN=C2C=C(C=NC2=C1Cl)F | 8-Chloro-3-Fluoro-1,5-Naphthyridine | AG000GDZ | 0.75g |
| 115193-61-8 | N=C(N)C1=NC(C2=CC=CC=C2)=CC=C1.[H]Cl | 6-Phenylpicolinimidamide hydrochloride | AG000GE1 | 5g |
| 115186-37-3 | CON(C([C@H]1N(C(OC(C)(C)C)=O)CCC1)=O)C | N-(TERT-BUTOXYCARBONYL)-L-PROLINE N’-METHOXY-N’-METHYLAMIDE | AG000GE6 | 125g |
| 115186-33-9 | CON(C)C(=O)[C@@H](Cc1ccccc1)NC(=O)OC(C)(C)C | (R)-tert-Butyl (1-(methoxy(methyl)amino)-1-oxo-3-phenylpropan-2-yl)carba | AG000GE7 | 25g |
| 115186-31-7 | C(OC(=O)NCCCC[C@@H](NC(=O)OC(C)(C)C)C(=O)O)C1c2c(c3c1cccc3)cccc2 | D-Lysine, N2-[(1,1-dimethylethoxy)carbonyl]-N6-[(9H-fluoren-9-ylmethoxy)c | AG000GE8 | 500g |
| 115185-79-0 | CC1=CC=C(NC1=O)C(O)=O | 5-Methyl-6-oxo-1,6-dihydropyridine-2-carboxylic acid | AG000GEB | 20g |
| 115182-91-7 | N#CC1NCC2CC12 | 2-Cyano-3-azabicyclo[3.1.0]hexane | AG000GED | 10g |
| 115199-84-3 | Cl.ClC=1C=C(C=CC1Cl)CC(=O)N([C@H](CN1CCCC1)C1=CC=CC=C1)C | (S)-2-(3,4-Dichlorophenyl)-N-methyl-N-(1-phenyl-2-(pyrrolidin-1-yl)ethyl)ac | AG000GEK | 0.5g |
| 115198-80-6 | O=C(OC(C)(C)C)NCC1OC1 | Tert-Butyl (Oxiran-2-Ylmethyl)Carbamate | AG000GEL | 50g |
| 1152-62-1 | CSCC[C@@H](C(O)=O)NC(OCC1=CC=CC=C1)=O | Z-Met-OH | AG000GEU | 800g |
| 1152-61-0 | OC(C[C@@H](C(O)=O)NC(OCC1=CC=CC=C1)=O)=O | Z-Asp-OH | AG000GEV | 4000g |
| 1150617-94-9 | CN1C=C2C=C(I)C=CC2=N1 | 5-iodo-2-methyl-2H-indazole | AG000FT9 | 250g |
| 1150617-92-7 | O=C1CCC2=CC=C(Cl)N=C21 | 2-Chloro-5H-cyclopenta[b]pyridin-7(6H)-one | AG000FTA | 500g |
| 1150617-80-3 | COC1=CC(Br)=CN=C1C | 5-Bromo-3-methoxy-2-methylpyridine | AG000FTB | 20g |
| 1150617-63-2 | CC1=CC(Cl)=CC(N)=C1I | 5-Chloro-2-iodo-3-methylaniline | AG000FTF | 225g |
| 1150617-62-1 | OC(=O)C1(F)CCOCC1 | 4-Fluorotetrahydro-2H-pyran-4-carboxylic acid | AG000FTG | 25g |
| 1150617-61-0 | CC1=C(I)C(=CC(Cl)=C1)[N+]([O-])=O | 5-Chloro-2-iodo-1-methyl-3-nitrobenzene | AG000FTH | 10g |
| 1150617-58-5 | ClC1=CNC2=NC=C(Br)N=C21 | 2-bromo-7-chloro-5H-pyrrolo[2,3-b]pyrazine | AG000FTJ | 10g |
| 1150617-56-3 | CN1N=CC2=NC=C(Br)C=C21 | 6-Bromo-1-methyl-1H-pyrazolo[4,3-b]pyridine | AG000FTK | 400g |
| 1150617-55-2 | CNC1=CC=CC(=C1N)Br | 3-Bromo-(N1-methyl)benzene-1,2-diamine | AG000FTL | 25g |
| 1150617-54-1 | BrC1=CN=C2C(NN=C2)=C1 | 6-Bromo-1H-pyrazolo[4,3-b]pyridine | AG000FTM | 250g |
| 1150617-53-0 | O=[N+](C1=C(Br)C=CC=C1NC)[O-] | 3-Bromo-n-methyl-2-nitrobenzenamine | AG000FTN | 10g |
| 1150617-52-9 | CC1=C(Br)C=NC2=C1C=CN2 | 5-Bromo-4-methyl-1H-pyrrolo[2,3-b]pyridine | AG000FTO | 8.25g |
| 1150618-42-0 | CC1NCCCC1NC(=O)OC(C)(C)C | tert-Butyl (2-methylpiperidin-3-yl)carbamate | AG000FTY | 50g |
| 1150618-39-5 | O=C(OC(C)(C)C)NC1CNC(C)CC1 | tert-Butyl (6-methylpiperidin-3-yl)carbamate | AG000FTZ | 75g |
| 115104-28-4 | ClC1=CC=C2C(N=C(/C=C/C3=CC=CC(C(SCCC(O)=O)SCCC(N(C)C)=O)=C3)C=C2)=C1 | MK-571 | AG000GAT | 0.3g |
| 115104-25-1 | ClC1=CC=C2C=CC(CBr)=NC2=C1 | 2-(Bromomethyl)-7-chloroquinoline | AG000GAU | 2g |
| 115103-85-0 | O=C([O-])CCSC(C1=CC=CC(/C=C/C2=NC3=CC(Cl)=CC=C3C=C2)=C1)SCCC(N(C)C)= | MK-571 sodium | AG000GAW | 1.25g |
| 115103-54-3 | CC1=C(/C(/C2=C(C)C=CS2)=C/CCN2C[C@H](C(O)=O)CCC2)SC=C1 | Tiagabine | AG000GAY | 0.3g |
| 1151397-80-6 | FC1=CC=CC2=C1NC(=O)CCC2 | 9-Fluoro-4,5-dihydro-1H-benzo[b]azepin-2(3H)-one | AG000GB1 | 0.25g |
| 115141-43-0 | C[C@H](OC(C)(C)C)[C@@H](N)C(OC)=O.[H]Cl | H-D-Thr(Tbu)-Ome HCl | AG000GB4 | 400g |
| 115132-84-8 | C1(CN)C=CSC=1.Cl | (Thiophen-3-yl)methanamine, HCl | AG000GB5 | 40g |
| 115127-23-6 | BrC1=NN2C(C=C1)=NN=C2 | 6-Bromo-1,2,4-triazolo[4,3-b]pyridazine | AG000GBB | 50g |
| 115122-63-9 | O=C(C1=C(O)N=C2C(CCC2)=C1)O | 2-Hydroxy-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxylic acid | AG000GBH | 25g |
| 115118-68-8 | O=C(C1(C(OC(C)C)=O)CC(OC)(OC)C1)OC(C)C | Diisopropyl 3,3-Dimethoxycyclobutane-1,1-dicarboxylate | AG000GBN | 7000g |
| 1151516-14-1 | O=C([O-])CSC1=NN=C(Br)N1C2=C3C=CC=CC3=C(C4CC4)C=C2.[Na+] | Lesinurad sodium | AG000GBQ | 2g |
| 115150-59-9 | C(N)(=O)[C@H](CCSC)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](CC1C2=C(C=CC=C2 | Antagonist G | AG000GC2 | 0.01g |
| 115144-40-6 | COC1=CC=C(F)C(F)=C1 | 3,4-Difluoroanisole | AG000GCC | 954g |
| 115144-35-9 | O=C([C@@H]1N=C(C2=NC3=CC=C(O)C=C3S2)SC1)[O-].[K+] | D-Luciferin potassium salt | AG000GCD | 25g |
| 1151665-15-4 | O=C(N1CC2=C(N=C(Cl)C=C2)CC1)OC(C)(C)C | TERT-BUTYL 2-CHLORO-7,8-DIHYDRO-1,6-NAPHTHYRIDINE-6(5H)-CARBOXYLAT | AG000GCF | 2500g |
| 1151564-17-8 | OC1=CC=CC(B2OC(C)(C)C(C)(C)O2)=C1Cl | 2-Chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol | AG000GCH | 100g |
| 1151564-03-2 | CC1(C)C(C)(C)OB(C2=CC=CC(OC)=C2Cl)O1 | 2-(2-Chloro-3-methoxyphenyl)-4,4,5,5-tetramethyl-[1,3,2]dioxaborolane | AG000GCI | 15g |
| 1151767-58-6 | O=[N+](C1=C(F)C(Cl)=CC=C1F)[O-] | 1-Chloro-2,4-difluoro-3-nitrobenzene | AG000GD4 | 20g |
| 1152-39-2 | O[C@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)[C@@H]1SC2=CC=C(C)C=C2 | (2R,3S,4S,5R,6S)-2-(Hydroxymethyl)-6-(P-Tolylthio)Tetrahydro-2H-Pyran-3,4, | AG000GF0 | 25g |
| 115204-76-7 | ClC1=NC(=C2N=CN(C2=N1)CC1=CC=C(C#N)C=C1)Cl | 4-((2,6-DICHLORO-9H-PURIN-9-YL)METHYL)BENZONITRILE | AG000GF8 | 1g |
| 115201-42-8 | COC1=CC=C(CN2C=NC=N2)C=C1 | 1-(4-Methoxybenzyl)-1,2,4-triazole | AG000GFV | 5g |
| 1152134-45-6 | O=C([C@]1(NC(OC(C)(C)C)=O)[C@H](C(F)F)C1)O | (1R,2R)-1-((tert-Butoxycarbonyl)amino)-2-(difluoromethyl)cyclopropanecarb | AG000GFW | 3g |
| 1152113-37-5 | Cl.CC1CCN1 | Azetidine, 2-methyl-, hydrochloride (1:1) | AG000GFX | 25g |
| 1152113-30-8 | O=C(N1C[C@H](N)[C@H](C)C1)OC(C)(C)C | Trans-1-Boc-3-Amino-4-Methylpyrrolidine | AG000GFZ | 5g |
| 1152111-80-2 | CC1(N2CCCC2)CNC1.Cl.Cl | 1-(3-Methyl-3-azetidinyl)-pyrrolidine dihydrochloride | AG000GG1 | 1g |
| 1152110-30-9 | C[C@H]1CN(C)CCN1.[H]Cl.[H]Cl | (S)-1,3-DiMethylpiperazine dihydrochloride | AG000GG2 | 20g |
| 1152110-26-3 | C[C@@H]1CN(C)CCN1.[H]Cl.[H]Cl | (R)-1,3-Dimethylpiperazine Dihydrochloride | AG000GG3 | 30g |
| 1152110-23-0 | N1(C)CCNC[C@H]1C.Cl.Cl | (R)-1,2-Dimethyl-piperazine dihydrochloride | AG000GG4 | 500g |
| 1152107-25-9 | C1(NNC(=O)[C@H](CC2CCCC2)CN(C=O)O)C(F)=C(N2C[C@@]3([H])COCCN3CC2) | Gsk-1322322 | AG000GG8 | 0.002g |
| 1152093-60-1 | CC(C)(C)OC(=O)N1CCCN(CC1)C1=NC(Br)=CC=C1 | tert-Butyl 4-(6-bromopyridin-2-yl)-1,4-diazepane-1-carboxylate | AG000GGA | 0.3g |
| 115210-54-3 | CC1Cc2cc(ccc2N1)N(=O)=O | 2,3-Dihydro-2-methyl-5-nitro-1H-indole | AG000GGH | 25g |
| 1152274-54-8 | O=S(C1=CC=C(B2OC(C)(C)C(C)(C)O2)C(C)=C1)(NC)=O | 2-Methyl-4-(N-methylsulfamoyl)phenylboronic acid, pinacol ester | AG000GGM | 2g |
| 1152172-19-4 | O=C(OC(C)(C)C)N(C1=C2N=CN([C@@H]3O[C@H](CO)[C@]4([H])[C@@]3([H])O | Adenosine, n,n-bis[(1,1-dimethylethoxy)carbonyl]-2′,3′-o-(1-methylethylide | AG000GGN | 0.2g |
| 115223-09-1 | O=C([C-]12[CH]3=[CH]4[Fe+2]5678923([CH]1=[CH]45)[CH-]1[CH]6=[CH]8[CH]9=[ | N-Succinimidyl Ferrocenecarboxylate | AG000GH0 | 4.2g |
| 1152441-29-6 | NC1=CC=C(F)C(B2OC(C)(C)C(C)(C)O2)=C1 | 5-Amino-2-fluorophenylboronic acid pinacol ester | AG000GHA | 18g |
| 115619-01-7 | C(C)N1CCN(CC1)C2=CC=C(C=C2)N | 4-(4-Ethylpiperazin-1-ly)aniline | AG000G95 | 200g |
| 115619-00-6 | [O-][N+](C1C=CC(=CC=1)N1CCN(CC)CC1)=O | 1-Ethyl-4-(4-Nitrophenyl)Piperazine | AG000G96 | 50g |
| 115617-41-9 | CCC1=C(Cl)C(Cl)=NC=N1 | 4，5-Dichloro-6-ethylpyrimidine | AG000G9B | 20g |
| 115616-51-8 | NNC(CCSSC1=CC=CC=N1)=O | 3-(2-PYridyldithio)propanoic acid hydrazide | AG000G9C | 2g |
| 115615-19-5 | CC1C(Br)=CC(Cl)=CC=1Cl | 2-Bromo-4,6-dichlorotoluene | AG000G9D | 7g |
| 115615-02-6 | O=C2(N(C1(=C(C=CC=C1)OC2))CC#N) | 4-(Cyanomethyl)-2h-1,4-benzoxazin-3(4h)-one | AG000G9E | 5g |
| 115611-57-9 | FC(C(OCc1ccccc1)(F)F)F | 1,1,2,2-Tetrafluoroethyl benzyl ether | AG000G9F | 600g |
| 115610-25-8 | O=C(/C=C/c1ccc(cc1)O)OCCc1ccccc1 | 2-Phenylethyl (2E)-3-(4-hydroxyphenyl)-2-propenoate | AG000G9K | 3.75g |
| 1156315-68-2 | O=C(C1=CC=C2OCCOC2=C1)N3CC(CO)CCC3 | (2,3-Dihydrobenzo[b][1,4]dioxin-6-yl)(3-(hydroxymethyl)piperidin-1-yl)meth | AG000G9O | 0.5g |
| 1156275-57-8 | BrC=1C=C(C=C2C(=CC(=NC12)C)Cl)C | 8-Bromo-4-chloro-2,6-dimethylquinoline | AG000G9W | 5g |
| 1156264-10-6 | CC(O)CNC(=O)C1=CC=C(F)C(F)=C1 | 3，4-Difluoro-N-(2-hydroxypropyl)benzamide | AG000GA0 | 0.5g |
| 115630-49-4 | O=C(C1NCCC1)N.[H]Cl | 2-Pyrrolidinecarboxamide HCl | AG000GA5 | 50g |
| 115109-65-4 | O=C(OCC1C=2C=CC=CC2C=3C=CC=CC31)NCC=4C(OC)=CC(OCCCCC(=O)O)=CC4OC | Fmoc-Pal-Linker | AG000GAK | 0.2g |
| 115109-59-6 | C(=O)C1=C(C=C(OCCCCC(=O)O)C=C1OC)OC | 5-(4-Formyl-3,5-dimethoxyphenoxy)pentanoic acid | AG000GAM | 60g |
| 115109-01-8 | CCC[C@H](CCC(=O)O)C | Heptanoic acid, 4-methyl-, (4R)- | AG000GAQ | 4g |
| 115571-66-9 | ClC1=C(C=C(C(=C1[N+](=O)[O-])C)C(F)(F)F)Cl | 3,4-Dichloro-2-Nitro-6-(Trifluoromethyl)Toluene | AG000G6I | 2500g |
| 115571-58-9 | Cc1ccc(c(c1Cl)Cl)C(F)(F)F | Benzene, 2,3-dichloro-1-methyl-4-(trifluoromethyl)- | AG000G6L | 0.3g |
| 115570-52-0 | CC(C)(COC1=CC=C(N)C=C1)COC2=CC=C(N)C=C2 | Neopentyl Glycol Bis(4-aminophenyl) Ether | AG000G6O | 50g |
| 1155877-70-5 | O=CC1=CC=C(OC)C(Br)=C1F | 3-Bromo-2-fluoro-4-methoxybenzaldehyde | AG000G6Y | 50g |
| 1155847-42-9 | FC1=C(Cl)C=CN=C1Br | 2-Bromo-4-chloro-3-fluoropyridine | AG000G70 | 125g |
| 1155846-86-8 | ClC=1C=C(C#N)C=C(C1)OC=1C(NC=CC1C(F)(F)F)=O | 3-Chloro-5-((2-oxo-4-(trifluoromethyl)-1,2-dihydropyridin-3-yl)oxy)benzonit | AG000G72 | 2g |
| 115581-36-7 | CSC1=CN=C(Cl)N=C1 | 2-Chloro-5-(Methylthio)Pyrimidine | AG000G7G | 50g |
| 115581-09-4 | OC1=CC=C2N=CC=CC2=C1Br | 5-Bromoquinolin-6-ol | AG000G7H | 2g |
| 115576-91-5 | CN1C=NC2=C1C=CC(CO)=C2 | (1-Methyl-1H-benzo[d]imidazol-5-yl)methanol | AG000G7L | 15g |
| 115575-11-6 | ClC=1C=C(C=CC1)C(C=1C=CC2=C(NC=N2)C1)N1C=NC=C1 | 6-((3-Chlorophenyl)(1H-imidazol-1-yl)methyl)-1H-benzo[d]imidazole | AG000G7M | 0.1g |
| 1155877-97-6 | O=C(N)NC1=CC=C(CC2=CC(C3=CC=CC(Cl)=C3)=C(OC)C=C2)C=C1 | 1-(4-((3′-Chloro-6-methoxy-[1,1′-biphenyl]-3-yl)methyl)phenyl)urea | AG000G7R | 0.2g |
| 115597-84-7 | C(COCCN1C(C=CC1=O)=O)OCCN1C(C=CC1=O)=O | 1H-Pyrrole-2,5-dione, 1,1′-[1,2-ethanediylbis(oxy-2,1-ethanediyl)]bis- | AG000G7T | 2g |
| 115595-27-2 | O=C(O)C1=CC=C(OCCC=C)C=C1 | 4-(3-Butenyloxy)benzoic Acid | AG000G81 | 100g |
| 115591-64-5 | COC(=O)c1ccc(c(c1)C(F)(F)F)Cl | Methyl 4-chloro-3-(trifluoromethyl)benzoate | AG000G83 | 30g |
| 1156-78-1 | Oc1ccc(C2=COc3cc(O)cc(O)c3C2=O)c(O)c1 | 2′-Hydroxygenistein | AG000G8U | 0.005g |
| 1156-50-9 | O=S(C1=CC=C([N+]([O-])=O)C=C1)(C2=CC=C([N+]([O-])=O)C=C2)=O | Bis(4-nitrophenyl) Sulfone | AG000G8W | 75g |
| 1156-19-0 | O=S(C1=CC=C(C)C=C1)(NC(NN2CCCCCC2)=O)=O | Tolazamide | AG000G8X | 15g |
| 115378-21-7 | COC(=O)c1cc(Br)cc(c1N)OC | Methyl 2-amino-5-bromo-3-methoxybenzoate | AG000GNX | 7g |
| 115377-94-1 | O=C(NC1=CC=CC=C1B(O)O)OC(C)(C)C | 2-BOC-aminophenylboronic acid | AG000GO0 | 50g |
| 115377-93-0 | COCOC1=CC=CC=C1B(O)O | 2-(Methoxymethoxy)phenylboronic acid | AG000GO1 | 221g |
| 1156491-10-9 | N[C@H]1[C@H](C2=CC=C(F)C(F)=C2)C1.Cl | (1R,2S)-rel-2-(3,4-Difluorophenyl)cyclopropanamine hydrochloride | AG000GO6 | 150.6g |
| 1156429-26-3 | O=C(C1=CC=C(OCO2)C2=C1)N3C(CO)CCCC3 | Benzo[d][1,3]dioxol-5-yl(2-(hydroxymethyl)piperidin-1-yl)methanone | AG000GO7 | 0.5g |
| 1156389-00-2 | FC1=C(Br)C=C2C(NC(CC2)=O)=C1 | 6-bromo-7-fluoro-3,4-dihydroquinolin-2(1H)-one | AG000GO8 | 0.75g |
| 115652-52-3 | OCC1(N)CC1.[H]Cl | 1-Amino-cyclopropanemethanol, HCl | AG000GOE | 200g |
| 115651-29-1 | O=C(O)C1=CC(C(C)=O)=C(O)C=C1N | 5-Acetyl-2-amino-4-hydroxybenzoic acid | AG000GON | 1g |
| 115643-59-9 | NC(=O)C1=C(N)C=CC=C1F | 2-Amino-6-fluorobenzamide | AG000GOQ | 78g |
| 1156630-89-5 | O1C2=CC=CC=C2OCC1C(N1CCCCC1CO)=O | (2,3-Dihydrobenzo[b][1,4]dioxin-2-yl)(2-(hydroxymethyl)piperidin-1-yl)meth | AG000GOS | 0.5g |
| 1156602-22-0 | CC1=CC(Br)=C2N=CC=C(Cl)C2=C1 | 8-Bromo-4-chloro-6-methylquinoline | AG000GOT | 4g |
| 1156601-73-8 | NC1=CN(C2=NC=CC=N2)N=C1 | 1-(Pyrimidin-2-yl)-1H-pyrazol-4-amine | AG000GOU | 20g |
| 1156542-25-4 | N#CC1=NC(Cl)=CC(C(F)(F)F)=C1 | 6-Chloro-4-(trifluoromethyl)picolinonitrile | AG000GOV | 8g |
| 115662-09-4 | O=CC1=C(O)C2=C3C(C(C)(C)CCN3CCC2(C)C)=C1 | 8-Hydroxy-1,1,7,7-tetramethyljulolidine-9-carboxaldehyde | AG000GP1 | 20g |
| 115661-82-0 | N#CC1=CC=CC2=C1NCC2 | 2,3-Dihydro-1h-indole-7-carbonitrile | AG000GP5 | 80g |
| 115661-37-5 | NC1=C(C#N)C=CC=C1F | 2-Amino-3-fluorobenzonitrile | AG000GP8 | 2500g |
| 115655-44-2 | O=C(C1(NC(OC(C)(C)C)=O)CCNCC1)OC | 4-N-Boc-amino-piperidine-4-carboxylic acid methyl ester | AG000GPB | 30g |
| 115655-42-0 | O=C(N1CCC(C(OC)=O)(N)CC1)OCC2=CC=CC=C2 | 1-benzyl 4-methyl 4-aminopiperidine-1,4-dicarboxylate | AG000GPC | 5g |
| 115404-57-4 | C[C@H]([C@@H]1CC[C@]2([C@@]1(C)CC[C@H]1C2=CC[C@@H]2[C@]1(C)CCC( | Niloticin | AG000FY8 | 0.005g |
| 1154-94-5 | O(C1=C(N(=O)=O)C=CC=C1)[C@H]2[C@H](O)[C@@H](O)[C@@H](O)[C@@H](C | 2-Nitrophenyl beta-D-Fucopyranoside | AG000FYD | 1.25g |
| 1154-59-2 | OC1=C(Cl)C=C(Cl)C=C1C(NC2=CC=C(Cl)C(Cl)=C2)=O | 3,5-Dichloro-N-(3,4-dichlorophenyl)-2-hydroxybenzamide | AG000FYM | 200g |
| 115416-52-9 | C[C@@H](CO)NC1=NC=C(C=C1)[N+]([O-])=O | (S)-(-)-N-(5-Nitro-2-pyridyl)alaninol | AG000FZ6 | 0.1g |
| 1154383-52-4 | O=C(C1=CNN=C1)NC | N-methyl-1H-pyrazole-4-carboxamide | AG000FZD | 100g |
| 1154319-87-5 | O=C(C(N1)=CC2=C1C=C(OC(F)(F)F)C=C2)OC | Methyl 6-(trifluoromethoxy)indole-2-carboxylate | AG000FZG | 0.2g |
| 1154278-17-7 | O=C(OC)C1=CC(Br)=CC([N+]([O-])=O)=C1F | Methyl 5-bromo-2-fluoro-3-nitrobenzoate | AG000FZJ | 500g |
| 115436-72-1 | OC(P(O)(O)=O)(P([O-])(O)=O)CC1=CC=CN=C1.[Na+] | sodium hydrogen [1-hydroxy-1-phosphono-2-(pyridin-3-yl)ethyl]phosphonat | AG000FZS | 500g |
| 1154579-82-4 | CC1(C)C(C)(C)OB(C2=CN=C(F)C(F)=C2)O1 | 2,3-Difluoropyridine-5-boronic acid pinacol ester | AG000G01 | 200g |
| 1154426-16-0 | CCOC(=O)C1=C(C=CC=C1F)[N+]([O-])=O | Ethyl 2-fluoro-6-nitrobenzoate | AG000G02 | 100g |
| 115458-99-6 | C[C@@H](OCC1=CC=CC=C1)C(OC)=O | (R)-Methyl 2-(benzyloxy)propanoate | AG000G06 | 2g |
| 115457-83-5 | CCCCCCCNC(=O)OC[C@H]1O[C@H](OC)[C@H](O)[C@@H](O)[C@@H]1O | Hecameg | AG000G08 | 25g |
| 115453-82-2 | O=C1OC2=C(C(C(F)(F)F)=C1)C=CC(OCC)=C2 | 7-Ethoxy-4-(trifluoromethyl)-2H-chromen-2-one | AG000G0A | 0.01g |
| 115445-21-1 | CCNC1CN(CC2=CC=CC=C2)CC1 | 1-Benzyl-3-(ethylamino)pyrrolidine | AG000G0H | 5g |
| 115440-10-3 | NC1=CC(F)=CC(Br)=C1N | 3-Bromo-1,2-diamino-5-fluorobenzene | AG000G0O | 500g |
| 1154741-20-4 | ClC1=C2C=CC=NC2=C(Br)C=C1 | 8-Bromo-5-chloroquinoline | AG000G0Q | 125g |
| 115655-41-9 | O=C(C1(N)CCN(C(OCC2=CC=CC=C2)=O)CC1)O | 4-Amino-1-cbz-piperidine-4-carboxylic acid | AG000GPD | 50g |
| 115665-96-8 | FC(C1=CC(/C=C/[N+]([O-])=O)=CC=C1)(F)F | (E)-1-(2-Nitrovinyl)-3-(trifluoromethyl)benzene | AG000GPH | 25g |
| 115665-95-7 | O=[N+](/C=C/C1=CC(Br)=CC=C1)[O-] | trans-3-Bromo-β-nitrostyrene | AG000GPI | 8g |
| 115665-92-4 | CC(/C=C/C1=CC=C(C(F)(F)F)C=C1)=O | (E)-4-(4-(Trifluoromethyl)phenyl)but-3-en-2-one | AG000GPK | 125g |
| 115665-52-6 | O=C(O)CN(C)S(=O)(=O)C | N-Methyl-N-(methylsulfonyl)glycine | AG000GPP | 50g |
| 1156804-89-5 | ClC1C(=CC=CN=1)C(N1CCCC(CO)C1)=O | (2-Chloro-pyridin-3-yl)-(3-hydroxymethyl-piperidin-1-yl)-methanone | AG000GQ6 | 0.5g |
| 1156800-32-6 | O=C(C1=CC(Cl)=NC=C1)N2CC(CO)CCC2 | (2-Chloropyridin-4-yl)(3-(hydroxymethyl)piperidin-1-yl)methanone | AG000GQ7 | 0.5g |
| 115666-47-2 | IC1=CC2=C(C=CN2)C=C1 | 6-Iodo-1H-indole | AG000GQO | 20g |
| 115666-46-1 | Ic1cc2c(cc1)CCN2 | 6-Iodoindoline | AG000GQP | 20g |
| 115666-21-2 | O=CC1=CNC2=C1C=CC=C2Br | 7-Bromo-3-formylindole | AG000GQU | 100g |
| 1156928-67-4 | CN1C2=C(C=C(C=C2)F)N=C1N | 2-Amino-5-fluoro-1-methylbenzimidazole | AG000GR0 | 3g |
| 115687-05-3 | ClC1=CC=C(C=C1)C(=O)N1CCN(CC1)C1=C2C=CC=NC2=C(C=C1)[N+](=O)[O-] | (4-Chlorophenyl)(4-(8-nitroquinolin-5-yl)piperazin-1-yl)methanone | AG000GRD | 1g |
| 1157012-67-3 | NC1=CC=NN1C2CCOCC2 | 1-(Tetrahydro-2H-pyran-4-yl)-1H-pyrazol-5-amine | AG000GRN | 3g |
| 1156980-49-2 | NNC1CCC1.Cl.Cl | Cyclobutylhydrazine dihydrochloride | AG000GRO | 1g |
| 115704-83-1 | OC1=C2C3=C(C=C1)C(C)(C)CCN3CCC2(C)C | Tetramethyljulolidine | AG000GRX | 200g |
| 1157-84-2 | O=N(=O)C1=CC=C(NN=CC=2C=CC=CC2)C(=C1)N(=O)=O | Benzaldehyde-2,4-dinitrophenylhydrazone | AG000GS5 | 75g |
| 1157-39-7 | O=C1C(C2=CC=C(OC)C=C2)=COC3=C1C=CC(OC)=C3 | 4′,7-Dimethoxyisoflavone | AG000GS7 | 10g |
| 1152427-91-2 | O=C(CN(C)C1)OB(C2OC2)OC1=O | 6-Methyl-2-(oxiran-2-yl)-1,3,6,2-dioxazaborocane-4,8-dione | AG000GHJ | 3g |
| 1152367-85-5 | C[C@H]1NC[C@H](C)N(C)C1 | (2S,5R)-1,2,5-Trimethylpiperazine oxalate | AG000GHK | 2g |
| 1152367-80-0 | C[C@H]1CN(C)CCN1 | (3S)-1,3-dimethylpiperazine | AG000GHL | 75g |
| 1152313-76-2 | CC([C@@H]1N=C(OC1(C)C)c1ccccc1P(c1ccccc1)c1ccccc1)C | Oxazole, 2-[2-(diphenylphosphino)phenyl]-4,5-dihydro-5,5-dimethyl-4-(1-m | AG000GHM | 0.4g |
| 1152311-62-0 | O=C(C1(C2=CC=C(OC(F)(F)O3)C3=C2)CC1)NC4=CC5=C(N(C[C@@H](O)CO)C(C(C) | 1-(2,2-difluoro-1,3-benzodioxol-5-yl)-N-{1-[(2R)-2,3-dihydroxypropyl]-6-fluor | AG000GHO | 15g |
| 1152519-74-8 | NC1=CN=C(CC)N=C1 | 2-Ethylpyrimidin-5-amine | AG000GI0 | 6g |
| 1152519-69-1 | Nc1cnc(nc1)C1CC1 | 2-Cyclopropylpyrimidin-5-amine | AG000GI1 | 3g |
| 1152475-50-7 | ClC1=NC2=C(C=N1)[NH]C=C2I | 2-CHLORO-7-IODO-5H-PYRROLO[3,2-D]PYRIMIDINE | AG000GI5 | 10g |
| 1152475-42-7 | BrC1=CSC2=C1N=C(N=C2)Cl | 7-Bromo-2-Chlorothieno[3,2-D]Pyrimidine | AG000GI6 | 75g |
| 1152475-40-5 | Clc1ncc2c(n1)c(I)cs2 | Thieno[3,2-d]pyrimidine, 2-chloro-7-iodo- | AG000GI7 | 0.1g |
| 115250-39-0 | OCC(CO)N[C@H]1C[C@](O)(COCc2ccccc2)[C@@H](OCc3ccccc3)[C@H](OCc4cccc | 2-(((1S,2S,3R,4S,5S)-2,3,4-Tris(benzyloxy)-5-((benzyloxy)methyl)-5-hydroxycy | AG000GI8 | 50g |
| 115250-38-9 | O[C@]1(COCc2ccccc2)CC(=O)[C@H](OCc3ccccc3)[C@@H](OCc4ccccc4)[C@@H]1 | (2R,3S,4S,5S)-5-Hydroxy-2,3,4-tris(phenylmethoxy)-5-[(phenylmethoxy)meth | AG000GI9 | 10g |
| 115247-41-1 | BrC1=CC=C(C=C1)B1OCCN(CCO1)C | 2-(4-Bromophenyl)-6-methyl-1,3,6,2-dioxazaborocane | AG000GIE | 15g |
| 1152617-14-5 | N#CC1=C(Br)N=CC=C1Br | 2,4-Dibromonicotinonitrile | AG000GIP | 10g |
| 1152582-56-3 | O=C(O)CC1=CN(C)N=C1 | 2-(1-Methyl-1H-Pyrazol-4-Yl)Acetic Acid | AG000GIR | 20g |
| 1159511-54-2 | CN1N=C2C(C=CC=C2CO)=C1 | (2-Methyl-2H-indazol-7-yl)methanol | AG000H6B | 1g |
| 1159511-53-1 | CN1C=C2C=CC(CO)=CC2=N1 | (2-Methyl-2H-indazol-6-yl)methanol | AG000H6C | 25g |
| 1159511-52-0 | CN1C=C2C=C(CO)C=CC2=N1 | (2-Methyl-2H-indazol-5-yl)methanol | AG000H6D | 1g |
| 1159511-51-9 | Cn1cc2cccc(C#N)c2n1 | 2-methyl-2H-indazole-7-carbonitrile | AG000H6E | 1g |
| 1159511-50-8 | CN1N=C2C=C(C#N)C=CC2=C1 | 2-Methyl-2H-indazole-6-carbonitrile | AG000H6F | 8g |
| 1159511-31-5 | CC(N)C1=C2C=NNC2=CC=C1 | 1-(1H-Indazol-4-yl)ethanamine | AG000H6G | 5g |
| 1159511-26-8 | CC(C1=CC=CC2=C1N(C)N=C2)=O | 1-(1-Methyl-1h-indazol-7-yl)ethanone | AG000H6I | 4g |
| 1159511-25-7 | CN1N=CC2=CC=C(C=C12)C(C)=O | 1-(1-methyl-1H-indazol-6-yl)ethanone | AG000H6J | 5g |
| 1159511-24-6 | CN1N=CC2=CC(=CC=C12)C(C)=O | 1-(1-Methyl-1H-indazol-5-yl)ethanone | AG000H6K | 3g |
| 1159511-23-5 | CC(=O)C1=C2C=NN(C)C2=CC=C1 | 1-(1-Methyl-1h-indazol-4-yl)ethan-1-one | AG000H6L | 5g |
| 1159511-22-4 | CC(=O)C1=C2NN=CC2=CC=C1 | 7-Acetyl-1h-indazole | AG000H6M | 20g |
| 1159511-21-3 | C(=O)(C)c1c2c([nH]nc2)ccc1 | 1-(1H-Indazol-4-yl)ethanone | AG000H6N | 25g |
| 1159511-19-9 | ClC1=C(Br)N=C2C=CC=CN21 | 2-Bromo-3-chloroimidazo[1,2-a]pyridine | AG000H6P | 2g |
| 1159512-70-5 | NCC1=CC(C(F)(F)F)=C(Br)C=C1 | (4-Bromo-3-(trifluoromethyl)phenyl)methanamine | AG000H6S | 2g |
| 1159512-64-7 | NC1=CC=CC(OC(F)(F)F)=C1F | 2-Fluoro-3-(trifluoromethoxy)aniline | AG000H6T | 75g |
| 1159512-39-6 | FC(C1=CC=C(F)C(Cl)=N1)(F)F | 2-Chloro-3-fluoro-6-(trifluoromethyl)pyridine | AG000H6X | 100g |
| 1159512-38-5 | FC(C1=CC=C(F)C(Br)=N1)(F)F | 2-Bromo-3-fluoro-6-(trifluoromethyl)pyridine | AG000H6Y | 500g |
| 1159512-36-3 | C(F)(F)(F)c1nc(F)c(cc1)Br | 3-bromo-2-fluoro-6-(trifluoromethyl)pyridine | AG000H6Z | 15g |
| 115269-99-3 | C=CCN(C(OC(C)(C)C)=O)C(OC(C)(C)C)=O | N,N-Bis-Boc-N-allylamine | AG000GIY | 50g |
| 115262-01-6 | C[Si](C(Br)(F)F)(C)C | Trimethyl(bromodifluoromethyl)silane | AG000GIZ | 1000g |
| 115262-00-5 | C[Si](C)(C(F)(Cl)F)C | (Chlorodifluoromethyl)trimethylsilane | AG000GJ0 | 50g |
| 115257-95-9 | C[Si](O[Si](O[Si](C)(C)C)(O[Si](C)(C)C)CCCNC(C(=C)C)=O)(C)C | N-(3-(1,1,1,5,5,5-Hexamethyl-3-((trimethylsilyl)oxy)trisiloxan-3-yl)propyl)me | AG000GJ5 | 10g |
| 115256-13-8 | CN(CCC1=CC=C(C=C1)N)CCOC2=CC=C(C=C2)N | N-Methyl-N-(2-(4-aminophenoxy)ethyl)-2-(4-aminophenyl)ehtanamine | AG000GJ7 | 20g |
| 115256-11-6 | CS(=O)(NC1=CC=C(CCN(C)CCOC2=CC=C(NS(=O)(C)=O)C=C2)C=C1)=O | N-(4-(2-(Methyl(2-(4-(methylsulfonamido)phenoxy)ethyl)amino)ethyl)phen | AG000GJ8 | 20g |
| 1152858-54-2 | NC1N(CC2=C(F)C=CC=C2)N=CC=1 | 5-Amino-1-(2-fluorobenzyl)-1H-pyrazole | AG000GJD | 10g |
| 1152832-76-2 | CCNCc1cccc(F)c1F | N-Ethyl-2,3-difluorobenzenemethanamine | AG000GJI | 25g |
| 1152781-66-2 | FC1=CC=C2C=CC(Cl)=NC2=C1Br | 8-Bromo-2-chloro-7-fluoroquinoline | AG000GJL | 0.75g |
| 115287-37-1 | O=[N+](C1=CC=C(OCCN(C)CCC2=CC=C([N+]([O-])=O)C=C2)C=C1)[O-] | N-Methyl-2-(4-nitrophenoxy)-N-[2-(4-nitrophenyl)ethyl]ethanamine | AG000GJN | 200g |
| 115282-41-2 | CN(C1=CC=C(C(C(O)=O)O)C=C1)C | 2-[4-(dimethylamino)phenyl]-2-hydroxyacetic acid | AG000GJO | 25g |
| 115279-73-7 | N#CC1(C2=CC=C(N)C=C2)CCCC1 | 1-(4-Aminophenyl)cyclopentanecarbonitrile | AG000GJR | 500g |
| 115279-57-7 | NC1=CC=C(C=C1)C(C#N)(C)C | 2-(4-Aminophenyl)-2-methylpropanenitrile | AG000GJT | 225g |
| 1152964-31-2 | CC(C1=CC(F)=C(N2N=CC=C2)C=C1)=O | 3′-Fluoro-4′-(1h-pyrazol-1-yl)acetophenone | AG000GK2 | 50g |
| 1152939-98-4 | NC1=CN(CCN(C)C)N=C1 | 1-[2-(DIMETHYLAMINO)ETHYL]-1H-PYRAZOL-4-AMINE | AG000GK3 | 40g |
| 1152923-36-8 | O=C(N1CCCC2=C1C=CC(N)=C2)OC(C)(C)C | tert-Butyl 6-amino-1,2,3,4-tetrahydroquinoline-1-carboxylate | AG000GK4 | 10g |
| 115299-16-6 | C(C)OC(=O)C1=CSC(=N1)C2=C(C=CC=C2)OC | 2-(2-Methoxy-phenyl)-thiazole-4-carboxylic acid ethyl ester | AG000GK8 | 2g |
| 115299-08-6 | CCOC(=O)c1csc(n1)c1cccc(c1)OC | 2-(3-Methoxy-phenyl)-thiazole-4-carboxylic acid ethyl ester | AG000GK9 | 0.75g |
| 115297-57-9 | NC(=N)c1ccc(cc1)Cl.I | 4-Chlorobenzamidine hydroiodide | AG000GKD | 0.2g |
| 115294-67-2 | C1(C(O)=O)=C(C)C(=NN1C)C | 1,3,4-Trimethyl-1H-pyrazole-5-carboxylic acid | AG000GKG | 25g |
| 115290-81-8 | O[C@H](CCNC)C1=CC=CC=C1 | (R)-3-(Methylamino)-1-phenylpropan-1-ol | AG000GKJ | 0.6g |
| 115289-55-9 | C=CCC(N)C(OC)=O.[H]Cl | Methyl 2-aminopent-4-enoate hydrochloride | AG000GKK | 45g |
| 1153-05-5 | O=[As](C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 | (diphenylarsoroso)benzene | AG000GKP | 20g |
| 1153103-84-4 | N#Cc1ccc(c(c1)F)OC(C)C | Benzonitrile, 3-fluoro-4-(1-methylethoxy)- | AG000GKQ | 50g |
| 115310-98-0 | CC1=NC2=C(C=CC=C2O)C(C)=C1 | 2,4-Dimethyl-8-hydroxyquinoline | AG000GKX | 30g |
| 115309-58-5 | O=C(NC(C)(C)C)C1=CN=C(Cl)C=C1 | N-t-Butyl 6-chloronicotinamide | AG000GL1 | 200g |
| 115309-57-4 | O=C(OC(C)(C)C)C1=CN=C(Cl)C=C1 | 6-Chloronicotinic acid tert-butyl ester | AG000GL2 | 36g |
| 115307-13-6 | O=C1NC(CN)CC1.[H]Cl | 5-(Aminomethyl)pyrrolidin-2-one hydrochloride | AG000GL4 | 25g |
| 115306-75-7 | NCCCO[Si](C)(C(C)(C)C)C | 3-(tert-Butyldimethylsilyloxy)propan-1-amine | AG000GL6 | 200g |
| 1153-85-1 | BrC1=CC2=C(C=C1)[N](C3=CC=CC=C23)C4=CC=CC=C4 | 3-Bromo-N-phenylcarbazole | AG000GL9 | 1500g |
| 115724-21-5 | C(CN1CCOCC1)CCS(O)(=O)=O | 4-Morpholinobutane-1-sulfonic acid | AG000GSJ | 500g |
| 1157454-73-3 | Nc1sc2c(n1)c(C)ccc2Br | 2-Benzothiazolamine, 7-bromo-4-methyl- | AG000GT3 | 0.6g |
| 1157581-09-3 | C[C@@H](N)C1=CC=C(F)C(OC)=C1 | (1R)-1-(4-Fluoro-3-methoxyphenyl)ethanamine | AG000GTM | 0.25g |
| 1157561-41-5 | O=C(C1C(C2=CC=CC(F)=C2)C1)O | 2-(3-Fluorophenyl)cyclopropane-1-carboxylic acid | AG000GTO | 3g |
| 115761-79-0 | FC1=CC(F)=C(N2CCNCC2)C=C1 | 1-(2,4-Difluorophenyl)piperazine | AG000GTR | 7g |
| 115761-61-0 | C1NCCN(C2=CC(C3=CC=CC=C3)=CC=C2)C1 | 1-(3-BIPHENYLYL)PIPERAZINE | AG000GTS | 2g |
| 115754-62-6 | CCCC[P+](CCCC)(CCCC)CC1OCCO1.[Br-] | Tributyl(1,3-dioxolan-2-ylmethyl)phosphonium bromide | AG000GU1 | 125g |
| 115754-21-7 | O=C(O)C1=CC=C(C(F)(F)F)C(F)=C1 | 3-Fluoro-4-(trifluoromethyl)benzoic acid | AG000GU2 | 3000g |
| 115754-20-6 | C(F)(F)(F)c1c(Cl)cc(cc1)C(=O)O | 3-Chloro-4-(trifluoromethyl)benzoic acid | AG000GU3 | 50g |
| 115753-79-2 | CC1(C)CCC[C@]2(C)[C@@H](CC=C3/CCOC3=O)[C@]3(CO3)CC[C@@H]12 | Galanolactone | AG000GU5 | 0.005g |
| 115777-72-5 | COC(C1=C(C(O)=O)C=CS1)=O | 2-(Methoxycarbonyl)thiophene-3-carboxylic acid | AG000GUP | 15g |
| 115777-53-2 | Ic1ccc2c(c1)c1ccccc1n2C | 9H-Carbazole, 3-iodo-9-methyl- | AG000GUQ | 1.3g |
| 1157938-97-0 | C(=O)(Cn1cncn1)c1c(F)ccc(c1)F | 1-(2,5-Difluorophenyl)-2-(1H-1,2,4-triazol-1-yl)ethanone | AG000GV1 | 500g |
| 1157867-61-2 | CCC(C1=C([N+]2=CN(C3=C(C(CC)CC)C=CC=C3C(CC)CC)C=C2)C(C(CC)CC)=CC=C1)C | 1,3-Bis(2,6-di(pentan-3-yl)phenyl)-1H-imidazol-3-ium chloride | AG000GV2 | 150g |
| 1157849-51-8 | N[C@@H]1CN(C)CCC1.Cl.Cl | (S)-3-Amino-1-methyl-piperidine dihydrochloride | AG000GV3 | 20g |
| 1157849-50-7 | N[C@H]1CN(C)CCC1.[H]Cl.[H]Cl | (3R)-1-Methylpiperidin-3-amine dihydrochloride | AG000GV4 | 93g |
| 115794-55-3 | OC[C@H]1O[C@H](C[C@@H]1O)n1cc(/C=C/CNC(=O)C(F)(F)F)c(=O)[nH]c1=O | TFA-aa-dU | AG000GVA | 0.9g |
| 115787-50-3 | O=CC1=CC(C(CBr)=O)=CC=C1O | 5-(2-Bromoacetyl)-2-hydroxybenzaldehyde | AG000GVL | 1000g |
| 1158098-73-7 | CC(S(/N=C1COC/1)=O)(C)C | 2-Methyl-N-(oxetan-3-ylidene)propane-2-sulfinamide | AG000GVQ | 100g |
| 1157989-25-7 | O=P1(O)OC(C([Si](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4)=C5)=[C@]([C@] | (11bS)-8,9,10,11,12,13,14,15-Octahydro-4-hydroxy-2,6-bis(triphenylsilyl)-4-ox | AG000GVS | 1.25g |
| 1158-35-6 | O=C(OC)[C@H](N)CCCCNC(OCC1=CC=CC=C1)=O.[H]Cl | H-D-Lys(Z)-Ome HCl | AG000GWA | 200g |
| 1158-17-4 | OC[C@H]1O[C@@H](Sc2ccccc2[N+]([O-])=O)[C@H](O)[C@@H](O)[C@H]1O | 2-Nitrophenyl-beta-d-thiogalactopyranoside | AG000GWC | 0.1g |
| 1158-10-7 | OC(CCC1=CC(I)=C(OC2=CC=C(O)C=C2)C(I)=C1)=O | 3-[4-(4-Hydroxyphenoxy)-3,5-diiodophenyl]propanoic acid | AG000GWD | 0.01g |
| 1158215-71-4 | C1CCN(C1)C2=C(C=C(C=C2)N)C(F)(F)F.Cl.Cl | 4-(1-Pyrrolidinyl)-3-(trifluoromethyl)bezenamine DiHCl | AG000GWF | 10g |
| 115822-57-6 | OC(=O)C1COC2=CC=CC=C2C1 | 3-Chromanecarboxylic acid | AG000GWQ | 200g |
| 115816-34-7 | NCC1(CCC1)C1=CC(Cl)=CC=C1 | (1-(3-Chlorophenyl)cyclobutyl)methanamine | AG000GX0 | 5g |
| 115816-31-4 | NCC1(C2=CC=CC(Cl)=C2)CC1 | (1-(3-Chlorophenyl)cyclopropyl)methanamine | AG000GX1 | 5.4g |
| 1158347-73-9 | O=C1NCN(C12CCN(CC2)CCNC(=O)C=2C=NC1=CC=CC=C1C2)C2=CC=CC=C2 | N-[2-(4-Oxo-1-phenyl-1,3,8-triazaspiro[4.5]dec-8-yl)ethyl]-3-quinolinecarbox | AG000GX5 | 0.25g |
| 1158331-26-0 | COC(=O)C1=CC2=C(N1)C(F)=CC=C2 | Methyl 7-fluoro-1H-indole-2-carboxylate | AG000GX6 | 169g |
| 1158279-20-9 | Cl.C(C)N1C2=CC=CC=C2C=2C=C(C=CC12)CNCC1=C(C=CC=C1)OC | 1-(9-Ethyl-9H-carbazol-3-yl)-N-(2-methoxybenzyl)methanamine hydrochlorid | AG000GX9 | 0.6g |
| 1158263-30-9 | ClC1=CC=C(C=C1)CNC2CC2.[H]Cl | N-(4-Chlorobenzyl)cyclopropanamine hydrochloride | AG000GXB | 0.75g |
| 1158259-09-6 | O=C(O)C1=CC(N)=CC=C1N.[H]Cl.[H]Cl | 2,5-Diaminobenzoic acid dihydrochloride | AG000GXC | 20g |
| 115833-93-7 | NC1=CC(N2CCCC2)=CC=C1 | 3-(Pyrrolidin-1-yl)aniline | AG000GXI | 50g |
| 1158447-85-8 | Cl.Cl.COC1=NC=CC=C1CN | 3-Aminomethyl-2-methoxypyridine dihydrochloride | AG000GXT | 30g |
| 1158441-78-1 | CNCC1=CC=C(C=C1)N(C)C.[H]Cl | N-Methyl-4-(dimethylamino)benzylamine Hydrochloride | AG000GXU | 10g |
| 1158758-79-2 | CCC1(CN(C(OC(C)(C)C)=O)C1)N | TERT-BUTYL 3-AMINO-3-ETHYLAZETIDINE-1-CARBOXYLATE | AG000H12 | 25g |
| 1158758-77-0 | O=C(N1CC(C)(N)C1)OC(C)(C)C | 3-Amino-1-Boc-3-methyl-azetidine | AG000H13 | 75g |
| 1158838-45-9 | CCN1CCN(CC1)C(=O)CC1=CC=C(NC2=NC(NC3=CC=C(C=C3)C(=O)NC3=C(Cl)C=CC= | Tc-s 7010 | AG000H18 | 1.25g |
| 1158786-59-4 | NC1=NC(Br)=CC(OC)=C1 | 6-Bromo-4-methoxypyridin-2-amine | AG000H1B | 30g |
| 1158767-35-1 | O=C(N1N=CC2=C1C=C(I)C=C2)OC(C)(C)C | tert-Butyl 6-iodo-1H-indazole-1-carboxylate | AG000H1E | 25g |
| 115880-04-1 | CCOC(/C=C1CCC(C2=CC=CC=C2)CC1)=O | ethyl 2-(4-phenylcyclohexylidene)acetate | AG000H1Q | 9g |
| 1158984-92-9 | O=C(C[N+](C)1C2)O[B-]1(C3=CC=CS3)OC2=O | 4-Methyl-2,6-dioxo-8-(thiophen-2-yl)hexahydro-[1,3,2]oxazaborolo[2,3-b][1, | AG000H20 | 200g |
| 1158941-47-9 | OB(c1ccccc1CN1CCSCC1)O | 2-(Thiomorpholinomethyl)phenylboronic acid | AG000H21 | 10g |
| 1158916-85-8 | O=CC1=C(OC)C=C(Cl)C=C1F | 4-Chloro-2-fluoro-6-methoxybenzaldehyde | AG000H23 | 13g |
| 115899-40-6 | OC[C@@H]1[C@@H](O)C[C@H](N2C=C(C#CCNC(C(F)(F)F)=O)C(NC2=O)=O)O1 | 2′-Deoxy-5-[3-[(2,2,2-trifluoroacetyl)amino]-1-propyn-1-yl]uridine | AG000H24 | 2g |
| 115899-39-3 | C1[C@@H](O[C@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)[C@@H]1O)N1C(N=C( | 5-Propargylamino-dCTP | AG000H25 | 0.01g |
| 115899-38-2 | O[C@H]1C[C@H](N2C(N=C(N)C(C#CCNC(C(F)(F)F)=O)=C2)=O)O[C@@H]1CO | TFA-ap-dC | AG000H26 | 10g |
| 115888-13-6 | [C@H](NC([C@H](C)N)=O)(CSSC[C@H](NC([C@H](C)N)=O)C(O)=O)C(O)=O | (2R,2’R)-3,3′-Disulfanediylbis(2-((S)-2-aminopropanamido)propanoic acid) | AG000H2H | 50g |
| 1159-15-5 | S(N[C@@H](CCCNC(=N)N)C(O)=O)(=O)(=O)C1=CC=C(C)C=C1 | Tos-Arg-OH | AG000H2I | 1400g |
| 1159-03-1 | OC1(CCCN(C)C)C2=CC=CC=C2CCC3=CC=CC=C13 | 5-(3-(Dimethylamino)propyl)-10,11-dihydro-5H-dibenzo[a,d][7]annulen-5-ol | AG000H2K | 15g |
| 1159011-01-4 | Cl.CC1=NC2=C(CNCC2)N1 | 2-Methyl-4,5,6,7-tetrahydro-3H-iMidazo[4,5-c]pyridine hydrochloride | AG000H2L | 10g |
| 1159010-96-4 | Cl.BrC1=CN=C2CCNCC2=C1 | 3-Bromo-5,6,7,8-tetrahydro-1,6-naphthyridine hydrochloride | AG000H2M | 20g |
| 115845-51-7 | CC1=CC=C(C=C1)S(=O)(=O)OCC1CCO1 | Toluene-4-sulfonic acid oxetan-2-ylmethyl ester | AG000GY6 | 50g |
| 115843-99-7 | NC1=CC=C(Br)C(Cl)=C1F | 4-Bromo-3-chloro-2-fluoroaniline | AG000GY8 | 1000g |
| 115842-95-0 | COC1=CC=C(C=C1)C2=C(N)SN=N2 | 4-(4-METHOXYPHENYL)-1,2,3-THIADIAZOL-5-AMINE | AG000GYA | 0.75g |
| 115841-09-3 | O=C(O)[C@H](OC(/C=C/C1=C2C=C(C3=CC=C(O)C(O)=C3)OC2=C(O)C=C1)=O)CC4 | Salvianolic acid C | AG000GYC | 1.25g |
| 1158503-82-2 | BrC2=C1[NH]C(=CC1=CC=C2)C(=O)OC | Methyl 7-bromo-1H-indole-2-carboxylate | AG000GYH | 10g |
| 115859-55-7 | O=CC1N(C(C)=O)CCC1 | 1-Acetylpyrrolidine-2-carbaldehyde | AG000GYL | 3g |
| 115863-91-7 | C(CCCCCCCCCCCCC\C=C\CCCCCCCC)(=O)O | (E)-Tetracos-15-enoic acid | AG000GZO | 0.5g |
| 1158758-67-8 | CC(C)(C)OC(=O)N1CCC(C)(CN)C1 | 1-Boc-3-(aminomethyl)-3-methylpyrrolidine | AG000GZU | 5g |
| 1158758-60-1 | CCC1(N)CCN(C(=O)OC(C)(C)C)C1 | tert-Butyl 3-amino-3-ethylpyrrolidine-1-carboxylate | AG000GZV | 10g |
| 1158758-59-8 | O=C(N1CC(C)(N)CC1)OC(C)(C)C | tert-butyl 3-amino-3-methylpyrrolidine-1-carboxylate | AG000GZW | 5g |
| 1158750-91-4 | CC(C)(C)OC(=O)N1CCCC2(CNC(=O)C2)C1 | tert-Butyl 3-oxo-2,7-diazaspiro[4.5]decane-7-carboxylate | AG000H00 | 1g |
| 1158750-89-0 | O=C1CC2(CN1)CCCNC2 | 2,7-DIAZASPIRO[4.5]DECAN-3-ONE | AG000H01 | 15g |
| 1158750-06-1 | O=C(OCc1ccccc1)N1CCC2(CCCCN2)CC1 | Benzyl 1,9-diazaspiro[5.5]undecane-9-carboxylate | AG000H02 | 1g |
| 1158749-94-0 | CC(OC(N1CCC2(NC(=O)CC2)CC1)=O)(C)C | Tert-Butyl 2-Oxo-1,8-Diazaspiro[4.5]Decane-8-Carboxylate | AG000H04 | 20g |
| 1158749-85-9 | O=C(OC(C)(C)C)N(CCC1)CC1(CC2)NC2=O | tert-Butyl 2-oxo-1,7-diazaspiro[4.5]decane-7-carboxylate | AG000H05 | 2g |
| 1158749-79-1 | CC(OC(N1CC2(NCC2)CC1)=O)(C)C | tert-Butyl 1,6-diazaspiro[3.4]octane-6-carboxylate | AG000H06 | 10g |
| 1158741-90-2 | CNCC1=CC=CC(OC)=C1OC.[H]Cl | 1-(2,3-Dimethoxyphenyl)-n-methylmethanamine hydrochloride | AG000H0C | 20g |
| 1158735-09-1 | OCC1=CN=C(OC)N=C1 | (2-Methoxypyrimidin-5-yl)methanol | AG000H0E | 25g |
| 115871-49-3 | COC(=O)CC1=C(Br)C=C(Cl)C=C1 | Methyl 2-bromo-4-chlorophenylacetate | AG000H0G | 200g |
| 115871-19-7 | [Na+].CN(C)c1ccc(cc1)N(C(=O)NCC([O-])=O)c1ccc(cc1)N(C)C | Sodium 2-(3，3-bis(4-(dimethylamino)phenyl)ureido)acetate | AG000H0H | 0.1g |
| 1158764-56-7 | BrC1=CC=C(CC2CNCC2)C=C1 | 3-[(4-bromophenyl)methyl]pyrrolidine | AG000H0K | 0.5g |
| 1158763-55-3 | O=C(O)C1=NC=C(C2=CC=CC(F)=C2)C=C1 | 5-(3-Fluorophenyl)picolinic acid | AG000H0N | 1.25g |
| 1158760-45-2 | CC1(CCOC1)C(O)=O | 3-Methyltetrahydrofuran-3-carboxylic acid | AG000H0Q | 10g |
| 1158760-32-7 | O=C(OC(C)(C)C)NC1(CN)COCC1 | tert-Butyl (3-(aminomethyl)tetrahydrofuran-3-yl)carbamate | AG000H0R | 5g |
| 1158760-25-8 | CC1(COCC1)N | 3-Amino-3-methyl-tetrahydrofuran | AG000H0S | 10g |
| 1158759-45-5 | CC(C)(C)OC(=O)N1CC(C1)(C#N)C(O)=O | 1-Boc-3-cyanoazetidine-3-carboxylic acid | AG000H0U | 10g |
| 1158759-06-8 | O=C(N1CC(C)(N)CCC1)OC(C)(C)C | tert-butyl 3-amino-3-methylpiperidine-1-carboxylate | AG000H0Y | 6g |
| 1158759-03-5 | O=C(OC(C)(C)C)NCC1(C)CCNCC1 | tert-Butyl (4-methylpiperidin-4-yl)methylcarbamate | AG000H0Z | 10g |
| 1158758-98-5 | CCC1(CN)CCN(C(=O)OC(C)(C)C)CC1 | tert-Butyl 4-(aminomethyl)-4-ethylpiperidine-1-carboxylate | AG000H10 | 10g |
| 1158758-85-0 | O=C(N1CC(C)(CN)C1)OC(C)(C)C | 1-Boc-3-(aminomethyl)-3-methylazetidine | AG000H11 | 25g |
| 115933-50-1 | O=C(OC)C1=CC=C(O)C(C(F)(F)F)=C1 | Methyl 4-hydroxy-3-(trifluoromethyl)benzoate | AG000H50 | 5g |
| 115933-30-7 | O=C(O)C=1SC(=CC1)C=2C=CC(F)=CC2 | 5-(4-Fluorophenyl)thiophene-2-carboxylic acid | AG000H51 | 30g |
| 115932-00-8 | O=C(C1=C2N=CC=CN2N=C1)OCC | Ethyl Pyrazolo[1,5-A]Pyrimidine-3-Carboxylate | AG000H57 | 100g |
| 1159511-18-8 | CC1=CNC2=C1C(=CC=C2)C(O)=O | 3-Methyl-1H-indole-4-carboxylic acid | AG000H5C | 10g |
| 1159489-46-9 | O=C(C1(C2=CC=C(B(O)O)C=C2)CC1)O | 4-(1-Carboxycyclopropyl)phenylboronic acid | AG000H5J | 25g |
| 115951-16-1 | CC(C)(C)OC(=O)NC1(CCCCC1)C(O)=O | 1-(Boc-amino)cyclohexanecarboxylic acid | AG000H5N | 500g |
| 1159511-83-7 | CC1=CC2=C(N(C)N=C2)C=C1Br | 6-Bromo-1,5-dimethyl-1H-indazole | AG000H61 | 8g |
| 1159511-81-5 | CC1=CC2=C(C=NN2C)C=C1Br | 5-Bromo-1,6-dimethyl-1H-indazole | AG000H62 | 10g |
| 1159511-80-4 | CN1N=CC2=C(C)C(Br)=CC=C12 | 5-Bromo-1,4-dimethyl-1H-indazole | AG000H63 | 8g |
| 1159511-79-1 | CC1=CC=C(Br)C2=C1N(C)N=C2 | 4-Bromo-1,7-dimethyl-1H-indazole | AG000H64 | 0.3g |
| 1159511-77-9 | CN1N=CC2=C(Br)C(C)=CC=C12 | 4-bromo-1,5-dimethyl-1H-indazole | AG000H65 | 10g |
| 1159511-76-8 | CC1=NN(C)C2=C1C(Br)=CC=C2 | 4-bromo-1,3-dimethyl-1H-indazole | AG000H66 | 5g |
| 1159511-75-7 | CC1=C2C=CC=C(C2=NN1)Br | 7-Bromo-3-methyl-1H-indazole | AG000H67 | 50g |
| 1159511-74-6 | CC1=CC=C(Br)C2=C1NN=C2 | 4-Bromo-7-methyl-1H-indazole | AG000H68 | 8.1g |
| 1159511-73-5 | CC1=NNC2=CC=CC(Br)=C12 | 4-Bromo-3-methyl-1H-indazole | AG000H69 | 200g |
| 1153279-80-1 | O=C(O)C1=CC(Br)=CC([N+]([O-])=O)=C1F | 5-BROMO-2-FLUORO-3-NITROBENZOIC ACID | AG000GLE | 120.8g |
| 1153269-45-4 | C1CC(C2NC=C(C3=CC=CC=C3)N=2)CNC1 | 3-(4-phenyl-1H-imidazol-2-yl)piperidine | AG000GLF | 0.5g |
| 1153252-25-5 | CNC1=C(C=CC(=C1)Br)F | N-Methyl 5-bromo-2-fluoroaniline | AG000GLG | 20g |
| 1153231-92-5 | O=C(C1=CC=C2OCCOC2=C1)N3CC(O)CCC3 | (2,3-Dihydrobenzo[b][1,4]dioxin-6-yl)(3-hydroxypiperidin-1-yl)methanone | AG000GLH | 0.5g |
| 115321-32-9 | O=C1OCC2=C1CC=Cc1c2cc2C(=O)O[C@H](c2c1C)c1cocc1 | 3H-Furo[3′,4′:3,4]cyclohept[1,2-f]isobenzofuran-3,10(1H)-dione, 8-(3-furanyl) | AG000GLN | 0.005g |
| 115315-95-2 | CCOC(C1=NN(C2=CC=CC=C2)C=C1)=O | Ethyl 1-phenyl-1H-pyrazole-3-carboxylate | AG000GLS | 70g |
| 115315-94-1 | CCOC(=O)c1ccnn1c1ccccc1 | 1H-Pyrazole-5-carboxylic acid, 1-phenyl-, ethyl ester | AG000GLT | 0.7g |
| 115311-41-6 | OC(C1N=C(C2=NC=CC=C2)SC=1)=O | Sodium 2-pyridin-2-yl-1,3-thiazole-4-carboxylate | AG000GM0 | 5.09g |
| 1153348-41-4 | OC1CN(S(=O)(C2=CC=CC(Cl)=C2Cl)=O)CCC1 | 1-((2,3-Dichlorophenyl)sulfonyl)piperidin-3-ol | AG000GM2 | 0.5g |
| 115344-47-3 | N(C#N)/C(=N/C1=CC=C(C2=NNC(=O)CC2C)C=C1)/NC | Siguazodan | AG000GMB | 0.005g |
| 115338-32-4 | O=C1N(CCCCN2CCN(C3=CC=CC=C3OC)CC2)C(C4=CC=CC=C41)=O.Br | NAN-190 | AG000GMH | 2.5g |
| 115372-36-6 | CC(C(OC12CC3(O)CC(C2)CC(C3)C1)=O)=C | 3-Hydroxyadamantan-1-yl methacrylate | AG000GMS | 600g |
| 115363-11-6 | CC1=C(C2=CC=CC=C2)C=CC=C1C(O)=O | 2-Methyl-3-phenylbenzoic acid | AG000GNA | 0.3g |
| 115378-31-9 | C=C[C@H]1N(C(OC(C)(C)C)=O)C(C)(C)OC1 | (R)-2,2-Dimethyl-4-vinyl-oxazolidine-3-carboxylic acid tert-butyl ester | AG000GNW | 2g |
| 1190312-37-8 | O=C(OC)C1=C2C(NC=C2)=NC(Cl)=C1 | Methyl 6-chloro-1H-pyrrolo[2,3-b]pyridine-4-carboxylate | AG000HIN | 20g |
| 1190312-27-6 | C(=O)c1c2c([nH]c1)cc(cn2)Br | 6-Bromo-1h-pyrrolo[3,2-b]pyridine-3-carbaldehyde | AG000HIS | 20g |
| 1190312-18-5 | BrC1=CN=C2C(NC=C2Br)=C1 | 3,6-Dibromo-1H-pyrrolo[3,2-b]pyridine | AG000HIY | 2g |
| 1190312-13-0 | OC(=O)c1ccc2c(n1)c(Cl)c[nH]2 | 3-Chloro-1H-pyrrolo[3,2-b]pyridine-5-carboxylic acid | AG000HJ0 | 0.5g |
| 1190312-84-5 | [O-][N+](=O)c1c[nH]c2c1ncc(c2)C(=O)O | 3-Nitro-1H-pyrrolo[3,2-b]pyridine-6-carboxylic acid | AG000HJB | 2g |
| 1190312-75-4 | COC(C1=CC2=C(CC(N2)=O)N=C1)=O | Methyl 4-aza-2-oxindole-6-carboxylate | AG000HJF | 10g |
| 1190312-64-1 | O=C(C1=CN=C2C(Br)=CNC2=C1)OC | Methyl 3-bromo-1H-pyrrolo[3,2-b]pyridine-6-carboxylate | AG000HJM | 2g |
| 1190312-60-7 | O=C(C1=CNC2=C(C)C=CN=C21)O | 7-Methyl-1H-pyrrolo[3,2-b]pyridine-3-carboxylic acid | AG000HJP | 5g |
| 1190313-15-5 | CC1NC2=C(N=CC(C(O)=O)=C2)C=1 | 2-Methyl-1h-pyrrolo[3,2-b]pyridine-6-carboxylic acid | AG000HK9 | 0.75g |
| 1190312-97-0 | COC(=O)c1cnc2cc(C)[nH]c2c1 | Methyl 2-methyl-1H-pyrrolo[3,2-b]pyridine-6-carboxylate | AG000HKJ | 0.5g |
| 117637-79-3 | O=C(C(N1)=C(I)C2=C1C=CC=C2)OCC | Ethyl 3-iodo-1H-indole-2-carboxylate | AG000HKN | 18g |
| 1190313-73-5 | CC1=CC=NC2=C1C=C(C)N2 | 2,4-Dimethyl-1H-pyrrolo[2,3-b]pyridine | AG000HKS | 0.5g |
| 1190313-69-9 | N#CC1=C2C(NC(C2)=O)=NC=C1 | 2-Oxo-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine-4-carbonitrile | AG000HKU | 1g |
| 1190313-65-5 | CC1=CC=NC2=C1C(I)=CN2 | 3-Iodo-4-methyl-1H-pyrrolo[2,3-b]pyridine | AG000HKW | 2g |
| 1190313-55-3 | C(=O)C1=CNC2=NC=C(C(=C21)C)C(=O)O | 3-Formyl-4-methyl-1H-pyrrolo[2,3-b]pyridine-5-carboxylic acid | AG000HL1 | 1.5g |
| 1190313-48-4 | O=C(N1)CC2=C1C=CN=C2Cl | 4-Chloro-1,3-dihydro-2H-pyrrolo[3,2-c]pyridin-2-one | AG000HL5 | 10g |
| 1159826-27-3 | C1=CC=C(C=C1)CN2CCC3(CCNC3)CC2.Cl.Cl | 8-Benzyl-2,8-diaza-spiro[4.5]decane DiHCl | AG000HCU | 3g |
| 1159833-34-7 | O=C(C1=C(C)N2C=C(C)C=CC2=N1)O | 3,6-Dimethylimidazo[1,2-a]pyridine-2-carboxylic acid | AG000HD1 | 9g |
| 1159831-86-3 | OC(=O)C1=NN=C2C=CC(Br)=CN12 | 6-BROMO-[1,2,4]TRIAZOLO[4,3-A]PYRIDINE-3-CARBOXYLIC ACID | AG000HD4 | 15g |
| 1159831-22-7 | O=C(C1=C(C)N2C=C(Cl)C=CC2=N1)O | 6-Chloro-3-methylimidazo[1,2-a]pyridine-2-carboxylic acid | AG000HD6 | 3g |
| 1159831-04-5 | BrC=1C=2N(C=CC1)C(=CN2)C(=O)O | 8-BROMOIMIDAZO[1,2-A]PYRIDINE-3-CARBOXYLIC ACID | AG000HD9 | 4g |
| 1159831-03-4 | O=C(C1=C(C)N2C=C(F)C=CC2=N1)O | 6-Fluoro-3-methylimidazo[1,2-a]pyridine-2-carboxylic acid | AG000HDA | 7g |
| 1159830-99-5 | O=C(C1=C(C)N2C=CC=C(Br)C2=N1)O | 8-Bromo-3-methylimidazo[1,2-a]pyridine-2-carboxylic acid | AG000HDB | 9g |
| 1159829-63-6 | BrC1=NC=CC2=C1C=NN2 | 4-Bromo-1H-pyrazolo[4,3-c]pyridine | AG000HDG | 150g |
| 1159919-79-5 | F[B-](F)(CCC#N)F.[K+] | Potassium 2-cyanoethyltrifluoroborate | AG000HDO | 15g |
| 1159883-05-2 | C=CCC(C1=CC=C(F)C=C1)N | 1-(4-Fluorophenyl)but-3-en-1-amine | AG000HDR | 0.5g |
| 1159878-06-4 | NC1(CC1)C1=NC=CC=N1 | 1-(Pyrimidin-2-yl)cyclopropan-1-amine | AG000HDY | 50g |
| 115994-87-1 | O=C(N1CCNCC1)NC2=CC=CC=C2 | N-Phenylpiperazine-1-carboxamide | AG000HE4 | 200g |
| 115992-15-9 | CSC(=O)C1=C2NCCC2=CC=C1 | S-methyl indoline-7-carbothioate | AG000HE7 | 17g |
| 1159982-14-5 | N#CC1=CNC2=NC=CC(Br)=C21 | 4-Bromo-1H-pyrrolo[2,3-b]pyridine-3-carbonitrile | AG000HED | 6g |
| 1159981-95-9 | BrC1=NC2=CC=NN2C=C1 | 5-Bromopyrazolo[1,5-a]pyrimidine | AG000HEG | 200g |
| 1159512-35-2 | FC(F)(F)c1ccc(Br)c(Br)n1 | 2,3-Dibromo-6-(trifluoromethyl)pyridine | AG000H70 | 1g |
| 1159512-34-1 | C(F)(F)(F)c1nc(Cl)c(cc1)Br | 3-Bromo-2-chloro-6-(trifluoromethyl)pyridine | AG000H71 | 25g |
| 1159511-92-8 | CC1=CC2=CN(C)N=C2C=C1Br | 6-Bromo-2,5-dimethyl-2H-indazole | AG000H78 | 2g |
| 1159511-90-6 | Brc1cc2c(cc1C)nn(c2)C | 2H-Indazole, 5-bromo-2,6-dimethyl- | AG000H79 | 2g |
| 1159511-89-3 | CN1C=C2C(C=CC(Br)=C2C)=N1 | 5-Bromo-2,4-dimethyl-2H-indazole | AG000H7A | 13g |
| 1159511-86-0 | CC1=C(Br)C2=CN(C)N=C2C=C1 | 4-Bromo-2,5-Dimethyl-2H-Indazole | AG000H7B | 25g |
| 1159511-84-8 | CC1=NN(C)C2=C1C=CC=C2Br | 7-bromo-1,3-dimethyl-1H-indazole | AG000H7C | 1g |
| 1159609-95-6 | O=C([C@]1(N)[C@H](C=C)C1)OCC.O=S(C2=CC=C(C)C=C2)(O)=O | (1R,2S)-Ethyl 1-amino-2-vinylcyclopropanecarboxylate 4-methylbenzenesulf | AG000H7F | 2.75g |
| 1159599-99-1 | O=C(O)C(O)=O.C1OCC12CNC2 | 2-Oxa-6-azaspiro[3.3]heptane oxalate | AG000H7I | 50g |
| 1159599-89-9 | NCC1COCCC1.[H]Cl | (Tetrahydro-2h-pyran-3-yl)methanamine, HCl | AG000H7L | 30g |
| 1159598-35-2 | OC[C@H]1CN(C)CCO1 | (R)-4-Methyl-2-(hydroxyMethyl)Morpholine | AG000H7M | 125g |
| 1159598-33-0 | OC[C@@H]1CN(C)CCO1 | (S)-4-Methyl-2-(hydroxymethyl)morpholine | AG000H7N | 15g |
| 1159579-44-8 | O=CC([C@@H]1CCC2=C([C@@]1(C)CC(=O)O)CC[C@@]1([C@]2(C)CC[C@]2([C | Alstonic acid A | AG000H7O | 0.005g |
| 1159554-51-4 | BrC1N2C(C=NC=C2)=NN=1 | 3-Bromo-[1,2,4]triazolo[4,3-a]pyrazine | AG000H7P | 0.5g |
| 115962-35-1 | O=C([C@@H]1N(C(OC(C)(C)C)=O)CC2=C(C=CC=C2)C1)O | Boc-D-Tic-oOH | AG000H7S | 500g |
| 115956-13-3 | CS(=O)(O)=O.O=C(C1=CNC2=C1C=CC=C2)O[C@@H]3C[C@]4([H])[N@@]5CC(C( | Dalasetron Mesylate | AG000H7W | 0.5g |
| 115956-12-2 | O(C(=O)C=1C=2C(NC1)=CC=CC2)[C@@H]3C[C@]4([N@]5[C@](CC(C4)C(=O)C5)( | Dolasetron | AG000H7X | 2g |
| 115956-07-5 | O[C@@H]1C[C@H]2C[C@@H]3C[C@@H](C1)N2CC3=O | endo-8-Hydroxyhexahydro-1H-2,6-methanoquinolizin-3(2H)-one | AG000H7Y | 250g |
| 115955-90-3 | C1=CC2=C(CCNC2)C(=C1)N | 1,2,3,4-Tetrahydroisoquinolin-5-amine hydrochloride | AG000H81 | 30g |
| 115955-48-1 | O=C(C1=CC=CC([N+]([O-])=O)=C1)/C=C/N(C)C | 3-(Dimethylamino)-1-(3-nitrophenyl)prop-2-en-1-one | AG000H82 | 30g |
| 1159680-21-3 | O=C(O)[C@@H](NC(OCC1C2=C(C3=C1C=CC=C3)C=CC=C2)=O)CCCCNC(NS(=O)(C | Fmoc-L-HomoArg(Pbf)-OH | AG000H8A | 174.6g |
| 127910-31-0 | C(=C(CP(=O)(O)O)/C)/C(C(=O)O)N | (E)-2-Amino-4-methyl-5-phosphonopent-3-enoic acid | AG000H8C | 0.5g |
| 115970-66-6 | O=S(CCCC[N+]1=C(C=CC2=C(Cl)C(CCC2)=CC=C3N(CCCCS(=O)([O-])=O)C4=C(C=C | 2-[2-[2-Chloro-3-[[1,3-dihydro-3,3-dimethyl-1-(4-sulfobutyl)-2H-indol-2-ylide | AG000H8H | 25g |
| 115964-29-9 | O=C(C1=CN(C2=CC=C(F)C=C2F)C3=C(C=C(F)C(N4CC(N)CC4)=N3)C1=O)O.O=S(C5= | Tosufloxacin tosilate | AG000H8P | 5g |
| 115964-19-7 | O=C(O)c1[nH]nc(Cl)c1Cl | 3,4-dichloro-1H-pyrazole-5-carboxylic acid | AG000H8Q | 1g |
| 1159738-31-4 | OC(=O)C1(COC1)NCC1=CC=CC=C1 | 3-(Benzylamino)oxetane-3-carboxylic acid | AG000H8S | 20g |
| 1159736-25-0 | N(C(=O)OC(C)(C)C)C1(C(=O)O)COC1 | 3-((tert-Butoxycarbonyl)amino)oxetane-3-carboxylic acid | AG000H8T | 25g |
| 1159735-22-4 | N#CC1(NC(OCC2=CC=CC=C2)=O)CC1 | Cbz-1-Amino-1-cyclopropanecarbonitrile | AG000H8U | 50g |
| 1159734-58-3 | CC(C)(C)OC(=O)NC1(CC1)C2=CC=CO2 | tert-Butyl (1-(furan-2-yl)cyclopropyl)carbamate | AG000H8V | 1.25g |
| 1159734-52-7 | OC(=O)C1(CC1)C1=CN=CC=N1 | 1-(Pyrazin-2-yl)cyclopropane-1-carboxylic acid | AG000H8W | 1g |
| 1159734-50-5 | N#CC1(C2=NC=CN=C2)CC1 | 1-(Pyrazin-2-yl)cyclopropane-1-carbonitrile | AG000H8X | 10g |
| 1159823-51-4 | N#CC1=CC2=C(CNC2)C=C1.[H]Cl | 2,3-Dihydro-1H-isoindole-5-carbonitrile hydrochloride | AG000HC8 | 10g |
| 1159828-70-2 | CC1=CC(NN=C2)=C2C(Cl)=N1 | 4-Chloro-6-methyl-1H-pyrazolo[4,3-c]pyridine | AG000HCA | 5g |
| 1159828-57-5 | CC1=CN=C(Cl)C2=C1NN=C2 | 4-Chloro-7-methyl-1H-pyrazolo[4,3-c]pyridine | AG000HCB | 5g |
| 1159827-76-5 | O=C(C1=CN=C2C=C(F)C=CN21)O | 7-Fluoroimidazo[1,2-a]pyridine-3-carboxylic acid | AG000HCC | 2g |
| 1159827-11-8 | N1C=CC=2C1=C(N=CC2)C#N | 1H-Pyrrolo[2,3-c]pyridine-7-carbonitrile | AG000HCE | 1g |
| 1159826-79-5 | CCOC1CNCCC1.[H]Cl | 3-Ethoxypiperidine hydrochloride | AG000HCF | 25g |
| 1159826-74-0 | CC(C)(C)OC(=O)N1C2CCC1CC(C2)C(O)=O | 8-(tert-Butoxycarbonyl)-8-azabicyclo[3.2.1]octane-3-carboxylic acid | AG000HCG | 15g |
| 1159826-67-1 | CC(C)(C)OC(=O)NCC1CCCNC1.Cl | 3-N-Boc-aminomethyl piperidine-hcl | AG000HCJ | 10g |
| 1159826-64-8 | [H]Cl.[H]Cl.C1NCCC12CCNCC2 | 2,8-diazaspiro[4.5]decane hydrochloride | AG000HCK | 0.3g |
| 1159826-63-7 | BrC1=CC=C(C=C1)CN2N=CC=C2 | 1-(4-Bromobenzyl)-1H-pyrazole | AG000HCL | 3g |
| 1159826-58-0 | Cl.CC(OC(NCCC1CCNCC1)=O)(C)C | 4-(Boc-aminoethyl)piperidine hcl | AG000HCM | 2g |
| 1159826-57-9 | Cl.CCC1NCCCC1=O | 2-Ethyl-piperidin-3-one, HCl | AG000HCN | 2g |
| 1159826-44-4 | Cl[H].O(CC1C=CC=CC=1)C(N1CCCCC1CN)=O | 1-Cbz-2-(aminomethyl)piperidine, HCl | AG000HCR | 5g |
| 1159826-41-1 | Cl[H].NC1CCN(CC1)C(=O)OCC1=CC=CC=C1 | 4-Amino-piperidine-1-carboxylic acid benzyl ester-HCl | AG000HCS | 1g |
| 1190315-61-7 | FC(C1=CC(NC=C2Br)=C2C=N1)(F)F | 3-Bromo-6-(trifluoromethyl)-1H-pyrrolo[3,2-c]pyridine | AG000HOT | 5g |
| 1190316-27-8 | FC(F)(F)c1ccnc2cc[nH]c12 | 7-(Trifluoromethyl)-1H-pyrrolo[3,2-b]pyridine | AG000HP6 | 0.5g |
| 1190316-24-5 | O=C1Cc2c(ncc(Br)c2Cl)N1 | 5-BROMO-4-CHLORO-1H,2H,3H-PYRROLO[2,3-B]PYRIDIN-2-ONE | AG000HP8 | 0.5g |
| 1190316-18-7 | OC(C1C2=C(C=C(C=N2)F)NC=1)=O | 6-FLUORO-1H-PYRROLO[3,2-B]PYRIDINE-3-CARBOXYLIC ACID | AG000HPB | 1g |
| 1190316-03-0 | Oc1nc2[nH]ccc2cc1F | 5-FLUORO-1H-PYRROLO[2,3-B]PYRIDIN-6-OL | AG000HPG | 0.5g |
| 1190316-69-8 | O=Cc1c[nH]c2cc(F)ncc12 | 6-fluoro-1H-pyrrolo[3,2-c]pyridine-3-carbaldehyde | AG000HPX | 1g |
| 1190316-61-0 | CC1=C2C=CN=C2NC=C1C(=O)O | 4-Methyl-1H-Pyrrolo[2,3-B]Pyridine-5-Carboxylic Acid | AG000HQ1 | 0.5g |
| 1190316-58-5 | O=C(C1=CNC2=CC(OC)=CN=C21)O | 6-Methoxy-1H-pyrrolo[3,2-b]pyridine-3-carboxylic acid | AG000HQ3 | 5g |
| 1190317-27-1 | OC1=CC(C)=C2N=CSC2=C1 | 4-Methylbenzo[d]thiazol-6-ol | AG000HQE | 1.5g |
| 1190317-24-8 | O=C(C1=CNC2=C1C=CN=C2O)O | 7-HYDROXY-1H-PYRROLO[2,3-C]PYRIDINE-3-CARBOXYLIC ACID | AG000HQG | 0.5g |
| 1190317-11-3 | NC1=C2C(NC=C2)=NC=C1Br | 5-Bromo-1H-pyrrolo[2,3-b]pyridin-4-amine | AG000HQO | 10g |
| 1190317-09-9 | N#CC1=CC=C2C(NC(C2)=O)=N1 | 2-oxo-2,3-Dihydro-1H-pyrrolo[2,3-b]pyridine-6-carbonitrile | AG000HQP | 0.75g |
| 1190316-96-1 | COC1=NC=CC2=C1NC=C2I | 3-Iodo-7-methoxy-1h-pyrrolo[2,3-c]pyridine | AG000HQV | 3g |
| 117738-82-6 | O=C(O)C1=CC=C(OC)C(C#N)=C1 | 3-cyano-4-methoxybenzoic acid | AG000HQZ | 1g |
| 1190317-75-9 | O=C(C1=CN=C(NC(C2)=O)C2=C1)OC | Methyl 2-oxo-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine-5-carboxylate | AG000HR1 | 1g |
| 1190317-72-6 | ClC1=C(Cl)C=C2C(NC=C2)=N1 | 5,6-Dichloro-1H-pyrrolo[2,3-b]pyridine | AG000HR3 | 5g |
| 1159000-88-0 | COC1=CC=C(C=C1)COC2=NC=C(Br)C=N2 | 5-Bromo-2-(4-methoxybenzyloxy)pyrimidine | AG000H2S | 50g |
| 115905-43-6 | N#Cc1c(C#N)nc(n1C)Br | 2-bromo-4,5-dicyano-1-methyl-1H-imidazole | AG000H2T | 5g |
| 1159-86-0 | O=C(c1ccccc1)c1ccccc1C(=O)c1ccccc1 | 1,2-Dibenzoylbenzene | AG000H34 | 0.7g |
| 1159-54-2 | P(c1ccc(cc1)Cl)(c1ccc(cc1)Cl)c1ccc(cc1)Cl | Phosphine, tris(4-chlorophenyl)- | AG000H38 | 200g |
| 1159-53-1 | CC1=CC=C(N(C2=CC=C(C)C=C2)C3=CC=C(C)C=C3)C=C1 | 4,4′,4”-Trimethyltriphenylamine | AG000H39 | 1000g |
| 115913-32-1 | O=C(C1(C2)CC2(C(OC)=O)C1)OC | dimethyl bicyclo[1.1.1]pentane-1,3-dicarboxylate | AG000H3K | 100g |
| 115913-30-9 | CC(C1(C2)CC2(C(C)=O)C1)=O | 1,1′-(bicyclo[1.1.1]pentane-1,3-diyl)diethanone | AG000H3M | 400g |
| 115909-91-6 | O=C(N1CCC(CCO)CC1)OCC2=CC=CC=C2 | 1-Cbz-4-(2-hydroxy-ethyl)-piperidine | AG000H3S | 25g |
| 115909-22-3 | [C@@H]1(O)[C@@H](O)[C@H](OC[C@H]2O[C@@H](OCCC3C=C(O)C(OC)=CC= | Angoroside C | AG000H3U | 0.25g |
| 1159280-53-1 | O=C(CC1)CCC21CCOCC2 | 3-oxaspiro[5.5]undecan-9-one | AG000H3Z | 10g |
| 1159196-53-8 | NC1=NNC(F)=C1 | 5-Fluoro-1H-Pyrazol-3-Amine | AG000H41 | 7g |
| 1159186-56-7 | OCC1=CC(F)=CC(Br)=C1F | (3-Bromo-2,5-difluorophenyl)methanol | AG000H44 | 10g |
| 115929-59-4 | OC1=C([N+]([O-])=O)C=C(OC)C=C1Br | 2-Bromo-4-methoxy-6-nitrobenzenol | AG000H48 | 50g |
| 1159429-52-3 | O=C(OC)C1=CC=C(OC(F)F)C(O)=C1 | Methyl 4-(difluoromethoxy)-3-hydroxybenzoate | AG000H4O | 25g |
| 1190315-04-8 | FC1=CN=CC2=C1NC=C2 | 7-Fluoro-5-Azaindole | AG000HMW | 8g |
| 1190314-85-2 | FC1=CN=C2NC(=O)CC2=C1 | 5-Fluoro-1H-pyrrolo[2,3-b]pyridin-2(3H)-one | AG000HN7 | 5g |
| 117693-17-1 | O=[N+](/C=C/C1=C(C)C=CS1)[O-] | (E)-3-Methyl-2-(2-nitrovinyl)thiophene | AG000HNG | 15g |
| 1190315-53-7 | O=C(C1=C2C(NC=C2)=NC(Br)=C1)OC | Methyl 6-bromo-1H-pyrrolo[2,3-b]pyridine-4-carboxylate | AG000HNK | 5g |
| 1190315-48-0 | C1=CNC2=CC(=NC=C12)C(F)(F)F | 6-(Trifluoromethyl)-1H-pyrrolo[3,2-c]pyridine | AG000HNN | 1g |
| 1190315-47-9 | COC1=CC(NC=C2I)=C2C=N1 | 3-Iodo-6-methoxy-1H-pyrrolo[3,2-c]pyridine | AG000HNO | 2g |
| 1190315-20-8 | O=C(C1=CNC2=C(Cl)C=CN=C21)O | 7-Chloro-1H-pyrrolo[3,2-b]pyridine-3-carboxylic acid | AG000HO2 | 1.25g |
| 117701-75-4 | O=C(N1CCNCC1)CO | 2-Hydroxy-1-(piperazin-1-yl)ethan-1-one | AG000HO4 | 2g |
| 1190315-94-6 | FC(C1=CC=C(NC=C2)C2=N1)(F)F | 5-(TRIFLUOROMETHYL)-1H-PYRROLO[3,2-B]PYRIDINE | AG000HOA | 2g |
| 1190315-81-1 | O=C(O)C1=C(F)N=CC=C1OC | 2-Fluoro-4-methoxynicotinic acid | AG000HOH | 25g |
| 1190315-79-7 | O=C(C1=CNC2=CC(Cl)=CN=C21)O | 6-Chloro-1H-pyrrolo[3,2-b]pyridine-3-carboxylic acid | AG000HOJ | 15g |
| 1190315-74-2 | Clc1c2c(NC(=O)C2)ncc1F | 4-Chloro-5-fluoro-1H-pyrrolo[2,3-b]pyridin-2(3H)-one | AG000HOL | 10g |
| 1190315-72-0 | O=[N+](C1=C(Br)C2=C(NN=C2)C=C1)[O-] | 4-BROMO-5-NITRO-1H-INDAZOLE | AG000HON | 25g |
| 1190315-69-5 | FC(C1=CC(NC=C2I)=C2C=N1)(F)F | 3-Iodo-6-(trifluoromethyl)-1H-pyrrolo[3,2-c]pyridine | AG000HOO | 5g |
| 1190315-68-4 | O=CC1=CNC2=CC(Cl)=CN=C12 | 6-Chloro-4-azaindole-3-carbaldehyde | AG000HOP | 13g |
| 1159977-65-7 | BrC1=NN2C=CN=C2C=C1 | 6-BROMOIMIDAZO[1,2-B]PYRIDAZINE | AG000HEK | 400g |
| 1159977-56-6 | Clc1cc2NC(=O)C(=O)c2cc1CCN3CCN(CC3)c4nsc5ccccc45 | 5-(2-(4-(Benzo[d]isothiazol-3-yl)piperazin-1-yl)ethyl)-6-chloroindoline-2,3-di | AG000HEL | 0.025g |
| 1159976-38-1 | BrC=1C=C2C(=NC(=NC2=CC1)C(=O)OCC)Cl | Ethyl 6-bromo-4-chloroquinazoline-2-carboxylate | AG000HES | 6g |
| 115996-72-0 | COC(C1(CCOCC1)O)=O | Methyl 4-hydroxy-tetrahydro-2h-pyran-4-carboxylate | AG000HEZ | 25g |
| 1159983-77-3 | CC(OC(N1CC(C(F)(F)F)C(=O)CC1)=O)(C)C | 1-BOC-3-trifluoromethyl-piperidin-4-one | AG000HF1 | 3g |
| 1159983-30-8 | O=C(O)CC1(N)CCN(C(OC(C)(C)C)=O)CC1 | 2-(4-Amino-1-(tert-butoxycarbonyl)piperidin-4-yl)acetic acid | AG000HF3 | 25g |
| 1159983-16-0 | FC1=C(C)C=C2C(C=NC=C2)=C1 | 7-fluoro-6-methylisoquinoline | AG000HF4 | 7g |
| 1159983-15-9 | C1(CCCC1)C(N)C1=NC2=CC=CC=C2C=C1 | Cyclopentyl(quinolin-2-yl)methanamine | AG000HF5 | 5g |
| 1159982-97-4 | N#Cc1cnn2c1nccc2Cl | 7-Chloropyrazolo[1,5-a]pyrimidine-3-carbonitrile | AG000HF6 | 0.5g |
| 1159982-64-5 | O=C(OC(C)(C)C)N1CCC(CC1)C(C(F)(F)F)N | 1-(1-Boc-4-piperidyl)-2,2,2-trifluoroethylamine | AG000HF7 | 9g |
| 1159982-58-7 | CC(C)(C)OC(=O)N1CCC(=O)C2(CCN(Cc3ccccc3)CC2)C1 | TERT-BUTYL 9-BENZYL-5-OXO-2,9-DIAZASPIRO[5.5]UNDECANE-2-CARBOXYLAT | AG000HF9 | 5g |
| 1159982-41-8 | O=C(C1=CCCN(CC2=CC=CC=C2)C1)OCC | Ethyl 1-benzyl-1,2,5,6-tetrahydropyridine-3-carboxylate | AG000HFA | 0.5g |
| 1159982-21-4 | COC(C1NC2=C(C(=CC=N2)Br)C=1)=O | Methyl 4-bromo-1h-pyrrolo[2,3-b]pyridine-2-carboxylate | AG000HFD | 0.25g |
| 116-26-7 | O=CC1=C(C)C=CCC1(C)C | 2,6,6-Trimethylcyclohexa-1,3-dienecarbaldehyde | AG000HFF | 300g |
| 116-25-6 | CC1(C)N(CO)C(=O)NC1=O | 1-Hydroxymethyl-5,5-Dimethylhydantoin | AG000HFG | 100g |
| 1159822-22-6 | Cl.Cl.N1CC(CCCC1)N | Azepan-3-amine dihydrochloride | AG000HBF | 2g |
| 1159822-20-4 | [H]Cl.[H]Cl.N1CCCC12CCNCC2 | 1,8-Diaza-spiro[4.5]decane 2hcl | AG000HBG | 0.75g |
| 1159825-57-6 | N#CC1=CC=CC2=C1CNC2.[H]Cl | 4-Cyano-isoindoline, HCl | AG000HBL | 2g |
| 1159825-34-9 | CC(C)(C)OC(=O)N1CCN2CCNCC2C1 | 2-Boc-octahydropyrazino[1,2-a]pyrazine | AG000HBP | 10g |
| 1159825-32-7 | O=CC1CCNCC1.[H]Cl | 4-Formylpiperidine hcl | AG000HBQ | 125g |
| 1159825-25-8 | BrC1=CC(C2CCNCC2)=CC=C1.[H]Cl | 4-(3-Bromo-phenyl)-piperidine, HCl | AG000HBR | 10g |
| 1159825-22-5 | Cl.BrCC1CCNCC1 | 4-(bromomethyl)piperidine hydrochloride | AG000HBS | 500g |
| 1159825-20-3 | O=C(N1CC(CO)NCC1)OCC2=CC=CC=C2.[H]Cl | Benzyl 3-(hydroxymethyl)piperazine-1-carboxylate hydrochloride | AG000HBT | 3g |
| 1159825-08-7 | Cl.COC1=CC(N)=CC=C1OCC1=CC=CC=C1 | 4-(Benzyloxy)-3-methoxyaniline hydrochloride | AG000HBV | 2g |
| 1159825-06-5 | Cl.C(C(=O)O)(CN)(F)F | 3-Amino-2,2-Difluoropropanoic Acid Hydrochloride | AG000HBW | 10g |
| 1159824-67-5 | O=S(C1=CC(C2=CN3C(C(F)=C2)=NC(N)=N3)=CN=C1)(NC(C)(C)C)=O | 5-{2-Amino-8-fluoro-[1,2,4]triazolo[1,5-a]pyridin-6-yl}-N-tert-butylpyridine-3 | AG000HBZ | 0.3g |
| 1159824-37-9 | Cl.Cl.C1CC2(C1)CNCCN2 | 5,8-Diaza-spiro[3.5]nonane DiHCl | AG000HC0 | 1.25g |
| 1159824-20-0 | Cl.Cl.N1CCC(CC1)C1=CC=C(N)C=C1 | 4-(Piperidin-4-yl)aniline dihydrochloride | AG000HC3 | 4g |
| 1190322-13-4 | O=C1CC2=C(Cl)C=C(Cl)N=C2N1 | 4,6-Dichloro-1H-pyrrolo[2,3-b]pyridin-2(3H)-one | AG000I1B | 20g |
| 1190322-59-8 | Nc1ccnc2[nH]cc(Br)c12 | 3-Bromo-1h-pyrrolo[2,3-b]pyridin-4-amine | AG000I1I | 1g |
| 1190322-58-7 | BrC=1C=CC=C2C(=CC=NC12)CNC | 1-(8-Bromoquinolin-4-yl)-N-methylmethanamine | AG000I1J | 2g |
| 1190322-53-2 | COC1N=C2C(C=CN2)=C(OC)C=1 | 4,6-Dimethoxy-1H-pyrrolo[2,3-b]pyridine | AG000I1O | 0.5g |
| 1190322-48-5 | Oc1cnc2c(c1)c(I)c[nH]2 | 1H-Pyrrolo[2,3-b]pyridin-5-ol, 3-iodo- | AG000I1T | 1g |
| 1190322-47-4 | COC(=O)C1=NNC2=CC=CC(Br)=C12 | methyl 4-bromo-1H-indazole-3-carboxylate | AG000I1U | 20g |
| 1190322-38-3 | Fc1cncc2[nH]cc(I)c12 | 4-fluoro-3-iodo-1H-pyrrolo[2,3-c]pyridine | AG000I22 | 1g |
| 1190322-37-2 | O=C(C1=CNC2=NC=CC(O)=C21)O | 4-Hydroxy-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid | AG000I23 | 5g |
| 1190322-87-2 | O=C1Cc2ccc(F)nc2N1 | 6-Fluoro-1H-pyrrolo[2,3-b]pyridin-2(3H)-one | AG000I26 | 0.5g |
| 1190322-81-6 | O=C1CC2=CC=C(Br)N=C2N1 | 6-Bromo-1H-pyrrolo[2,3-b]pyridin-2(3H)-one | AG000I2C | 4g |
| 1190322-78-1 | IC1=CNC2=NC(Cl)=CC=C21 | 6-Chloro-3-iodo-1H-pyrrolo[2,3-b]pyridine | AG000I2F | 5g |
| 1190322-73-6 | Cc1cc2cc([N+](=O)[O-])cnc2[nH]1 | 2-Methyl-5-nitro-1H-pyrrolo[2,3-b]pyridine | AG000I2K | 5g |
| 1190322-65-6 | COC(=O)C1=CN=C2NC=C(Br)C2=C1 | 3-Bromo-7-azaindole-5-carboxylic acid methyl ester | AG000I2S | 75g |
| 1190323-01-3 | BrC1=CNC=2C1=NC=C(C2)C | 3-Bromo-6-methyl-1H-pyrrolo[3,2-b]pyridine | AG000I2Z | 0.5g |
| 1190323-00-2 | Cc1ccnc2c1CC(=O)N2 | 4-Methyl-1H-pyrrolo[2,3-b]pyridin-2(3H)-one | AG000I30 | 1g |
| 1190322-98-5 | O=C1CC2=NC=C(C)C=C2N1 | 6-Methyl-1H,3H-pyrrolo[3,2-b]pyridin-2-one | AG000I31 | 5g |
| 1190322-96-3 | IC1=CNC=2C1=NC=C(C2)C(=O)O | 3-Iodo-1H-pyrrolo[3,2-b]pyridine-6-carboxylic acid | AG000I33 | 2g |
| 1159813-53-2 | Cl.BrC2=C1CNCCC1=CC=C2 | 8-Bromo-1,2,3,4-tetrahydroisoquinoline, HCl | AG000H9H | 10g |
| 1159813-15-6 | CC1=NN2C=C(C=C(C2=N1)Br)Cl | 8-Bromo-6-chloro-2-methyl-[1,2,4]triazolo[1,5-a]pyridine | AG000H9M | 20g |
| 1159812-65-3 | CC(C1NCCNC1)(C)C.[H]Cl.[H]Cl | 2-tert-Butylpiperazine dihydrochloride | AG000H9Q | 2g |
| 1159812-31-3 | CC1=NN2C=CC(Br)=CC2=N1 | 7-Bromo-2-methyl-[1,2,4]triazolo[1,5-a]pyridine | AG000H9R | 30g |
| 1159811-97-8 | BrC2=C[N]1C(=NC(=C1)C)C=N2 | 6-Bromo-2-methylimidazo[1,2-a]pyrazine | AG000H9S | 50g |
| 1159811-23-0 | ClC2=CC1=NC=N[N]1C=N2 | 7-Chloro[1,2,4]triazolo[1,5-c]pyrimidine | AG000H9X | 75g |
| 115978-59-1 | O=C(C1CCC(C2CCC(CCC)CC2)CC1)OC3=CC=C([C@H]4CC[C@H](CCCC)CC4)C=C3 | 4-(trans,trans-4-Butylcyclohexyl)phenyl 4′-propyl-[1,1′-bi(cyclohexane)]-4-ca | AG000HA1 | 500g |
| 1159821-66-5 | NC1=CC=C(C2CC2)N=C1 | 6-Cyclopropylpyridin-3-amine | AG000HA6 | 75g |
| 1159821-42-7 | OC1=NC=C(C2CC2)C=C1 | 5-Cyclopropylpyridin-2-ol | AG000HA7 | 15g |
| 1159820-58-2 | CC(C1=NC=C(Br)C=C1)C | 5-Bromo-2-isopropylpyridine | AG000HAB | 10g |
| 1159818-57-1 | NC1=NC=NC(=C1)Br | 4-AMINO-6-BROMOPYRIMIDINE | AG000HAE | 125g |
| 1159817-16-9 | CC(C1=CN=C(Br)S1)C | 2-Bromo-5-isopropylthiazole | AG000HAH | 6.67g |
| 1159816-70-2 | BrC1=CN=C(OC2CCC2)C=C1 | 5-Bromo-2-cyclobutoxypyridine | AG000HAJ | 2g |
| 1190317-61-3 | COC1=CC=C2C(=N1)NC=C2C(=O)O | 6-Methoxy-1H-Pyrrolo[2,3-B]Pyridine-3-Carboxylic Acid | AG000HR9 | 0.5g |
| 1190317-45-3 | N#CC1=C(Br)C=C2C(NC=C2)=N1 | 5-Bromo-1H-pyrrolo[2,3-b]pyridine-6-carbonitrile | AG000HRH | 10g |
| 117752-88-2 | N[C@@H](CO1)CC1=O.[H]Cl | (R)-3-AMINO-GAMMA-BUTYROLACTONE HYDROCHLORIDE | AG000HRM | 50g |
| 117752-82-6 | N[C@H](CO1)CC1=O.[H]Cl | (S)-3-Amino-gamma-butyrolactone hydrochloride | AG000HRN | 10g |
| 1190318-10-5 | IC1=CNC2=C(Cl)C=CN=C21 | 7-CHLORO-3-IODO-1H-PYRROLO[3,2-B]PYRIDINE | AG000HRU | 1g |
| 1190318-05-8 | Clc1c2c([nH]c1)ncc(c2)N(=O)=O | 1H-Pyrrolo[2,3-b]pyridine, 3-chloro-5-nitro- | AG000HRX | 2g |
| 1190318-02-5 | ClC1=NC=CC2=C1NC=C2Br | 3-Bromo-7-chloro-1H-pyrrolo[2,3-c]pyridine | AG000HRY | 10g |
| 1190317-94-2 | FC1=C2C(NC=C2)=NC=C1Cl | 5-Chloro-4-fluoro-7-azaindole | AG000HS3 | 3g |
| 1190317-85-1 | Clc1cnc2c(Br)c[nH]c2c1 | 3-Bromo-6-chloro-1H-pyrrolo[3,2-b]pyridine | AG000HS6 | 5g |
| 1190317-82-8 | O=CC1=CNC2=CC=C(Br)N=C12 | 5-Bromo-1H-pyrrolo[3,2-b]pyridine-3-carbaldehyde | AG000HS7 | 2g |
| 1190318-68-3 | CC1=C2C(I)=CNC2=CN=C1 | 3-Iodo-4-methyl-1H-pyrrolo[2,3-c]pyridine | AG000HSC | 2g |
| 1190318-63-8 | Brc1c2c(ncc1)cc[nH]2 | 7-Bromo-4-azaindole | AG000HSE | 20g |
| 1190318-41-2 | ClC1=C(NC=C2Br)C2=NC=C1 | 3-Bromo-7-chloro-1H-pyrrolo[3,2-b]pyridine | AG000HSR | 10g |
| 1190318-26-3 | O=C1Cc2ccnc(Br)c2N1 | 7-Bromo-1H-pyrrolo[2,3-c]pyridin-3-amine | AG000HSX | 10g |
| 1190318-93-4 | O=C(N1)CC2=C1C=NC=C2Br | 4-Bromo-1H-pyrrolo[2,3-c]pyridin-2(3H);-one | AG000HT2 | 5g |
| 1190318-92-3 | O=C1Cc2c(N1)c(ncc2)C(=O)O | 1H-Pyrrolo[2,3-c]pyridine-7-carboxylic acid, 2,3-dihydro-2-oxo- | AG000HT3 | 0.575g |
| 1190865-42-9 | FC(C(C1=CC(Br)=CC(Br)=C1)=O)(F)F | 1-(3,5-dibromophenyl)-2,2,2-trifluoroethan-1-one | AG000I52 | 2.2g |
| 1190862-72-6 | O=C(O)C1=CN=C(C)C(Br)=C1 | 5-Bromo-6-methylnicotinic acid | AG000I53 | 50g |
| 1190862-70-4 | CCOC(=O)C1=CN=C(C)C(Br)=C1 | Ethyl 5-bromo-6-methylnicotinate | AG000I54 | 50g |
| 1190862-68-0 | C=1(C(=CC(=CN1)C(=O)OCC)Br)Br | Ethyl 5,6-dibromonicotinate | AG000I55 | 2g |
| 1190861-43-8 | O=C1NC2=C(C=CC(Br)=C2)C13CCOCC3 | 6-Bromo-2′,3′,5′,6′-tetrahydrospiro[indoline-3,4′-pyran]-2-one | AG000I57 | 6g |
| 119083-00-0 | O=C(C1=C(C(F)(F)F)N(C)N=C1)O | 1-Methyl-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid | AG000I5E | 1g |
| 119082-97-2 | OC(C1SC(C2=NC=CC=C2)=CC=1)=O | 5-(Pyridin-2-yl)thiophene-2-carboxylic acid | AG000I5G | 1g |
| 1190927-76-4 | CC1=NN=C2C=C(Br)C=CN21 | 7-Bromo-3-methyl-[1,2,4]triazolo[4,3-a]pyridine | AG000I5N | 50g |
| 1190927-74-2 | ClC1=C2C(CNC2)=NC(Cl)=N1.[H]Cl | 2,4-Dichloro-6,7-dihydro-5h-pyrrolo[3,4-d]pyrimidine hcl | AG000I5O | 20g |
| 1190897-26-7 | O=C(N1CCC2=NN=C(O)C=C2CC1)OCC | Ethyl 3-hydroxy-8,9-dihydro-5H-pyridazino[3,4-d]azepine-7(6H)-carboxylate | AG000I5S | 5g |
| 1190890-12-0 | O=C(N1[C@@H](CN)CCC1)OC(C)(C)C.[H]Cl | (R)-tert-Butyl 2-(aminomethyl)pyrrolidine-1-carboxylate hydrochloride | AG000I5W | 3g |
| 1190890-11-9 | O=C(N1[C@H](CN)CCC1)OC(C)(C)C.[H]Cl | (S)-tert-Butyl 2-(aminomethyl)pyrrolidine-1-carboxylate hydrochloride | AG000I5X | 6g |
| 1190875-60-5 | OB(C1=CC=C(CO)C(Cl)=C1)O | 3-Chloro-4-(hydroxymethyl)phenylboronic acid | AG000I5Y | 40g |
| 1190989-12-8 | O=C(C1=C(F)C(B(O)O)=CC=C1F)OC | 2,4-Difluoro-3-(methoxycarbonyl)phenylboronic acid | AG000I6A | 20g |
| 1190989-09-3 | O=C(C1=C(F)C=C(B(O)O)C=C1F)OC | 3，5-Difluoro-4-(methoxycarbonyl)phenylboronic acid | AG000I6B | 10g |
| 1190987-12-2 | OC(=O)c1nc2c(s1)CNCC2 | 4,5,6,7-Tetrahydrothiazolo[5,4-c]pyridine-2-carboxylic acid | AG000I6C | 1g |
| 1190978-93-8 | CCCCCCOC1=CC2=NSN=C2C=C1OCCCCCC | 5,6-Bis(hexyloxy)benzo[c][1,2,5]thiadiazole | AG000I6F | 5g |
| 1190971-73-3 | O=C(C(S1)=NC2=C1CNCC2)O.[H]Cl | 4,5,6,7-Tetrahydrothiazolo[5,4-c]pyridine-2-carboxylic acid hydrochloride | AG000I6G | 25g |
| 116-09-6 | CC(CO)=O | Hydroxyacetone | AG000HFM | 1143.5g |
| 116-02-9 | CC1CC(C)(C)CC(O)C1 | 3,3,5-Trimethylcyclohexanol | AG000HFP | 500g |
| 1190310-52-1 | O=C1NC2=C(F)N=CC=C2C1 | 7-Fluoro-1H-pyrrolo[2,3-c]pyridin-2(3H)-one | AG000HFV | 1.25g |
| 1190310-51-0 | ClC1=NC=C2C(C(=CN2)I)=C1 | 5-Chloro-3-Iodo-1H-Pyrrolo[2,3-c]Pyridine | AG000HFW | 25.04g |
| 1190310-24-7 | COC(=O)c1c(F)cnc2[nH]ccc12 | METHYL 5-FLUORO-1H-PYRROLO[2,3-B]PYRIDINE-4-CARBOXYLATE | AG000HGE | 1g |
| 1190310-88-3 | ClC1=NC2=C(NC=C2I)C=C1 | 5-Chloro-3-iodo-1H-pyrrolo[3,2-b]pyridine | AG000HGR | 2g |
| 1190310-82-7 | COC(=O)C1=C2C(Br)=CNC2=NC=C1 | Methyl 3-bromo-7-azaindole-4-carboxylate | AG000HGU | 40g |
| 1190310-75-8 | ClC1=CC=C(NC=C2Br)C2=N1 | 3-Bromo-5-chloro-1H-pyrrolo[3,2-b]pyridine | AG000HGZ | 15g |
| 1190310-73-6 | C1=CN=C2C(=CNC2=C1C(=O)O)I | 3-Iodo-1H-pyrrolo[3,2-b]pyridine-7-carboxylic acid | AG000HH0 | 2g |
| 117559-36-1 | NCCC[Si](C(C)C)(C(C)C)OCC | 3-(Ethoxydiisopropylsilyl)propan-1-amine | AG000HH5 | 2.5g |
| 1190311-44-4 | FC(C1=CN=C2C(NC=C2)=C1)(F)F | 6-(Trifluoromethyl)-1H-pyrrolo[3,2-b]pyridine | AG000HHA | 25g |
| 1190311-14-8 | O=C(C1=CC=C(NC(C2)=O)C2=N1)OC | Methyl 2-oxo-2,3-dihydro-1H-pyrrolo[3,2-b]pyridine-5-carboxylate | AG000HHS | 0.5g |
| 1190311-94-4 | O=[N+](C1=CNC2=CC(Br)=CN=C21)[O-] | 6-Bromo-3-Nitro-1H-Pyrrolo[3,2-B]Pyridine | AG000HHX | 25g |
| 1190314-15-8 | OC1=C2NC=C(Br)C2=CC=N1 | 3-Bromo-1H-pyrrolo[2,3-c]pyridin-7-ol | AG000HLH | 0.5g |
| 1190314-13-6 | Cl.COC1(CCNCC1)C(=O)OC | methyl 4-methoxypiperidine-4-carboxylate hydrochloride | AG000HLJ | 10g |
| 1190314-08-9 | OC1=C2NC=C(Cl)C2=CC=N1 | 3-Chloro-1H-pyrrolo[2,3-c]pyridin-7-ol | AG000HLM | 1.25g |
| 1190314-06-7 | COC(=O)c1ccnc2[nH]cc(C=O)c12 | Methyl 3-formyl-1H-pyrrolo[2,3-b]pyridine-4-carboxylate | AG000HLN | 1g |
| 1190313-88-2 | COC(=O)c1ccnc2[nH]cc(I)c12 | METHYL 3-IODO-1H-PYRROLO[2,3-B]PYRIDINE-4-CARBOXYLATE | AG000HLW | 5g |
| 1190314-69-2 | O=C(C1=CNC2=NC=C(F)C=C21)OC | Methyl 5-fluoro-7-azaindole-3-carboxylate | AG000HM3 | 30g |
| 1190314-63-6 | C1=CN=C(C2=C1C(=CN2)I)Cl | 7-Chloro-3-Iodo-1H-Pyrrolo[2,3-C]Pyridine | AG000HM6 | 25g |
| 1190314-60-3 | O=C1CC2=CC(Cl)=CN=C2N1 | 5-Chloro-1H-pyrrolo[2,3-b]pyridin-2(3H)-one | AG000HM8 | 50g |
| 1190314-42-1 | COC1=C(Br)C(NC=C2)=C2C=N1 | 7-Bromo-6-methoxy-1H-pyrrolo[3,2-c]pyridine | AG000HMI | 13g |
| 1190314-41-0 | CC1=CN=C(NC=C2Br)C2=C1 | 3-Bromo-5-methyl-1h-pyrrolo[2,3-b]pyridine | AG000HMJ | 15g |
| 1190314-35-2 | O=[N+](C1=C(C)C=C(C)C2=C1C=CN2)[O-] | 5,7-Dimethyl-4-nitro-1H-indole | AG000HMM | 10g |
| 1190315-15-1 | ClC1=C2NC=C(Cl)C2=NC=C1 | 3,7-Dichloro-1H-pyrrolo[3,2-b]pyridine | AG000HMS | 2g |
| 1190315-07-1 | COC1=C(C=C2C=CNC2=N1)Cl | 5-Chloro-6-methoxy-7-azaindole | AG000HMU | 10g |
| 1191-43-1 | SCCCCCCS | 1,6-Hexanedithiol | AG000I6L | 3500g |
| 1191-30-6 | O=CCCCCBr | 5-Bromopentanal | AG000I6P | 3g |
| 1191-25-9 | O=C(O)CCCCCO | 6-HYDROXYCAPROIC ACID | AG000I6Q | 200g |
| 1191-16-8 | CC(OC/C=C(C)C)=O | Prenyl acetate | AG000I6T | 2775g |
| 1191-08-8 | SCCCCS | 1,4-Butanedithiol | AG000I6V | 300g |
| 1191-04-4 | CCCC=CC(O)=O | Trans-2-hexenoic acid | AG000I6W | 25g |
| 1191028-50-8 | ClC1=CC2=C(NC=C2)C=C1Br | 6-Bromo-5-chloro-1H-indole | AG000I6Y | 125g |
| 119102-24-8 | C(=O)(OCC)C12CN(CC1)CC2 | 1-Azabicyclo[2.2.1]heptane-4-carboxylic acid, ethyl ester | AG000I74 | 10g |
| 1191-95-3 | O=C1CCC1 | Cyclobutanone | AG000I79 | 518.9g |
| 1191-87-3 | COCCOCCOCCOCCOCCOC | 2,5,8,11,14,17-Hexaoxaoctadecane | AG000I7E | 0.5g |
| 1191-85-1 | CCCCCCCCCCCCCCCCCCCC(=O)O | 5,8,11,14-Eicosatetraynoic Acid | AG000I7F | 0.004g |
| 1191-62-4 | C(CCCCS)CCCS | 1,8-Octanedithiol | AG000I7K | 500g |
| 1191-50-0 | O=S(OCCCCCCCCCCCCCC)([O-])=O.[Na+] | Sodium Tetradecyl Sulfate | AG000I7M | 50g |
| 1191076-36-4 | O=C(O)C1=C(C)C=C(Br)C=C1N | 2-Amino-4-bromo-6-methylbenzoic acid | AG000I7R | 4g |
| 1191063-90-7 | O=C(O)CCB1OC(C)(C)C(C)(C)O1 | 2-Carboxyethylboronic acid, pinacol ester | AG000I7S | 15g |
| 1191063-07-6 | FC1=CC(C#C)=CC=C1Br | 1-Bromo-4-ethynyl-2-fluorobenzene | AG000I7U | 10g |
| 1191062-85-7 | CC1=C(N2CCOCC2)N=CC(B(O)O)=C1 | (5-Methyl-6-morpholinopyridin-3-yl)boronic acid | AG000I7W | 2g |
| 119111-65-8 | CN(C1(CC1)C(=O)O)C | 1-(Dimethylamino)cyclopropanecarboxylic acid | AG000I84 | 15g |
| 119111-64-7 | OC(=O)C1(CC1)N1CCCCC1 | 1-(Piperidin-1-yl)cyclopropanecarboxylic acid | AG000I85 | 1g |
| 117968-51-1 | O=C(OC)C#CCO[Si](C)(C(C)(C)C)C | 4-(tert-Butyl-dimethyl-silanyloxy)-but-2-ynoic acid methyl ester | AG000I8D | 8g |
| 119137-15-4 | N(=[N+]=[N-])CCCCCCI | 1-Azido-6-iodohexane | AG000I8L | 2g |
| 119124-53-7 | O=C1C(C)COCC1 | 3-Methyldihydro-2H-pyran-4(3H)-one | AG000I8Q | 100g |
| 1191453-81-2 | NC1=NN(C)C(Cl)=C1 | 5-Chloro-1-methyl-1H-pyrazol-3-amine | AG000I93 | 1g |
| 1191429-20-5 | C=CCCCCCC[C@@H](NC(OCC1C2=C(C3=C1C=CC=C3)C=CC=C2)=O)C(O)=O | (R)-2-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)dec-9-enoic acid | AG000I94 | 6g |
| 118-03-6 | NC1=C(S(O)(=O)=O)C=C2C(C(S(O)(=O)=O)=CC(S(O)(=O)=O)=C2)=C1 | 2-Naphthylamine-3,6,8-Trisulfonic Acid | AG000I9M | 3500g |
| 118-00-3 | O=C1C(N=CN2[C@H]3[C@H](O)[C@H](O)[C@@H](CO)O3)=C2NC(N)=N1 | Guanosine | AG000I9O | 29.95g |
| 119169-78-7 | C[C@@]12[C@@H](C(=O)NC(C)(C)C)CC[C@@]1([H])[C@]1([H])CC=C3C=C(C(=O | Epristeride | AG000I9P | 0.03g |
| 119165-68-3 | C1(C2=NC=CN2)=NC=CN=C1 | 2-(1H-Imidazol-2-yl)pyrazine | AG000I9S | 10g |
| 119162-53-7 | NC1=CC(=NO1)C1=CC=C(Br)C=C1 | 3-(4-Bromo-phenyl)isoxazol-5-ylamine | AG000I9W | 20g |
| 119162-52-6 | NC1=CC(=NO1)C1=CC(Br)=CC=C1 | 3-(3-Bromophenyl)-5-isoxazolamine | AG000I9X | 0.5g |
| 119162-51-5 | C1=CC=C(C(=C1)C2=NOC(=C2)N)Br | 3-(2-Bromophenyl)-1,2-oxazol-5-amine | AG000I9Y | 3g |
| 119162-50-4 | NC1=CC(C2=CC=CC(F)=C2)=NO1 | 3-(3-Fluorophenyl)-1,2-oxazol-5-amine | AG000I9Z | 20g |
| 119162-49-1 | C1=CC=C(C(=C1)C2=NOC(=C2)N)F | 3-(2-Fluorophenyl)-1,2-oxazol-5-amine | AG000IA0 | 4g |
| 1190319-70-0 | FC1=CC2=C(NC=C2)C=N1 | 5-Fluoro-1H-pyrrolo[2,3-c]pyridine | AG000HVD | 25g |
| 1190319-63-1 | O=C(C1=CN=CC2=C1C=CN2)O | 1H-Pyrrolo[2,3-c]pyridine-4-carboxylic acid | AG000HVK | 30g |
| 1190319-62-0 | O=C1CC2=NC=C(Br)C=C2N1 | 6-Bromo-1H-pyrrolo[3,2-b]pyridin-2(3H)-one | AG000HVL | 100g |
| 1190319-59-5 | N#CC1=CN=CC2=C1C=CN2 | 1H-Pyrrolo[2,3-c]pyridine-4-carbonitrile | AG000HVN | 5.08g |
| 1190319-56-2 | OC(=O)C1=CNC2=C1N=CC(Br)=C2 | 6-Bromo-1H-pyrrolo[3,2-b]pyridine-3-carboxylic acid | AG000HVP | 10g |
| 1190320-05-8 | Fc1ccnc2[nH]cc(I)c12 | 4-Fluoro-3-iodo-1H-pyrrolo[2,3-b]pyridine | AG000HVU | 0.5g |
| 1190320-00-3 | FC1=C2C(Br)=CNC2=NC=C1 | 3-Bromo-4-fluoro-1H-pyrrolo[2,3-b]pyridine | AG000HVZ | 10g |
| 1190319-97-1 | O=C(C1=CNC2=NC(F)=CC=C21)O | 6-Fluoro-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid | AG000HW2 | 1.5g |
| 1190319-95-9 | N#CC1=C(C)C=C(C)C2=C1C=CN2 | 5,7-Dimethyl-1H-indole-4-carbonitrile | AG000HW4 | 2g |
| 1190319-87-9 | OC(C1C2=C(C=CC(=N2)F)NC=1)=O | 5-Fluoro-1H-pyrrolo[3,2-b]pyridine-3-carboxylic acid | AG000HWC | 1g |
| 1190319-86-8 | O=[N+](C1=CC=C(Br)C2=C1NN=C2)[O-] | 4-Bromo-7-Nitro-1H-Indazole | AG000HWD | 10g |
| 1190320-33-2 | FC1=CN=C2C(NC=C2)=C1 | 6-Fluoro-1H-pyrrolo[3,2-b]pyridine | AG000HWH | 25g |
| 1190320-21-8 | FC(C1=CC=C(NC=C2I)C2=N1)(F)F | 3-Iodo-5-(trifluoromethyl)-1H-pyrrolo[3,2-b]pyridine | AG000HWT | 5g |
| 1190320-16-1 | FC(c1ccc2c(n1)c(Br)c[nH]2)(F)F | 3-Bromo-5-(trifluoromethyl)-1H-pyrrolo[3,2-b]pyridine | AG000HWX | 3g |
| 1190320-10-5 | NC1=CN=CC2=C1C=CN2 | 1H-Pyrrolo[2,3-c]pyridin-4-aMine | AG000HX3 | 1g |
| 1190320-09-2 | FC1=CN=CC2=C1NC=C2Br | 3-Bromo-7-fluoro-1H-pyrrolo[3,2-c]pyridine | AG000HX4 | 3g |
| 1159815-90-3 | BrC1SC(C2CC2)=CN=1 | 2-Bromo-5-cyclopropylthiazole | AG000HAM | 1g |
| 1159815-51-6 | Brc1csc(n1)C1CCNCC1 | 4-Bromo-2-(piperidin-4-yl)thiazole | AG000HAP | 2g |
| 1159815-12-9 | CCC1=NC=C(Cl)C=C1 | 5-Chloro-2-ethylpyridine | AG000HAQ | 0.75g |
| 1159813-93-0 | NCC1CC(F)(F)C1.[H]Cl | (3,3-difluorocyclobutyl)methanamine hydrochloride | AG000HAT | 100g |
| 1159823-45-6 | Cl.Cl.NC1(=C(C=CC=C1)CCN) | 2-(2-Aminoethyl)aniline 2HCl | AG000HAW | 0.5g |
| 1159823-34-3 | OC1CCNCCC1.[H]Cl | Hexahydro-1h-azepin-4-ol, HCl | AG000HAX | 25g |
| 1159823-04-7 | O=C(N1C(CN)CCCC1)OC(C)(C)C.[H]Cl | 2-(Aminomethyl)-1-n-boc-piperidine-hcl | AG000HAZ | 15g |
| 1159823-02-5 | CC(C1=CN=CC=C1)N.Cl.Cl | 1-Pyridin-3-yl-ethylamine DiHCl | AG000HB0 | 75g |
| 1159822-76-0 | N(CC1=CC=CC=C1)(CCC2)C32CNC3.Cl.Cl | 5-Benzyl-2,5-diaza-spiro[3.4]octane DiHCl | AG000HB7 | 9g |
| 1159822-61-3 | COC1=CC2=C(CNC2)C=C1.[H]Cl | 5-Methoxyisoindoline hydrochloride | AG000HBA | 5g |
| 1159822-27-1 | O=C(N1CC(N)CC1)OCC2=CC=CC=C2.[H]Cl | benzyl 3-aminopyrrolidine-1-carboxylate, HCl | AG000HBC | 10g |
| 1159822-23-7 | OC(C1CC2N(C(OCC3=CC=CC=C3)=O)C(CC2)C1)=O | N-Cbz-8-azabicyclo[3.2.1]octane-3-carboxylic acid | AG000HBE | 5g |
| 1190320-39-8 | ClC1=CC2=C(C=N1)C(=CN2)N | 6-Chloro-1H-pyrrolo[3,2-c]pyridin-3-amine | AG000HXQ | 2g |
| 1190321-04-0 | C1=C2C(=CNC2=NC=C1N)Br | 5-AMino-3-BroMo-7-azaindole | AG000HXY | 10g |
| 1190321-01-7 | Fc1nccc2c1[nH]cc2 | 1H-Pyrrolo[2,3-c]pyridine, 7-fluoro- | AG000HY1 | 0.5g |
| 1190320-95-6 | Brc1c[nH]c2c1ccnc2F | 3-Bromo-7-fluoro-1H-pyrrolo[2,3-c]pyridine | AG000HY6 | 2g |
| 117879-49-9 | O=C1NCCC1N.[H]Cl | 3-Aminopyrrolidin-2-One Hydrochloride | AG000HYM | 25g |
| 1190321-49-3 | O=C(C1=CNC2=NC=C(Cl)C=C21)OC | methyl 5-chloro-1H-pyrrolo[2,3-b]pyridine-3-carboxylate | AG000HYQ | 1g |
| 1190321-31-3 | ClC1=CNC2=C1C=CC(Br)=N2 | 6-Bromo-3-chloro-1H-pyrrolo[2,3-b]pyridine | AG000HYX | 5g |
| 1190321-28-8 | N#CC1=CC=C(C)C2=C1NC=C2 | 4-Methyl-1H-indole-7-carbonitrile | AG000HYY | 2g |
| 1190321-24-4 | CC1=CC2=C(N=C1)NC=C2[N+]([O-])=O | 5-Methyl-3-nitro-1H-pyrrolo[2,3-b]pyridine | AG000HZ0 | 4g |
| 1190321-22-2 | O=CC1=CNC2=C1C=C(F)C=C2C | 5-Fluoro-7-methyl-1H-indole-3-carbaldehyde | AG000HZ1 | 0.95g |
| 1190321-20-0 | O=C(C1=CNC2=NC(Br)=CC=C21)O | 6-Bromo-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid | AG000HZ2 | 2g |
| 1190321-17-5 | CC1=CC2=C(NC=C2C=O)N=C1 | 5-Methyl-1H-pyrrolo[2,3-b]pyridine-3-carbaldehyde | AG000HZ4 | 6g |
| 1190321-08-4 | BrC1=C[NH]C2=NC(=CC=C12)Cl | 3-Bromo-6-chloro-7-azaindole | AG000HZ9 | 125g |
| 1190321-81-3 | O=C(C1=CC(Br)=C2C(NC=C2)=N1)O | 4-Bromo-1H-pyrrolo[2,3-b]pyridine-6-carboxylic acid | AG000HZE | 5g |
| 1190321-80-2 | COC(=O)C=1C=C2C(=NC1)NC=C2C(=O)O | 5-(Methoxycarbonyl)-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid | AG000HZF | 1.25g |
| 1190321-71-1 | COc1cnc2[nH]ccc2c1Br | 4-Bromo-5-methoxy-1H-pyrrolo[2,3-b]pyridine | AG000HZO | 5g |
| 1190321-63-1 | O(C)c1nc2c(cc1Br)cc[nH]2 | 5-Bromo-6-methoxy-1H-pyrrolo[2,3-b]pyridine | AG000HZV | 15g |
| 1190321-61-9 | Clc1c2c([nH]c(=O)c1)[nH]cc2 | 4-CHLORO-1H-PYRROLO[2,3-B]PYRIDIN-6-OL | AG000HZW | 0.5g |
| 1190321-59-5 | ClC1=C(Br)C=C2C(NC=C2)=N1 | 5-Bromo-6-chloro-1H-pyrrolo[2,3-b]pyridine | AG000HZY | 5g |
| 1190322-05-4 | O=CC1=CNC2=CC=C(F)N=C12 | 5-Fluoro-1H-pyrrolo[3,2-b]pyridine-3-carbaldehyde | AG000I05 | 0.75g |
| 1190321-96-0 | FC1=C(Cl)N=C2NC=CC2=C1 | 6-Chloro-5-fluoro-7-azaindole | AG000I0D | 0.5g |
| 1190321-94-8 | NC1=NC2=C(C=CN2)C=C1F | 5-Fluoro-1h-pyrrolo[2,3-b]pyridin-6-amine | AG000I0F | 2g |
| 1190321-93-7 | O=C(C1=CNC2=CC=C(Cl)N=C21)O | 5-Chloro-1h-pyrrolo[3,2-b]pyridine-3-carboxylic acid | AG000I0G | 5g |
| 1190321-92-6 | Fc1cc(Cl)nc2[nH]ccc12 | 6-CHLORO-4-FLUORO-1H-PYRROLO[2,3-B]PYRIDINE | AG000I0H | 0.5g |
| 1190321-86-8 | Cc1cncc2[nH]ccc12 | 4-Methyl-1H-pyrrolo[2,3-c]pyridine | AG000I0N | 5g |
| 1190322-32-7 | COc1cnc2[nH]ccc2c1C(=O)O | 5-METHOXY-1H-PYRROLO[2,3-B]PYRIDINE-4-CARBOXYLIC ACID | AG000I0S | 1g |
| 1190322-28-1 | COC=1C=C2C(=NC1)NC(C2)=O | 5-Methoxy-1H-pyrrolo[2,3-b]pyridin-2(3H)-one | AG000I0W | 5g |
| 1190322-26-9 | OC(=O)C1=NC2=C(C=CN2)C=C1Br | 5-Bromo-1H-pyrrolo[2,3-b]pyridine-6-carboxylic acid | AG000I0Y | 20g |
| 1190322-23-6 | COC1=CC2=C(NC=C2C(O)=O)N=C1 | 5-METHOXY-1H-PYRROLO[2,3-B]PYRIDINE-3-CARBOXYLIC ACID | AG000I11 | 0.75g |
| 1190322-18-9 | NC1=NC2=C(C=CN2)C=C1Br | 5-Bromo-1H-pyrrolo[2,3-b]pyridin-6-amine | AG000I16 | 1g |
| 119162-46-8 | NC1=CC(C2=CC=CC(OC)=C2)=NO1 | 3-(3-Methoxy-phenyl)-isoxazol-5-ylamine | AG000IA2 | 25g |
| 1191885-41-2 | O=C([C@H](CN1)NCC1=O)OC | (S)-Methyl 5-oxopiperazine-2-carboxylate | AG000IAA | 5g |
| 119188-47-5 | COC(=O)[C@@]12C[C@]3([C@H]4[C@@]2(CCN4CC=C3)c2c(NC1=O)ccc(c2)O)C= | 10-Hydroxyscandine | AG000IAB | 0.005g |
| 119188-38-4 | O=CC1=CC(OOC(C1)O)C1C(=C)CCC2C1(C)CCCC2(C)C | 3H-1,2-Dioxepin-5-carboxaldehyde, 7-(decahydro-5,5,8a-trimethyl-2-methyl | AG000IAC | 0.005g |
| 119188-37-3 | CC12C(C/C=C3/CC(O)OC/3=O)C(=C)CCC1C(CCC2)(C)C | Coronarin D | AG000IAD | 0.005g |
| 119188-33-9 | C=C1[C@@H](O)C[C@@H]2[C@]([C@H]1/C=C/c1cocc1)(C)CCCC2(C)C | Coronarin A | AG000IAE | 0.005g |
| 119179-66-7 | OC1=C(Cl)C=C2C(OC(=O)C=C2C(F)(F)F)=C1 | 6-Chloro-7-hydroxy-4-(trifluoromethyl)coumarin | AG000IAL | 15g |
| 119174-33-3 | CC(SCCC#N)=O | S-(2-Cyanoethyl) ethanethioate | AG000IAP | 3g |
| 119171-73-2 | CC(N1C2=C(C=C(O)C=C2)OC3=CC(O)=CC=C13)=O | 1-(3,7-Dihydroxy-10H-phenoxazin-10-yl)ethanone | AG000IAS | 1.4g |
| 1191951-57-1 | O=S(C1=CC=C(CCCCCCCCCCCC)C=C1)(NC2=NN=CS2)=O | PHT-427 | AG000IAU | 0.3g |
| 1191908-44-7 | NC1CCC2=C1C=C(F)C=C2.[H]Cl | 6-Fluoro-2,3-dihydro-1H-inden-1-amine hydrochloride | AG000IAV | 4g |
| 1191908-38-9 | NC1CCC2=C1C=C(Cl)C=C2.[H]Cl | 6-Chloro-2,3-dihydro-1H-inden-1-amine hydrochloride | AG000IAW | 2g |
| 1191901-07-1 | O=C(N1CCN(C2=C(C=CS3)C3=CC=C2)CC1)OC(C)(C)C | tert-Butyl 4-(benzo[b]thiophen-4-yl)piperazine-1-carboxylate | AG000IAY | 20g |
| 1191885-45-6 | O=C1NC[C@@H](N(C1)C(=O)OC(C)(C)C)C(=O)[O-] | (R)-1-(tert-Butoxycarbonyl)-5-oxopiperazine-2-carboxylic acid | AG000IAZ | 3g |
| 119193-19-0 | C[C@@]1([C@@H](C)CNCC1)c1cc(O)ccc1 | Phenol, 3-[(3R,4R)-3,4-dimethyl-4-piperidinyl]- | AG000IB3 | 10g |
| 119192-10-8 | NC1=CC=C(CN2N=CN=C2)C=C1 | 1-(4-Aminobenzyl)-1,2,4-triazole | AG000IB6 | 1500g |
| 119192-09-5 | [O-][N+](=O)c1ccc(Cn2cncn2)cc1 | 1-[(4-Nitrophenyl)methyl]-1H-1,2,4-triazole | AG000IB7 | 75g |
| 1180132-17-5 | CCN1CCN(CC2=CN=C(N)C=C2)CC1 | 5-((4-Ethylpiperazin-1-yl)methyl)pyridin-2-amine | AG000IBE | 75g |
| 1190322-94-1 | OC(C1=CC2=C(C(=CN2)Br)N=C1)=O | 3-Bromo-1h-pyrrolo[3,2-b]pyridine-6-carboxylic acid | AG000I34 | 0.75g |
| 1190322-93-0 | C1=CNC2=C1C(=CC(=N2)F)Br | 4-Bromo-6-fluoro-1H-pyrrolo[2,3-b]pyridine | AG000I35 | 6g |
| 1190322-90-7 | COC(=O)C1C=C2C(=NC=1)C(C=O)=CN2 | Methyl 3-formyl-1H-pyrrolo[3,2-b]pyridine-6-carboxylate | AG000I38 | 1g |
| 1190423-36-9 | CC1(OB(C2=CN=C(N(C(OC(C)(C)C)=O)C(OC(C)(C)C)=O)N=C2)OC(C)1C)C | 2-(N,N-BisBOC-Amino)pyrimidine-5-boronic acid, pinacol ester | AG000I3O | 60g |
| 1190399-72-4 | CSC1=NC(Cl)=C2C(NN=C2C)=N1 | 4-Chloro-3-methyl-6-(methylthio)-1H-pyrazolo[3,4-d]pyrimidine | AG000I3Q | 3g |
| 1190380-60-9 | CN1N=CC2=CC(N)=CN=C12 | 1-methyl-1H-pyrazolo[3,4-b]pyridin-5-amine | AG000I3X | 60g |
| 1190380-49-4 | NC1=CN(C2CCOCC2)N=C1 | 1-(Tetrahydro-2H-pyran-4-yl)-1h-pyrazol-4-amine | AG000I3Z | 15g |
| 1190380-38-1 | O=C1c2c(CN1C)cc(cc2)N | 5-Amino-2-methylisoindolin-1-one | AG000I40 | 100g |
| 1190379-70-4 | CN(C1)CCC2=C1C=CC(NC3=NC=C(C4CC4)C(NCCCNC(C5CCC5)=O)=N3)=C2 | MRT68921 | AG000I41 | 0.05g |
| 1190363-46-2 | FC1=C(F)C([C@H]2C(C3=CC=CN=C3[C@H](O[Si](C(C)C)(C(C)C)C(C)C)CC2)=O)=C | (6S,9R)-6-(2,3-Difluorophenyl)-6,7,8,9-tetrahydro-9-[[tris(1-methylethyl)silyl | AG000I42 | 20g |
| 1190363-45-1 | O=C1CCC[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)C2=NC=CC=C21 | (R)-9-((Triisopropylsilyl)oxy)-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-5-o | AG000I43 | 500g |
| 1190360-23-6 | CC1(C)C2=C(C3=C1C=CC=C3)C=C(Br)C=C2 | 3-Bromo-9,9-dimethyl-9H-fluorene | AG000I44 | 50g |
| 1179362-15-2 | Cl.NC(C1=NC=C(F)C=C1)=N | 5-fluoropyridine-2-carboxamidine hydrochloride | AG000I4B | 0.25g |
| 119062-05-4 | [H][C@@](CC(O)=O)(NC(=O)OCC1C2=CC=CC=C2C2=CC=CC=C12)C(O)=O | Fmoc-L-Asp-OH | AG000I4I | 200g |
| 119060-44-5 | CC(C)(C)OC(=O)C1CC12C(Cl)(Cl)C2(Cl)Cl | tert-butyl 4,4,5,5-tetrachlorospiro[2.2]pentane-1-carboxylate | AG000I4O | 1g |
| 1190865-44-1 | O=C(C1=CC(Cl)=C(F)C(Cl)=C1)C(F)(F)F | 1-(3,5-Dichloro-4-fluoro-phenyl)-2,2,2-trifluoroethanone | AG000I51 | 2500g |
| 1192051-39-0 | CC1(C)OB(OC1(C)C)c1cc(Br)ccc1C | 2-(5-Bromo-2-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane | AG000IDU | 2g |
| 1192045-84-3 | CC1(C)C(C)(C)OB(C2=CC(C)=CC=C2F)O1 | 2-(2-Fluoro-5-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane | AG000IDV | 50g |
| 1192037-87-8 | CC1(C)C(C)(C)OB(C(N2C)=CC3=C2C=CC(Br)=C3)O1 | 5-Bromo-1-methylindole-2-boronic acid, pinacol ester | AG000IDW | 4g |
| 119205-39-9 | S(=O)(=O)([O-])C3(=CC1(=C(NC(=C1)C2(=CC=CC=C2))C=C3)).[Na+] | Sodium 2-phenylindole-5-sulfonate | AG000IE7 | 100g |
| 119205-38-8 | COC(=O)C1=C(N)C2=C(CCCC2)S1 | Methyl 3-amino-4,5,6,7-tetrahydrobenzo[b]thiophene-2-carboxylate | AG000IE8 | 4g |
| 1192263-98-1 | ClC1(=NC=CC(=C1Cl)C(=O)N) | 2,3-Dichloroisonicotinamide | AG000IEB | 10g |
| 1192263-89-0 | [Br]C1(=NC(=CC=C1C=O)C(F)(F)F) | 2-Bromo-6-(trifluoromethyl)nicotinaldehyde | AG000IEC | 10g |
| 1192217-75-6 | O=S(=O)(c1ccccc1)n1ccc(Br)c1 | 1-(BENZENESULFONYL)-3-BROMO-1H-PYRROLE | AG000IEG | 500g |
| 1192178-33-8 | C[C@@]12CCC(=O)[C@]1(O)CCCC2=O | (+/-)-cis-6-Hydroxy-1-methylbicyclo[4.3.0]nonane-2,7-dione | AG000IEH | 0.05g |
| 1192155-06-8 | O=C(C1=NN=C(C(F)(F)F)C=C1)OCC | Ethyl 6-(trifluoromethyl)pyridazine-3-carboxylate | AG000IEJ | 4g |
| 1192155-05-7 | O=C(C1=NN=C(C(F)(F)F)C=C1)O | 6-(TRIFLUOROMETHYL)PYRIDAZINE-3-CARBOXYLIC ACID | AG000IEK | 5g |
| 1192150-15-4 | O=C1NC=NC2=NC=C(Br)N=C12 | 6-Bromopteridin-4-ol | AG000IEL | 1g |
| 119223-01-7 | ClCc1onc(n1)C1CC1 | 5-(Chloromethyl)-3-cyclopropyl-1，2，4-oxadiazole | AG000IES | 0.4g |
| 1192356-25-4 | CC(N)(C1=NC(C(F)(F)F)=CC=C1)C | 2-(6-(Trifluoromethyl)pyridin-2-yl)propan-2-amine | AG000IF0 | 5g |
| 1192352-10-5 | CCCCCCCCOc1c(OCCCCCCCC)c(-c2ccc(Br)s2)c2nsnc2c1-c1ccc(Br)s1 | 4,7-Bis(5-Bromothiophen-2-Yl)-5,6-Bis(Octyloxy)Benzo[C][1,2,5]Thiadiazole | AG000IF4 | 2g |
| 1192352-08-1 | CCCCCCCCOC1=C(Br)C2=NSN=C2C(Br)=C1OCCCCCCCC | 4,7-Dibromo-5,6-Bis(Octyloxy)Benzo[C][1,2,5]Thiadiazole | AG000IF5 | 2g |
| 1192313-64-6 | FC1=C(Cl)C=CC=C1C(CBr)=O | 2-Bromo-1-(3-chloro-2-fluorophenyl)ethanone | AG000IF7 | 0.75g |
| 119238-52-7 | C[C@H](CS)C(=O)N1CCC[C@@H]1C(=O)O | (R)-1-((S)-3-Mercapto-2-methylpropanoyl)pyrrolidine-2-carboxylic acid | AG000IFE | 0.05g |
| 118220-71-6 | FC1=CC=C2N=CSC2=C1 | 6-Fluorobenzo[D]Thiazole | AG000IK9 | 15g |
| 118219-23-1 | OCC[C@@H](CO)NC(=O)OCC1=CC=CC=C1 | (S)-2-Cbz-aminobutane-1,4-diol | AG000IKC | 15g |
| 1193111-39-5 | C(ON1C(=O)CCC1=O)(=O)C(S(O)(=O)=O)CCSSC1=NC=CC=C1 | sulfo-SPDB | AG000IKE | 0.25g |
| 1193104-83-4 | CC1=CC=C(C=C1)C1(C2=C(C=CC=C2)C2=C1C=C(C=C2)B(O)O)C1=CC=C(C)C=C1 | 9,9-Di(p-tolyl)fluorene-2-boronic Acid (contains varying amounts of Anhydrid | AG000IKG | 7g |
| 1193104-11-8 | FC(C1=NC=CC(Cl)=C1)F | 4-Chloro-2-(difluoromethyl)pyridine | AG000IKH | 8g |
| 119308-57-5 | O=C(OC)C1=CC(Br)=NC(Br)=C1 | Methyl 2,6-dibromopyridine-4-carboxylate | AG000IKO | 500g |
| 119302-91-9 | C=CC[N@@+]1([C@H]5C[C@@]4([H])[C@]3([H])CC[C@@]2([H])C[C@H](O)[C | Pyrrolidinium, 1-[(2β,3α,5α,16β,17β)-17-(acetyloxy)-3-hydroxy-2-(4-morpholi | AG000IKU | 10g |
| 119302-86-2 | C[C@@]12[C@]([C@]3([C@@]([C@]4(C)[C@@](CC3)(C[C@H](O)[C@H](C4)N5 | 1-Allyl-1-((2S,3S,5S,8R,9S,10S,13S,14S,16S,17R)-3,17-dihydroxy-10,13-dimethy | AG000IKV | 0.05g |
| 119302-24-8 | CC(=O)O[C@H]1[C@H](C[C@H]2[C@@H]3CC[C@H]4C[C@H](O)[C@H](C[C@]4( | (2b,3a,5a,16b,17b)-17-Acetoxy-3-hydroxy-2-(4-morpholinyl)-16-(1-pyrrolidin | AG000IKW | 5g |
| 119301-59-6 | OC1=CC=C(C=C1)C(=C(C1=CC=C(C=C1)O)C1=CC=C(C=C1)O)C1=CC=C(C=C1)O | Tetrakis(4-hydroxyphenyl)ethene | AG000IKZ | 6.5g |
| 1193244-89-1 | CC(O)(C1=NC=C(Br)C=N1)C | 2-(5-Bromopyrimidin-2-yl)propan-2-ol | AG000IL3 | 50g |
| 1193162-25-2 | COC(=O)C1=C(O)C=C(Br)C(F)=C1 | Methyl 4-bromo-5-fluoro-2-hydroxybenzoate | AG000IL5 | 50g |
| 1193162-21-8 | O=C(OC)C1=CC(F)=C(Br)C=C1F | Methyl 4-broMo-2,5-difluorobenzoate | AG000IL6 | 191g |
| 1193162-18-3 | O=C(OC)C1=C(O)C=C(Br)C=C1F | Methyl 4-bromo-2-fluoro-6-hydroxybenzoate | AG000IL7 | 30g |
| 1193116-74-3 | BrCC1=NC=C(Br)C=N1 | 5-Bromo-2-(Bromomethyl)Pyrimidine | AG000IL8 | 10g |
| 119323-52-3 | C[C@@H](OC(C)(C)C)[C@@H](N)C(O)=O | (2R,3R)-2-Amino-3-(tert-butoxy)butanoic acid | AG000ILA | 50g |
| 119318-15-9 | OCC1(C)C(O)CC[C@]2(C1CC[C@@]1([C@@H]2CC=C2[C@@]1(C)CC[C@@]1([C | Olean-12-ene-3,24-diol | AG000ILH | 0.005g |
| 119313-12-1 | CCC(N(C)C)(CC1=CC=CC=C1)C(C2=CC=C(N3CCOCC3)C=C2)=O | 2-Benzyl-2-(dimethylamino)-4′-morpholinobutyrophenone | AG000ILJ | 125g |
| 1192-58-1 | C(=O)c1n(C)ccc1 | 1H-Pyrrole-2-carboxaldehyde, 1-methyl- | AG000ICG | 2600g |
| 1192-53-6 | ClC=1N=CN(C1Cl)C | 4,5-Dichloro-1-methyl-1H-imidazole | AG000ICI | 10g |
| 1192-52-5 | O=C1SSC(Cl)=C1Cl | 4,5-Dichloro-3H-1,2-dithiol-3-one | AG000ICJ | 100g |
| 1192-40-1 | [S-]C1=CC=CC=C1.[Cu+] | Benzenethiol, copper(1+) salt | AG000ICM | 5g |
| 1192-34-3 | O=C1NC(C)=CN1 | 4-Methyl-1H-imidazol-2(3H)-one | AG000ICN | 7g |
| 1192-30-9 | BrCC1OCCC1 | Tetrahydrofurfuryl bromide | AG000ICQ | 1000g |
| 1192-28-5 | C1(=N/O)/CCCC/1 | Cyclopentanone Oxime | AG000ICR | 4000g |
| 1192027-04-5 | S=C1SSC(/N=C/N(C)C)=N1 | ((Dimethylamino-methylidene)amino)-3h-1,2,4-dithiazoline-3-thione | AG000ICY | 200g |
| 1192025-01-6 | CC1(C)C(C)(C)OB(C2=CC=CC(Cl)=C2F)O1 | 2-(3-Chloro-2-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane | AG000ICZ | 25g |
| 1192023-08-7 | N#Cc1cc(F)c(cc1C)B1OC(C(O1)(C)C)(C)C | 4-Cyano-2-fluoro-5-methylphenylboronic acid, pinacol ester | AG000ID0 | 1.75g |
| 1192004-62-8 | COC1=CC=C2NN=CC2=C1Br | 4-Bromo-5-methoxy-1H-indazole | AG000IDC | 5g |
| 1192-95-6 | CN1CCCCCC1 | 1-Methylazepane | AG000IDF | 5g |
| 1192-88-7 | O=CC1CCCCC=1 | 1-Cyclohexene-1-carboxaldehyde | AG000IDI | 20g |
| 1192066-93-5 | O(C)C1CCC(CC1)(C(O)=O)N | 1-Amino-4-methoxycyclohexanecarboxylic acid | AG000IDO | 2g |
| 1192064-63-3 | ClC1=NC=C(C(=N1)C)Cl | 2,5-Dichloro-4-methylpyrimidine | AG000IDP | 16g |
| 1192057-13-8 | COC(C(CC1CCOCC1)N)=O | Methyl 2-amino-3-(tetrahydro-2H-pyran-4-yl)propanoate | AG000IDS | 1g |
| 1192755-14-8 | CC1(C)C(C)(C)OB(C2=C(OC=C3)C3=CC=C2)O1 | Benzofuran-7-boronic acid pinacol ester | AG000IHQ | 5g |
| 1192711-88-8 | NC1=C2C(NC=C2)=NC(Cl)=N1 | 2-chloro-7H-pyrrolo[2,3-d]pyriMidin-4-aMine | AG000IHS | 25g |
| 1192711-71-9 | CC1=CC2=C(Cl)N=C(Cl)N=C2N1 | 2,4-Dichloro-6-methyl-7H-pyrrolo[2,3-d]pyrimidine | AG000IHT | 50g |
| 119273-61-9 | C(O)(=O)C(NC(OC(C)(C)C)=O)CC1C=CC(C2C=CC=CC=2)=CC=1 | 2-(Boc-amino)-3-(biphenyl-4-yl)propanoic acid | AG000II1 | 25g |
| 119270-27-8 | NC1N2C(=C(C=N2)C#N)N=CC=1C#N | 7-Aminopyrazolo[1,5-A]pyrimidine-3,6-dicarbonitrile | AG000II6 | 25g |
| 1192834-16-4 | O=C(N1CCC2(C3=CC(Br)=CN=C3NC2=O)CC1)OC(C)(C)C | Tert-Butyl 5′-Bromo-2′-Oxo-1′,2′-Dihydrospiro[Piperidine-4,3′-Pyrrolo[2,3-B]P | AG000IIC | 0.75g |
| 1192815-02-3 | BrC1=CC=C2C(=C1)C=NC(=C2)N | 7-Bromoisoquinolin-3-amine | AG000IID | 25g |
| 1192815-01-2 | Brc1c2c(cnc(c2)N)ccc1 | 5-Bromoisoquinolin-3-amine | AG000IIE | 10g |
| 119291-22-4 | BrCCN1C=CC=N1 | 1-(2-bromoethyl)-1H-pyrazole | AG000IIJ | 50g |
| 119290-91-4 | OC1=CC(Cl)=C(O)C=C1O | 5-Chlorobenzene-1,2,4-Triol | AG000IIK | 4g |
| 119285-07-3 | C(=O)(OC(C)(C)C)N1CCN(CC1)C2=NC=C(C=C2)N | 5-Amino-2-(4-BOC-piperazino)pyridine | AG000IIS | 23g |
| 1192944-73-2 | COc1cccc(NC(=O)Nc2ccc(cc2)-n2nc(OCc3ccc(F)cc3)nc2-c2cccc(F)c2)c1 | 1-(4-(3-((4-Fluorobenzyl)oxy)-5-(3-fluorophenyl)-1H-1,2,4-triazol-1-yl)phenyl | AG000IIZ | 1.28g |
| 1193-30-2 | O=C(NCC1)C21CCC2 | 6-Azaspiro[3.4]octan-5-one | AG000IJ8 | 25g |
| 1193-24-4 | OC1=CC(O)=NC=N1 | 4,6-Dihydroxypyrimidine | AG000IJ9 | 5246.6g |
| 1193-22-2 | OC1=CC(N)=NC=N1 | 4-Amino-6-hydroxypyrimidine | AG000IJA | 200g |
| 1193-21-1 | ClC1=CC(Cl)=NC=N1 | 4,6-Dichloropyrimidine | AG000IJB | 500g |
| 1193-20-0 | O=C1CC(C)OCC1 | 2-METHYL-TETRAHYDRO-PYRAN-4-ONE | AG000IJC | 500g |
| 1180112-41-7 | O=C(N(CC1)CCC21CCN2)OC(C)(C)C | tert-Butyl 1,7-diazaspiro[3.5]nonane-7-carboxylate | AG000IBG | 20g |
| 1180002-01-0 | O=C(OCC1=CC=CN=C1NC)CN(C(OC(C)(C)C)=O)C | (2-(Methylamino)pyridin-3-yl)methyl 2-((tert-butoxycarbonyl)(methyl)amin | AG000IBH | 1500g |
| 1191996-99-2 | Cl.COC(=O)[C@@H](N)CC1CCCC1 | (S)-Methyl 2-amino-3-cyclopentylpropanoate hydrochloride | AG000IBK | 2g |
| 1191988-29-0 | O=C(O)C1=CC(F)=C(C)C(Br)=C1 | 3-broMo-5-fluoro-4-Methylbenzoic acid | AG000IBM | 300g |
| 119198-88-8 | O=CC1=C(C(C=O)=C(C(C=O)=C1C)C)C | 2,4,6-Trimethylbenzene-1,3,5-tricarbaldehyde | AG000IBQ | 15g |
| 1192-21-8 | C1=C(N)[N](C)N=C1 | 5-Amino-1-methyl-1H-pyrazole | AG000IBV | 225g |
| 1192-17-2 | C(C)C1(OC1)CC | 2,2-Diethyloxirane | AG000IBZ | 25g |
| 1192-16-1 | O=S1(CCC=C1)=O | 2-Sulfolene | AG000IC0 | 15g |
| 1192-04-7 | BrC1=CCCC1 | 1-Bromocyclopent-1-ene | AG000IC2 | 10g |
| 1192-01-4 | BrC1C(=O)CC1 | 2-Bromocyclobutanone | AG000IC4 | 125g |
| 1192-81-0 | CC1=NOC(CCl)=N1 | 5-(CHLOROMETHYL)-3-METHYL-1,2,4-OXADIAZOLE | AG000IC6 | 100g |
| 1192-80-9 | CC1=NC(CCl)=NO1 | 3-(Chloromethyl)-5-methyl-1,2,4-oxadiazole | AG000IC7 | 40g |
| 1192-79-6 | O=CC1=CC=C(C)N1 | 5-Methyl-1H-Pyrrole-2-Carbaldehyde | AG000IC8 | 10g |
| 1192-63-8 | ClC(N1CCCC1)=O | 1-PYRROLIDINECARBONYL CHLORIDE | AG000ICD | 75g |
| 1195-81-9 | O=C(C1(CO)CCC1)OCC | Cyclobutanecarboxylic acid, 1-(hydroxymethyl)-, ethyl ester | AG000IWB | 10g |
| 1195-66-0 | CC1(C)C(C)(C)OB(OC)O1 | Methoxyboronic acid pinacol ester | AG000IWE | 400g |
| 1195-59-1 | OCC1=NC(CO)=CC=C1 | 2,6-Pyridinedimethanol | AG000IWF | 1000g |
| 1195-58-0 | N#CC1=CC(C#N)=CN=C1 | Pyridine-3,5-dicarbonitrile | AG000IWG | 25g |
| 1195-52-4 | OC(=O)C=C/c1cscc1 | 3-thio-Pheneacrylic Acid | AG000IWI | 250g |
| 1195-42-2 | CC(NC1CCCCC1)C | N-Isopropylcyclohexanamine | AG000IWK | 175g |
| 1195-34-2 | CCC1=NC(Cl)=CC(Cl)=N1 | 4,6-Dichloro-2-ethylpyrimidine | AG000IWM | 10g |
| 1195-33-1 | C1=C(C=CC(=C1)S(=O)O)Br | 4-Bromobenzenesulfinic acid | AG000IWN | 15g |
| 1195233-59-0 | CCO/C(=C1/C(=O)C=C(C1=O)OC)/C=C/c1ccccc1 | Ethyllucidone | AG000IWO | 0.005g |
| 1195189-83-3 | N#CC1=CC=NC(Cl)=C1C | 2-Chloro-3-methylisonicotinonitrile | AG000IWP | 10g |
| 119520-06-8 | O=C2NC1=C(N2CC[C@@H](NC(C)C)[C@@H]3O)C3=CC=C1.[H]Cl | Imidazo[4,5,1-jk][1]benzazepin-2(1H)-one, 4,5,6,7-tetrahydro-7-hydroxy-6-[( | AG000IWT | 2g |
| 119516-86-8 | N#Cc1ccc(cc1)n1c(C)ccc1C | 4-(2,5-Dimethylpyrrol-1-yl)benzonitrile | AG000IWX | 2g |
| 119509-24-9 | COC(NC(O)=C1C([C@H](C[C@H](C)[C@H](CCl)Cl)C)=O)=C(OC)C1=O | Atpenin A5 | AG000IX9 | 0.02g |
| 1195306-28-5 | C(#N)C1=C(C(=O)O)C=CC(=C1)C | 2-Cyano-4-methylbenzoic acid | AG000IXE | 10g |
| 1195256-01-9 | C(=O)(OCc1ccccc1)N1CCC(CCC1)C(=O)O | 1-[(Benzyloxy)carbonyl]azepane-4-carboxylic acid | AG000IXG | 1g |
| 1195251-29-6 | ClC1=CC=CN2C1=NC=C2 | 8-Chloroimidazo[1,2-a]pyridine | AG000IXH | 125g |
| 1195251-01-4 | CC1=NC=CC(Cl)=C1F | 4-Chloro-3-fluoro-2-methylpyridine | AG000IXI | 35g |
| 119532-26-2 | Cl.Clc1c(cccc1Cl)N1CCNCC1 | Piperazine, 1-(2,3-dichlorophenyl)-, hydrochloride (1:1) | AG000IXV | 5500g |
| 1185-02-0 | C(C(CC)(C)O)(CC)(C)O | 3,4-Hexanediol, 3,4-dimethyl- | AG000IXZ | 0.2g |
| 119584-70-2 | NC1=NC2=CC=CC(F)=C2C(N)=N1 | 2,4-DIAMINO-5-FLUOROQUINAZOLINE | AG000IZT | 50g |
| 119581-52-1 | N#CC1=CC=NN=C1N | 3-Amino-4-pyridazinecarbonitrile | AG000IZW | 10g |
| 1226898-93-6 | ClC1=NC2=C(C=C1)C(=O)NCC2 | 2-chloro-5,6,7,8-tetrahydro-1,6-naphthyridin-5-one | AG000IZY | 25g |
| 1226898-27-6 | [H]C12=C3([H])[CH]4=C5(C6=N[C@@H](CO6)C(C)(C)C)[Fe+2]431789%10([CH-]% | (R)-4-tert-Butyl-2-[(SP)-2-(diphenylphosphino)ferrocenyl]-2-oxazoline | AG000IZZ | 25g |
| 1226896-38-3 | C[C@@H](Oc1cccc(O[C@H](C)C(=O)Nc2c(C)cc(C)cc2C)c1I)C(=O)Nc1c(C)cc(C)cc1 | (R,R)-2-Iodo-1,3-bis[1-(mesitylcarbamoyl)ethoxy]benzene | AG000J00 | 0.2g |
| 1226895-20-0 | CC(C1=CC=C2C=C(OC)C=CC2=C1)C(OC3=CC=C(C(N)=S)C=C3)=O | ATB 346 | AG000J01 | 0.2g |
| 1226879-79-3 | COc1ccc2CNC(=O)c2c1Br | 7-Bromo-6-methoxyisoindolin-1-one | AG000J02 | 9g |
| 1226878-99-4 | OC1=C(I)C=NC(Cl)=C1 | 2-Chloro-5-iodopyridin-4-ol | AG000J03 | 1g |
| 1226878-98-3 | COC1=CC(Cl)=NC=C1I | 2-Chloro-5-iodo-4-methoxypyridine | AG000J04 | 30g |
| 122699-51-8 | O=C(C1CC(=C)C1)OC(C)(C)C | tert-Butyl 3-methylenecyclobutane-1-carboxylate | AG000J07 | 5g |
| 12270-25-6 | [Cl-].N(=NC=1N(C=C[N+]1C)C)C2=CC=C(C=C2)N(C)C | 2-((4-(Dimethylamino)phenyl)diazenyl)-1,3-dimethyl-1H-imidazol-3-ium chl | AG000J0C | 300g |
| 12269-78-2 | O=[Si]([O-])O.O=[Si]([O-])[O-].[Al+3] | Pyrophyllite | AG000J0D | 500g |
| 1227-51-6 | CCCCCCCCCCCCCC1CCCC(=O)O1 | 6-Tridecyltetrahydro-2H-pyran-2-one | AG000J0F | 0.1g |
| 1227-49-2 | O=C(O)C1=CC=CC(SSC2=CC(C(O)=O)=CC=C2)=C1 | 3,3′-Dithiobisbenzoic acid | AG000J0G | 40g |
| 1227-45-8 | S=C(NC1=CC=C(OC)C=C1)NC2=CC=C(OC)C=C2 | 1,3-Bis(4-methoxyphenyl)thiourea | AG000J0I | 75g |
| 1227089-74-8 | CN1N=CC2=C1N=C(Cl)C=C2Cl | 4,6-DICHLORO-1-METHYL-1H-PYRAZOLO[3,4-B]PYRIDINE | AG000J0J | 10g |
| 1227068-84-9 | CC1(C)C(C)(C)OB(C2=CCC(F)(F)CC2)O1 | 4,4-Difluoro-1-cyclohexene-1-boronic acid pinacol ester | AG000J0K | 200g |
| 1227068-67-8 | CC(N1CCC(B2OC(C)(C)C(C)(C)O2)=CC1)=O | 1-Acetyl-5,6-dihydro-2H-pyridine-4-boronic acid, pinacol ester | AG000J0L | 200g |
| 1227068-37-2 | CC(C(F)(F)F)(C1CCNCC1)O | 1,1,1-Trifluoro-2-(piperidin-4-yl)propan-2-ol | AG000J0M | 1g |
| 1227048-93-2 | C(=O)(OC)c1c(N)nc(cc1)OC | methyl 2-amino-6-methoxynicotinate | AG000J0O | 9g |
| 1193-18-6 | CC1=CC(=O)CCC1 | 3-Methyl-2-cyclohexenone | AG000IJD | 4000g |
| 1193-12-0 | N1CCCC(C)(C)C1 | 3,3-Dimethylpiperidine | AG000IJH | 30g |
| 1193-11-9 | CC1OC(C)(C)OC1 | 2,2,4-Trimethyl-1,3-dioxolane | AG000IJI | 300g |
| 1193-10-8 | CC1=CCS(=O)(=O)C1 | 3-Methyl-2,5-Dihydrothiophene 1,1-Dioxide | AG000IJJ | 20g |
| 1193-92-6 | O/N=C/C1=CC=CN=C1 | 3-PYRIDINEALDOXIME | AG000IJO | 500g |
| 1193-82-4 | S(=O)(C)c1ccccc1 | Benzene, (methylsulfinyl)- | AG000IJP | 815.5g |
| 1193-81-3 | CC(O)C1CCCCC1 | 1-Cyclohexylethanol | AG000IJQ | 50g |
| 1193-79-9 | CC(=O)C1=CC=C(C)O1 | 1-(5-Methylfuran-2-yl)ethanone | AG000IJS | 1000g |
| 1193-74-4 | NC1=NC=C(C)C(C)=N1 | 4,5-Dimethylpyrimidin-2-amine | AG000IJU | 25g |
| 1193-72-2 | C1=C(C=CC(=C1Cl)Br)Cl | 2,4-Dichlorobromobenzene | AG000IJV | 2000g |
| 1193-71-1 | CC1=NC=C(N)C(C)=C1 | 5-Amino-2,4-dimethylpyridine | AG000IJW | 125g |
| 1193-69-7 | O=CC1=C(Br)SC(Br)=C1 | 2,5-Dibromothiophene-3-Carbaldehyde | AG000IJY | 5g |
| 1193-62-0 | O=C(C1=CC=CN1)OC | METHYL 1H-PYRROLE-2-CARBOXYLATE | AG000IK2 | 2000g |
| 1193-56-2 | OC1=NC=NC(O)=C1Cl | 5-Chloropyrimidine-4,6-diol | AG000IK5 | 20g |
| 1193-55-1 | O=C1C(C)C(CCC1)=O | 2-Methyl-1,3-cyclohexanedione | AG000IK6 | 1000g |
| 1193-47-1 | CC1(C(=O)CCCC1)C | 2,2-Dimethylcyclohexanone | AG000IK7 | 10g |
| 119237-64-8 | C1CN[C@@H](C1)C(c2ccccc2)c3ccccc3 | (S)-(-)-2-(Diphenylmethyl)pyrrolidine | AG000IFG | 175g |
| 1192539-75-5 | CCOC(=O)C1=CC(=NC=C1)C(F)F | ethyl 2-(difluoromethyl)pyridine-4-carboxylate | AG000IFP | 5g |
| 1192491-61-4 | O=S(ON1[C@]2([H])CC[C@@H](C(N)=O)[N@@](C2)C1=O)([O-])=O.[Na+] | Avibactam Sodium | AG000IFQ | 50g |
| 1192479-36-9 | CC1N=C(Cl)N=C(C)C=1F | 2-Chloro-5-fluoro-4,6-dimethylpyrimidine | AG000IFT | 40g |
| 119248-43-0 | O=C(C1=CNC2=C1C=NC=C2)O | 1H-Pyrrolo[3,2-c]pyridine-3-carboxylic acid | AG000IG0 | 300g |
| 119246-82-1 | CC(B1OCCNCCO1)C | 2-Isopropyl-1,3,6,2-dioxazaborocane | AG000IG2 | 1130g |
| 1192549-09-9 | O=C([C@H]1C[C@@H](N)C1)OC(C)(C)C.[H]Cl | cis-tert-Butyl 3-aminocyclobutanecarboxylate hydrochloride | AG000IGB | 6g |
| 119256-40-5 | NC1=NC2=C(S1)C=C(F)C=C2F | 2-Amino-4,6-difluorobenzothiazole | AG000IGR | 300g |
| 1192657-15-0 | N12CCNCC1CCC2.C(O)(=O)C(O)=O | Octahydropyrrolo[1,2-a]pyrazine oxalate (1:2) | AG000IGV | 5g |
| 1192651-80-1 | CCCC[N+](CCCC)(CCCC)CCCC.NC(=O)C1CCC2CN1C(=O)N2OS(O)(=O)=O | Tetrabutylammonium (1R,2S,5R)-2-Carbamoyl-7-Oxo-1,6-Diazabicyclo[3.2.1] | AG000IGW | 40g |
| 1192651-49-2 | O=C([C@H](CC[C@@]1([H])N2OCC3=CC=CC=C3)[N@@](C1)C2=O)N | (1R,2S,5R)-6-(Benzyloxy)-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboxamide | AG000IGX | 50g |
| 119269-24-8 | CCCCCCCCCCCCCCCCC1=CSC=C1 | 3-n-Hexadecylthiophene | AG000IH1 | 300g |
| 1192814-45-1 | NC1=NC(Cl)=C(Cl)C=C1 | 5,6-Dichloropyridin-2-amine | AG000IHK | 100g |
| 1192813-64-1 | FC(F)OC1=CN=C(Cl)N=C1 | 2-Chloro-5-(difluoromethoxy)pyrimidine | AG000IHL | 200g |
| 1192813-41-4 | O=[N+](C1=CN=C(OC(F)F)C=C1)[O-] | 2-(Difluoromethoxy)-5-nitropyridine | AG000IHM | 10g |
| 118264-04-3 | O=C1CC(=O)NC(C2=CC=CC=C2)C1 | 6-Phenylazaperhydroine-2,4-dione | AG000ILQ | 0.75g |
| 1193387-98-2 | O=[N+](C1=CC=C(SCCN2)C2=C1)[O-] | 6-Nitro-3,4-dihydro-2h-1,4-benzothiazine | AG000ILV | 5g |
| 1193387-88-0 | O=C(OC)CN1N=CC(N)=C1.[H]Cl.[H]Cl | Methyl 2-(4-amino-1h-pyrazol-1-yl)acetate dihydrochloride | AG000ILW | 1.25g |
| 1193387-70-0 | Cl.NCCOC1CCCCC1 | 2-(Cyclohexyloxy)ethylamine, HCl | AG000ILX | 50g |
| 1193386-53-6 | CN1CC(CNC(=O)OC(C)(C)C)C1 | tert-butyl N-[(1-methylazetidin-3-yl)methyl]carbamate | AG000ILZ | 0.5g |
| 1193386-43-4 | IC1CNC1.[H]Cl | 3-Iodoazetidine hydrochloride | AG000IM3 | 5g |
| 1193385-18-0 | NC1=CC(Br)=CC(F)=C1[N+]([O-])=O | 5-bromo-3-fluoro-2-nitroaniline | AG000IM4 | 45g |
| 1193383-09-3 | C1=C(C(=CC2=C1NC(=N2)N3C=C(C=N3)C(=O)O)OC(F)(F)F)Cl | JNJ 42041935 | AG000IM5 | 0.5g |
| 1193334-87-0 | CN1C=C(F)C(Br)=CC1=O | 4-Bromo-5-fluoro-1-methylpyridin-2(1H)-one | AG000IM7 | 6g |
| 1193334-86-9 | O=C1C=C(Br)C=CN1C2CC2 | 4-Bromo-1-Cyclopropylpyridin-2(1H)-One | AG000IM8 | 20g |
| 1193314-23-6 | FC1=C(C=C(C2=C1)NC3=C2C[C@@H](N[C@]34C5=C(NC4=O)C=CC(Cl)=C5)C)Cl | Spiro[3h-indole-3,1′-[1h]pyrido[3,4-b]indol]-2(1h)-one, 5,7′-dichloro-6′-fluor | AG000IMA | 0.005g |
| 119329-48-5 | C1(=O)C(N)CCN1C | 3-Amino-1-methylpyrrolidin-2-one | AG000IMD | 2g |
| 1193389-14-8 | OC1(C(F)(F)F)CCNCC1.[H]Cl | 4-(Trifluoromethyl)piperidin-4-ol hydrochloride | AG000IMN | 100g |
| 119347-92-1 | BrCC1=CC=C(C=C1)CC(C)C | 1-(Bromomethyl)-4-isobutylbenzene | AG000IMV | 2g |
| 119344-86-4 | CCC(C(=O)c1ccc(cc1)N1CCOCC1)(N(C)C)Cc1ccc(cc1)C | 1-Butanone, 2-(dimethylamino)-2-[(4-methylphenyl)methyl]-1-[4-(4-morpho | AG000IMZ | 200g |
| 1194044-20-6 | NC1=N[C@](C)(C2=CC(C3=CN=CN=C3)=C(F)C=C2F)CCS1 | (4S)-4-[2,4-Difluoro-5-(pyrimidin-5-yl)phenyl]-4-methyl-5,6-dihydro-1,3-thia | AG000IQ1 | 0.15g |
| 119433-80-6 | O=C(O)[C@@H](N)CC1=CSC=N1 | L-4-Thiazolylalanine | AG000IQH | 50g |
| 119431-25-3 | ClC(C=C1)=CC=C1C(O)CN(CC2)CCC2CC3=CC=C(F)C=C3 | Eliprodil | AG000IQK | 1g |
| 119430-40-9 | CC(=O)Nc1cc(Br)cc(c1)Br | N-Acetyl 3,5-dibromoaniline | AG000IQM | 5g |
| 119410-08-1 | OC1=CN=C2C(CCC3=CC(Cl)=CC=C3/C2=C4CCNCC4)=C1 | 8-CHLORO-11-(PIPERIDIN-4-YLIDENE)-6,11-DIHYDRO-5H-BENZO[5,6]CYCLOHEP | AG000IR2 | 0.15g |
| 1194374-25-8 | O=C(C1=C(C)SC(Br)=N1)O | 2-Bromo-5-methylthiazole-4-carboxylic acid | AG000IRF | 75g |
| 1194374-24-7 | CC1=C(N=C(Cl)S1)C(O)=O | 2-Chloro-5-methylthiazole-4-carboxylic acid | AG000IRG | 30g |
| 1194374-23-6 | COC1=CC(C2=CC=NO2)=CC=C1 | 5-(3-Methoxyphenyl)isoxazole | AG000IRH | 20g |
| 119434-75-2 | O=C(O)[C@@H](NC(OC(C)(C)C)=O)CC1=CSC=N1 | Boc-L-4-thiazolylalanine | AG000IRQ | 125g |
| 1194376-46-9 | FC1=C(OC=C2)C2=C(Br)C=C1 | 4-Bromo-7-fluoro-1-benzofuran | AG000IRT | 50g |
| 1194376-44-7 | CC(OC(N1CC2(C(=O)NCC2)CC1)=O)(C)C | Tert-Butyl 6-Oxo-2,7-Diazaspiro[4.4]Nonane-2-Carboxylate | AG000IRU | 10g |
| 1194376-31-2 | CC(OC(N1CC(C#N)(O)CC1)=O)(C)C | tert-Butyl 3-cyano-3-hydroxypyrrolidine-1-carboxylate | AG000IRV | 10g |
| 1194375-87-5 | C1=CC=C(C=C1)CN2CC3(CNCC3)C2 | 2-benzyl-2,7-diazaspiro[3.4]octane | AG000IRW | 5g |
| 1194375-85-3 | N1CC2(C1)CN(C2)Cc1ccccc1.Cl.Cl | 2-Benzyl-2,6-diazaspiro[3.3]heptane dihydrochloride | AG000IRX | 25g |
| 1194375-62-6 | FC(C1=CC2=C(C=NC=C2)C=C1)(F)F | 6-(Trifluoromethyl)isoquinoline | AG000IRY | 9g |
| 1194375-40-0 | CC1=CN2C=CC(=CC2=N1)Br | 7-BROMO-2-METHYLIMIDAZO[1,2-A]PYRIDINE | AG000IRZ | 10g |
| 1194375-38-6 | O=C(OCC)CC1=NC(N)=NC=C1 | Ethyl 2-(2-aminopyrimidin-4-yl)acetate | AG000IS0 | 2g |
| 1193697-61-8 | OP1(OC2=CC=C3CCCCC3=[C@]2[C@]4=C5CCCCC5=CC=C4O1)=O | (R)-4-Hydroxy-8,9,10,11,12,13,14,15-octahydrodinaphtho[2,1-d:1′,2′-f][1,3,2]d | AG000IN7 | 2g |
| 1193639-02-9 | [O-][N+](=O)c1ncn(c1)C1CC1 | 1-Cyclopropyl-4-nitro-1H-imidazole | AG000IN8 | 2g |
| 119368-03-5 | COC1=CC=NC2=C1C=NN2 | 4-Methoxy-1H-pyrazolo[3,4-b]pyridine | AG000INF | 1g |
| 119363-63-2 | O=C(OC(C)(C)C)NC(C(=O)O)C(C1(=CC=CC=C1))C2(=CC=CC=C2) | 2-Boc-amino-3,3-diphenyl propionic acid | AG000INK | 5g |
| 119356-77-3 | CN(C)[C@@H](CCOC1=CC=CC2=C1C=CC=C2)C1=CC=CC=C1 | (S)-N,N-Dimethyl-3-(naphthalen-1-yloxy)-1-phenylpropan-1-amine | AG000INO | 65g |
| 1183047-51-9 | OC1CC(C2=CC=C(Br)C=C2)C1 | 3-(4-Bromophenyl)cyclobutanol | AG000INV | 15g |
| 1193779-97-3 | CCC(=O)c1cc(Cl)ccc1C | 1-(5-chloro-2-methylphenyl)propan-1-one | AG000INW | 1.25g |
| 119389-05-8 | O=C1OC(C2=C1C=CC(C#CC3=CC=CC=C3)=C2)=O | 4-Phenylethynylphthalic Anhydride | AG000IO0 | 147g |
| 119385-80-7 | NC1=C(F)C(=CC(F)=C1F)C(O)=O | 3-Amino-2,4,5-trifluorobenzoic acid | AG000IO7 | 10g |
| 119378-70-0 | C1(=CC=CC=C1)N1CCN(CC1)CC(=O)O | 2-(4-Phenylpiperazin-1-yl)acetic acid | AG000IOC | 5g |
| 119396-88-2 | N#CC1=CC(OC)=C(OC)C=C1F | 4,5-Dimethoxy-2-fluorobenzonitrile | AG000IOK | 75g |
| 119396-04-2 | ClCC1=NC=CC(Cl)=C1.[H]Cl | 4-Chloro-2-(chloromethyl)pyridine hydrochloride | AG000IOL | 8g |
| 1194-22-5 | CC1=NC(=CC(N1)=O)O | 4,6-Dihydroxy-2-Methylpyrimidine | AG000IOT | 970g |
| 1194-21-4 | O=C1N=C(NC(=C1)Cl)N | 2-Amino-4-chloro-6-hydroxypyrimidine | AG000IOU | 200g |
| 1194-18-9 | C1(CCCCC(C1)=O)=O | 1,3-Cycloheptanedione | AG000IOV | 300g |
| 1194-16-7 | O=C1CC(C)(C)OCC1 | 2,2-Dimethyltetrahydropyran-4-one | AG000IOX | 500g |
| 1194-06-5 | O=C(N)NC1CCCC1 | 1-Cyclopentylurea | AG000IOZ | 10g |
| 1190318-90-1 | BrC1=C2C(NC=C2C=O)=CN=C1 | 4-bromo-1H-pyrrolo[2,3-c]pyridine-3-carbaldehyde | AG000HT5 | 1g |
| 1190319-23-3 | O=C(C1=CNC2=CC=C(OC)N=C21)O | 5-Methoxy-1H-pyrrolo[3,2-b]pyridine-3-carboxylic acid | AG000HTP | 10g |
| 1190319-18-6 | O=C(C1=C(NC=C2)C2=NC=C1)O | 1H-Pyrrolo[3,2-b]pyridine-7-carboxylic acid | AG000HTU | 15g |
| 1190319-16-4 | IC1=CNC2=CC=C(Br)N=C21 | 5-BROMO-3-IODO-1H-PYRROLO[3,2-B]PYRIDINE | AG000HTV | 10g |
| 1190319-04-0 | COc1ccc2CC(=O)Nc2n1 | 6-Methoxy-1H-pyrrolo[2,3-b]pyridin-2(3H)-one | AG000HU3 | 1g |
| 1178-24-1 | O=C1C(OC)=C(C2=CC=C(OC)C(OC)=C2)OC3=C1C(OC)=C(OC)C(OC)=C3OC | 3,3′,4′,5,6,7,8-Heptamethoxyflavone | AG000HUC | 0.03g |
| 1190319-51-7 | CC1=CC2=NC=C(Br)C=C2N1 | 6-Bromo-2-methyl-1H-pyrrolo[3,2-b]pyridine | AG000HUE | 45g |
| 1190319-48-2 | Oc1cc(F)c2cc[nH]c2n1 | 4-fluoro-1H-pyrrolo[2,3-b]pyridin-6-ol | AG000HUH | 1g |
| 1190319-82-4 | O=C(C1=CNC2=C1C(Br)=CC=N2)OC | methyl 4-bromo-1H-pyrrolo[2,3-b]pyridine-3-carboxylate | AG000HV3 | 80g |
| 1190319-78-8 | O=C1Cc2c(N1)cncc2C(=O)O | 1H-Pyrrolo[2,3-c]pyridine-4-carboxylic acid, 2,3-dihydro-2-oxo- | AG000HV6 | 3g |
| 1227048-89-6 | O=C(OC)C1=C(N)N=CC(C(F)(F)F)=C1 | Methyl 2-amino-5-(trifluoromethyl)nicotinate | AG000J0P | 30g |
| 1227048-78-3 | O=C(OC)C1=C(N)N=CC(I)=C1 | Methyl 2-amino-5-iodonicotinate | AG000J0Q | 25g |
| 1227002-03-0 | O=C(OC)C1=C(Cl)C=NC(N)=C1 | Methyl 2-amino-5-chloropyridine-4-carboxylate | AG000J0S | 10g |
| 122710-21-8 | CC(=O)C1=C(N)C=C(C)C=C1 | 1-(2-Amino-4-methylphenyl)ethanone | AG000J0W | 7.75g |
| 122709-21-1 | O=C(N1C(C)(C)OC[C@H]1C(N(OC)C)=O)OC(C)(C)C | (S)-3-Boc-4-(methoxymethylcarbamoyl)-2,2-dimethyloxazolidine | AG000J0X | 10g |
| 122702-20-9 | O=C(N)[C@H](N)CO.[H]Cl | D-Serinamide hydrochloride | AG000J12 | 50g |
| 1227195-24-5 | C(C1=CC=C(C2=CC=NC=C2)C=C1)(C3=CC=C(C4=CC=NC=C4)C=C3)=C(C5=CC=C(C6= | 1,1,2,2-Tetrakis(4-(pyridin-4-yl)phenyl)ethene | AG000J19 | 125g |
| 1227184-58-8 | CC1=CC(Br)=CC(OC(F)F)=N1 | 4-Bromo-2-(difluoromethoxy)-6-methylpyridine | AG000J1B | 5g |
| 1227177-68-5 | FC1=NC=CC=C1C2CC2 | 3-Cyclopropyl-2-fluoropyridine | AG000J1D | 3g |
| 1227159-85-4 | OCC1(C2=CC=C(Br)C=C2)CCC1 | (1-(4-Bromophenyl)cyclobutyl)methanol | AG000J1G | 2g |
| 1227157-98-3 | Cl.OC[C@H]1CNCC1 | (3R)-Pyrrolidin-3-ylmethanol, HCl | AG000J1H | 10g |
| 122717-54-8 | C=C1C2CCC3C(C1=O)(C2O)C(O)CC1C3(C)C=CC(=O)C1(C)C | Liangshanin A | AG000J1N | 0.005g |
| 1227267-07-3 | O=C(C1=CC2=C(C=C1C#N)C=CN2)OC | Methyl 5-cyano-1H-indole-6-carboxylate | AG000J1Y | 1g |
| 1227266-96-7 | ClC1=CC=C2C(=N1)N(C(=C2)C)S(=O)(=O)C2=CC=CC=C2 | 6-Chloro-2-methyl-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine | AG000J24 | 25g |
| 1227210-35-6 | BrC1=C(C(=C(C=C1)F)[N+](=O)[O-])C | Benzene, 1-bromo-4-fluoro-2-methyl-3-nitro- | AG000J2I | 150g |
| 1227210-33-4 | NC1=NN2C(CN(C)CC2)=C1 | 5-Methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-amine | AG000J2J | 0.5g |
| 1227267-28-8 | O=C(C1=CC2=C(C=C1Br)C=CN2)OC | methyl 5-bromo-1H-indole-6-carboxylate | AG000J2V | 50g |
| 1227267-17-5 | ClC1=NC=C2C=C(I)N(C2=C1)S(=O)(=O)C1=CC=CC=C1 | 1-(PHENYLSULFONYL)-6-CHLORO-2-IODO-5-AZAINDOLE | AG000J33 | 8g |
| 119565-00-3 | N[C@@H](C1=CC=CC(Cl)=C1)C(O)=O | L-3-CHLOROPHENYLGLYCINE | AG000IY4 | 175g |
| 118507-50-9 | O=C(OCC1=CC=CC=C1)N[C@@H]2C(NCC2)=O | (S)-(-)-3-Cbz-aminopyrrolidin-2-one | AG000IYJ | 3g |
| 118507-45-2 | C(=O)(O)c1ccc(cc1)CF | 4-(Fluoromethyl)benzoic acid | AG000IYK | 5g |
| 1195782-28-5 | Cl.Cl.C[C@H]1CNC[C@@H](C)N1C | (2R,6S)-rel-1,2,6-TriMethylpiperazine dihydrochloride | AG000IYL | 25g |
| 1195771-65-3 | CC(SC(SCC)=S)(C#N)CCC(ON1C(CCC1=O)=O)=O | 2,5-DIOXOPYRROLIDIN-1-YL 4-CYANO-4-(((ETHYLTHIO)CARBONOTHIOYL)THIO) | AG000IYN | 1.25g |
| 1195768-19-4 | S(=O)(=O)(Nc1c(F)c(C(=O)OC)ccc1)c1c(F)cccc1F | Methyl 3-(2,6-difluorophenylsulfonamido)-2-fluorobenzoate | AG000IYO | 20g |
| 1195768-18-3 | COC(=O)C1=C(F)C(N)=CC=C1 | Methyl 3-amino-2-fluorobenzoate | AG000IYP | 500g |
| 1195768-06-9 | O=S(C1=C(F)C=CC=C1F)(NC2=CC=CC(C3=C(C4=NC(N)=NC=C4)SC(C(C)(C)C)=N3)= | Dabrafenib Mesylate | AG000IYQ | 10g |
| 1195765-45-7 | O=S(C1=C(F)C=CC=C1F)(NC2=CC=CC(C3=C(C4=NC(N)=NC=C4)SC(C(C)(C)C)=N3)= | Dabrafenib | AG000IYR | 125g |
| 1195760-68-9 | CON1c2cc(O)ccc2[C@@]2(C1=O)C[C@@H]1N=C([C@@H]3C[C@H]2OC[C@H]13 | 11-Hydroxygelsenicine | AG000IYS | 0.005g |
| 1195684-52-6 | OCC1(COC1)NCC1=CC=CC=C1 | 3-[(Phenylmethyl)amino]-3-oxetanemethanol | AG000IYV | 10g |
| 119580-41-5 | FC([C@H]1NCCC1)(F)F | (S)-2-(Trifluoromethyl)pyrrolidine | AG000IYZ | 2g |
| 119567-63-4 | OC[C@H](N(C)C)[C@H](O)/C=C/CCCCCCCCCCCCC | N,N-Dimethylsphingosine (d18:1) | AG000IZ5 | 0.01g |
| 1195901-53-1 | BrC1=CC2=C(C=C1)CCCN2.Cl | 7-Bromo-1,2,3,4-tetrahydroquinoline, HCl | AG000IZ8 | 400g |
| 1195821-09-0 | O=C(C1=C(F)C=C(C2=CC=C(C3=CC=C(CCC)C=C3)C=C2F)C=C1F)O | 2′,3,5-Trifluoro-4”-propyl-[1,1′:4′,1”-terphenyl]-4-carboxylic acid | AG000IZA | 3g |
| 119586-44-6 | CC1=CC=C(N(C2=CC=C(C=C2)C=CC3=CC=C(C4=CC=C(C=CC5=CC=C(N(C6=CC=C(C) | 4,4′-Bis[4-(di-p-tolylamino)styryl]biphenyl | AG000IZG | 0.25g |
| 119584-73-5 | N#CC1=C(F)C=CC=C1OCC | 2-Ethoxy-6-fluorobenzonitrile | AG000IZQ | 125g |
| 119584-71-3 | CSC1=CC=CC(=C1C#N)F | 2-Fluoro-6-(methylthio)benzonitrile | AG000IZS | 0.5g |
| 1227509-42-3 | CC1=CC(Cl)=CC(F)=N1 | 4-Chloro-2-fluoro-6-methylpyridine | AG000J9O | 5g |
| 1227508-94-2 | OC1=C(N)C=CN=C1Cl | 4-Amino-2-chloropyridin-3-ol | AG000J9Q | 25g |
| 1227502-89-7 | OC1=C(C)C=C(Cl)N=C1 | 2-Chloro-5-hydroxy-4-methylpyridine | AG000J9U | 45.9g |
| 1227502-60-4 | FC1=NC=CC(F)=C1Br | 3-Bromo-2,4-difluoropyridine | AG000J9W | 25g |
| 1227502-36-4 | OC(C1=CC(C(F)(F)F)=C(C#N)C=C1)=O | 4-Cyano-3-(trifluoromethyl)benzoic acid | AG000J9Y | 0.2g |
| 1227502-29-5 | OCC1=CC(Br)=NC=C1F | (2-broMo-5-fluoropyridin-4-yl)Methanol | AG000J9Z | 1.25g |
| 1227499-99-1 | FC(C1=CN=C(Cl)C=C1OC)(F)F | 2-chloro-4-methoxy-5-(trifluoromethyl)pyridine | AG000JA0 | 3g |
| 1227499-98-0 | O=CC1=NC=C(C(F)(F)F)C=C1F | 3-Fluoro-5-(trifluoromethyl)picolinaldehyde | AG000JA1 | 30g |
| 1227496-31-2 | O=CC1=CNC2=C1C=C(Br)C(F)=C2 | 5-Bromo-6-fluoro-1H-indole-3-carbaldehyde | AG000JA2 | 10g |
| 1227490-36-9 | OCC1=CC(Br)=NC(Cl)=C1 | (2-Bromo-6-chloropyridin-4-yl)methanol | AG000JA5 | 5g |
| 1227564-07-9 | O=C(O)CC1=CC(OC)=CN=C1F | 2-(2-FLUORO-5-METHOXYPYRIDIN-3-YL)ACETIC ACID | AG000JA9 | 5g |
| 1227564-00-2 | O=CC1=CNC2=C1C=CC(Cl)=C2Cl | 6,7-Dichloro-1H-indole-3-carbaldehyde | AG000JAA | 5g |
| 1227563-98-5 | OCC1=NC=C(F)C=C1Cl | (3-Chloro-5-fluoropyridin-2-yl)methanol | AG000JAB | 0.5g |
| 1227563-79-2 | FC(C1=C(Cl)C(OC)=NC=C1)(F)F | 3-Chloro-2-methoxy-4-(trifluoromethyl)pyridine | AG000JAC | 25g |
| 1227563-67-8 | FC(C1=CN=C(Cl)C(OC)=C1)(F)F | 2-CHLORO-3-METHOXY-5-(TRIFLUOROMETHYL)PYRIDINE | AG000JAD | 10g |
| 1227563-64-5 | C1=CC(=C(Cl)N=C1CO)Br | (5-Bromo-6-chloropyridin-2-yl)methanol | AG000JAE | 20g |
| 1227563-63-4 | FC(C1=C(Br)C=CC(Cl)=N1)(F)F | 3-Bromo-6-chloro-2-(trifluoromethyl)pyridine | AG000JAF | 30g |
| 1227563-54-3 | BrC1=NC=C(C(=C1)CO)Br | (2,5-Dibromopyridin-4-yl)methanol | AG000JAG | 3g |
| 1227381-94-3 | O=C(N1CC(OC2=NC=CC=C2Br)C1)OC(C)(C)C | tert-Butyl 3-((3-bromopyridin-2-yl)oxy)azetidine-1-carboxylate | AG000J8B | 20g |
| 1227381-91-0 | Cl.O=C(OCc1ccccc1)N1CC2(CCNCC2)C1 | 2,7-Diazaspiro[3.5]-nonane-2-carboxylic acid, phenylmethyl ester, hcl (1:1) | AG000J8C | 25g |
| 122741-44-0 | FC1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1 | 2,3,4,6-Tetra-o-benzyl-beta-d-glucopyranosyl fluoride | AG000J8H | 0.5g |
| 122734-32-1 | CNCCNC(OC(C)(C)C)=O | tert-Butyl 2-(methylamino)ethylcarbamate | AG000J8Q | 200g |
| 1227490-32-5 | OCC1=C(Br)N=CC(Br)=C1 | (2,5-Dibromopyridin-3-yl)methanol | AG000J8V | 35g |
| 1227489-83-9 | C1=C(C=NC(=C1C(F)(F)F)C=O)Br | 5-Bromo-3-(trifluoromethyl)picolinaldehyde | AG000J8X | 20g |
| 1227489-72-6 | [O-][N+](=O)C1=C(C=CC(=C1)C#N)C(F)(F)F | 3-Nitro-4-(trifluoromethyl)benzonitrile | AG000J8Z | 50g |
| 1227489-68-0 | O=C(O)C1=C(N)N=CC=C1C(F)(F)F | 2-Amino-4-(trifluoromethyl)nicotinic acid | AG000J90 | 0.75g |
| 1227418-26-9 | CC1(C)CNC2=CC=CC(Br)=C12 | 4-BroMo-3，3-diMethylindoline | AG000J96 | 1g |
| 122745-12-4 | Cl.N[C@H](C(O)=O)CC1=CC2=C(C=CC=C2)C=C1 | 3-(2-Naphthyl)-l-alanine HCl | AG000J9B | 40g |
| 122745-11-3 | N[C@H](CC1=CC=C2C=CC=CC2=C1)C(O)=O.[H]Cl | 3-(2-Naphthyl)-d-alanine hydrochloride | AG000J9C | 50g |
| 122745-10-2 | Cl.N[C@H](C(O)=O)CC1=C2C(C=CC=C2)=CC=C1 | 3-(1-Naphthyl)-l-alanine HCl | AG000J9D | 25g |
| 122745-09-9 | O=C(O)[C@H](N)CC1=C2C=CC=CC2=CC=C1.[H]Cl | 3-(1-Naphthyl)-D-alanine Hydrochloride | AG000J9E | 45g |
| 122744-78-9 | O=C(O)C1=CC(OC)=C(OC)C=C1NC(OC(C)(C)C)=O | 2-tert-Butoxycarbonylamino-4,5-dimethoxy-benzoic acid | AG000J9F | 10g |
| 122742-14-7 | O=C([C@@H](CC1)N(C)C1=O)OC | Methyl 1-methyl-5-oxopyrrolidine-2-carboxylate | AG000J9I | 3g |
| 1227511-58-1 | FC(C1=NC(Cl)=CC=C1F)(F)F | 6-Chloro-3-fluoro-2-(trifluoromethyl)pyridine | AG000J9M | 25g |
| 1227511-52-5 | COC1=CC(F)=C(C(O)=O)N=C1 | 3-fluoro-5-methoxypicolinic acid | AG000J9N | 1g |
| 1227581-36-3 | OCC1=CC(C(F)(F)F)=CN=C1OC | (2-Methoxy-5-(trifluoromethyl)pyridin-3-yl)methanol | AG000JCZ | 25g |
| 1227595-72-3 | NC1=NC(C(F)(F)F)=C(Cl)C=C1 | 5-chloro-6-(trifluoromethyl)pyridin-2-amine | AG000JD2 | 10g |
| 1227595-52-9 | NC1=NC=CC(Cl)=C1C | 4-Chloro-3-methylpyridin-2-amine | AG000JD3 | 30g |
| 1227595-09-6 | FC=1C(=NC=CC1I)OC | 3-Fluoro-4-iodo-2-methoxypyridine | AG000JD4 | 3g |
| 1227595-02-9 | O=C(OC)C1=C(C)N=C(F)C=C1 | Methyl 6-fluoro-2-methylnicotinate | AG000JD5 | 9g |
| 1227594-89-9 | O=C1C(F)=C(C(F)(F)F)C=CN1 | 3-Fluoro-4-(trifluoromethyl)pyridin-2(1H)-one | AG000JD6 | 15g |
| 1227594-72-0 | O=C(O)C1=C(OC)N=CC(C)=C1 | 2-Methoxy-5-Methylnicotinic Acid | AG000JD7 | 5g |
| 1227594-40-2 | O=C(C1=CC(Cl)=NC(C(F)(F)F)=C1)OC | Methyl 2-chloro-6-(trifluoromethyl)isonicotinate | AG000JD8 | 5g |
| 1227593-97-6 | COc1ccc(c(n1)C)Cl | 3-Chloro-6-methoxy-2-methylpyridine | AG000JDA | 0.5g |
| 1227593-86-3 | CC1=CC(=C(N=C1)OC)Cl | 3-Chloro-2-methoxy-5-methylpyridine | AG000JDB | 10g |
| 1227592-47-3 | COC1=C(Br)C=CN=C1C | 4-BROMO-3-METHOXY-2-METHYLPYRIDINE | AG000JDD | 20g |
| 1227592-43-9 | CC1=C(OC)C=CN=C1Br | 2-Bromo-4-methoxy-3-methylpyridine | AG000JDE | 45g |
| 1227590-07-9 | N#CCc1cnc(c(c1)Br)F | 2-(5-BROMO-6-FLUOROPYRIDIN-3-YL)ACETONITRILE | AG000JDF | 3g |
| 1227589-11-8 | OCc1ccc(nc1Br)Cl | (2-Bromo-6-chloropyridin-3-yl)methanol | AG000JDG | 10g |
| 1227588-87-5 | O=CC1=CC=C(Br)N=C1F | 6-Bromo-2-fluoropyridine-3-carbaldehyde | AG000JDI | 25g |
| 1227588-49-9 | C1=C(C=NC(=C1Br)C=O)Cl | 3-Bromo-5-chloropicolinaldehyde | AG000JDK | 7g |
| 1227587-24-7 | C(F)(F)(F)c1c(C(=O)O)ccnc1Cl | 4-Pyridinecarboxylic acid, 2-chloro-3-(trifluoromethyl)- | AG000JDM | 0.5g |
| 122759-89-1 | CC1=C(Br)C=C2C=CC=NC2=C1 | 6-Bromo-7-methylquinoline | AG000JDN | 20g |
| 1227601-71-9 | OCC1=NC(Cl)=CC=C1Br | (3-bromo-6-chloropyridin-2-yl)methanol | AG000JDP | 75g |
| 1227268-81-6 | BrC1C(I)=C(N)C(Br)=CN=1 | 2,5-dibromo-3-iodo-pyridin-4-amine | AG000J3C | 0.5g |
| 1227268-77-0 | O=C(C1=C(C)N2C=CC=CC2=N1)O | 3-Methylimidazo[1,2-a]pyridine-2-carboxylic acid | AG000J3G | 0.5g |
| 1227268-71-4 | [O-][N+](=O)c1cc(Cl)c(c(c1)C(=O)O)C | Benzoic acid, 3-chloro-2-methyl-5-nitro- | AG000J3L | 10g |
| 1227268-70-3 | O=C(C1=CC=C2C(NC(C2)=O)=N1)OC | Methyl 2-oxo-2,3-dihydro-1h-pyrrolo[2,3-b]pyridine-6-carboxylate | AG000J3M | 5g |
| 1227268-62-3 | ClC1=CC2=C(N=CC=C2)N1S(=O)(=O)C1=CC=CC=C1 | 1-(Phenylsulphonyl)-2-chloro-7-azaindole | AG000J3U | 1g |
| 1227268-58-7 | COC=1C=C2C=NNC2=CC1C(=O)O | 5-Methoxy-1H-indazole-6-carboxylic acid | AG000J3X | 2g |
| 1227269-07-9 | COC(=O)C1=CC2=NNC=C2C=C1Cl | 5-Chloro-1H-indazole-6-carboxylic acid methyl ester | AG000J43 | 1.25g |
| 1227269-04-6 | ClC1=NC2=C(C=C(N2)I)C=C1 | 6-Chloro-2-iodo-1h-pyrrolo[2,3-b]pyridine | AG000J46 | 10g |
| 1227268-98-5 | BrC=1C(=NC=C(C1N)I)OC | 3-Bromo-5-iodo-2-methoxypyridin-4-amine | AG000J4B | 2g |
| 1227268-94-1 | O=S(N1C=CC2=CC(I)=CN=C21)(C3=CC=CC=C3)=O | 1-Benzenesulfonyl-5-iodo-1h-pyrrolo[2,3-b]pyridine | AG000J4E | 3g |
| 1227268-85-0 | O=C(C1=CC2=C(C=C1I)C=NN2)OC | Methyl 5-iodo-1H-indazole-6-carboxylate | AG000J4N | 1g |
| 1227269-39-7 | IC1=CC2=C(NN=C2)C=C1Cl | 6-Chloro-5-iodo-1H-indazole | AG000J4P | 5g |
| 1227269-14-8 | IC(N1)=CC2=C1C=CN=C2 | 2-Iodo-1H-pyrrolo[3,2-c]pyridine | AG000J5A | 4g |
| 1227270-15-6 | Cc1cnc2[nH]c(I)cc2c1 | 2-Iodo-5-methyl-1H-pyrrolo[2,3-b]pyridine | AG000J5U | 1g |
| 1227270-14-5 | C1=C(C(=CC2=NNC=C12)C(=O)O)Br | 5-Bromo-1h-indazole-6-carboxylic acid | AG000J5V | 10g |
| 1227269-44-4 | O=C(C1=CC2=C(C=C1Br)C=CN2)O | 5-Bromo-1H-indole-6-carboxylic acid | AG000J5Y | 0.2g |
| 122833-58-3 | C[S](N[C@@H]1CCCC[C@H]1N[S](C)(=O)=O)(=O)=O | (1R,2R)-1,2-N,N’-BIS[(METHANE-SULFONYL)AMINO]-CYCLOHEXANE | AG000JKE | 10g |
| 122833-04-9 | NC1=CC=C(N2CCN(C)CC2)C=C1OC | 2-Methoxy-4-(4-methylpiperazin-1-yl)aniline | AG000JKH | 34g |
| 122828-48-2 | C(Oc1ccc(cc1)N)C1CC1 | 4-(Cyclopropylmethoxy)Aniline | AG000JKK | 10g |
| 1228450-70-1 | Cc1c[nH]c2ncc(Br)nc12 | 2-BROMO-7-METHYL-5H-PYRROLO[2,3-B]PYRAZINE | AG000JKN | 5g |
| 122848-57-1 | O=C(N1C2CNCC2C1)OC(C)(C)C | 6-Boc-3,6-diazabicyclo[3.2.0]heptane | AG000JKT | 5g |
| 122841-12-7 | O=S(O)(O)=O.CO/N=C(C1=CSC(N)=N1)C(N[C@H]2[C@](SCC(CN3N(CCO)C(C=C3) | Cefoselis sulfate | AG000JL0 | 0.2g |
| 1228548-29-5 | C1=CC(=CC(=C1)C(F)(F)F)[C@H](C(=O)O)N | (2R)-2-Amino-2-[3-(trifluoromethyl)phenyl]acetic acid | AG000JLA | 3g |
| 1228547-87-2 | CC(C)(C)OC(=O)N[C@@H](C1=CC=CC=C1Br)C(=O)O | (2S)-2-[(TERT-BUTOXY)CARBONYLAMINO]-2-(2-BROMOPHENYL)ACETIC ACID | AG000JLB | 10g |
| 1228542-19-5 | O=C(O)[C@@H](NC(OC(C)(C)C)=O)C1CCCCCC1 | (2S)-2-([(tert-Butoxy)carbonyl]amino)-2-cycloheptylacetic acid | AG000JLF | 20g |
| 1228537-69-6 | O=C(N1CC(C)(C#N)CC1)OC(C)(C)C | 1-Boc-3-cyano-3-methylpyrrolidine | AG000JLG | 25g |
| 122855-49-6 | C=CCCCCCC(C(CC#CC#C)O)O | Panaxyne | AG000JLL | 0.005g |
| 122855-38-3 | OC1=CC=C2C=C(N)C=NC2=C1 | 3-Aminoquinolin-7-ol | AG000JLM | 1.25g |
| 122855-37-2 | O=C(C1=CC2=CC=CC(O)=C2N=C1)OCC | Ethyl 8-hydroxyquinoline-3-carboxylate | AG000JLN | 0.75g |
| 122852-75-9 | CN1C2=C(C3=CC=CC=C13)C(=O)NCC2 | 5-Methyl-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indol-1-one | AG000JLQ | 15g |
| 122852-69-1 | CN(C1=C2C=CC=C1)C3=C2C(N(CC4=C(C)NC=N4)CC3)=O.Cl | Alosetron (hydrochloride) | AG000JLR | 35g |
| 122851-69-8 | ClCC1=NC=CC=C1Br | 3-Bromo-2-(Chloromethyl)Pyridine | AG000JLT | 75g |
| 122851-60-9 | N#CCC1=NC=CC=C1Br | 2-(3-Bromopyridin-2-yl)acetonitrile | AG000JLU | 75g |
| 12285-90-4 | O[Pt-2](O)(O)(O)(O)O.[K+].[K+] | Potassium hexahydroxoplatinate | AG000JLX | 4g |
| 122794-99-4 | CCOC(=O)C1=C(O)C2=C(C=CC(Br)=C2)N=C1 | Ethyl 6-bromo-4-hydroxyquinoline-3-carboxylate | AG000JHT | 125g |
| 1228032-35-6 | FC(C1=CC(C(F)(F)F)=CC(C2=CN=C3C(C=CC4=CC(C5=CC(C(F)(F)F)=CC(C(F)(F)F)=C5 | 3,8-Bis[3,5-bis(trifluoromethyl)phenyl]-1,10-phenanthroline | AG000JHU | 10g |
| 1228014-35-4 | O=C(N1C=CC2=C(Br)C=CN=C21)OC(C)(C)C | tert-Butyl 4-bromo-1H-pyrrolo[2,3-b]pyridine-1-carboxylate | AG000JHV | 30g |
| 1228014-22-9 | NC(=O)c1ccc(c(n1)C)Br | 5-Bromo-6-methylpicolinamide | AG000JHW | 100g |
| 1228014-10-5 | CC(C1=NC=C(B2OC(C)(C)C(C)(C)O2)C=C1)(O[Si](C)(C)C)C | 6-(2-(Trimethylsilyloxy)propan-2-yl)pyridine-3-boronic acid pinacol ester | AG000JHX | 30g |
| 1228013-30-6 | O=C1CNC2=NC=C(C3=CC=C(C(C)(O)C)N=C3)N=C2N1[C@H]4CC[C@H](OC)CC4 | CC-223 | AG000JHY | 0.75g |
| 1228013-15-7 | O=C1CN=C2C(N1CC)=NC(C3=C(C)N=C(C4=NN=CN4)C=C3)=CN2 | CC-115 | AG000JHZ | 0.1g |
| 122801-57-4 | COC1=C(C=CC=C1)C1=CC(=CC=C1)C=O | 2′-Methoxy-[1,1′-biphenyl]-3-carbaldehyde | AG000JI4 | 10g |
| 122799-98-8 | NC1=N[N](C=C1C#N)C2CCCC2 | 3-Amino-1-cyclopentyl-1H-pyrazole-4-carbonitrile | AG000JI6 | 4g |
| 122799-38-6 | OC[C@H]1O[C@H]([C@@H]([C@@H]1O)F)n1cc(C)c(=O)[nH]c1=O | 2′-Deoxy-2′-fluorothymidine | AG000JI7 | 0.2g |
| 12280-03-4 | OB(O)O.OB(O)O.OB(O)O.OB(O)O.OB(O)O.OB(O)O.OB(O)O.[O-]B(O)[O-].O.O.O | Boron sodium oxide(B8Na2O13), tetrahydrate | AG000JIA | 2000g |
| 1228-72-4 | C[C@@]12[C@]([C@]3([C@@](C=4C(CC3)=CC(O)=CC4)(CC1)[H])[H])(C[C@@H]( | (16α,17α)-Estra-1,3,5(10)-triene-3,16,17-triol | AG000JIE | 0.005g |
| 1228-53-1 | [O-][N+](=O)c1cccc(c1)S(=O)(=O)c1cccc(c1)[N+]([O-])=O | 3,3′-Sulfonylbis(nitrobenzene) | AG000JIG | 3g |
| 1228108-74-4 | NC1=C(Cl)C=C(OC(F)(F)F)C=C1Br | 2-Bromo-6-Chloro-4-(Trifluoromethoxy)Aniline | AG000JIM | 10g |
| 1228105-51-8 | C/C(C1)=CC=C[C@](OC)([H])[C@](C[C@@](O2)([H])[C@@H](C)[C@H]3[C@](O | DM1-SMCC | AG000JIN | 0.2g |
| 1228102-89-3 | COc1ccc(COc2cccc(Nc3ccnc4cc(Br)sc34)c2)cc1 | 2-Bromo-n-(3-[(4-methoxyphenyl)methoxy]phenyl)thieno[3,2-b]pyridin-7-a | AG000JIO | 1g |
| 1228093-54-6 | COc1cc(F)c(cc1I)F | 1,2-Difluoro-4-iodo-5-methoxybenzene | AG000JIR | 20g |
| 1228079-29-5 | O=C1C2(CCN(C(OC(C)(C)C)=O)CC2)CC3=C1C=CC=C3 | N-Boc-1-oxo-1,3-dihydrospiro[indene-2,4′-piperidine] | AG000JIU | 100g |
| 1228070-91-4 | NC1=CNN=C1C.[H]Cl | 3-Methyl-1H-pyrazol-4-amine hydrochloride | AG000JIY | 40g |
| 1227270-55-4 | N#Cc1ccnc2c1cc(n2S(=O)(=O)c1ccccc1)I | 2-Iodo-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine-4-carbonitrile | AG000J68 | 5g |
| 1227270-50-9 | C1=C2C=NNC2=CC(=C1Br)O | 5-BROMO-1H-INDAZOL-6-OL | AG000J6D | 5g |
| 1227270-38-3 | O=C(C1=CC2=C(C=C1F)C=NN2)OC | Methyl 5-fluoro-1H-indazole-6-carboxylate | AG000J6N | 25g |
| 1227270-34-9 | ClC1=NC=CC2=C1C=C(N2S(=O)(=O)C2=CC=CC=C2)I | 4-Chloro-2-iodo-1-(phenylsulfonyl)-1H-pyrrolo[3,2-c]pyridine | AG000J6Q | 2g |
| 1227270-32-7 | IC1=CC2=CC=CN=C2N1 | 2-Iodo-1h-pyrrolo[2,3-b]pyridine | AG000J6R | 25g |
| 1227270-85-0 | O=C(C1=CC2=C(C=C1C)C=CN2)OC | Methyl 5-methyl-1H-indole-6-carboxylate | AG000J6W | 3g |
| 1227270-79-2 | COC(=O)C1=CC2=C(C=C1Cl)C(I)=NN2 | 3-Iodo-5-chloro-(1h)indazole-6-carboxylic methyl ester | AG000J72 | 0.5g |
| 1227311-09-2 | N#CC1=CC(C)=C(I)C(C)=C1 | 4-Iodo-3,5-dimethylbenzonitrile | AG000J7H | 20g |
| 1227301-51-0 | OC1=CC=C(C[C@H](NC(CCC)=O)C(NCCCCCCCNCCCCN)=O)C=C1.Cl.Cl | Philanthotoxin 74 (hydrochloride) | AG000J7I | 0.01g |
| 1227271-03-5 | BrC(N1S(=O)(C2=CC=CC=C2)=O)=CC3=C1N=CC=C3 | 2-Bromo-1-(phenylsulfonyl)-1h-pyrrolo[2,3-b]pyridine | AG000J7K | 0.5g |
| 1227271-01-3 | O=C(C1=CC2=C(C=C1OC)C=CN2)O | 5-Methoxy-1H-indole-6-carboxylic acid | AG000J7M | 0.5g |
| 1227384-86-2 | C1=C(C=CC(=C1)S(=O)(=O)N2CC3(C2)COC3)F | 6-((4-Fluorophenyl)sulfonyl)-2-oxa-6-azaspiro[3.3]Heptane | AG000J86 | 75g |
| 1227384-81-7 | O=S(C1=CN=C(Br)C=C1)(CC)=O | 2-Bromo-5-(ethylsulfonyl)pyridine | AG000J87 | 40g |
| 1227382-15-1 | Cl.O=C(OCc1ccccc1)N1CCC2(CC1)CNC2 | benzyl 2,7-diazaspiro[3.5]nonane-7-carboxylate hydrochloride | AG000J88 | 25g |
| 1227382-05-9 | OC(=O)C(O)=O.CC(C)(C)OC(=O)N1CC2(C1)CCCNC2 | tert-Butyl 2,6-diazaspiro[3.5]nonane-2-carboxylate oxalate(2:1) | AG000J89 | 3g |
| 1227382-01-5 | C(C(=O)O)(=O)O.C(=O)(OC(C)(C)C)N1CC2(C1)CNC2 | tert-Butyl 2,6-diazaspiro[3.3]heptane-2-carboxylate oxalate | AG000J8A | 50g |
| 118350-17-7 | C1(=CC=CC(=C1)C=O)C1C=CC(=CC=1)OC | 3-(4-Methoxyphenyl)benzaldehyde | AG000IP4 | 5g |
| 119400-87-2 | Cc1cc2[C@@H]3C[C@H]4C(C)(C)CCC[C@]4(CO3)c2cc1O | Przewalskin | AG000IP5 | 0.005g |
| 1194-99-6 | ON=C(C=1C=CN=CC1)C | 1-(4-Pyridinyl)ethanone oxime | AG000IP7 | 25g |
| 1194-98-5 | O=CC1=CC(O)=CC=C1O | 2,5-Dihydroxybenzaldehyde | AG000IP8 | 2500g |
| 1194-97-4 | COC(=O)C1=CC=C(C)N1 | Methyl 5-methyl-1H-pyrrole-2-carboxylate | AG000IP9 | 200g |
| 1194-96-3 | O=C(C1=CC(Cl)=CN1)OC | Methyl 4-chloro-1H-pyrrole-2-carboxylate | AG000IPA | 100g |
| 1194-87-2 | O=C(O)[C@@H](N)C1=CSC=C1 | (S)-3-Thienylglycine | AG000IPE | 10g |
| 1194-86-1 | C(O)(=O)[C@H](N)C1C=CSC=1 | (R)-3-Thienylglycine | AG000IPF | 10g |
| 1194-78-1 | NC1=NC(Cl)=C(N)C(N)=N1 | 2,4,5-Triamino-6-chloropyrimidine | AG000IPG | 5g |
| 1194-74-7 | CC1=NC(O)=C(C)C(O)=N1 | 2,5-Dimethyl-4,6-dihydroxypyrimidine | AG000IPI | 20g |
| 1194-73-6 | O=C1N=C(C)NC(Cl)=C1C | 6-Chloro-5-iodo-2-methylpyrimidin-4-ol | AG000IPJ | 5g |
| 1194-66-7 | ClC1=C(N=O)C(Cl)=CC=C1 | 2,6-Dichloronitrosobenzene | AG000IPL | 1g |
| 1194-64-5 | CC1=CC=CC(Cl)=C1C=O | 2-Chloro-6-methylbenzaldehyde | AG000IPN | 50g |
| 1194-56-5 | C=C1CCC2=C1C=CC=C2 | 1-Methyleneindane | AG000IPR | 10g |
| 1227605-02-8 | O=C(O)C1=CC=CC(Br)=C1C(F)(F)F | 3-Bromo-2-(trifluoromethyl)benzoic acid | AG000JEP | 0.6g |
| 1227603-81-7 | Clc1[nH]c(=O)ccc1Br | 5-Bromo-6-chloropyridin-2-ol | AG000JET | 1g |
| 1227603-55-5 | FC(F)(F)C1=C(I)C=CN=C1Cl | 2-Chloro-4-iodo-3-(trifluoromethyl)pyridine | AG000JEU | 26g |
| 1227602-85-8 | COC1=NC=C(Cl)C(I)=C1 | 5-Chloro-4-iodo-2-methoxypyridine | AG000JEV | 75g |
| 1227602-76-7 | COc1cc(I)cc(n1)Cl | 2-Chloro-4-iodo-6-methoxypyridine | AG000JEW | 25g |
| 1227602-73-4 | IC1=CC(=NC=C1C)OC | 4-Iodo-2-methoxy-5-methylpyridine | AG000JEX | 5g |
| 1227602-42-7 | C1=C(C=C(Cl)N=C1C(F)(F)F)O | 2-Chloro-6-(trifluoromethyl)pyridin-4-ol | AG000JEZ | 1g |
| 1227601-75-3 | OCC1=C(F)C(Br)=NC=C1 | (2-Bromo-3-fluoropyridin-4-yl)methanol | AG000JF1 | 10g |
| 1227635-12-2 | CC(N1C=CC2=C(Cl)N=C(Cl)N=C21)C | 2,4-DICHLORO-7-ISOPROPYL-7H-PYRROLO[2,3-D]PYRIMIDINE | AG000JF2 | 7g |
| 1227633-49-9 | OC1=CC=C(CCNC2=C3N=CN(C(C)C)C3=NC(C4=CSC5=CC=CC=C54)=N2)C=C1 | StemRegenin 1 | AG000JF4 | 0.2g |
| 1227628-83-2 | FC1=C(C=O)C=CC(OC(F)(F)F)=C1 | 2-Fluoro-4-(trifluoromethoxy)benzaldehyde | AG000JF7 | 60g |
| 1227628-78-5 | BrC1=CC=C(NN=C2)C2=N1 | 5-Bromo-1H-pyrazolo[4,3-b]pyridine | AG000JF8 | 500g |
| 122763-67-1 | C=CC(O)CC(OC(C)(C)C)=O | tert-Butyl 3-hydroxypent-4-enoate | AG000JFH | 200g |
| 1227743-83-0 | BrC=1C(=CC2=CC(=C(C=C2C1)O)Br)O | 3,7-Dibromo-2,6-dihydroxynaphthalene | AG000JFR | 40g |
| 1227700-45-9 | C=1C(=NC(B2OC(CN(CC(O2)=O)C)=O)=CC1)OC | 2-(6-Methoxypyridin-2-yl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione | AG000JFW | 10g |
| 122775-19-3 | C(=O)(C=C)N | Acrylamide-d3 | AG000JG1 | 1.5g |
| 122773-97-1 | C1=CC=C(C=C1)C2=NC=C(C=N2)C(=O)O | 2-PHENYLPYRIMIDINE-5-CARBOXYLIC ACID | AG000JG6 | 4g |
| 1227572-25-9 | N#CCC1=NC=C(Cl)C=C1F | 2-(5-Chloro-3-fluoropyridin-2-yl)acetonitrile | AG000JB8 | 3g |
| 1227571-82-5 | CCOC(=O)c1ncc(Cl)cn1 | ethyl 5-chloropyrimidine-2-carboxylate | AG000JB9 | 5g |
| 1227570-72-0 | CC1=CN=C(Br)C=C1O | 2-Bromo-5-methylpyridin-4-ol | AG000JBD | 25g |
| 1227565-50-5 | CC1=CC(Br)=CC(F)=N1 | 4-Bromo-2-fluoro-6-methylpyridine | AG000JBE | 0.4g |
| 1227564-33-1 | [Br]C1(=C(OC)C=NC(=C1)F) | 4-Bromo-2-fluoro-5-methoxypyridine | AG000JBG | 5g |
| 1227581-20-5 | O=C(O)C1=CC(C(F)(F)F)=NC(OC)=C1 | 2-Methoxy-6-(Trifluoromethyl)Isonicotinic Acid | AG000JBM | 1g |
| 1227579-00-1 | OC1=C(F)C(F)=NC=C1 | 2,3-Difluoropyridin-4-ol | AG000JBP | 10g |
| 1227578-99-5 | CC1=C(Br)C=CN=C1O | 4-bromo-3-methyl-1,2-dihydropyridin-2-one | AG000JBQ | 20g |
| 1227578-94-0 | ClC1=C(Cl)C=C2C(NC=C2C=O)=C1 | 5,6-DICHLORO-1H-INDOLE-3-CARBALDEHYDE | AG000JBR | 25g |
| 1227578-74-6 | OC1=C(C)C=CN=C1Br | 2-BroMo-4-Methylpyridin-3-ol | AG000JBT | 1.25g |
| 1227578-45-1 | CC1=CC(OC)=CC(Cl)=N1 | 2-Chloro-4-methoxy-6-methylpyridine | AG000JBV | 90g |
| 1227578-23-5 | OC1=C(Br)C=C(F)N=C1 | 4-Bromo-6-fluoropyridin-3-ol | AG000JBW | 5g |
| 1227577-96-9 | OC1=C(F)C=CN=C1Cl | 2-Chloro-4-fluoro-3-hydroxypyridine | AG000JBY | 30g |
| 1227577-73-2 | CC1=CC(C=O)=C(Br)N=C1 | 2-bromo-5-methylpyridine-3-carbaldehyde | AG000JBZ | 5.7g |
| 1227577-26-5 | CC1=CN=C(Br)C=C1I | 2-Bromo-4-iodo-5-methylpyridine | AG000JC1 | 7g |
| 1227577-18-5 | CC1=C(O)C=NC(F)=C1 | 2-Fluoro-5-hydroxy-4-methylpyridine | AG000JC2 | 20g |
| 1227577-03-8 | NC1=C(F)C(Cl)=NC=C1 | 2-Chloro-3-fluoropyridin-4-amine | AG000JC4 | 200g |
| 119483-47-5 | C(=O)(OC(C)(C)C)[C@@H](N)CCC.Cl | L-Norvaline tert-butyl ester, HCl | AG000IUY | 238g |
| 119483-45-3 | CC(C)(C)[C@H](N)C(OC(C)(C)C)=O.[H]Cl | H-TLE-OTBU HCL | AG000IV0 | 1500g |
| 119479-32-2 | C=CCC(NC(OC(C)(C)C)=O)C(O)=O | 2-((tert-Butoxycarbonyl)amino)pent-4-enoic acid | AG000IV2 | 45.02g |
| 119478-56-7 | O=C(C(N12)=C(S[C@@H]3CN[C@H](C(N(C)C)=O)C3)[C@H](C)[C@]2([H])[C@@ | (4R,5S,6S)-3-{[(3S,5S)-5-(dimethylcarbamoyl)pyrrolidin-3-yl]sulfanyl}-6-[(1R)- | AG000IV3 | 189g |
| 119478-55-6 | O=C(C1=CN(C2CC2)C3=C(C=C(F)C(N4[C@](C5)([H])CN(C)[C@]5([H])C4)=C3)C1= | Danofloxacin Mesylate | AG000IV4 | 150g |
| 1184913-75-4 | CC1=CC(F)=NC=C1I | 2-Fluoro-5-iodo-4-methylpyridine | AG000IVB | 150g |
| 1194961-19-7 | O=C(C1=CN=C(N[C@H]2[C@@H](N)CCCC2)N=C1NC3=CC=CC(C)=C3)N | PRT-060318 | AG000IVF | 0.5g |
| 1195-16-0 | CC(NC1C(=O)SCC1)=O | 2-Acetamido-4-mercaptobutyric acid gamma-thiolactone | AG000IVU | 75g |
| 1195-14-8 | Cc1cc2c(s1)cccc2 | Benzo[b]thiophene, 2-methyl- | AG000IVV | 20g |
| 1195-08-0 | O=CC1=CNC(=O)NC1=O | 5-Formyluracil | AG000IVX | 50g |
| 1195-07-9 | Cl.CC1=NC(N)=C(CN)C=N1 | 5-(Aminomethyl)-2-methylpyrimidin-4-amine hydrochloride | AG000IVY | 3g |
| 1195-98-8 | CC(C)(C#N)C1=CC=CC=C1 | 2-Methyl-2-phenylpropanenitrile | AG000IW6 | 50g |
| 1195-92-2 | C=C(C1CCC2(C)OC2C1)C | 1-Methyl-4-(prop-1-en-2-yl)-7-oxabicyclo[4.1.0]heptane | AG000IW8 | 200g |
| 1195-91-1 | O=C1C(Br)C(CC(C)(C)C1)=O | 2-Bromo-5,5-dimethyl-1,3-cyclohexanedione | AG000IW9 | 10g |
| 1227577-02-7 | CC1=CN=C(F)C=C1Br | 4-Bromo-2-fluoro-5-methylpyridine | AG000JC5 | 125g |
| 1227576-86-4 | O=C1C=C(I)C(F)=CN1 | 5-Fluoro-4-iodopyridin-2(1H)-one | AG000JC6 | 2g |
| 1227576-13-7 | CC1=CC(Cl)=CC(O)=N1 | 4-Chloro-6-methylpyridin-2-ol | AG000JC7 | 2g |
| 1227576-08-0 | BrCC=1C(=NC=C(C1)C(F)(F)F)OC | 3-(Bromomethyl)-2-methoxy-5-(trifluoromethyl)pyridine | AG000JC8 | 100g |
| 1227575-72-5 | CC1=CNC(=O)C(C=O)=C1 | 5-Methyl-2-oxo-1,2-dihydropyridine-3-carbaldehyde | AG000JCA | 5g |
| 1227587-12-3 | CC1=NC(F)=CC=C1CCl | 3-(CHLOROMETHYL)-6-FLUORO-2-METHYLPYRIDINE | AG000JCB | 0.3g |
| 1227586-61-9 | CC1=C(F)C=CN=C1N | 4-Fluoro-3-Methylpyridin-2-Amine | AG000JCC | 2g |
| 1227586-39-1 | NC1=CC(Cl)=NC=C1OC | 2-chloro-5-methoxypyridin-4-amine | AG000JCE | 25g |
| 1227586-36-8 | OCC1=CC(N)=NC=C1Br | 2-Amino-5-bromo-4-(hydroxymethyl)pyridine | AG000JCF | 3g |
| 1227586-05-1 | NC1=NC=CC(Br)=C1C | 4-Bromo-3-methylpyridin-2-amine | AG000JCH | 75g |
| 1227585-65-0 | OCC1=CC(Cl)=CN=C1Br | (2-Bromo-5-chloropyridin-3-yl)methanol | AG000JCI | 2g |
| 1227585-56-9 | FC(C1=NC=CC(CBr)=C1)(F)F | 4-(Bromomethyl)-2-(Trifluoromethyl)Pyridine | AG000JCJ | 2g |
| 1227585-35-4 | OCc1cc(Cl)ncc1C(F)(F)F | 2-Chloro-5-(trifluoromethyl)-4-pyridinemethanol | AG000JCL | 0.5g |
| 1227583-91-6 | C1=CC(=C(Cl)N=C1C=O)Br | 5-broMo-6-chloropicolinaldehyde | AG000JCO | 60g |
| 1227581-81-8 | NC1=NC=C(C)C(I)=C1 | 2-Amino-4-iodo-5-methylpyridine | AG000JCU | 4g |
| 1227581-80-7 | N#CC1=C(C(F)(F)F)C=CC=C1[N+]([O-])=O | 2-Nitro-6-(trifluoromethyl)benzonitrile | AG000JCV | 200g |
| 1227581-39-6 | COC(C1=C(N)C(C)=NC=C1)=O | methyl 3-amino-2-methylpyridine-4-carboxylate | AG000JCX | 25g |
| 1194375-29-5 | C1=COC2=C(C=C(C=C12)Br)Cl | 5-Bromo-7-chlorobenzofuran | AG000IS1 | 5g |
| 1194375-23-9 | CC(C)(C)OC(=O)N1CC2CNC3=C(C=CC=C3)C2C1 | 2-Boc-2,3,3A,4,5,9B-hexahydro-1H-pyrrolo[3,4-C]quinoline | AG000IS2 | 5g |
| 1194375-12-6 | O=CC1=CN2C=CC=C(Br)C2=N1 | 8-Bromoimidazo[1，2-A]Pyridine-2-Carbaldehyde | AG000IS3 | 25g |
| 1194488-90-8 | O=C(N1CCC(B2OC(C)(C)C(C)(C)O2)=C(C(OCC)=O)C1)OC(C)(C)C | 1-tert-Butyl 3-ethyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5,6-dihyd | AG000ISG | 9.4g |
| 1184204-30-5 | COC(=O)C1=C(N)C(F)=CC=C1F | Methyl 2-Amino-3,6-Difluorobenzoate | AG000IT6 | 15g |
| 119452-66-3 | NNC1=C(F)C=CC=C1F | 2,6-Difluorophenylhydrazine | AG000ITP | 175g |
| 118443-89-3 | O=C(/C(C1=CSC(N)=N1)=NOC)N[C@H](C2=O)[C@]3([H])N2C(C(O)=O)=C(C[N+]4 | Cefquinome sulfate | AG000ITV | 800g |
| 118431-88-2 | O=C(CC#N)C1CC1 | 3-CYCLOPROPYL-3-OXOPROPANENITRILE | AG000IU2 | 1000g |
| 1194804-60-8 | O=C(O)C1=CC=CC(NC)=C1.[H]Cl | 3-(Methylamino)benzoic acid hydrochloride | AG000IUN | 40g |
| 1194760-60-5 | OC(C(F)(F)F)C1=C(Cl)C=C(Cl)C=C1 | 1-(2,4-dichlorophenyl)-2,2,2-trifluoroethanol | AG000IUO | 0.75g |
| 1194757-83-9 | NC1=CN(C)C=C1.[H]Cl | 1-Methyl-1H-pyrrol-3-amine hydrochloride | AG000IUP | 3g |
| 119485-56-2 | CC(C)(C)OC(=O)NC1=C(I)C=CS1 | tert-Butyl (3-iodothiophen-2-yl)carbamate | AG000IUW | 10g |
| 1228880-06-5 | Cl.NC1(C2=CC=C(C(F)(F)F)C=C2)CC1 | 1-(4-(Trifluoromethyl)phenyl)cyclopropanamine hydrochloride | AG000JP2 | 0.75g |
| 1228879-41-1 | NC(C1=CC=CN=C1)CC.[H]Cl.[H]Cl | 1-(3-Pyridyl)-1-propylamine Dihydrochloride | AG000JP4 | 20g |
| 1228879-34-2 | NC1(C2=CC=CC(Br)=C2)CCC1.[H]Cl | 1-(3-Bromophenyl)cyclobutanamine hydrochloride | AG000JP6 | 3g |
| 1228879-24-0 | NC1(C2=CC=CC=C2C(F)(F)F)CC1.[H]Cl | 1-(2-(Trifluoromethyl)phenyl)cyclopropanamine hydrochloride | AG000JP8 | 1g |
| 1228878-85-0 | CC1=CC=CC=C1C2NCCC2.[H]Cl | 2-(o-Tolyl)pyrrolidine hydrochloride | AG000JPC | 0.5g |
| 122889-11-6 | O=C(O)[C@H](NC(OCC1C2=C(C3=C1C=CC=C3)C=CC=C2)=O)COCC4=CC=CC=C4 | Fmoc-D-Ser(Bzl)-OH | AG000JPE | 50g |
| 1228943-80-3 | CC1(C)CC(Cl)=C(C=O)CC1 | 2-Chloro-4,4-dimethylcyclohex-1-enecarbaldehyde | AG000JPG | 125g |
| 1228900-15-9 | CC(C)CC(NC[C@H](C(O)=O)NC(=O)OCC1C2C(=CC=CC=2)C3C1=CC=CC=3)=C4C(=O | Fmoc-D-Dap(ivDde)-OH | AG000JPH | 1.25g |
| 122894-73-9 | O=C(OCC)C1=CC(F)=C(F)C(F)=C1F | Ethyl 2,3,4,5-tetrafluorobenzoate | AG000JPJ | 5000g |
| 122894-70-6 | ClCC1CNCCO1 | 2-(Chloromethyl)morpholine | AG000JPK | 0.75g |
| 122894-66-0 | CCN(CC)CC1CNCCO1 | Diethyl-morpholin-2-ylmethyl-amine | AG000JPM | 20g |
| 122894-56-8 | CN(C)CC1CNCCO1 | Dimethyl-morpholin-2-ylmethyl-amine | AG000JPO | 40g |
| 122894-45-5 | CNCC1CNCCO1 | Methyl-morpholin-2-ylmethyl-amine | AG000JPP | 10g |
| 122894-40-0 | Cl.Cl.CN(C)CC1CNCCO1 | N,N-Dimethyl-1-(morpholin-2-yl)methanamine dihydrochloride | AG000JPQ | 1g |
| 122892-31-3 | C(=O)(NCc1ccc(cc1)OCCN(C)C)c1cc(OC)c(cc1)OC.Cl | Benzamide, N-[[4-[2-(dimethylamino)ethoxy]phenyl]methyl]-3,4-dimethoxy | AG000JPW | 175g |
| 122891-92-3 | OC(=O)C1CCN(CC1)S(=O)(=O)C1=CC=CC=C1 | 1-(Phenylsulfonyl)-4-piperidinecarboxylic acid | AG000JPX | 15g |
| 123-17-1 | CC(C)CC(C)CC(O)CC(C)C | 4-Nonanol, 2,6,8-trimethyl- | AG000JWI | 20g |
| 123-11-5 | O=CC1=CC=C(OC)C=C1 | 4-Methoxybenzaldehyde | AG000JWL | 1953g |
| 123-09-1 | S(C)c1ccc(cc1)Cl | Benzene, 1-chloro-4-(methylthio)- | AG000JWM | 1250g |
| 123-08-0 | O=CC1=CC=C(O)C=C1 | 4-Hydroxybenzaldehyde | AG000JWN | 10000g |
| 123-07-9 | OC1=CC=C(CC)C=C1 | 4-Ethylphenol | AG000JWO | 50g |
| 123-04-6 | CCC(CCl)CCCC | 3-(Chloromethyl)heptane | AG000JWQ | 75g |
| 123-01-3 | CCCCCCCCCCCCC1=CC=CC=C1 | Dodecylbenzene | AG000JWS | 6500g |
| 123-57-9 | CC1COCC(C)N1 | 3,5-Dimethylmorpholine | AG000JX0 | 3g |
| 123-56-8 | O=C(N1)CCC1=O | Succinimide | AG000JX1 | 2000g |
| 123-45-5 | OC(CS(CC(O)=O)(=O)=O)=O | 2-(carboxymethanesulfonyl)acetic acid | AG000JX6 | 5g |
| 123-41-1 | OCC[N+](C)(C)C.[OH-] | Choline | AG000JX9 | 140g |
| 123-39-7 | O=CNC | N-Methylformamide | AG000JXA | 4000g |
| 123-99-9 | O=C(O)CCCCCCCC(O)=O | Nonanedioic acid | AG000JXI | 1750g |
| 123-98-8 | O=C(Cl)CCCCCCCC(Cl)=O | Azelaoyl Chloride | AG000JXJ | 125g |
| 1228878-69-0 | CN1N=CC2=C1CNCC2.[H]Cl.[H]Cl | 1-Methyl-4,5,6,7-tetrahydro-1H-pyrazolo[3,4-c]pyridine dihydrochloride | AG000JO2 | 3g |
| 1228878-45-2 | NCC1(CCC1)c1ccc(cc1)Br.Cl | (1-(4-bromophenyl)cyclobutyl)methanamine hydrochloride | AG000JO4 | 1g |
| 1228875-16-8 | NS(=O)(=O)C1=CC(=C(Cl)N=C1)C(F)(F)F | 6-Chloro-5-(trifluoromethyl)pyridine-3-sulfonamide | AG000JO5 | 0.75g |
| 1228875-13-5 | NCC1(F)CCOCC1 | (4-Fluorotetrahydro-2H-pyran-4-yl)methanamine | AG000JO6 | 0.5g |
| 1228838-10-5 | N1(C)CC(N)CCC1=O.Cl | 5-Amino-1-methylpiperidin-2-one hydrochloride | AG000JO7 | 2g |
| 1228838-07-0 | O=C1N(C)CC(N)C1.[H]Cl | 4-Amino-1-methylpyrrolidin-2-one hydrochloride | AG000JO8 | 4g |
| 1228837-05-5 | O=CC1=C(C2=CC=C(Cl)C=C2)CC(C)(C)CC1 | 4′-Chloro-5,5-dimethyl-3,4,5,6-tetrahydro-[1,1′-biphenyl]-2-carbaldehyde | AG000JO9 | 200g |
| 1228829-54-6 | OB(C1=CC=C([N+]([O-])=O)C=C1C)O | 2-Methyl-4-nitrophenylboronic acid | AG000JOB | 30g |
| 1228829-43-3 | N#CC1=CC(C=O)=CC=C1Br | 2-Bromo-5-formylbenzonitrile | AG000JOC | 50g |
| 1228826-41-2 | NC(=O)c1ccc(c(c1)Cl)Br | 4-Bromo-3-chlorobenzamide | AG000JOD | 5g |
| 1228788-32-6 | Cl.NCC1=NC=C(F)C=C1 | 1-(5-Fluoropyridin-2-yl)methanamine hydrochloride | AG000JOE | 5g |
| 1228788-25-7 | Cl.NCC1=NN=CC=C1 | pyridazin-3-ylmethanamine hydrochloride | AG000JOF | 2g |
| 122883-93-6 | Cl.ClC1=C(CCN2CCN(C3C4=C(C=CC=C4)SN=3)CC2)C=C2C(NC(C2)=O)=C1 | 5-{2-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]ethyl}-6-chloro-2,3-dihydro-1H-i | AG000JOJ | 0.75g |
| 1228898-68-7 | FC(C1=C(CCl)C(Cl)=CC=C1)(F)F | 1-chloro-2-(chloromethyl)-3-(trifluoromethyl)benzene | AG000JOS | 14.8g |
| 1228898-61-0 | COC1=NC(=C(C=C1)CO)Cl | (2-Chloro-6-methoxypyridin-3-yl)methanol | AG000JOT | 5g |
| 1228898-36-9 | COc1nccc(c1F)N | 3-Fluoro-2-methoxypyridin-4-amine | AG000JOU | 10g |
| 1228880-68-9 | O=C(OC)C1=NC=C(C)C=C1Br | Methyl 3-bromo-5-methylpicolinate | AG000JOX | 30g |
| 1228880-25-8 | COC1=CC=CC=C1C(N)C(F)(F)F.[H]Cl | 2,2,2-Trifluoro-1-(2-methoxyphenyl)ethanamine hydrochloride | AG000JP1 | 1g |
| 1227563-22-5 | O=CC1=C(Cl)N=C(F)C=C1 | 2-Chloro-6-fluoronicotinaldehyde | AG000JAJ | 1g |
| 1227562-37-9 | O=CC1=C(Br)C=NC(O)=C1 | 5-Bromo-2-hydroxyisonicotinaldehyde | AG000JAK | 0.75g |
| 1227516-28-0 | C1=C(C=NC(=C1F)CBr)F | 2-(Bromomethyl)-3,5-difluoropyridine | AG000JAN | 2g |
| 1227515-76-5 | ClC1=CC=CN=C1CBr | 2-(Bromomethyl)-3-chloropyridine | AG000JAO | 5g |
| 1227515-71-0 | O=C(C1=CC=C(OC)N=C1C)O | 6-Methoxy-2-methylpyridine-3-carboxylic acid | AG000JAP | 6.4g |
| 1227515-52-7 | OCC1=NC=C(C(F)(F)F)C=C1F | (3-Fluoro-5-trifluoromethyl-pyridin-2-yl)-methanol | AG000JAQ | 10g |
| 1227515-14-1 | OC1=NC(C(F)(F)F)=C(I)C=C1 | 5-Iodo-6-(trifluoromethyl)pyridin-2-ol | AG000JAR | 9g |
| 122752-16-3 | [C@@H](NC(=O)[C@@H](C)NC(=O)[C@@H](N)CC1C=CC(O)=CC=1)(C(=O)N[C@ | Deltorphin 2 | AG000JAV | 0.2g |
| 122752-15-2 | [C@@H](NC(=O)[C@@H](C)NC(=O)[C@@H](N)CC1C=CC(O)=CC=1)(C(=O)N[C@ | Deltorphin I | AG000JAW | 0.005g |
| 1227575-47-4 | O=C(C1=NC=C(F)C=N1)OC | Methyl 5-Fluoropyrimidine-2-Carboxylate | AG000JAX | 45g |
| 1227574-72-2 | OCC1=NC=C(F)C=N1 | (5-Fluoropyrimidin-2-yl)methanol | AG000JAZ | 50g |
| 1227574-33-5 | CC1=CN=C(Br)C=C1OC | 2-Bromo-4-methoxy-5-methylpyridine | AG000JB1 | 30g |
| 1227574-31-3 | FC(F)(F)C1=CN=CC(CBr)=C1 | 3-(Bromomethyl)-5-(trifluoromethyl)pyridine | AG000JB2 | 5g |
| 1227574-24-4 | CC1=CN=C(Cl)C=C1F | 2-Chloro-4-fluoro-5-methylpyridine | AG000JB3 | 15g |
| 1227572-94-2 | O=CC1=C(F)C(Br)=NC=C1 | 2-Bromo-3-fluoroisonicotinaldehyde hydrate | AG000JB6 | 50g |
| 1227572-43-1 | COC1=CC(Cl)=CC(Cl)=N1 | 2,4-DICHLORO-6-METHOXYPYRIDINE | AG000JB7 | 1g |
| 1227601-36-6 | OCC1=NC=C(Br)C=C1Br | (3,5-Dibromopyridin-2-yl)methanol | AG000JDR | 15g |
| 1227601-23-1 | OCC1=NC(Cl)=CC(C)=C1 | (6-Chloro-4-methylpyridin-2-yl)methanol | AG000JDT | 3g |
| 1227601-12-8 | OCC1=CC(Br)=CN=C1F | 5-Bromo-2-fluoro-3-(hydroxymethyl)pyridine | AG000JDU | 5g |
| 1227600-23-8 | O(C)c1c(N)ccnc1Cl | 2-Chloro-3-methoxy-4-pyridinamine | AG000JDV | 28.65g |
| 1227600-15-8 | OC1=NC(Cl)=CC(N)=C1 | 4-AMINO-6-CHLOROPYRIDIN-2-OL | AG000JDW | 2g |
| 1227599-35-0 | OCC1=C(Cl)N=C(Br)C=C1 | (6-Bromo-2-chloropyridin-3-yl)methanol | AG000JDZ | 3g |
| 1227599-27-0 | COC1=CC=C(Br)C(F)=N1 | 3-Bromo-2-fluoro-6-methoxypyridine | AG000JE0 | 300g |
| 1227599-26-9 | OCC1=NC=C(Cl)C=C1Br | (3-Bromo-5-chloropyridin-2-yl)methanol | AG000JE1 | 5g |
| 1227599-15-6 | OCc1cc(Br)ncc1Cl | (2-Bromo-5-chloropyridin-4-yl)methanol | AG000JE2 | 3g |
| 1227597-58-1 | OC1=NC(F)=C(Br)C=C1 | 5-Bromo-6-fluoropyridin-2-ol | AG000JE6 | 20g |
| 1227597-53-6 | FC1=C(Br)C=CN=C1F | 4-Bromo-2,3-difluoropyridine | AG000JE7 | 50g |
| 1227597-35-4 | O=CC1=C(F)N=CC(OC)=C1 | 2-Fluoro-5-methoxypyridine-3-carbaldehyde | AG000JE8 | 60g |
| 1227607-99-9 | O=C1NC=C(Br)C2=C1C=CC(F)=C2 | 4-Bromo-6-fluoroisoquinolin-1(2H)-one | AG000JEF | 20g |
| 1227606-71-4 | BrCc1nccc(c1)C(F)(F)F | 2-(Bromomethyl)-4-(trifluoromethyl)pyridine | AG000JEJ | 2g |
| 1227606-22-5 | FC(C1=CC(Cl)=CN=C1CCl)(F)F | 5-CHLORO-2-(CHLOROMETHYL)-3-(TRIFLUOROMETHYL)PYRIDINE | AG000JEM | 5g |
| 1227605-52-8 | O=CC1=C(Br)N=CC(Cl)=C1 | 2-broMo-5-chloronicotinaldehyde | AG000JEN | 50g |
| 122770-39-2 | OC1(C2=CC=C(F)C=C2)CCC2(OCCO2)CC1 | 8-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decan-8-ol | AG000JGE | 41.4g |
| 12277-88-2 | C1([Pt]C2=CC=CC=C2)=CC=CC=C1.C3=CCC/C=CCC/3 | (1,5-Cyclooctadiene)diphenylplatinum(II) | AG000JGF | 3g |
| 1227926-67-1 | CC(C)(C)OC(=O)N1CCCCC[C@@H]1C(O)=O | (R)-1-Boc-azepane-2-carboxylic acid | AG000JGH | 10g |
| 1227919-32-5 | C[C@H]1CNC[C@H](NC(=O)OC(C)(C)C)C1 | (3R,5R)-3-(Boc-amino)-5-methylpiperidine | AG000JGI | 0.1g |
| 1227918-15-1 | CC[C@@H]1CO[C@@H](CN1)CO | ((2S,5R)-5-Ethylmorpholin-2-yl)methanol | AG000JGJ | 10g |
| 1227917-63-6 | C[C@H]1CC[C@H](CN1)NC(OC(C)(C)C)=O | tert-Butyl ((3R,6S)-6-methylpiperidin-3-yl)carbamate | AG000JGK | 50g |
| 1227917-52-3 | CC([C@H]1NCCOC1)C.[H]Cl | (R)-3-Isopropylmorpholine hydrochloride | AG000JGL | 8g |
| 1227911-51-4 | CC1(C)C(C)(C)OB(C2=CC3=C(C=C2)C(C)=NN3)O1 | 3-Methylindazole-6-boronic acid pinacol ester | AG000JGM | 13g |
| 1227798-75-5 | COC1=CC=C([C@@H]2NCCC2)C=C1.[H]Cl | (R)-2-(4-Methoxyphenyl)pyrrolidine hydrochloride | AG000JGQ | 2g |
| 122779-41-3 | [O-][N+](=O)c1ccccc1[C@H](N)C | (1R)-1-(2-Nitrophenyl)ethylamine | AG000JGU | 2g |
| 122775-35-3 | OB(C1=CC=C(OC)C(OC)=C1)O | 3,4-Dimethoxyphenylboronic acid | AG000JH2 | 1500g |
| 1227962-62-0 | OC1=CC=CC=C1C(C2=C(N3C(C(C4=CC=CC=C4O)=O)=CC(Cl)=C3Cl)C(Cl)=C(Cl)N2)= | Marinopyrrole A | AG000JH5 | 0.006g |
| 1227958-63-5 | CC1=CC=NN1C2=CC=C(Br)C=C2 | 1-(4-broMophenyl)-5-Methyl-1H-pyrazole | AG000JH8 | 25g |
| 1227958-53-3 | NC1=C(C(Br)=NC=C1F)[N+]([O-])=O | 2-Bromo-5-fluoro-3-nitropyridin-4-amine | AG000JHB | 1g |
| 1227958-32-8 | O=C(OC(C)(C)C)NC1=CC=C(Cl)N=C1Br | tert-Butyl (2-bromo-6-chloropyridin-3-yl)carbamate | AG000JHD | 35g |
| 1227958-31-7 | Clc1nc(nc2c1ccn2C(=O)OC(C)(C)C)N1CCOCC1 | tert-Butyl 4-chloro-2-morpholino-7H-pyrrolo[2,3-d]pyrimidine-7-carboxylate | AG000JHE | 2g |
| 1228630-89-4 | O=C(N1CCC([N+]([O-])=O)CC1)OC(C)(C)C | TERT-BUTYL 4-NITROPIPERIDINE-1-CARBOXYLATE | AG000JMY | 150g |
| 1228600-25-6 | CC(C1CNCCO1)=O.[H]Cl | 1-(Morpholin-2-yl)ethanone hydrochloride | AG000JN3 | 1g |
| 122864-94-2 | OC([C@@H](N)CCC(NC(C=C1)=CC=C1[N+]([O-])=O)=O)=O.O | Gamma-l-glutamyl-4-nitroanilide | AG000JN4 | 125g |
| 122860-33-7 | C(=O)(OCc1ccccc1)N1CCC(CC1)CO | Benzyl 4-(hydroxymethyl)piperidine-1-carboxylate | AG000JNB | 1000g |
| 1228780-72-0 | CC1(C)CCC(CN2CCNCC2)=C(C3=CC=C(Cl)C=C3)C1 | 1-((4′-Chloro-5,5-dimethyl-3,4,5,6-tetrahydro-[1,1′-biphenyl]-2-yl)methyl)pip | AG000JND | 200g |
| 1228779-96-1 | O=S(C1=CC=C(NCC2CCOCC2)C([N+]([O-])=O)=C1)(N)=O | 3-NITRO-4-((TETRAHYDRO-2H-PYRAN-4-YL)METHYLAMINO)BENZENESULFONA | AG000JNE | 2500g |
| 1228765-06-7 | CC(OC(N1CC(CN)(F)CC1)=O)(C)C | Tert-Butyl 3-(Aminomethyl)-3-Fluoropyrrolidine-1-Carboxylate | AG000JNH | 10g |
| 1228765-03-4 | C(Br)C1(F)CN(CC1)C(=O)OC(C)(C)C | tert-Butyl 3-(bromomethyl)-3-fluoropyrrolidine-1-carboxylate | AG000JNI | 2g |
| 1228690-56-9 | CC(O)C1=CC=CC(F)=C1F | 1-(2,3-Difluorophenyl)ethanol | AG000JNL | 50g |
| 1228690-36-5 | Cc1c(c(on1)c2ccc(cc2)c3ccc(cc3)CC(=O)O)NC(=O)O[C@H](C)c4ccccc4 | [4′-[3-Methyl-4-[[[((R)-1-phenylethyl)oxy]carbonyl]amino]isoxazol-5-yl]biph | AG000JNM | 0.2g |
| 1228690-19-4 | O=C(O)CC1=CC=C(C2=CC=C(C3=C(NC(O[C@@H](C4=CC=CC=C4Cl)C)=O)C(C)=NO | (R)-2-(4′-(4-(((1-(2-Chlorophenyl)ethoxy)carbonyl)amino)-3-methylisoxazol- | AG000JNN | 2g |
| 1228666-56-5 | Brc1cnc2c(c1)nc([nH]c2=O)C | 7-Bromo-2-methylpyrido[3,2-d]pyrimidin-4-ol | AG000JNP | 2g |
| 1228666-41-8 | O=C(C1=C2C(NC=C2)=NC=C1F)O | 5-Fluoro-1H-pyrrolo[2,3-b]pyridine-4-carboxylic acid | AG000JNR | 1g |
| 1228666-28-1 | IC1=CC2=NC=CC=C2N=C1 | 3-Iodo-1,5-naphthyridine | AG000JNT | 2g |
| 1228666-03-2 | ClC=1C(Br)=CN=C(N)C1I | 5-Bromo-4-Chloro-3-Iodopyridin-2-Amine | AG000JNU | 5g |
| 1228665-94-8 | C(=O)(O)c1c2c(ncc1)OCCO2 | 2,3-Dihydro-[1,4]dioxino[2,3-b]pyridine-8-carboxylic acid | AG000JNW | 5g |
| 1228595-79-6 | C[Si]1(C)C2=CC(Br)=CC=C2C3=CC=C(Br)C=C31 | 3,7-Dibromo-5,5-dimethyl-5H-dibenzo[b,d]silole | AG000JLZ | 25g |
| 1228591-30-7 | O=C(C1CC1)NC2=NC3=CC=C(OC4=CC=C(F)C(NC(CC5=CC=CC(C(F)(F)F)=C5)=O)=C | N-[7-cyano-6-(4-fluoro-3-{2-[3-(trifluoromethyl)phenyl]acetamido}phenoxy) | AG000JM1 | 0.7g |
| 1228583-52-5 | Cl.C1NCC(C2=NNN=N2)C1 | 5-(Pyrrolidin-3-yl)-2h-tetrazole hcl | AG000JM2 | 0.5g |
| 1228581-13-2 | O=C(N1CC(CO)(C#N)C1)OC(C)(C)C | TERT-BUTYL 3-CYANO-3-(HYDROXYMETHYL)AZETIDINE-1-CARBOXYLATE | AG000JM3 | 25g |
| 1228571-53-6 | OC1=CC=C(Cl)C=C1[C@H](N)C | (R)-2-(1-Aminoethyl)-4-chlorophenol | AG000JM5 | 50g |
| 1228570-71-5 | N[C@H]1CCC2=C1C=CC=C2Br | (S)-4-Bromo-2，3-dihydro-1H-inden-1-amine | AG000JM6 | 5g |
| 1228569-01-4 | ClC1=CC=C(Cl)C([C@@H]2NCCC2)=C1 | (R)-2-(2,5-Dichlorophenyl)pyrrolidine | AG000JM8 | 0.25g |
| 1228566-94-6 | O=C(OC(C)(C)C)N[C@H](CC1)CNC1=O | (R)-tert-Butyl (6-oxopiperidin-3-yl)carbamate | AG000JM9 | 9g |
| 1228561-39-4 | OC(C[C@@H](C1=C(C(F)=CC=C1)F)N)=O | (βS)-β-Amino-2,3-difluorobenzenepropanoic acid | AG000JMA | 3g |
| 1228556-85-1 | BrC=1C=C2[C@H](CCOC2=CC1)N | (S)-6-Bromochroman-4-amine | AG000JMC | 5g |
| 1228556-71-5 | N[C@@H]1CCC2=C1C=CC=C2Br | (R)-4-Bromo-2，3-dihydro-1H-inden-1-amine | AG000JMD | 5g |
| 1228552-87-1 | CC(C1=CC2=CC=C(Br)C=C2N=C1)=O | 1-(7-BROMOQUINOLIN-3-YL)ETHANONE | AG000JMG | 5g |
| 1228552-85-9 | CCOC(C1C(N)=CN(C)N=1)=O | ETHYL 4-AMINO-1-METHYL-1H-PYRAZOLE-3-CARBOXYLATE | AG000JMH | 10g |
| 1228634-93-2 | OC(C1(CNCC1)F)=O | 3-FLUOROPYRROLIDINE-3-CARBOXYLIC ACID | AG000JMP | 25g |
| 1228631-69-3 | FC1(F)C2(CCN(C1)C(=O)OC(C)(C)C)CNC2 | 2,7-Diazaspiro[3.5]nonane-7-carboxylic acid, 5,5-difluoro-, 1,1-dimethylethyl | AG000JMR | 10g |
| 1228631-10-4 | O=C(N1CCC(CC(O)C(F)(F)F)CC1)OC(C)(C)C | TERT-BUTYL 4-(3,3,3-TRIFLUORO-2-HYDROXYPROPYL)PIPERIDINE-1-CARBOXYL | AG000JMX | 5g |
| 1228962-22-8 | CC1(C)C(=CCN(C1)C(=O)OC(C)(C)C)B1OC(C(O1)(C)C)(C)C | tert-Butyl 3,3-dimethyl-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,3,6-tetra | AG000JQ4 | 5g |
| 1228960-86-8 | CC(COC1=CC=NC=C1)(COC2=CC=NC=C2)COC3=CC=NC=C3 | 4,4′-((2-Methyl-2-((pyridin-4-yloxy)methyl)propane-1,3-diyl)bis(oxy))dipyrid | AG000JQ5 | 4g |
| 1228957-09-2 | CCOc1cc(Br)ccc1C(=O)N | 4-Bromo-2-ethoxybenzamide | AG000JQ9 | 3.9g |
| 1228957-07-0 | BrC1=CC=C(C(=C1OC)F)OCC1C=CC=CC=1 | 3-(Benzyloxy)-6-bromo-2-fluoroanisole | AG000JQB | 0.6g |
| 1228957-06-9 | COc1ccc(c(c1Cl)O)Br | 6-Bromo-2-chloro-3-methoxyphenol | AG000JQC | 4g |
| 1228957-05-8 | CCOC(=O)C(F)(F)C1=C(F)C=C(F)C=C1 | Ethyl 2-(2,4-difluorophenyl)-2,2-difluoroacetate | AG000JQD | 50g |
| 1228957-04-7 | O=C(C1=CC=CN1)NC(C)(C)C | N-t-Butyl pyrrole-2-carboxamide | AG000JQE | 3g |
| 1228957-03-6 | BrC1=CC(=C(C(=O)NC)C=C1)OC | 4-Bromo-2-methoxy-N-methylbenzamide | AG000JQF | 10g |
| 1228956-99-7 | CC(COc1cc(Br)cc(c1)C(=O)O)C | 3-Bromo-5-isobutoxybenzoic acid | AG000JQJ | 4.6g |
| 1228956-98-6 | C1=CC=C(C=C1)COC2C(F)=C(O)C(Br)=CC=2 | 3-(Benzyloxy)-6-bromo-2-fluorophenol | AG000JQK | 25g |
| 1228956-96-4 | CCCCOc1cc(Br)cc(c1)C(=O)O | 3-Bromo-5-butoxybenzoic acid | AG000JQL | 3g |
| 1228956-94-2 | O=Cc1cc(OCc2ccccc2)cc(c1)Cl | 3-(Benzyloxy)-5-chlorobenzaldehyde | AG000JQN | 2g |
| 1228956-93-1 | COc1ccc(c(c1Cl)OC)Br | 1-Bromo-3-chloro-2,4-dimethoxybenzene | AG000JQO | 2g |
| 1228947-14-5 | O[C@H]1CC[C@H](N2CCOCC2)CC1 | trans-4-(4-Morpholinyl)cyclohexanol | AG000JQP | 7g |
| 1229037-03-9 | FC1=CC=CC2=C1C(Cl)=CC=N2 | 4-Chloro-5-fluoroquinoline | AG000JQT | 5g |
| 1229025-32-4 | Cl.N([C@H](CN)C)C(=O)OC | (S)-Methyl (1-aminopropan-2-yl)carbamate hydrochloride | AG000JQV | 15g |
| 1229012-68-3 | ClC1=CC(C2=CC=CC=C2)=C(C=CC3=C(C4=CC=CC=C4)C=C(Cl)N=C53)C5=N1 | 2,9-Dichloro-4,7-diphenyl-1,10-phenanthroline | AG000JQW | 30g |
| 1229006-21-6 | O=C(C1=C(OCC2=CC=CC=C2)C(C(C(NCC3=CC=C(F)C=C3F)=O)=CN1CC(OC)OC)=O) | Methyl 3-(benzyloxy)-5-((2,4-difluorobenzyl)carbamoyl)-1-(2,2-dimethoxyet | AG000JQZ | 3g |
| 1229000-10-5 | [NH]1C3=C(N=C1C2CCCN(C2)C(=O)OC(C)(C)C)C=CC=C3 | 2-(N-Boc-piperidin-3-yl)-1H-benzoimidazole | AG000JR0 | 20g |
| 1229-35-2 | Cl.S1C2=C(C=CC=C2)N(CC2CCN(C)C2)C2=C1C=CC=C2 | 10-((1-Methylpyrrolidin-3-yl)methyl)-10H-phenothiazine hydrochloride | AG000JRC | 0.005g |
| 1229-29-4 | CN(C)CC/C=C1C2=C(C=CC=C2)COC3=C/1C=CC=C3.Cl | dimethyl({3-[(2E)-9-oxatricyclo[9.4.0.0^{3,8}]pentadeca-1(11),3(8),4,6,12,14-h | AG000JRE | 75g |
| 1229-24-9 | C[C@]12CC[C@H]3[C@@H](C[C@H](O)c4cc(O)ccc34)[C@@H]1CC[C@@H]2O | 6a-Hydroxy 17b-Estradiol | AG000JRF | 0.005g |
| 1229208-44-9 | C12=NC=CN1C=C(C3=CC4=C(C=C3)C=NN4)N=C2NC5=CC=C(N6CCOCC6)C=C5 | GS-9973 | AG000JRH | 1g |
| 1229194-11-9 | O=C(NC1=NC=C(Cl)C=C1)C(N[C@@H]2[C@H](NC(C(S3)=NC4=C3CN(C)CC4)=O)C | Edoxaban Tosylate Hydrate | AG000JRI | 15g |
| 122918-25-6 | N#CC1=NC(Br)=CC=C1 | 6-Bromo-2-Pyridinecarbonitrile | AG000JRN | 100g |
| 1229383-37-2 | NC1=CC2=NC=CN2C=N1 | IMIDAZO[1,2-C]PYRIMIDIN-7-AMINE | AG000JS5 | 0.5g |
| 1229383-25-8 | NC1=NOC2=C1C=NC=C2 | Isoxazolo[4,5-c]pyridin-3-amine | AG000JS6 | 2g |
| 1229381-08-1 | O=C(O)[C@@H](C1=CC=CC=C1)CC(OC(C)(C)C)=O | (R)-4-(tert-Butoxy)-4-oxo-2-phenylbutanoic acid | AG000JS7 | 2g |
| 1229337-32-9 | CC(C)(C)[C@H](NC(=O)NC1(CS(=O)(=O)C(C)(C)C)CCCCC1)C(=O)N1C[C@H]2[C@ | (1R,2S,5S)-3-((S)-2-(3-(1-(tert-butylsulfonylMethyl)cyclohexyl)ureido)-3,3-di | AG000JS8 | 7.7g |
| 1229311-50-5 | O=C(OC)C(CC(C)C)(CC(C)C)C(OC)=O | Dimethyl 2,2-diisobutylmalonate | AG000JSB | 25g |
| 1229236-86-5 | CC1=CC(NC2=NN3C(C(CN4CCOCC4)=C2)=NC(C)=C3CC5=CC=C(Cl)C=C5F)=NN1 | Gandotinib | AG000JSD | 0.05g |
| 1229224-93-4 | FC(C1=CC(CCCN[C@@H](C2=C3CCCCC3=CC=C2)C)=CC=C1)(F)F | (R)-N-[1-(5,6,7,8-Tetrahydronaphthalen-1-yl)ethyl]-3-[3-(trifluoromethyl)ph | AG000JSG | 1.5g |
| 122929-08-2 | O=C1CC[C@H](N1)C(=O)N[C@@H]([C@H](O)C)C(=O)N[C@@H](CC1=CC=CC=C1 | 5-Oxo-L-prolyl-L-threonyl-L-phenylalanyl-L-glutaminyl-L-tyrosyl-L-seryl-L-arg | AG000JSN | 0.015g |
| 122927-84-8 | OC1=CC=C(I)C(F)=C1 | 3-Fluoro-4-iodophenol | AG000JSO | 50g |
| 38101-59-6 | OC([C@H](CC1=CNC2=C1C=CC=C2)NC([C@H](CCC(O)=O)N)=O)=O | H-GLU-TRP-OH | AG000JSR | 5g |
| 1229455-14-4 | CC(OC(N1CC2=C(N=CNC2=O)C1)=O)(C)C | tert-Butyl 4-oxo-5,7-dihydro-3h-pyrrolo[3,4-d]pyrimidine-6(4h)-carboxylate | AG000JSU | 10g |
| 1231709-23-1 | CC(C)C[C@@](C)(NC(OCC1C2=C(C3=C1C=CC=C3)C=CC=C2)=O)C(O)=O | (R)-N-Fmoc-alpha-methylleucine | AG000K3M | 5g |
| 1231709-22-0 | CC[C@@](C)(NC(OCC1C2=C(C3=C1C=CC=C3)C=CC=C2)=O)C(O)=O | (R)-2-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-2-methylbutanoic acid | AG000K3N | 25g |
| 123171-59-5 | C(=O)(O)C1=C(C[N+]2(C)CCCC2)CS[C@H]2N1C(=O)[C@H]2NC(=O)/C(=NOC)/c1c | Pyrrolidinium, 1-[[(6R,7R)-7-[[(2Z)-2-(2-amino-4-thiazolyl)-2-(methoxyimino) | AG000K3S | 700g |
| 1231892-74-2 | O=C1NCCC2=C1C=C(B3OC(C)(C)C(C)(C)O3)C=C2 | 7-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydroisoquinolin-1(2H) | AG000K4A | 5g |
| 1231892-37-7 | N#CC1=CC=CC(B2OC(C)(C)C(C)(C)O2)=C1C | 2-Methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile | AG000K4B | 10g |
| 1231761-14-0 | COC1=C2C(Cl)=CC=NC2=CC=C1 | 4-Chloro-5-methoxyquinoline | AG000K4E | 1.25g |
| 1231761-02-6 | N#Cc1cccc2ncncc12 | 5-CYANOQUINAZOLINE | AG000K4I | 0.5g |
| 123191-00-4 | CC([Si](N1C=CC2=C1C=CC=C2)(C(C)C)C(C)C)C | 1-(Triisopropylsilyl)-1H-indole | AG000K4J | 10g |
| 123173-60-4 | OC1=C(F)C(F)=C([N+]([O-])=O)C=C1 | 2,3-Difluoro-4-nitrophenol | AG000K4V | 10g |
| 1231943-08-0 | CN1N=CC(C2=CN=C(Cl)N=C2)=C1 | 2-Chloro-5-(1-methyl-1h-pyrazol-4-yl)pyrimidine | AG000K52 | 0.5g |
| 1231934-40-9 | C1(=CC=CC2=CC=NN12)B(O)O | Pyrazolo[1,5-a]pyridin-7-ylboronic acid | AG000K53 | 0.5g |
| 1231930-82-7 | CC1=NC2=C(F)C=C(C3=NC(NC4=NC=C(CN5CCN(CC)CC5)C=C4)=NC=C3F)C=C2N1C | 2-Pyrimidinamine, N-[5-[(4-ethyl-1-piperazinyl)methyl]-2-pyridinyl]-5-fluoro | AG000K54 | 25g |
| 1231930-42-9 | CC1=NC2=C(F)C=C(C3=NC(Cl)=NC=C3F)C=C2N1C(C)C | 6-(2-Chloro-5-fluoropyrimidin-4-yl)-4-fluoro-1-isopropyl-2-methyl-1H-benzo | AG000K55 | 200g |
| 1231930-37-2 | CC1(C)C(C)(C)OB(C2=CC(F)=C3C(N(C(C)C)C(C)=N3)=C2)O1 | 1H-Benzimidazole, 4-fluoro-2-methyl-1-(1-methylethyl)-6-(4,4,5,5-tetrameth | AG000K56 | 40.64g |
| 1231930-33-8 | CC2=NC1=C(F)C=C(Br)C=C1N2C(C)C | 6-Bromo-4-fluoro-1-isopropyl-2-methyl-1H-benzo[d]imidazole | AG000K57 | 1000g |
| 1231930-25-8 | CCN1CCN(CC2=CC=C(Br)N=C2)CC1 | 1-((6-Bromopyridin-3-yl)methyl)-4-ethylpiperazine | AG000K58 | 300g |
| 1231930-13-4 | O=[N+](C1=CC=C(Br)C(C)=N1)[O-] | 3-Bromo-2-methyl-6-nitropyridine | AG000K59 | 50g |
| 1231929-97-7 | CC1=NC2=C(F)C=C(C3=NC(NC4=NC=C(CN5CCN(CC)CC5)C=C4)=NC=C3F)C=C2N1C | N-{5-[(4-ethylpiperazin-1-yl)methyl]pyridin-2-yl}-5-fluoro-4-(7-fluoro-3-isop | AG000K5A | 19g |
| 123237-62-7 | C[Si](OC[C@@H]1CO1)(C(C)(C)C)C | (S)-Glycidoxy-t-butyldimethylsilane | AG000K74 | 125g |
| 1232432-20-0 | O=CC1=C(F)N=CC=C1Cl | 4-Chloro-2-fluoronicotinaldehyde | AG000K7Q | 150g |
| 1232432-08-4 | NC1=NC=C([N+]([O-])=O)C=C1F | 3-Fluoro-5-nitropyridin-2-amine | AG000K7R | 10g |
| 1232431-81-0 | NC1=CC=CN2C1=NC=C2Br | 3-Bromoimidazo[1,2-a]pyridin-8-amine | AG000K7S | 15g |
| 1232431-75-2 | NC1=NC=CC(Br)=C1N | 2,3-Diamino-4-bromopyridine | AG000K7T | 25g |
| 1232431-48-9 | COC1=NC=C(Br)C(N)=C1 | 4-Amino-5-bromo-2-methoxypyridine | AG000K7U | 50g |
| 1232431-41-2 | NC1=NC(F)=CC=C1Br | 2-Amino-3-bromo-6-fluoropyridine | AG000K7V | 25g |
| 1232431-11-6 | NC1=NC=C(Br)C(OC)=C1 | 5-Bromo-4-methoxypyridin-2-amine | AG000K7W | 500g |
| 1232430-97-5 | NC1=CC(F)=NC=C1Br | 4-Amino-5-bromo-2-fluoropyridine | AG000K7X | 2g |
| 1232424-44-0 | C(=O)(OC)c1cc(C#N)c(cc1)Br | Benzoic acid, 4-bromo-3-cyano-, methyl ester | AG000K7Y | 10g |
| 1232423-55-0 | CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)C1=NC=C(Br)N=C1C#C | Ditert-butyl 5-bromo-3-ethynylpyrazin-2-ylcarbamate | AG000K7Z | 10g |
| 1232416-25-9 | Nc1c(nc(cn1)c1ccc(cc1)S(=O)(=O)C(C)C)c1cc(no1)c1ccc(cc1)CNC | 2-Pyrazinamine, 3-[3-[4-[(methylamino)methyl]phenyl]-5-isoxazolyl]-5-[4-[( | AG000K80 | 1.5g |
| 1232410-49-9 | O=C(C1=NC(C2=CC=C(S(=O)(C)=O)C=C2)=CN=C1N)NC3=CC=CC=C3 | 3-Amino-6-(4-methanesulfonylphenyl)-N-phenylpyrazine-2-carboxamide | AG000K81 | 1g |
| 1232407-68-9 | CC(O)C1=C(F)C=CC=C1Br | 1-(2-bromo-6-fluorophenyl)ethanol | AG000K82 | 20g |
| 1232407-29-2 | ClC1=C(Br)C(CO)=CC=C1 | 2-Bromo-3-chlorobenzyl alcohol | AG000K83 | 7g |
| 1232407-25-8 | Brc1ccc(c(c1N)F)C | Benzenamine, 6-bromo-2-fluoro-3-methyl- | AG000K84 | 10g |
| 123240-66-4 | O=CNC1=C(Cl)N=CN=C1Cl | N-(4,6-Dichloropyrimidin-5-yl)formamide | AG000K8A | 10g |
| 123257-07-8 | O=C(C1=CC=CN1CC#N)OC | Methyl 1-(cyanomethyl)-1H-pyrrole-2-carboxylate | AG000K8K | 0.75g |
| 123254-58-0 | CC[C@@](C)(NC(OC(C)(C)C)=O)C(O)=O | (R)-2-((tert-Butoxycarbonyl)amino)-2-methylbutanoic acid | AG000K8M | 50g |
| 123-96-6 | CC(O)CCCCCC | Octan-2-ol | AG000JXK | 4000g |
| 123-95-5 | CCCCCCCCCCCCCCCCCC(OCCCC)=O | Butyl octadecanoate | AG000JXL | 3000g |
| 123-93-3 | O=C(O)CSCC(O)=O | Thiodiglycolic acid | AG000JXM | 20000g |
| 123-90-0 | C1CSCCN1 | Thiomorpholine | AG000JXP | 400g |
| 123-84-2 | CC(CNCCN)O | N-(2-Hydroxypropyl)ethylenediamine | AG000JXS | 175g |
| 123-79-5 | CCCCCCCCOC(=O)CCCCC(=O)OCCCCCCCC | Hexanedioic acid,1,6-dioctyl ester | AG000JXV | 32g |
| 123-78-4 | N[C@@H](CO)[C@@H](\C=C\CCCCCCCCCCCCC)O | (2S,3R,4E)-2-Amino-4-octadecene-1,3-diol | AG000JXW | 3.46g |
| 123-76-2 | C(C(C)=O)CC(O)=O | 4-Oxopentanoic acid | AG000JXX | 500g |
| 123013-13-8 | COC1=CC(C(C)(C)C)=C(O)C(C=O)=C1 | Benzaldehyde, 3-(1,1-dimethylethyl)-2-hydroxy-5-methoxy- | AG000JY5 | 0.2g |
| 123004-74-0 | CC(C)(C)OC([C@@H](CCBr)NC(OC(C)(C)C)=O)=O | (R)-4-Bromo-2-[[(tert-butoxy)carbonyl]amino]butanoic acid tert-butyl ester | AG000JYC | 10g |
| 123020-20-2 | IC1=CC(Br)=CC2=C1NC=C2 | 5-Bromo-7-iodo-1H-indole | AG000JZ2 | 2g |
| 123019-95-4 | O=C(Nc1ccccc1Br)CC(=O)O | Propanoic acid, 3-[(2-bromophenyl)amino]-3-oxo- | AG000JZ4 | 5g |
| 123043-54-9 | C=C([C@H]([C@@H](O)[C@@H]1OC(C)=O)C2)C([C@@]32[C@@H](OC(C)=O)C[ | Bulleyanin | AG000JZH | 0.005g |
| 123040-79-9 | CN1C(=O)COC2=C(C=C(Cl)C=C12)C(O)=O | 6-Chloro-3,4-dihydro-4-methyl-3-oxo-2H-1,4-benzoxanine-8-carboxylic acid | AG000JZL | 15g |
| 123040-16-4 | O=C(C1=C(OCC(N2C)=O)C2=CC(Cl)=C1)NC3C4CCN(CC4)C3.Cl | Azasetron (hydrochloride) | AG000JZQ | 2g |
| 123039-72-5 | O=C(O)C1=CC(OC)=C(N)C(OC)=C1 | 4-AMINO-3,5-DIMETHOXYBENZOIC ACID | AG000JZS | 25g |
| 122806-10-4 | O=C(OCC)C(N1CCCCC1)CC2=CC=CC=C2 | Ethyl 3-phenyl-2-(piperidin-1-yl)propanoate | AG000JJ4 | 3g |
| 1228185-45-2 | O=C(N1C[C@H](F)[C@@H](N)CC1)OC(C)(C)C | (3S,4S)-tert-Butyl 4-amino-3-fluoropiperidine-1-carboxylate | AG000JJ9 | 100g |
| 1228185-09-8 | CC(C1=C([N+]2=C(Cl)N(C3=C(C(C)C)C=CC=C3C(C)C)C=C2)C(C(C)C)=CC=C1)C.[Cl-] | 2-Chloro-1,3-bis(2,6-diisopropylphenyl)-1H-imidazol-3-ium chloride | AG000JJA | 30g |
| 1228183-72-9 | O=C(N1C=C(I)C2=CC(C(F)(F)F)=CN=C21)OC(C)(C)C | tert-Butyl 3-iodo-5-(trifluoromethyl)-1h-pyrrolo[2,3-b]pyridine-1-carboxylate | AG000JJC | 5g |
| 1228183-22-9 | OB(C1=CC=C2NC=NC2=C1)O | 1H-Benzimidazole-5-boronic acid | AG000JJE | 50g |
| 1228180-82-2 | OB(C1=CC=C(OCC2=NC=CC=C2)C=C1)O | 4-(Pyridin-2-ylmethoxy)phenylboronic acid | AG000JJL | 4g |
| 1228376-68-8 | N#CC1=CC(F)=C(N)C=C1Cl | 4-amino-2-chloro-5-fluorobenzonitrile | AG000JJX | 20g |
| 1228360-09-5 | CCOC(=O)[C@@H]1CC[C@@H]([C@H](C1)F)O | Cyclohexanecarboxylic acid, 3-fluoro-4-hydroxy-, ethyl ester, (1R,3S,4S)-rel- | AG000JJZ | 0.5g |
| 1228230-82-7 | COCC1CNC1.O=C(O)C(F)(F)F | 3-(Methoxymethyl)azetidine 2,2,2-trifluoroacetate | AG000JK3 | 1g |
| 122839-52-5 | N[C@H](CC1=CC=C(F)C=C1)C(O)=O.[H]Cl | 4-Fluoro-d-phenylalanine hydrochloride | AG000JK5 | 250g |
| 122833-60-7 | FC(S(=O)(=O)N[C@@H]1CCCC[C@H]1NS(=O)(=O)C(F)(F)F)(F)F | Methanesulfonamide, N,N’-(1R,2R)-1,2-cyclohexanediylbis[1,1,1-trifluoro- | AG000JKD | 3g |
| 1234356-69-4 | Fc1c(cccc1)[C@H]1c2c(c3c(C1)cnc(n3)Nc1cc(CCNCCOC)ccc1)cccc2 | Derazantinib | AG000KK9 | 1.25g |
| 1234321-83-5 | COC(=O)C[C@@H](Cc1cc(F)c(cc1F)F)NC(=O)C | (R)-Methyl 3-acetamido-4-(2,4,5-trifluorophenyl)butanoate | AG000KKB | 3g |
| 1234319-14-2 | CC1(C)C(C)(C)OB(C2=CC=C(C(F)F)C=C2)O1 | 2-(4-(DifluoroMethyl)phenyl)-4,4,5,5-tetraMethyl-1,3,2-dioxaborolane | AG000KKD | 10g |
| 123433-20-5 | C1=CC(=C(C(=C1Br)O)O)Br | 3,6-Dibromo-1,2-benzenediol | AG000KKO | 3g |
| 1234490-83-5 | C[C@]1([C@@H]([C@H](O[C@@]1([H])N1C=NC2=C(N=C(N=C12)N)OC)COP(=O) | Inx-08189 | AG000KKW | 0.05g |
| 1234480-50-2 | O=C1C2=CC=CC=C2N(C)C3=NC(NC4=CC=C(N5CCC(O)CC5)C=C4OCC)=NC=C3N1C | XMD8-92 | AG000KKX | 0.1g |
| 1234480-46-6 | O=C1C2=CC=CC=C2N(C)C3=NC(NC4=CC=C(N5CCN(C)CC5)C=C4OC)=NC=C3N1 | XMD8-87 | AG000KKY | 0.5g |
| 1234474-58-8 | C(C(=O)OC)[C@@H]1c2c(OC1)cc(cc2)O | 3-Benzofuranacetic acid, 2,3-dihydro-6-hydroxy-, methyl ester, (3R)- | AG000KKZ | 15g |
| 123447-62-1 | O=C(C1=C(SC2C)N2C3=C(C=C(F)C(N4CCN(CC5=C(C)OC(O5)=O)CC4)=C3)C1=O)O | Prulifloxacin | AG000KL9 | 50g |
| 123441-03-2 | O=C(OC1=CC=CC([C@@H](N(C)C)C)=C1)N(CC)C | 3-[(1S)-1-(dimethylamino)ethyl]phenyl N-ethyl-N-methylcarbamate | AG000KLF | 10g |
| 123440-34-6 | O=CC1=CC(OCCCCCCCC)=C(C=C1OCCCCCCCC)C=O | 2,5-Bis(Octyloxy)Terephthalaldehyde | AG000KLG | 10g |
| 1234616-01-3 | COC(=O)c1c[nH]c2ncc(N)cc12 | METHYL 5-AMINO-7-AZAINDOLE-3-CARBOXYLATE | AG000KLK | 1g |
| 1234615-97-4 | CCOC(=O)c1cc2c(s1)ncc(c2)Br | Ethyl 5-bromothieno[2,3-b]pyridine-2-carboxylate | AG000KLM | 8g |
| 1234615-95-2 | N=1N=CN2C1C=CC=C2C(=O)O | [1,2,4]triazolo[4,3-a]pyridine-5-carboxylic acid | AG000KLN | 10g |
| 1234615-94-1 | CCN1C(=O)C2=C(C=C(C=C2)N)C1 | 5-Amino-2,3-dihydro-2-ethyl-1H-isoindol-1-one | AG000KLO | 25g |
| 1234615-81-6 | COC(=O)C1=CNC2=NC(Cl)=CC=C12 | Methyl 6-chloro-7-azaindole-3-carboxylate | AG000KLQ | 40g |
| 1234615-80-5 | CCOC(=O)Cc1ccc(I)cn1 | ethyl 2-(5-iodopyridin-2-yl)acetate | AG000KLR | 1g |
| 1234615-78-1 | COC(=O)c1c[nH]c2ncc(I)cc12 | methyl 5-iodo-1H-pyrrolo[2,3-b]pyridine-3-carboxylate | AG000KLS | 10g |
| 1234615-76-9 | O=C(C1=CNC2=NC=NC=C21)OC | Methyl 7H-pyrrolo[2,3-d]pyrimidine-5-carboxylate | AG000KLT | 100g |
| 1234615-75-8 | O=C(C1=CC=CC2=CN(C)N=C12)O | 2-Methylindazole-7-carboxylic acid | AG000KLU | 10g |
| 12325-31-4 | O[Pt-2](O)(O)(O)(O)O.[Na+].[Na+] | Sodium hexahydroxyplatinate(IV) | AG000K92 | 5g |
| 123280-64-8 | CC1=NC(Cl)=CC=C1Cl | 3,6-Dichloropicoline | AG000K9D | 30g |
| 123278-07-9 | O=C(O)C1=C(C)C=CC(Br)=C1C | 3-Bromo-2,6-dimethylbenzoic acid | AG000K9I | 55g |
| 123278-03-5 | O=C(O)C1=CC=CC(Cl)=C1I | 3-Chloro-2-Iodobenzoic Acid | AG000K9J | 200g |
| 123266-59-1 | BrC1=CC(Br)=C2OCCC2=C1 | 5,7-Dibromo-2,3-dihydrobenzofuran | AG000K9S | 200g |
| 123297-88-1 | O=CC1=CC=C2C=COC2=C1 | Benzofuran-6-carbaldehyde | AG000K9U | 15g |
| 123296-71-9 | O=C(C1=C2NCCOC2=CC=C1)O | 3,4-Dihydro-2H-benzo[b][1,4]oxazine-5-carboxylic acid | AG000K9X | 0.5g |
| 123293-78-7 | N1=CC=C(C=C1)/C=C/C(=O)OCC | (E)-Ethyl 3-(pyridin-4-yl)acrylate | AG000KA1 | 20g |
| 123291-97-4 | CCOC1=C(C=C(C)C=C1)B(O)O | 2-Ethoxy-5-methylphenylboronic acid | AG000KA9 | 175g |
| 123291-54-3 | C12=CN=NN1CCNC2 | 4,5,6,7-TETRAHYDRO-[1,2,3]TRIAZOLO[1,5-A]PYRAZINE | AG000KAA | 10g |
| 1233055-24-7 | O=C(O)/C=C/C1=CC=C(Br)C=C1Cl | 3-(4-Bromo-2-chlorophenyl)acrylic acid | AG000KAJ | 75g |
| 1233026-52-2 | OC1=CC=C(Br)C(F)=C1Cl | 4-Bromo-2-chloro-3-fluorophenol | AG000KAO | 250g |
| 1233026-31-7 | O=S(C1=NC(Cl)=NC=C1)(C)=O | 2-Chloro-4-(methylsulfonyl)pyrimidine | AG000KAQ | 8g |
| 1233025-78-9 | ClC1=NC=CC2=C1C(Br)=CC=C2 | 8-Bromo-1-chloroisoquinoline | AG000KAU | 20g |
| 1233143-48-0 | OC(=O)C(O)=O.C1NCC11CSC1.C1NCC11CSC1 | 2-Thia-6-azaspiro[3.3]heptane, ethanedioate (2:1) | AG000KB7 | 15g |
| 1233094-95-5 | CSc1ncc2ccc(Br)n2n1 | 7-Bromo-2-(methylthio)pyrrolo[2,1-f][1,2,4]triazine | AG000KB8 | 5g |
| 123312-76-5 | N=1N(N=CC1)N | 2H-1,2,3-Triazol-2-amine | AG000KBN | 0.5g |
| 123330-92-7 | COC1=C(N)C=CC(=C1)C(=O)OC(C)(C)C | tert-Butyl 4-amino-3-methoxybenzoate | AG000KCY | 1.75g |
| 1233339-22-4 | N1C=CC2=C(C=CC=C12)C1=NC(=CC(=N1)N1[C@@H](COCC1)C)C1(CC1)S(=O)(=O) | (R)-4-(2-(1H-Indol-4-yl)-6-(1-(methylsulfonyl)cyclopropyl)pyrimidin-4-yl)-3- | AG000KDB | 0.2g |
| 1233335-84-6 | C(C1=CC=CC=C1)(=O)OC[C@H]1O[C@H]([C@]([C@@H]1OC(C1=CC=CC=C1)=O)( | ((2R,3R,4R,5S)-3-(Benzoyloxy)-5-bromo-4-fluoro-4-methyltetrahydrofuran-2- | AG000KDC | 1g |
| 123333-92-6 | NNC1=CC=CC(C)=C1C.[H]Cl.[H]O[H] | (2,3-Dimethylphenyl)hydrazine hydrochloride xhydrate | AG000KDK | 75g |
| 123333-91-5 | N#[N+]C1=CC=C(Cl)C=C1Cl.O=S(=O)([O-])C=1C=CC=C2C1C=CC=C2S(=O)(=O)O.O | 1,5-Naphthalenedisulfonic acid, ion(1-), 2,4-dichlorobenzenediazonium, dihy | AG000KDL | 50g |
| 123333-88-0 | O.FC(C(=O)[O-])(F)F.[Cu+2].FC(C(=O)[O-])(F)F | Copper(II) 2,2,2-trifluoroacetate hydrate | AG000KDM | 1500g |
| 123333-71-1 | O=C(O)C(N)CC1=CNC=N1.[H]Cl.[H]O[H] | Dl-histidine monohydrochloride | AG000KDT | 1000g |
| 123333-70-0 | O.[Na+].Nc1ccc(cc1)S([O-])(=O)=O | Sodium sulfanilate hydrate | AG000KDU | 1500g |
| 123333-68-6 | [H]O[H].OC(=O)C1=CC=CC=C1S(O)(=O)=O | 2-Sulfobenzoic acid trihydrate | AG000KDW | 175g |
| 1233369-41-9 | S=C(N[C@H]([C@@H](N(C)C)C1=CC=CC=C1)C2=CC=CC=C2)NC3=CC(C(F)(F)F)=CC | 1-(3,5-Bis(trifluoromethyl)phenyl)-3-((1S,2S)-2-(dimethylamino)-1,2-dipheny | AG000KE0 | 2g |
| 1233369-39-5 | S=C(NC1=CC(C(F)(F)F)=CC(C(F)(F)F)=C1)N[C@H]2CCCC[C@@H]2N(CC3=CC=CC= | N-[(1S,2S)-2-[Bis(phenylmethyl)amino]cyclohexyl]-N’-[3,5-bis(trifluorometh | AG000KE1 | 0.5g |
| 123342-03-0 | O=C(C1=C(OC)C(Br)=C(C)S1)OC | Methyl 4-bromo-3-methoxy-5-methylthiophene-2-carboxylate | AG000KE2 | 9g |
| 123334-59-8 | O=C(OC(C)(C)C)NC(C(=O)O)Cc1cccc(c1)OCc1ccccc1 | Phenylalanine, N-[(1,1-dimethylethoxy)carbonyl]-3-(phenylmethoxy)- | AG000KEA | 10g |
| 123334-16-7 | O=C1C(O)=C(O)C(C(O)=C1O)=O.[H]O[H] | 2,3,5,6-Tetrahydroxycyclohexa-2,5-diene-1,4-dione hydrate | AG000KEH | 25g |
| 123334-05-4 | CC1=CC=C(S(=O)([O-])=O)C=C1.CC2=CC=C(S(=O)([O-])=O)C=C2.[H]O[H].[Zn+2] | Zinc p-toluenesulfonate xhydrate | AG000KEL | 2500g |
| 1233501-65-9 | Cl.CCOC(=O)[C@H]1CN(C[C@H]1N)C(=O)OC(C)(C)C | Cis-1-tert-butyl 3-ethyl 4-aminopyrrolidine-1,3-dicarboxylate, HCl | AG000KEO | 26g |
| 1233495-02-7 | CC(C)(OC1=CC=C(C[C@@H](NC(OCC2C3=CC=CC=C3C4=CC=CC=C42)=O)CC(O)=O) | (R)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-(4-(tert-butoxy)phenyl | AG000KEQ | 45g |
| 1233479-42-9 | BrCC1=C(C=CC=C1Br)C#N | 3-Bromo-2-(bromomethyl)benzonitrile | AG000KER | 10g |
| 123348-27-6 | IC1=CC2=C(C=C1)C3=C(C=C(Br)C=C3)C2 | 2-Bromo-7-iodo-9H-fluorene | AG000KEY | 3000g |
| 123344-02-5 | NC1=CC([N+]([O-])=O)=C(F)C=C1F | 2,4-Difluoro-5-nitroaniline | AG000KF2 | 100g |
| 123343-99-7 | CS(=O)(=O)NC1=C(C=CC(=C1)[N+](=O)[O-])F | N-(2-Fluoro-5-nitrophenyl)methanesulfonamide | AG000KF3 | 1g |
| 1233542-00-1 | CN1C=NC2=CC=CC(Br)=C12 | 7-Bromo-1-methylbenzodiazole | AG000KFD | 40g |
| 1233526-60-7 | CC1(C)C(C)(C)OB(C2=CN(C3CCCC3)N=C2)O1 | 1-Cyclopentyl-1H-pyrazole-4-boronic acid, pinacol ester | AG000KFE | 10g |
| 1233526-47-0 | CC1(C(C)(C)OB(C2=CN(CC3CCC3)N=C2)O1)C | 1-(Cyclobutylmethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1h-pyr | AG000KFF | 10g |
| 1233526-31-2 | CC1(C(C)(C)OB(C2=CN(C3CS(=O)(=O)CC3)N=C2)O1)C | 1-(Tetrahydro-1,1-dioxido-3-thienyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborol | AG000KFG | 5g |
| 1233518-21-2 | Cl.NC1=C2C=CNC2=NC=N1 | 4-amino-7h-pyrrolo[2,3-d]pyrimidine hcl | AG000KFH | 25g |
| 1233513-31-9 | CO[Si](C)(CCCC1=CC=CC=C1)OC | dimethoxy(methyl)(3-phenylpropyl)silane | AG000KFI | 20g |
| 1233513-16-0 | NNCC1=CN=C(Cl)C=C1.[H]Cl | 2-Chloro-5-(hydrazinylmethyl)pyridine hydrochloride | AG000KFJ | 0.75g |
| 1233513-02-4 | CNC1=CC=C(Br)C(F)=C1 | 4-BroMo-3-fluoro-N-Methylaniline | AG000KFK | 15g |
| 123036-51-1 | O=C(O)CC1=CC=CC(NC(OC(C)(C)C)=O)=C1 | 3-tert-Butoxy carbonylaminophenyl acetic acid | AG000JZW | 150g |
| 123027-99-6 | BrC1=C(C=C(C=C1)OC)NC(C)=O | N-(2-Bromo-5-Methoxyphenyl)Acetamide | AG000K02 | 500g |
| 123056-60-0 | CC(=O)OC1(CC1)C(=O)O | 1-Acetoxycyclopropanecarboxylic acid | AG000K0F | 15g |
| 123053-48-5 | O=C([C@]1(C)NCCC1)O.[H]Cl | (R)-2-Methylpyrrolidine-2-carboxylic acid hydrochloride | AG000K0H | 2000g |
| 123053-23-6 | Cl.N[C@@H](Cc1ccc(Cl)cc1)C(=O)O | 4-Chloro-l-phenylalanine HCl | AG000K0J | 25g |
| 123053-22-5 | O=C([C@H](CC1C=C(Cl)C=CC=1)N)O.[H]Cl | (S)-2-Amino-3-(3-chlorophenyl)propanoic acid hydrochloride | AG000K0K | 1g |
| 123088-59-5 | C1=C(C=CC(=C1)B(O)O)C(=O)N | 4-Aminocarbonylphenylboronic acid | AG000K15 | 100g |
| 123066-64-8 | FC(C1=N[N](C(=C1)C(F)(F)F)C2=CC=C(C=C2)N)(F)F | 4-(3,5-Bis(trifluoromethyl)-1H-pyrazol-1-yl)phenylamine | AG000K1C | 2g |
| 1231160-83-0 | O=C1C2=C(Br)SC(Br)=C2C(N1CC(CC)CCCC)=O | 1,3-Dibromo-5-(2-ethylhexyl)-4H-thieno[3,4-c]pyrrole-4,6(5H)-dione | AG000K1I | 10g |
| 1231160-82-9 | O=C1C2=CSC=C2C(N1CC(CC)CCCC)=O | 5-(2-Ethylhexyl)-4H-thieno[3,4-c]pyrrole-4,6(5H)-dione | AG000K1J | 20g |
| 1231-75-0 | O=C([C@]1(C)CCC[C@]2(C)C3=C(CC[C@]12[H])C=C(C(C)C)C=C3)O | (1R,4aS,10aS)-7-Isopropyl-1,4a-dimethyl-1,2,3,4,4a,9,10,10a-octahydrophena | AG000K26 | 0.02g |
| 123148-78-7 | ClC1=NC=NC2=C1C(=C[NH]2)I | 4-Chloro-5-iodo-1h-pyrrolo[2,3-d]pyrimidine | AG000K29 | 2000g |
| 123148-66-3 | OCC1=CC(OC)=NC=C1 | (2-Methoxypyridin-4-yl)methanol | AG000K2A | 75g |
| 123131-67-9 | C(C(=O)O)C1C(C1)(F)F | 2,2-Difluorocyclopropaneacetic acid | AG000K2I | 10g |
| 123126-40-9 | C(CCCCCCCCCCC)OC=1C=C(C(=O)O)C=C(C1)OCCCCCCCCCCCC | 3,5-Bis(dodecyloxy)benzoic acid | AG000K2L | 15g |
| 123158-75-8 | NC1=C([N+]([O-])=O)C=C(Cl)C=C1I | 4-Chloro-2-iodo-6-nitro-phenylamine | AG000K2X | 25g |
| 123158-68-9 | NC1=CC(CC)=CC(Br)=C1 | 3-Bromo-5-ethylaniline | AG000K2Y | 10g |
| 1229444-44-3 | [Br-].C[N+]1(Cc2ccc(cc2)P(c2ccccc2)c2ccccc2)CCCC1 | 1-Methyl-1-[4-(diphenylphosphino)benzyl]pyrrolidinium Bromide | AG000JSV | 5g |
| 1229439-64-8 | O=C(N1[C@@H](C(O)=O)C[C@H](CC2=CC=CC=C2)C1)OC(C)(C)C | (2R,4S)-4-Benzyl-1-(tert-butoxycarbonyl)pyrrolidine-2-carboxylic acid | AG000JSX | 2g |
| 122948-57-6 | CCOC(=O)C1CCC(=CC1)OS(=O)(=O)C(F)(F)F | Ethyl 4-(((trifluoromethyl)sulfonyl)oxy)cyclohex-3-enecarboxylate | AG000JT4 | 13.8g |
| 122955-42-4 | O=C1C2=C(C=CC=C2)C(CC3=CC=NC=C3)(CC4=CC=NC=C4)C5=CC=CC=C15 | XE991 | AG000JTW | 0.1g |
| 1229705-06-9 | O=C(O)C1=CC(OC)=C(NC([C@H]2[C@H](C3=C(F)C(Cl)=CC=C3)[C@](C4=CC=C(Cl) | RG7388 | AG000JU9 | 10g |
| 1229627-05-7 | O=C(OC(C)(C)C)NCCCNC(C)C | tert-Butyl (3-(isopropylamino)propyl)carbamate | AG000JUB | 2g |
| 1229622-03-0 | COc1ccc2C(O)CNCCc2c1 | 7-methoxy-2,3,4,5-tetrahydro-1H-3-benzazepin-1-ol | AG000JUD | 0.5g |
| 1229603-71-7 | FC1(F)C2=C(C=CC(Br)=C2)C2=C1C=C(Br)C=C2 | 2,7-Dibromo-9,9-difluoro-9H-fluorene | AG000JUF | 10g |
| 12297-72-2 | [I-].[I-].[I-].[Cs+].[Cs+].[Cs+] | Cesium iodide (Cs(I3)) (6CI,7CI,8CI,9CI) | AG000JUT | 15g |
| 1229784-79-5 | NC1CCC2=C1C(F)=CC(F)=C2.[H]Cl | 5,7-Difluoro-2,3-dihydro-1H-inden-1-amine hydrochloride | AG000JUY | 1g |
| 122987-01-3 | O=C(NC1=CC=C(Cl)C=C1)C2=C(F)C=CC=C2F | N-(4-Chlorophenyl)-2,6-difluorobenzamide | AG000JV0 | 1.9g |
| 122996-47-8 | O=C([C@H]1N(C(OCC2C3=C(C4=C2C=CC=C4)C=CC=C3)=O)C[C@H](OC(C)(C)C)C1 | FMOC-HYP(TBU)-OH | AG000JVO | 1042.5g |
| 123-32-0 | C1=NC(=CN=C1C)C | Pyrazine, 2,5-dimethyl- | AG000JWB | 3500g |
| 123-29-5 | CCCCCCCCC(OCC)=O | Ethyl nonanoate | AG000JWC | 600g |
| 123-25-1 | O=C(OCC)CCC(OCC)=O | Diethyl Succinate | AG000JWD | 1000g |
| 1234615-74-7 | O=C(C1=CN=C(NC=C2)C2=C1F)OC | Methyl 4-fluoro-1H-pyrrolo[2,3-b]pyridine-5-carboxylate | AG000KLV | 1g |
| 1234576-86-3 | I[C@@H]1CCN(C1)C(=O)OC(C)(C)C | (R)-3-Iodo-pyrrolidine-1-carboxylic acid tert-butyl ester | AG000KLW | 0.5g |
| 1234563-16-6 | OB1O[C@H](CN)C2=CC=CC(OCCCO)=C21.Cl | (S)-3-(Aminomethyl)-7-(3-hydroxypropoxy)benzo[c][1,2]oxaborol-1(3H)-ol h | AG000KLZ | 0.075g |
| 123457-83-0 | O=C=Nc1ccc(cc1)N1C(=O)C=CC1=O | 4-(Maleinimido)phenyl isocyanate | AG000KM4 | 0.1g |
| 123455-94-7 | F/C(F)=C/C1CC2CCC1C2 | 2-(2,2-Difluorovinyl)bicyclo[2.2.1]heptane | AG000KM5 | 95.5g |
| 1234616-36-4 | OC(=O)C1=CC=CN2N=CN=C12 | [1,2,4]Triazolo[1,5-A]pyridine-8-carboxylic acid | AG000KM9 | 7g |
| 1234616-35-3 | CN1C(=O)Cc2c(Cl)ncnc21 | 4-Chloro-7-methyl-5,7-dihydro-6H-pyrrolo[2,3-D]pyrimidin-6-one | AG000KMA | 10g |
| 1234616-33-1 | O=C(C1=CC2=C(N(C)N=C2I)C=C1)O | 3-Iodo-1-methylindazole-5-carboxylic acid | AG000KMC | 40g |
| 1234616-30-8 | CC1=NNC2=C1C(Br)=CN=C2 | 4-bromo-3-methyl-1H-pyrazolo[3,4-c]pyridine | AG000KME | 10g |
| 1234616-29-5 | OC(=O)C1=CC2=NC=NN2C=C1 | [1,2,4]triazolo[1,5-a]pyridine-7-carboxylic acid | AG000KMF | 10g |
| 1234616-28-4 | NC1=NNC2=C1C=CC=C2Br | 3-Amino-7-bromo-1H-indazole | AG000KMG | 20g |
| 1234616-25-1 | BrC1=CC=NC2=C1C=CN2C | 4-Bromo-1-methyl-1H-pyrrolo[2,3-b]pyridine | AG000KMI | 125g |
| 1234616-24-0 | O=C(C1=CC2=CN=CN=C2C=C1)OC | METHYL 6-QUINAZOLINECARBOXYLATE | AG000KMJ | 5g |
| 1234616-21-7 | COC(=O)C1=NN2C=CN=C2C=C1 | Methyl imidazo[1,2-b]pyridazine-6-carboxylate | AG000KMK | 9g |
| 1234616-19-3 | NCC1=C(F)C=C(Br)C=N1 | (5-Bromo-3-fluoropyridin-2-yl)methanamine | AG000KMM | 3g |
| 1234616-18-2 | O=C(OC)C1=NC=CC=2NC=NC12 | Methyl 3H-imidazo[4,5-c]pyridine-4-carboxylate | AG000KMN | 0.5g |
| 1234616-17-1 | O=C1N(CC)CC2=C1C=C(N)C=C2 | 6-Amino-2,3-dihydro-2-ethyl-1h-isoindol-1-one | AG000KMO | 7g |
| 1234616-14-8 | O=C(C1=NNC2=CC=CN=C21)OCC | ethyl 1H-pyrazolo[4,3-b]pyridine-3-carboxylate | AG000KMQ | 8g |
| 1234616-13-7 | O=C(C1CC(F)(F)C1)OC | Methyl 3,3-difluoro-cyclobutanecarboxylate | AG000KMR | 136.4g |
| 1234616-09-1 | CCOC(=O)c1cc2ncc(Br)cc2[nH]1 | Ethyl 6-bromo-1H-pyrrolo[3,2-b]pyridine-2-carboxylate | AG000KMT | 2g |
| 1234616-08-0 | Brc1c2n(cc(c1)C(=O)OC)ccn2 | Methyl 8-bromoimidazo[1,2-a]pyridine-6-carboxylate | AG000KMU | 100g |
| 1234616-07-9 | BrC1=CN=C2N1N=C(C=C2)C(=O)OC | methyl 3-bromoimidazo[1，2-b]pyridazine-6-carboxylate | AG000KMV | 25g |
| 1234616-82-0 | O=C(C1=CNC2=NC=CC(Cl)=C21)OC | methyl 4-chloro-1H-pyrrolo[2,3-b]pyridine-3-carboxylate | AG000KMY | 5g |
| 1234616-81-9 | COC(=O)C1CC(NC(=O)OC(C)(C)C)C1 | METHYL 3-(BOC-AMINO)CYCLOBUTANECARBOXYLATE | AG000KMZ | 0.2g |
| 1234616-78-4 | CC1=C2C(C=C(C(O)=O)C=C2)=NN1C | 2,3-DIMETHYL-2H-INDAZOLE-6-CARBOXYLIC ACID | AG000KN1 | 10g |
| 1234616-77-3 | O=C(C1=CNC2=NC=NC=C21)O | 7H-pyrrolo[2,3-d]pyrimidine-5-carboxylic acid | AG000KN2 | 1g |
| 1234616-72-8 | COC(=O)c1cc2cc(F)cnc2[nH]1 | Methyl 5-fluoro-7-azaindole-2-carboxylate | AG000KN5 | 5g |
| 1234616-70-6 | ClC1=C(C=C(Br)C=N2)C2=NC(Cl)=N1 | 6-Bromo-2,4-dichloro-pyrido[2,3-d]pyrimidine | AG000KN6 | 5g |
| 1234616-67-1 | N#Cc1cnc2[nH]ncc2c1 | 1H-Pyrazolo[3,4-b]pyridine-5-carbonitrile | AG000KN8 | 25g |
| 1234616-66-0 | C12=NN=CN1C=CC(C(O)=O)=C2 | [1,2,4]triazolo[4,3-a]pyridine-7-carboxylic acid | AG000KN9 | 25g |
| 1234616-58-0 | CC1=C2C=CC(I)=CC2=NN1C | 6-Iodo-2,3-dimethyl-2H-indazole | AG000KNA | 0.5g |
| 1234616-53-5 | CCOC(=O)c1cn(C)c2c(Cl)ncnc12 | Ethyl 4-chloro-5-methyl-5h-pyrrolo[3,2-d]pyrimidine-7-carboxylate | AG000KNB | 1g |
| 1234616-51-3 | CC(C)(C)OC(=O)N1CC2(C1)CNC(=O)C2 | 7-Oxo-2,6-diazaspiro[3.4]octane-2-carboxylic acid tert-butyl ester | AG000KNC | 125g |
| 1234616-50-2 | NC1=C2N=C(Cl)C=CN2N=C1 | 3-Amino-5-chloropyrazolo[1,5-a]pyrimidine | AG000KND | 20g |
| 1234616-47-7 | C(=O)(OC)c1c2n(c(cn2)Br)ccc1 | methyl 3-bromoimidazo[1,2-a]pyridine-8-carboxylate | AG000KNF | 50g |
| 1234616-46-6 | O=C(N1N=C(Br)C2=CC=CN=C21)OC(C)(C)C | 1-BOC-3-BROMO-1H-PYRAZOLO[3,4-B]PYRIDINE | AG000KNG | 10g |
| 1234616-44-4 | O=C(C1=CC2=C(N(C)N=C2I)C=C1)OC | methyl 3-iodo-1-methyl-1H-indazole-5-carboxylate | AG000KNH | 100g |
| 1233967-22-0 | FC(F)(F)C(C1=CC(Br)=CC=C1N)=O | 1-(2-Amino-5-bromophenyl)-2,2,2-trifluoroethanone | AG000KI8 | 10g |
| 1233967-21-9 | FC(F)(F)C(C1=C(OC)C=CC=C1N)=O | 1-(2-Amino-6-methoxyphenyl)-2,2,2-trifluoroethanone | AG000KI9 | 0.5g |
| 1233960-11-6 | O[C@@H](CC(O)=O)C(O)=O.CN[C@H]1CN(C[C@@H]1O)C(=O)OC(C)(C)C | (3S,4S)-Tert-butyl 3-hydroxy-4-(methylamino)pyrrolidine-1-carboxylate (S)-2 | AG000KIA | 30g |
| 1233953-16-6 | O=C(N1CCC(CNC2=CC=CC=C2[N+]([O-])=O)CC1)OC(C)(C)C | tert-Butyl 4-(((2-nitrophenyl)amino)methyl)piperidine-1-carboxylate | AG000KIE | 1.25g |
| 1233932-59-6 | FC1=CC2=C(N=CC(=N2)Cl)C=C1 | 2-Chloro-7-fluoroquinoxaline | AG000KIJ | 1g |
| 1234-35-1 | O=C(O)[C@@H](NC(OCC1=CC=CC=C1)=O)CCCNC(N)=N | Z-Arg-OH | AG000KIQ | 3000g |
| 1234015-61-2 | CC(C1=C(OCC2=CC=C(OC)C=C2)C=CC=C1OC)=O | 1-(2-methoxy-6-(4-methoxybenzyloxy)phenyl)ethanone | AG000KIU | 50g |
| 123409-01-8 | O.[Na+].[Na+].[Na+].[O-]S(=O)(=O)c1ccc2c(cc(cc2c1)S([O-])(=O)=O)S([O-])(=O)= | trisodium hydrate naphthalene-1,3,6-trisulfonate | AG000KJ3 | 1500g |
| 123408-98-0 | O=P([O-])([O-])O[C@H]1[C@H](OP([O-])([O-])=O)[C@@H](OP([O-])([O-])=O)[ | Phytic acid dodecasodium salt xhydrate | AG000KJ5 | 700g |
| 123402-21-1 | O=C1NC(N)=NC2=C1N=CN2[C@@H]3O[C@H](CO)[C@@H](F)[C@H]3O | 3′-Deoxy-3′-fluoroguanosine | AG000KJG | 5g |
| 123402-20-0 | Nc1ccn([C@@H]2O[C@H](CO)[C@@H](F)[C@H]2O)c(=O)n1 | 3′-Fluoro-3′-deoxycytidine | AG000KJH | 0.3g |
| 1234217-58-3 | O=C(OC)CC1=CC(Br)=NC=C1 | Methyl 2-(2-Bromo-4-pyridyl)acetate | AG000KJI | 25g |
| 123418-69-9 | O=C(C1=CC(Cl)=C(Br)S1)O | 5-Bromo-4-chlorothiophene-2-carboxylic acid | AG000KJV | 6g |
| 123418-66-6 | CC(C1=CC(Cl)=C(Br)S1)=O | 1-(5-Bromo-4-chlorothiophen-2-yl)ethan-1-one | AG000KJX | 10g |
| 123418-43-9 | OC(=O)c1cc(c(s1)C)Cl | 4-Chloro-5-methylthiophen-2-yl hydrogen carbonate | AG000KJZ | 0.5g |
| 123417-18-5 | C(C1C2C=CC=CC=2C2C=CC=CC1=2)OC(CC[C@@H](C(=O)O)NC(OC(C)(C)C)=O)=O | Boc-Glu(OFm)-OH | AG000KK2 | 125g |
| 123415-45-2 | C(CCCCCCCCCCC)OC1=C(C=O)C=C(C(=C1)C=O)OCCCCCCCCCCCC | 2,5-Bis(dodecyloxy)terephthalaldehyde | AG000KK3 | 2g |
| 123312-22-1 | NC(C1=CC=C(Cl)C=C1)C2CC2 | (4-Chlorophenyl)(cyclopropyl)methylamine | AG000KBR | 0.6g |
| 1233243-98-5 | N#CC1=CC=C(N=C1C(F)(F)F)N | 2-Amino-6-(trifluoromethyl)pyridine-5-carbonitrile | AG000KBW | 0.1g |
| 1233243-56-5 | CCOC(=O)C1=C2CCC(C)(C)CC2=NN1 | 6,6-Dimethyl-4,5,6,7-tetrahydro-2h-indazole-3-carboxylic acid ethyl ester | AG000KBZ | 20g |
| 1233219-43-6 | O=C1[C@H]2[C@H](C(O)=O)C[C@H](C2)O1.C=C[C@@H](C[N@@]3CC4)[C@@H | (1R,4R,5R)-3-Oxo-2-oxabicyclo[2.2.1]heptane-5-carboxylic acid cinchonidine s | AG000KC3 | 100g |
| 1233205-73-6 | FC1=CC=CC(=N1)C#C | 2-Ethynyl-6-fluoropyridine | AG000KC4 | 15g |
| 1233200-57-1 | BrC1=CC(C2=CC(C3=CC=CC=C3)=CC(C4=CC=CC=C4)=C2)=CC=C1 | 3-Bromo-5′-phenyl-1，1′:3’，1”-terphenyl | AG000KC5 | 12g |
| 1233186-50-9 | ClC1=NN2C(Br)=CC=C2C=N1 | 7-BROMO-2-CHLOROPYRROLO[2,1-F][1,2,4]TRIAZINE | AG000KC9 | 10g |
| 1233181-67-3 | CSc1ncc2c(Br)ccn2n1 | 5-Bromo-2-(methylsulfanyl)pyrrolo[2,1-f][1,2,4]triazine | AG000KCA | 0.5g |
| 123324-71-0 | CC(C1=CC=C(B(O)O)C=C1)(C)C | 4-t-Butylphenylboronic acid | AG000KCC | 5000g |
| 123320-44-5 | OCC1=CC(OCC2=CC=CC=C2)=NO1 | (3-(Benzyloxy)isoxazol-5-yl)methanol | AG000KCF | 4g |
| 123318-82-1 | NC1=C2N=CN([C@H]3[C@@H](F)[C@@H]([C@@H](CO)O3)O)C2=NC(Cl)=N1 | (2R,3R,4S,5R)-5-(6-amino-2-chloro-9H-purin-9-yl)-4-fluoro-2-(hydroxymethyl | AG000KCJ | 25g |
| 1233323-61-9 | CC(C)(C)OC(=O)N1C2COCC1CC(C(=O)O)C2 | 9-Boc-3-oxa-9-aza-bicyclo[3.3.1]nonane-7-carboxylic acid | AG000KCN | 5g |
| 1233323-55-1 | CC(OC(N1CCC2(C(N)C2)CC1)=O)(C)C | tert-Butyl 1-amino-6-azaspiro[2.5]octane-6-carboxylate | AG000KCO | 1g |
| 123333-55-1 | n1ccc(cc1)c1ccncc1.O | 4,4′-Bipyridine hydrate | AG000KCV | 200g |
| 1233690-80-6 | C1=CC2=NC=C(I)N2C=C1C(F)(F)F | 3-Iodo-6-(trifluoromethyl)imidazo[1,2-a]pyridine | AG000KG6 | 2g |
| 1233689-64-9 | Ic1cnc2cnccn12 | 3-iodoimidazo[1,2-a]pyrazine | AG000KG7 | 2g |
| 123367-27-1 | O=C(C1=CC=NC=C1)/C=C/N(C)C | (E)-3-(Dimethylamino)-1-(pyridin-4-yl)prop-2-en-1-one | AG000KGE | 50g |
| 123367-26-0 | O=C(C1=CC=CN=C1)/C=C/N(C)C | (E)-3-(Dimethylamino)-1-(pyridin-3-yl)prop-2-en-1-one | AG000KGF | 3500g |
| 123367-25-9 | CN(C=CC(C1=NC=CC=C1)=O)C | (2E)-3-(Dimethylamino)-1-(2-pyridyl)-2-propen-1-one | AG000KGG | 125g |
| 1233855-46-3 | O=C(N1C=C(C2=C[N+]([O-])=CC=C2)N=C1)N(C3CCCCC3)C | BIA 10-2474 | AG000KGU | 0.5g |
| 123387-50-8 | O=C(N1CCC(C)CC1)OC(C)(C)C | 1-Boc-4-methylpiperidine | AG000KGV | 50g |
| 123387-49-5 | O=C(N1CCC(C2=CC=CC=C2)CC1)OC(C)(C)C | tert-Butyl 4-phenylpiperidine-1-carboxylate | AG000KGW | 50g |
| 123372-69-0 | OCC1=NNC=N1 | (1H-1,2,4-Triazol-3-yl)methanol | AG000KH6 | 10g |
| 123387-72-4 | O=C(OC(C)(C)C)N(C)CC=O | N-Boc-(Methylamino)acetaldehyde | AG000KHQ | 416.3g |
| 123387-53-1 | O=C(N1CCCC2=C1C=CC=C2)OC(C)(C)C | tert-Butyl 3,4-dihydroquinoline-1(2H)-carboxylate | AG000KHU | 50g |
| 123387-52-0 | CC(C)(C)OC(=O)N1CCCCCC1 | 1-(Tert-Butoxycarbonyl)Hexahydroazepine | AG000KHV | 50g |
| 123387-51-9 | CC(OC(N1CCC2(OCCO2)CC1)=O)(C)C | 1-BOC-4,4-(ethylenedioxy)piperidine | AG000KHW | 10g |
| 1234014-66-4 | BrC1=CC(SC=N2)=C2C=N1 | 6-Bromothiazolo[4,5-c]pyridine | AG000KI5 | 2g |
| 1234014-36-8 | CN1C2=C(C=NC(C(O)=O)=C2)N=C1 | 1-Methyl-1H-imidazo[4,5-c]pyridine-6-carboxylic acid | AG000KI6 | 2g |
| 1233968-22-3 | OB(C1=CC=C(OC)C=C1C#N)O | 2-Cyano-4-methoxyphenylboronic acid | AG000KI7 | 4g |
| 1235011-96-7 | O=C([C@H]1N(CC2=CC=CC=C2)CCOC1)O | (S)-4-Benzylmorpholine-3-carboxylic acid | AG000KP7 | 10g |
| 1235005-44-3 | O=C(O)[C@H](CC1=C(F)C=CC=C1F)NC(OCC2C3=CC=CC=C3C4=CC=CC=C24)=O | Fmoc-Phe(2,6-DiF)-OH | AG000KP8 | 5g |
| 123506-66-1 | O=CC1=C(C)C=C(OC)N=C1 | 5-Formyl-2-methoxy-4-picoline | AG000KPH | 200g |
| 123506-64-9 | CC1=C(N=C(C=C1)OC)C=O | 6-Methoxy-3-methylpicolinaldehyde | AG000KPI | 0.75g |
| 1235280-35-9 | COC(=O)[C@@H](Cc1c[nH]c2cc(Cl)ccc12)NC(C)=O | (R)-N-Acetyl-6-Chloro-Trp-OMe | AG000KPR | 1.25g |
| 1235181-00-6 | O=C([C@H](COC1)N(CC2=CC=CC=C2)C1=O)OC | Methyl (s)-4-benzyl-5-oxo-morpholine-3-carboxylate | AG000KPS | 125g |
| 1235142-07-0 | CC1(C(C)(C)OB(C2=CC3=C(CCCN3)C=C2)O1)C | 7-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,3,4-tetrahydroquinoline | AG000KPT | 0.3g |
| 1235141-58-8 | O=C(N1CCCc2c1cc(cc2)B1OC(C(O1)(C)C)(C)C)OC(C)(C)C | 1(2H)-Quinolinecarboxylic acid, 3,4-dihydro-7-(4,4,5,5-tetramethyl-1,3,2-diox | AG000KPU | 2g |
| 1235134-83-4 | O=C([C@@H]1N(CC2=CC=CC=C2)CCOC1)OC | (R)-Methyl 4-benzylmorpholine-3-carboxylate | AG000KPW | 20g |
| 1235126-46-1 | COC1=C[C@H](c2ccccc2)C2(C(=C[C@@H](C31C(=O)C(=C(C3=O)OC)OC)c1ccccc1) | Linderaspirone A | AG000KPX | 0.005g |
| 123531-52-2 | O=C(C1=CN=C2C=CC=CN21)OCC | Ethyl imidazo[1，2-a]pyridine-3-carboxylate | AG000KPZ | 10g |
| 123531-27-1 | O=C(C1=CN2N=CC=CC2=N1)OCC | Ethyl imidazo[1,2-b]pyridazine-2-carboxylate | AG000KQ1 | 50g |
| 123530-66-5 | O=C(O)/C=C/C1=NC=CN=C1 | (2E)-3-Pyrazin-2-ylacrylic acid | AG000KQ4 | 3g |
| 123524-52-7 | O=C(C1=C(N)NC(C)=C(C(OC(C)C)=O)C1C2=CC=CC([N+]([O-])=O)=C2)OC3CN(C(C | Azelnidipine | AG000KQ9 | 50g |
| 1235374-46-5 | Clc1c2n(c(cn2)Br)ncn1 | 7-Bromo-4-chloroimidazo[2,1-f][1,2,4]triazine | AG000KQH | 5g |
| 1235374-44-3 | NC1=NC=NN2C1=NC=C2Br | 4-AMINO-7-BROMOIMIDAZO[2,1-F][1,2,4]TRIAZINE | AG000KQI | 100g |
| 1235342-53-6 | Br.BrCC=1C=NC=C(C1)C | 3-(Bromomethyl)-5-methylpyridine hydrobromide | AG000KQK | 10g |
| 1235318-89-4 | CC1=C(N=C(NC2=NC=CC(C)=N2)S1)C1=CNN=C1 | ADX88178 | AG000KQL | 0.45g |
| 123990-78-3 | COC1=CC2=CC(=C(N=C2C=C1)O)C=O | 2-hydroxy-6-methoxyquinoline-3-carbaldehyde | AG000LC5 | 2g |
| 123990-76-1 | O(C)c1cc2c(cc1)nc(c(c2)C)Cl | Quinoline,2-chloro-6-methoxy-3-methyl- | AG000LC6 | 0.1g |
| 123989-29-7 | CC(C1CC1)C(=O)c1ccc(Cl)cc1 | 1-(4-Chlorophenyl)-2-cyclopropylpropan-1-one | AG000LC7 | 100g |
| 1239964-16-9 | N#CC1=CC(F)=C(CBr)C(F)=C1 | 4-(Bromomethyl)-3,5-difluorobenzonitrile | AG000LCF | 25g |
| 124-10-7 | CCCCCCCCCCCCCC(OC)=O | Methyl Tetradecanoate | AG000LCT | 11500g |
| 124-06-1 | CCCCCCCCCCCCCC(OCC)=O | Ethyl tetradecanoate | AG000LCX | 11000g |
| 124-05-0 | C(COC(=O)Cl)OC(=O)Cl | Ethylenebis(chloroformate) | AG000LCY | 10g |
| 124-04-9 | OC(=O)CCCCC(O)=O | Adipic acid | AG000LCZ | 9500g |
| 124-03-8 | CCCCCCCCCCCCCCCC[N+](C)(CC)C.[Br-] | Ethylhexadecyldimethylammonium bromide | AG000LD0 | 4975g |
| 124-48-1 | C(Br)(Br)Cl | Methane, dibromochloro- | AG000LD5 | 25g |
| 124-25-4 | CCCCCCCCCCCCCC=O | Tetradecanal | AG000LDC | 800g |
| 124-22-1 | C(CCCCCCCCCCC)N | Dodecanamine | AG000LDE | 44975g |
| 124-21-0 | C(C)OCCNCCOCC | Bis(2-ethoxyethyl)amineE | AG000LDF | 20g |
| 124-20-9 | NCCCCNCCCN | Spermidine | AG000LDG | 500g |
| 124-19-6 | CCCCCCCCC=O | Nonanal | AG000LDH | 2500g |
| 1235865-75-4 | O=C(OC)C1=CC=C(F)C=C1OC2=CN=C(NC=C3)C3=C2 | METHYL 2-(1H-PYRROLO[2,3-B]PYRIDIN-5-YLOXY)-4-FLUOROBENZOATE | AG000KT5 | 100g |
| 123577-99-1 | CC(C1=CC(F)=CC(F)=C1)=O | 3′,5′-Difluoroacetophenone | AG000KT9 | 1000g |
| 123572-63-4 | NC1=CC(F)=CC=C1OC(F)(F)F | 5-Fluoro-2-(trifluoromethoxy)aniline | AG000KTF | 50g |
| 123572-62-3 | FC(F)(F)OC1=CC=C(F)C=C1[N+]([O-])=O | 4-Fluoro-2-nitro-1-(trifluoromethoxy)benzene | AG000KTG | 15g |
| 123572-59-8 | NC1=CC(OC(F)(F)F)=C(F)C=C1F | 2,4-Difluoro-5-(trifluoromethoxy)aniline | AG000KTH | 20g |
| 123572-58-7 | NC1=CC=C(OC(F)(F)F)C=C1F | 2-Fluoro-4-(trifluoromethoxy)aniline | AG000KTI | 25g |
| 1236007-42-3 | C(=O)(OC(C)(C)C)N1CC[C@H](C1)S | 1-Pyrrolidinecarboxylic acid, 3-mercapto-, 1,1-dimethylethyl ester, (3R)- | AG000KTU | 3g |
| 1235993-30-2 | O=[N+](C1=CN=C2C=CC(F)=CN21)[O-] | 6-Fluoro-3-nitroimidazo[1,2-a]pyridine | AG000KTV | 0.75g |
| 1235865-77-6 | O=C(O)C1=CC=C(N2CCN(CC3=C(C4=CC=C(Cl)C=C4)CC(C)(C)CC3)CC2)C=C1OC5=C | 2-((1H-Pyrrolo[2,3-b]pyridin-5-yl)oxy)-4-(4-((4′-chloro-5,5-dimethyl-3,4,5,6-t | AG000KTW | 36g |
| 123594-04-7 | ClC1=C2C(CNC2)=CC=C1 | 4-Chloroisoindoline | AG000KU5 | 2g |
| 123593-99-7 | CC1=CC=CC2=C1CCNC2 | 5-Methyl-1,2,3,4-Tetrahydroisoquinoline | AG000KU7 | 1.5g |
| 1236127-55-1 | CN1N=CC2=C1C=C(OC)C=C2 | 6-Methoxy-1-methyl-1H-indazole | AG000KUH | 0.75g |
| 1236033-34-3 | C[Si](C)(C(C)(C)C)OC(C1=CC=CC=C1)([C@@H]2NCCC2)C3=CC=CC=C3 | (R)-Diphenylprolinol tert-butyldimethylsilyl ether | AG000KUQ | 10g |
| 123606-23-5 | N(C(C1C=COC=1)C)(O)C(N)=O | A-69412 | AG000KUX | 0.05g |
| 123606-06-4 | CSc1nn2c(n1)[nH]nc(c2=O)[N+](=O)[O-] | 7-(Methylthio)-3-nitro-[1,2,4]triazolo[5,1-c][1,2,4]triazin-4(6H)-one | AG000KV0 | 0.1g |
| 1236199-60-2 | ClCCN(C1=CC2=C(N(C(=N2)CCCCCCC(=O)NO)C)C=C1)CCCl | 7-(5-(Bis(2-chloroethyl)amino)-1-methyl-1H-benzo[d]imidazol-2-yl)-N-hydro | AG000KV6 | 0.025g |
| 1236191-14-2 | CC(C)(C)COC1=CC(B(O)O)=CC=C1 | 3-(Neopentyloxy)phenylboronic acid | AG000KV7 | 10g |
| 123195-72-2 | CC(OC1=CC=C(CCO)C=C1)(C)C | 2-(4-(Tert-Butoxy)Phenyl)Ethanol | AG000K5F | 0.5g |
| 123195-23-3 | CC(N)C1=CC=C(OC(F)(F)F)C=C1 | 1-[4-(Trifluoromethoxy)phenyl]ethylamine | AG000K5G | 125g |
| 1232064-63-9 | Cl.CO[C@H]1COCC[C@H]1N | (3R,4R)-3-Methoxytetrahydro-2H-pyran-4-amine hydrochloride | AG000K5O | 5g |
| 1232060-77-3 | CO[C@H]1[C@H](N)CCOC1 | Trans-4-amino-3-(methoxy)tetrahydropyran | AG000K5P | 25g |
| 1232059-97-0 | CO[C@@H]1CN(C(=O)OC(C)(C)C)CC[C@H]1N | trans-4-AMino-1-Boc-3-Methoxypiperidine | AG000K5R | 1g |
| 1232059-52-7 | CCOC(=O)C1=NC=NC(Cl)=C1C | Ethyl 6-chloro-5-methylpyrimidine-4-carboxylate | AG000K5S | 5g |
| 1232030-35-1 | ClC1=C(C=CC(=C1)Cl)C1=CC2=C(N=C(N=C2)NC2=CC(=C(C=C2)N2CCNCC2)F)N(C1= | 6-(2,4-Dichlorophenyl)-8-ethyl-2-((3-fluoro-4-(piperazin-1-yl)phenyl)amino) | AG000K5V | 1.25g |
| 1232028-11-3 | OC(C1=NOC(C2=C([N+]([O-])=O)C=CC=C2)=C1)=O | 5-(2-Nitrophenyl)isoxazole-3-carboxylic acid | AG000K5W | 25g |
| 123207-57-8 | [O-][N+](C1=CC(CN2CCOCC2)=CC=C1)=O | 4-(3-Nitrobenzyl)morpholine | AG000K60 | 2g |
| 123207-48-7 | NC1=CC=CC(CN2CCOCC2)=C1 | 3-(Morpholin-4-ylmethyl)aniline | AG000K61 | 10g |
| 123207-39-6 | O=C(OCC)C1=CC(N)=CC=C1F | ETHYL 5-AMINO-2-FLUOROBENZOATE | AG000K62 | 50g |
| 123214-39-1 | OC1CCC(=O)C(C1)(C)C | 4-Hydroxy-2,2-dimethylcyclohexanone | AG000K6U | 10g |
| 1232365-42-2 | CC(OC(NC1(CC(F)(F)C1)CO)=O)(C)C | 1-(Boc-amino)-3,3-difluorocyclobutane-1-methanol | AG000K71 | 25g |
| 1234616-41-1 | O=C(C1=CC2=NC=NC=C2C=C1)O | Quinazoline-7-carboxylic acid | AG000KNJ | 2g |
| 1234616-39-7 | OC(C1=C2C(N=CN2)=CN=C1)=O | 3H-imidazo[4,5-c]pyridine-7-carboxylic acid | AG000KNK | 1g |
| 1234616-38-6 | N12N=CN=C1C=CC=C2C(O)=O | [1,2,4]triazolo[1,5-a]pyridine-5-carboxylic acid | AG000KNL | 1g |
| 1234703-40-2 | O=S(C1=CC=C([C@]2(C[C@H]2C3CCCCC3)C(NC4=NC=C(SCCN5CCCC5)S4)=O)C=C | LY2608204 | AG000KNR | 0.1g |
| 1234616-83-1 | O=C(C1=CC2=CC(Br)=CN=C2N1)OC | Methyl 5-bromo-7-azaindole-2-carboxylate | AG000KNS | 150g |
| 123470-94-0 | C(O)(=O)C1C=CC=C(OCCC2=CC=CC=C2)C=1 | 3-Phenethoxybenzoic acid | AG000KO0 | 10g |
| 123464-89-1 | O=C(N[C@H]1CN2CCC1CC2)C3=CC=C(Cl)C=C3.[H]Cl | PNU-282987 | AG000KO7 | 2g |
| 1234996-74-7 | N[C@@H](C1=NC2=CC=CC=C2N1)C.[H]Cl | (R)-1-(1H-Benzimidazol-2-yl)ethylamine, HCl | AG000KOC | 4g |
| 1234988-79-4 | Cl.Cl.CCNCC1=CC=C(C=C1)N(C)C | N-Ethyl-4-(dimethylamino)benzylamine DiHCl | AG000KOD | 100g |
| 123495-48-7 | O=C([C@H]1NCCCC1)OCC.[H]Cl | ETHYL (S)-PIPERIDINE-2-CARBOXYLATE HCL | AG000KOJ | 10g |
| 1235-82-1 | OC(CCN1CCCCC1)(C1C2CC(C=C2)C1)C1C=CC=CC=1.[H]Cl | Biperiden (hydrochloride) | AG000KOS | 0.75g |
| 1235-74-1 | O=C([C@]1(C)CCC[C@]2(C)C3=C(CC[C@@]12[H])C=C(C(C)C)C=C3)OC | (1R,4aS,10aR)-methyl 7-isopropyl-1,4a-dimethyl-1,2,3,4,4a,9,10,10a-octahydr | AG000KOT | 10g |
| 1235-21-8 | O=C(C)C[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[Cl-] | (2-Oxopropyl)triphenylphosphonium chloride | AG000KOY | 2000g |
| 1235099-38-3 | F[B-](F)(C1=CC=C(Cl)N=C1)F.[K+] | Potassium 2-chloropyridine-5-trifluoroborate | AG000KP1 | 100g |
| 1235036-15-3 | O=C(OC(C)(C)C)C1=NC(Cl)=CC=C1Br | tert-Butyl 3-bromo-6-chloropicolinate | AG000KP4 | 25g |
| 1235020-13-9 | O=C(O)[C@@H](CC1=C(F)C=CC=C1F)NC(OCC2C3=CC=CC=C3C4=CC=CC=C24)=O | (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(2,6-difluorophenyl)pr | AG000KP6 | 2g |
| 1239-94-7 | O=C(O)[C@H]1N(S(C2=CC=CC3=C(C=CC=C32)N(C)C)(=O)=O)CCC1 | (S)-1-((5-(Dimethylamino)Naphthalen-1-Yl)Sulfonyl)Pyrrolidine-2-Carboxylic | AG000L84 | 10g |
| 1239-45-8 | CC[N+]1=C(C2=CC=CC=C2)C3=CC(N)=CC=C3C4=C1C=C(N)C=C4.[Br-] | 3,8-Diamino-5-ethyl-6-phenylphenanthridin-5-ium bromide | AG000L86 | 150g |
| 1239370-98-9 | F[B-](F)(C1=CC=C(Br)S1)F.[K+] | PotassiuM (5-broMothiophen-2-yl)trifluoroboranuide | AG000L89 | 20g |
| 1239363-40-6 | IC1=CN(N=C1)C1CC1 | 1-Cyclopropyl-4-iodo-1H-pyrazole | AG000L8A | 50g |
| 1239355-46-4 | O=C(N1[C@@H](C(OC)=O)C1)OC(C)(C)C | (R)-Methyl 1-N-Boc-aziridine-2-carboxylate | AG000L8B | 20g |
| 1239327-73-1 | O=C(N(CCCCCC)C(C(C(Br)=C1)=C23)=O)C3=CC(Br)=C(C(N4CCCCCC)=O)C2=C1C4= | 4,9-Dibromo-2,7-dihexylbenzo[lmn][3,8]phenanthroline-1,3,6,8(2H,7H)-tetra | AG000L8C | 1.75g |
| 1239319-94-8 | O=C(N(CC1)CC21CC(N)C2)OC(C)(C)C | 2-Amino-6-aza-spiro[3.4]octane-6-carboxylic acid tert-butyl ester | AG000L8D | 20g |
| 1239319-91-5 | O=C(N(CC1)CC21CC(O)C2)OC(C)(C)C | 6-Boc-2-hydroxy-6-aza-spiro[3.4]octane | AG000L8E | 200g |
| 1239319-82-4 | O=C(N(CC1)CCC21CC(N)C2)OC(C)(C)C | 2-Amino-7-azaspiro[3.5]nonane-7-carboxylic acid tert-butyl ester | AG000L8F | 45.3g |
| 1239262-52-2 | O=C(NO)C1=CC=C(CN2C3=C(CN(C)CC3)C4=C2C=CC=C4)C=C1.O=C(O)C(F)(F)F | N-Hydroxy-4-((2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5(2H)-yl)methyl) | AG000L8H | 5g |
| 1239233-86-3 | CC(C)COc1ccc(cc1C(=O)N)c2nc(C)c(s2)C(=O)O | 2-(3-Carbamoyl-4-isobutoxyphenyl)-4-methylthiazole-5-carboxylic acid | AG000L8I | 1g |
| 1239205-33-4 | Cl.CS(NC1CNC1)(=O)=O | N-(Azetidin-3-YL)methanesulfonamide hydrochloride | AG000L8J | 25g |
| 123926-62-5 | OC1=CC=CC(CNC)=C1 | 3-[(Methylamino)methyl]phenol | AG000L8T | 500g |
| 1239492-22-8 | FC1=C(Br)C(OC(F)F)=CC=C1 | 2-Bromo-1-(difluoromethoxy)-3-fluorobenzene | AG000L8Y | 5g |
| 1239489-82-7 | CC1=NC2=C(O1)C(Br)=CC=C2 | 7-Bromo-2-methylbenzo[d]oxazole | AG000L8Z | 10g |
| 1239481-05-0 | CC1(C(C)(C)OB(C2=CC=C(CN=[N+]=[N-])C=C2)O1)C | 2-[4-(azidomethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane | AG000L90 | 0.8g |
| 1239478-87-5 | C12(CC3CC(CC(C1)C3)C2)P(C2=CC=NN2C=2C(=NN(C2C2=CC=CC=C2)C2=CC=CC=C | 5-[Bis(tricyclo[3.3.1.13,7]dec-1-yl)phosphino]-1′,3′,5′-triphenyl-1,4′-bi-1H-pyr | AG000L92 | 30g |
| 1239464-24-4 | O=C(C1=C(N)SC=N1)OC | Methyl 5-aminothiazole-4-carboxylate | AG000L93 | 5g |
| 1239463-43-4 | FC1=C(Br)C2=C(C=NC=C2)C=C1 | 5-Bromo-6-fluoroisoquinoline | AG000L94 | 33.3g |
| 1239462-41-9 | FC(C1=CC2=C(Br)C=CC=C2N=C1)(F)F | 5-Bromo-3-(trifluoromethyl)quinoline | AG000L95 | 0.75g |
| 1239462-10-2 | NC1=CC(C(F)(F)F)=NC=C1I | 5-Iodo-2-(trifluoromethyl)pyridin-4-amine | AG000L96 | 15g |
| 1239460-83-3 | O=C1C(C(Br)=CS2)=C2N=CN1 | 5-Bromothieno[2，3-d]pyrimidin-4(3H)-one | AG000L97 | 2g |
| 1239460-75-3 | FC(C1=C2N=CC=CC2=C(Br)C=C1)(F)F | 5-Bromo-8-(trifluoromethyl)quinoline | AG000L9A | 2g |
| 123948-87-8 | O=C1[C@](O)(CC)C2=C(CO1)C(N3CC4=CC5=C(CN(C)C)C(O)=CC=C5N=C4C3=C2)= | (4S)-10-[(Dimethylamino)methyl]-4-ethyl-4,9-dihydroxy-1H-pyrano[3′,4′:6,7]i | AG000L9E | 0.39g |
| 1239596-54-3 | OC1C(F)(F)CNCC1 | 3,3-Difluoropiperidin-4-OL | AG000L9M | 5g |
| 1239596-53-2 | OC1C(F)(F)CN(CC2=CC=CC=C2)CC1 | 1-Benzyl-3,3-difluoropiperidin-4-ol | AG000L9N | 15g |
| 1239589-52-6 | O=C(OC(C)(C)C)NC1CC2(CC(N)C2)C1 | tert-Butyl (6-aminospiro[3.3]heptan-2-yl)carbamate | AG000L9O | 10g |
| 1239588-11-4 | OCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)OC | 4,7,10,13,16,19,22,25,28,31,34,37-Dodecaoxanonatriacontanoic acid, 39-hydro | AG000L9P | 3g |
| 123956-65-0 | CC(NC(C=CN1[C@@H]2O[C@H](COC(C3=CC=C(OC)C=C3)(C4=CC=C(OC)C=C4)C5 | N-(1-((2R,3R,4S,5R)-5-((Bis(4-methoxyphenyl)(phenyl)methoxy)methyl)-4-((t | AG000L9U | 25g |
| 123950-46-9 | C1(C=CC(=C(F)C=1F)N)C(F)(F)F | 4-Amino-2,3-difluorobenzotrifluoride | AG000LA5 | 50g |
| 123950-44-7 | C1C(=CC(F)=C(C(F)(F)F)C=1F)N | 3,5-Difluoro-4-(trifluoromethyl)aniline | AG000LA7 | 0.2g |
| 1239720-33-2 | NC1=C(C=C(C#N)C=C1[N+](=O)[O-])Br | 4-Amino-3-bromo-5-nitrobenzonitrile | AG000LAC | 300g |
| 1239720-32-1 | CC1=CN2C=C(Br)N=C(Cl)C2=N1 | 6-Bromo-8-chloro-2-methylimidazo[1,2-a]pyrazine | AG000LAD | 10g |
| 1239648-74-8 | NC1=NN2C=CC=C(C)C2=N1 | 8-Methyl-[1,2,4]triazolo[1,5-a]pyridin-2-ylamine | AG000LAF | 1g |
| 1239648-57-7 | CC1=CC2=NC(=N)NN2C=C1 | 7-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-amine | AG000LAG | 30g |
| 1239647-61-0 | CC1=CN2C(=NC(=N2)N)C=C1 | 6-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-amine | AG000LAH | 5.5g |
| 1239647-60-9 | NC1=NN2C=C(Cl)C=CC2=N1 | [1,2,4]Triazolo[1,5-a]pyridin-2-amine, 6-chloro- | AG000LAI | 100g |
| 123843-57-2 | C(#N)c1c(F)cc(cc1F)O | 2,6-Difluoro-4-hydroxybenzonitrile | AG000L5V | 125g |
| 123843-54-9 | CCCCOc1ccc(c(c1)F)C(=O)O | 4-Butoxy-2-fluorobenzoic acid | AG000L5W | 10g |
| 123864-17-5 | C=CC(=O)OCCCCCCOc1ccc(cc1)C(=O)Oc1ccc(cc1)OC(=O)c1ccc(cc1)OCCCCCCOC(= | 1,4-Phenylene bis(4-((9-(acryloyloxy)-3-methylnonyl)oxy)benzoate) | AG000L6A | 30g |
| 123863-99-0 | CCCCCCCCC1(CCCCCCCC)c2ccccc2-c2ccccc12 | 9,9-Di-n-octylfluorene | AG000L6B | 10g |
| 123863-97-8 | CCCCCCC1(CCCCCC)C2=C(C3=C1C=CC=C3)C=CC=C2 | 9,9-Dihexylfluorene | AG000L6C | 75g |
| 123858-51-5 | CC(C1=CC=C(Br)C=C1N)=O | 1-(2-Amino-4-bromophenyl)ethanone | AG000L6E | 200g |
| 123855-55-0 | [O-][N+](=O)c1ccc(OC(=O)CS(=O)Cc2occc2)cc1 | 4-Nitrophenyl 2-(furfurylsulfinyl)acetic acid | AG000L6I | 3000g |
| 123855-25-4 | C1=C(F)C=C(F)C=C1N(C)C | 3,5-Difluoro-N,N-dimethylaniline | AG000L6J | 10g |
| 123853-39-4 | COC(=O)C1=C(C)NC(C)=C(C1C1=C(Cl)C(Cl)=CC=C1)C(O)=O | 4-(2,3-Dichlorophenyl)-5-(methoxycarbonyl)-2,6-dimethyl-1,4-dihydropyridi | AG000L6M | 500g |
| 123852-08-4 | COCCOCCOCCOCCNCCOCCOCCOCCOC | NH-(mPEG4)2 | AG000L6P | 25g |
| 123846-69-5 | [O-][N+](=O)c1ccc(nc1CC#N)Cl | 2-(6-Chloro-3-nitropyridin-2-yl)acetonitrile | AG000L6U | 10g |
| 1238702-58-3 | CC1(C)OB(OC1(C)C)C1=CC=NN1C1=CC=CC=C1 | 1-Phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole | AG000L6X | 35g |
| 123892-38-6 | CS(N1C(C=O)=CC=C1)(=O)=O | 1-(Methylsulfonyl)-1H-pyrrole-2-carbaldehyde | AG000L6Z | 2g |
| 1239034-70-8 | O=C(OC)C1=CC=C(CN2C3=C(CN(C)CC3)C4=C2C=CC=C4)C=C1 | Methyl 4-((2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5(2H)-yl)methyl)ben | AG000L7L | 0.2g |
| 1238951-37-5 | C[C@H]1CN([C@@H](C)CN1)C(=O)OC(C)(C)C | (2S,5S)-tert-Butyl 2,5-dimethylpiperazine-1-carboxylate | AG000L7N | 50g |
| 123912-78-7 | CC(N1CCCC1)C(O)=O | 2-(1-Pyrrolidyl)propanoic acid | AG000L7U | 6g |
| 123910-88-3 | O=C(OC)C1=CC=C(CCCCO)C=C1 | methyl 4-(4-hydroxybutyl)benzoate | AG000L7V | 300g |
| 123910-26-9 | C(O)(=O)[C@H]1CC2=C(CN1C(OC(C)(C)C)=O)NC=3C2=CC=CC3 | Boc-d-1,2,3,4-tetrahydronorharman-3-carboxylic acid | AG000L7W | 70g |
| 124-17-4 | CCCCOCCOCCOC(C)=O | Ethanol, 2-(2-butoxyethoxy)-, 1-acetate | AG000LDJ | 6000g |
| 124-13-0 | O=CCCCCCCC | n-Octanaldehyde | AG000LDL | 350g |
| 124004-31-5 | NC1=CC(=NN1)C(O)=O | 5-Amino-1H-pyrazole-3-carboxylic acid | AG000LDP | 125g |
| 124002-32-0 | [H][C@]12CCC[C@@](C[C@H](N2C(OC(C)(C)C)=O)C(O)=O)1[H] | (2S,3aS,6aS)-1-(tert-Butoxycarbonyl)octahydrocyclopenta[b]pyrrole-2-carbox | AG000LDQ | 10g |
| 1240-04-6 | O=S(OC(C=C1CC[C@@]2([H])[C@]3([H])CC4)=CC=C1[C@@]2([H])CC[C@]3(C)C4 | Estrone 3-sulfate potassium salt | AG000LE0 | 0.3g |
| 1240113-42-1 | N#CC1=C(F)C2=C(NC=C2)C=C1 | 4-fluoro-1H-indole-5-carbonitrile | AG000LEC | 10g |
| 1240113-40-9 | IC1=C(F)C2=C(NC=C2)C=C1 | 4-Fluoro-5-iodo-1H-indole | AG000LED | 20g |
| 1240061-39-5 | O=C(O)C1(=NNC(=C1)C2(=CC(NC(=O)C)=CC=C2)) | 5-(3-Acetylaminophenyl)-1H-pyrazole-3-carboxylic acid | AG000LEE | 6.1g |
| 124014-00-2 | COC1=C(Cl)C=C(C2OC(C=O)=CC=2)C=C1 | 5-(3-Chloro-4-Methoxyphenyl)Furfural | AG000LEM | 2.5g |
| 124009-63-8 | CC1=NN(C2=CC=CC=C2)C(=C1C3(C(=NN(C4=CC=CC=C4)C3=O)C)C5=C(N(C6=CC=C | 2,4-Dihydro-4,4-bis(5-hydroxy-3-methyl-1-phenyl-1H-pyrazol-4-yl)-5-methyl- | AG000LEP | 3g |
| 124004-75-7 | FC1=CC=CC=C1C(C(F)(F)F)=O | 2,2,2,2′-Tetrafluoroacetophenone | AG000LET | 20g |
| 124004-74-6 | FC1=CC=CC=C1C(O)C(F)(F)F | 2,2,2-TRIFLUORO-1-(2-FLUOROPHENYL)ETHANOL | AG000LEU | 8g |
| 1240257-07-1 | OCC1=C(F)C=C(OC(F)(F)F)C=C1 | 2-Fluoro-4-(trifluoromethoxy)benzyl alcohol | AG000LF1 | 7.7g |
| 124027-47-0 | OC1CCCC2=NC3=CC=CC=C3C(N)=C21 | Velnacrine | AG000LFB | 0.3g |
| 1240466-16-3 | S=C(NC1=CC(C(F)(F)F)=CC(C(F)(F)F)=C1)N[C@H]2[C@H](N(CC3=CC=CC=C3)CC4= | N-[(1R,2R)-2-[Bis(phenylmethyl)amino]cyclohexyl]-N’-[3,5-bis(trifluorometh | AG000LFO | 0.5g |
| 123638-09-5 | ClC1=CC(=NC2=CC=C(C=C12)CC)C | 4-Chloro-6-ethyl-2-methylquinoline | AG000KWS | 2g |
| 123637-97-8 | CC1=CC2=C(N=C(C(=C2)CO)Cl)C=C1 | 2-Chloro-6-methylquinoline-3-methanol | AG000KWT | 1g |
| 86386-73-4 | C(Cn1cncn1)(Cn1cncn1)(O)c1c(F)cc(cc1)F | Fluconazole | AG000KX6 | 3500g |
| 119-17-5 | CC1=NN(C(=O)C1)c1cccc(c1)S(O)(=O)=O | 1-(3-Sulfophenyl)-3-methyl-5-pyrazolone | AG000KX7 | 1000g |
| 1236791-61-9 | Cl.Cl.C1NCC1C1=CC=CN=C1 | 3-(Azetidin-3-yl)pyridine dihydrochloride | AG000KXA | 25g |
| 1236791-32-4 | Cl.Cl.C1NCC1C1=CC=NC=C1 | 4-(Azetidin-3-yl)pyridine dihydrochloride | AG000KXB | 15g |
| 1236699-92-5 | O=C(NC[C@H](O)CO)C1=CC=NC=C1NC2=CC=C(I)C=C2F | AS-703026 | AG000KXC | 3g |
| 1236670-87-3 | ClC1=NC=C(C)C(NC2=CC(NC(O3)=O)=C3C=C2)=N1 | 5-((2-chloro-5-methylpyrimidin-4-yl)amino)benzo[d]oxazol-2(3H)-one | AG000KXD | 50g |
| 123685-60-9 | FC1=CC=C(NCC#C)C=C1 | 4-fluoro-N-(prop-2-yn-1-yl)aniline | AG000KXG | 1.9g |
| 123664-84-6 | CS(=O)(NC1=CC(OC)=CC=C1OC2=CC=CC=C2)=O | N-(5-Methoxy-2-phenoxyphenyl)methanesulfonamide | AG000KXM | 20g |
| 123663-49-0 | O=CNC1=COC2=C(C=C(OC3=CC=CC=C3)C(NS(=O)(C)=O)=C2)C1=O | Iguratimod | AG000KXN | 20.925g |
| 123654-26-2 | NC1=C2CCOC2=C(C=C1Cl)C(O)=O | 4-AMINO-5-CHLORO-2,3-DIHYDROBENZOFURAN-7-CARBOXYLIC ACID | AG000KXV | 300g |
| 1236862-38-6 | FC(F)(F)C1=CC=C(OC2CNC2)C=C1.Cl | 3-(4-(Trifluoromethyl)phenoxy)azetidine hydrochloride | AG000KXX | 200g |
| 1236862-34-2 | COC1=CC=C(C=C1)OC2CNC2.Cl | 3-(4-Methoxyphenoxy)-azetidine hydrochloride | AG000KXY | 8g |
| 123696-02-6 | COC1=CC(Cl)=NN=C1 | 3-Chloro-5-methoxypyridazine | AG000KY1 | 200g |
| 123696-01-5 | COC1=CC(NN=C1)=O | 5-Methoxypyridazin-3(2H)-one | AG000KY2 | 40g |
| 1240963-55-6 | OB(C1=CC=C(C2=CC3=C(C=C2)N(C4=CC=CC=C4)C5=C3C=CC=C5)C=C1)O | (4-(9-Phenyl-9H-carbazol-3-yl)phenyl)boronic acid | AG000LJT | 50g |
| 1240948-77-9 | N#CC1=CNC(C2=CC=CC=C2F)=C1 | 5-(2-Fluorophenyl)-1H-pyrrole-3-carbonitrile | AG000LJV | 1000g |
| 1240948-72-4 | Fc1c(c2cc(c([nH]2)Cl)C#N)cccc1 | 1H-Pyrrole-3-carbonitrile, 2-chloro-5-(2-fluorophenyl)- | AG000LJW | 400g |
| 1241009-48-2 | OCC1CCN(CC2=CC=CC(Cl)=C2)CC1 | (1-(3-Chlorobenzyl)piperidin-4-yl)methanol | AG000LKJ | 3g |
| 124111-47-3 | CCCCCCCCCCCCCCCCCCCCCCC(C(=O)OCC)O | 2-Hydroxytetracosanoic acid ethyl ester | AG000LKL | 0.005g |
| 1241-94-7 | O=P(OC1=CC=CC=C1)(OCC(CC)CCCC)OC2=CC=CC=C2 | 2-Ethylhexyl Diphenyl Phosphate | AG000LL3 | 500g |
| 1241-87-8 | OC(C=C1C=CC(O[C@]2(C[C@H]([C@H]([C@@H](C2)O)O)O)C(O)=O)=O)=C(C=C1 | 1-O-Caffeoylquinic Acid | AG000LL4 | 0.009g |
| 1241675-24-0 | Cc1ccc(S(=O)(=O)n2cc(I)c3cc(Cl)cnc32)cc1 | 5-Chloro-3-iodo-1-(4-methylbenzenesulfonyl)-1h-pyrrolo[2,3-b]pyridine | AG000LL9 | 1g |
| 1241377-74-1 | BrC1=CC2=CC=C(C(=C2C=C1)N)N | 6-Bromonaphthalene-1,2-diamine | AG000LLG | 2g |
| 1241253-40-6 | OCC1CCN(CC2=CC=CC=C2F)CC1 | (1-(2-Fluorobenzyl)piperidin-4-yl)methanol | AG000LLH | 1.25g |
| 1241231-81-1 | O=C(C1COc2c(O1)cccc2)NC1CCN(CC1)C(=O)OC(C)(C)C | tert-Butyl 4-(2,3-dihydrobenzo[b][1,4]dioxine-2-carboxamido)piperidine-1-c | AG000LLI | 0.5g |
| 124150-87-4 | C[Si](OC[C@H]1CO1)(C(C)(C)C)C | (R)-tert-Butyldimethyl(oxiran-2-ylmethoxy)silane | AG000LLO | 300g |
| 1241725-60-9 | FCC1CNCCC1.[H]Cl | 3-(Fluoromethyl)piperidine hydrochloride | AG000LLX | 2g |
| 1241682-84-7 | O=C(OC(C)(C)C)[C@H](N)CC1=CC=CC(Br)=C1 | (R)-tert-Butyl 2-amino-3-(3-bromophenyl)propanoate | AG000LM2 | 20g |
| 1241680-33-0 | O=C(O)[C@H](N)CC1=CC=C(O)C(Br)=C1 | (R)-2-Amino-3-(3-bromo-4-hydroxyphenyl)propanoic acid | AG000LM4 | 3g |
| 1241680-31-8 | N[C@H](CC1=CC(Cl)=CC(Cl)=C1)C(O)=O | (2R)-2-Amino-3-(3,5-dichlorophenyl)propanoic acid | AG000LM5 | 10g |
| 1241678-48-7 | C[C@H](N)C1=CC(F)=CC(Cl)=C1 | (S)-1-(3-Chloro-5-fluorophenyl)ethanamine | AG000LM9 | 2g |
| 1241677-90-6 | O=C(O)[C@H](N)CC1=CC=C(OC(F)(F)F)C=C1 | (2R)-2-Amino-3-[4-(trifluoromethoxy)phenyl]propanoic acid | AG000LMB | 3g |
| 1241677-87-1 | O=C(O)[C@H](N)CC1=CC=CC(I)=C1 | (R)-2-Amino-3-(3-iodophenyl)propanoic acid | AG000LMC | 10g |
| 124170-06-5 | FC(F)(F)OC1=CC=C(F)C([N+]([O-])=O)=C1 | 1-Fluoro-2-nitro-4-(trifluoromethoxy)benzene | AG000LMF | 50g |
| 1239611-34-7 | CC(Oc1ccc(c(n1)C)Br)C | 3-Bromo-6-isopropoxypicoline | AG000LAJ | 15.5g |
| 123973-31-9 | NC1=C(F)C=C(C(F)(F)F)C=C1Cl | 2-Chloro-6-fluoro-4-(trifluoromethyl)aniline | AG000LAN | 50g |
| 123973-25-1 | FC(F)(F)C1=CC=CC(N)=C1F | 3-Amino-2-fluorobenzotrifluoride | AG000LAO | 200g |
| 123973-22-8 | NC1=CC=CC(F)=C1C(F)(F)F | 2-Amino-6-Fluorobenzotrifluoride | AG000LAP | 500g |
| 123971-45-9 | NC1=NC(=CS1)C1=CC=C(Cl)S1 | 4-(5-Chlorothiophen-2-yl)thiazol-2-amine | AG000LAU | 5g |
| 123968-25-2 | CCC(C)(C)c1cc(C(C)c2cc(cc(c2OC(=O)C=C)C(C)(C)CC)C(C)(C)CC)c(O)c(c1)C(C)(C)C | Antioxidant GS | AG000LAY | 3500g |
| 1239875-86-5 | N#CCC1=CC=CC(C2=C3C(NC=C3C)=NC(NC4=CC=C(N5CCN(C)CC5)C(F)=C4)=N2)=C | SGI-7079 | AG000LB0 | 0.075g |
| 123987-12-2 | OCC2(=C(N1(CCN(C)CC1))C=CC=C2) | [2-(4-Methylpiperazin-1-yl)phenyl]methanol | AG000LB8 | 1g |
| 123986-64-1 | C(NC(=O)OC(C)(C)C)c1ccc(cc1)CO | Carbamic acid, N-[[4-(hydroxymethyl)phenyl]methyl]-, 1,1-dimethylethyl est | AG000LB9 | 200g |
| 123983-05-1 | OC1=CC=CC=C1[C@H](N)C | 2-[(1R)-1-Aminoethyl]-phenol | AG000LBD | 10g |
| 123982-81-0 | OC1=CC=CC([C@@H](N)C)=C1 | (S)-3-(1-Aminoethyl)Phenol | AG000LBE | 0.3g |
| 123973-75-1 | CC1=C(C2=CC=CC=C2N1)C3=CC(=O)C4=CC=CC=C4C3=O | 2-(2-Methyl-1H-indol-3-yl)naphthalene-1,4-dione | AG000LBM | 9g |
| 123973-36-4 | [O-][N+](=O)C1=C(F)C(=C(F)C=C1)C(F)(F)F | 1,3-Difluoro-4-nitro-2-(trifluoromethyl)benzene | AG000LBN | 450g |
| 1239908-20-3 | O=C1C(CC(O)=O)(CC(O)=O)OB([C@@H](NC(CNC(C2=CC(Cl)=CC=C2Cl)=O)=O)CC | Ixazomib citrate | AG000LBQ | 14g |
| 1239880-00-2 | BrC1=CN2C=NC=C2C=C1 | 6-Bromoimidazo[1,5-a]pyridine | AG000LBS | 50g |
| 1239879-72-1 | BrC1=CC=C(C2=C1)N=C3N2CCNCC3 | 9-Bromo-2,3,4,5-tetrahydro-1H-benzo[4,5]imidazo[1,2-d][1,4]diazepine | AG000LBT | 0.75g |
| 1239879-65-2 | BrC=1C=CC2=C(N=C3N2CCNCC3)C1 | 8-Bromo-2,3,4,5-tetrahydro-1H-benzo[4,5]imidazo[1,2-d][1,4]diazepine | AG000LBU | 3g |
| 123994-49-0 | O=S(=O)(C(F)(F)F)OC1=CCCc2c1cccc2 | Methanesulfonic acid, 1,1,1-trifluoro-, 3,4-dihydro-1-naphthalenyl ester | AG000LC3 | 0.75g |
| 1240390-36-6 | O=C(OC(C)(C)C)N[C@H]1COCC[C@H]1N | tert-Butyl ((3R,4R)-4-aminotetrahydro-2H-pyran-3-yl)carbamate | AG000LFP | 10g |
| 1240390-32-2 | O[C@@H]1[C@@H](N)COCC1 | (3S,4S)-3-AMINO-4-HYDROXY-TETRAHYDROPYRAN | AG000LFQ | 5.044g |
| 1240390-28-6 | O=C(C1=CN=C(Cl)N=C1Cl)N | 2,4-Dichloropyrimidine-5-carboxylic acid amide | AG000LFR | 188.5g |
| 1240361-06-1 | O=C(C1=C(NC(OC(C)(C)C)=O)SC2=C1CCCC2)O | 2-tert-Butoxycarbonylamino-4,5,6,7-tetrahydro-benzo[b]thiophene-3-carbox | AG000LFT | 50g |
| 124045-51-8 | O=C(OC(C)(C)C)N(CC#C)C | tert-Butyl methyl(prop-2-yn-1-yl)carbamate | AG000LFU | 50g |
| 124041-00-5 | O(C1=CC=CC=C1)C2=NC=NC(=C2)Cl | 4-Phenoxy-6-chloropyrimidine | AG000LG1 | 30g |
| 124038-36-4 | O=C(OC)C1=CC=CC(C2OCCO2)=C1 | Methyl 3-(1,3-dioxolan-2-yl)benzoate | AG000LG4 | 0.5g |
| 124035-08-1 | ClC1=CC=C2NC(C3CCCCC3)=NC2=C1 | 5-Chloro-2-cyclohexyl-1h-benzimidazole | AG000LG7 | 9g |
| 1240583-48-5 | O=C(N1[C@@H](C2=CC=CC=C2)CNCC1)OC(C)(C)C | (S)-tert-Butyl 2-phenylpiperazine-1-carboxylate | AG000LGD | 15g |
| 1240568-16-4 | O=[N+](C1=CN(C2CC2)N=C1)[O-] | 1-cyclopropyl-4-nitro-1H-pyrazole | AG000LGH | 10g |
| 1240567-18-3 | NC1=CN(C2CC2)N=C1 | 1-cyclopropyl-1H-pyrazol-4-amine | AG000LGI | 50g |
| 1240565-06-3 | NC1=NN(C2CC2)C=C1 | 1-Cyclopropyl-1H-pyrazol-3-amine | AG000LGJ | 50g |
| 1240529-10-5 | O=C(C1(N)CCC(F)(F)CC1)O | 1-amino-4,4-difluorocyclohexanecarboxylic acid | AG000LGL | 100g |
| 1240527-25-6 | NC1=CC2=C(N(C)CC2)C=C1.[H]Cl.[H]Cl | 1-Methylindolin-5-amine dihydrochloride | AG000LGM | 6g |
| 1240526-59-3 | Cl.OC(C1C2CNCC1CC2)=O | 3-Azabicyclo[3.2.1]octane-8-carboxylic acid hydrochloride | AG000LGN | 5g |
| 1240518-54-0 | NC1=NNC2=CC=CC(C#N)=C12 | 3-Amino-1H-indazole-4-carbonitrile | AG000LGQ | 75g |
| 1236162-31-4 | Cl.Cl.NCc1n[nH]c(N)nc1=O | 3-Amino-6-(aminomethyl)-1,2,4-triazin-5(4h)-one DiHCl | AG000KV9 | 30g |
| 1236162-22-3 | OC1=C2C=CC=NC2=CC(Cl)=C1 | 7-Chloroquinolin-5-ol | AG000KVB | 10g |
| 1236144-51-6 | CC(C)(C)OC(=O)C1CN(C(=O)OCc2ccccc2)C1 | 1-Benzyl 3-tert-butyl azetidine-1,3-dicarboxylate | AG000KVG | 25g |
| 1236141-95-9 | O=CC1=C(C(F)(F)F)C=CC=C1Br | 2-Bromo-6-(trifluoromethyl)benzaldehyde | AG000KVH | 10g |
| 1236132-25-4 | Cl.NC[C@@H]1CC[C@H](O)CC1 | cis-4-(aminomethyl)cyclohexanol hydrochloride | AG000KVI | 5g |
| 123620-80-4 | C[C@@H](N1CCCC1)[C@H](C2=CC=CC=C2)O | (1S,2R)-1-Phenyl-2-(pyrrolidin-1-yl)propan-1-ol | AG000KVK | 9g |
| 1236303-09-5 | O=C(OC)C1=CC=C(C(F)(F)F)C=C1I | Methyl 2-iodo-4-(trifluoromethyl)benzoate | AG000KVW | 30g |
| 1236254-79-7 | O=C(OCC)C(N)C1=NC=CC=C1.[H]Cl.[H]Cl | Ethyl 2-amino-2-(2-pyridinyl)acetate DiHCl | AG000KW2 | 10g |
| 1236201-15-2 | Nc1ncnn2ccc(C(=O)O)c12 | 4-AMINOPYRROLO[2,1-F][1,2,4]TRIAZINE-5-CARBOXYLIC ACID | AG000KW4 | 0.5g |
| 123622-48-0 | C(OC(=O)NCCCCC(=O)O)C1c2c(c3c1cccc3)cccc2 | Pentanoic acid, 5-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]- | AG000KWD | 2500g |
| 1236365-97-1 | O=CC1N(CC2CC2)N=CC=1 | 2-(Cyclopropylmethyl)pyrazole-3-carbaldehyde | AG000KWK | 3.2g |
| 1236365-81-3 | O=CC1=CC=C(F)C(OC(C)C)=C1 | 4-Fluoro-3-isopropoxybenzaldehyde | AG000KWL | 2g |
| 1236357-65-5 | O=C(C1(C2=CC=C(Br)C=C2)CCC1)OC | 1-(4-Bromophenyl)cyclobutanecarboxylic acid methyl ester | AG000KWO | 50g |
| 1236353-78-8 | O=C(OC)C1=CC=CC([C@H](N)C)=C1.[H]Cl | (R)-Methyl 3-(1-aminoethyl)benzoate hydrochloride | AG000KWP | 0.1g |
| 123694-03-1 | CC(=O)/C=C/c1ccc(c(c1)O)O | (E)-4-(3,4-Dihydroxyphenyl)but-3-en-2-one | AG000KY7 | 0.1g |
| 123690-79-9 | CCOC(OCC)P(=O)(CCCN)O | P-(3-Aminopropyl)-P-(diethoxymethyl)phosphinic acid | AG000KYE | 0.75g |
| 123690-78-8 | O=P(CCCN)(CCCC)O | CGP 36742 | AG000KYF | 0.05g |
| 123688-59-5 | N#CC1=CC(F)=C(Br)C(F)=C1 | 4-Bromo-3,5-difluorobenzonitrile | AG000KYL | 500g |
| 123702-97-6 | C([C@@H]1OC2=CC3OC(C4C=C(O)C=C(O)C=4)=CC=3C=C2C1)(O)(C)C | Moracin O | AG000KYT | 0.1g |
| 1237-75-8 | COc1ccccc1NC(=O)c1cc2cc(Br)ccc2cc1O | 7-Bromo-3-hydroxy-N-(2-methoxyphenyl)-2-naphthamide | AG000KZ5 | 2g |
| 1237117-14-4 | O=C(C1=CC=C(C2=CC=CC=C2Cl)C=C1Cl)O | 2-Chloro-4-(2-chlorophenyl)benzoic acid | AG000KZD | 20g |
| 1237084-18-2 | OC(=O)C1=C(Cl)C=C(OCC2CC2)C=C1 | 2-Chloro-4-(cyclopropylmethoxy)benzoic acid | AG000KZF | 5g |
| 123715-02-6 | O=C(O)[C@@H](N)CC1=C(C)C=C(O)C=C1C | (S)-2-Amino-3-(4-Hydroxy-2,6-Dimethylphenyl)Propanoic Acid | AG000KZP | 15g |
| 123707-26-6 | CON(C)C(=O)N(C)OC | 1，3-Dimethoxy-1，3-dimethylurea | AG000KZX | 25g |
| 123730-67-6 | C(C)OC(=O)C1(CCN(CC1)CC2=CC=CC=C2)C#N | 1-Benzyl-4-Cyano-4-Piperidinecarboxylic Acid Ethyl Ester | AG000L04 | 200g |
| 123730-64-3 | O=C(C1(C#N)CCNCC1)OCC.[H]Cl | Ethyl 4-cyanopiperidine-4-carboxylate hydrochloride | AG000L05 | 3g |
| 1237479-38-7 | O=C(C1=C(F)C2=C(Br)SC(Br)=C2S1)OCC(CC)CCCC | 2-Ethylhexyl 4,6-dibromo-3-fluorothieno[3,4-b]thiophene-2-carboxylate | AG000L0Q | 2g |
| 123750-60-7 | O=S(C1=CC=C([N+]([O-])=O)C=C1)(OC[C@H]2CO2)=O | (R)-Oxiran-2-ylmethyl 4-nitrobenzenesulfonate | AG000L0T | 130g |
| 123732-04-7 | C1(C=CC(=CC=1)OCCCCCCC)Br | 1-Bromo-4-(Heptyloxy)Benzene | AG000L1C | 25g |
| 123536-15-2 | N[C@H]1CN2CCC1CC2 | (3R)-1-Azabicyclo[2.2.2]octan-3-amine | AG000KQN | 1.5g |
| 123536-14-1 | N[C@H]1CN2CCC1CC2.[H]Cl.[H]Cl | (R)-(+)-3-Aminoquinuclidine DiHCl | AG000KQO | 25g |
| 123532-18-3 | OC1=CC=CC=C1C2=NN(C)C=C2 | 2-(1-Methyl-1H-pyrazol-3-yl)phenol | AG000KR2 | 10g |
| 123531-54-4 | N#CC1=CN=C2C=CC(Cl)=NN21 | 6-Chloroimidazo[1,2-b]pyridazine-3-carbonitrile | AG000KR3 | 15g |
| 1235407-34-7 | O=[N+](C1=C(Br)C=NN1C2CCCCO2)[O-] | 4-Bromo-5-nitro-1-(tetrahydro-2H-pyran-2-yl)-1H-pyrazole | AG000KR7 | 2g |
| 1235407-33-6 | O=[N+](C1=NN(C2CCCCO2)C=C1Br)[O-] | 1H-Pyrazole, 4-bromo-3-nitro-1-(tetrahydro-2H-pyran-2-yl)- | AG000KR8 | 26g |
| 1235406-42-4 | O=C(OC(C)(C)C)NC1=CSC=N1 | Tert-Butyl Thiazol-4-Ylcarbamate | AG000KRG | 600g |
| 1235406-28-6 | S(=O)(=O)(Nc1nccs1)c1cc(C#N)c(cc1)F | 3-Cyano-4-fluoro-N-(thiazol-2-yl)benzenesulfonamide | AG000KRH | 3g |
| 1235403-62-9 | NC1=NNC=C1C1=C(OC2=CC(=C(C=C2Cl)S(=O)(=O)NC=2N=CSC2)F)C=CC(=C1)Cl | 4-(2-(3-Amino-1H-pyrazol-4-yl)-4-chlorophenoxy)-5-chloro-2-fluoro-N-(thiaz | AG000KRK | 0.1g |
| 1235387-14-0 | COC(=O)[C@@H]1COCCN1CC1=CC=CC=C1 | Methyl (S)-4-Benzyl-3-morpholinecarboxylate | AG000KRL | 10g |
| 1235481-90-9 | BrC(C=C1)=CC2=C1N(CC(CNC3=CC(OC)=CC=C3)F)C4=CC=C(Br)C=C42 | P7C3-A20 | AG000KRT | 0.2g |
| 1235481-43-2 | COC1=CC=CC(NC[C@H](O)CN2C3=CC=C(Br)C=C3C4=CC(Br)=CC=C42)=C1 | (R)-1-(3,6-dibroMo-9H-carbazol-9-yl)-3-(3-MethoxyphenylaMino)propan-2-ol | AG000KRU | 0.1g |
| 124312-73-8 | CN1C=CN=C1CN | (1-Methyl-1H-imidazol-2-yl)methanamine | AG000LTO | 20g |
| 124309-74-6 | Nc1nc(Cl)c2ccccc2n1 | 4-Chloroquinazolin-2-amine | AG000LTW | 1g |
| 124305-68-6 | FC(C1=CC(C2(C#N)CC2)=CC=C1)(F)F | 1-(3-(Trifluoromethyl)phenyl)cyclopropanecarbonitrile | AG000LTY | 10g |
| 1243259-19-9 | O=C([C@@H](N)[C@@H](C)CC)NCCN1CCOCC1.Cl.Cl | LM11A-31 (hydrochloride) | AG000LU5 | 0.75g |
| 1243244-14-5 | O=C(NC1=NC=C(C2=NC=CN=C2)C=C1)CC3=CN=C(C4=CC(C)=NC=C4)C(C)=C3 | 2-(2′,3-Dimethyl-[2,4′-bipyridin]-5-yl)-N-(5-(pyrazin-2-yl)pyridin-2-yl)acetami | AG000LUA | 0.5g |
| 1243243-89-1 | O=C(NC1=CC=C(C2=CC=CN=C2)C=C1)CC3=CC=C(C4=CC(C)=NC=C4)C=C3 | 2-(4-(2-Methylpyridin-4-yl)phenyl)-N-(4-(pyridin-3-yl)phenyl)acetamide | AG000LUB | 0.5g |
| 1243174-57-3 | Cl.[C@@H](CC(C)C)(N)B1OC(C(O1)(C)C)(C)C | 1,3,2-Dioxaborolane-2-methanamine, 4,4,5,5-tetramethyl-α-(2-methylpropyl | AG000LUE | 50g |
| 1243360-12-4 | Fc1ccc2c(Cl)n[nH]c2c1 | 3-chloro-6-fluoro-1H-indazole | AG000LUT | 0.5g |
| 1243312-43-7 | O(C)c1c(ccnc1)B1OC(C(O1)(C)C)(C)C | 3-Methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine | AG000LV0 | 10g |
| 1243308-37-3 | O=C(OCC)C(NC1=NC=C(Cl)C=C1)=O.[H]Cl | Ethyl 2-((5-chloropyridin-2-yl)amino)-2-oxoacetate hydrochloride | AG000LV2 | 1500g |
| 1243288-53-0 | BrC1=CN(C(C=N1)=O)C | 5-Bromo-1-methyl-1h-pyrazin-2-one | AG000LV3 | 50g |
| 1243281-23-3 | N#CC1=CC=CC(O)=C1OC | 3-Hydroxy-2-methoxybenzonitrile | AG000LV5 | 10g |
| 1243279-74-4 | N#CC1=CC=CC(O)=C1C(C)C | 3-Hydroxy-2-(propan-2-yl)benzonitrile | AG000LV6 | 1.25g |
| 124335-65-5 | N1(CCN(CC1)CCO)CC(O)=O | 2-(4-(2-Hydroxyethyl)Piperazin-1-Yl)Acetic Acid | AG000LV8 | 5g |
| 1243415-14-6 | CC1CNC(=O)C2=CC=CN12 | 4-Methyl-3,4-dihydropyrrolo[1,2-a]pyrazin-1(2H)-one | AG000LVI | 1.5g |
| 1243414-96-1 | OC1=CC(CN)=CN=C1 | 5-(Aminomethyl)pyridin-3-ol | AG000LVK | 5g |
| 1243395-68-7 | O=CC1=CC=C(O)C=C1C(F)(F)F | 4-Hydroxy-2-(trifluoromethyl)benzaldehyde | AG000LVM | 20g |
| 1243391-44-7 | O=C(O)C1=CC=C(O)C(OCC2CC2)=C1 | 3-(Cyclopropylmethoxy)-4-hydroxybenzoic acid | AG000LVO | 10g |
| 187752-72-3 | C[C@H]1C[C@@H](C(O)=O)N(C(OC(C)(C)C)=O)CC1 | cis-1-(tert-Butoxycarbonyl)-4-methylpiperidine-2-carboxylic acid | AG000L48 | 5g |
| 123812-79-3 | OC([C@@H]1C[C@@H](F)C1)=O | Trans-3-fluorocyclobutane-1-carboxylic acid | AG000L4C | 5g |
| 123812-78-2 | OC([C@@H]1C[C@H](F)C1)=O | cis-3-fluorocyclobutane-1-carboxylic acid | AG000L4D | 1g |
| 123811-87-0 | CC(OC(N1C2=C(C=CC=C2)CCC1C(O)=O)=O)(C)C | 1-Boc-1,2,3,4-tetrahydro-quinoline-2-carboxylic acid | AG000L4E | 245g |
| 123811-75-6 | O=C(O)C1=NC=CC(C(C)(C)C)=C1.[H]Cl | 4-(tert-Butyl)picolinic acid hydrochloride | AG000L4G | 0.5g |
| 123811-72-3 | O=C(O)C1=NC=CC=C1C.[H]Cl | 3-Methylpyridine-2-carboxylic acid, HCl | AG000L4J | 75g |
| 1238324-73-6 | CC(C)(C)OC(=O)NC1=C(C=O)C=CN=C1Cl | tert-Butyl (2-chloro-4-formylpyridin-3-yl)carbamate | AG000L4Y | 2g |
| 1238214-63-5 | O=C(C1=CC(Cl)=CC2=C1NC=C2)OC | Methyl 5-chloro-1H-indole-7-carboxylate | AG000L52 | 3g |
| 123846-66-2 | N#CCC1=NC=C([N+]([O-])=O)C=C1 | 2-(5-Nitropyridin-2-yl)acetonitrile | AG000L5K | 10g |
| 123843-69-6 | O=C(OC1=CC(F)=C(C#N)C(F)=C1)C2=CC=C(CCCCC)C=C2 | 4-Cyano-3,5-Difluorophenyl 4-Pentyl-Benzoate | AG000L5Q | 500g |
| 123843-67-4 | N#CC1=C(F)C=C(Br)C=C1F | 4-Bromo-2,6-difluorobenzonitrile | AG000L5R | 1000g |
| 123843-66-3 | COC1=CC(F)=C(C#N)C(F)=C1 | 2,6-Difluoro-4-methoxybenzonitrile | AG000L5S | 125g |
| 123843-65-2 | O=C(O)C1=C(F)C=C(OC)C=C1F | Benzoic acid, 2,6-difluoro-4-methoxy- | AG000L5T | 50g |
| 123843-64-1 | CCCCOC1=CC(F)=CC(F)=C1 | 1-Butoxy-3,5-difluorobenzene | AG000L5U | 1g |
| 1235469-00-7 | CC1(C)C(C)(C)OB(C2=CC3=C(N(C)N=C3)C=C2)O1 | 1-Methylindazole-5-boronic acid pinacol ester | AG000KRW | 100g |
| 1235451-62-3 | O=C(N1CCC2=C1C=CC=C2B3OC(C)(C)C(C)(C)O3)OC(C)(C)C | tert-Butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indoline-1-carboxyl | AG000KRY | 0.5g |
| 1235451-38-3 | O=C(OC(C)(C)C)NCC1=NC=C(Br)C=N1 | N-BOC-5-BROMO-2-PYRIMIDINEMETHANAMINE | AG000KRZ | 20g |
| 1235450-86-8 | O=C(C1=NC(CC)=NC=C1Br)O | 5-Bromo-2-ethylpyrimidine-4-carboxylic acid | AG000KS1 | 2g |
| 1235440-18-2 | O=C1NCC(N)CC1.[H]Cl | 5-aminopiperidin-2-one hydrochloride | AG000KS7 | 10g |
| 1235440-17-1 | O=C1NC2(CCNCC2)C1 | 1,7-Diazaspiro[3.5]nonan-2-one | AG000KS8 | 40g |
| 1235639-75-4 | COC(=O)[C@H]1COCC(=O)N1CC1=CC=CC=C1 | Methyl (R)-4-benzyl-5-oxo-3-morpholinecarboxylate | AG000KSG | 10g |
| 1235566-57-0 | COc1cc(OC(C)C)cc(c1)Br | 1-bromo-3-isopropoxy-5-methoxybenzene | AG000KSI | 35g |
| 1235560-28-7 | O=S(C1=CC(C(N2C[C@](CCC3)([H])N3CC2)=O)=C(Cl)C=C1F)(NC4=CC=CC=C4F)=O | ABT-639 | AG000KSJ | 0.1g |
| 123560-48-5 | CCC[C@H]1CC[C@H]([C@H]2CC[C@H](C3=CC=C(OCC)C(F)=C3F)CC2)CC1 | Trans,trans-4′-(4-ethoxy-2,3-difluoro-phenyl)-4-propyl-bicyclohexyl | AG000KSQ | 300g |
| 123557-91-5 | CC(C)(C)C1=C2C(C(O)(C(F)(F)F)C(O2)=O)=CC(C(C)(C)C)=C1 | (R,S)-BHFF | AG000KSV | 0.2g |
| 123551-49-5 | COC1=NC(OC)=NC=C1Cl | 5-chloro-2,4-dimethoxypyrimidine | AG000KT0 | 20g |
| 1235865-76-5 | ClC1=CC=C(C2=C(CN3CCN(C4=CC(OC5=CN=C(NC=C6)C6=C5)=C(C(OC)=O)C=C4)C | Methyl 2-((1H-pyrrolo[2,3-b]pyridin-5-yl)oxy)-4-(4-((4′-chloro-5,5-dimethyl-3 | AG000KT4 | 0.6g |
| 1240612-08-1 | CC1=C(C)N=C(Br)O1 | 2-Bromo-4,5-dimethyloxazole | AG000LI2 | 5g |
| 1240610-45-0 | BrC1=CC=CC=2N(C(=NC21)Cl)C | 4-Bromo-2-chloro-1-methyl-1H-benzo[d]imidazole | AG000LI4 | 6g |
| 1240606-58-9 | CCOC(=O)CC1=CC=NC=N1 | Methyl 2-(pyrimidin-4-yl)acetate | AG000LI5 | 50g |
| 1240605-84-8 | [K+].CC1N=C(C([O-])=O)ON=1 | Potassium 3-methyl-1,2,4-oxadiazole-5-carboxylate | AG000LI7 | 5g |
| 1240602-95-2 | C(O)c1nc(Cl)cnc1 | (6-Chloropyrazin-2-yl)methanol | AG000LI8 | 10.9g |
| 124061-43-4 | OC1=CC=C(O)C=C1/C=N/CC/N=C/C2=CC(O)=CC=C2O | N,N-Bis(2,5-dihydroxybenzylidene)ethylenediamine | AG000LIE | 35g |
| 1240622-62-1 | FC(C1=C(Br)C(Cl)=NC(Cl)=N1)(F)F | 5-Bromo-2,4-dichloro-6-(trifluoromethyl)pyrimidine | AG000LIJ | 10g |
| 1240621-87-7 | OC1=CN=C(Br)N=C1 | 2-Bromopyrimidin-5-ol | AG000LIO | 400g |
| 124068-97-9 | O=C(OC1=CC=C([N+]([O-])=O)C=C1)NCC2=CC=CC=C2 | 4-NITRO-PHENYL-N-BENZYLCARBAMATE | AG000LIY | 30g |
| 1240783-02-1 | NCC1=NC=C(Br)C=N1 | 5-Bromo-2-pyrimidinemethanamine | AG000LJ6 | 0.15g |
| 1240782-81-3 | CC(C)(C)OC(=O)N1C[C@H]2CC[C@@H]1CN2 | (1R，4R)-tert-Butyl 2，5-diazabicyclo[2.2.2]octane-2-carboxylate | AG000LJ7 | 5g |
| 1240725-66-9 | ClC1=CN=C(NN=C2)C2=C1 | 5-chloro-1H-pyrazolo[3,4-b]pyridine | AG000LJ8 | 25g |
| 124078-87-1 | C1(=CC=CC=C1)N1CCN(CC1)CCC(=O)O | 3-(4-phenylpiperazin-1-yl)propanoic acid | AG000LJB | 2g |
| 124073-08-1 | N(C(=O)OC(C)(C)C)(CCCCC(=O)O)C | 5-((tert-Butoxycarbonyl)(methyl) amino)pentanoic acid | AG000LJH | 5g |
| 124072-89-5 | Cl.Cl.C1CCNNC1 | Hexahydropyridazine Dihydrochloride | AG000LJI | 175g |
| 124072-61-3 | O=C(O)CCN(C(OC(C)(C)C)=O)C | 3-[(tert-Butoxycarbonyl)(methyl)amino]propanoic acid | AG000LJK | 150g |
| 1242156-53-1 | FC1=C2C(C=CNC2=O)=CC(C2CC2)=C1 | 6-Cyclopropyl-8-fluoroisoquinolin-1(2H)-one | AG000LOZ | 5g |
| 1242156-51-9 | O=C(N)C1=C(C)C=C(Br)C=C1F | 4-Bromo-2-fluoro-6-methylbenzamide | AG000LP0 | 24g |
| 1242153-34-9 | NC1=CC=C(C2(C)CCN(C)CC2)C=C1 | 4-(1,4-DiMethylpiperidin-4-yl)aniline | AG000LP1 | 5g |
| 124225-99-6 | CN1C=CN=C1CC2=NC=CN2C | Bis(1-methyl-1H-imidazol-2-yl)methane | AG000LP4 | 2g |
| 124221-71-2 | O=C(C1=CC(C2=CC=CC(N)=C2)=CC=C1)O | 3′-Aminobiphenyl-3-carboxylic acid | AG000LP7 | 10g |
| 124221-69-8 | C1=CC(=CC(=C1)N)C2=CC=C(C=C2)C(=O)O | 4-(3-Aminophenyl)benzoic acid | AG000LP8 | 0.75g |
| 1242329-23-2 | NC1=NC=C(Br)C(Cl)=C1Br | 3,5-Dibromo-4-chloropyridin-2-amine | AG000LPF | 25g |
| 1242320-57-5 | O=C(OC)C1=NC=C(Br)C=C1O | Methyl 5-bromo-3-hydroxypicolinate | AG000LPG | 50g |
| 1242268-17-2 | O=C(C1CC12CCN(C(OC(C)(C)C)=O)CC2)OCC | 6-TERT-BUTYL 1-ETHYL 6-AZASPIRO[2.5]OCTANE-1，6-DICARBOXYLATE | AG000LPL | 3g |
| 1242339-08-7 | [H]Cl.[H]Cl.N1(C2CNCC2)N=CC=C1 | 1-Pyrrolidin-3-yl-1h-pyrazole dihydrochloride | AG000LQ0 | 2g |
| 1242336-81-7 | OC(C1SC2=C(C=C(C=N2)Br)C=1)=O | 5-bromothieno[2,3-b]pyridine-2-carboxylic acid | AG000LQ1 | 7.75g |
| 1242336-80-6 | O=C(O)C1=C(N)C=NC(Br)=C1 | 5-AMino-2-broMoisonicotinic acid | AG000LQ2 | 50g |
| 1242336-78-2 | NC1=C(C(O)=O)C=NC(F)=C1 | 4-Amino-6-fluoronicotinic acid | AG000LQ3 | 1g |
| 1242336-77-1 | Nc1n[nH]c2ncc(Br)nc12 | 3-Amino-5-bromo-1h-pyrazolo[3,4-b]pyrazine | AG000LQ4 | 1g |
| 1242336-70-4 | Brc1cc(OCc2ccccc2)cc(c1)C(=O)O | 3-Benzyloxy-5-bromobenzoic acid | AG000LQ8 | 15g |
| 1242336-69-1 | FC1=C(Br)C=C(NN=N2)C2=C1 | 6-Bromo-5-fluoro-1H-benzo[d][1,2,3]triazole | AG000LQ9 | 20g |
| 1242336-66-8 | CC(Oc1cc(Cl)cc(c1)Br)C | 1-Bromo-3-chloro-5-isopropoxybenzene | AG000LQB | 35g |
| 1242336-53-3 | COC1=C(N)N=CC(Cl)=C1 | 2-Amino-5-chloro-3-methoxypyridine | AG000LQN | 1.8g |
| 124168-59-8 | ClCc1cn2c(n1)cc(cc2)Cl | Imidazo[1,2-a]pyridine, 7-chloro-2-(chloromethyl)- | AG000LMI | 2g |
| 1241897-93-7 | BrC1=NOC(=C1)C(=O)N | 3-Bromoisoxazole-5-carboxamide | AG000LML | 5g |
| 1241894-37-0 | OCC1=CC(Br)=CC=C1[N+]([O-])=O | (5-Bromo-2-nitrophenyl)methanol | AG000LMM | 165g |
| 1241891-64-4 | BrC1=CC(C23C4=C(C=CC=C4)N(C5=CC=CC=C5)C6=CC=CC=C26)=C(C7=C3C=CC=C7) | 2′-Bromo-10-phenyl-10H-spiro[acridine-9,9′-fluorene] | AG000LMN | 5g |
| 1241752-35-1 | CCOc1ncc(cc1OCC)Br | 5-Bromo-2,3-diethoxypyridine | AG000LMP | 3.4g |
| 1241752-33-9 | COc1cc(Br)cnc1OC(C)C | 5-Bromo-2-isopropoxy-3-methoxypyridine | AG000LMQ | 15g |
| 1241752-29-3 | CCOC1=CC(Br)=CN=C1Cl | 5-bromo-2-chloro-3-ethoxypyridine | AG000LMS | 15g |
| 1241725-84-7 | Cl.C1CC2=C(CN1)SC=N2 | 4,5,6,7-Tetrahydrothiazolo[5,4-c]pyridine hydrochloride | AG000LMV | 2g |
| 124187-74-2 | O=c1[nH][nH]c2c1SCCC2 | Thiopyrano[3,2-c]pyrazol-3(5H)-one, 1,2,6,7-tetrahydro- | AG000LMY | 5g |
| 124185-35-9 | NC1=CC(C)=C(F)C=C1Cl | 2-Chloro-4-fluoro-5-methylaniline | AG000LN0 | 300g |
| 124185-34-8 | Fc1ccc(c(c1F)N)C(F)(F)F | 2,3-DIFLUORO-6-(TRIFLUOROMETHYL)ANILINE | AG000LN1 | 1g |
| 124184-67-4 | O=C(O)[C@H](NC(OC(C)(C)C)=O)CC(OC)=O | (R)-2-((Tert-Butoxycarbonyl)Amino)-4-Methoxy-4-Oxobutanoic Acid | AG000LN3 | 1000g |
| 120225-54-9 | CCNC([C@@H]1[C@@H](O)[C@@H](O)[C@H](N2C=NC3=C2N=C(NCCC4=CC=C( | 3-{4-[2-({6-amino-9-[(2R,3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2 | AG000LN7 | 0.02g |
| 1242057-00-6 | O=C(OC)CCC1=CC=C2C=C3C(=CC(=[N]3[B+3]([F-])([F-])[N-]21)C)C | Methyl 3-(5,5-Difluoro-1,3-Dimethyl-3H,5H-5L4-Dipyrrolo[1,2-C:2′,1′-F][1,3,2] | AG000LN9 | 0.5g |
| 1241911-26-1 | NCC1=NC=C(Br)C=C1.[H]Cl | (5-Bromopyridin-2-yl)methanamine hydrochloride | AG000LNJ | 10g |
| 1242137-20-7 | CC(C)(NC1=CC(F)=C(C=C1)C(N)=O)C(O)=O | 2-((4-Carbamoyl-3-fluorophenyl)amino)-2-methylpropanoic acid | AG000LNY | 5g |
| 124052-68-2 | O=C(C1=CC=C(C(N)=O)O1)N | Furan-2,5-dicarboxamide | AG000LGV | 25g |
| 1240597-30-1 | O=C(C1=CN=C(N)N=C1Cl)OCC | Ethyl 2-amino-4-chloropyrimidine-5-carboxylate | AG000LH4 | 20g |
| 1240595-43-0 | O=C(OCC)C1=CN=CC(Br)=C1N | Ethyl 4-amino-5-bromonicotinate | AG000LH7 | 10g |
| 1240594-92-6 | O=C(C1=CN=C(N)N=C1Cl)O | 2-Amino-4-chloropyrimidine-5-carboxylic acid | AG000LHA | 0.75g |
| 1240594-67-5 | OCC1=NC=CC(C(F)(F)F)=N1 | (4-(Trifluoromethyl)pyrimidin-2-yl)methanol | AG000LHB | 9g |
| 1240594-62-0 | Cl.NCC1=NC=C(Br)C=N1 | (5-Bromopyrimidin-2-yl)methanamine hydrochloride | AG000LHC | 1g |
| 1240590-33-3 | OC([C@@H]1NC(=O)CNC1)=O | (R)-6-Oxopiperazine-2-carboxylic acid | AG000LHH | 60g |
| 1240590-31-1 | OC(=O)[C@H]1CNC(=O)CN1 | (R)-5-Oxopiperazine-2-carboxylic acid | AG000LHI | 10g |
| 1240589-57-4 | C[C@@H]1CNCC(=O)N1 | (R)-6-Methyl-piperazin-2-one | AG000LHJ | 5g |
| 1240588-24-2 | C(C)(C)(C)[C@@H]1CN(CCN1)C(=O)OC(C)(C)C | (R)-tert-Butyl 3-(tert-butyl)piperazine-1-carboxylate | AG000LHK | 1.25g |
| 1240586-48-4 | C(=O)(OC(C)(C)C)N1[C@H](C)CN[C@@H](C1)C | 1-Piperazinecarboxylic acid, 2,5-dimethyl-, 1,1-dimethylethyl ester, (2R,5R)- | AG000LHL | 35g |
| 1240586-17-7 | O=C(N1[C@@H](C2CC2)CNCC1)OC(C)(C)C | (S)-Tert-Butyl 2-Cyclopropylpiperazine-1-Carboxylate | AG000LHM | 5g |
| 1240586-09-7 | CC(OC(N1CC(=O)N[C@H](C(O)=O)C1)=O)(C)C | (S)-4-(tert-Butoxycarbonyl)-6-oxopiperazine-2-carboxylic acid | AG000LHN | 4g |
| 1240584-74-0 | OC([C@H]1NC(=O)CNC1)=O | (S)-6-Oxopiperazine-2-carboxylic acid | AG000LHO | 20g |
| 1240584-34-2 | O=C(N1C[C@@H](C2=CC=CC=C2)NCC1)OC(C)(C)C | (R)-tert-Butyl 3-phenylpiperazine-1-carboxylate | AG000LHP | 35g |
| 1240620-56-7 | O=C1CCC(C2=CC=NC=C2)(C#N)CC1 | 4-OXO-1-(4-PYRIDINYL)CYCLOHEXANECARBONITRILE | AG000LHS | 1g |
| 1240620-05-6 | CC(C1=NC=C(OCC(F)(F)F)C=C1)=O | 1-(5-(2,2,2-Trifluoroethoxy)pyridin-2-yl)ethanone | AG000LHV | 5g |
| 124432-70-8 | COC1=NC=C(Br)C=C1F | 5-Bromo-3-fluoro-2-methoxypyridine | AG000M0S | 400g |
| 124432-63-9 | FC(C1=CN=C(OC)C(Br)=C1)(F)F | 3-Bromo-2-methoxy-5-trifluoromethylpyridine | AG000M0U | 20g |
| 124431-80-7 | O=C(O)CCC1=CC=C(CCNC2=NC(N)=C3N=CN([C@@H]4O[C@H](C(NCC)=O)[C@@ | CGS 21680 hydrochloride | AG000M0V | 0.75g |
| 124461-27-4 | Brc1ccccc1C(=O)N1CCCC1 | 1-(Pyrrolidin-1-ylcarbonyl)-2-bromobenzene | AG000M13 | 40g |
| 124459-91-2 | O=C(C1=NNC2=C1C=C(Cl)C(Cl)=C2)O | 5,6-Dichloro-1H-indazole-3-carboxylic acid | AG000M14 | 8g |
| 124458-27-1 | CC(S2)=NC1=C2CNCC1 | 4,5,6,7-Tetrahydro-2-methylthiazolo[5,4-c]pyridine | AG000M17 | 25g |
| 124458-11-3 | CC(N1CCC2=C(SC(N)=N2)C1)=O | 1-(2-Amino-6,7-dihydrothiazolo[5,4-c]pyridin-5(4H)-yl)ethanone | AG000M19 | 125g |
| 124456-04-8 | O=C(OC)[C@H](NC(OCC1=CC=CC=C1)=O)CC2=CC=C(O)C=C2 | Z-D-TYROSINE METHYL ESTER | AG000M1B | 500g |
| 124447-81-0 | NCCCC[C@@H](C(=O)N[C@H]1CSSC[C@H](NC(=O)[C@@H](NC(=O)[C@@H](N | Amylin receptor | AG000M1D | 0.03g |
| 124443-68-1 | O=C(N1CCC(C(OC)=O)CC1)OC(C)(C)C | Methyl (1-BOC-piperidin-4-yl)carboxylate | AG000M1H | 53000g |
| 1244642-73-6 | OC(=O)C1=CC(Br)=C(F)C(F)=C1 | 3-Bromo-4,5-difluorobenzoic acid | AG000M1S | 125g |
| 1244642-70-3 | O=C(OC)C1=CC(F)=C(F)C(Br)=C1 | Methyl 3-bromo-4,5-difluorobenzoate | AG000M1T | 700g |
| 124473-12-7 | COC1=C(C)C(CCl)=NC=C1 | 2-(chloromethyl)-4-methoxy-3-methylpyridine | AG000M27 | 275g |
| 124467-36-3 | O=C1C2=C(N=C(Cl)C=C2)CCC1 | 2-Chloro-7,8-dihydroquinolin-5(6H)-one | AG000M2A | 50g |
| 124467-23-8 | FC1=C2N=C(Cl)C=CC2=CC=C1 | 2-Chloro-8-Fluoroquinoline | AG000M2C | 25g |
| 124467-20-5 | ClC1=NC2=C(C=C1)C=C(I)C=C2 | 2-CHLORO-6-IODO-QUINOLINE | AG000M2E | 20g |
| 124276-75-1 | N#CC1(C2=CC=CC=C2Br)CC1 | 1-(2-Bromophenyl)Cyclopropanecarbonitrile | AG000LSC | 100g |
| 124276-67-1 | C(#N)C1(CC1)c1ccc(cc1)Br | 1-(4-bromophenyl)cyclopropanecarbonitrile | AG000LSD | 200g |
| 124276-61-5 | N#CC1(C2=CC=C(C(F)(F)F)C=C2)CC1 | 1-(4-(Trifluoromethyl)phenyl)cyclopropanecarbonitrile | AG000LSG | 10g |
| 124276-57-9 | N#CC1(C2=CC=C(Cl)C(Cl)=C2)CC1 | 1-(3,4-DICHLOROPHENYL)CYCLOPROPANECARBONITRILE | AG000LSH | 10g |
| 124276-55-7 | FC=1C=C(C=CC1)C1(CC1)C#N | 1-(3-Fluorophenyl)cyclopropanecarbonitrile | AG000LSI | 10g |
| 124276-34-2 | O=C(C1(C2=CC=CC(Cl)=C2)CC1)O | 1-(3-Chlorophenyl)cyclopropane-1-carboxylic acid | AG000LSK | 55g |
| 124276-32-0 | N#CC1(C2=CC=CC(Cl)=C2)CC1 | 1-(3-chlorophenyl)cyclopropanecarbonitrile | AG000LSL | 40g |
| 1242933-88-5 | OC(=O)[C@H](CCCCNC(=O)C1=CC2=C(C=C1)C1(OC2=O)C2=C(OC3=C1C=CC(O)=C | Fmoc-Lys(5-FAM)-OH | AG000LSQ | 2g |
| 1242822-57-6 | OCC1=C(Br)C=CC=C1Cl | (2-Bromo-6-chlorophenyl)methanol | AG000LST | 170g |
| 124300-38-5 | CC1=CN=C(C#CC2=CC=CC=C2)C=C1 | 5-Methyl-2-(phenylethynyl)pyridine | AG000LSU | 2g |
| 124289-24-3 | N#CC1=CC(CBr)=CC(Br)=C1 | 3-Bromo-5-(bromomethyl)benzonitrile | AG000LSZ | 10g |
| 124289-22-1 | N#CC1=CC([N+]([O-])=O)=CC(C)=C1 | 3-Methyl-5-nitrobenzonitrile | AG000LT0 | 50g |
| 124289-21-0 | BrC1=CC(=CC(=C1)C#N)C | 3-Bromo-5-methylbenzonitrile | AG000LT1 | 115g |
| 1243144-97-9 | BrC1=C(C(C(OC)=O)C(C)=O)C=CC=C1 | Methyl 2-(2-bromophenyl)-3-oxobutanoate | AG000LTG | 9g |
| 1243143-45-4 | OC1=CC=C(B2OC(C)(C)C(C)(C)O2)C=C1C(F)(F)F | 4-Hydroxy-3-trifluoromethylphenylboronic acid pinacol ester | AG000LTH | 50g |
| 1242085-06-8 | C[C@@H]1C[C@H](O)[C@]2([C@@H]([C@H]1C)C1=CC[C@H]3[C@@]([C@@]1( | Urs-12-ene-3,16,22-triol, (3β,16β,22α)- | AG000LO3 | 0.005g |
| 1242081-29-3 | O=C(N1C(=N[C@H]([C@@H]1c1ccccc1)c1ccccc1)C1=CC=CC(=[C]1)C1=N[C@H]([C | Palladium, [2,6-bis[(4S,5S)-1-benzoyl-4,5-dihydro-4,5-diphenyl-1H-imidazol- | AG000LO4 | 0.1g |
| 1242070-98-9 | O=C(O)C1=C(F)C=C(C=O)C=C1F | 2,6-Difluoro-4-forMylbenzoic acid | AG000LO6 | 10g |
| 1242070-97-8 | CC(Oc1c(Br)ccc(c1F)F)C | 1-Bromo-3,4-difluoro-2-isopropoxybenzene | AG000LO7 | 145g |
| 1242070-95-6 | CCCCOc1c(Cl)cc(cc1Cl)Br | 5-Bromo-2-butoxy-1,3-dichlorobenzene | AG000LO8 | 45g |
| 1242070-94-5 | CCOc1ncc(cc1C=O)Br | 5-Bromo-2-ethoxynicotinaldehyde | AG000LO9 | 5g |
| 1242070-92-3 | CC(OC1=CC(F)=C(C=O)C=C1)C | 2-Fluoro-4-isopropoxybenzaldehyde | AG000LOA | 0.5g |
| 1242066-20-1 | OP1(OC2=C(C3=C4C=CC=CC4=CC=C3)C=C5CCCCC5=C2C6=C7CCCCC7=CC(C8=C9C= | (11bR)-4-Hydroxy-2,6-di(naphthalen-1-yl)-8,9,10,11,12,13,14,15-octahydrodin | AG000LOE | 2g |
| 124215-44-7 | CC1(C)OB(CCCBr)OC1(C)C | 3-BROMOPROPYLBORONIC ACID, PINACOL ESTER | AG000LOF | 50g |
| 124211-72-9 | CC(C1=CC=C(C(C(F)(F)F)=O)C=C1)C | 2,2,2-trifluoro-1-[4-(propan-2-yl)phenyl]ethan-1-one | AG000LOH | 2g |
| 1242258-38-3 | FC1=CC(OC(F)F)=CC=C1Br | 4-(Difluoromethoxy)-2-fluorobromobenzene | AG000LON | 10g |
| 1242258-31-6 | C1=CC(=C(C(=C1)F)OC(F)(F)F)Br | 1-Bromo-3-fluoro-2-(trifluoromethoxy)benzene | AG000LOO | 25g |
| 1242251-52-0 | OC1=C(N)C(Cl)=NC=C1 | 3-Amino-2-chloropyridin-4-ol | AG000LOP | 20g |
| 1242240-00-1 | CNC1CCN(C(=O)OC(C)(C)C)CC1(C)C | 1-BOC-4-METHYLAMINO-3,3-DIMETHYLPIPERIDINE | AG000LOQ | 5g |
| 1242157-23-8 | CC1=CC(Br)=CC(F)=C1C(O)=O | 4-Bromo-2-fluoro-6-methylbenzoic acid | AG000LOU | 500g |
| 1242157-14-7 | FC1=C2C(=O)CCC2=CC(Br)=C1 | 5-Bromo-7-fluoro-1-indanone | AG000LOV | 200g |
| 1242156-59-7 | O=C1NN=CC2=C1C(F)=CC(C(C)(C)C)=C2 | 6-(tert-Butyl)-8-fluorophthalazin-1(2H)-one | AG000LOY | 1.75g |
| 124529-07-3 | SC[C@H](C(=O)O)NC(=O)C(C)C | D-Cysteine, N-(2-methyl-1-oxopropyl)- | AG000M5H | 0.5g |
| 124529-02-8 | SC[C@@H](C(=O)O)NC(=O)C(C)C | L-Cysteine,N-(2-methyl-1-oxopropyl)- | AG000M5J | 1g |
| 124526-56-3 | OC=1C=CC(=CC1)C=2C=CC=C(C2)C=3C=CC(O)=CC3 | 4,4′′-Dihydroxy-m-terphenyl | AG000M5K | 2g |
| 124522-09-4 | COc1ccc2nc(CBr)c(=O)oc2c1 | 3-Bromomethyl-7-methoxy-1,4-benzoxazin-2-one | AG000M5Q | 1g |
| 124522-01-6 | CCCCCCCCCCCCCCCCCC(=O)Oc1ccc(c(c1)O)N=Nc1ccc(cc1)[N+](=O)[O-] | Octadecanoic acid,3-hydroxy-4-[2-(4-nitrophenyl)diazenyl]phenyl ester | AG000M5R | 0.05g |
| 1245319-54-3 | O=C(N1CCN(CC1)C2=C3N=C(C4=CN=CC=C4)SC3=NC(N)=N2)NC5=CC=C(C)C=C5 | PI4KIIIbeta Inhibitor 3 | AG000M60 | 0.01g |
| 124529-64-2 | CC(OC(NCCCCCCN1C(=O)C=CC1=O)=O)(C)C | tert-Butyl 6-(2,5-dioxo-2h-pyrrol-1(5h)-yl)hexylcarbamate | AG000M6J | 25g |
| 1245563-11-4 | CC1=CC(=CC(=C1)Br)OCC2CC2 | 1-Bromo-3-(cyclopropylmethoxy)-5-methylbenzene | AG000M6M | 10g |
| 1245563-09-0 | COC(=O)C(C(=O)OC)c1ncc(Br)cc1[N+]([O-])=O | Dimethyl 2-(5-bromo-3-nitropyridin-2-yl)malonate | AG000M6O | 17.1g |
| 1245563-06-7 | CCCCOc1c(Br)cc(cc1Br)C | 1,3-Dibromo-2-butoxy-5-methylbenzene | AG000M6R | 70g |
| 1245532-88-0 | C(C=1C(=C(C(=C(C1)C)C)Br)OC)(=O)O | 3-bromo-2-methoxy-4,5-dimethylbenzoic acid | AG000M6S | 20g |
| 1245524-02-0 | CC1(C)OB(OC1(C)C)C1=CC(Cl)=CC(F)=C1 | 3-Chloro-5-fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzene | AG000M6T | 2g |
| 1245506-62-0 | OC1=CN=C(Cl)N=C1C | 2-Chloro-5-hydroxy-4-MethylpyriMidine | AG000M6W | 50g |
| 1245506-61-9 | CC1=NC(Cl)=NC=C1OC | 2-Chloro-5-Methoxy-4-Methylpyrimidine | AG000M6X | 250g |
| 124555-44-8 | O[C@H]1C[C@@H](N)CCC1.[H]Cl | cis-3-Aminocyclohexanol hydrochloride | AG000M70 | 10g |
| 124555-43-7 | C1[C@@H](CCC[C@H]1N)O.Cl | Trans-3-amino-cyclohexanol hydrochloride | AG000M71 | 10g |
| 124555-42-6 | O[C@H]1C[C@@H](N)CC1 | Cis-(3-Amino)Cyclopentanol | AG000M72 | 20g |
| 1246549-93-8 | FC(C1=CC2=CC=C(Br)C=C2N=C1)(F)F | 7-Bromo-3-(trifluoromethyl)quinoline | AG000MJE | 4g |
| 1246549-62-1 | ClC1=CC2=C(C=C(Br)C=C2)N=C1 | 7-Bromo-3-chloroquinoline | AG000MJG | 20g |
| 1246548-95-7 | COC1=CC2=CC=C(Br)C=C2N=C1 | 7-Bromo-3-methoxyquinoline | AG000MJI | 0.2g |
| 1246548-55-9 | O=C1NCCNC1C2=CC=CC=C2OC | 3-(2-Methoxyphenyl)piperazin-2-one | AG000MJJ | 33g |
| 124655-63-6 | Cl.OC(=O)CC12CCCN1CCC2 | Tetrahydro-1h-pyrrolizine-7a(5h)-acetic acid, HCl | AG000MJN | 35g |
| 124655-17-0 | CC(C)(C)[C@@H](NC(OC(C)(C)C)=O)C(O)=O | (R)-N-(tert-Butoxycarbonyl)-tert-leucine | AG000MJO | 417g |
| 124655-09-0 | CC(C)(C)OC(C[C@H]1C[C@@H](CO)OC(C)(C)O1)=O | (4R-Cis)-6-Hydroxymethyl-2,2-Dimethyl-1,3-Dioxane-4-Acetic Acid 1,1-Dimet | AG000MJP | 1000g |
| 1246633-55-5 | OCC1=C(F)C=CC=C1B(O)O | 3-Fluoro-2-(hydroxymethyl)phenylboronic acid | AG000MJX | 15g |
| 1246633-54-4 | OCC1=C(B(O)O)C(F)=CC=C1 | (2-Fluoro-6-(hydroxymethyl)phenyl)boronic acid | AG000MJY | 25g |
| 1246633-53-3 | OCC1=CC=C(F)C=C1B(O)O | 5-Fluoro-2-hydroxymethylphenylboronic acid | AG000MJZ | 125g |
| 1246616-66-9 | O=C(C1=C(OCC2=CC=CC=C2)C(C(C(OC)=O)=CO1)=O)OC | Dimethyl 3-(benzyloxy)-4-oxo-4H-pyran-2,5-dicarboxylate | AG000MK1 | 200g |
| 1246609-06-2 | CN1C(C(O)=O)CNCC1 | 1-Methylpiperazine-2-carboxylic acid | AG000MK2 | 5g |
| 1246562-40-2 | CC1(C)C2=C(C3=C1C=CC=C3)C=CC(N(C4=CC=C(C5=CC=CC=C5)C=C4)C6=CC=C(Br)C | N-([1,1′-Biphenyl]-4-yl)-N-(4-bromophenyl)-9,9-dimethyl-9H-fluoren-2-amin | AG000MK3 | 300g |
| 1246560-33-7 | CC1=NC(C(C2=CN=C(N)N=C2)=N3)=C(N1C(C)C)N=C3N4CCOCC4 | 5-[9-Isopropyl-8-methyl-2-(morpholin-4-yl)purin-6-yl]pyrimidin-2-amine | AG000MK4 | 0.05g |
| 1246556-01-3 | NC1=CC=C2C=CC=NC2=C1.[H]Cl | 7-Aminoquinoline hydrochloride | AG000MK6 | 15g |
| 1246555-91-8 | Clc1cc2ccsc2cn1 | 5-CHLOROTHIENO[2,3-C]PYRIDINE | AG000MK7 | 5g |
| 124663-30-5 | C(OC)(=O)C1C=CC(=CC=1)COC1C=CC(=CC=1)C=O | Methyl 4-[(4-formylphenoxy)methyl]benzoate | AG000MK9 | 15g |
| 1246669-45-3 | CC1(C)C(C)(C)OB(C2=CC(N(C3=CC=CC=C3)C4=C5C=CC=C4)=C5C=C2)O1 | 9-Phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9H-carbazole | AG000MKG | 30g |
| 1246668-93-8 | O=C(C1=CC2=C(NC=C2)C=C1O)O | 6-Hydroxy-1H-indole-5-carboxylic acid | AG000MKH | 0.5g |
| 1245648-93-4 | N#CC1=C(I)C=CC=C1Br | 2-Bromo-6-iodobenzonitrile | AG000MC8 | 150g |
| 1245648-84-3 | N(C(=O)OC(C)(C)C)C1CC(=O)NC1 | Carbamic acid, N-(5-oxo-3-pyrrolidinyl)-, 1,1-dimethylethyl ester | AG000MCA | 125g |
| 1245648-36-5 | O=C1NC2=C(C(F)=CC=C2Br)C1=O | 7-Bromo-4-fluoroindoline-2,3-dione | AG000MCN | 10g |
| 1245648-32-1 | O=C(N1C(C(F)(F)F)CC(CC1)=O)OC(C)(C)C | tert-butyl 4-oxo-2-(trifluoromethyl)piperidine-1-carboxylate | AG000MCQ | 10g |
| 1245649-96-0 | ClC1=CN=C(NN=C2Br)C2=C1 | 3-Bromo-5-chloro-1H-pyrazolo[3,4-b]pyridine | AG000MCV | 1g |
| 1245649-93-7 | CC(C)(C)OC(=O)N1CCC2(C1)CCCN(Cc1ccccc1)C2 | tert-Butyl 7-benzyl-2,7-diazaspiro[4.5]decane-2-carboxylate | AG000MCX | 0.5g |
| 1245649-70-0 | COC(=O)C1CCC(=CC1)OS(=O)(=O)C(F)(F)F | Methyl 4-(((trifluoromethyl)sulfonyl)oxy)cyclohex-3-enecarboxylate | AG000MD0 | 2g |
| 1245649-52-8 | O=S(N1C=CC2=C(Cl)C([N+]([O-])=O)=CN=C21)(C3=CC=CC=C3)=O | 4-Chloro-5-nitro-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine | AG000MDA | 6500g |
| 1245649-51-7 | C[C@H](N)C1=NC(C2=CC=CC=C2)=CN1.Cl[H].Cl[H] | (S)-1-(4-Phenyl-1H-imidazol-2-yl)ethanamine dihydrochloride | AG000MDB | 199g |
| 1245649-46-0 | CCCCC1=CC(F)=CC(F)=C1 | 1-Butyl-3,5-Difluorobenzene | AG000MDD | 200g |
| 1245649-45-9 | CC1=CC2=CC=CN=C2N=C1Cl | 2-Chloro-3-methyl-1,8-naphthyridine | AG000MDE | 2g |
| 1245649-28-8 | CC1=CC(C)=CC([C@H]2NCCC2)=C1.[H]Cl | (S)-2-(3，5-Dimethylphenyl)pyrrolidine hydrochloride | AG000MDG | 0.25g |
| 1245748-66-6 | O=S1(=O)NS(=O)(=O)c2c(-c3c1ccc1c3cccc1)c1ccccc1cc2 | (S)-1,1′-Binaphthyl-2,2′-disulfonamide | AG000MDI | 5g |
| 1245745-55-4 | NC1=CN=CC(C2=NC=CC=C2)=C1 | [2,3′-Bipyridin]-5′-amine | AG000MDJ | 2g |
| 1245724-46-2 | N[C@@H]1COCCC1.[H]Cl | (S)-Tetrahydro-2H-pyran-3-amine, HCl | AG000MDN | 50g |
| 1245718-89-1 | O(C(=O)CCOCCOCCOCCN=[N+]=[N-])N1C(=O)CCC1=O | Propanoic acid, 3-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-, 2,5-dioxo-1-pyrrolidi | AG000MDO | 75g |
| 1245708-13-7 | O=C1NC2=CC=C(Br)N=C2OC1 | 6-Bromo-1H-pyrido[2,3-b][1,4]oxazin-2(3H)-one | AG000MDR | 8g |
| 1245700-93-9 | S(=O)(=O)(O)c1ccc(cc1)CCN.Cl | Benzenesulfonic acid, 4-(2-aminoethyl)-, hydrochloride (1:1) | AG000MDS | 2g |
| 1237588-13-4 | P(C12CC3CC(C2)CC(C3)C1)(C45CC6CC(C5)CC(C6)C4)C7=CC=CC=C7N8CCCCC8 | 1-(2-(Di(Adamantan-1-Yl)Phosphino)Phenyl)Piperidine | AG000L1E | 5g |
| 1237588-12-3 | N1(C2=CC=CC=C2P(C34CC5CC(C4)CC(C5)C3)C67CC8CC(C7)CC(C8)C6)CCOCC1 | N-[2-(Di-1-adamantylphosphino)phenyl]morpholine | AG000L1F | 20g |
| 1237542-10-7 | Cc1ccc(S(=O)(=O)N2CC3(C2)CC(C(=O)OC(C)C)(C(=O)OC(C)C)C3)cc1 | Diisopropyl 2-tosyl-2-azaspiro[3.3]heptane-6,6-dicarboxylate | AG000L1G | 0.5g |
| 1237535-78-2 | O=C1NC2=C(C(F)=CC=N2)CC1 | 5-fluoro-3,4-dihydro-1,8-naphthyridin-2(1H)-one | AG000L1I | 5g |
| 123770-62-7 | O=C(C1=NOC(CO)=C1)OCC | ethyl 5-(hydroxymethyl)-1,2-oxazole-3-carboxylate | AG000L1K | 200g |
| 123761-12-6 | NC(C(O)=O)CC1=NC2=C(C=CC=C2)C=C1 | 3-(2-Quinolyl)-dl-alanine | AG000L1U | 10g |
| 1237744-13-6 | O=C(O)C1=CC=C(N2C(/C=C/C3=CC=CC([N+]([O-])=O)=C3)=NC4=C(C=C(OC)C=C4) | QNZ46 | AG000L26 | 0.025g |
| 123771-23-3 | C1(C2CNCCC2)=NC3=CC=CC=C3N1 | 2-Piperidin-3-yl-1h-benzoimidazole | AG000L2K | 50g |
| 123792-59-6 | [O-][N+](=O)c1cnc2c(c1)CCCCC2 | 3-Nitro-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridine | AG000L2Y | 2g |
| 123784-07-6 | BrC1=CC=C(C2=NC=CC=C2)S1 | 2-(5-Bromothiophen-2-yl)pyridine | AG000L38 | 7g |
| 1238196-66-1 | B(O)(O)c1c(O)cc(cc1)Cl | Boronic acid, B-(4-chloro-2-hydroxyphenyl)- | AG000L46 | 50g |
| 124391-60-2 | OC(=O)C1=CC=C(C=C1C1=CC=CC=C1)[N+]([O-])=O | 4-Nitro-2-phenylbenzoic acid | AG000LXS | 5g |
| 124389-14-6 | OCCCCCCCCCCCOc1ccc(cc1)C=O | 4-(11-Hydroxyundecyloxy)benzaldehyde | AG000LXW | 3.1g |
| 1244061-69-5 | S=C(NC1=CC(C(F)(F)F)=CC(C(F)(F)F)=C1)N[C@@H]2[C@@H](N3CCCCC3)CCCC2 | N-[3,5-Bis(trifluoromethyl)phenyl]-N’-[(1S,2S)-2-(1-piperidinyl)cyclohexyl]th | AG000LYA | 0.3g |
| 1244029-51-3 | O=C(OC)CC1=CN=C2C=CC=CN21 | Methyl 2-(Imidazo[1,2-a]Pyridin-3-Yl)Acetate | AG000LYB | 28g |
| 124405-67-0 | ClC1=CN=C(Br)N=C1 | 2-BROMO-5-CHLOROPYRIMIDINE | AG000LYG | 200g |
| 124401-38-3 | N(C(=O)CC(=O)C(C)C)c1ccccc1 | Pentanamide, 4-methyl-3-oxo-N-phenyl- | AG000LYH | 200g |
| 124423-84-3 | O=C1N(C(C)C)C2=C(C=CC=C2)N2C1=C(C1N=C(C3CC3)ON=1)N=C2 | Panadiplon | AG000LZ1 | 0.001g |
| 124421-12-1 | CC1=CC(Cl)=C(N=C=O)C(C)=C1 | 1-chloro-2-isocyanato-3,5-dimethylbenzene | AG000LZ6 | 2g |
| 124421-11-0 | Cc1cc(C)c(c(c1)Cl)[N+](=O)[O-] | Benzene, 1-chloro-3,5-dimethyl-2-nitro- | AG000LZ7 | 13g |
| 124429-27-2 | FC1=C2N=CN=C(Cl)C2=CC=C1 | 4-Chloro-8-fluoroquinazoline | AG000LZO | 6g |
| 124425-87-2 | ClCC1=NC=CC=C1Cl.[H]Cl | 3-Chloro-2-(chloromethyl)pyridine hydrochloride | AG000M08 | 10g |
| 124425-84-9 | ClCC1=NC=C(Cl)C=C1.[H]Cl | 5-Chloro-2-(chloromethyl)pyridine hydrochloride | AG000M09 | 1g |
| 124436-59-5 | O=C(OCC)C1=CC=C(OCCC2CCN(C3=NN=C(C)C=C3)CC2)C=C1 | Pirodavir | AG000M0M | 0.2g |
| 124433-70-1 | O=S(C1=NC(F)=CC=C1)(N)=O | 6-Fluoropyridine-2-sulfonamide | AG000M0R | 10g |
| 1246509-59-0 | O=C(C1=CC([C@H](N)CCO2)=C2C=C1)OC.[H]Cl | (R)-Methyl 4-aminochroman-6-carboxylate hydrochloride | AG000MIG | 0.75g |
| 1246471-48-6 | CCOC(=O)CC1CCN(CC1)C1=NN=C(Cl)C=C1 | ETHYL 2-[1-(6-CHLORO-3-PYRIDAZINYL)-4-PIPERIDYL]ACETATE | AG000MIJ | 0.75g |
| 1246471-46-4 | Cl.CC(C)(N)CC(=O)N1CCCC1 | 3-Amino-3-methyl-1-pyrrolidino-1-butanone, HCl | AG000MIK | 500g |
| 1246471-45-3 | COC(C1=C(Cl)N=CN=C1)=O | Methyl 4-chloropyrimidine-5-carboxylate | AG000MIL | 50g |
| 1246471-43-1 | CSC1=NC=C2N(CCCC2=N1)C(=O)OC(C)(C)C | 5-Boc-2-(methylthio)-5,6,7,8-tetrahydropyrido[3,2-d]pyrimidine | AG000MIM | 2g |
| 1246471-39-5 | S=C1OC2=CC=CC(OC)=C2N1 | 4-Methoxybenzo[d]oxazole-2-thiol | AG000MIN | 2g |
| 1246471-38-4 | O=C(C1=CNN=C1C2CC2)OCC | Ethyl 3-cyclopropylpyrazole-4-carboxylate | AG000MIO | 50g |
| 1246471-36-2 | ClC1=CC2=C(C=C1)C(Br)=CN2C(OC(C)(C)C)=O | N-Boc-3-bromo-6-chloroindole | AG000MIP | 50g |
| 1246471-35-1 | CN(C)C1=NC=C2N(CCCC2=N1)C(=O)OC(C)(C)C | 5-Boc-2-(dimethylamino)-5,6,7,8-tetrahydropyrido[3,2-d]pyrimidine | AG000MIQ | 5g |
| 1246471-29-3 | CC(C)(C)OC(=O)n1cc(Br)c2ccc([N+](=O)[O-])cc21 | N-Boc-3-bromo-6-nitroindole | AG000MIS | 1g |
| 1246471-11-3 | O=[N+](C1=CC2=C(NC(Br)=C2)C=C1)[O-] | 2-bromo-5-nitro-1H-indole | AG000MIT | 50g |
| 1246555-47-4 | CCOC(=O)C1=CC=NN1C2=CC=CC=C2F | Ethyl 1-(2-fluorophenyl)-1h-pyrazole-5-carboxylate | AG000MJ2 | 1g |
| 1246553-28-5 | O=C(C(CN1)N(C(OC(C)(C)C)=O)CC1=O)O | 1-(tert-Butoxycarbonyl)-5-oxopiperazine-2-carboxylic acid | AG000MJ4 | 30g |
| 1246553-15-0 | BrC1=NNC2=C1CCCC2 | 3-Bromo-4,5,6,7-tetrahydro-1H-indazole | AG000MJ5 | 10g |
| 1246552-73-7 | COC1=NN2C(C=C1)=C(Br)C=N2 | 3-Bromo-6-methoxypyrazolo[1,5-b]pyridazine | AG000MJ6 | 2g |
| 1246552-63-5 | CCOC(=O)C1=C2C=NNC2=NC(O)=C1 | ETHYL 6-HYDROXY-1H-PYRAZOLO[3,4-B]PYRIDINE-4-CARBOXYLATE | AG000MJ8 | 2g |
| 1246551-25-6 | O=C(N1CC2N(C(NC2)=O)CC1)OC(C)(C)C | 7-Boc-3-oxohexahydroimidazo[1,5-a]pyrazine | AG000MJB | 20g |
| 1242422-55-4 | O=C(N)C1=CC=C(Cl)C(B2OC(C)(C)C(C)(C)O2)=C1 | 5-Carbamoyl-2-chlorophenylboronic acid, pinacol ester | AG000LQS | 6g |
| 1242419-39-1 | OC1=C(C=C2C=CC=CC2=C1C3=C(O)C(=CC=4C=CC=CC43)C=5C=CC(=CC5)C)C6=CC= | (R)-3,3′-Bis(4-methylphenyl)-1,1′-bi-2-naphthol | AG000LQT | 0.5g |
| 1242339-95-2 | Cl.Cl.NNCC1=CC(C(F)(F)F)=CC=C1 | ([3-(Trifluoromethyl)phenyl]methyl)hydrazine dihydrochloride | AG000LQU | 5g |
| 1242339-79-2 | CC1=CC(F)=CC(Cl)=C1I | 1-Chloro-5-fluoro-2-iodo-3-methylbenzene | AG000LQW | 0.75g |
| CAS_Number | SMILES | Chemical_Name | Catalog_Number | Inventory |
| 1242339-67-8 | O=C(O)C1=C(F)C=C(F)C=C1Cl | 2-chloro-4,6-difluorobenzoic acid | AG000LQY | 75g |
| 1242339-16-7 | C1(Cl)=CC(F)=CC(C)=C1Br | 2-Bromo-1-chloro-5-fluoro-3-methylbenzene | AG000LR2 | 4g |
| 1242339-10-1 | CC1=C(Br)C(F)=CC(Cl)=C1 | 2-Bromo-5-chloro-1-fluoro-3-methylbenzene | AG000LR3 | 25g |
| 124236-38-0 | O=C(OC)C1=CN=CC(C(F)(F)F)=C1 | Methyl 5-(trifluoroMethyl)nicotinate | AG000LRB | 5g |
| 124236-37-9 | O=C(OC)C1=NC=C(C(F)(F)F)C=C1 | methyl 5-(trifluoromethyl)pyridine-2-carboxylate | AG000LRC | 200g |
| 1242770-50-8 | CC1(C)OB(OC1(C)C)C=Cc1ccc(cc1)C(F)(F)F | 4,4,5,5-tetramethyl-2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3,2-dioxa | AG000LS3 | 10g |
| 124276-95-5 | O=C(C1(C2=CC=CC(Br)=C2)CC1)O | 1-(3-Bromophenyl)cyclopropanecarboxylic acid | AG000LS8 | 500g |
| 124276-87-5 | O=C(C1(C2=CC=CC=C2Br)CC1)O | 1-(2-Bromophenyl)cyclopropanecarboxylic acid | AG000LSA | 100g |
| 124276-83-1 | N#CC1(C2=CC=CC(Br)=C2)CC1 | 1-(3-bromophenyl)cyclopropanecarbonitrile | AG000LSB | 50g |
| 124555-33-5 | N[C@H]1C[C@H](O)CC1.[H]Cl | trans-3-Aminocyclopentanol HCl | AG000M73 | 25g |
| 124555-31-3 | O[C@H]1C[C@@H](NC(OCC2=CC=CC=C2)=O)CC1 | Cis-benzyl (3-hydroxycyclopentyl)carbamate | AG000M74 | 10g |
| 124555-18-6 | [H][C@]1(O[C@H](CO)[C@@H](O)[C@H]1O)N2C=NC3=C(N[C@@H]4[C@@H]( | GR79236 | AG000M75 | 0.05g |
| 1245642-79-8 | CNC[C@@H]1CCN(C(=O)OC(C)(C)C)C1 | (S)-tert-Butyl 3-((methylamino)methyl)pyrrolidine-1-carboxylate | AG000M79 | 25g |
| 1245606-63-6 | O=C(OC)C[C@H](N)C1=CC=C(Br)C=C1.[H]Cl | (S)-Methyl 3-amino-3-(4-bromophenyl)propanoate hydrochloride | AG000M7B | 0.5g |
| 1245603-92-2 | C1(C(N(C)C)=O)=NC=C(OC2=C3C(=CC(C(NC4=NC=C(C)N=C4)=O)=C2)OC(C)=C3)C | Nerigliatin | AG000M7C | 0.005g |
| 1245572-24-0 | [Os].[Os].[Os].[Os].[Os].[Os].[Os].[Os].[Os].[Os].[Os].[Os].[Os].[Os].[Os].[Os].[ | β-D-Glucopyranoside, (1S,4aS,5R,7S,7aR)-1,4a,5,6,7,7a-hexahydro-4a,5,7-trihy | AG000M7D | 0.01g |
| 1245563-18-1 | FC(C1=CC=CC(OCC)=N1)(F)F | 2-Ethoxy-6-trifluoromethylpyridine | AG000M7I | 10g |
| 1245563-15-8 | BrC1C=C(C=C(C=1)N1CCCC1)Br | 1-(3,5-Dibromophenyl)pyrrolidine | AG000M7L | 10g |
| 1245643-70-2 | OC1=C(Cl)C=NN=C1 | 5-Chloropyridazin-4-ol | AG000M7Y | 20g |
| 1245643-68-8 | Cc1ccncc1C1CC1 | 3-Cyclopropyl-4-methylpyridine | AG000M7Z | 0.1g |
| 1245643-61-1 | O=C(C1=CC2=C(C=C1Cl)C=CN2)OC | Methyl 5-chloro-1H-indole-6-carboxylate | AG000M83 | 10g |
| 1245643-49-5 | O=CC1=NN=C(C(F)(F)F)C=C1 | 6-(Trifluoromethyl)-3-pyridazinecarboxaldehyde | AG000M84 | 0.5g |
| 1245643-21-3 | O=C1OC(C)(C)C2=CC=C(Br)C=C2N1 | 7-Bromo-4,4-dimethyl-1H-benzo[d][1,3]oxazin-2(4H)-one | AG000M8E | 15g |
| 1245643-19-9 | O=C(N[C@H](CCO)CO)C1=CC=CC=C1 | (R)-N-(1,4-Dihydroxybutan-2-yl)benzamide | AG000M8F | 5g |
| 1245643-11-1 | O=C(OC)C1=CC(Br)=C(N)C(N)=C1 | Methyl 3,4-diamino-5-bromobenzoate | AG000M8K | 200g |
| 1245643-02-0 | CC1=C(C(O)=O)C2=C(C=C1)C(Cl)=NC=C2 | 1-Chloro-6-methylisoquinoline-5-carboxylic acid | AG000M8L | 0.5g |
| 1245644-42-1 | BrC2=C[N]1C(=NC=C1I)C=N2 | 6-Bromo-3-iodoimidazo[1,2-a]pyrazine | AG000M8R | 48g |
| 1246034-86-5 | C(C)(C)(C)OC(=O)N1CC2CCC(CC2CC1)C(=O)O | 2-(tert-Butoxycarbonyl)decahydroisoquinoline-6-carboxylic acid | AG000MGK | 2g |
| 1246034-32-1 | CC(=O)c1cc(Cl)nc(Cl)n1 | 1-(2,6-dichloropyrimidin-4-yl)ethanone | AG000MGM | 0.5g |
| 124612-15-3 | O=C1CC(CC(C(F)(F)F)C1)=O | 5-(Trifluoromethyl)cyclohexane-1,3-dione | AG000MGO | 1g |
| 124605-42-1 | O[C@H]([C@H](C1=CC=CC=C1)NC(OC(C)(C)C)=O)C(OC)=O | (2R,3S)-N-Boc-3-Phenylisoserine methyl ester | AG000MGV | 300g |
| 124613-28-1 | C(C1=CC=CC=C1)NC(CO)CO | 2-(Benzylamino)propane-1,3-diol | AG000MHJ | 5g |
| 1246372-66-6 | N#CC1=C(N)N=CC(B2OC(C)(C)C(C)(C)O2)=C1 | 2-Amino-3-cyanopyridine-5-boronic Acid Pinacol Ester | AG000MHP | 4g |
| 1246349-99-4 | ClC1=NC=CC2=C1C(Br)=NN2 | 3-Bromo-4-Chloro-1H-Pyrazolo[4,3-C]Pyridine | AG000MHR | 25g |
| 1246349-97-2 | COC1=CC=C(C=C1)CN2C3=C(C(=NC=C3)Cl)C(=N2)I | 4-CHLORO-3-IODO-1-(4-METHOXYBENZYL)-1H-PYRAZOLO[4,3-C]PYRIDINE | AG000MHS | 0.5g |
| 1246349-89-2 | CC(=O)C1=C(Cl)C=CN=C1Cl | 1-(2,4-Dichloropyridin-3-yl)ethanone | AG000MHT | 25g |
| 1246307-74-3 | OC1=CC=CC2=C1C(I)=NN2 | 3-Iodo-1H-indazol-4-ol | AG000MHV | 0.75g |
| 1246303-14-9 | [C@@H]1(C(N[C@@H](C)CN2CCC(N3C(=O)NC4=CC(Br)=CC=C43)CC2)=O)C[C@H | VU0359595 | AG000MHY | 0.005g |
| 1246281-86-6 | CC(OC(N1C2CC(CC1C2)=O)=O)(C)C | Tert-butyl 3-oxo-6-azabicyclo[3.1.1]heptane-6-carboxylate | AG000MI1 | 3g |
| 124643-45-4 | NC1=CC=CC=C1C#CC2=CC=C(C)C=C2 | 2-(p-tolylethynyl)aniline | AG000MI4 | 20g |
| 124638-99-9 | CCCCCCCCCCCCn1nc(N)nc1N | 1-Dodecyl-1H-1,2,4-triazole-3,5-diamine | AG000MI6 | 2g |
| 124638-53-5 | BrC1=C(Br)SC2=C1SC(Br)=C2Br | Tetrabromo-thieno[3,2-b]thiophene | AG000MI7 | 75g |
| 1246536-95-7 | CCOC1=CN=C(C=C1)C=O | 5-Ethoxypyridine-2-carbaldehyde | AG000MIC | 5g |
| 1246535-95-4 | CC(C)N(C=N1)C2=C1C(C3=CN=C(N)N=C3)=NC(N4CCOCC4)=N2 | 5-(9-Isopropyl-2-morpholino-9H-purin-6-yl)pyrimidin-2-amine | AG000MID | 0.002g |
| 1246532-96-6 | O=C(N1CCN(C2=CC=C(N)C(OC)=C2)CC1)OC(C)(C)C | Tert-butyl 4-(4-aMino-3-Methoxyphenyl)piperazine-1-carboxylate | AG000MIE | 25g |
| 1245807-64-0 | O=C(O)C1=CC(F)=C(C(O)=O)C=C1Br | 2-Bromo-5-fluoroterephthalic acid | AG000ME7 | 6g |
| 1245782-70-0 | Cl.Cl.CCOC(=O)C(N)C1=CC=NC=C1 | Ethyl 2-amino-2-(4-pyridinyl)acetate DiHCl | AG000MEK | 10g |
| 1245782-69-7 | CC(C)(C)OC(=O)N1CCn2nncc2C1 | 5-Boc-4,6,7-trihydro-1,2,3-triazolo[1,5-A]pyrazine | AG000MEL | 20g |
| 1245782-62-0 | O=C(N1C(C(OCC)=O)C(CCC1)=O)OC(C)(C)C | 1-tert-Butyl 2-ethyl 3-oxopiperidine-1,2-dicarboxylate | AG000MEM | 25g |
| 1245782-61-9 | NC1(C2=CC=C(Cl)C=C2)COC1.[H]Cl | 3-(4-Chlorophenyl)oxetan-3-amine hydrochloride | AG000MEN | 4g |
| 1245824-36-5 | CC1(C)C(C)(C)OB(C2=CC=CC(OCOC)=C2)O1 | 2-(3-(Methoxymethoxy)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane | AG000MEV | 20g |
| 1245823-50-0 | C#CCOCCOCCOCCOCCOCCC(OC(C)(C)C)=O | 4,7,10,13,16-Pentaoxanonadec-18-ynoic acid, 1,1-dimethylethyl ester | AG000MEW | 0.75g |
| 1245816-31-2 | CC(C)(C)OC(=O)N1CCC2(COC2)C1 | 2-Oxa-6-azaspiro[3.4]octane-6-carboxylic acid tert-butyl ester | AG000MEX | 10g |
| 1245816-29-8 | O=C(N(CCC1)CC21COC2)OC(C)(C)C | tert-Butyl 2-oxa-6-azaspiro[3.5]nonane-6-carboxylate | AG000MEZ | 5g |
| 1245816-27-6 | CC(OC(N1C2(COC2)CC1)=O)(C)C | 6-Oxa-1-azaspiro[3.3]heptane-1-carboxylic acid tert-butyl ester | AG000MF0 | 1g |
| 1245816-26-5 | OB(C1=CC2=C(C=C1)C(C)=NN2)O | 3-Methyl-1H-indazole-6-boronic acid | AG000MF1 | 5g |
| 1245816-25-4 | OB(C1=CC2=C(NN=C2C)C=C1)O | 3-Methyl-1H-indazole-5-boronic acid | AG000MF2 | 25g |
| 1245816-10-7 | OB(C1=C(C)C=CC2=C1C=NN2)O | 5-Methyl-1H-indazol-4-yl boronic acid | AG000MF8 | 50g |
| 1245816-09-4 | OB(C1=C(C)C2=C(NN=C2)C=C1)O | 4-Methyl-1H-indazolyl-5-boronic acid | AG000MF9 | 50g |
| 1245816-07-2 | CC1=CC(B(O)O)=CC2=C1NN=C2 | (7-methyl-1H-indazol-5-yl)boronic acid | AG000MFA | 50g |
| 1244772-70-0 | NC1=C(B2OC(C)(C)C(C)(C)O2)C=NC=C1 | 3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-4-amine | AG000M2F | 5g |
| 124491-42-5 | CC(C1=CN=C(N)N=C1)=O | 1-(2-Aminopyrimidin-5-yl)ethanone | AG000M2I | 25g |
| 124480-95-1 | O=C(O)C1=CC(OCC)=CC(OCC)=C1 | 3,5-Diethoxybenzoic Acid | AG000M2S | 175g |
| 1244949-72-1 | CC(OC(NC1=NC(Cl)=NC(Cl)=C1)=O)(C)C | TERT-BUTYL (2,6-DICHLOROPYRIMIDIN-4-YL)CARBAMATE | AG000M37 | 5g |
| 1244949-68-5 | OCC1=NC(Cl)=CC(Cl)=N1 | (4,6-Dichloropyrimidin-2-yl)methanol | AG000M3A | 2g |
| 1244949-48-1 | OC(C1=C(Br)N=CS1)=O | 4-Bromothiazole-5-carboxylic acid | AG000M3E | 10g |
| 1244949-43-6 | COc1cc(Br)cc(c1C=O)C | 4-Bromo-2-methoxy-6-methylbenzaldehyde | AG000M3F | 45g |
| 1244949-24-3 | NC1=C(OC(F)(F)F)C=C(Cl)C=C1Br | 2-Bromo-4-chloro-6-(trifluoromethoxy)aniline | AG000M3H | 19.7g |
| 124499-37-2 | N#CCC1CCC2(CC1)OCCO2 | 1,4-DIOXASPIRO[4.5]DECANE-8-ACETONITRILE | AG000M3U | 75g |
| 124499-34-9 | NCCC1CCC2(OCCO2)CC1 | 2-(1,4-dioxa-spiro[4.5]dec-8-yl)-ethylamine | AG000M3V | 1g |
| 1245-13-2 | OC(=O)C1=CC(=NC2=CC=CC=C12)C1=NC2=CC=CC=C2C(=C1)C(O)=O | 2,2′-Biquinoline-4,4′-dicarboxylic acid | AG000M4H | 1000g |
| 1245014-05-4 | OB(O)C1=CC(=C(OCC2=CC=CC=C2)C=C1)C(F)(F)F | [4-(benzyloxy)-3-(trifluoromethyl)phenyl]boronic acid | AG000M4R | 25g |
| 1245210-84-7 | CC1=NC2=CN=CC=C2C(N)=C1 | 2-Methyl-1,7-naphthyridin-4-aMine | AG000M5F | 5g |
| 1246652-29-8 | CC(OC(N1C2(CCC2)C2=C(C(=NN2)N)C1)=O)(C)C | tert-butyl 3′-amino-1’h-spiro[cyclobutane-1,6′-pyrrolo[3,4-c]pyrazole]-5′(4’h)- | AG000MKJ | 5g |
| 1246651-90-0 | O=C(O)C[C@H](NC(OCC1C2=C(C3=C1C=CC=C3)C=CC=C2)=O)CC(OC(C)(C)C)=O | (S)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-5-(tert-butoxy)-5-oxope | AG000MKL | 25g |
| 1246651-15-9 | C(CO)[C@H]1CNCCN1.Cl.Cl | (S)-2-(Piperazin-2-yl)ethanol dihydrochloride | AG000MKM | 111g |
| 1246649-06-8 | C[C@@H](N)C1=CC=C(I)C=C1.[H]Cl | (R)-1-(4-Iodophenyl)ethanamine hydrochloride | AG000MKQ | 30g |
| 124668-49-1 | CN(C)C1CNC1.[H]Cl.[H]Cl | 3-(Dimethylamino)azetidine diHCl | AG000MKW | 100g |
| 124668-47-9 | Cl.Cl.CC1(CNC1)N | 3-Amino-3-methylazetidine dihydrochloride | AG000MKX | 10g |
| 124668-46-8 | OC1(C)CNC1.[H]Cl | 3-Hydroxy-3-methylazetidine, HCl | AG000MKY | 600g |
| 124668-45-7 | Cl.NC(=O)C1CNC1 | azetidine-3-carboxamide hydrochloride | AG000MKZ | 5g |
| 1246765-38-7 | O=C1NC2=C(C=C(Br)C=C2)CN1 | 6-BroMo-3,4-dihydroquinazolin-2(1H)-one | AG000ML7 | 20g |
| 1246765-32-1 | O=C(OC)C1=CC=C(B2OC(C)(C)C(C)(C)O2)C(OC)=C1 | Methyl 3-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate | AG000ML9 | 20g |
| 1246765-28-5 | O=C1NC2=CC(B(O)O)=CC=C2OC1 | 3-Oxo-3,4-dihydro-2h-benzo[b][1,4]oxazin-6-ylboronic acid | AG000MLA | 25g |
| 1246765-27-4 | O=C(OC)C1=C(OC)N=C(B2OC(C)(C)C(C)(C)O2)C=C1 | 2-Methoxy-3-(methoxycarbonyl)pyridine-6-boronic acid pinacol ester | AG000MLB | 3g |
| 1246761-84-1 | OB(C1=C2C(NC=C2)=NC=C1)O | 1H-Pyrrolo[2,3-b]pyridin-4-ylboronic acid | AG000MLC | 10g |
| 1246748-00-4 | NNCC1CCC1.[H]Cl.[H]Cl | (Cyclobutylmethyl)hydrazine dihydrochloride | AG000MLE | 25g |
| 1246738-30-6 | NCC1=C(C)N(C)N=C1C.[H]Cl | (1,3,5-Trimethyl-1H-pyrazol-4-yl)methanamine hydrochloride | AG000MLJ | 15g |
| 1246685-28-8 | O=C(C1=CC(Cl)=NC=C1C(F)(F)F)OC | Methyl 2-chloro-5-(trifluoroMethyl)pyridine-4-carboxylate | AG000MLL | 15g |
| 1245645-77-5 | O=C(C1=NOC(CC)=N1)OCC | Ethyl 5-ethyl-1,2,4-oxadiazole-3-carboxylate | AG000MAL | 5g |
| 1245645-49-1 | NC1=NN2C=CC(F)=CC2=N1 | 7-Fluoro-[1,2,4]triazolo[1,5-a]pyridin-2-amine | AG000MAP | 3g |
| 1245647-03-3 | C1C(CC1O)CO | 3-(Hydroxymethyl)cyclobutanol | AG000MAR | 50g |
| 1245646-80-3 | O=C(OC(C)(C)C)NC(CC1)CNC1=O | tert-Butyl (6-oxopiperidin-3-yl)carbamate | AG000MAV | 1g |
| 1245646-59-6 | Cc1ccc(cc1)c1cccc(n1)F | Pyridine, 2-fluoro-6-(4-methylphenyl)- | AG000MB7 | 3.6g |
| 1245647-95-3 | O=C(OC(C)(C)C)NC1=CSC(Br)=N1 | tert-Butyl (2-bromothiazol-4-yl)carbamate | AG000MBR | 200g |
| 1245647-91-9 | C1C(C2=CC=CC=C2)(N2CCNCC2)C1 | 1-(1-Phenylcyclopropyl)piperazine | AG000MBS | 0.75g |
| 1245647-80-6 | O=C1NC2=C(C=CC=C2)C1C3=C(O)C=C4OCCOC4=C3 | 3-(7-Hydroxy-2,3-dihydrobenzo[b][1,4]dioxin-6-yl)indolin-2-one | AG000MBT | 10g |
| 1245647-61-3 | O=C(OC)C1=NC(C)=C(F)C=C1 | Methyl 5-fluoro-6-methylpicolinate | AG000MBV | 20g |
| 1245647-53-3 | Cl.CC1(CN)CCC1 | (1-Methylcyclobutyl)methanamine hydrochloride | AG000MBW | 200g |
| 1245647-50-0 | O(C)c1c(C#N)c(Br)ccc1 | 2-Bromo-6-methoxybenzonitrile | AG000MBX | 80.25g |
| 1245647-43-1 | BrC1=CN2C(C=N1)=NC=C2Br | 3,6-Dibromo-imidazo[1,2-a]pyrazine | AG000MBY | 5g |
| 1245647-25-9 | CC1=C(Br)C2=C(C=C1)C(Cl)=NC=C2 | 5-Bromo-1-chloro-6-methylisoquinoline | AG000MC1 | 1g |
| 1245649-03-9 | CC(O)([C@H]1CNCC1)C | (R)-2-(3-Pyrrolidinyl)-2-propanol | AG000MC5 | 25g |
| 1245649-01-7 | CCOC(C1C(C)(C)CNC1)=O | ethyl 4,4-dimethylpyrrolidine-3-carboxylate | AG000MC6 | 5g |
| 1245644-40-9 | NC1=NN2C=C(F)C=CC2=N1 | 6-Fluoro-[1,2,4]triazolo[1,5-a]pyridin-2-amine | AG000M8S | 15g |
| 1245644-35-2 | O=C(O)C1=CC(S(=O)(N2CCN(CC)CC2)=O)=CC=C1OCC | 2-Ethoxy-5-((4-ethylpiperazin-1-yl)sulfonyl)benzoic acid hydrochloride | AG000M8T | 400g |
| 1245643-85-9 | CC(=O)C1=C(Br)C=NC=N1 | 1-(5-Bromopyrimidin-4-yl)ethanone | AG000M92 | 0.2g |
| 1245643-74-6 | Brc1c(C)cnc(n1)N | 2-Pyrimidinamine, 4-bromo-5-methyl- | AG000M99 | 0.4g |
| 1245645-38-8 | ClC1=NC(Cl)=CN2C1=NC=C2 | 6,8-Dichloroimidazo[1,2-a]pyrazine | AG000M9E | 10g |
| 1245645-24-2 | CC([C@@H]1CNCC1)(O)C | (S)-2-(3-Pyrrolidinyl)-2-propanol | AG000M9L | 10g |
| 1245645-20-8 | O=C(C1=CC2=C(N=C1)CN(C(OC(C)(C)C)=O)CC2)O | 7-(tert-Butoxycarbonyl)-5,6,7,8-tetrahydro-1,7-naphthyridine-3-carboxylic aci | AG000M9M | 25g |
| 1245645-10-6 | IC1=CN=C2C=NC(Cl)=CN21 | 6-Chloro-3-iodoimidazo[1,2-a]pyrazine | AG000M9O | 10g |
| 1245644-88-5 | Cl.ClC1=C(Cl)C=NN=C1 | 4,5-Dichloropyridazine hydrochloride | AG000M9T | 40g |
| 1245644-74-9 | FC1=CC=CN2N=C(N=C12)N | 8-Fluoro-[1,2,4]triazolo[1,5-a]pyridin-2-ylamine | AG000MA0 | 20g |
| 1245646-10-9 | O=C1N(C(OC(C)(C)C)=O)CCC(O)C1 | tert-Butyl 4-hydroxy-2-oxopiperidine-1-carboxylate | AG000MA4 | 200g |
| 1245645-97-9 | Clc1c2c(ncc1N(=O)=O)[nH]cc2 | 4-Chloro-5-nitro-1H-pyrrolo[2,3-b]pyridine | AG000MAD | 25g |
| 1245811-22-6 | OC1=C2C(NC=C2)=NC(Cl)=N1 | 2-Chloro-3h,4h,7h-pyrrolo[2,3-d]pyrimidin-4-one | AG000MFC | 25g |
| 1245811-20-4 | O=C1C2=C(C=CS2)N=C(Cl)N1 | 2-Chlorothieno[3,2-d]pyriMidin-4(3H)-one | AG000MFD | 25g |
| 1245808-57-4 | CCC1(C(O)=O)CN(C(OCC2=CC=CC=C2)=O)CCC1 | 1-Cbz-3-ethylpiperidine-3-carboxylic acid | AG000MFF | 5g |
| 1245808-01-8 | C[C@H](N)C1=CC=C(Cl)C(F)=C1.[H]Cl | (S)-1-(4-Chloro-3-Fluorophenyl)Ethanamine Hydrochloride | AG000MFG | 0.25g |
| 1245807-94-6 | O=C(C1=NN=C(CN)O1)OCC.O=C(O)C(F)(F)F | Ethyl 5-(aminomethyl)-1,3,4-oxadiazole-2-carboxylate 2,2,2-trifluoroacetate | AG000MFH | 10g |
| 1245943-60-5 | OB(C1=C(C2=CC=CC=C2S3)C3=CC=C1)O | Dibenzo[b,d]thiophen-1-ylboronic acid | AG000MFL | 40.9g |
| 1245915-89-2 | NCC1=CC(C(F)(F)F)=C(Cl)N=C1 | (6-CHLORO-5-(TRIFLUOROMETHYL)PYRIDIN-3-YL)METHANAMINE | AG000MFS | 3g |
| 1245915-29-0 | FC(F)(F)c1cc(cnc1Cl)C#N | 6-Chloro-5-(trifluoromethyl)nicotinonitrile | AG000MFV | 0.5g |
| 1245914-65-1 | FC(F)(F)c1ccc(Cl)nc1C=O | 6-Chloro-3-(trifluoromethyl)picolinaldehyde | AG000MFX | 5g |
| 1245913-20-5 | N#CC1=C(C(F)(F)F)N=C(Cl)C=C1 | 6-Chloro-2-(trifluoromethyl)nicotinonitrile | AG000MFY | 25g |
| 1246088-60-7 | O=Cc1nc2[nH]ccc2cc1F | 5-Fluoro-1H-pyrrolo[2,3-b]pyridine-6-carbaldehyde | AG000MGA | 0.25g |
| 1246088-38-9 | OC(=O)c1nc2[nH]ccc2c(c1F)Cl | 4-Chloro-5-fluoro-1H-pyrrolo[2,3-b]pyridine-6-carboxylic acid | AG000MGF | 0.5g |
| 1246086-78-1 | O=C(C1=NC=CC=C1)NC2=CC=C(S(NC3=CC=CC=C3Cl)(=O)=O)C(Cl)=C2 | VU0364439 | AG000MGG | 1g |
| 1246034-93-4 | CC(OC(N1CC2(NCCCC2)C1)=O)(C)C | tert-butyl 2,5-diazaspiro[3.5]nonane-2-carboxylate | AG000MGJ | 10g |
| 124676-19-3 | O=C(O)C(N1N=NC2=CC=CC=C21)NC(OCC3=CC=CC=C3)=O | BENZOTRIAZOL-1-YL-BENZYLOXYCARBONYLAMINO-ACETIC ACID | AG000MLQ | 75g |
| 1246841-00-8 | P([C-]12[Fe+2]3456789(C1([C@@H]([P@@](C(C)(C)C)C(C)(C)C)C)=[CH]3C4(=C52 | (S)-1-[(S)-2-(Dicyclohexylphosphino)ferrocenyl]ethyldi-tert-butylphosphine | AG000MLW | 10g |
| 1246834-64-9 | NCC1=NC=CC=N1.CC(O)=O | pyrimidin-2-ylmethanamine acetate | AG000MLX | 5g |
| 1246965-06-9 | NC1=CC2=C(C=C1OC)C=CN2 | 5-Methoxy-1H-indol-6-amine | AG000MMK | 0.5g |
| 1246926-09-9 | COc1c(O)cc2oc(-c3cc(CCC(C)CO)c(O)c(CC=C(C)C)c3)c(OC)c(=O)c2c1O | 5′-Prenylaliarin | AG000MMO | 0.005g |
| 1246926-08-8 | COc1c(O)cc2oc(-c3cc(CC=C(C)C)c(O)c(CC=C(C)C)c3)c(OC)c(=O)c2c1O | 5,7,4′-Trihydroxy-3,6-dimethoxy-3′,5′-diprenylflavone | AG000MMP | 0.005g |
| 124700-70-5 | CSc1nc(O)ccn1 | 2-Methylthiopyrimidin-4-ol | AG000MMR | 1g |
| 124700-41-0 | C(=O)(O)c1c(F)ccc(c1)I | Benzoic acid, 2-fluoro-5-iodo- | AG000MMS | 200g |
| 124700-40-9 | FC1=C(C(=O)O)C=CC(=C1)I | 2-Fluoro-4-iodobenzoic acid | AG000MMT | 444.8g |
| 124700-26-1 | FC1=CC=C(OCC#C)C=C1 | 1-fluoro-4-(prop-2-yn-1-yloxy)benzene | AG000MMU | 10g |
| 124695-22-3 | N1(C=CC=C1C=O)C1C=CC=CC=1Cl | 1-(2-Chloro-phenyl)-1H-pyrrole-2-carbaldehyde | AG000MMX | 2g |
| 124691-76-5 | ClC1=CC2=C(C=C1Cl)C=NN2 | 5,6-Dichloro-1H-indazole | AG000MN0 | 10g |
| 1247-64-9 | [C@@H]1(OS(O)(=O)=O)CC2[C@](C)(CC1)[C@]1([H])[C@]([H])([C@@]3([H])[C | Pregnenolone monosulfate | AG000MN2 | 0.25g |
| 1247-42-3 | OCC([C@@]([C@H](C[C@]2([H])[C@](CC([C@@]3([H])[C@]([H])2CCC4=CC(C=C | (16β)-17,21-Dihydroxy-16-methylpregna-1,4-diene-3,11,20-trione | AG000MN4 | 40g |
| 1247124-77-1 | ClC1=NC(C2=CC=C3C=CC=CC3=C2)=NC(C4=CC=C5C=CC=CC5=C4)=N1 | 2-Chloro-4,6-bis(naphthalene-2-yl)-1,3,5-triazine | AG000MN8 | 50g |
| 1247119-83-0 | CC(C)(C1=CC=C(CC)C=C1)C(O)=O | 2-(4-ethylphenyl)-2-methylpropanoic acid | AG000MN9 | 200g |
| 1247119-36-3 | O=C(OCC)[C@@H](NC(N(CC1=CSC(C(C)C)=N1)C)=O)CCN2CCOCC2.O=C(O)C(O)= | (S)-Ethyl 2-(3-((2-isopropylthiazol-4-yl)methyl)-3-methylureido)-4-morpholi | AG000MNA | 1000g |
| 1251904-51-4 | C=CCCCC[C@H](NC(OCC1C2=C(C3=C1C=CC=C3)C=CC=C2)=O)C(O)=O | (S)-N-Fmoc-2-(5′-pentenyl)glycine | AG000NC0 | 8g |
| 1251904-23-0 | O=C(OC)[C@H](N)C1CCC1 | (R)-Methyl 2-amino-2-cyclobutylacetate HCl | AG000NC3 | 0.2g |
| 1251903-95-3 | O=C(O)[C@H](NC(OC(C)(C)C)=O)C1CCOCC1 | (R)-2-((tert-Butoxycarbonyl)amino)-2-(tetrahydro-2H-pyran-4-yl)acetic acid | AG000NC5 | 2g |
| 1251903-93-1 | O=C(N1[C@H](C(OC)=O)CNCC1)OC(C)(C)C.[H]Cl | (S)-1-tert-Butyl 2-methyl piperazine-1,2-dicarboxylate hydrochloride | AG000NC6 | 8g |
| 1251903-83-9 | O=C(N1C[C@H](C(OC)=O)NCC1)OC(C)(C)C.[H]Cl | (R)-4-N-Boc-piperazine-2-carboxylic acid methyl ester-hcl | AG000NC8 | 40g |
| 125197-40-2 | N[C@@H]1CNC[C@H]1F.[H]Cl.[H]Cl | rel-(3R,4R)-4-Fluoropyrrolidin-3-amine dihydrochloride | AG000NCB | 10g |
| 1252046-16-4 | N#CC1=NC(Br)=CC=C1Cl | 6-Bromo-3-chloropicolinonitrile | AG000NCF | 25g |
| 125218-55-5 | O=C(C1(N)COCC1)O | 3-Aminotetrahydrofuran-3-carboxylic acid | AG000NCJ | 25g |
| 125218-33-9 | OC(C=C1)=C(F)C=C1C[C@@H](C(O)=O)NC(OC(C)(C)C)=O | (S)-2-((tert-Butoxycarbonyl)amino)-3-(3-fluoro-4-hydroxyphenyl)propanoic a | AG000NCK | 10g |
| 125209-79-2 | NC1=NC=CC=C1SSC1=CC=CN=C1N | 3,3′-Disulfanediylbis(pyridin-2-amine) | AG000NCX | 0.5g |
| 125208-06-2 | O=C(C1=C(C)NC2=NC=C(Br)N=C21)OCC | 2-Bromo-6-methyl-5h-pyrrolo[2,3-b]pyrazine-7-carboxylic acid ethyl ester | AG000NCZ | 7g |
| 1252257-56-9 | C(ON1C(=O)CCC1=O)(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCNC(=O)CCSSC1=N | Opss-peg(8)-nhs | AG000ND4 | 5g |
| 125238-99-5 | O=C(O)[C@@H](NC(OCC1C2=C(C3=C1C=CC=C3)C=CC=C2)=O)CCNC(OC(C)(C)C)= | Fmoc-Dab(Boc)-OH | AG000ND6 | 2500g |
| 125229-64-3 | O[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)[C@H]1OC2=CNC3=C2C(Cl)=C | 5-Bromo-4-chloro-3-indolyl alpha-d-mannopyranoside | AG000ND8 | 0.2g |
| 125224-64-8 | Br.Br.CN1[C@H]2CN[C@H](C2)C1 | (1R,4R)-2-Methyl-2,5-diazabicyclo[2.2.1]heptane dihydrobromide | AG000NDG | 25g |
| 125224-62-6 | Br.Br.CN1C[C@@H]2C[C@H]1CN2 | (1S,4S)-2-Methyl-2,5-diazabicyclo[2.2.1]heptane dihydrobromide | AG000NDH | 100g |
| 125224-43-3 | OC[C@@H]1CNCC[C@H]1C2=CC=C(F)C=C2 | ((3S,4R)-4-(4-Fluorophenyl)piperidin-3-yl)methanol | AG000NDK | 25g |
| 1252572-24-9 | OC(=O)C1=CC2=C(N1)C=NC=C2Br | 4-Bromo-1H-pyrrolo[2,3-c]pyridine-2-carboxylic acid | AG000NDT | 9g |
| 1252450-11-5 | O=C(OC(C)(C)C)NCC1CCN(C(C2COC3=CC=CC=C3O2)=O)CC1 | tert-Butyl ((1-(2,3-dihydrobenzo[b][1,4]dioxine-2-carbonyl)piperidin-4-yl)me | AG000NDV | 3g |
| 124796-97-0 | O=C(OCC)C1=C(CCl)N=CC(C)=C1 | Ethyl 2-(chloromethyl)-5-methylnicotinate | AG000MR3 | 0.6g |
| 124788-36-9 | O=c1n(C)cc(c(=O)n1C)S(=O)(=O)Cl | 1,3-Dimethyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-sulfonyl chloride | AG000MR5 | 10g |
| 1248-42-6 | O=C(OC)C1=CC=CC=C1C(C2=CC=C(OCCN3CCCCC3)C=C2)=O.[H]Cl | Pitofenone HCl | AG000MR7 | 0.5g |
| 1248081-37-9 | OC1(CCC2(CC1)OCCO2)C(F)(F)F | 8-(TRIFLUOROMETHYL)-1,4-DIOXASPIRO[4.5]DECAN-8-OL | AG000MRC | 10g |
| 124811-71-8 | N#Cc1ccc(O)c(c1)C(F)(F)F | 4-Hydroxy-3-(trifluoromethyl)benzonitrile | AG000MRK | 275g |
| 1248399-37-2 | CN(C)CCCOC1=NC=C(Br)C=C1 | 5-Bromo-2-(3-(N,N-dimethylamino)propoxy)pyridine | AG000MRZ | 2g |
| 1248348-67-5 | S=C(N[C@@H]1[C@@H](N2CCCC2)CCCC1)NC3=CC(C(F)(F)F)=CC(C(F)(F)F)=C3 | 1-[3,5-Bis(trifluoromethyl)phenyl]-3-[(1S,2S)-2-(pyrrolidin-1-yl)cyclohexyl]th | AG000MS1 | 1g |
| 1248324-93-7 | CCOC(=O)C1(N)CCSCC1 | Ethyl 4-aminothiane-4-carboxylate | AG000MS2 | 25g |
| 1248324-24-4 | NC=1C(N(N(C1C)C)C1CCCCC1)=O | 4-Amino-2-cyclohexyl-1,5-dimethyl-2,3-dihydro-1H-pyrazol-3-one | AG000MS3 | 2g |
| 124840-61-5 | OC(=O)CC1=CC(Br)=CC=C1[N+]([O-])=O | 2-(5-Bromo-2-nitrophenyl)acetic acid | AG000MS7 | 10g |
| 124840-60-4 | [O-][N+](=O)C1=CC=C(CC#N)C=C1Br | 3-Bromo-4-nitrophenylacetonitrile | AG000MS8 | 5g |
| 124837-37-2 | Cc1cccc(c1O)C(F)(F)F | 2-METHYL-6-(TRIFLUOROMETHYL)PHENOL | AG000MSA | 5g |
| 124832-31-1 | CC(C)[C@H](NC(OCC1=CC=CC=C1)=O)C(OCCOCN2C=NC3=C2N=C(N)NC3=O)=O | Benzyloxycarbonyl Valacyclovir | AG000MSB | 100g |
| 124832-27-5 | N[C@@H](C(C)C)C(OCCOCN1C=NC2=C1NC(N)=NC2=O)=O.[H]Cl | L-Valine,2-[(2-amino-1,6-dihydro-6-oxo-9H-purin-9-yl)methoxy]ethyl ester, | AG000MSC | 800g |
| 124832-26-4 | CC([C@@H](C(OCCOCN1C2=C(C(NC(=N2)N)=O)N=C1)=O)N)C | 2-[(2-amino-6-oxo-6,9-dihydro-1H-purin-9-yl)methoxy]ethyl (2S)-2-amino-3- | AG000MSD | 0.5g |
| 1248566-21-3 | OCc1nc2c([nH]1)c(Br)ccc2 | 4-Bromo-2-(hydroxymethyl)benzimidazole | AG000MSN | 10g |
| 1243389-57-2 | Clc1c2c(on1)cc(cc2)Br | 1,2-Benzisoxazole, 6-bromo-3-chloro- | AG000LVP | 4g |
| 1243372-21-5 | O=C(O)C1=CC(O)=CC=C1C#N | 2-Cyano-5-hydroxybenzoic acid | AG000LVR | 2g |
| 1243364-91-1 | Oc1cc(cc(c1)C(=O)O)NS(=O)(=O)C | 3-Hydroxy-5-(methylsulfonamido)benzoic Acid | AG000LVS | 5g |
| 124340-93-8 | O=C(C1=C2C(N=C(C3=CC=NC=C3)N2)=CC=C1)O | 2-(Pyridin-4-yl)-1H-benzo[d]imidazole-4-carboxylic acid | AG000LVW | 5g |
| 124337-34-4 | N1(C2C=CC=CC=2C2C=CC=CC1=2)CN1C2C=CC=CC=2N=N1 | 9-(1H-Benzotriazol-1-Ylmethyl)-9H-Carbazole | AG000LW4 | 80g |
| 1243471-01-3 | NC1=CC(OC2CC2)=CC(=C1)C(F)(F)F | 3-Cyclopropoxy-5-(trifluoromethyl)aniline | AG000LWD | 2g |
| 1243419-67-1 | CN1N=C2C=C(Br)C=CC2=C1Cl | 6-Bromo-3-chloro-2-methyl-2H-indazole | AG000LWL | 5g |
| 124391-76-0 | O=C(N1C[C@@H](CO)CC1)OCC2=CC=CC=C2 | (S)-1-CBZ-3-HYDROXYMETHYLPYRROLIDINE | AG000LXQ | 60g |
| 124391-75-9 | OC[C@H]1COCC1 | (S)-Tetrahydrofuran-3-ylmethanol | AG000LXR | 0.2g |
| 1247358-96-8 | CC1N(C2=C(Cl)C=CC=C2)N=CC=1 | 1-(2-Chlorophenyl)-5-methyl-1H-pyrazole | AG000MOR | 0.2g |
| 1247645-16-4 | N=1C(=NC(=CC1N)C)N2CCCC2 | 6-Methyl-2-(pyrrolidin-1-yl)pyrimidin-4-amine | AG000MPB | 20g |
| 1247501-81-0 | NCCC1CCS(=O)(=O)CC1 | 2-(1,1-dioxidotetrahydro-2h-thiopyran-4-yl)ethanamine | AG000MPE | 1g |
| 124771-44-4 | CNC(=O)c1ccc(cc1)C#C | 4-Ethynyl-N-methylbenzamide | AG000MPF | 2g |
| 124763-51-5 | OCC(CO)(N(CCO)CCO)CO.[H]Cl | Bis-Tris HCl | AG000MPJ | 2500g |
| 124755-24-4 | CCOC(=O)CP(=O)(OCC(F)(F)F)OCC(F)(F)F | Ethyl 2-(bis(2,2,2-trifluoroethoxy)phosphoryl)acetate | AG000MPN | 200g |
| 124752-23-4 | CC(C)(C)OC(=O)C[C@H]1C[C@H](OC(C)(C)O1)C=O | tert-Butyl (4R, 6S)-6-formaldehydel-2,2-dimethyl-1,3-dioxane-4-acetate | AG000MPQ | 200g |
| 124750-99-8 | [O-]CC1=C(Cl)N=C(CCCC)N1CC2=CC=C(C3=CC=CC=C3C4=NNN=N4)C=C2.[K+] | Losartan Potassium | AG000MPS | 890g |
| 124750-92-1 | CCCCC1=NC(Cl)=C(C(O)=O)N1CC(C=C2)=CC=C2C3=C(C4=NN=NN4)C=CC=C3 | Losartan Carboxylic Acid | AG000MPU | 10g |
| 124750-59-0 | O=C(C1=C(C(OC)=O)NC(CCC)=N1)OC | 2-Propyl-1H-imidazole-4,5-dicarboxylic acid dimethyl ester | AG000MPV | 300g |
| 124750-53-4 | CC1=CC=C(C2=CC=CC=C2C3=NN=NN3C(C4=CC=CC=C4)(C5=CC=CC=C5)C6=CC=CC= | 5-(4′-Methyl-[1，1′-biphenyl]-2-yl)-1-trityl-1H-tetrazole | AG000MPW | 3000g |
| 1247745-21-6 | NC1=CC=C(OC(F)F)C=C1Cl | 2-CHLORO-4-(DIFLUOROMETHOXY)ANILINE | AG000MQ0 | 15g |
| 124784-76-5 | Oc1cnccn1 | Pyrazinol | AG000MQ1 | 125g |
| 1247885-41-1 | N#CC1=CC(N)=CC(F)=C1F | 5-Amino-2,3-difluorobenzonitrile | AG000MQP | 5g |
| 1247885-40-0 | N#CC1=CC([N+]([O-])=O)=CC(F)=C1F | 2,3-Difluoro-5-nitrobenzonitrile | AG000MQQ | 3g |
| 1247119-31-8 | N[C@H](CC[C@@H](N)CC1=CC=CC=C1)CC2=CC=CC=C2.[H]Cl.[H]Cl | (2R,5R)-1,6-diphenylhexane-2,5-diamine dihydrochloride | AG000MNC | 50g |
| 1247103-30-5 | OCC1CCN(C2=NC(Cl)=NC(C)=C2)CC1 | (1-(2-Chloro-6-methylpyrimidin-4-yl)piperidin-4-yl)methanol | AG000MND | 5g |
| 1247053-55-9 | C1(NC2=C3C=CC=C2)=C3C=CC4=C1C5=C(N4C6=CC=CC=C6)C=CC=C5 | 5-Phenyl-5,12-dihydroindolo[3,2-a]carbazole | AG000MNE | 250g |
| 1247000-92-5 | CC1(C)OB(OC1(C)C)c1ccc(cc1)C1CCN(CC1)C | 1-Methyl-4-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)piperidin | AG000MNI | 75g |
| 124703-78-2 | O=C1NC=NC(CC)=C1 | 6-Ethylpyrimidin-4(3H)-one | AG000MNQ | 20g |
| 124702-80-3 | OC1=C(O)C=C2C(=O)CCC2=C1 | 5,6-DIHYDROXY-2,3-DIHYDRO-1H-INDEN-1-ONE | AG000MNT | 300g |
| 1247348-92-0 | FC1=C2N=CSC2=CC=C1 | 4-Fluorobenzo[d]thiazole | AG000MNW | 25g |
| 124730-56-9 | OC(=O)C1=CN2CCCC3=CC=CC1=C23 | 5,6-Dihydro-4H-pyrrolo[3,2,1-ij]quinoline-1-carboxylic acid | AG000MO4 | 4g |
| 124729-02-8 | CCCCC[C@H]1CC[C@H](C2=CC=C(OCC)C(F)=C2F)CC1 | TRANS-1-ETHOXY-2,3-DIFLUORO-4-(4-PENTYL-CYCLOHEXYL)-BENZENE | AG000MO7 | 125g |
| 124728-93-4 | CCCOC1=C(F)C(F)=CC=C1 | 1,2-difluoro-3-propoxybenzene | AG000MO8 | 200g |
| 124728-90-1 | Fc1c(O)ccc(c1F)O | 2,3-Difluorohydroquinone | AG000MO9 | 15g |
| 124728-81-0 | CCCCC[C@H]1CC[C@H]([C@H]2CC[C@H](C3=CC=C(OCC)C(F)=C3F)CC2)CC1 | (trans,trans)-4-(4-Ethoxy-2,3-difluorophenyl)-4′-pentyl-1,1′-bi(cyclohexane) | AG000MOA | 125g |
| 124728-45-6 | CCOC1=C(F)C(F)=C(C=C1)C(O)=O | 4-Ethoxy-2,3-difluorobenzoic acid | AG000MOB | 15g |
| 124717-60-8 | Cc1ccc(cc1Br)C1OCCO1 | 1,3-Dioxolane, 2-(3-bromo-4-methylphenyl)- | AG000MOJ | 50g |
| 1247394-67-7 | CN(C1CNCC1)C(C)C | N-Isopropyl-N-methylpyrrolidin-3-amine | AG000MON | 5g |
| 1253792-97-0 | C[C@@H](N)C1=CC=CC(Cl)=C1F.[H]Cl | (1R)-1-(3-Chloro-2-fluorophenyl)ethylamine-hcl | AG000NLH | 35g |
| 1253792-95-8 | CC[C@H](C1=CC=C(F)C=C1F)N.[H]Cl | (R)-1-(2,4-Difluorophenyl)propan-1-amine hydrochloride | AG000NLI | 0.75g |
| 1253792-93-6 | N#CC1=CC=CC([C@H](N)CC)=C1.[H]Cl | (R)-3-(1-Aminopropyl)benzonitrile hydrochloride | AG000NLJ | 0.25g |
| 1253792-64-1 | FC1=NC=CC(OCC2=CC=CC=C2)=C1 | 4-(Benzyloxy)-2-fluoropyridine | AG000NLM | 5g |
| 1253792-57-2 | O=C(C1=CC2=C(N=C1)CNCC2)OC.[H]Cl | Methyl 5,6,7,8-tetrahydro-1,7-naphthyridine-3-carboxylate hydrochloride | AG000NLN | 2g |
| 1253792-35-6 | FC1=C2C=NNC2=CC(OCC2=CC=CC=C2)=C1 | 6-(Benzyloxy)-4-fluoro-1H-indazole | AG000NLQ | 0.75g |
| 1253792-21-0 | O=C(O)[C@H](NC(OCC1C(C=CC=C2)=C2C3=C1C=CC=C3)=O)CC4=CC(F)=CC=C4F | (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(2,5-difluorophenyl)pr | AG000NLR | 5g |
| 1253791-76-2 | CC(C)(C)OC(=O)N[C@H](CNC(=O)OCc1ccccc1)Cc1ccc(Br)cc1 | benzyl N-[(2S)-3-(4-bromophenyl)-2-{[(tert-butoxy)carbonyl]amino}propyl]c | AG000NLU | 0.5g |
| 1253791-66-0 | OC1=CC2=C(C=NN2)C(F)=C1 | 4-Fluoro-1H-indazol-6-ol | AG000NLV | 0.5g |
| 1253955-71-3 | Cl.CC(C)(C)OC(=O)NC(CN)C1=CC=CC=C1 | 2-(Boc-amino)-2-phenylethylamine hydrochloride | AG000NM0 | 10g |
| 1253952-02-1 | Cl.CC1=C(C(=O)OCC2=CC=C(C=C2)[C@H](C(=O)NC=2C=C3C=CN=CC3=CC2)CN)C= | Benzoic acid, 2,4-dimethyl-, [4-[(1S)-1-(aminomethyl)-2-(6-isoquinolinylamin | AG000NM1 | 0.3g |
| 1253929-33-7 | OC1(CF)CCNCC1.[H]Cl | 4-Fluoromethyl-4-hydroxypiperidine hydrochloride | AG000NM2 | 10g |
| 1253929-32-6 | O=C(N1CCC(O)(CF)CC1)OC(C)(C)C | tert-butyl 4-(fluoromethyl)-4-hydroxypiperidine-1-carboxylate | AG000NM3 | 25g |
| 1253924-71-8 | O=C1NC(C2=CC=C(C=C2)OC(F)(F)F)=NC13CCNCC3 | 2-[4-(Trifluoromethoxy)phenyl]-1,3,8-triazaspiro[4.5]dec-1-en-4-one | AG000NM5 | 30g |
| 1253912-00-3 | CC1=C2C(C=C(B(O)O)C=C2)=NN1C | 2,3-Dimethyl-2h-indazol-6-ylboronic acid | AG000NM7 | 10g |
| 1253911-22-6 | FC1=CC2=C(NN=C2)C=C1B(O)O | 5-Fluoro-1h-indazol-6-ylboronic acid | AG000NMA | 1.75g |
| 125398-82-5 | O=S(C1=CC=CC=C1)(N1CCNCCC1)=O | 1-(Phenylsulfonyl)-1,4-diazepane | AG000NMC | 1g |
| 1254-38-2 | O=C(O[C@H]1[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H](OC(C | (1R,2R,3S,4R,5s,6S)-Cyclohexane-1,2,3,4,5,6-hexayl hexaacetate | AG000NMJ | 50g |
| 124980-98-9 | O=C(OC)[C@H](O)CC1=CC=C(F)C=C1 | (R)-Methyl 3-(4-fluorophenyl)-2-hydroxypropanoate | AG000MXW | 0.75g |
| 124980-94-5 | O=C([C@@H](CC1=CC=C(C=C1)F)O)O | (R)-3-(4-Fluorophenyl)-2-Hydroxypropanoic Acid | AG000MXX | 1g |
| 124980-93-4 | O=C(O)[C@@H](O)CC1=CC=C(F)C=C1 | (S)-3-(4-Fluorophenyl)-2-hydroxypropionic Acid | AG000MXY | 4g |
| 125-46-2 | O=C(C1(C)C(OC2=C(C(C)=O)C(O)=C(C)C(O)=C12)=C3)C(C(C)=O)C3=O | 4,10-diacetyl-11,13-dihydroxy-2,12-dimethyl-8-oxatricyclo[7.4.0.0^{2,7}]tride | AG000MYI | 400g |
| 125-31-5 | Cc1cc(c(cc1O)C)C2(c3ccccc3S(=O)(=O)O2)c4cc(c(cc4C)O)C | Xylenol Blue | AG000MYJ | 9000g |
| 125-13-3 | O=C1NC2=C(C=CC=C2)C1(C3=CC=C(O)C=C3)C4=CC=C(O)C=C4 | Oxyphenisatine | AG000MYN | 3g |
| 125-12-2 | C[C@@]12[C@@H](OC(=O)C)C[C@@H](C1(C)C)CC2 | rel-(1R,2R,4R)-1,7,7-Trimethylbicyclo[2.2.1]heptan-2-yl acetate | AG000MYO | 20g |
| 125-10-0 | C[C@@]12[C@]([C@]3([C@](C(=O)C1)([C@]4(C)C(CC3)=CC(=O)C=C4)[H])[H])(C | 21-(Acetyloxy)-17-hydroxypregna-1,4-diene-3,11,20-trione | AG000MYP | 200g |
| 1250038-98-2 | CC1=CC(NC2CC2)=NC(Cl)=N1 | (2-Chloro-6-methyl-pyrimidin-4-yl)-cyclopropyl-amine | AG000MYR | 2g |
| 1250022-24-2 | N#CC1=NC=CN=C1Br | 3-BroMopyrazine-2-carbonitrile | AG000MYU | 10g |
| 1250004-31-9 | C1(C2CC2)CNCC1 | 3-Cyclopropylpyrrolidine | AG000MYV | 3g |
| 1250-95-9 | C[C@H](CCCC(C)C)[C@@]1([H])CC[C@@]2([H])[C@]3([H])C[C@H]4[C@@]5(O4 | (4aR,5aS,6aS,6bS,9R,9aR,11aS,11bR)-9a,11b-dimethyl-9-((R)-6-methylheptan- | AG000MZ2 | 0.5g |
| 1250241-63-4 | FC1=CC(C(N)CO)=CC=C1Cl | 2-Amino-2-(4-chloro-3-fluorophenyl)ethanol | AG000MZB | 5g |
| 124899-25-8 | O[C@@]1(C)CC[C@@H](O)CC1 | Cis-1-methylcyclohexane-1,4-diol | AG000MV4 | 10g |
| 124898-13-1 | FC([Si](C)(C)C)(F)C(F)(F)F | Trimethyl(pentafluoroethyl)silane | AG000MV5 | 35g |
| 1249-97-4 | CN(C)c1ccc2N(C(=O)c3ccccc3)c3ccc(cc3Sc2c1)N(C)C | Benzoyl Leuco Methylene Blue | AG000MV8 | 1000g |
| 1249147-55-4 | COc1cccc(c1)Oc1ccc(cn1)Br | 5-Bromo-2-(3-methoxyphenoxy)pyridine | AG000MVE | 21.6g |
| 124915-06-6 | C[N+](C)(C)C1=CC=C(C(OCC)=O)C=C1.O=S(C(F)(F)F)([O-])=O | 4-(Ethoxycarbonyl)-N,N,N-trimethylbenzenaminium trifluoromethanesulfon | AG000MVT | 3g |
| 1249321-20-7 | OCCN(CC1=CC=CC=C1)CC2CC2 | 2-[Benzyl(cyclopropylmethyl)amino]ethanol | AG000MW4 | 75g |
| 1249274-01-8 | CC(CC1=CC=C(OC(F)(F)F)C=C1)=O | 1-[4-(Trifluoromethoxy)phenyl]propan-2-one | AG000MW6 | 4g |
| 124937-51-5 | CC(N(C(C)C)CC[C@@H](C1=C(O)C=CC(C)=C1)C1=CC=CC=C1)C | 2-[(1R)-3-[bis(propan-2-yl)amino]-1-phenylpropyl]-4-methylphenol | AG000MWB | 0.5g |
| 124932-43-0 | N[C@H]1CNCCCC1 | (R)-3-Amino-hexahydro-1h-azepin | AG000MWG | 20g |
| 124931-12-0 | O=C(N(OC)C)CP(OCC)(OCC)=O | Diethyl (N-Methoxy-N-Methylcarbamoylmethyl)Phosphonate | AG000MWI | 200g |
| 1249591-96-5 | CS(=O)(=O)CC(O)C1=C(Cl)C=CC=C1 | 1-(2-Chlorophenyl)-2-(methylsulfonyl)ethanol | AG000MWS | 25g |
| 124959-28-0 | ClC1=NC=CC(C2=CC=CO2)=N1 | 2-Chloro-4-(2-furyl)pyrimidine | AG000MX8 | 5g |
| 1249763-34-5 | COC(C1C2=C(C=C(C=C2)N)NC=1)=O | Methyl 6-amino-1H-indole-3-carboxylate | AG000MXK | 10g |
| 1249610-72-7 | COCC1=CC(Cl)=NC=C1 | 2-Chloro-4-(methoxymethyl)pyridine | AG000MXN | 2g |
| 125144-04-9 | NC1NN=C(C#N)C=1 | 5-Amino-1H-pyrazole-3-carbonitrile | AG000N9L | 1g |
| 125164-55-8 | C=C([C@@](C[C@@H]1OC(C)=O)(O)C2)C([C@@]32CC[C@]4([H])[C@@](CO)(C) | Rosthornin A | AG000N9V | 0.005g |
| 125163-12-4 | NC1=CC(OC)=C(F)C=C1[N+]([O-])=O | 4-Fluoro-5-methoxy-2-nitroaniline | AG000NA0 | 10g |
| 125162-81-4 | NCCCCC(CO)CO | 2-(4-Aminobutyl)propane-1,3-diol | AG000NA1 | 4g |
| 1251761-36-0 | CCOC(=O)c1nccn2cccc12 | ETHYL PYRROLO[1,2-A]PYRAZINE-1-CARBOXYLATE | AG000NAE | 1g |
| 1251734-12-9 | CC1SC=C(NC(OC(C)(C)C)=O)C=1 | tert-butyl N-(5-methylthiophen-3-yl)carbamate | AG000NAJ | 2g |
| 1251732-64-5 | O=C(OC(C)(C)C)NC1CC=C(B2OC(C)(C)C(C)(C)O2)CC1 | 4-(N-Boc-Amino)cyclohex-1-enyl-1-boronic acid pinacol ester | AG000NAK | 200g |
| 1251731-71-1 | CC(=O)OCCn1cc(cn1)B1OC(C)(C)C(C)(C)O1 | Acetic acid 2-[4-(4,4,5,5-tetramethyl-[1,3,2]dioxaborolan-2-yl)-pyrazol-1-yl]-e | AG000NAL | 2g |
| 1251844-44-6 | O=C(OC)C1=CC=NC(C(F)F)=C1 | Methyl 2-(difluoromethyl)isonicotinate | AG000NB2 | 1.35g |
| 1252046-13-1 | C(#N)c1c(Br)ccc(c1)I | 2-Bromo-5-iodobenzonitrile | AG000NBR | 150g |
| 1252006-72-6 | [B+3]([F-])([F-])([F-])[F-].ClC1=C([N+]2=CN3[C@]4(C=5C(C[C@]4(OCC3=N2)[H]) | (5Ar,10Bs)-2-(2,4,6-Trichlorophenyl)-4,5A,6,10B-Tetrahydroindeno[2,1-B][1,2, | AG000NBS | 1.5g |
| 1251999-74-2 | OC(=O)C(CCc1ccccc1Cl)N | 2-Amino-4-(2-chlorophenyl)butanoic acid | AG000NBT | 5g |
| 1251953-04-4 | NCC1=CC=C(Br)N=C1.[H]Cl.[H]Cl | (6-Bromopyridin-3-yl)methanamine dihydrochloride | AG000NBU | 5g |
| 1251953-03-3 | NCC1=NC=C(Br)C=C1.[H]Cl.[H]Cl | (5-Bromopyridin-2-yl)methanamine dihydrochloride | AG000NBV | 10g |
| 1251923-31-5 | OC1(C(F)(F)F)C2CNCC1CC2 | 8-HYDROXY-8-(TRIFLUOROMETHYL)-3-AZABICYCLO[3.2.1]OCTANE | AG000NBX | 1g |
| 1251923-10-0 | O=C(C1=CC2=C(NCCC2)C=C1)O.[H]Cl | 1,2,3,4-Tetrahydroquinoline-6-carboxylic acid hydrochloride | AG000NBY | 25g |
| 1253-47-0 | O=C(C1=CC=C(C=C1)C[P+](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4)OC.[Cl-] | 4-Carbomethoxybenzyl triphenylphosphonium chloride | AG000NGG | 50g |
| 1253106-58-9 | O=C1C=C(C)[C@H]2[C@@](C1)(C)C[C@]1(C(=C(C(=O)O1)C)C2)O | Chlorantholide D | AG000NGH | 0.005g |
| 1253055-92-3 | COC(CC(CC1=C(F)C=C(F)C(F)=C1)N)=O | Methyl 3-amino-4-(2，4，5-trifluorophenyl)butanoate | AG000NGI | 1g |
| 1253055-87-6 | OB(C1=CC=C(C2CC2)N=C1)O | 6-Cyclopropylpyridin-3-ylboronic acid | AG000NGJ | 25g |
| 125305-73-9 | CC(C)(O)[C@H]1CC[C@@H](CO1)[C@H]1CC[C@@]2(C)[C@@H]3CC[C@@H]4[C | 21,24-Epoxycycloartane-3,25-diol | AG000NGS | 0.005g |
| 125304-04-3 | OC1C(N2N=C3C=CC=CC3=N2)=CC(C)=CC=1CCCCCCCCCCCC | 2-(2H-Benzo[d][1,2,3]triazol-2-yl)-6-dodecyl-4-methylphenol | AG000NGU | 300g |
| 125300-69-8 | CCCCC(COc1cscc1)CC | 3-((2-Ethylhexyl)oxy)thiophene | AG000NH1 | 45g |
| 125300-42-7 | O=C(C1=C2N=CC(Cl)=CC2=CC=C1)O | 3-chloroquinoline-8-carboxylic acid | AG000NH2 | 5g |
| 125324-00-7 | [C@H](C(=O)O)(CC1C=CC(Cl)=CC=1)N(C)C(=O)OC(C)(C)C | Boc-d-mephe(4-cl)-oh | AG000NHA | 10g |
| 125316-60-1 | O=C(O)C1=CC=C2C=C(C3=CC=C(O)C(C45CC6CC(C5)CC(C6)C4)=C3)C=CC2=C1 | CD-437 | AG000NHE | 2g |
| 125314-13-8 | O=C1C(C2=CN(C)C3=CC=CC=C23)=C(C4=CC(N)=CC=C4)C(N1)=O | CP21R7 | AG000NHH | 0.3g |
| 125313-92-0 | O=C1C(=C(C(=O)N1)c1c2c(n(c1)C)cccc2)c1c2c(n(c1)C)cc(cc2)N(=O)=O | 3-(1-Methyl-1H-indol-3-yl)-4-(1-methyl-6-nitro-1H-indol-3-yl)-1H-pyrrole-2,5 | AG000NHI | 0.14g |
| 1253383-91-3 | C(=O)(OC)c1cc(F)c(nc1)C | 3-Pyridinecarboxylic acid, 5-fluoro-6-methyl-, methyl ester | AG000NHT | 20g |
| 1253383-90-2 | O=C(OC)C1=C(Cl)N=C(C)C(F)=C1 | Methyl 2-chloro-5-fluoro-6-methylnicotinate | AG000NHU | 10g |
| 1253286-56-4 | [H][C@]12CS[C@H]([C@]1(NC(N2)=O)[H])CCCCC(NCCOCCOCCOCCC(ON3C(CCC | 4,7,10-Trioxa-13-azaoctadecanoic acid, 18-[(3aS,4S,6aR)-hexahydro-2-oxo-1H- | AG000NHW | 10g |
| 1253282-31-3 | O=C(O)[C@@H](NC(OCC1C2=C(C3=C1C=CC=C3)C=CC=C2)=O)CC4=CC=C(NC([C@ | (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(4-((s)-2,6-dioxohexah | AG000NHX | 10g |
| 125337-31-7 | O(CCCCCCOC(=O)C=C)c1ccc(cc1)c1ccc(cc1)OCCCCCCOC(=O)C=C | 2-Propenoic acid, 1,1′-[[1,1′-biphenyl]-4,4′-diylbis(oxy-6,1-hexanediyl)] ester | AG000NI2 | 50g |
| 1250994-14-9 | O=C(N(CC1)CCC21CCC(C2)=O)OC(C)(C)C | tert-butyl 2-oxo-8-azaspiro[4.5]decane-8-carboxylate | AG000N56 | 30g |
| 1250993-54-4 | C(=O)(OC(C)(C)C)N1C[C@H]2[C@@H](CC1)NCC2 | tert-butyl octahydro-1H-pyrrolo[3,2-c]pyridine-5-carboxylate | AG000N57 | 10g |
| 125097-83-8 | O=C(C1=CCCN(C(OC(C)(C)C)=O)C1)OC | 1-tert-Butyl 3-methyl 5,6-dihydropyridine-1,3(2H)-dicarboxylate | AG000N5D | 10g |
| 125096-73-3 | IC1=CC=CC2=C(Cl)N=CN=C12 | 4-Chloro-8-iodoquinazoline | AG000N5E | 20g |
| 125096-72-2 | ClC1=C2C=CC=C(Br)C2=NC=N1 | 8-BROMO-4-CHLOROQUINAZOLINE | AG000N5F | 25g |
| 1251009-03-6 | CC(C)(C)OC(=O)N1CCC2(CNC(=O)C2)C1 | tert-Butyl 8-oxo-2,7-diazaspiro[4.4]nonane-2-carboxylate | AG000N5I | 125g |
| 1251007-91-6 | CC(C)(C)OC(=O)N1CCC2(CNC(=O)CO2)C1 | TERT-BUTYL 8-OXO-6-OXA-2,9-DIAZASPIRO[4.5]DECANE-2-CARBOXYLATE | AG000N5K | 10g |
| 1251006-64-0 | O=C(N1CC(C2CCNCC2)C1)OC(C)(C)C | tert-Butyl 3-(piperidin-4-yl)azetidine-1-carboxylate | AG000N5N | 245g |
| 1251005-78-3 | CC(C)(C)OC(=O)N1CC2(C1)CNc1cccnc21 | tert-Butyl 1′,2′-dihydrospiro[azetidine-3,3′-pyrrolo[3,2-b]pyridine]-1-carboxyl | AG000N5O | 5g |
| 1251005-61-4 | CC(C)(C)OC(=O)N1CCOC2(CNC2)C1 | tert-butyl 5-oxa-2,8-diazaspiro[3.5]nonane-8-carboxylate | AG000N5P | 25g |
| 1251005-45-4 | CC(C)(C)OC(=O)N1CCC11CCCNC1 | 1-Boc-1,6-diazaspiro[3.5]nonane | AG000N5Q | 10g |
| 1251004-87-1 | CC(OC(N1C2(C(O)=O)C(C2)CC1)=O)(C)C | 2-(Tert-Butoxycarbonyl)-2-Azabicyclo[3.1.0]Hexane-1-Carboxylic Acid | AG000N5R | 0.75g |
| 1251003-99-2 | O=C(N1C[C@](C(NC2=O)=O)([H])[C@]2([H])C1)OC(C)(C)C | (3aR,6aS)-rel-tert-Butyl 4,6-dioxohexahydropyrrolo[3,4-c]pyrrole-2(1H)-carbo | AG000N5T | 2g |
| 1251002-42-2 | CC(OC(N1CC2(CC(C(O)=O)C2)CC1)=O)(C)C | 6-BOC-6-AZA-SPIRO[3.4]OCTANE-2-CARBOXYLIC ACID | AG000N5W | 20g |
| 1251002-39-7 | C(C)(C)(C)OC(=O)N1CC2(C1)CC(C2)CC(=O)O | 2-(2-(tert-Butoxycarbonyl)-2-azaspiro[3.3]heptan-6-yl)acetic acid | AG000N5X | 4g |
| 1254055-46-3 | CCc1nc(C#N)c(Cl)nc1Cl | 3,5-Dichloro-6-ethylpyrazine-2-carbonitrile | AG000NMN | 1g |
| 1254053-84-3 | O=C(O)/C=C/C(O)=O.O=C(C1=NC(CC)=C(NC3CCOCC3)N=C1NC2=CC=C(N4CCC(N5 | 6-Ethyl-3-[[3-methoxy-4-[4-(4-methyl-1-piperazinyl)-1-piperidinyl]phenyl]a | AG000NMO | 0.1g |
| 1254053-43-4 | O=C(C1=NC(CC)=C(NC2CCOCC2)N=C1NC3=CC=C(N4CCC(N5CCN(C)CC5)CC4)C(O | Gilteritinib | AG000NMP | 25g |
| 1254040-46-4 | OC1=C(OC2=CC(=CC(=C2C1=O)O)O)C1=CC=C(C=C1)C(F)(F)F | 3,5,7-Trihydroxy-2-(4-(trifluoromethyl)phenyl)-4H-chromen-4-one | AG000NMQ | 0.5g |
| 1254036-71-9 | CC(C)N1CCN(CC1)CC2=CN=C(O2)C3=C4C=NNC4=CC(=C3)C5=C6C=CNC6=CC=C5 | 1H-Indazole, 6-(1H-indol-4-yl)-4-[5-[[4-(1-methylethyl)-1-piperazinyl]methyl | AG000NMT | 0.005g |
| 125404-00-4 | Nc1ccc(cc1)c1c2c(ccc1)cccc2 | 4-(1-Naphthalenyl)benzenamine | AG000NMZ | 400g |
| 125401-75-4 | COc1cc(OC)nc(Oc2cccc(Oc3nc(OC)cc(OC)n3)c2C(=O)O)n1 | 2,6-Bis((4,6-dimethoxypyrimidin-2-yl)oxy)benzoic acid | AG000NN5 | 3500g |
| 125401-64-1 | CCCCCCCCCCCCCCCCCCOC(CC[C@H](NC(CCC(O)=O)=O)C(OCCCCCCCCCCCCCCC | 1,5-Dioctadecyl N-(3-carboxy-1-oxopropyl)-L-glutamate | AG000NN6 | 7g |
| 125401-63-0 | [C@@H](NC(=O)CCC(=O)O)(C(=O)OCCCCCCCCCCCCCCCC)CCC(=O)OCCCCCCCCC | (S)-4-((1，5-Bis(hexadecyloxy)-1，5-dioxopentan-2-yl)amino)-4-oxobutanoi | AG000NN7 | 100g |
| 1254-85-9 | OC1=C2C(C)(C)C(=O)C=C[C@]2(C)[C@@H]2[C@](C1=O)(C)[C@@]13O[C@@H]1 | Cedrelone | AG000NN8 | 0.005g |
| 1254163-81-9 | O=C(OC)C1=NC(Cl)=C(C#N)C=C1 | Methyl 6-chloro-5-cyanopicolinate | AG000NNE | 3g |
| 1254123-51-7 | COC1=NC=C(Br)C=C1C(F)F | 5-Bromo-3-(difluoromethyl)-2-methoxypyridine | AG000NNF | 25g |
| 1254120-14-3 | O=C(N1CC(C(N)=O)(N)C1)OC(C)(C)C | tert-Butyl 3-amino-3-carbamoylazetidine-1-carboxylate | AG000NNH | 2g |
| 1254115-23-5 | N1(C2COC2)CCNCC1 | 1-Oxetan-3-yl-piperazine | AG000NNI | 400g |
| 1254115-22-4 | O=C(OCc1ccccc1)N1CCN(C2COC2)CC1 | benzyl 4-(oxetan-3-yl)piperazine-1-carboxylate | AG000NNJ | 25g |
| 1254115-16-6 | Cl.OCC1(F)CCNCC1 | (4-fluoropiperidin-4-yl)methanol hydrochloride | AG000NNK | 50g |
| 1254104-06-7 | FC1(CC(CC2)NC2C1)F.Cl | 3,3-difluoro-8-azabicyclo[3.2.1]octane hydrochloride | AG000NNM | 5g |
| 1254073-41-0 | O=C(NN)C1=NC=C(F)C=C1 | 5-Fluoropicolinohydrazide | AG000NNO | 2g |
| 1254058-34-8 | NC1=CC=C(N2CCC(N3CCN(C)CC3)CC2)C(OC)=C1 | 3-Methoxy-4-(4-(4-methylpiperazin-1-yl)piperidin-1-yl)aniline | AG000NNR | 10g |
| 1251002-01-3 | O=C(N1CC2(NCCOC2)C1)OC(C)(C)C | tert-Butyl 8-oxa-2,5-diazaspiro[3.5]nonane-2-carboxylate | AG000N5Y | 10g |
| 1251002-00-2 | O=C(N(CCC1)CC21CCN2)OC(C)(C)C | 1,6-Diazaspiro[3.5]nonane-6-carboxylic acid tert-butyl ester | AG000N5Z | 25g |
| 1251000-12-0 | CC(OC(N1CC2(NC(=O)COC2)C1)=O)(C)C | tert-Butyl 6-oxo-8-oxa-2,5-diazaspiro[3.5]nonane-2-carboxylate | AG000N61 | 10g |
| 1251-85-0 | O=c1n(n(c(c1Cc1c(=O)n(n(c1C)C)c1ccccc1)C)C)c1ccccc1 | 3H-Pyrazol-3-one, 4,4′-methylenebis[1,2-dihydro-1,5-dimethyl-2-phenyl- | AG000N65 | 5000g |
| 1251021-71-2 | CC1(C)[C@@H]2[C@H](CN(C1)C(=O)OC(C)(C)C)CN2 | (1R,6R)-rel-3-Boc-5,5-diMethyl-3,7-diazabicyclo[4.2.0]octane | AG000N67 | 0.5g |
| 1251020-88-8 | CC(C)(C)OC(=O)N1CC2(CCC2=O)C1 | tert-Butyl 5-oxo-2-azaspiro[3.3]heptane-2-carboxylate | AG000N69 | 7g |
| 1251017-66-9 | O=C(N1CC(C2)NC2C1)OC(C)(C)C | tert-butyl 3,6-diazabicyclo[3.1.1]heptane-3-carboxylate | AG000N6D | 25g |
| 1251014-35-3 | O=C(C1=CN2C=C(Br)C=CC2=C1)OCC | Ethyl 6-Bromoindolizine-2-Carboxylate | AG000N6I | 9g |
| 1251013-26-9 | O=C(N(CC1C2)CC2C1=O)OC(C)(C)C | 3-Boc-6-oxo-3-aza-bicyclo[3.1.1]heptane | AG000N6J | 20g |
| 1251012-82-4 | O=C(C1CC12CN(C(OC(C)(C)C)=O)C2)O | 5-Boc-5-aza-spiro[2.3]hexane-1-carboxylic acid | AG000N6L | 15g |
| 1251011-05-8 | O=C(N1CC2(OCCNC2)C1)OC(C)(C)C | tert-Butyl 5-oxa-2,8-diazaspiro[3.5]nonane-2-carboxylate | AG000N6M | 10g |
| 1251010-63-5 | O=C(N1CC[C@@]2([H])[C@]1([H])CCCN2)OC(C)(C)C | Cis-Tert-Butyl Octahydro-1H-Pyrrolo[3,2-B]Pyridine-1-Carboxylate | AG000N6N | 7g |
| 1251010-45-3 | O=C(N1C2COCC1CNC2)OC(C)(C)C | tert-Butyl 3-oxa-7,9-diazabicyclo[3.3.1]nonane-9-carboxylate | AG000N6O | 5g |
| 1251010-17-9 | O=C(N1CCC2(CCC2=O)C1)OC(C)(C)C | tert-Butyl 1-oxo-6-azaspiro[3.4]octane-6-carboxylate | AG000N6Q | 1g |
| 1248548-54-0 | ClC1=NC2=CC=CC(Br)=C2N1 | 4-Bromo-2-chloro-1h-benzimidazole | AG000MSP | 8g |
| 1248548-23-3 | COC(=O)CC1=CN(C)N=C1 | Methyl 2-(1-methyl-1H-pyrazol-4-yl)acetate | AG000MSQ | 15g |
| 1248541-63-0 | O=C(OC)C1=CC(Br)=CC(N)=C1N | methyl 2,3-diamino-5-bromobenzoate | AG000MST | 200g |
| 124845-04-1 | O=C(C1=C(C2CC2)ON=C1)O | 5-CYCLOPROPYLISOXAZOLE-4-CARBOXYLIC ACID | AG000MT7 | 100g |
| 124842-96-2 | NC(C1=CC=C(C)C=C1)C(C2=CC=C(C)C=C2)N | 1,2-Di-p-tolylethylenediamine | AG000MT9 | 50g |
| 124842-28-0 | O=C(N)C[C@@H](C(OC)=O)NC(OC(C)(C)C)=O | Methyl N2-(tert-butoxycarbonyl)-L-asparaginate | AG000MTA | 125g |
| 1248730-88-2 | O=C(N1CCN(C2CCC(NC(OC(C)(C)C)=O)CC2)CC1)OCC3=CC=CC=C3 | 4-(4-tert-Butoxycarbonylamino-cyclohexyl)-piperazine-1-carboxylic acid ben | AG000MTC | 7g |
| 1248703-88-9 | NC(C(O)=O)CC1COCC1 | 2-Amino-3-(tetrahydrofuran-3-yl)propanoic acid | AG000MTE | 2g |
| 124870-33-3 | O=C(OC)CC1=C(C#N)C=NC=C1 | Methyl 2-(3-cyanopyridin-4-yl)acetate | AG000MTJ | 20g |
| 124858-37-3 | Oc1ccc(cc1)[C@@H]1CC(=O)c2c(O1)cc1c(c2)C=CC(O1)(C)C | 5-Dehydroxyparatocarpin K | AG000MTY | 0.005g |
| 124858-35-1 | O=C(C1=CN2C(C)CCC3=C2C(C1=O)=CC(F)=C3N4CCC(O)CC4)O | 7-fluoro-8-(4-hydroxypiperidin-1-yl)-12-methyl-4-oxo-1-azatricyclo[7.3.1.0^{ | AG000MTZ | 25g |
| 1251039-74-3 | CC(NC1=NC=C(F)C=C1)C | 5-Fluoro-N-isopropylpyridin-2-amine | AG000N6W | 0.5g |
| 1251033-82-5 | CC(OC(NCC1=NNC=C1)=O)(C)C | tert-Butyl N-(1H-pyrazol-3-ylmethyl)carbamate | AG000N6X | 25g |
| 1251033-27-8 | BrC1=N[NH]C2=NC=NC=C12 | 3-Bromo-1H-pyrazolo[3,4-d]pyrimidine | AG000N6Z | 25g |
| 1251033-05-2 | Cl[H].FC1=CC=C(C=C1F)C1CNCCO1 | 2-(3,4-Difluorophenyl)morpholine hydrochloride | AG000N71 | 0.2g |
| 1251032-65-1 | ClC1=CC(C(C)(C)C)=CC=C1Br | 1-Bromo-4-(tert-butyl)-2-chlorobenzene | AG000N74 | 1500g |
| 1251023-52-5 | BrC2=CC1=C([N](N=C1C=C2)C)C=O | 5-Bromo-2-methyl-2H-indazole-3-carbaldehyde | AG000N77 | 10g |
| 125104-34-9 | O=C(OC)C1=CC=NC(C=O)=C1 | Methyl 2-formylisonicotinate | AG000N7E | 100g |
| 1251156-96-3 | COCCOCC1=CC(Br)=CC=C1 | 1-Bromo-3-(2-methoxyethoxy)methylbenzene | AG000N7R | 31.1g |
| 125114-77-4 | O=C1CCC2=C1C(Br)=CC=C2 | 7-bromo-2,3-dihydroinden-1-one | AG000N82 | 200g |
| 125113-68-0 | OC[C@H]([C@@H]([C@@H]([C@H](C=O)O)O)OS(=O)(=O)[O-])O.[Na+] | Sodium (2R,3S,4R,5R)-1,2,4,5-tetrahydroxy-6-oxohexan-3-yl sulfate | AG000N83 | 0.03g |
| 125141-73-3 | OC1CC2=C(C(Br)=CC=C2)C1 | 4-Bromo-2-hydroxylindan | AG000N8I | 5g |
| 125133-96-2 | C[C@@H]1[C@H](OC(=O)N1)c1ccccc1 | (4R,5R)-4-Methyl-5-phenyl-2-oxazolidinone | AG000N8Q | 1g |
| 1251537-39-9 | O=C(N1CCC(B(O)O)CC1)OC(C)(C)C | (1-(tert-Butoxycarbonyl)piperidin-4-yl)boronic acid | AG000N91 | 100g |
| 1251456-87-7 | C=CC(NC1=CC(OC)=C(C=O)C=C1Cl)=O | N-(2-Chloro-4-formyl-5-methoxyphenyl)acrylamide | AG000N94 | 5g |
| 1250236-70-4 | O=C(OC)CN(C1(=NC=CC=C1))C | Methyl 2-[methyl(pyridin-2-yl)amino]acetate | AG000MZC | 10g |
| 125036-88-6 | FC1=CC(C=O)=CC(F)=C1OCC1=CC=CC=C1 | 4-(Benzyloxy)-3,5-difluorobenzaldehyde | AG000N0D | 205g |
| 125033-59-2 | CC(OC(NCC1(CNCC1)O)=O)(C)C | 3-(Boc-aminomethyl)-3-hydroxypyrrolidine | AG000N0F | 2g |
| 125032-87-3 | CC1(O)CCNC1 | 3-Methylpyrrolidin-3-ol | AG000N0H | 125g |
| 1250444-03-1 | CNCC1CC(F)(F)C1.[H]Cl | 1-(3,3-Difluorocyclobutyl)-N-methylmethanamine hydrochloride | AG000N0R | 1g |
| 1250443-94-7 | COC(C1SC2=C(C=C(C=N2)Br)C=1)=O | Methyl 5-bromothieno[2,3-b]pyridine-2-carboxylate | AG000N0S | 0.1g |
| 1250443-61-8 | N1(C(C2=CC=CC=C2)C3=CC=CC=C3)CC4(CNCC4)C1 | 2-Benzhydryl-2,6-diazaspiro[3.4]octane | AG000N0U | 25g |
| 1250443-39-0 | O=C1NCC2=C1C=C(CN)C=C2.[H]Cl | 6-(Aminomethyl)isoindolin-1-one hydrochloride | AG000N0W | 3g |
| 125043-83-6 | Cl.[O-][N+](C1=CC(OC2CCNCC2)=CC=C1)=O | 4-(3-Nitrophenoxy)piperidine, HCl | AG000N12 | 10g |
| 125043-04-1 | C[C@@H](NC(=O)OCC1c2ccccc2-c2ccccc12)C(=O)Oc1c(F)c(F)c(F)c(F)c1F | Fmoc-D-Ala-OPfp | AG000N15 | 5g |
| 1250663-38-7 | O=C(OC)C1=CC(Cl)=C(Cl)C(N)=C1 | Methyl 3-amino-4,5-dichlorobenzoate | AG000N2S | 2g |
| 125072-69-7 | COc1cc(C[C@H]2COC(=O)[C@@]2(O)Cc2ccc(O)c(OC)c2)ccc1O | Epinortrachelogenin | AG000N2X | 0.005g |
| 125072-68-6 | CCOC([C@H](Cc1c(OC)ccc2c1oc(=O)cc2)O)(C)C | (S)-Yuehgesin C | AG000N2Y | 0.005g |
| 125068-54-4 | CC1CC(NN=C1C1=CC=C(C=C1)NC1=C(C(CC1)=O)C)=O | 5-Methyl-6-(4-((2-methyl-3-oxocyclopent-1-en-1-yl)amino)phenyl)-4,5-dihyd | AG000N32 | 0.05g |
| 125067-75-6 | FC1=CC(C2CNCC2)=CC=C1 | 3-(3-Fluorophenyl)pyrrolidine | AG000N35 | 1g |
| 1250814-06-2 | NC1=NC=CC=C1CN1CCOCC1 | 2-Amino-3-(morpholinomethyl)pyridine | AG000N3J | 2g |
| 1250756-65-0 | C1(CC12CCOCC2)N | 6-Oxaspiro[2.5]octan-1-amine | AG000N3N | 0.5g |
| 1250921-20-0 | O=C(O)C1=CC=CC(F)=C1NC | 3-Fluoro-2-(methylamino)benzoic acid | AG000N47 | 5g |
| 125096-15-3 | O=C(NN)CN1C2=C(C=CC=C2)SC3=CC=CC=C13 | 2-(10H-Phenothiazin-10-yl)acetohydrazide | AG000N4E | 10g |
| 125092-42-4 | CCCNc1c(N)n(C)c(=O)[nH]c1=O | 6-amino-1-methyl-5-(propylamino)-1,2,3,4-tetrahydropyrimidine-2,4-dione | AG000N4K | 3g |
| 1250997-29-5 | OC([C@H]1[C@H]2CC[C@@H]1CN(C(OC(C)(C)C)=O)C2)=O | 3-Boc-3-azabicyclo[3.2.1]octane-8-carboxylic acid | AG000N4V | 25g |
| 1250997-05-7 | CC(OC(N1C2C(C(O)=O)CC(CC2)C1)=O)(C)C | 2-Azabicyclo[2.2.2]octane-2,6-dicarboxylic acid 2-tertbutyl ester | AG000N4W | 0.5g |
| 1250996-97-4 | ClC=1N=CC=2N(C1)C(=CN2)C(=O)OCC | Ethyl 6-chloroimidazo[1,2-a]pyrazine-3-carboxylate | AG000N4X | 5g |
| 1250996-75-8 | CC(OC(N1CC2C(CC(O)=O)C(CC2)C1)=O)(C)C | 2-(3-(Tert-Butoxycarbonyl)-3-Azabicyclo[3.2.1]Octan-8-Yl)Acetic Acid | AG000N4Z | 1g |
| 1250996-70-3 | O=C(N1CC2=NC(CO)=CN2CC1)OC(C)(C)C | TERT-BUTYL 2-(HYDROXYMETHYL)-5,6-DIHYDROIMIDAZO[1,2-A]PYRAZINE-7(8H | AG000N50 | 2g |
| 1250995-41-5 | C(O)(=O)[C@H]1[C@@]2(C[C@]1(CN(C(OC(C)(C)C)=O)C2)[H])[H] | rel-(1R,5S,6s)-3-(tert-Butoxycarbonyl)-3-azabicyclo[3.1.1]heptane-6-carboxyli | AG000N52 | 1g |
| 125257-38-7 | Cc1csc(c1Br)Br | Thiophene, 2,3-dibromo-4-methyl- | AG000NDX | 10g |
| 125256-00-0 | C(CC)C1=NC=CC(=C1)C=1SC=C(N1)C1=CC=C(C=C1)C | 2-(2-Propylpyridin-4-yl)-4-(p-tolyl)thiazole | AG000NE0 | 2g |
| 125248-71-7 | CC1=CC(OC(C2=CC=C(OCCCCCCOC(C=C)=O)C=C2)=O)=CC=C1OC(C3=CC=C(OCCC | 2-Methyl-1,4-phenylene bis(4-((6-(acryloyloxy)hexyl)oxy)benzoate) | AG000NE5 | 2500g |
| 1252686-51-3 | S=C1N(C(CC)=O)[C@H](C(C)C)CO1 | 1-[(4R)-4-(1-Methylethyl)-2-thioxo-3-oxazolidinyl]-1-propanone | AG000NEG | 8g |
| 1252686-45-5 | Cl.C(CN)c1c2c([nH]c1)cc(cc2)OC(F)(F)F | 1H-Indole-3-ethanamine, 6-(trifluoromethoxy)-, hydrochloride (1:1) | AG000NEH | 0.075g |
| 1252672-38-0 | COC(=O)C12CCC(N)(CC1)C2 | Methyl 4-aminobicyclo[2.2.1]heptane-1-carboxylate | AG000NEK | 10g |
| 1252597-70-8 | NC1=NC=C(I)N=C1Cl | 3-Chloro-5-iodopyrazin-2-amine | AG000NEO | 20g |
| 125261-30-5 | CCOC(=O)c1ccc(OS(=O)(=O)C(F)(F)F)cc1 | ethyl 4-(trifluoromethanesulfonyloxy)benzoate | AG000NEW | 50g |
| 1252867-16-5 | CC(OC(N1CC(C(O)=O)CCCC1)=O)(C)C | 1-(tert-Butoxycarbonyl)azepane-3-carboxylic acid | AG000NF6 | 10g |
| 125278-10-6 | N[C@H](C(F)(F)F)C | (S)-1,1,1-Trifluoropropan-2-amine | AG000NFN | 2g |
| 125274-16-0 | OCCOCCOCCOCCOC(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3 | 3,6,9,12-Tetraoxatridecan-1-ol, 13,13,13-triphenyl- | AG000NFQ | 10g |
| 1252934-30-7 | FC1(F)CC(CBr)C1 | 3-(Bromomethyl)-1,1-difluorocyclobutane | AG000NFV | 50g |
| 125299-79-8 | BrC1=C(O)C(Br)=CC(/C2=C(C=C3)/N=C3/C(C4=CC(Br)=C(O)C(Br)=C4)=C(C=C/5)N | Tetra(3,5-dibromo-4-hydroxyphenyl)porphyrin | AG000NFY | 10g |
| 125290-87-1 | O=C(OC(C)(C)C)NCC1(C)CNCC1 | tert-Butyl (3-methylpyrrolidin-3-yl)methylcarbamate | AG000NGA | 10g |
| 1256360-12-9 | C1(=CC=CC=C1)C(=O)N1C=C(C=C1)B1OC(C(O1)(C)C)(C)C | Phenyl(3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrol-1-yl)metha | AG000O7W | 20g |
| 1256360-11-8 | CC1(OB(OC1(C)C)C1=CN(C=C1)C(=O)OCC1=CC=CC=C1)C | Benzyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrole-1-carboxyl | AG000O7X | 4g |
| 1256360-06-1 | O=C(N1C=C(B2OC(C)(C)C(C)(C)O2)C=C1)OCC | 1-(Ethoxycarbonyl)pyrrole-3-boronic acid, pinacol ester | AG000O82 | 5g |
| 1256393-27-7 | [H][C@]12CC[C@]([H])(C1)N([C@@H]2C1=NC2=CC=C(C=C2N1)C1=CC2=C(C=C1) | Ledipasvir Intermediate | AG000O84 | 2.6g |
| 1256387-87-7 | O=C(N1[C@](C2)([H])CC[C@]2([H])[C@H]1C3=NC4=CC=C(B5OC(C)(C)C(C)(C)O5) | (1R,3S,4S)-2-tert-Butyl-3-(6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1h- | AG000O85 | 125g |
| 1256387-73-1 | [H][C@]12CC[C@]([H])(C1)N([C@@H]2C(=O)NC1=CC=C(Br)C=C1N)C(=O)OC(C)( | (1R,3S,4S)-tert-butyl 3-((2-amino-4-bromophenyl)carbamoyl)-2-azabicyclo[2. | AG000O86 | 1.9g |
| 1256360-64-1 | [Br]C2(=NC=C(B1(OC(C)(C)C(O1)(C)C))C=C2C) | 2-Bromo-3-methylpyridine-5-boronic acid, pinacol ester | AG000O88 | 30g |
| 1256360-63-0 | CC(C)NC1=CC=C(C=C1)B1OC(C)(C)C(C)(C)O1 | 4-Isopropylaminophenylboronic acid, pinacol ester | AG000O89 | 30g |
| 1256360-62-9 | ClC1=NC=C(C(B2OC(C)(C(C)(O2)C)C)=C1)F | 2-Chloro-5-fluoropyridine-4-boronic acid pinacol ester | AG000O8A | 15g |
| 1256360-61-8 | CC1(C)OB(OC1(C)C)C1=C(CNC2CCCC2)C=CC(F)=C1 | 2-(Cyclopentylamino)methyl-5-fluorophenylboronic acid, pinacol ester | AG000O8B | 5g |
| 1256360-60-7 | CC1(C)OB(OC1(C)C)C1=C(CNC2CCCCC2)C=CC(F)=C1 | 2-(Cyclohexylaminomethyl)-5-fluorophenylboronic acid, pinacol ester | AG000O8C | 3g |
| 1256360-59-4 | CCCNCC1=C(C=C(F)C=C1)B1OC(C)(C)C(C)(C)O1 | 2-(Propylaminomethyl)-5-fluorophenylboronic acid, pinacol ester | AG000O8D | 2g |
| 1256360-58-3 | CC1(C)OB(OC1(C)C)C1=C(CNC2CC2)C=CC(F)=C1 | 2-(Cyclopropylaminomethyl)-5-fluorophenylboronic acid, pinacol ester | AG000O8E | 4g |
| 1256360-56-1 | CCCNCC1=C(C=CC=C1)B1OC(C)(C)C(C)(C)O1 | 2-(N-Propylaminomethyl)phenylboronic acid, pinacol ester | AG000O8G | 5g |
| 1256360-55-0 | CC1(C)C(C)(C)OB(C2=CC=C(CBr)C=C2Cl)O1 | 4-Bromomethyl-2-chlorophenylboronic acid, pinacol ester | AG000O8H | 200g |
| 1256360-51-6 | CC1(C)C(C)(C)OB(C2=C(F)C(CN3CCOCC3)=CC=C2)O1 | 2-Fluoro-3-(morpholinomethyl)phenylboronic acid, pinacol ester | AG000O8I | 8g |
| 1256360-48-1 | N#CC1(C2=CC(B3OC(C)(C)C(C)(C)O3)=CC(Cl)=C2)CC1 | 3-Chloro-5-(1-cyano-1-cyclopropyl)phenylboronic acid, pinacol ester | AG000O8J | 10g |
| 125643-61-0 | O=C(OCCCCCCCC)CCC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 | Octyl-3，5-di-tert-butyl-4-hydroxy-hydrocinnamate | AG000O8K | 3000g |
| 125639-64-7 | O=C(OCC)[C@@H](O)CCC1=CC=CC=C1 | (S)-Ethyl 2-hydroxy-4-phenylbutanoate | AG000O8O | 50g |
| 1256355-37-9 | C(C)OC1=CC(=C(C=N1)B(O)O)C | (6-Ethoxy-4-methylpyridin-3-yl)boronic acid | AG000O4L | 2g |
| 1256355-77-7 | OB(O)c1ccccc1OCc1ccccc1C#N | 2-(2-Cyanophenylmethoxy)phenylboronic acid | AG000O4W | 2g |
| 1256355-75-5 | Clc1ccc(c(c1)Cl)COc1ccc(cc1)B(O)O | 4-(2,4-Dichlorophenylmethoxy)phenylboronic acid | AG000O4Y | 2g |
| 1256355-70-0 | OB(O)C1=CC=C(OCC2=CC=C(C=C2)C#N)C=C1 | 4-(4-Cyanophenylmethoxy)phenylboronic acid | AG000O53 | 2g |
| 1256355-69-7 | ClC1=CC(=CC=C1COC1=CC=CC=C1B(O)O)Cl | 2-(2,4-dichlorophenylmethoxy)phenylboronic acid | AG000O54 | 2g |
| 1256355-67-5 | N#CC1=CC(COC2=CC=CC=C2B(O)O)=CC=C1 | 2-(3-Cyanophenylmethoxy)phenylboronic acid | AG000O56 | 5g |
| 1256355-63-1 | FCCOc1ccc(cc1)B(O)O | 4-(2-Fluoroethoxy)phenylboronic acid | AG000O5A | 5g |
| 1256358-67-4 | OB(O)C1=CC(COC2=C(Cl)C=CC=C2)=CC=C1 | 3-(2-Chlorophenoxymethyl)phenylboronic acid | AG000O5H | 2g |
| 1256358-66-3 | OB(C1=CC=C(COCC2=CC=CO2)C=C1)O | 4-[(furan-2-ylmethoxy)methyl]phenylboronic acid | AG000O5I | 6g |
| 1256358-64-1 | OB(O)C1=CC=CC(COC2CCCCC2)=C1 | 3-(Cyclohexyloxy)methylphenylboronic acid | AG000O5J | 20g |
| 1256358-61-8 | COCCOCC1=CC(B(O)O)=CC=C1 | 3-[(2-methoxyethoxy)methyl]phenylboronic acid | AG000O5L | 3g |
| 1256358-60-7 | C(c1ccc(cc1)B(O)O)N1CCSCC1 | 4-(Thiomorpholin-4-ylmethyl)phenylboronic acid | AG000O5M | 10g |
| 1256358-59-4 | OB(c1cccc(c1)CN1CCSCC1)O | 3-(Thiomorpholin-4-ylmethyl)phenylboronic acid | AG000O5N | 2g |
| 1256358-55-0 | O=S(N1C=CC2=C1C=CC=C2B(O)O)(C3=CC=CC=C3)=O | 1-Benzenesulfonyl-1h-indole-4-boronic acid | AG000O5R | 10g |
| 1256358-53-8 | Fc1ccc(c(c1)B(O)O)OCc1cccc(c1)F | 5-Fluoro-2-(3-fluorophenylmethoxy)phenylboronic acid | AG000O5T | 7.1g |
| 1256359-17-7 | O=C(N1N=CC=C1B2OC(C)(C)C(C)(C)O2)OC(C)(C)C | N-Boc-1H-Pyrazole-5-boronic acid, pinacol ester | AG000O61 | 25g |
| 1256359-16-6 | CCS(=O)(NC1=CC=C(B2OC(C)(C)C(C)(C)O2)C=C1)=O | N-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)ethanesulfonamid | AG000O62 | 2g |
| 1256359-15-5 | CC1(C)C(C)(C)OB(C2=CN(C(C)(C)C)N=C2)O1 | 1-t-Butylpyrazole-4-boronic acid, pinacol ester | AG000O63 | 200g |
| 1256359-13-3 | CC(C)S(=O)(=O)C1=CC=C(C=C1)B1OC(C)(C)C(C)(C)O1 | 4-Isopropylsulfonylphenylboronic acid, pinacol ester | AG000O64 | 10g |
| 1256359-11-1 | N#CC1=CC2=C(NC(B3OC(C)(C)C(C)(C)O3)=C2)C=C1 | 5-Cyanoindole-2-boronic acid, pinacol ester | AG000O65 | 5g |
| 1256359-94-0 | CC(C)(C)OC(=O)n1cc(B2OC(C)(C)C(C)(C)O2)c2c(Cl)cccc21 | 1-BOC-4-chloroindole-3-boronic acid, pinacol ester | AG000O6Y | 5g |
| 1256359-86-0 | C(=O)(OC(C)(C)C)n1cc(c2c1cc(cc2)C)B1OC(C(O1)(C)C)(C)C | 1H-Indole-1-carboxylic acid, 6-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaboro | AG000O72 | 1.08g |
| 1256359-33-7 | N#CCOC1=C(C)C=C(B2OC(C)(C)C(C)(C)O2)C=C1C | 4-Cyanomethoxy-3,5-dimethylphenylboronic acid pinacol ester | AG000O74 | 0.5g |
| 1256359-27-9 | NC1=CC(OC(F)(F)F)=CC=C1B2OC(C)(C)C(C)(C)O2 | 2-Amino-4-trifluoromethoxyphenylboronic acid pinacol ester | AG000O76 | 1g |
| 1256359-23-5 | CC1(C)C(C)(C)OB(C2=CC3=C(N(S(=O)(C4=CC=CC=C4)=O)C=C3)C=C2)O1 | 1-(Phenylsulfonyl)indole-5-boronic acid, pinacol ester | AG000O79 | 10g |
| 1256359-22-4 | CCC(C1=CC=C(B2OC(C)(C)C(C)(C)O2)C=C1)=O | 4-(Propionyl)phenylboronic acid pinacol ester | AG000O7A | 10g |
| 1256359-21-3 | O=C(C1=CC2=C(C=C1)C=C(B3OC(C)(C)C(C)(C)O3)N2)OC | 6-Methoxycarbonylindole-2-boronic acid pinacol ester | AG000O7B | 15g |
| 1256359-20-2 | CSc1cc(Br)cc(c1)B1OC(C(O1)(C)C)(C)C | 3-Bromo-5-methylthiophenylboronic acid pinacol ester | AG000O7C | 2g |
| 1256359-19-9 | N#CC1=CC=CC2=C1C=C(B3OC(C)(C)C(C)(C)O3)N2 | 4-Cyanoindole-2-boronic acid pincol ester | AG000O7D | 25g |
| 1256360-47-0 | CC1(C)OB(OC1(C)C)C1=C(F)C=CC(CBr)=C1 | 5-(Bromomethyl)-2-fluorophenylboronic acid, pinacol ester | AG000O7E | 5g |
| 1256360-46-9 | O=S(N1CC=C(B2OC(C)(C)C(C)(C)O2)CC1)(C3=CC=C(C)C=C3)=O | 1-Tosyl-1,2,3,6-tetrahydropyridine-4-boronic acid, pinacol ester | AG000O7F | 25g |
| 1256360-41-4 | CC1(C)C(C)(C)OB(C(N2C)=CC3=C2C=CC(OC)=C3)O1 | 5-Methoxy-1-methylindole-2-boronic acid pinacol ester | AG000O7G | 6g |
| 1256360-38-9 | CC1(C)C(C)(C)OB(C2=C(F)C(CN3CCCC3)=CC=C2)O1 | 2-Fluoro-3-pyrrolidinomethylphenylboronic acid, pinacol ester | AG000O7H | 15g |
| 1256360-37-8 | CC1(C)OB(OC1(C)C)C1=C(F)C(CBr)=CC=C1 | 3-Bromomethyl-2-fluorophenylboronic acid, pinacol ester | AG000O7I | 25g |
| 1256360-31-2 | CC1(C)OB(OC1(C)C)c1c(C)cc(cc1C)N | 3,5-Dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline | AG000O7K | 1g |
| 1256360-28-7 | COC1=CC(=CN=C1Cl)B1OC(C)(C)C(C)(C)O1 | 2-Chloro-3-methoxypyridine-5-boronic acid, pinacol ester | AG000O7L | 2g |
| 1256360-24-3 | CSc1cc(Cl)cc(c1)B1OC(C(O1)(C)C)(C)C | 3-Chloro-5-methylthiophenylboronic acid, pinacol ester | AG000O7N | 3g |
| 1256360-21-0 | CC1(C)C(C)(C)OB(C2=CC(OCCOC)=C(Cl)C=C2F)O1 | 4-Chloro-2-fluoro-5-(2-methoxyethoxy)phenylboronic acid, pinacol ester | AG000O7O | 3g |
| 1256360-16-3 | CC1(C)C(C)(C)OB(C2=CC(OC(C)C)=C(Cl)C=C2F)O1 | 4-Chloro-2-fluoro-5-isopropoxyphenylboronic acid, pinacol ester | AG000O7S | 20g |
| 1256360-14-1 | CC1(C)C(C)(C)OB(C2=CC3=C(C=C2)C=NN3COC)O1 | 1-(Methoxymethyl)indazole-6-boronic acid, pinacol ester | AG000O7U | 5g |
| 1256346-20-9 | CCOc1c(Cl)ccc(c1F)B(O)O | 4-Chloro-3-ethoxy-2-fluorophenylboronic acid | AG000O1D | 5g |
| 1256346-18-5 | O=C(O)C1=CC(B(O)O)=CC=C1C | 3-Carboxy-4-methylphenylboronic acid | AG000O1E | 5g |
| 1256346-14-1 | CCCOC1=CC(B(O)O)=C(Cl)C=C1 | 2-Chloro-5-propoxyphenylboronic acid | AG000O1G | 20g |
| 1256346-12-9 | CC(Oc1ccc(c(c1)B(O)O)Cl)C | 2-Chloro-5-isopropoxyphenylboronic acid | AG000O1H | 1g |
| 1256346-11-8 | CC(C)COC1=CC(B(O)O)=C(Cl)C=C1 | 2-Chloro-5-isobutoxyphenylboronic acid | AG000O1I | 20g |
| 1256346-10-7 | OB(c1cc(OCc2ccccc2)ccc1Cl)O | 5-Benzyloxy-2-chlorophenylboronic acid | AG000O1J | 3g |
| 1256346-08-3 | FC(C1=CN=C(SC)C(B(O)O)=C1)(F)F | 2-Methylthio-5-trifluoromethylpyridine-3-boronic acid | AG000O1L | 5g |
| 1256346-07-2 | CC1=CC(=CC(OC2CCCC2)=C1)B(O)O | 3-(Cyclopentyloxy)-5-methylphenylboronic acid | AG000O1M | 2g |
| 1256346-06-1 | CCCOC1=CC(=CC(C)=C1)B(O)O | 3-Methyl-5-propoxyphenylboronic acid | AG000O1N | 25g |
| 1256346-05-0 | CCOc1cc(C)cc(c1)B(O)O | 3-Ethoxy-5-methylphenylboronic acid | AG000O1O | 25g |
| 1256346-03-8 | CC(COc1cc(cc(c1)B(O)O)OC(F)(F)F)C | 3-Isobutoxy-5-(trifluoromethoxy)phenylboronic acid | AG000O1Q | 0.5g |
| 1256346-02-7 | CCCOc1cc(cc(c1)B(O)O)OC(F)(F)F | 3-Propoxy-5-(trifluoromethoxy)phenylboronic acid | AG000O1R | 2.5g |
| 1256346-01-6 | FC(F)(F)OC1=CC(OC(C)C)=CC(B(O)O)=C1 | 3-Isopropoxy-5-(trifluoromethoxy)phenylboronic acid | AG000O1S | 10g |
| 1256346-00-5 | OB(CSC1=NC=CC=C1)O | (Pyridin-2-ylthio)methylboronic acid | AG000O1T | 0.3g |
| 1256353-14-6 | NC1=NC=C2C(CN(CC3=CC=CC=C3)C2)=N1 | 6-Benzyl-6,7-dihydro-5h-pyrrolo[3,4-d]pyrimidin-2-amine | AG000O1U | 0.75g |
| 1256353-07-7 | NCC1=CC=CC(C(F)F)=C1.[H]Cl | (3-(Difluoromethyl)phenyl)methanamine hydrochloride | AG000O1W | 10g |
| 1256346-47-0 | Clc1cc(Cl)c(cc1OCc1ccccc1)B(O)O | 5-(Benzyloxy)-2,4-dichlorophenylboronic acid | AG000O21 | 4g |
| 1256346-45-8 | CCCOC1=CC(B(O)O)=C(Cl)C=C1Cl | 2,4-Dichloro-5-propoxyphenylboronic acid | AG000O23 | 7g |
| 1256346-41-4 | OB(c1cc(c(s1)C(=O)C)Br)O | 5-Acetyl-4-bromothiophen-2-boronic acid | AG000O27 | 10g |
| 125328-84-9 | O[C@@H]1[C@H](O[C@H]([C@H]([C@H]1O)O)C)Oc1c[nH]c2c1c(Cl)c(cc2)Br | 5-Bromo-4-chloro-3-indoxyl-beta-l-fucopyranoside | AG000NID | 0.5g |
| 125328-80-5 | CC(=O)NC1=C(C)C(Cl)=C(Br)C=C1 | N-Acetyl-4-bromo-3-chloro-2-methylaniline | AG000NIE | 100g |
| 1253522-03-0 | FC(F)(F)OC1=CC=C2N=C(Cl)C(Cl)=NC2=C1 | 2,3-Dichloro-6-(trifluoromethoxy)quinoxaline | AG000NIK | 2g |
| 1253452-78-6 | OCCC1=CC=C(C=C1)NC(C2=C(C=CC=C2)NC(C3=CC=C(C=C3)[N+]([O-])=O)=O)=O | KS 176 | AG000NIL | 0.2g |
| 1253421-94-1 | CO[C@H]1C[C@H](O[C@H]2CC[C@]3([C@](C2)(O)CC[C@@H]2[C@@H]3CC[C | (3β,5β)-3-[(2,6-Dideoxy-4-O-β-D-glucopyranosyl-3-O-methyl-β-D-xylo-hexop | AG000NIM | 0.1g |
| 125353-44-8 | C[C@H](N)C(F)(F)F.[H]Cl | (S)-2-Amino-1,1,1-trifluoropropane hydrochloride | AG000NIR | 107.65g |
| 125347-83-3 | CCOC(=O)C1CCCN1C(=O)OC(C)(C)C | Boc-DL-proline ethyl ester | AG000NIV | 200g |
| 125342-48-5 | CCCCC(C(O)=O)NC(OC(C)(C)C)=O | 2-{[(tert-butoxy)carbonyl]amino}hexanoic acid | AG000NJ2 | 100g |
| 1253654-77-1 | NC1=CC(C)=C(F)N=C1Br | 2-Bromo-6-fluoro-5-methylpyridin-3-amine | AG000NJ9 | 0.5g |
| 1253654-37-3 | O=C(N1CCC(SC(Br)=N2)=C2C1)OC(C)(C)C | tert-Butyl 2-bromo-6,7-dihydrothiazolo[4,5-c]pyridine-5(4H)-carboxylate | AG000NJF | 15g |
| 1253577-76-2 | COC1=CN=C(F)C(B(O)O)=C1 | 2-Fluoro-5-methoxypyridine-3-boronic acid | AG000NJG | 2g |
| 125369-57-5 | COC1=CC(F)=C(C(N)=O)C(F)=C1 | 2,6-Difluoro-4-methoxybenzamide | AG000NJI | 30g |
| 125367-34-2 | N(CC(=O)OC)(CC(=O)OC)c1c(OCCOc2c(N(CC(=O)OC)CC(=O)OC)cccc2)cccc1 | Tetramethyl 1,2-bis(2-aminophenoxy)ethane-N,N,N’,N’-tetraacetate | AG000NJK | 175g |
| 1253789-02-4 | CC(C)(C)OC(=O)N1N=CC2=C(F)C=C(OCC3=CC=CC=C3)C=C12 | tert-Butyl 6-(benzyloxy)-4-fluoro-1H-indazole-1-carboxylate | AG000NK0 | 0.75g |
| 1256359-09-7 | CC1(C)C(C)(C)OB(C2=CC3=C(C=C2)C=NN3C)O1 | 1-Methylindazole-6-boronic acid pinacol ester | AG000O66 | 20g |
| 1256359-07-5 | CC(N1N=CC2=C1C=C(B3OC(C)(C)C(C)(C)O3)C=C2)=O | 1-Acetyl-1H-indazole-6-boronic acid, pinacol ester | AG000O67 | 5g |
| 1256359-05-3 | FC1=CC(=C(CN2CCCC2)C=C1)B1OC(C(O1)(C)C)(C)C | 1-(4-Fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzyl)pyrrolidin | AG000O68 | 10g |
| 1256359-03-1 | CC1(C(C)(OB(O1)C2=CC(OCC3=CC=CC=C3)=NC=C2)C)C | 2-Benzyloxypyridine-4-boronic acid, pinacol ester | AG000O69 | 2g |
| 1256359-01-9 | ClCCOC2(=CC=C(B1(OC(C)(C)C(O1)(C)C))C=C2) | 4-(2-Chloroethoxy)phenylboronic acid, pinacol ester | AG000O6B | 0.4g |
| 1256358-91-4 | CC1(C)OB(OC1(C)C)C1=CC2=C(N1)C=CC(Cl)=C2 | 5-Chloroindole-2-boronic acid pinacol ester | AG000O6C | 125g |
| 1256358-90-3 | CC1(C)OB(OC1(C)C)C1=CC(=O)NC=C1 | 2-Hydroxypyridine-4-boronic acid pinacol ester | AG000O6D | 75g |
| 1256358-89-0 | CC1(C)C(C)(C)OB(C2=CC(OC(C)(C)C)=NC=C2)O1 | 2-t-Butoxypyridine-4-boronic acid pinacol ester | AG000O6E | 0.75g |
| 1256358-85-6 | O=C(C1=CC(C2=CC=C(B3OC(C)(C)C(C)(C)O3)C=C2)=CC=C1)OC | 3′-(Methoxycarbonyl)biphenyl-4-boronic acid pinacol ester | AG000O6G | 20g |
| 1256358-84-5 | CC1=CC(C(F)(F)F)=CC(B2OC(C)(C)C(C)(C)O2)=C1 | 3-Methyl-5-trifluoromethylphenylboronic acid, pinacol ester | AG000O6H | 5g |
| 1256358-83-4 | FC1=C(C=C(C(=C1)B(O)O)F)B(O)O | 2,5-Difluoro-1,4-phenylenediboronic acid | AG000O6I | 50g |
| 1256358-82-3 | OB(c1ccnc(c1)N1CCCCC1)O | 2-Piperidinopyridine-4-boronic acid | AG000O6J | 4g |
| 1256360-05-0 | O=C(N1C=C(B2OC(C)(C)C(C)(C)O2)C=C1)OC | Methyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrole-1-carboxyl | AG000O6P | 6g |
| 1256360-03-8 | Cc1cccc2c1n(cc2B1OC(C(O1)(C)C)(C)C)C(=O)OC(C)(C)C | 1-BOC-7-Methylindole-3-boronic acid, pinacol ester | AG000O6Q | 2g |
| 1256360-02-7 | O=C(N1C=C(B2OC(C)(C)C(C)(C)O2)C3=C1C(C(OC)=O)=CC=C3)OC(C)(C)C | 1-BOC-7-methoxycarbonylindole-3-boronic acid, pinacol ester | AG000O6R | 2g |
| 1256360-00-5 | O=C(N1C=C(B2OC(C)(C)C(C)(C)O2)C3=C1C=C(OC)C=C3)OC(C)(C)C | 1-Boc-6-Methoxyindole-3-boronic acid, pinacol ester | AG000O6T | 2g |
| 1256359-99-5 | O=C(N1C=C(B2OC(C)(C)C(C)(C)O2)C3=C1C=CC(OC)=C3)OC(C)(C)C | 1-Boc-5-Methoxyindole-3-boronic acid, pinacol ester | AG000O6U | 20g |
| 1256359-97-3 | O=C(C1=CC=CC2=C1C(B3OC(C)(C(C)(C)O3)C)=CN2C(OC(C)(C)C)=O)OC | 1-BOC-4-(methylcarbonyl)indole-3-boronic acid, pinacol ester | AG000O6W | 1.5g |
| 1256359-95-1 | CC1(C)C(C)(C)OB(C(N2)=CC3=C2C=C(OC)C=C3)O1 | 6-Methoxyindole-2-boronic acid, pinacol ester | AG000O6X | 3g |
| 125414-41-7 | O=C(OC(C)(C)C)NC(CO)CO | tert-Butyl (1,3-dihydroxypropan-2-yl)carbamate | AG000NNU | 740g |
| 125422-83-5 | BrCCCN1CCOCC1 | 3-Morpholinopropyl bromide | AG000NO9 | 5g |
| 125421-98-9 | Cl[H].NC1=CC=CC(=C1)N1CCNCC1 | 3-(Piperazin-1-yl)aniline hydrochloride | AG000NOD | 50g |
| 125418-96-4 | ClC1=CC=C(OCC#N)C(C=O)=C1 | (4-Chloro-2-formyl-phenoxy)-acetonitrile | AG000NOJ | 5g |
| 125418-83-9 | N#CCOC1=CC=CC=C1C=O | (2-FORMYLPHENOXY)ACETONITRILE | AG000NOL | 30g |
| 1254473-68-1 | C[C@@H](O)C1=C(Cl)C=NC=C1Cl | (R)-1-(3,5-Dichloropyridin-4-yl)ethanol | AG000NOQ | 75g |
| 1254473-64-7 | OCCN1N=CC(/C=C/C2=NNC3=C2C=C(O[C@@H](C4=C(Cl)C=NC=C4Cl)C)C=C3)=C1 | Ponatinib | AG000NOR | 5g |
| 1254366-15-8 | FC(F)(F)OC1=CC2=NC(Cl)=C(C=O)C=C2C=C1 | 2-Chloro-7-(trifluoromethoxy)quinoline-3-carbaldehyde | AG000NOS | 4g |
| 1254353-37-1 | CCCCCCCCOC1=CC2=NSN=C2C=C1OCCCCCCCC | 5,6-Bis(Octyloxy)Benzo[c][1,2,5]Thiadiazole | AG000NOT | 0.75g |
| 1254332-84-7 | [Br]C2(=CC=1(NC(COC=1C=C2)C)) | 6-Bromo-3-methyl-3,4-dihydro-2H-benzo[b][1,4]oxazine | AG000NOX | 5g |
| 1254328-26-1 | O=C(OC)C1=CC=NC(C)=C1C | Methyl 2,3-dimethylisonicotinate | AG000NOY | 2g |
| 1254319-51-1 | O=C1N(C)CC2=C1C=C(Br)C=C2 | 6-Bromo-2-methylisoindolin-1-one | AG000NP1 | 50g |
| 1254300-95-2 | NC1=NC2=CC=CC(OC)=C2S1 | 7-Methoxybenzo[d]thiazol-2-amine | AG000NP2 | 15g |
| 125441-05-6 | Cc1ccc(cc1)S(=O)(=O)O.C=CCOC(=O)[C@H](Cc1ccc(cc1)O)N | H-Tyr-Oall P-Tosylate | AG000NP6 | 50g |
| 1254717-53-7 | NCC1=NNC(C(F)(F)F)=C1 | [5-(Trifluoromethyl)-1h-pyrazol-3-yl]methylamine | AG000NPG | 5g |
| 1253740-09-8 | COc1c(O)ccc2-c3ccc4cc5OCOc5cc4c3N(C)C(CC(C)=O)c12 | 6-Acetonyl-N-methyl-dihydrodecarine | AG000NK1 | 0.005g |
| 1253732-93-2 | O=Cc1cc(C)c(c(c1)C)C#N | Benzonitrile, 4-formyl-2,6-dimethyl- | AG000NK2 | 1g |
| 125372-22-7 | O=C(O)C1=CC=CC=C1S(=O)(NC)=O | 2-(n-Methylsulfamoyl)benzoic acid | AG000NKF | 10g |
| 1253791-63-7 | CCOC(=O)C1(CCC(=O)CC1)NC(=O)OC(C)(C)C | ETHYL 1-(TERT-BUTOXYCARBONYLAMINO)-4-OXOCYCLOHEXANECARBOXYLATE | AG000NKL | 1g |
| 1253791-57-9 | CCOC(C1(C=O)CCN(C(OC(C)(C)C)=O)CC1)=O | 1-tert-Butyl 4-ethyl 4-formylpiperidine-1,4-dicarboxylate | AG000NKM | 2g |
| 1253791-53-5 | O=C([C@H]1CN(C(OC(C)(C)C)=O)C[C@@H]1C)O | Boc-(+/-)-trans-4-methyl-pyrrolidine-3-carboxylic acid | AG000NKN | 10g |
| 1253790-80-5 | C[C@@H](N)C1=CC=C(Cl)C(F)=C1.[H]Cl | (R)-1-(4-Chloro-3-fluorophenyl)ethanamine hydrochloride | AG000NKR | 10g |
| 1253790-21-4 | O=C(NC1)COC21CC2 | 4-oxa-7-azaspiro[2.5]octan-6-one | AG000NKW | 25g |
| 1253790-00-9 | CCOC(=O)c1cnn2c1COCC2 | ETHYL 6,7-DIHYDRO-4H-PYRAZOLO[5,1-C][1,4]OXAZINE-3-CARBOXYLATE | AG000NKZ | 10g |
| 1253789-76-2 | CC(C)(C)OC(=O)N1CCC(CC1)C1=NOC(N)=C1 | tert-Butyl 4-(5-aminoisoxazol-3-yl)piperidine-1-carboxylate | AG000NL2 | 3g |
| 1253789-61-5 | CC(C)(C)OC(=O)n1ncc2c(F)cc(O)cc21 | tert-Butyl 4-fluoro-6-hydroxy-1H-indazole-1-carboxylate | AG000NL5 | 10g |
| 1253789-47-7 | CCC1N2C(C=CC(=C2)Br)=NN=1 | 6-Bromo-3-ethyl-[1,2,4]triazolo[4,3-a]pyridine | AG000NL7 | 5g |
| 1253907-90-2 | BrC1=C(C=C(N)C=C1C)Cl | 4-Bromo-3-chloro-5-methylaniline | AG000NLA | 13.9g |
| 1253889-53-0 | NC1=CC=C(Br)C(F)=C1Br | 2,4-Dibromo-3-fluoroaniline | AG000NLB | 2g |
| 125562-30-3 | COCCOCCOCCOCCOCCOCCOCCOCCOCCBr | 2,5,8,11,14,17,20,23,26-Nonaoxaoctacosane, 28-bromo- | AG000NW7 | 25g |
| 125572-95-4 | O.N(CC(=O)O)(CC(=O)O)[C@H]1[C@H](N(CC(=O)O)CC(=O)O)CCCC1 | Glycine, N,N’-(1R,2R)-1,2-cyclohexanediylbis[N-(carboxymethyl)-, hydrate (1: | AG000NWR | 2000g |
| 125572-93-2 | OC1C=CC=C2C=1CC[C@@H](C2)N(CCC1SC=CC=1)CCC.[H]Cl | Rotigotine | AG000NWS | 0.5g |
| 125568-73-2 | O=C(OC)C1=CC(N)=C(F)C=C1F | Methyl 5-amino-2,4-difluorobenzoate | AG000NWV | 125g |
| 125568-71-0 | O=C(OC)C1=CC([N+]([O-])=O)=C(F)C=C1F | Methyl 2,4-difluoro-5-nitrobenzoate | AG000NWW | 400g |
| 1255945-85-7 | O=C(O)CC1=CC=C(F)C(B2OC(C)(C)C(C)(C)O2)=C1 | [4-fluoro-3-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetic acid | AG000NWZ | 25g |
| 1255942-06-3 | O=C(N1C2=CC=CC=C2C#CC3=CC=CC=C3C1)CCN | DBCO-Amine | AG000NX0 | 50g |
| 1255917-95-3 | ClC1(=C(OC)C(=NC=C1)C(=O)OC) | Methyl 4-chloro-3-methoxypicolinate | AG000NX6 | 2g |
| 1255870-63-3 | N#CC1=CC=C(Br)C=C1OCC | 4-Bromo-2-ethoxybenzonitrile | AG000NX8 | 125g |
| 1256038-40-0 | OC(C1(C2=CC(Br)=CN=C2)CC1)=O | 1-(5-BROMOPYRIDIN-3-YL)CYCLOPROPANE-1-CARBOXYLIC ACID | AG000NXO | 1g |
| 1256037-25-8 | FC=1C=C(C=CC1)C=1NC2=CC=C(C(=C2C(C1)=O)OC)OC | 2-(3-Fluorophenyl)-5,6-dimethoxyquinolin-4(1H)-one | AG000NXQ | 90g |
| 1256037-07-6 | C(C)(=O)C1=C(C=CC(=C1OC)OC)NC(C1=CC(=CC=C1)F)=O | N-(2-Acetyl-3,4-dimethoxyphenyl)-3-fluorobenzamide | AG000NXR | 10g |
| 125607-30-9 | CCCCCCc1ccsc1-c1sccc1CCCCCC | 2,2′-Bithiophene, 3,3′-dihexyl- | AG000NXW | 5g |
| 125602-71-3 | O=C(O)CCCN1CCC(O[C@@H](C2=CC=C(Cl)C=C2)C3=NC=CC=C3)CC1 | BEPOTASTINE | AG000NY5 | 0.5g |
| 125602-26-8 | COc1cc(C)c(c(c1C)C)S(=O)(=O)NC(=N)NCCC[C@H](N(C(=O)OC(C)(C)C)C)C(=O)O | Boc-N-Me-Arg(Mtr)-OH | AG000NY8 | 25g |
| 1256268-95-7 | N#CC1(=C(N=NC=C1)NC) | 3-(Methylamino)pyridazine-4-carbonitrile | AG000NYD | 4g |
| 1256345-58-0 | ClC1=C(OCCCC)C=CC=C1B(O)O | 3-Butoxy-2-chlorophenylboronic acid | AG000O07 | 3g |
| 1256345-50-2 | OB(O)C1=C(F)C=CC(=C1)C1(CC1)C#N | 5-(1-Cyanocyclopropyl)-2-fluorophenylboronic acid | AG000O0F | 7g |
| 1256345-99-9 | CC(COc1ccc(cc1B(O)O)C(F)(F)F)C | 2-Isobutoxy-5-(trifluoromethyl)phenylboronic acid | AG000O0G | 15g |
| 1256345-96-6 | CCCCOc1cc(cc(c1)B(O)O)OC(F)(F)F | 3-Butoxy-5-(trifluoromethoxy)phenylboronic acid | AG000O0J | 2g |
| 1256345-95-5 | OB(c1cc(OCc2ccccc2)cc(c1)OC(F)(F)F)O | 3-(Benzyloxy)-5-(trifluoromethoxy)phenylboronic acid | AG000O0K | 16.1g |
| 1256345-90-0 | CC(SC1=CC=C(B(O)O)C=N1)C | (6-(Isopropylthio)pyridin-3-yl)boronic acid | AG000O0P | 1g |
| 1256345-88-6 | COC1=CC(OC(F)(F)F)=CC(=C1)B(O)O | 3-Methoxy-5-(trifluoromethoxy)phenylboronic acid | AG000O0R | 10g |
| 1256345-87-5 | CCOc1cc(cc(c1)B(O)O)OC(F)(F)F | 3-Ethoxy-5-(trifluoromethoxy)phenylboronic acid | AG000O0S | 1.5g |
| 1256345-86-4 | OB(O)C1=CC(=CC=C1)C1=CCCC1 | 3-Cyclopentenylphenylboronic acid | AG000O0T | 8g |
| 1256345-84-2 | O=S(C1=CC=C(B(O)O)C=N1)(CC)=O | 6-(Ethanesulfonyl)pyridine-3-boronic acid | AG000O0V | 1.75g |
| 1256345-82-0 | Clc1cc(OCc2ccccc2)cc(c1)B(O)O | 3-Benzyloxy-5-chlorophenylboronic acid | AG000O0X | 50g |
| 1256345-79-5 | B(O)(O)c1cc(C)cc(c1)O | 3-Hydroxy-5-methylphenylboronic acid | AG000O10 | 25g |
| 1256345-78-4 | CC1=CC(=CC(OCC2CC2)=C1)B(O)O | 3-(Cyclopropylmethoxy)-5-methylphenylboronic acid | AG000O11 | 6g |
| 1256345-77-3 | CC(COc1cc(C)cc(c1)B(O)O)C | 3-Isobutoxy-5-methylphenylboronic acid | AG000O12 | 3.4g |
| 1256345-76-2 | CC(C)OC1=CC(C)=CC(=C1)B(O)O | 3-Isopropoxy-5-methylphenylboronic acid | AG000O13 | 45g |
| 1256346-27-6 | OB(c1ccc(c(c1F)OCc1ccccc1)Cl)O | 3-Benzyloxy-4-chloro-2-fluorophenylboronic acid | AG000O18 | 3.9g |
| 1256346-26-5 | COCCOC1=C(F)C(B(O)O)=CC=C1Cl | 4-Chloro-2-fluoro-3-(2-methoxyethoxy)phenylboronic acid | AG000O19 | 10g |
| 1256346-25-4 | FC1=C(OCCCC)C(Cl)=CC=C1B(O)O | 3-Butoxy-4-chloro-2-fluorophenylboronic acid | AG000O1A | 2g |
| 1256346-23-2 | CCCOC1=C(F)C(B(O)O)=CC=C1Cl | 4-Chloro-2-fluoro-3-propoxyphenylboronic acid | AG000O1B | 2g |
| 1256346-21-0 | CC(Oc1c(Cl)ccc(c1F)B(O)O)C | 4-Chloro-2-fluoro-3-isopropoxyphenylboronic acid | AG000O1C | 1.8g |
| 1256255-96-5 | CC1(C(C)(C)OB(C2=CC3=C(OCCN3)C(F)=C2)O1)C | 8-Fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-2h-ben | AG000NYF | 0.2g |
| 1256245-86-9 | [C@@H](NC1=C(NC2=CC(C(F)(F)F)=CC(C(F)(F)F)=C2)C(=O)C1=O)([C@]3([N@@] | 3-[[3,5-bis(trifluoroMethyl)phenyl]aMino]-4-[(8α,9S)-cinchonan-9-ylaMino]- | AG000NYI | 2g |
| 1256240-40-0 | Cl.O[C@H]1C[C@@H]2[C@@H](CNC2)C1 | (3aR,5r,6aS)-octahydrocyclopenta[c]pyrrol-5-ol hydrochloride | AG000NYM | 1g |
| 1256162-94-3 | O=CC1=C2N=C(Cl)C=CN2N=C1 | 5-Chloropyrazolo[1,5-a]pyrimidine-3-carbaldehyde | AG000NYO | 25g |
| 125610-78-8 | COc1ccc(cc1)c1ccccc1C#N | 2-(4-Methoxyphenyl)benzonitrile | AG000NYY | 3g |
| 47163-75-7 | O=S([O-][Zn+2](O([H])[H])([O-]S(C1=CC=CC=C1)=O)O([H])[H])C2=CC=CC=C2 | Zinc(II) benzenesulfinate dihydrate | AG000NZ0 | 300g |
| 1256345-47-7 | CCCOc1cc(cc(c1)C(F)(F)F)B(O)O | 3-Propoxy-5-trifluoromethylphenylboronic acid | AG000NZ4 | 5g |
| 1256345-46-6 | OB(C1=CC=CC2=C1C=CN=C2)O.[H]Cl | Isoquinoline-5-boronic acid, HCl | AG000NZ5 | 2g |
| 1256345-45-5 | CCCCOc1cc(cc(c1)C(F)(F)F)B(O)O | 3-Butoxy-5-trifluoromethylphenylboronic acid | AG000NZ6 | 1.1g |
| 1256345-44-4 | CC(OC1=CC(C(F)(F)F)=CC(B(O)O)=C1)C | 3-Isopropoxy-5-trifluoromethylphenylboronic acid | AG000NZ7 | 35g |
| 1256345-73-9 | CCOc1cc(cc(c1)Cl)B(O)O | 3-Chloro-5-ethoxyphenylboronic acid | AG000NZS | 5.3g |
| 1256345-72-8 | NC1(C2=CC=C(B(O)O)C=C2)CC1.[H]Cl | 4-(1-Aminocyclopropyl)phenylboronic acid, HCl | AG000NZT | 15g |
| 1256345-69-3 | CCOC(=O)CC1=CC=CC(=C1)B(O)O | 3-ETHOXYCARBONYLMETHYLPHENYLBORONIC ACID | AG000NZW | 10g |
| 1256345-68-2 | OB(O)C1=CN(N=C1)C1CCCCO1 | 1-(Tetrahydro-2H-pyran-2-yl)pyrazole-4-boronic acid | AG000NZX | 20g |
| 1256345-67-1 | COC1=C(C=CC(=C1)C#N)B(O)O | 4-Cyano-2-methoxyphenylboronic acid | AG000NZY | 125g |
| 1256345-66-0 | FC1=NC(Cl)=CC=C1B(O)O | 6-Chloro-2-fluoropyridine-3-boronic acid | AG000NZZ | 15g |
| 1256345-60-4 | OC1=C(B(O)O)C(F)=CC=C1 | 2-Fluoro-6-hydroxyphenylboronic Acid | AG000O05 | 500g |
| 1256345-59-1 | COC1=CC(B(O)O)=CC=C1Br | 4-bromo-3-methoxyphenylboronic acid | AG000O06 | 50g |
| 1255580-76-7 | COC1=CC2=C(NC3CCN(C(C)C)CC3)N=C(C4CCCCC4)N=C2C=C1OCCCN5CCCC5 | UNC0638 | AG000NUW | 0.25g |
| 1255574-73-2 | NC1=CC(Cl)=C(OCC)C(Br)=C1 | 3-Bromo-5-chloro-4-ethoxyaniline | AG000NUY | 15g |
| 1255574-60-7 | BrC1CCSCC=1 | 4-Bromo-3,6-dihydro-2H-thiopyran | AG000NV8 | 82.4g |
| 125559-00-4 | O=C(CCCCCNC(=O)C1CCC(CN2C(=O)C=CC2=O)CC1)ON3C(=O)CCC3=O | Lc-smcc | AG000NVG | 5g |
| 1255667-06-1 | O=C(N1CC(C(OC)=O)CC(F)(F)C1)OC(C)(C)C | 1-tert-butyl 3-methyl 5,5-difluoropiperidine-1,3-dicarboxylate | AG000NVL | 1g |
| 1255666-86-4 | O=C(C1CN(C(OC(C)(C)C)=O)CC(F)(F)C1)O | 5,5-Difluoro-1,3-piperidinedicarboxylic acid tert-butyl ester | AG000NVM | 25g |
| 1255666-59-1 | FC1(CN(C1)C(=O)OC(C)(C)C)F | tert-Butyl 3,3-difluoroazetidine-1-carboxylate | AG000NVN | 10g |
| 1255666-50-2 | O=C1NCC(F)(F)CC1 | 5,5-Difluoropiperidin-2-one | AG000NVO | 20g |
| 1255666-48-8 | CC(C)(C)OC(=O)N1CCC(N)C(F)(F)C1 | tert-Butyl 4-amino-3,3-difluoropiperidine-1-carboxylate | AG000NVP | 100g |
| 1255666-44-4 | O=C(N1CC(F)C1)OC(C)(C)C | tert-Butyl 3-fluoroazetidine-1-carboxylate | AG000NVQ | 10g |
| 1255666-29-5 | COC(=O)C1CC(C(=O)O)CCN1C(=O)OC(C)(C)C | 1-(tert-Butoxycarbonyl)-2-(methoxycarbonyl)piperidine-4-carboxylic acid | AG000NVS | 0.5g |
| 1255666-28-4 | COC(=O)C1CC(F)(F)CCN1C(=O)OC(C)(C)C | 1-tert-butyl 2-methyl 4,4-difluoropiperidine-1,2-dicarboxylate | AG000NVT | 0.5g |
| 1255666-24-0 | CC(OC(N1CCC(CC(C(O)=O)N)CC1)=O)(C)C | 2-Amino-3-[1-(tert-butoxycarbonyl)piperidin-4-yl]propanoic acid | AG000NVU | 1g |
| 1255663-89-8 | OC(C1NCC(F)(F)CC1)=O | 5,5-Difluoro-2-piperidinecarboxylic acid | AG000NVW | 0.5g |
| 1255651-12-7 | C(=O)(OC)[C@@H]1CCCNC1.Cl | 3-Piperidinecarboxylic acid, methyl ester, hydrochloride (1:1), (3R)- | AG000NVX | 75g |
| 1255635-99-4 | OC(=O)c1ccc(cc1)-c1ccc(Br)cn1 | 4-(5-BROMOPYRIDIN-2-YL)BENZOIC ACID | AG000NW1 | 1.2g |
| 1256355-21-1 | OB(O)C1=CC(OCC2=CC=CC=C2)=CC(Br)=C1 | 3-(Benzyloxy)-5-bromophenylboronic acid | AG000O3N | 10g |
| 1256355-20-0 | CCCCOc1ncc(cc1C)B(O)O | 6-Butoxy-5-methylpyridine-3-boronic acid | AG000O3O | 35g |
| 1256355-19-7 | CC(C)COC1=C(C)C=C(C=N1)B(O)O | 6-Isobutoxy-5-methylpyridine-3-boronic acid | AG000O3P | 25g |
| 1256355-16-4 | OB(O)c1cc(Br)cc(c1)N2CCCC2 | 3-Bromo-5-pyrrolidinophenylboronic acid | AG000O3S | 2.9g |
| 1256355-15-3 | CCCCOC1=CC(OC)=CC(=C1)B(O)O | 3-Butoxy-5-methoxyphenylboronic acid | AG000O3T | 0.5g |
| 1256355-14-2 | CCCOC1=CC(=CC(OC)=C1)B(O)O | 3-Methoxy-5-propoxyphenylboronic acid | AG000O3U | 1.25g |
| 1256355-12-0 | Ic1ccc(c(c1)B(O)O)OC(F)(F)F | 5-Iodo-2-trifluoromethoxyphenylboronic acid | AG000O3W | 5g |
| 1256355-61-9 | CC1=CC(=CC(OCC2=CC=CC=C2)=C1)B(O)O | 3-(Benzyloxy)-5-methylphenylboronic acid | AG000O3Y | 0.75g |
| 1256355-56-2 | OCC1=CC=C(O1)B(O)O | 5-(Hydroxymethyl)Furan-2-Ylboronic Acid | AG000O43 | 10g |
| 1256355-55-1 | O=C(OC)COC1=CC(B(O)O)=CC=C1 | 3-(2-Methoxy-2-oxoethoxy)phenylboronic acid | AG000O44 | 15g |
| 1256355-54-0 | COCOc1ccc(cc1B(O)O)C(F)(F)F | 2-Methoxymethoxy-5-(trifluoromethyl)phenylboronic acid | AG000O45 | 10g |
| 1256355-53-9 | FC1=CC=CC(B(O)O)=C1OCC2=CC=CC=C2 | 2-Benzyloxy-3-fluorophenylboronic acid | AG000O46 | 100g |
| 1256355-52-8 | OB(c1ccc(nc1Br)Br)O | 2,6-Dibromopyridine-3-boronic acid | AG000O47 | 10g |
| 1256355-51-7 | COCOc1cccc(c1B(O)O)Cl | (2-Chloro-6-(methoxymethoxy)phenyl)boronic acid | AG000O48 | 1g |
| 1256355-49-3 | OB(C1=CC=CC=C1OCC2=CC=NC=C2)O | 2-(Pyridin-4-ylmethoxy)phenylboronic acid | AG000O4A | 1.5g |
| 1256355-46-0 | COC1=C(F)C=C(Cl)C(B(O)O)=C1 | 2-Chloro-4-fluoro-5-methoxyphenylboronic acid | AG000O4D | 25g |
| 1256355-43-7 | COC(=O)C1=C(C=CC(C)=C1)B(O)O | 2-Methoxycarbonyl-4-methylphenylboronic acid | AG000O4F | 6g |
| 1256355-40-4 | COC(C1=C(B(O)O)C=CC(OC)=C1)=O | 2-Methoxycarbonyl-4-methoxyphenylboronic acid | AG000O4I | 3g |
| 1256355-38-0 | BrC1=CSC(B(O)O)=C1Br | 3,4-Dibromothiophen-2-boronic acid | AG000O4K | 3g |
| 1256346-38-9 | OB(C1=CNN=C1)O.[H]Cl | 1H-Pyrazole-4-boronic acid, HCl | AG000O2A | 1g |
| 1256346-35-6 | CC(C)OC1=C(Cl)C=CC(=C1)B(O)O | 4-Chloro-3-isopropoxyphenylboronic acid | AG000O2D | 3g |
| 1256355-10-8 | Brc1cc(cc(c1)B(O)O)N1CCOCC1 | 3-Bromo-5-morpholinophenylboronic acid | AG000O2K | 0.3g |
| 1256355-09-5 | CC1=CC(B(O)O)=C2N=CC=CC2=C1 | 6-Methylquinoline-8-boronic acid | AG000O2L | 0.5g |
| 1256355-08-4 | OCC1=CC=CC(B(O)O)=C1F | 2-Fluoro-3-hydroxymethylphenylboronic acid | AG000O2M | 25g |
| 1256355-06-2 | OB(c1ccc(cc1OCC(C)C)Cl)O | 4-Chloro-2-isobutoxyphenylboronic acid | AG000O2O | 11g |
| 1256355-04-0 | OB(c1ccc(cc1OC(C)C)Cl)O | 4-Chloro-2-isopropoxyphenylboronic acid | AG000O2Q | 10g |
| 1256355-00-6 | COCCOC1=C(Cl)C=CC(=C1)B(O)O | 4-Chloro-3-(2-methoxyethoxy)phenylboronic acid | AG000O2U | 10g |
| 1256354-98-9 | COC(=O)C1=CC(C(=O)OC)=C(C=C1)B(O)O | 2,4-Bis(Methoxycarbonyl)phenylboronic acid | AG000O2W | 10g |
| 1256354-93-4 | COC1=CC(Cl)=C(Cl)C=C1B(O)O | 4,5-Dichloro-2-methoxyphenylboronic acid | AG000O31 | 5g |
| 1256354-92-3 | CC(C)C1=CC(B(O)O)=C(F)C=C1 | 2-Fluoro-5-isopropylphenylboronic acid | AG000O32 | 1.25g |
| 1256353-15-7 | O=C1C(C=NC=C2Br)=C2N=CN1 | 8-Bromopyrido[4,3-d]pyrimidin-4(3H)-one | AG000O37 | 6g |
| 1256355-34-6 | COC1=C(B(O)O)C(OC)=CC(C=O)=C1 | 2,6-Dimethoxy-4-formylphenylboronic acid | AG000O3A | 2g |
| 1256355-33-5 | COC(C1=C(B(O)O)C=CC=C1F)=O | 2-Methoxycarbonyl-3-fluorophenylboronic acid | AG000O3B | 2g |
| 1256355-32-4 | FC1=CC(B(O)O)=CC=C1N.[H]Cl | 4-Amino-3-fluorophenylboronic acid, HCl | AG000O3C | 3g |
| 1256355-31-3 | CC1=C(OCC2=CC=CC=C2)C=C(C=C1)B(O)O | 3-(Benzyloxy)-4-methylphenylboronic acid | AG000O3D | 20g |
| 1256355-30-2 | OB(O)C1=C(C=O)C=CC(F)=C1 | 5-Fluoro-2-formylphenylboronic acid | AG000O3E | 600g |
| 1256355-29-9 | CN1CCN(C2=NC=C(B(O)O)C=N2)CC1 | 2-(4-Methylpiperazino)pyrimidine-5-boronic acid | AG000O3F | 3g |
| 1256355-26-6 | O.COC1=C(C=NC=C1)B(O)O | 4-Methoxypyridine-3-boronic acid hydrate | AG000O3I | 5g |
| 1256355-23-3 | Cl.CN(C)C1=CC=CC(=C1)B(O)O | 3-Dimethylaminophenylboronic acid, HCl | AG000O3L | 50g |
| 1256633-23-4 | O=C(OC)CCCN(CC1=CC=CC=C1)CC(OCC)=O | Methyl 4-[n-benzyl-n-(2-ethoxy-2-oxoethyl)amino]butanoate | AG000OA6 | 10g |
| 1256633-22-3 | COC(=O)CC1=CC(NC(=O)OC(C)(C)C)=CC=C1 | Methyl N-Boc-3-aminophenylacetate | AG000OA7 | 2g |
| 1256633-21-2 | OCC1CN(CCCO1)C(=O)OCC1=CC=CC=C1 | N-Cbz-2-(hydroxymethyl)homomorpholine | AG000OA8 | 0.5g |
| 1256633-18-7 | O=C(C1=CC=NN=C1N)OC | Methyl 3-AMinopyridazine-4-carboxylate | AG000OAB | 2g |
| 1256633-17-6 | NC(C)(C1=NC=CC=C1)C.[H]Cl.[H]Cl | 2-(2-Pyridyl)-2-propylamine DiHCl | AG000OAC | 10g |
| 1256633-15-4 | COC(=O)c1cccc(c1C)S(C)(=O)=O | Methyl 2-Methyl-3-(methylsulfonyl)benzoate | AG000OAE | 15g |
| 1256589-74-8 | N#CC1=CC2=C(C=C1)C3=C(C(C)(C)C4=CC(N5CCC(N6CCOCC6)CC5)=C(CC)C=C4C3= | 5H-Benzo[b]carbazole-3-carbonitrile, 9-ethyl-6,11-dihydro-6,6-dimethyl-8-[4- | AG000OAG | 10g |
| 1256584-80-1 | CCC1=CC2=C(C=C1I)C(C)(C)C3=C(C4=C(C=C(C=C4)C#N)N3)C2=O | 9-ethyl-8-iodo-6,6-dimethyl-11-oxo-6,11-dihydro-5H-benzo[b]carbazole-3-ca | AG000OAH | 20g |
| 1256584-75-4 | O=C(C1=C(C(C)(C2=CC=C(CC)C(I)=C2)C)NC3=C1C=CC(C#N)=C3)OC(C)(C)C | tert-Butyl 6-cyano-2-(2-(4-ethyl-3-iodophenyl)propan-2-yl)-1H-indole-3-carb | AG000OAI | 300g |
| 125662-60-4 | OC(=O)c1c(F)c(F)c(c(c1F)F)S(=O)(=O)O | 4-Sulfo-2,3,5,6-tetrafluorobenzoic acid | AG000OAL | 0.15g |
| 1256633-41-6 | CCOC(=O)C1=CC(N2C=CC=N2)=C(F)C=C1[N+]([O-])=O | Ethyl 4-fluoro-2-nitro-5-(1-pyrazolyl)benzoate | AG000OAY | 4g |
| 1256633-39-2 | FC1=C(Br)C=C(NC(OCC2=CC=CC=C2)=O)C=C1 | N-Cbz-3-bromo-4-fluoroaniline | AG000OB0 | 200g |
| 1256633-38-1 | OC(=O)C1=CC(F)=CC=C1N1CCN(CC2=CC=CC=C2)CC1 | 2-(4-Benzylpiperazino)-5-fluorobenzoic acid | AG000OB1 | 25g |
| 1256633-34-7 | CCOC(=O)CN(CCCC(=O)OC)C(=O)OC(C)(C)C | Methyl 4-[n-boc-n-(2-ethoxy-2-oxoethyl)amino]butanoate | AG000OB5 | 25g |
| 1256633-27-8 | COC(=O)c1cc(O)ccn1.Cl | Methyl 4-hydroxypicolinate, HCl | AG000OBB | 10g |
| 1256633-26-7 | CS(=O)(NC1=CC=C(F)C(Br)=C1)=O | N-(3-Bromo-4-fluorophenyl)methanesulfonamide | AG000OBC | 125g |
| 1256633-25-6 | CCOC(=O)C1=CC(N2C=CC=N2)=C(C=C1[N+]([O-])=O)N1C=CC=N1 | Ethyl 2-nitro-4,5-di(1-pyrazolyl)benzoate | AG000OBD | 3g |
| 125664-95-1 | CC1(C)C23[C@@H](C[C@H]1CC3)N(S(=O)(=O)C2)C(=O)CC | 1-Propanone, 1-[(3aS,6R,7aR)-tetrahydro-8,8-dimethyl-2,2-dioxido-3H-3a,6- | AG000OBI | 5g |
| 1255099-33-2 | Cl.C1OC2=C(O1)C=C1CNCC1=C2 | 6,7-Dihydro-5h-[1,3]dioxolo[4,5-f]isoindole, HCl | AG000NSM | 4g |
| 1255099-26-3 | NC1(C2=NC=CN=C2)CC1.[H]Cl | 1-(Pyrazin-2-yl)cyclopropanamine hcl | AG000NSR | 2g |
| 125511-90-2 | O=C(OC(C)(C)C)N[C@@H](C(=O)N[C@@H](C(=O)O)Cc1ccccc1)Cc1ccccc1 | N-[(1,1-Dimethylethoxy)carbonyl]-D-phenylalanyl-D-phenylalanine | AG000NST | 225g |
| 1255308-97-4 | C1(NC2=C3C=CC=C2)=C3C4=C(C5=CC=CC=C5S4)C=C1 | 5H-Benzo[4,5]thieno[3,2-c]carbazole | AG000NSW | 175g |
| 1255306-36-5 | C[C@@H](N)C1=CC=C(Cl)C(C)=C1.[H]Cl | (R)-1-(4-Chloro-3-methylphenyl)ethanamine hydrochloride | AG000NSY | 0.25g |
| 1255207-47-6 | CC1=C(C#N)C(F)=CC=C1Br | 3-Bromo-6-fluoro-2-methylbenzonitrile | AG000NSZ | 5g |
| 125533-82-6 | Brc1ncco1 | 2-Bromooxazole | AG000NT5 | 300g |
| 1255529-23-7 | O=C(NC1=NC=C(Cl)C=C1)C(N[C@H]2[C@@H](NC(C(S3)=NC4=C3CN(C)CC4)=O)C | N1-(5-CHLOROPYRIDIN-2-YL)-N2-((1R,2S,4R)-4-(DIMETHYLCARBAMOYL)-2-(5- | AG000NTN | 0.02g |
| 125552-89-8 | BrCC1CCOCC1 | 4-Bromomethyltetrahydropyran | AG000NTS | 923.7g |
| 125542-04-3 | CC1=C(C)C(=C(C)C1[Si](C)(C)NC(C)(C)C)C | N-tert-Butyl-1,1-dimethyl-1-(2,3,4,5-tetramethyl-2,4-cyclopentadien-1-yl)sila | AG000NTW | 500g |
| 125541-20-0 | O1CCN(CC1)C1CCN(CC1)C(=O)OC(C)(C)C | tert-Butyl 4-morpholinopiperidine-1-carboxylate | AG000NTZ | 50g |
| 125537-92-0 | COc1c(O)cc(cc1O)-c1cc(=O)c2c(O)c(OC)c(O)cc2o1 | 3′,5,5′,7-Tetrahydroxy-4′,6-Dimethoxyflavone | AG000NU0 | 0.005g |
| 1255574-48-1 | COC(=O)C1=CC(OC(C)C)=CC(Br)=C1 | Methyl 3-bromo-5-isopropoxybenzoate | AG000NUE | 5g |
| 1255574-47-0 | [O-][N+](=O)c1cc(Br)c(cc1N)OCCCCCCCC | 4-Bromo-2-nitro-5-octyloxyaniline | AG000NUF | 10g |
| 1255574-44-7 | CC(COc1ncc(cc1Br)C)C | 3-Bromo-2-isobutoxy-5-methylpyridine | AG000NUI | 5.3g |
| 1256781-64-2 | CC1(C)OB(OC1(C)C)C1=C(Br)C=CC(Br)=C1 | 2-(2,5-Dibromophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane | AG000OBL | 10g |
| 1256781-63-1 | CC1(C)OB(OC1(C)C)C1=C(Br)C=CC(Cl)=C1 | 2-(2-Bromo-5-chlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane | AG000OBM | 5g |
| 1256781-58-4 | COC1=CC(B2OC(C)(C)C(C)(C)O2)=C(Br)C=C1 | 2-(2-bromo-5-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane | AG000OBQ | 25g |
| 1256667-56-7 | N[C@@H]1CCN(C1)C1COC1 | (3R)-1-(Oxetan-3-yl)pyrrolidin-3-amine | AG000OBR | 1g |
| 1256667-38-5 | NCC1CCC2(COC2)CC1 | 2-OXASPIRO[3.5]NONANE-7-METHANAMINE | AG000OBS | 4g |
| 1256789-55-5 | O=C(O)C1=C(OC)C=NC(Br)=C1 | 2-Bromo-5-methoxyisonicotinic acid | AG000OC9 | 2g |
| 1256789-09-9 | O=C(OC)C1=C(C)N=C(Cl)C=C1C | Methyl 6-chloro-2,4-dimethylnicotinate | AG000OCB | 10g |
| 1256788-71-2 | N#CC1=NC(Br)=CC=C1F | 6-Bromo-3-fluoropyridine-2-carbonitrile | AG000OCE | 50g |
| 1256788-36-9 | N#CC1=CC(Cl)=NC(OC)=C1 | 2-Chloro-6-methoxyisonicotinonitrile | AG000OCF | 2g |
| 1256788-26-7 | O=CC1=NC=CC=C1C2CC2 | 3-Cyclopropylpicolinaldehyde | AG000OCH | 6g |
| 1256788-23-4 | BrC1=NC=CC=C1C2CC2 | 2-Bromo-3-cyclopropylpyridine | AG000OCI | 0.75g |
| 1256787-42-4 | O=C(C1=CC2=C(C(Cl)=NC=C2)C=C1)O | 1-Chloroisoquinoline-6-carboxylic acid | AG000OCL | 2g |
| 1256787-17-3 | ClC1=CC=CC2=C1C(Br)=CN=C2 | 4-Bromo-5-chloroisoquinoline | AG000OCM | 25g |
| 1256785-40-6 | O=C(OC)C1=CN=C(Cl)C=C1N | Methyl 4-amino-6-chloronicotinate | AG000OCO | 200g |
| 1256784-52-7 | O=C(N1CCOC2=CC=C(B3OC(C)(C)C(C)(C)O3)C=C2C1)OC(C)(C)C | tert-Butyl 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydrobenzo[f | AG000OCS | 0.5g |
| 1256781-74-4 | CC1=CC(B2OC(C)(C)C(C)(C)O2)=C(Cl)C(C)=C1 | 2-(2-Chloro-3,5-dimethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane | AG000OCT | 10g |
| 1256812-94-8 | N#CC1=CC(Cl)=CN=C1OC | 5-Chloro-2-methoxypyridine-3-carbonitrile | AG000OEF | 2g |
| 1256811-82-1 | O=C1c2c(CN1)nc(cc2)Cl | 5H-Pyrrolo[3,4-b]pyridin-5-one, 2-chloro-6,7-dihydro- | AG000OEI | 30g |
| 1256811-26-3 | CC1=NC=C(O)C(Br)=C1 | 4-Bromo-6-methylpyridin-3-ol | AG000OEJ | 30g |
| 1256811-09-2 | O=C(OC)C1=NC=C(O)C=C1Cl | Methyl 3-Chloro-5-hydroxypyridine-2-carboxylate | AG000OEK | 11g |
| 1256811-02-5 | C(=O)(C)c1c(OC)ncc(c1)Br | Ethanone, 1-(5-bromo-2-methoxy-3-pyridinyl)- | AG000OEL | 0.4g |
| 1256810-97-5 | COC1=C(Br)N=C(F)C=C1 | 2-bromo-6-fluoro-3-methoxypyridine | AG000OEM | 14g |
| 1256810-92-0 | O=C(OC)C1=CC=NC(C#C)=C1 | Methyl 2-ethynylisonicotinate | AG000OEN | 2g |
| 1256810-64-6 | COC1=CN=C(Br)C=C1Cl | 2-Bromo-4-Chloro-5-Methoxypyridine | AG000OEO | 10g |
| 1256810-42-0 | O=C(OC)C1=C(O)C=NC(Br)=C1 | METHYL 2-BROMO-5-HYDROXYPYRIDINE-4-CARBOXYLATE | AG000OEQ | 1g |
| 1256810-34-0 | Oc1cnc(c(c1)C(=O)O)Br | 2-Bromo-5-hydroxynicotinic acid | AG000OER | 0.5g |
| 1256810-26-0 | C(=O)(O)c1c(OC)ccc(n1)Br | 2-Pyridinecarboxylic acid, 6-bromo-3-methoxy- | AG000OES | 20g |
| 1256809-21-8 | O=C(C1=CC=CN=C1C(F)F)O | 2-(Difluoromethyl)pyridine-3-carboxylic acid | AG000OEW | 3g |
| 1256808-62-4 | O=C(OC)C1=CN=CC(Br)=C1Cl | Methyl 5-bromo-4-chloronicotinate | AG000OEY | 50g |
| 1256808-59-9 | O=C(O)C1=NC=C(F)C=C1C | 5-Fluoro-3-methylpicolinic acid | AG000OEZ | 25g |
| 1256819-37-0 | COC1=CC=C(Cl)N=C1Br | 2-Bromo-6-chloro-3-methoxypyridine | AG000OF0 | 125g |
| 1256819-32-5 | BrC1=CC(C2OC=NC=2)=CN=C1 | 5-(5-BROMOPYRIDIN-3-YL)OXAZOLE | AG000OF1 | 5g |
| 1256819-16-5 | N#CC1=C(C)N=CC(Cl)=C1 | 5-Chloro-2-methylnicotinonitrile | AG000OF4 | 2g |
| 1256818-99-1 | OC1=CN=C(NN=C2)C2=C1 | 1H-pyrazolo[3,4-b]pyridin-5-ol | AG000OF6 | 0.5g |
| 1256818-46-8 | CC(C1=CC(C2CC2)=CN=C1)=O | 1-(5-Cyclopropylpyridin-3-yl)ethanone | AG000OF8 | 6g |
| 1256818-41-3 | O=C(OCC)C1=C(C)N=CC=C1Br | Ethyl 4-bromo-2-methylnicotinate | AG000OF9 | 2g |
| 1256818-37-7 | CC1CCN(C(=O)OC(C)(C)C)C1 | tert-butyl 3-methylpyrrolidine-1-carboxylate | AG000OFB | 100g |
| 1256818-31-1 | O=C(C1=CN=C(OCCO2)C2=C1)O | 2,3-Dihydro-[1,4]dioxino[2,3-b]pyridine-7-carboxylic acid | AG000OFD | 2g |
| 1256818-14-0 | FC(C=1C=C(C(=O)O)C=CN1)F | 2-(Difluoromethyl)isonicotinic acid | AG000OFE | 1g |
| 1256815-07-2 | O=C(N1C(CN)CN(C(OC(C)(C)C)=O)CC1)OC(C)(C)C | 1,4-di-tert-butyl 2-(aminomethyl)piperazine-1,4-dicarboxylate | AG000OFJ | 1g |
| 1256813-70-3 | COC(=O)C1=CSC2=C1CCNC2 | Methyl 4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carboxylate | AG000OFN | 5g |
| 1256824-48-2 | CCOC(C1=CC2=C(NN=C2)N=C1)=O | Ethyl 1H-pyrazolo[3,4-b]pyridine-5-carboxylate | AG000OFP | 1.7g |
| 1256824-45-9 | OC(C1=NC=C2C(C=NN2)=C1)=O | 1H-Pyrazolo[3,4-c]pyridine-5-carboxylic acid | AG000OFQ | 5g |
| 1256824-38-0 | O=CC1=CN=C(F)C=C1Cl | 4-chloro-6-fluoronicotinaldehyde | AG000OFR | 5g |
| 1256824-17-5 | CC(C1=NC=C(Cl)C=C1F)=O | 1-(5-Chloro-3-fluoropyridin-2-yl)ethanone | AG000OFT | 6g |
| 1256824-06-2 | FC(C1=CNC2=NC=CC(Br)=C21)(F)F | 4-Bromo-3-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine | AG000OFU | 0.75g |
| 1256823-89-8 | CC1=C(C=C(C=N1)Br)C(=O)C | 1-(5-Bromo-2-methylpyridin-3-yl)ethanone | AG000OFV | 30g |
| 1256823-71-8 | N#Cc1cnc(F)c(Br)c1 | 5-BROMO-6-FLUORONICOTINONITRILE | AG000OFW | 1g |
| 1256823-65-0 | N#CC1=NC(Cl)=C(Br)C=C1 | 5-Bromo-6-chloropicolinonitrile | AG000OFX | 125g |
| 1256823-49-0 | COC1=CC(Br)=C(C)N=C1 | 3-Bromo-5-methoxy-2-methylpyridine | AG000OFY | 1g |
| 1256823-07-0 | N#CC1=NC=C(Br)C(OC)=C1 | 5-Bromo-4-Methoxypicolinonitrile | AG000OG1 | 0.5g |
| 1256822-94-2 | OC1=CC=C(F)N=C1Br | 2-Bromo-6-fluoropyridin-3-ol | AG000OG2 | 175g |
| 1256822-80-6 | FC1=CC2=C(NN=C2Br)N=C1 | 3-Bromo-5-fluoro-1H-pyrazolo[3,4-b]pyridine | AG000OG3 | 15g |
| 1256822-16-8 | N#CC1=C(F)C=NC(Br)=C1 | 2-Bromo-5-fluoroisonicotinonitrile | AG000OG5 | 100g |
| 1256822-12-4 | C1=CC2=C(CCC(C2)C(=O)O)N=C1 | 5,6,7,8-Tetrahydroquinoline-6-carboxylic acid | AG000OG6 | 5g |
| 1256821-83-6 | N#CC1=C(F)N=CC(Br)=C1 | 5-Bromo-2-fluoronicotinonitrile | AG000OG7 | 50g |
| 1256821-58-5 | Brc1c2c(cnc1)cn[nH]2 | 1H-Pyrazolo[4,3-c]pyridine, 7-bromo- | AG000OG9 | 50g |
| 1256821-12-1 | NC1=CC(C(C)C)=CN=C1 | 5-Isopropylpyridin-3-amine | AG000OGA | 3g |
| 1256820-00-4 | FC(C1=CC(Cl)=CN=C1Br)(F)F | 2-Bromo-5-chloro-3-(trifluoromethyl)pyridine | AG000OGC | 20g |
| 1256834-88-4 | OC(=O)C1CCc2c(C1)ccc(n2)Cl | 2-Chloro-5,6,7,8-tetrahydroquinoline-6-carboxylic acid | AG000OGE | 3g |
| 1256834-59-9 | O=C(OC)C1=C(Cl)N=CC(O)=C1 | Methyl 2-chloro-5-hydroxynicotinate | AG000OGG | 10g |
| 1256834-38-4 | NC1=CC(Cl)=NC2=CC=C(Br)C=C12 | 6-Bromo-2-Chloroquinolin-4-Amine | AG000OGH | 9g |
| 1256834-13-5 | O=C(O)C1=CN=C(Cl)C=C1Br | 4-Bromo-6-chloronicotinic acid | AG000OGJ | 50g |
| 1256833-84-7 | COc1cc(O)cnc1Br | 6-Bromo-5-methoxypyridin-3-ol | AG000OGK | 4g |
| 1256833-42-7 | N#CC1=NNC2=NC=C(F)C=C21 | 5-Fluoro-1H-pyrazolo[3,4-b]pyridine-3-carbonitrile | AG000OGL | 4g |
| 1256826-72-8 | CC1=NNC2=NC(Cl)=CC=C21 | 6-Chloro-3-methyl-1H-pyrazolo[3,4-b]pyridine | AG000OGN | 20g |
| 1256826-55-7 | O=C(OC)C1=C(OC)N=CC=C1Cl | Methyl 4-chloro-2-methoxynicotinate | AG000OGO | 125g |
| 1256825-86-1 | COC(=O)C1=CC=C2C=CNC2=N1 | Methyl 1H-pyrrolo[2,3-b]pyridine-6-carboxylate | AG000OGR | 10g |
| 1256825-30-5 | NCC1=NC(Cl)=C(Cl)C=C1 | (5,6-Dichloropyridin-2-yl)MethanaMine | AG000OGV | 6g |
| 1256825-20-3 | O=C(C1=NC=C(N)C=C1Cl)OC | Methyl 5-aMino-3-chloropyridine-2-carboxylate | AG000OGX | 20g |
| 1256825-19-0 | O=C1COCC2=NC=CC=C21 | 6,8-Dihydro-5H-pyrano[3,4-b]pyridin-5-one | AG000OGY | 0.3g |
| 1255098-88-4 | O=C(C1=NC=CO1)[O-].[Na+] | Oxazole-2-carboxylic acid sodium salt | AG000NRP | 100g |
| 1255098-82-8 | CCOC(=O)c1cc2nc(Br)ccc2[nH]1 | Ethyl 5-bromo-1H-pyrrolo[3,2-b]pyridine-2-carboxylate | AG000NRS | 125g |
| 1255098-74-8 | COc1nc(CN)ccc1OC.Cl.Cl | (5,6-Dimethoxypyridin-2-yl)methanamine dihydrochloride | AG000NRV | 1.25g |
| 1255098-60-2 | CC1(CNC(C(O)=O)CO1)C.Cl | 6,6-Dimethyl-morpholine-3-carboxylic acid hydrochloride | AG000NRZ | 2g |
| 1255098-56-6 | CC1(C)CNC(CO1)C(=O)OC | Methyl 6,6-dimethyl-morpholine-3-carboxylate | AG000NS1 | 5g |
| 1255098-50-0 | O=C(C1N(C(OC(C)(C)C)=O)CC(C)(C)OC1)O | 4-Boc-6,6-dimethyl-morpholine-3-carboxylic acid | AG000NS4 | 1g |
| 1255099-67-2 | CC(C)(OC(NC1CN(C(OCC2=CC=CC=C2)=O)CC1CO)=O)C | 3-Boc-amino-1-cbz-4-hydroxymethyl-pyrrolidine | AG000NS6 | 9g |
| 1255099-63-8 | O=C(N(OC)C)C1=CC=C(Cl)C=C1Br | 2-Bromo-4-chloro-n-methoxy-n-methylbenzamide | AG000NS7 | 60g |
| 1255099-53-6 | OC1C2CN(CC12)C(=O)OCC1=CC=CC=C1 | benzyl 6-hydroxy-3-azabicyclo[3.1.0]hexane-3-carboxylate | AG000NSC | 2g |
| 1255099-52-5 | CSC1=NC=C(C(Cl)=NC=C2)C2=N1 | 5-Chloro-2-(methylsulfanyl)pyrido[4,3-d]pyrimidine | AG000NSD | 10g |
| 1256825-17-8 | NC1=NC(Br)=CC(C(F)(F)F)=C1 | 6-Bromo-4-(trifluoromethyl)pyridin-2-amine | AG000OGZ | 10g |
| 1256824-90-4 | CC1=C(Cl)N=CC(CN)=C1 | (6-chloro-5-Methylpyridin-3-yl)MethanaMine | AG000OH2 | 1.5g |
| 1256958-47-0 | CC(C)(C)OC(=O)N1CC2CC(CN)CC2C1 | Tert-butyl 5-(aminomethyl)hexahydrocyclopenta[C]pyrrole-2(1H)-carboxylat | AG000OH3 | 1g |
| 1256958-34-5 | NC1=C(C(=O)OC)C=C(C(=C1)OC)I | Methyl 2-amino-5-iodo-4-methoxybenzoate | AG000OH4 | 10g |
| 1256955-36-8 | O=C(OC)C1=CC(OC)=C(Br)C=C1N | Methyl 2-amino-4-bromo-5-methoxybenzoate | AG000OH6 | 50g |
| 1256945-00-2 | FC(C1=CC=C(Br)C=C1I)(F)F | 4-Bromo-2-iodo-1-(trifluoromethyl)benzene | AG000OH8 | 175g |
| 1256944-96-3 | C[C@@H](N)C1=CC=C(F)C(OC)=C1.[H]Cl | (R)-1-(4-Fluoro-3-methoxyphenyl)ethanamine hydrochloride | AG000OH9 | 30g |
| 1256921-67-1 | O=C(C1=NC(Br)=CN=C1Cl)OC | Methyl 6-bromo-3-chloropyrazine-2-carboxylate | AG000OHA | 300g |
| 1256836-96-0 | COC(=O)C1=NC=C(O)C=C1F | METHYL 3-FLUORO-5-HYDROXYPICOLINATE | AG000OHB | 10g |
| 1256836-57-3 | CC(C1=NC(Cl)=CC=C1Br)=O | 1-(3-Bromo-6-chloropyridin-2-yl)ethanone | AG000OHC | 0.75g |
| 1256835-79-6 | N#CC1=CN=C(Cl)C(OC)=C1 | 6-Chloro-5-methoxynicotinonitrile | AG000OHF | 2g |
| 1256835-28-5 | N#CC1=CN=C(C)C(Cl)=C1 | 5-Chloro-6-methylnicotinonitrile | AG000OHH | 5g |
| 1256835-20-7 | O=C(OC)C1=NC(N)=CC=C1Cl | Methyl 6-amino-3-chloropicolinate | AG000OHI | 20g |
| 12569-38-9 | O.[Ca+2].OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(=O)[O-].OC[C@@H | Calcium Glubionate | AG000OHR | 700g |
| 1256964-50-7 | Cc1[nH]c2ncccc2c1I | 3-Iodo-2-methyl-1H-pyrrolo[2,3-b]pyridine | AG000OHS | 5g |
| 125700-73-4 | O=C1N(C(C2C3C=CC(C12)C3)=O)O/C(N(C)C)=[N+](C)C.[F-][B+3]([F-])([F-])[F-] | TNTU | AG000OHW | 250g |
| 125700-71-2 | O=C1C=CC=CN1OC(N(C)C)=[N+](C)C.F[B-](F)(F)F | TPTU | AG000OHY | 500g |
| 125700-69-8 | O=C1C2=CC=CC=C2N=NN1OC(N(C)C)=[N+](C)C.F[B-](F)(F)F | TDBTU | AG000OHZ | 300g |
| 1256781-73-3 | COC1=CC(B2OC(C)(C)C(C)(C)O2)=C(Cl)C=C1 | 2-Chloro-5-methoxyphenylboronic acid pinacol ester | AG000OCU | 20g |
| 1256781-69-7 | IC1(=C(C=C(OC)C=C1)B2(OC(C)(C)C(O2)(C)C)) | 2-(2-Iodo-5-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane | AG000OCW | 5.5g |
| 1256794-28-1 | ClC1=CC2=C(C=NN2)C(Cl)=N1 | 4,6-Dichloro-1H-pyrazolo[4,3-c]pyridine | AG000OCZ | 4.38g |
| 1256794-24-7 | O=C(C1=CC(Cl)=NN=C1)O | 6-chloropyridazine-4-carboxylic acid | AG000OD0 | 200g |
| 1256794-18-9 | CC1=NNC2=CC(Br)=CN=C21 | 6-Bromo-3-Methyl-1H-Pyrazolo[4,3-B]Pyridine | AG000OD1 | 14g |
| 1256794-12-3 | O=C(C1=NC(C(F)(F)F)=CC=C1N)OC | Methyl 3-Amino-6-(trifluoromethyl)-2-pyridinecarboxylate | AG000OD2 | 2g |
| 1256793-68-6 | FC(C1=CC2=C(NN=C2)C=N1)(F)F | 5-(Trifluoromethyl)-1H-pyrazolo[3,4-c]pyridine | AG000OD5 | 25g |
| 1256793-40-4 | COC1=C(N)C=CC(C(O)=O)=N1 | 5-Amino-6-methoxypicolinic acid | AG000OD6 | 0.75g |
| 1256792-12-7 | COC=1C=C(C(=NC1)C#N)C | 5-Methoxy-3-methylpicolinonitrile | AG000OD9 | 5.5g |
| 1256791-78-2 | O=C(OC)C1=NC(OC)=C(O)C=C1 | Methyl 5-hydroxy-6-methoxypicolinate | AG000ODA | 1g |
| 1256791-37-3 | OC1=CC=C(C(F)F)N=C1 | 6-(Difluoromethyl)pyridin-3-ol | AG000ODB | 0.5g |
| 1256791-15-7 | C(=O)(OC)c1cc(OC)cnc1Cl | Methyl 2-Chloro-5-Methoxynicotinate | AG000ODC | 5g |
| 1256791-13-5 | CC(C1=CC(C)=C(Cl)N=C1)=O | 1-(6-Chloro-5-methylpyridin-3-yl)ethanone | AG000ODD | 4g |
| 1256790-85-8 | O=C(O)C1=CN=CC(Br)=C1Cl | 5-Bromo-4-chloronicotinic acid | AG000ODG | 10g |
| 1256790-45-0 | N#CC1=C(OC)N=C(Br)C=C1 | 6-Bromo-2-methoxynicotinonitrile | AG000ODI | 5g |
| 1256789-95-3 | O=C(OC)C1=NC=C(Br)C(OC)=C1 | Methyl 5-bromo-4-methoxypicolinate | AG000ODJ | 200g |
| 1256789-73-7 | O=C(OC)C1=CN=C(Br)C=C1Cl | Methyl 6-bromo-4-chloronicotinate | AG000ODL | 200g |
| 1256807-59-6 | O=C(C1=CN=C2C(NN=C2)=C1)O | 1H-pyrazolo[4,3-b]pyridine-6-carboxylic acid | AG000ODN | 25g |
| 1256807-03-0 | CC1=CN=C(C(O)=O)C(F)=C1 | 3-Fluoro-5-Methylpyridine-2-carboxylic acid | AG000ODQ | 3g |
| 1256807-01-8 | O=C(OC)C1=CC(OC)=NC(C(F)F)=C1 | Methyl 2-(difluoromethyl)-6-methoxyisonicotinate | AG000ODR | 5g |
| 1256806-83-3 | NC1=CC(F)=C(Cl)N=C1 | 6-Chloro-5-fluoropyridin-3-amine | AG000ODT | 100g |
| 1256806-33-3 | BrC1=CC=NC2=C1NN=C2 | 7-Bromo-1H-pyrazolo[4,3-b]pyridine | AG000ODU | 0.5g |
| 1256805-99-8 | COC1=CC=CN=C1C#C | 2-Ethynyl-3-methoxypyridine | AG000ODW | 1g |
| 1256805-06-7 | FC1=CN=C(Br)C=C1Br | 2,4-Dibromo-5-fluoropyridine | AG000OE0 | 25g |
| 1256804-49-5 | O=C(C1=NC=CC(C(F)F)=C1)O | 4-(Difluoromethyl)picolinic acid | AG000OE3 | 3g |
| 1256804-48-4 | CC1=NC=C(OC)C(Br)=C1 | 4-Bromo-5-methoxy-2-methylpyridine | AG000OE4 | 50g |
| 1256803-11-8 | C1CC1C2=CC(=CN=C2)Cl | 3-Chloro-5-cyclopropylpyridine | AG000OE5 | 50g |
| 1256802-03-5 | OC(=O)C1=CC2=C(C=NN2)C=N1 | 1H-Pyrazolo[4,3-c]pyridine-6-carboxylic acid | AG000OE7 | 5g |
| 1256801-93-0 | FC(F)(F)c1c[nH]c2nc(Cl)cc(Cl)c12 | 4,6-Dichloro-3-(trifluoromethyl)-1h-pyrrolo[2,3-b]pyridine | AG000OE9 | 0.5g |
| 1256813-52-1 | O=C(OC)C1=NC=C(C)C(Br)=C1 | Methyl 4-bromo-5-methylpicolinate | AG000OEB | 1g |
| 1256813-45-2 | BrC1=CNC2=C1C(=NC=C2)N | 3-Bromo-1H-pyrrolo[3,2-c]pyridin-4-amine | AG000OEC | 1g |
| 125471-00-3 | CC(C)(C)OC(=O)N1CCS[C@@H]1C(=O)O | N-Boc-(r)-thiazolidine-2-carboxylic acid | AG000NPS | 20g |
| 125469-89-8 | COC(=O)C(CN)(CC1=CC=CC=C1)CC1=CC=CC=C1 | Methyl 3-amino-2,2-dibenzylpropanoate | AG000NPT | 2g |
| 125455-64-3 | CC(=O)N[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]1O[C@H]2[C@@ | 4-Nitrophenyl 2-Acetamido-3-O-(2-acetamido-2-deoxy-b-D-glucopyranosyl)- | AG000NPZ | 0.005g |
| 125455-62-1 | [Na+].OC1O[C@H](COS(=O)(=O)[O-])[C@H](O)[C@H](O)[C@H]1O | Sodium (2R,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl sulfate | AG000NQ0 | 0.05g |
| 125486-96-6 | C[Si](CCS(=O)(N)=O)(C)C | 2-(Trimethylsilyl)ethanesulfonamide | AG000NQF | 10g |
| 125483-00-3 | NC1=C(C(F)(F)F)C=CC(C(O)=O)=C1 | 3-Amino-4-(trifluoromethyl)benzoic acid | AG000NQK | 300g |
| 1254982-25-6 | CN1CCC=C(B2OC(C)(C)C(C)(C)O2)C1 | 1-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,3,6-tetrahydrop | AG000NQV | 1g |
| 1255099-13-8 | O=C(OC)C1=CC=C(C)C(C#C)=C1 | methyl 3-ethynyl-4-methylbenzoate | AG000NRH | 25g |
| 1255098-89-5 | O=C(C1CC2(CCC2)C1)OCC | Ethyl spiro[3.3]heptane-2-carboxylate | AG000NRO | 10g |
| 125700-67-6 | O=N1=N[N+](C=2C=CC=CC21)=C(N(C)C)N(C)C.[F-][B+3]([F-])([F-])[F-] | Tbtu | AG000OI0 | 2000g |
| 125697-93-0 | Oc1ccc(O)c(CNc2ccc(O)c(c2)C(=O)O)c1 | 5-((2,5-Dihydroxybenzyl)amino)-2-hydroxybenzoic acid | AG000OIA | 0.02g |
| 125697-92-9 | OC1=CC(CN(C2=CC=C(O)C(C(O)=O)=C2)CC3=CC=CC=C3O)=C(O)C=C1 | Lavendustin A | AG000OIB | 0.04g |
| 125697-91-8 | OC1=C(CN(C=2C=CC(=C(C(=O)O)C2)O)CC2=C(C=CC=C2)O)C=CC=C1 | 5-(Bis(2-hydroxybenzyl)amino)-2-hydroxybenzoic acid | AG000OIC | 0.5g |
| 125697-63-4 | O=C(ON1C(CCC1=O)=O)CCCCCNC(OCC2C3=C(C4=C2C=CC=C4)C=CC=C3)=O | 2,5-Dioxopyrrolidin-1-yl 6-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)hexa | AG000OIE | 50g |
| 1257095-63-8 | S=C(NC1=CC=C(C)C([N+]([O-])=O)=C1)C2=CC=C(C(F)(F)F)C=C2 | N-(4-Methyl-3-nitrophenyl)-4-(trifluoromethyl)benzothioamide | AG000OIH | 0.75g |
| 1257095-61-6 | S=C(NC1=CC=C(Cl)C([N+]([O-])=O)=C1)C2=CC=C(C(F)(F)F)C=C2 | N-(4-Chloro-3-nitrophenyl)-4-(trifluoromethyl)benzothioamide | AG000OII | 0.75g |
| 1257081-01-8 | Cl.SC1CNCCC1 | Piperidine-3-thiol hydrochloride | AG000OIN | 10g |
| 1257072-34-6 | N#CC1=NC(Br)=CN=C1Cl | 6-Bromo-3-chloropyrazine-2-carbonitrile | AG000OIR | 15g |
| 1257044-40-8 | O=C(NS(=O)(C1=CC=C(NCC2CCOCC2)C([N+]([O-])=O)=C1)=O)C3=CC=C(N4CCN(C | 4-(4-{[2-(4-chlorophenyl)-4,4-dimethylcyclohex-1-en-1-yl]methyl}piperazin- | AG000OIU | 200g |
| 1257236-69-3 | C1CC1(CN2CCOCC2)C(=O)O | 1-(Morpholinomethyl)Cyclopropanecarboxylic Acid | AG000OJ5 | 30g |
| 1257231-51-8 | O=C(OC)C1=CC=C(Br)C(I)=C1 | Methyl 4-bromo-3-iodobenzoate | AG000OJ6 | 8g |
| 1257220-47-5 | CC(C1=CC(NC2=C3C=CC=C2)=C3C=C14)(C)C5=C4C=CC=C5 | 7,7-Dimethyl-5,7-dihydroindeno[2,1-b]carbazole | AG000OJ8 | 200g |
| 1257220-44-2 | CC(C1=CC(N(C2=CC=CC=C2)C3=C4C=C(Br)C=C3)=C4C=C15)(C)C6=C5C=CC=C6 | 2-Bromo-7,7-dimethyl-5-phenyl-5,7-dihydroindeno[2,1-b]carbazole | AG000OJ9 | 15g |
| 1257213-52-7 | C(=O)(OCC)C1(CC1)c1ccc(cc1)B1OC(C(O1)(C)C)(C)C | Cyclopropanecarboxylic acid, 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2- | AG000OJA | 3g |
| 1257213-50-5 | O=C(O)C1(CC1)C(C=C2)=CC=C2C(C=C3)=CC=C3C4=C(NC(O[C@H](C)C5=CC=CC=C | BMS-986020 | AG000OJB | 1.25g |
| 1257106-65-2 | C[C@@H](N)C1=CC=C(F)C(Cl)=C1.[H]Cl | (R)-1-(3-Chloro-4-fluorophenyl)ethanamine hydrochloride | AG000OJD | 1g |
| 119-63-1 | CN(C1=CC=C(N)C=C1)C(C)=O | N1-(4-Aminophenyl)-N1-methylacetamide | AG000P00 | 5g |
| 119-62-0 | OCC(C(c1ccc(cc1)[N+](=O)[O-])O)N | 1,3-Propanediol,2-amino-1-(4-nitrophenyl)- | AG000P01 | 0.45g |
| 119-60-8 | O=C(C1CCCCC1)C1CCCCC1 | Dicyclohexyl ketone | AG000P03 | 10g |
| 119-58-4 | CN(C)c1ccc(cc1)C(O)c1ccc(cc1)N(C)C | 4,4′-Bis(dimethylamino)benzhydrol | AG000P05 | 10g |
| 119-56-2 | OC(C1=CC=C(Cl)C=C1)C2=CC=CC=C2 | (4-Chlorophenyl)(phenyl)methanol | AG000P06 | 9000g |
| 119-54-0 | CCN(C(N1CCNCC1)=O)CC | N,N-Diethylpiperazine-1-carboxamide | AG000P07 | 2g |
| 1190-69-8 | CCOC(=O)CCCCC(=O)N | Ethyl 6-amino-6-oxohexanoate | AG000P0A | 2g |
| 1190-63-2 | CCCCCCCCCCCCCCCCCC(=O)OCCCCCCCCCCCCCCCC | Cetyl Stearate | AG000P0B | 5g |
| 1190-53-0 | N=C(NCCCC)NC(N)=N.[H]Cl | Butyl-biguanidehydrochloride | AG000P0C | 10g |
| 1190-49-4 | [H][C@](N)(CCCCNC(N)=O)C(O)=O | (S)-2-Amino-6-Ureidohexanoic Acid | AG000P0D | 20g |
| 1190-48-3 | O=CNCCCC[C@@H](C(=O)O)N | n-Epsilon-formyl-l-lysine | AG000P0E | 6g |
| 1190-46-1 | O=C(O)[C@@H](N)CCNC(C)=O | (2S)-4-(Acetylamino)-2-aminobutanoic acid | AG000P0F | 10g |
| 1190-39-2 | O=C(OCCCC)CC(OCCCC)=O | Dibutylmalonate | AG000P0G | 200g |
| 1190-32-5 | CC(C(O)=O)NC(CCl)=O | Chloroacetyl-dl-alanine | AG000P0H | 1g |
| 1190-22-3 | CC(Cl)CCCl | Butane, 1,3-dichloro- | AG000P0K | 275g |
| 1190-09-6 | BrCCCP(O)(O)=O | (3-Bromopropyl)Phosphonicacid | AG000P0N | 175g |
| 1257431-63-2 | CC(O)(C1=CC(B2OC(C)(C)C(C)(C)O2)=CN=C1)C | 5-(2-Hydroxypropan-2-yl)pyridine-3-boronic acid pinacol ester | AG000OL9 | 6g |
| 1257426-19-9 | FC(F)(F)OC1=CC=C(C2=CC=C(CO[C@H]3CN4C(OC3)=NC([N+]([O-])=O)=C4)C=N2) | TBA-354 | AG000OLB | 0.075g |
| 125743-80-8 | CCOC(=O)N1CCC(CC1)C2(F)c3ccc(Cl)cc3CCc4cccnc24 | Ethyl 4-(8-chloro-5H-benzo[5,6]cyclohepta[1,2-b]pyridin-11(6H)-ylidene)pipe | AG000OLR | 0.75g |
| 125743-63-7 | N#CC1=CC=C(CN2CCN(C)CC2)C=C1 | 4-(4-Methylpiperazin-1-ylmethyl)benzonitrile | AG000OLT | 25g |
| 1257535-47-9 | CC1=CC(CN)=NC=C1Br.[H]Cl | (5-Bromo-4-methylpyridin-2-yl)methanamine hydrochloride | AG000OLX | 2g |
| 1257535-46-8 | CC1=C2C(NN=C2)=C(Br)C=C1 | 7-Bromo-4-methyl-1H-indazole | AG000OLY | 0.5g |
| 1257535-45-7 | CC1=C(Br)C2=C(C=C1)C=NN2 | 7-bromo-6-methyl-1H-indazole | AG000OLZ | 10g |
| 1257535-43-5 | Cl.BrC=1C(=NC=C(C1)Cl)CN | (3-Bromo-5-chloropyridin-2-yl)methanamine hydrochloride | AG000OM1 | 3g |
| 1257535-42-4 | NCC1=NC=C(Br)C=C1C.[H]Cl | (5-Bromo-3-methylpyridin-2-yl)methanamine HCl | AG000OM2 | 0.75g |
| 1257535-33-3 | CC1=CC=C(C=C1C)CNC2CC2.[H]Cl | N-cyclopropyl 3,4-dimethylbenzylamine HCl | AG000OM4 | 0.75g |
| 1257535-29-7 | NCC1=NC=C(Cl)C=C1F.[H]Cl | (5-Chloro-3-fluoropyridin-2-yl)methanamine HCl | AG000OM5 | 7g |
| 1257535-28-6 | NC1=CC=C(F)C(Br)=C1.[H]Cl | 3-Bromo-4-fluoroaniline, HCl | AG000OM6 | 500g |
| 1257535-19-5 | Cl.NCC1=C(F)C=C(Br)C=N1 | (5-Bromo-3-fluoropyridin-2-yl)methanamine HCl | AG000OM7 | 5g |
| 1257535-08-2 | NCC1=NC(F)=CC=C1.[H]Cl.[H]Cl | 2-(Aminomethyl)-6-fluoropyridine diHCl | AG000OM9 | 2g |
| 1257535-06-0 | NC1=CC=C(F)C(Br)=C1N | 3-Bromo-4-fluorobenzene-1,2-diamine | AG000OMA | 10g |
| 1257628-77-5 | O=C(NC1=CC=C(CN2CCN(C)CC2)C(C(F)(F)F)=C1)C3=CC=C(C)C(C#CC4=CN=C(NN= | 3-((1H-Pyrazolo[3,4-b]pyridin-5-yl)ethynyl)-4-methyl-N-(4-((4-methylpiperaz | AG000OMK | 0.5g |
| 1257554-93-0 | CC(C)(C)OC(=O)NCC1=CN=CC(=C1)B1OC(C)(C)C(C)(C)O1 | tert-Butyl ((5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-yl)meth | AG000OML | 5g |
| 1257855-07-4 | O=C(N1[C@H](CCO)COCC1)OC(C)(C)C | (R)-N-Boc-3-(2-hydroxyethyl)morpholine | AG000OQ4 | 10g |
| 1257854-99-1 | OC(=O)C[C@H]1CNCCO1 | (S)-2-Morpholineacetic acid | AG000OQ5 | 2g |
| 1257854-98-0 | CC(C)(C)OC(=O)NC1C2=C(C=C(Br)C=C2)OC1 | Tert-butyln-(6-bromo-2,3-dihydrobenzofuran-3-yl)carbamate | AG000OQ6 | 4g |
| 1257854-97-9 | OC(=O)C[C@@H]1CNCCO1 | (R)-2-(Morpholin-2-yl)acetic acid | AG000OQ7 | 0.5g |
| 1257853-72-7 | Fc1c2c(c(n[nH]2)Br)ccc1 | 3-bromo-7-fluoro-1H-indazole | AG000OQB | 50g |
| 1257853-70-5 | O=CC[C@@H]1CN(C(OC(C)(C)C)=O)CCO1 | (R)-N-Boc-2-(2-Oxoethyl)morpholine | AG000OQC | 1.5g |
| 1257852-22-4 | O=C(C1=NC2=NC(Br)=CC=C2N1)OC | Methyl 5-bromo-1H-imidazo[4,5-b]pyridine-2-carboxylate | AG000OQF | 1.25g |
| 1257850-88-6 | O=C(OC(C)(C)C)NC[C@@H]1NCCOC1 | (S)-tert-Butyl (morpholin-3-ylmethyl)carbamate | AG000OQI | 5g |
| 1257850-86-4 | O=C[C@@H]1N(C(OC(C)(C)C)=O)CCOC1 | (R)-N-Boc-3-Morpholinecarbaldehyde | AG000OQJ | 3g |
| 1257850-83-1 | CC(C)(OC(NC[C@@H]1COCCN1)=O)C | (R)-tert-Butyl (morpholin-3-ylmethyl)carbamate | AG000OQK | 2g |
| 1257850-82-0 | O=C(O)C[C@H]1CN(C(OC(C)(C)C)=O)CCO1 | (S)-N-Boc-Morpholine-2-acetic acid | AG000OQL | 2g |
| 1257850-78-4 | O=C(N1C[C@H](C#N)OCC1)OC(C)(C)C | (R)-tert-Butyl 2-cyanomorpholine-4-carboxylate | AG000OQM | 5g |
| 1257877-12-5 | COC2=CC=C1C=C(C=CC1=C2)C3=CC(=N[NH]3)C(=O)O | 5-(6-Methoxynaphthalen-2-yl)-1H-pyrazole-3-carboxylic acid | AG000OQQ | 10g |
| 1257861-04-3 | C(=O)(OCC)c1c(C)c([nH]n1)Br | 1H-Pyrazole-3-carboxylic acid, 5-bromo-4-methyl-, ethyl ester | AG000OQR | 2.875g |
| 1257856-86-2 | O=C(N1[C@@H](C#N)COCC1)OC(C)(C)C | (S)-tert-Butyl 3-cyanomorpholine-4-carboxylate | AG000OQT | 5g |
| 1257856-32-8 | O=C(N1[C@H](C#N)COCC1)OC(C)(C)C | (R)-N-Boc-3-Cyanomorpholine | AG000OQW | 5g |
| 1257856-31-7 | O=C(N1C[C@@H](C#N)OCC1)OC(C)(C)C | (S)-N-Boc-2-Cyanomorpholine | AG000OQX | 5g |
| 1259305-29-7 | CCCCCCCCCCCC(OCN1C(CCC2=C1C=C(OCCCCN3CCN(C4=CC=CC(Cl)=C4Cl)CC3)C= | Aripiprazole lauroxil | AG000OZ0 | 0.5g |
| 1259285-61-4 | NC1=CC=C(B2OC(C)(C)C(C)(C)O2)C(C(F)(F)F)=C1 | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)aniline | AG000OZ1 | 2g |
| 1259280-37-9 | CC1(C(OB(O1)C1C=CC=C2C=1C1=CC=CC=C1C2(C1C=CC=CC=1)C1C=CC=CC=1)(C)C) | 2-(9,9-Diphenyl-9h-fluoren-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane | AG000OZ2 | 15g |
| 1259279-57-6 | S(=O)(=O)(n1c2c(c(c1)B1OC(C(O1)(C)C)(C)C)cc(cn2)F)c1ccc(cc1)C | 5-Fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-tosyl-1H-pyrrolo[2 | AG000OZ3 | 2g |
| 1259278-17-5 | O=C(OC(C)(C)C)N[C@H]1C[C@@H](N)CCC1 | (1r,3s)-3-amino-1-(boc-amino)cyclohexane | AG000OZ4 | 48g |
| 1259278-10-8 | OC([C@H]1C[C@@H](NC(OCC2=CC=CC=C2)=O)CCC1)=O | (1R,3S)-3-(Carbobenzoxyamino)cyclohexanecarboxylic acid | AG000OZ5 | 1g |
| 1259277-49-0 | O=C(OC(C)(C)C)N[C@H]1[C@H](CN)CCCC1 | tert-Butyl ((1R,2S)-rel-2-(aminomethyl)cyclohexyl)carbamate | AG000OZ6 | 5g |
| 1259224-17-3 | BrC1=CC2=C(C=C(C=O)C=C2)N=C1 | 3-Bromoquinoline-7-carbaldehyde | AG000OZ7 | 4g |
| 1259224-15-1 | Nc1ncc2c(c1)cccc2F | 8-Fluoroisoquinolin-3-amine | AG000OZ8 | 0.2g |
| 1259224-11-7 | BrC1=CC2=C(NC(C3=CC=CC=C3)=C2C4=CC=CC=C4)C=C1 | 5-Bromo-2,3-Diphenyl-1H-Indole | AG000OZA | 200g |
| 1259224-00-4 | O=C(OC(C)(C)C)NC1(C2=CC=C(N)C=C2)CCC1 | tert-Butyl 1-(4-aminophenyl)cyclobutylcarbamate | AG000OZD | 1g |
| 119-84-6 | O=C1CCC2=CC=CC=C2O1 | Dihydrocoumarin | AG000OZL | 4000g |
| 119-81-3 | COC1=CC([N+]([O-])=O)=C(NC(C)=O)C=C1 | N-(4-Methoxy-2-nitrophenyl)acetamide | AG000OZM | 200g |
| 119-80-2 | O=C(O)C1=CC=CC=C1SSC2=CC=CC=C2C(O)=O | 2,2′-Dithiodibenzoic acid | AG000OZN | 3000g |
| 119-79-9 | O=S(C1=CC=C2C(N)=CC=CC2=C1)(O)=O | 5-Aminonaphthalene-2-sulfonic acid | AG000OZO | 5000g |
| 119-68-6 | O=C(O)C1=CC=CC=C1NC | N-Methylanthranilic acid | AG000OZV | 1500g |
| 119-67-5 | C1=CC=CC(=C1C=O)C(O)=O | 2-Carboxybenzaldehyde | AG000OZW | 10000g |
| 119-65-3 | C12=C(C=NC=C2)C=CC=C1 | Isoquinoline | AG000OZY | 386g |
| 1257554-10-1 | CC1(C)OB(OC1(C)C)c1cc(OC(C)C)ncc1 | 2-Isopropoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine | AG000OMN | 10g |
| 1257554-02-1 | CC1(C)OB(OC1(C)C)c1cc2c(nc1)n(cn2)C | 3-Methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl);-3H-imidazo[4,5-b] | AG000OMO | 3g |
| 1257554-01-0 | Cn1c(C)nc2c1ncc(c2)B1OC(C(O1)(C)C)(C)C | 3H-Imidazo[4,5-b]pyridine, 2,3-dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxab | AG000OMP | 1.75g |
| 1257554-00-9 | CN1N=NC2=C1N=CC(Br)=C2 | 6-Bromo-3-methyl-3H-[1,2,3]triazolo[4,5-b]pyridine | AG000OMQ | 7g |
| 1257553-90-4 | CC(=O)NC1=C(N=CC(=C1)Br)OC | N-(5-Bromo-2-methoxypyridin-3-yl)acetamide | AG000OMS | 4g |
| 1257553-87-9 | CC1(C)C(C)(C)OB(C2=CN=CC(OCC3CC3)=C2)O1 | 3-(Cyclopropylmethoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrid | AG000OMT | 7g |
| 1257553-85-7 | CC1(C)C(C)(C)OB(C2=CN=C(OCCC)C=C2)O1 | 2-Propoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine | AG000OMU | 30g |
| 1257553-79-9 | CC1(C)C(C)(C)OB(C2=CN=C(OCCOC)C=C2)O1 | 2-(2-Methoxyethoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin | AG000OMV | 10g |
| 1257535-62-8 | Cl.CC1=CN=C(CN)C(Br)=C1 | (3-Bromo-5-methylpyridin-2-yl)methanamine HCl | AG000OMX | 0.5g |
| 1257535-60-6 | CC1=CC(=C(C(=O)OC)S1)Br | Methyl 3-bromo-5-methylthiophene-2-carboxylate | AG000OMY | 15g |
| 1257535-54-8 | NCC1=NC=C(Cl)C=C1.[H]Cl.[H]Cl | (5-Chloropyridin-2-yl)methanamine diHCl | AG000ON2 | 10g |
| 1257535-53-7 | Cl.CC1=C(Cl)N=CC(CN)=C1 | (6-Chloro-5-methylpyridin-3-yl)methanamine hydrochloride | AG000ON3 | 1g |
| 1488424-86-7 | O=C1(OB(OC(=O)CN(C1)C)C2(=CC(=CC=C2)C=O)) | 3-(6-Methyl-4,8-dioxo-1,3,6,2-dioxazaborocan-2-yl)benzaldehyde | AG000ONA | 3.8g |
| 1422172-82-4 | O=C1[O-][B+3]2([O-]C(=O)C[N]2(C)C1)[C-]3=CC=C(C=C)C=C3 | 4-Methyl-2,6-dioxo-8-(4-vinylphenyl)hexahydro-[1,3,2]oxazaborolo[2,3-b][1, | AG000ONB | 10g |
| 1287221-36-6 | O=C1[O-][B+3]2([O-]C(=O)C[N]2(C)C1)[C-]3=CC=C(I)C=C3 | (T-4)-[N-[(Carboxy-κO)methyl]-N-methylglycinato(2-)-κN,κO](4-iodophenyl) | AG000ONF | 125g |
| 1257651-13-0 | CC1(C)C(C)(C)OB(C2=CC=C3N=NNC3=C2)O1 | 1H-Benzo[d][1,2,3]triazol-5-ylboronic acid pinacol ester | AG000ONJ | 10g |
| 1257651-11-8 | O1B(C2CC(C)(C)NC(C)(C)C=2)OC(C)(C)C1(C)C | (2,2,6,6-Tetramethyl-3,6-dihydro-2H-pyridin-4-yl) boronic acid pinacol ester | AG000ONK | 50g |
| 1196152-88-1 | OC1=CC(Br)=NC=C1F | 2-Bromo-5-fluoropyridin-4-ol | AG000PBD | 10g |
| 1196152-62-1 | O=C(C1=C(SC(Cl)=N2)C2=CC=C1)OC | Methyl 2-chlorobenzo[d]thiazole-7-carboxylate | AG000PBE | 0.5g |
| 1196152-43-8 | CN1C(=CN=N1)I | 5-Iodo-1-Methyl-1H-1,2,3-Triazole | AG000PBF | 2g |
| 1196152-38-1 | FC(C1=CN=C(Br)C=N1)(F)F | 2-Bromo-5-(trifluoromethyl)pyrazine | AG000PBG | 10g |
| 1196152-34-7 | NC1=CC(Br)=NC(OC)=C1 | 2-Bromo-6-methoxypyridin-4-amine | AG000PBI | 50g |
| 1196152-13-2 | Cl.FC(C1NCCOC1)(F)F | 3-(Trifluoromethyl)morpholine hydrochloride | AG000PBJ | 10g |
| 1196152-02-9 | O(C)c1cc(Br)cc(n1)Cl | Pyridine, 4-bromo-2-chloro-6-methoxy- | AG000PBK | 5g |
| 1196152-00-7 | O=C(C1=NC(Cl)=NC=C1)OCC | Ethyl 2-chloropyrimidine-4-carboxylate | AG000PBL | 20g |
| 1196151-89-9 | C(#C)C1=CC(=NC=C1)C(F)(F)F | 4-Ethynyl-2-(trifluoromethyl)pyridine | AG000PBM | 5g |
| 1196155-73-3 | ClC1=CC2=C(C=C1)C=CN=C2Br | 1-Bromo-7-chloroisoquinoline | AG000PBP | 8g |
| 1196155-68-6 | O=CC1=CC2=CC(Br)=CC=C2N=C1 | 6-Bromoquinoline-3-carbaldehyde | AG000PBQ | 2g |
| 1196155-47-1 | BrC1=C2CCCCN2N=C1 | 3-Bromo-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine | AG000PBT | 10g |
| 1196155-38-0 | N#CC1=CC(C(F)(F)F)=NC(Cl)=C1 | 2-chloro-6-(trifluoromethyl)pyridine-4-carbonitrile | AG000PBU | 25g |
| 1196155-35-7 | BrC1=CC(Br)=NN=C1 | 3,5-dibromopyridazine | AG000PBV | 5g |
| 1196155-33-5 | ClC1=NN=CC(Br)=C1 | 5-Bromo-3-chloropyridazine | AG000PBW | 50g |
| 1196155-22-2 | C#CC1=NC=CC(=C1)Br | 4-Bromo-2-ethynylpyridine | AG000PBX | 15g |
| 1196155-18-6 | COC1=CN=C(C#C)C=C1 | 2-Ethynyl-5-methoxypyridine | AG000PBY | 25g |
| 1196154-93-4 | O=C(O)C1=NC=C(C)C(Br)=C1 | 4-Bromo-5-methylpicolinic acid | AG000PBZ | 35g |
| 1196154-87-6 | O=C1CCC2=NC=C(Br)C=C21 | 3-Bromo-6,7-dihydro-5H-cyclopenta[b]pyridin-5-one | AG000PC1 | 125g |
| 1190309-69-3 | N#Cc1cnc2[nH]cc(Br)c2c1 | 3-Bromo-1H-pyrrolo[2,3-b]pyridine-5-carbonitrile | AG000P3G | 0.5g |
| 1190307-88-0 | C[C@@H](C(OC(C)C)=O)N[P@@](OC1=CC=CC=C1)(OC[C@H]2O[C@@H](N(C(N | Sofosbuvir | AG000P3H | 149g |
| 1190310-21-4 | N#CC1C2=C(C=NC=1)NC=C2Br | 3-bromo-1H-pyrrolo[2,3-c]pyridine-4-carbonitrile | AG000P3M | 2g |
| 1190310-18-9 | N#Cc1cc(Br)c2cc[nH]c2n1 | 4-Bromo-1H-pyrrolo[2,3-b]pyridine-6-carbonitrile | AG000P3N | 25g |
| 1190310-15-6 | O=Cc1c(F)cnc2c1cc[nH]2 | 5-Fluoro-1H-pyrrolo[2,3-b]pyridine-4-carbaldehyde | AG000P3P | 1g |
| 1190310-05-4 | OC1=CC(Br)=C2C(NC=C2)=N1 | 4-Bromo-1H-pyrrolo[2,3-b]pyridin-6-ol | AG000P3V | 1g |
| 1190310-00-9 | COC1=CC(Br)=C2C(NC=C2)=N1 | 4-Bromo-6-methoxy-1H-pyrrolo[2,3-b]pyridine | AG000P3Y | 50g |
| 1190309-92-2 | O=[N+]([O-])c1c[nH]c2nc(Cl)ccc12 | 6-Chloro-3-nitro-1H-pyrrolo[2,3-b]pyridine | AG000P46 | 5g |
| 1190313-39-3 | C1=C2C(=C(Cl)N=C1)C(=CN2)I | 4-Chloro-3-iodo-1H-pyrrolo[3,2-c]pyridine | AG000P4H | 25g |
| 1190314-70-5 | FC1=NC2=C(NC=C2I)C=C1 | 5-Fluoro-3-iodo-1H-pyrrolo[3,2-b]pyridine | AG000P4K | 0.5g |
| 1190315-22-0 | FC1=NC2=C(C(=CN2)Br)C=C1 | 3-BROMO-6-FLUORO-1H-PYRROLO[2,3-B]PYRIDINE | AG000P4Q | 1g |
| 1190316-08-5 | N#CC1=C(F)C=C2C(NC=C2)=N1 | 5-FLUORO-1H-PYRROLO[2,3-B]PYRIDINE-6-CARBONITRILE | AG000P4T | 4g |
| 1190316-06-3 | OC(C1=CC2=C(C(=CN2)C=O)N=C1)=O | 3-Formyl-4-azaindole-6-carboxylic acid | AG000P4U | 1g |
| 1190316-90-5 | COC1=C(Br)C=C2C(NC(=O)C2)=N1 | 5-BROMO-6-METHOXY-1,3-DIHYDROPYRROLO[2,3-B]PYRIDIN-2-ONE | AG000P4V | 10g |
| 1190317-33-9 | OC(=O)c1ccc2c(n1)c(Br)c[nH]2 | 3-Bromo-1H-pyrrolo[3,2-b]pyridine-5-carboxylic acid | AG000P4X | 1g |
| 1190317-79-3 | COC1=CN=C2C(Br)=CNC2=C1 | 3-Bromo-6-methoxy-1H-pyrrolo[3,2-b]pyridine | AG000P50 | 4g |
| 1190317-53-3 | ClC1=CC2=C(NC=C2Cl)N=C1 | 3,5-Dichloro-1H-pyrrolo[2,3-b]pyridine | AG000P51 | 3g |
| 1190317-52-2 | COC1=NC2=C(C=C1)C(Br)=CN2 | 3-Bromo-6-methoxy-1H-pyrrolo[2,3-b]pyridine | AG000P52 | 2g |
| 119009-47-1 | O=C(O)[C@@H](N)CC1=CC=CC=C1C(F)(F)F | (S)-2-Amino-3-(2-(trifluoromethyl)phenyl)propanoic acid | AG000P24 | 25g |
| 1190235-39-2 | CC1(C)OB(CC2=CC(=CC=C2)C(F)(F)F)OC1(C)C | 4,4,5,5-Tetramethyl-2-(3-(Trifluoromethyl)Benzyl)-1,3,2-Dioxaborolane | AG000P29 | 30g |
| 1190219-72-7 | COC1=C(Cl)C(Cl)=C(B(O)O)C=C1 | 2,3-Dichloro-4-methoxyphenylboronic acid | AG000P2B | 1.75g |
| 1190198-21-0 | COC1=C(I)C(N)=CC=N1 | 3-Iodo-2-methoxypyridin-4-amine | AG000P2F | 25g |
| 119023-25-5 | NC(=O)C1=C(N)C=C(F)C=C1 | 2-Amino-4-fluorobenzamide | AG000P2N | 25g |
| 119022-51-4 | O=C1NN(C)C(C(F)(F)F)=C1 | 1-Methyl-5-trifluoromethyl-1,2-dihydropyrazol-3-one | AG000P2P | 50g |
| 119020-06-3 | O=C(N1C(C#N)CCC1)OCC2=CC=CC=C2 | 1-N-Cbz-2-cyanopyrrolidine | AG000P2R | 50g |
| 119020-04-1 | Cl.Cl.NC[C@@H]1NCCC1 | (2R)-Pyrrolidin-2-ylmethanamine dihydrochloride | AG000P2S | 10g |
| 119020-03-0 | O=C(N1C(CN)CCC1)OCC2=CC=CC=C2 | 2-Aminomethyl-pyrrolidine-1-carboxylic acid benzyl ester | AG000P2T | 100g |
| 119020-00-7 | O=C(N1C(CN)CCC1)OCC2=CC=CC=C2.[H]Cl | Benzyl 2-(aminomethyl)pyrrolidine-1-carboxylate hydrochloride | AG000P2U | 3g |
| 119018-29-0 | O=S(C1=CC=C(CCNC(N2C(C(CC)=C(C)C2)=O)=O)C=C1)(N)=O | 4-[2-[(3-Ethyl-4-methyl-2-oxo-3-pyrrolin-1-yl)carboxamido]ethyl]benzenesul | AG000P2V | 600g |
| 1190309-89-7 | FC(C1=NC=CC2=C1C=CN2)(F)F | 4-(Trifluoromethyl)-5-azaindole | AG000P2X | 0.5g |
| 1190309-83-1 | Brc1c2c([nH]c1)ncc(c2)N(=O)=O | 3-Bromo-5-nitro-1H-pyrrolo[2，3-b]pyridine | AG000P32 | 20g |
| 1190309-82-0 | O=Cc1c[nH]c2ccnc(F)c12 | 4-fluoro-1H-pyrrolo[3,2-c]pyridine-3-carbaldehyde | AG000P33 | 1g |
| 1190309-80-8 | COC(=O)c1cnc2[nH]cc(C=O)c2c1 | METHYL 3-FORMYL-1H-PYRROLO[2,3-B]PYRIDINE-5-CARBOXYLATE | AG000P35 | 1g |
| 1190309-79-5 | Fc1nccc2[nH]cc(I)c12 | 4-fluoro-3-iodo-1H-pyrrolo[3,2-c]pyridine | AG000P36 | 10g |
| 1190309-77-3 | O=CC1=CN=C(NC=C2Cl)C2=C1 | 3-CHLORO-1H-PYRROLO[2,3-B]PYRIDINE-5-CARBALDEHYDE | AG000P38 | 5g |
| 1190309-76-2 | FC1=C2C(NC=C2)=CC=N1 | 4-Fluoro-1H-pyrrolo[3,2-c]pyridine | AG000P39 | 1g |
| 1190309-71-7 | FC1=CN=C(NC=C2Br)C2=C1 | 3-Bromo-5-fluoro-7-azaindole | AG000P3E | 5g |
| 1256490-52-4 | C[C@H](NP(OC1=CC=CC=C1)(OC2=C(F)C(F)=C(F)C(F)=C2F)=O)C(OC(C)C)=O | N-[(S)-(2,3,4,5,6-Pentafluorophenoxy)phenoxyphosphinyl]-l-alanine 1-meth | AG000O8S | 125g |
| 1256490-31-9 | CC(C)OC([C@@H](N[P@](=O)(OC1=CC=CC=C1)OC1=CC=C(C=C1)[N+](=O)[O-])C) | N-[(S)-(4-Nitrophenoxy)phenoxyphosphinyl]-L-alanine 1-Methylethyl ester | AG000O8T | 0.05g |
| 1256482-19-5 | C(F)(F)(F)C(=O)C1=CC(=CC(F)=C1)OC | 2,2,2-Trifluoro-1-(3-fluoro-5-methoxyphenyl)ethanone | AG000O8W | 4.9g |
| 1256470-62-8 | COC1=C(Cl)C=CC(C(C(F)(F)F)=O)=C1 | 1-(4-chloro-3-methoxyphenyl)-2,2,2-trifluoroethan-1-one | AG000O93 | 2.5g |
| 1256467-37-4 | COC1=C(C(C(F)(F)F)=O)C=C(F)C=C1 | 2,2,2-trifluoro-1-(5-fluoro-2-methoxyphenyl)ethan-1-one | AG000O95 | 20.9g |
| 125650-44-4 | O=C1NC(=O)NC1(C1CCC1)C1C=CC=CC=1 | 5-Cyclobutyl-5-phenylhydantoin | AG000O99 | 1.75g |
| 1256581-66-4 | O=C(OCC)CC1=CC=C(OC(C)C)C(OC)=C1 | Ethyl 2-(4-isopropoxy-3-methoxyphenyl)acetate | AG000O9G | 0.75g |
| 1256580-46-7 | N#CC1=CC2=C(C=C1)C3=C(C(C)(C)C4=CC(N5CCC(N6CCOCC6)CC5)=C(CC)C=C4C3= | 9-Ethyl-6,6-dimethyl-8-[4-(morpholin-4-yl)piperidin-1-yl]-11-oxo-5H-benzo[ | AG000O9H | 20g |
| 1256578-99-0 | COc1cc2c(CCC(=O)C2(C)C)cc1Br | 6-bromo-7-methoxy-1,1-dimethyl-3,4-dihydronaphthalen-2(1H)-one | AG000O9I | 2g |
| 1256577-71-5 | N#CC1=CC2=C(C=C1)C3=C(C(C)(C)C4=CC(N5CCC(N6CCOCC6)CC5)=CC=C4C3=O)N | CH5424802 analog | AG000O9J | 0.75g |
| 1256546-76-5 | C1OCC12CCC(CC2)CO | (2-Oxaspiro[3.5]nonan-7-yl)methanol | AG000O9M | 1g |
| 1256546-74-3 | O=C(CC1)CCC21COC2 | 2-Oxaspiro[3.5]nonan-7-one | AG000O9N | 50g |
| 1256546-72-1 | OCC(CC1)(CO)CCC21OCCO2 | 1,4-Dioxaspiro[4.5]decane-8,8-diyldimethanol | AG000O9O | 200g |
| 125652-55-3 | CC1=C[N+](CCCC)=CC=C1.[Cl-] | 1-Butyl-3-methylpyridinium Chloride | AG000O9Y | 75g |
| 1193-02-8 | NC1=CC=C(S)C=C1 | 4-Aminothiophenol, tech grade | AG000P6P | 350g |
| 1193-00-6 | [O-]C1=CC=C(Cl)C=C1.[Na+] | Sodium 4-chlorophenolate | AG000P6Q | 50g |
| 1193-96-0 | ON=Cc1ccccn1 | syn-2-Pyridinealdoxime | AG000P6R | 225g |
| 119302-20-4 | C[C@]12C[C@@H]([C@@H](O)C[C@@H]1CC[C@@H]3[C@@H]2CC[C@]4(C)[C | (2b，3a，5a，16b，17b)-2-(4-Morpholinyl)-16-(1-pyrrolidinyl)androstane-3 | AG000P6V | 125g |
| 1194-02-1 | C1=C(C=CC(=C1)F)C#N | 4-Fluorobenzonitrile | AG000P73 | 2000g |
| 1194057-63-0 | O=C(N1[C@H](CO)C[C@@H](NC(OCC2=CC=CC=C2)=O)C1)OC(C)(C)C | (2S,4R)-tert-Butyl 4-(((benzyloxy)carbonyl)amino)-2-(hydroxymethyl)pyrroli | AG000P76 | 2g |
| 1194373-85-7 | O=C(C1=NNC2=C(C=CC(Br)=C2)C1=O)O | 7-Bromo-4-oxo-1,4-dihydrocinnoline-3-carboxylic acid | AG000P7C | 3g |
| 119448-87-2 | CCOC(=O)C1=C2C=CC=CN2C=N1 | IMIDAZO[1,5-A]PYRIDINE-1-CARBOXYLIC ACID ETHYL ESTER | AG000P7H | 30g |
| 1194550-59-8 | O=C(OCC1=CC=CC=C1)[C@@H](N)CC2=CC=CC(S(=O)(C)=O)=C2.[H]Cl | (S)-Benzyl 2-amino-3-(3-(methylsulfonyl)phenyl)propanoate hydrochloride | AG000P7I | 50g |
| 1194707-71-5 | O.OC(=O)C1=NC=C(O)C=C1 | 5-Hydroxy-pyridine-2-carboxylic acid h2o | AG000P7L | 50g |
| 1194683-55-0 | COc1ccccc1c1ccc(cn1)Br | 5-Bromo-2-(2-methoxyphenyl)pyridine | AG000P7P | 4g |
| 1195-09-1 | COC1=C(O)C=C(C)C=C1 | 2-Methoxy-5-methylphenol | AG000P7U | 100g |
| 1195-44-4 | COCC1=CC=C(Cl)C=C1 | 1-CHLORO-4-(METHOXYMETHYL)BENZENE | AG000P7W | 50g |
| 1195625-75-2 | Nc1n2c(nn1)nccc2 | [1,2,4]triazolo[4,3-a]pyrimidin-3-amine | AG000P81 | 0.2g |
| 1195768-23-0 | FC1=C(NS(=O)(C2=C(F)C=CC=C2F)=O)C=CC=C1C3=C(C4=NC(Cl)=NC=C4)SC(C(C)(C | N-(3-(2-(tert-Butyl)-5-(2-chloropyrimidin-4-yl)thiazol-4-yl)-2-fluorophenyl)-2 | AG000P87 | 1.75g |
| 1195768-20-7 | O=S(C1=C(F)C=CC=C1F)(NC2=CC=CC(C(CC3=NC(Cl)=NC=C3)=O)=C2F)=O | N-(3-(2-(2-chloropyriMidin-4-yl)acetyl)-2-fluorophenyl)-2,6-difluorobenzene | AG000P88 | 30g |
| 1195995-72-2 | NC1=NC=CC(B(OC2(C)C)OC2(C)C)=C1 | 2-Aminopyridine-4-boronic acid pinacol ester | AG000P89 | 150g |
| 1195975-03-1 | BrC1=C2C=CC(C3=CC=CC=C3)=CC2=C(C4=CC=C(C5=CC=CC=C5)C=C4)C6=C1C=CC= | 9-([1,1′-Biphenyl]-4-yl)-10-bromo-2-phenylanthracene | AG000P8B | 50g |
| 1259034-35-9 | O=C(N1CC(O)(C#C)C1)OC(C)(C)C | TERT-BUTYL 3-ETHYNYL-3-HYDROXYAZETIDINE-1-CARBOXYLATE | AG000OXJ | 25g |
| 1259023-29-4 | N#CCC1=CC=C(Br)C(Cl)=C1 | 2-(4-Bromo-3-chlorophenyl)acetonitrile | AG000OXL | 2g |
| 125903-81-3 | OCC1=CC(OC(F)F)=CC=C1 | (3-(Difluoromethoxy)phenyl)methanol | AG000OXP | 25g |
| 125903-77-7 | N=C(N)C1=NC=CC=C1C.[H]Cl | 3-Methylpicolinimidamide hydrochloride | AG000OXQ | 5g |
| 1259-35-4 | FC1=C(F)C(F)=C(F)C(F)=C1P(C2=C(F)C(F)=C(F)C(F)=C2F)C3=C(F)C(F)=C(F)C(F)=C3 | Tris(pentafluorophenyl)phosphine | AG000OY4 | 300g |
| 1259223-99-8 | CC(C)(C)OC(=O)NC1(CCC1)C1=CC=C(C=C1)C(O)=O | 4-(1-((tert-Butoxycarbonyl)amino)cyclobutyl)benzoic acid | AG000OY7 | 3g |
| 1259223-95-4 | IC1=NNC2=NC(Cl)=CC=C21 | 6-Chloro-3-iodo-1H-pyrazolo[3,4-b]pyridine | AG000OY9 | 100g |
| 1259065-07-0 | COC(C1CCN(C(OC(C)(C)C)=O)CCC1)=O | 1-tert-Butyl 4-methyl azepane-1,4-dicarboxylate | AG000OYB | 10g |
| 1259062-50-4 | N#CC1CCNCCC1 | Azepane-4-carbonitrile hydrochloride | AG000OYC | 5g |
| 1259056-34-2 | CC(C)(C)OC(=O)N1CCCC(CC1)C#N | 4-Cyano-azepane-1-carboxylic acid tert-butyl ester | AG000OYE | 300g |
| 125917-60-4 | N1C2=CC=CC=C2C=C(CO)C=1Cl | (2-Chloro-3-quinolinyl)methanol | AG000OYG | 75g |
| 125910-07-8 | COc1cc(/C=C/c2cc(OC)cc(c2)OC)cc(c1)OC | Benzene, 1,1′-(1E)-1,2-ethenediylbis[3,5-dimethoxy- | AG000OYL | 0.2g |
| 1259323-62-0 | O=C(O)C1=CC=C(OC(F)(F)F)C=C1N | 2-Amino-4-(trifluoromethoxy)benzoic acid | AG000OYX | 25g |
| 1259319-35-1 | COC1=CC=C(Br)C2=NC(Cl)=C(C=O)C=C12 | 8-Bromo-2-chloro-5-methoxyquinoline-3-carbaldehyde | AG000OYY | 4g |
| 1259318-83-6 | CC1=CC(B(O)O)=C(C)C(Br)=C1 | 3-Bromo-2,5-dimethylphenylboronic acid | AG000OYZ | 70g |
| 1190317-86-2 | COC1=CC2=C(C=CN2)N=C1 | 6-Methoxy-1H-pyrrolo[3,2-b]pyridine | AG000P56 | 0.1g |
| 1190318-32-1 | O=C1Cc2nccc(Cl)c2N1 | 7-Chloro-1H-pyrrolo[3,2-b]pyridin-2(3H)-one | AG000P58 | 10g |
| 1190318-72-9 | O=C(C1=CC=C2NC=C(Br)C2=N1)OC | Methyl 3-bromo-1H-pyrrolo[3,2-b]pyridine-5-carboxylate | AG000P5B | 20g |
| 1190318-71-8 | O=C1CC2=NC=CC(Br)=C2N1 | 7-Bromo-1H-pyrrolo[3,2-b]pyridin-2(3H)-one | AG000P5C | 10g |
| 1190423-61-0 | O(CC1C=CC=CC=1)C1=CN=CC(B(O)O)=C1 | 5-(Benzyloxy)pyridine-3-boronic Acid | AG000P5D | 30.02g |
| 1190875-39-8 | CC(C)(C)OC(=O)N1CCC(CC1)N1C=C(C=N1)B(O)O | 1-(1-BOC-Piperidino)pyrazole-4-boronic acid | AG000P5J | 50g |
| 1191385-19-9 | Cl.Cl.N1=CN=C2NC=NC2=C1C=1C(=NC=CC1)NC=1C=2C=CN=C(C2C=CC1C)NC1=CC | N5-(3-(9H-Purin-6-yl)pyridin-2-yl)-N1-(4-chlorophenyl)-6-methylisoquinolin | AG000P5N | 0.3g |
| 1191252-49-9 | BrC=1C=C(C=C(C1O)Br)C1=NOC(=N1)C(=O)NCC1=CC=C(C=C1)OC1=CC=CC=C1 | 3-(3,5-Dibromo-4-hydroxyphenyl)-N-(4-phenoxybenzyl)-1,2,4-oxadiazole-5-c | AG000P5O | 0.1g |
| 119139-23-0 | O=C(C(C1=CNC2=C1C=CC=C2)=C3C4=CNC5=C4C=CC=C5)NC3=O | Bisindolylmaleimide IV | AG000P5P | 1.25g |
| 1191429-14-7 | C(OC(N[C@](CCCCCCN=[N+]=[N-])(C(O)=O)C)=O)C1C=2C(C=3C1=CC=CC3)=CC=C | (2R)-8-Azido-2-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-2-methyloctanoi | AG000P5R | 2g |
| 1191429-12-5 | C(OC(N[C@](CCCCCN=[N+]=[N-])(C(O)=O)C)=O)C1C=2C(C=3C1=CC=CC3)=CC=CC | (2R)-7-Azido-2-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-2-methylheptan | AG000P5S | 1g |
| 119171-18-5 | CCC[N+]1=CN(C)C=C1.[I-] | 1-Methyl-3-propylimidazolium Iodide | AG000P5W | 2000g |
| 1192-14-9 | CC1(C(=O)CC1)C | 2,2-DIMETHYLCYCLOBUTAN-1-ONE | AG000P68 | 2g |
| 1192-08-1 | CC1CC(=O)C1 | 3-Methylcyclobutan-1-one | AG000P69 | 10g |
| 1192-37-6 | C=C1CCCCC1 | methylidenecyclohexane | AG000P6B | 90g |
| 1192548-13-2 | O=C(OC)C1=CC(C)=C(I)C(C)=C1 | Methyl 4-Iodo-3,5-Dimethylbenzoate | AG000P6H | 75g |
| 1192547-87-7 | O=C(OC)C1=CC(C)=C(Cl)C(C)=C1 | Methyl 4-Chloro-3，5-Dimethylbenzoate | AG000P6K | 2g |
| 1192539-95-9 | C(F)(F)(F)c1c(CN)ccc(c1)Br | 4-Bromo-2-(trifluoromethyl)benzenemethanamine | AG000P6M | 2.9g |
| 1195967-46-4 | C=CCCCCCC[C@@](C)(N)C(O)=O | (R)-2-Amino-2-Methyldec-9-Enoic Acid | AG000P8C | 5g |
| 1195945-67-5 | OB(O)C1=C(C=CC(Cl)=C1)C(F)(F)F | 5-Chloro-2-(trifluoromethyl)phenylboronic acid | AG000P8D | 10g |
| 1195902-15-8 | OCC1=CC=C(N)C(C#C)=C1 | (4-Amino-3-ethynylphenyl)methanol | AG000P8E | 2g |
| 119591-34-3 | IC1=CC2=C(C(NS2(=O)=O)=O)C=C1 | 1,2-Benzisothiazol-3(2H)-one,6-iodo-, 1,1-dioxide | AG000P8L | 0.5g |
| 1196-38-9 | C1=CC=CC2=C1C(=O)NCC2 | 3,4-Dihydro-2H-isoquinolin-1-one | AG000P8M | 35g |
| 1196-30-1 | O=C(NC)C1=NC=CC=C1O | 3-Hydroxy-N-methylpicolinamide | AG000P8N | 5g |
| 1196-29-8 | CC(=NO)C1=C(O)C=CC=C1 | 1-(2-Hydroxyphenyl)-1-ethanone oxime | AG000P8O | 40g |
| 1196-19-6 | BrCC1C2=C(C=CC=C2)SC=1 | 3-(Bromomethyl)-1-benzothiophene | AG000P8R | 1g |
| 1196-09-4 | CC1=CSC2=C1C=C(C=C2)Br | 5-Bromo-3-methylbenzo[b]thiophene | AG000P8V | 40g |
| 1196-07-2 | O=C(C1=CC=C(Br)N1C)OC | Methyl 5-bromo-1-methyl-1H-pyrrole-2-carboxylate | AG000P8W | 7g |
| 1196-01-6 | CC1(C)[C@H]2C[C@@H]1C(=O)C=C2C | (1S,5S)-4,6,6-Trimethylbicyclo[3.1.1]hept-3-en-2-one | AG000P8X | 191g |
| 119600-38-3 | COC1=CC=C(C=C1)C(=O)CC(=O)CCC(O)=O | 6-(4-Methoxyphenyl)-4,6-dioxohexanoic acid | AG000P92 | 2g |
| 1196-92-5 | NCC1=CC=C(O)C(OC)=C1 | 4-(Aminomethyl)-2-methoxyphenol | AG000P93 | 75g |
| 1196-90-3 | COC(=O)C1=CC(Br)=CN1C | Methyl 4-Bromo-1-Methylpyrrole-2-Carboxylate | AG000P94 | 50g |
| 1196-79-8 | C1=C([NH]C2=CC=C(C=C12)C)C | 2,5-Dimethylindole | AG000P96 | 1500g |
| 1196-70-9 | O=CC1=CC2=C(C=C1)C=CN2 | 6-Formylindole | AG000P99 | 300g |
| 1196-69-6 | C(=O)c1cc2c(cc1)[nH]cc2 | 1H-Indole-5-carboxaldehyde | AG000P9A | 1000g |
| 1196-67-4 | C/C(C1=CC=CC=C1)=CC=O | 3-Phenylbut-2-enal | AG000P9B | 9g |
| 1196-58-3 | CCC(c1ccccc1)CC | (1-Ethylpropyl)benzene | AG000P9E | 5g |
| 1258639-21-2 | CC(OC(N1CCC(C(CO)(F)F)CC1)=O)(C)C | tert-butyl 4-(1,1-difluoro-2-hydroxyethyl)piperidine-1-carboxylate | AG000OVO | 10g |
| 1258639-06-3 | O=C(N1CCC2(CC1)C(NC3=C2C=CC(OC)=C3)=O)OC(C)(C)C | tert-Butyl 6-methoxy-2-oxospiro[indoline-3,4′-piperidine]-1′-carboxylate | AG000OVP | 1.25g |
| 1258638-82-2 | O=C(N1CC(F)(F)CC(N)C1)OC(C)(C)C | tert-Butyl 5-amino-3,3-difluoropiperidine-1-carboxylate | AG000OVQ | 30g |
| 1258637-09-0 | C(=O)(O)c1cc(cc(c1)O)c1cc(C#N)ccc1 | 3′-Cyano-5-hydroxy-[1,1′-biphenyl]-3-carboxylic acid | AG000OVT | 0.89g |
| 125872-97-1 | CCOC(=O)/C=C/C1=CC(=CC=C1)N | (E)-Ethyl 3-aminocinnamate | AG000OWF | 5g |
| 125872-95-9 | CN1C=CC2=C1C=C(Br)C=C2 | 6-Bromo-1-methyl-1H-indole | AG000OWH | 400g |
| 125867-31-4 | CC(C(NC1=C(C(O)=O)C=NC=C1)=O)(C)C | 4-[(2,2-Dimethylpropanoyl)amino]nicotinic acid | AG000OWM | 1.5g |
| 125867-25-6 | O=C(O)C1=C(NC(C(C)(C)C)=O)N=CC=C1 | 2-(2,2-Dimethyl-propionylamino)-nicotinic acid | AG000OWO | 20g |
| 125867-19-8 | CC(C)(C)C(NC1=CC=CN=C1OC)=O | N-(2-Methoxypyridin-3-yl)pivalamide | AG000OWP | 2g |
| 1258963-59-5 | CC(S(N[C@@H]1[C@H](OC2=CC=C(C3SC(C#N)=CC=3)C=C2)COC1)(=O)=O)C | Pesampator | AG000OWT | 0.025g |
| 1258963-53-9 | N[C@H]1COC[C@H]1Oc1ccc(Br)cc1 | (3S,4S)-4-(4-BROMOPHENOXY)TETRAHYDROFURAN-3-AMINE | AG000OWV | 5g |
| 1258963-20-0 | O=C(OC)C1=CC=C(B2OC(C)(C)C(C)(C)O2)C(C#N)=C1 | Methyl 3-cyano-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate | AG000OWW | 10g |
| 1258940-00-9 | Cl.C1(=CC=CC=C1)[C@H]1CNCCC1 | (S)-3-Phenylpiperidine hydrochloride | AG000OWX | 2g |
| 1258884-26-2 | O=[N+](C1=C(OC)C=C(Cl)N=C1Cl)[O-] | 2,6-Dichloro-4-methoxy-3-nitropyridine | AG000OWY | 175g |
| 1258861-20-9 | FC1=CC(C(F)(F)F)=C(C(N(C2CCN(C3=C(C=CC=C4)C4=C(C5=CC=NN5C)N=N3)CC2)C | LY2940680 | AG000OX0 | 0.1g |
| 1258833-80-5 | FC1=CC2=C(C=C1Br)C=CN=C2 | 6-bromo-7-fluoroisoquinoline | AG000OX2 | 50g |
| 1258833-77-0 | Fc1c2c(cc(c1)Br)ccnc2 | 6-Bromo-8-fluoroisoquinoline | AG000OX3 | 10g |
| 119692-41-0 | O=C(O)C1=C(C(F)(F)F)C=CC=C1OC | 2-Methoxy-6-(trifluoromethyl)benzoic acid | AG000PGE | 10g |
| 1196985-65-5 | OC1=CC=C(C)C(B2OC(C)(C)C(C)(C)O2)=C1 | 4-Methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol | AG000PGL | 10g |
| 1196976-68-7 | OC(=O)C12CC(F)(C1)CN2 | 4-Fluoro-2-azabicyclo[2.1.1]hexane-1-carboxylic acid | AG000PGM | 0.5g |
| 1197-37-1 | NC1=CC=C(OCC)C=C1N | 4-Ethoxybenzene-1,2-diamine | AG000PGO | 350g |
| 1197-34-8 | C(C)C=1C=C(C=C(C1)CC)O | 3,5-Diethylphenol | AG000PGP | 0.75g |
| 1197-23-5 | CS(=O)(NC1=NC=CC=C1)=O | N-(Pyridin-2-yl)methanesulfonamide | AG000PGV | 30g |
| 1197-22-4 | CS(=O)(NC1=CC=CC=C1)=O | N-Phenylmethanesulfonamide | AG000PGW | 500g |
| 1197-19-9 | CN(C)C1=CC=C(C=C1)C#N | 4-(Dimethylamino)benzonitrile | AG000PGY | 175g |
| 1197-18-8 | O=C([C@H]1CC[C@H](CN)CC1)O | (1r,4r)-4-(aminomethyl)cyclohexane-1-carboxylic acid | AG000PGZ | 8000g |
| 1197-17-7 | O=C([C@H]1CC[C@@H](CN)CC1)O | cis-4-(Aminomethyl)cyclohexanecarboxylic acid | AG000PH0 | 5g |
| 1197-13-3 | O=C(C1=CC=C(C=O)N1)OC | Methyl 5-formylpyrrole-2-carboxylate | AG000PH1 | 50g |
| 1197-10-0 | O=C(C1=NC(CO)=CC=C1)O | 6-HYDROXYMETHYL-PYRIDINE-2-CARBOXYLIC ACID | AG000PH3 | 25g |
| 1197-09-7 | CC(C1=CC=C(O)C(O)=C1)=O | 3′,4′-Dihydroxyacetophenone | AG000PH4 | 589.85g |
| 1197-05-3 | CCC(C1=CC=CC(N)=C1)=O | 3′-Aminopropiophenone | AG000PH5 | 15g |
| 1197-01-9 | Cc1ccc(cc1)C(C)(C)O | 2-(4-Methylphenyl)propan-2-ol | AG000PH7 | 175g |
| 1197050-28-4 | O=CC1=CC=CC(Br)=C1Cl | 3-Bromo-2-chlorobenzaldehyde | AG000PH8 | 200g |
| 1197020-22-6 | CCCCC[C@H](NC(OCC1C2=CC=CC=C2C3=CC=CC=C13)=O)C(O)=O | (S)-2-(Fmoc-amino)heptanoic acid | AG000PH9 | 17.5g |
| 119707-74-3 | OC1=C(Br)C=C2C=CC=CC2=C1C3=C4C=CC=CC4=CC(Br)=C3O | (S)-3,3′-Dibromo-1,1′-bi-2-naphthol | AG000PHC | 75g |
| 1197-66-6 | CC1(C)CC(=O)CC(C)(C)O1 | 2,2,6,6-Tetramethyl-2H-3,5,6-trihydropyran-4-one | AG000PHN | 300g |
| 1258001-18-1 | O=C(N1CCC(NN)CC1)OC(C)(C)C.[H]Cl | tert-Butyl 4-hydrazinylpiperidine-1-carboxylate hydrochloride | AG000ORD | 125g |
| 1257998-65-4 | [H]Cl.[H]Cl.C12COCCN1CCNC2 | Octahydropyrazino[2,1-c][1,4]oxazine dihydrochloride | AG000ORE | 1g |
| 1257997-18-4 | CC(C)(C)[Si](C)(C)O[C@H]1CC[C@@H](CC1)N1C=C(I)C=N1 | 1H-Pyrazole, 1-[trans-4-[[(1,1-dimethylethyl)dimethylsilyl]oxy]cyclohexyl]-4- | AG000ORF | 25g |
| 1257997-17-3 | CC1(C)C(C)(C)OB(C2=CN([C@H]3CC[C@H](O[Si](C)(C(C)(C)C)C)CC3)N=C2)O1 | 1-(trans-4-((tert-Butyldimethylsilyl)oxy)cyclohexyl)-4-(4,4,5,5-tetramethyl-1, | AG000ORG | 3g |
| 1257996-82-9 | BrC1CC2(OCCO2)C1 | 2-bromo-5,8-dioxaspiro[3.4]octane | AG000ORH | 100g |
| 1258226-87-7 | CC(C)(C)C1=CC=C(N2[C@H](C3=CC=C(NC([C@H]4N(CCC4)C([C@H](C(C)C)NC(O | Methyl ((S)-1-((S)-2-((4-((2S,5S)-1-(4-(tert-butyl)phenyl)-5-(4-((S)-1-((methox | AG000OS1 | 0.5g |
| 1258298-29-1 | O=C(O)C1=C(F)C=C(C#N)C=C1Cl | 2-Chloro-4-cyano-6-fluorobenzoic acid | AG000OSO | 15g |
| 1258298-01-9 | OC(C1=C(Cl)C=C(I)C=C1Cl)=O | 2,6-dichloro-4-iodobenzoic acid | AG000OSQ | 30g |
| 1258287-39-6 | OC1=CC(C)=NC=C1Br | 5-Bromo-2-methylpyridin-4-ol | AG000OST | 7g |
| 1258283-17-8 | O=C(C1=C(Br)N=CO1)OCC | Ethyl 4-bromo-1,3-oxazole-5-carboxylate | AG000OSU | 50g |
| 1258277-12-1 | C[C@@H]1NC[C@H](C)OC1 | (2S,5S)-2,5-Dimethylmorpholine | AG000OSV | 1g |
| 1258276-28-6 | O=P1(O)OC2=C(C3=C(C(C)C)C=C(C(C)C)C=C3C(C)C)C=CC4=C2C5(CCC6=C5C(O1)= | (11aS)-3,7-Bis[2,4,6-tris(1-methylethyl)phenyl]-10,11,12,13-tetrahydro-5-hyd | AG000OSX | 5g |
| 1258269-13-4 | OC(=O)C1=CN=CC(=N1)C1=CC=C(OC(F)(F)F)C=C1 | 6-[4-(Trifluoromethoxy)phenyl]pyrazine-2-carboxylic acid | AG000OSY | 0.2g |
| 125827-86-3 | NC1(C2=CC(F)=CC=C2)CCCCC1 | 1-(3-fluorophenyl)cyclohexan-1-amine | AG000OT8 | 25g |
| 1258405-40-1 | CN1CCN(CC1)C(=O)[C@H](N)C | 1-Propanone, 2-amino-1-(4-methyl-1-piperazinyl)-, (2R)- | AG000OTI | 5g |
| 1257648-75-1 | OB(O)C1=CC=CN=C1N1CCCC1 | 2-(Pyrrolidin-1-yl)pyridine-3-boronic acid | AG000ONP | 3g |
| 1257665-14-7 | BrC1=CC(=C(C(=O)NC(C)(C)C)C=C1)OC | 4-Bromo-N-(tert-butyl)-2-methoxybenzamide | AG000OO3 | 10g |
| 1257665-03-4 | O=CC1=CC(C)=CC(Br)=C1F | 3-Bromo-2-fluoro-5-methylbenzaldehyde | AG000OO9 | 125g |
| 1257664-92-8 | Brc1ccc(c2c1cccn2)I | 5-Bromo-8-iodoquinoline | AG000OOH | 0.75g |
| 1257705-04-6 | C1=CN2C(=NC(=N2)Cl)C(=C1)Br | 8-Bromo-2-chloro-[1,2,4]triazolo[1,5-a]pyridine | AG000OOR | 10g |
| 1257704-57-6 | O=S(C1=CC=C(C2=CC=CN3C2=NC(NC4=CC=CC(N5CCN(C)CC5)=C4)=N3)C=C1)(C)= | CEP-33779 | AG000OOS | 0.15g |
| 125772-42-1 | CC(C1=CC=C(C(N)=N)C=C1)(C)C | 4-(tert-Butyl)benzimidamide | AG000OOZ | 5g |
| 125769-67-7 | S=C(SCC=1C=CC=CC1CSC(=S)N(CC(C)C)CC(C)C)N(CC(C)C)CC(C)C | C,C′-[1,2-Phenylenebis(methylene)] bis[N,N-bis(2-methylpropyl)carbamodit | AG000OP2 | 0.5g |
| 1257849-25-4 | C(=O)(OC(C)(C)C)N1CCN(CC1)C2=CC(=CC=C2)C=O | 1-Boc-4-(3-formylphenyl)piperazine | AG000OPF | 10g |
| 1257849-07-2 | O=C(O)[C@H](CC1=CNC2=CC=C(Cl)C=C12)NC(OCC3C4=CC=CC=C4C5=CC=CC=C35 | Fmoc-5-chloro-L-tryptophan | AG000OPJ | 50g |
| 1257848-48-8 | O=C(O)C[C@@H]1CN(C(OC(C)(C)C)=O)CCO1 | (R)-N-Boc-Morpholine-2-acetic acid | AG000OPK | 20g |
| 1257793-03-5 | OB(c1cc(F)c(c(c1)F)I)O | 3,5-Difluoro-4-iodophenylboronic acid | AG000OPP | 10g |
| 1257856-15-7 | OCC[C@H]1CN(C(OC(C)(C)C)=O)CCO1 | (S)-N-Boc-2-(2-Hydroxyethyl)morpholine | AG000OPZ | 10g |
| 1257855-77-8 | O=C(N1CC2=C(C=CC(C(F)(F)F)=C2)CC1)OC(C)(C)C | tert-Butyl 7-(trifluoromethyl)-3,4-dihydroisoquinoline-2(1H)-carboxylate | AG000OQ1 | 0.2g |
| 1257855-12-1 | NC=1C(=C(C(=O)OC)C=CN1)Br | Methyl 2-amino-3-bromoisonicotinate | AG000OQ2 | 10g |
| 1258327-08-0 | O=P1(O)OC=2C(=CC=C3C2C4(C5=C(O1)C(=CC=C5CC4)C6=CC=CC=7C=CC=CC76)CC | (11aS)-10,11,12,13-Tetrahydro-5-hydroxy-3,7-di-1-naphthalenyl-diindeno[7,1 | AG000OTL | 5g |
| 1258327-07-9 | O=P1(O)OC2=C(C3=CC(C(F)(F)F)=CC(C(F)(F)F)=C3)C=CC4=C2C5(CCC6=C5C(O1)=C | (11aS)-3,7-Bis[3,5-bis(trifluoromethyl)phenyl]-10,11,12,13-tetrahydro-5-hydr | AG000OTM | 1g |
| 1258327-04-6 | O=P1(O)OC2=C(C=CC3=C2C4(C=5C(O1)=C(C=CC5CC4)C=6C=CC=CC6)CC3)C=7C=C | (11aS)-10,11,12,13-Tetrahydro-5-hydroxy-3,7-diphenyldiindeno[7,1-de:1′,7′-f | AG000OTP | 1.25g |
| 1258327-02-4 | C1CC2(CCC3=C2C(=C(C=C3)C4=CC=CC5=CC=CC=C54)O)C6=C1C=CC(=C6O)C7=CC= | (1S)-2,2′,3,3′-Tetrahydro-6,6′-di(1-naphthalenyl)-1,1′-spirobi[1H-indene]-7,7′- | AG000OTQ | 0.3g |
| 1258327-01-3 | C1CC2(CCC3=C2C(=C(C=C3)C4=CC(=CC(=C4)C(F)(F)F)C(F)(F)F)O)C5=C1C=CC(=C5 | (1S)-6,6′-bis[3,5-bis(trifluoroMethyl)phenyl]-2,2′,3,3′-tetrahydro-1,1′-Spirobi[ | AG000OTR | 0.4g |
| 1258327-00-2 | C1CC2(CCC3=C2C(=C(C=C3)C4=CC=C(C=C4)C5=CC=CC=C5)O)C6=C1C=CC(=C6O)C7 | (1S)-6,6′-Bis([1,1′-biphenyl]-4-yl)-2,2′,3,3′-tetrahydro-1,1′-spirobi[1H-indene] | AG000OTS | 0.5g |
| 1258298-41-7 | NC(=O)[C@H]1C[C@H]1F | cis-2-Fluorocyclopropanecarboxamide | AG000OTW | 1g |
| 1258595-00-4 | O=C(OCC)CCC1=CC=C(Cl)C(NC(OC(C)(C)C)=O)=C1 | Ethyl 3-(3-((tert-butoxycarbonyl)amino)-4-chlorophenyl)propanoate | AG000OU4 | 10g |
| 1258457-59-8 | NCC1=CC=C(C=C1)CN1C(=NC=2C(=NC=3C=CC=CC3C21)N)CCCC | 1-[[4-(Aminomethyl)phenyl]methyl]-2-butyl-1H-imidazo[4,5-c]quinolin-4-am | AG000OUD | 0.4g |
| 125849-96-9 | COC(=O)c1cc(Cl)nc(c1C)Cl | Methyl 2,6-dichloro-3-methylisonicotinate | AG000OUI | 5g |
| 1258612-04-2 | O=C(O)C1=NC=CC(C2=CC=C(Cl)C=C2)=C1 | 4-(4-Chlorophenyl)picolinic acid | AG000OVA | 2g |
| 1258652-24-2 | CC(C)(C)OC(=O)N1CC(N)(C1)C(F)(F)F | 3-AMINO-1-BOC-3-(TRIFLUOROMETHYL)AZETIDINE | AG000OVF | 1g |
| 1258651-83-0 | NC1CC1C2=CC(F)=CC=C2.Cl | 2-(3-FLuorophenyl)cyclopropan-1-amine hydrochloride | AG000OVG | 15g |
| 1258640-14-0 | Cl.Cl.COCC(C)N1CCNCC1 | 1-(1-Methoxypropan-2-yl)piperazine dihydrochloride | AG000OVL | 0.5g |
| 1197193-17-1 | CS(C1=CC(N2CCCC2)=C(C(O)=O)C=C1)(=O)=O | 4-(Methylsulfonyl)-2-pyrrolidinobenzoic Acid | AG000PIY | 5g |
| 1197193-16-0 | CN1CCN(CC1)C1=CC(C=O)=CC=C1F | 4-Fluoro-3-(4-methyl-1-piperazinyl)benzaldehyde | AG000PIZ | 20g |
| 1197193-14-8 | OC(=O)C1=CC=C(C=C1F)N1CCCC1 | 2-Fluoro-4-pyrrolidinobenzoic Acid | AG000PJ0 | 3g |
| 1197193-13-7 | Fc1c(cc(cc1)C=O)N1CCOCC1 | Benzaldehyde, 4-fluoro-3-(4-morpholinyl)- | AG000PJ1 | 25g |
| 1197193-11-5 | CS(C1=CC(F)=C(C=O)C=C1)(=O)=O | 2-fluoro-4-(methylsulfonyl)benzaldehyde | AG000PJ3 | 5g |
| 1197193-10-4 | CN1CCN(CC1)C1=C(C=CC(=C1)S(C)(=O)=O)C(O)=O | 2-(4-Methyl-1-piperazinyl)-4-(Methylsulfonyl)benzoic Acid | AG000PJ4 | 25g |
| 1197193-08-0 | CS(=O)(=O)C1=C(C=CC(=C1)N1CCNCC1)[N+]([O-])=O | N-(3-Methylsulphonyl-4-nitrophenyl)piperazine | AG000PJ6 | 25g |
| 1197193-05-7 | CN1CCN(CC1)C1=CC(=CC=C1S(C)(=O)=O)C(O)=O | 3-(4-Methyl-1-piperazinyl)-4-(methylsulfonyl)benzoic acid | AG000PJ8 | 20g |
| 1197193-04-6 | O=C(O)C1=CC=C(N2CCNCC2)C(F)=C1 | 3-Fluoro-4-piperazinobenzoic acid | AG000PJ9 | 1g |
| 1197181-29-5 | O=[N+](C1=CC(Cl)=CC2=C1NC=C2)[O-] | 5-CHLORO-7-NITRO-1H-INDOLE | AG000PJA | 50g |
| 1197231-94-9 | CC(C1=CC=C(Br)C=C1C(F)(F)F)=O | 1-[4-Bromo-2-(trifluoromethyl)phenyl]ethan-1-one | AG000PJD | 35g |
| 1197231-86-9 | O=C(OC)CC(N)C1=NC=CC=C1.[H]Cl.[H]Cl | 3-Amino-3-pyridin-2-yl-propionic acid methyl ester dihydrochloride | AG000PJE | 0.25g |
| 1197230-88-8 | O=CC1=CNN=C1.[H]Cl | 1H-Pyrazole-4-carboxaldehyde hydrochloride | AG000PJF | 125g |
| 1197230-21-9 | NC1=CN(CC)N=C1C.[H]Cl | 1-Ethyl-3-methyl-1h-pyrazol-4-ylamine HCl | AG000PJG | 0.5g |
| 1197193-46-6 | NC1=NNC2=C1C=C([N+]([O-])=O)C=C2Cl | 3-Amino-7-chloro-5-nitro-1H-indazole | AG000PJP | 3g |
| 1197193-45-5 | CS(=O)(=O)c1ccc(cc1Cl)C(=O)O | 3-Chloro-4-(methylsulfonyl)benzoic Acid | AG000PJQ | 0.9g |
| 1197193-44-4 | CN1CCN(CC1)C1=C(C=CC(Cl)=C1)C(O)=O | 4-Chloro-2-(4-methylpiperazin-1-yl)benzoic acid | AG000PJR | 40g |
| 1197193-42-2 | CN1CCN(CC1)C1=CC=C(C=O)C(F)=C1 | 2-Fluoro-4-(4-methylpiperazin-1-yl)benzaldehyde | AG000PJS | 100g |
| 1197193-39-7 | OC(=O)C1=CC(F)=CC=C1N1CCNCC1 | 5-Fluoro-2-piperazinobenzoic acid | AG000PJU | 10g |
| 125721-49-5 | OC(=O)Cc1cccc(c1)OCc1ccc(cc1)F | 2-(3-((4-Fluorobenzyl)oxy)phenyl)acetic acid | AG000OJJ | 10g |
| 18776-12-0 | ClCCC(O)C1=CC=CC=C1 | 3-Chloro-1-phenyl-1-propanol | AG000OJR | 1500g |
| 1257301-28-2 | C(N)(=O)C1(C)CCNCC1.Cl | 4-Methylpiperidine-4-carboxamide hydrochloride | AG000OJT | 25g |
| 1257296-40-4 | O=C(N1N=C(Br)C2=C1C=CC=C2)OC(C)(C)C | tert-Butyl 3-bromoindazole-1-carboxylate | AG000OJV | 100g |
| 1257294-43-1 | CC1=NC=C(Br)C2=C1NC=C2 | 4-bromo-7-methyl-1H-Pyrrolo[2，3-c]pyridine | AG000OJX | 30g |
| 1257294-05-5 | O=C1N(C2CNC2)CCC1 | 1-(Azetidin-3-yl)pyrrolidin-2-one | AG000OK1 | 1g |
| 1257293-88-1 | CC(C)(C)OC(=O)N1CCN(CC1)C1COC1 | tert-Butyl 4-(oxetan-3-yl)piperazine-1-carboxylate | AG000OK6 | 2g |
| 1257293-79-0 | O=C(N1CC(C(C)(O)C)C1)OC(C)(C)C | tert-Butyl 3-(1-hydroxy-1-methyl-ethyl)azetidine-1-carboxylate | AG000OKA | 25g |
| 1257293-73-4 | CC(C)(C)OC(=O)N1CC(N2CC[C@H](O)C2)C1 | (S)-tert-Butyl 3-(3-hydroxypyrrolidin-1-yl)azetidine-1-carboxylate | AG000OKB | 1g |
| 125735-40-2 | IC1CN(C(C2=CC=CC=C2)C3=CC=CC=C3)C1 | 1-Benzhydryl-3-iodoazetidine | AG000OL1 | 40g |
| 125733-43-9 | FC(C(C1=CC(Cl)=C(Cl)C=C1)=O)(F)F | 1-(3,4-dichlorophenyl)-2,2,2-trifluoroethan-1-one | AG000OL4 | 110g |
| 125732-13-0 | CCOC(=O)CC(=O)c1c(OC)cccc1OC | Benzenepropanoic acid, 2,6-dimethoxy-β-oxo-, ethyl ester | AG000OL5 | 5g |
| 1257442-93-5 | Cl.OC[C@H]1C[C@@H]2N[C@@H](CC2)C1 | Endo-8-azabicyclo[3.2.1]octane-3-methanol hydrochloride | AG000OL7 | 5g |
| 1196-57-2 | OC1=NC2=C(C=CC=C2)N=C1 | Quinoxaline-2-one | AG000P9F | 3000g |
| 1196-43-6 | O=C(N1)[N-]C2=C(NC=N2)C1=O.[Na+] | Xanthine sodium salt | AG000P9J | 10g |
| 1196145-38-6 | O=C(O)CC1=NC=C(F)C=N1 | (5-Fluoropyrimidin-2-yl)acetic acid | AG000P9N | 0.1g |
| 1196145-13-7 | O=CC1=C(O)C=NC(Br)=C1 | 2-Bromo-5-hydroxyisonicotinaldehyde | AG000P9O | 4g |
| 1196145-11-5 | CC(OC(N1CC(F)(F)C(C(O)=O)C1)=O)(C)C | 1-(tert-Butoxycarbonyl)-4,4-difluoropyrrolidine-3-carboxylic acid | AG000P9P | 1g |
| 1196145-07-9 | CC(OC(NCC(C(O)=O)(F)F)=O)(C)C | 3-(tert-Butoxycarbonylamino)-2,2-difluoropropanoic acid | AG000P9Q | 50g |
| 1196145-01-3 | O=C(N1CC(N)C(CC1)=O)OCC2=CC=CC=C2.[H]Cl | Benzyl 3-amino-4-oxopiperidine-1-carboxylate hydrochloride | AG000P9R | 2g |
| 1196107-75-1 | CC1(C)c2cc(Br)ccc2-c2cc3c(-c4ccc5ccccc5c4)c4ccccc4c(-c4ccc5ccccc5c4)c3cc12 | 2-[9-Bromo-7,7-dimethyl-13-(naphthalen-2-yl)indeno[1,2-b]anthracen-5-yl]n | AG000P9S | 5g |
| 1196107-73-9 | O=C1C2=C(C=CC=C2)C(C3=CC(C(C)(C)C4=C5C=CC(Br)=C4)=C5C=C13)=O | 2-Bromo-13,13-dimethyl-6H-indeno[1,2-b]anthracene-6,11(13H)-dione | AG000P9T | 400g |
| 1196053-06-1 | CC(C)(C)OC(=O)N[C@@H]1C[C@H]1c1ccc(O)cc1 | tert-Butyl N-[(1R,2S)-rel-2-(4-hydroxyphenyl)cyclopropyl]carbamate | AG000P9X | 1g |
| 1196051-71-4 | Brc1ccc(c(c1C(F)(F)F)C)N | Benzenamine, 4-bromo-2-methyl-3-(trifluoromethyl)- | AG000P9Z | 5g |
| 1196049-17-8 | Cl.COC(C1=CC=C([C@H](CO)N)C=C1)=O | Methyl 4-((1r)-1-amino-2-hydroxyethyl)benzoate hcl | AG000PA0 | 0.25g |
| 1196048-19-7 | CCOC(=O)C1=CC=C(C2=C1NC=C2)F | Ethyl 4-fluoro-1H-indole-7-carboxylate | AG000PA1 | 15g |
| 1196047-26-3 | O=C(C1=CN=CC2=C1NC=C2)OC | Methyl 1H-pyrrolo[3,2-c]pyridine-7-carboxylate | AG000PA2 | 5g |
| 1196151-72-0 | O=C(C1=CC2=C(Cl)C=CN=C2N1)OCC | Ethyl 4-chloro-1H-pyrrolo[2,3-b]pyridine-2-carboxylate | AG000PAC | 10g |
| 1196151-62-8 | N#CC1=CNC2=C1N=CC=C2 | 1H-Pyrrolo[3,2-b]pyridine-3-carbonitrile | AG000PAF | 40g |
| 1196151-58-2 | O=C(C1(NC(OC(C)(C)C)=O)CCC(F)(F)CC1)O | 1-((tert-butoxycarbonyl)amino)-4,4-difluorocyclohexanecarboxylic acid | AG000PAH | 10g |
| 1196156-42-9 | O=C(C1=CN=C(NN=C2)C2=C1)OC | Methyl 1H-Pyrazolo[3,4-B]Pyridine-5-Carboxylate | AG000PCT | 25g |
| 1196156-17-8 | C#CC1=CC(Br)=NC=C1 | 2-Bromo-4-ethynylpyridine | AG000PCU | 2g |
| 1196156-15-6 | O=C(N1CCC2=CN=C(Cl)N=C2C1)OC(C)(C)C | 7-Boc-2-chloro-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine | AG000PCV | 10g |
| 1196156-05-4 | OC1=NC=C(C=C1)C#C | 5-Ethynylpyridin-2-ol | AG000PCX | 7g |
| 1196155-89-1 | ClC1=NC=C2NCCC2=C1 | 5-Chloro-2,3-dihydro-1H-pyrrolo[2,3-c]pyridine | AG000PD0 | 1g |
| 1196157-51-3 | O=C(O)C1=C(N)N=C(Br)C=C1 | 2-Amino-6-bromonicotinic acid | AG000PD4 | 25g |
| 1196157-47-7 | OC1=C(Cl)C=C(Cl)N=C1 | 4,6-dichloropyridin-3-ol | AG000PD6 | 50g |
| 1196157-42-2 | ClC1=NC(Cl)=C2NN=CC2=N1 | 5,7-Dichloro-1H-pyrazolo[4,3-d]pyrimidine | AG000PD7 | 0.1g |
| 1196157-41-1 | OCC1=CC(C(F)(F)F)=NC(Cl)=C1 | (2-Chloro-6-(trifluoromethyl)pyridin-4-yl)methanol | AG000PD8 | 4g |
| 1196157-40-0 | FC1(OC2=C(O1)C=CC(=C2)C2(CC2)N)F | 1-(2,2-Difluorobenzo[D][1,3]Dioxol-5-Yl)Cyclopropanamine | AG000PD9 | 10g |
| 1196157-27-3 | CC1=CC2=C(N1)C(Cl)=NC(Cl)=N2 | 2,4-dichloro-6-Methyl-5H-pyrrolo[3,2-d]pyriMidine | AG000PDC | 25g |
| 1196157-14-8 | O=CC1=NC=C(C)C(Br)=C1 | 4-Bromo-5-methylpicolinaldehyde | AG000PDE | 10g |
| 119623-66-4 | C(N1CCCC1)CO.N(C1C(Cl)=CC=CC=1Cl)C1C=CC=CC=1CC(=O)O | Diclofenac Epolamine | AG000PDN | 0.2g |
| 119644-22-3 | OC[C@H]1O[C@H](C[C@@H]1F)N2C=C(Cl)C(=O)NC2=O | Raluridine | AG000PDV | 0.005g |
| 119642-82-9 | C=C[C@]1(C)C=C2CC[C@H]3[C@@]([C@@H]2C[C@@H]1O)(C)CC(=O)[C@H](C3 | Yucalexin P-17 | AG000PE3 | 0.005g |
| 119637-67-1 | O=C(OCC)CC(N1C(COC2=CC=CC=C2OC)SCC1)=O | ethyl 3-[2-(2-methoxyphenoxymethyl)-1,3-thiazolidin-3-yl]-3-oxopropanoate | AG000PE9 | 5g |
| 119630-94-3 | O[C@@]1(CC2)[C@@]([C@](O3)([H])C2=NNC(C4=CC=CC=C4)=O)(CC5)C(C3=C6 | Naloxone benzoylhydrazone | AG000PEF | 0.001g |
| 1196474-68-6 | O=C(OCC)C1=CC=C(OC2=CC=C(C=O)C(Br)=C2)C=C1 | Ethyl 4-(3-bromo-4-formylphenoxy)benzoate | AG000PEJ | 3g |
| 1196473-37-6 | OB1OCC2=CC=C(O)C=C12 | Benzo[c][1,2]oxaborole-1,6(3H)-diol | AG000PEM | 1g |
| 1197-58-6 | [N+](#[C-])CC1=CC=C(C=C1)OC | 1-(Isocyanomethyl)-4-methoxybenzene | AG000PHP | 5g |
| 1197-55-3 | C1=CC(=CC=C1N)CC(O)=O | 4-Aminophenylacetic acid | AG000PHQ | 3000g |
| 1197-54-2 | NC1CCC(CC(O)=O)CC1 | 2-(4-Aminocyclohexyl)acetic acid | AG000PHR | 6g |
| 1197-51-9 | C#CCNCc1ccccc1 | 3-(Benzylamino)-1-propyne | AG000PHT | 50g |
| 1197-40-6 | C1(CC2=CC=CO2)=CC=CO1 | Di(furan-2-yl)methane | AG000PHW | 5g |
| 1197171-76-8 | O=C(NC)C1=CC=CC(B2OC(C)(C)C(C)(C)O2)=C1 | 3-(N-Methylaminocarbonyl)phenylboronic acid, pinacol ester | AG000PHX | 100g |
| 1197160-78-3 | O=C(NC1=CC=C(C2=NC(N3CCOCC3)=NC(N4CCOCC4)=N2)C=C1)NC5=CC=C(C(N6C | PKI-587 | AG000PHY | 5g |
| 1197159-91-3 | Nc1ccc(cc1)-c1nc(nc(n1)N1CCOCC1)N1CCOCC1 | 4-(4,6-Dimorpholino-1,3,5-triazin-2-yl)aniline | AG000PHZ | 15g |
| 119715-66-1 | O=C(OC)C1=NC(C2=CC=CC=C2)=CC(C)=C1 | Methyl 4-methyl-6-phenylpicolinate | AG000PI6 | 1.15g |
| 1197193-34-2 | CS(=O)(=O)C1=CC=C(C(O)=O)C(=C1)N1CCOCC1 | 4-(Methylsulfonyl)-2-morpholinobenzoic acid | AG000PIM | 25g |
| 1197193-33-1 | O=C(O)C1=CC=C(C(Cl)=C1)N2CCN(C)CC2 | 3-Chloro-4-(4-methyl-1-piperazinyl)benzoic acid | AG000PIN | 2g |
| 1197193-31-9 | O=CC1=CC=C(F)C(N2CCCC2)=C1 | 4-Fluoro-3-pyrrolidinobenzaldehyde | AG000PIO | 50g |
| 1197193-30-8 | BrC1=CN=C(N=C1)C(=O)OCC | Ethyl 5-bromopyrimidine-2-carboxylate | AG000PIP | 150g |
| 1197193-29-5 | O=CC1=CC=C(N2CCOCC2)C=C1S(=O)(C)=O | 2-(Methylsulfonyl)-4-morpholinobenzaldehyde | AG000PIQ | 25g |
| 1197193-24-0 | NC1=NNC2=C1C(F)=CC(F)=C2 | 4,6-Difluoro-1H-indazol-3-amine | AG000PIS | 0.5g |
| 1197193-21-7 | NC1=CC=C(F)C=C1S(=O)(C)=O | 4-Fluoro-2-(methylsulfonyl)aniline | AG000PIV | 50g |
| 1197193-19-3 | CS(=O)(=O)C1=CC=C(C=C1N1CCOCC1)C(O)=O | 4-(Methylsulfonyl)-3-morpholinobenzoic acid | AG000PIX | 15g |
| 1198-40-9 | NC1=CC=NC2=CC(Cl)=CC=C12 | 4-Amino-7-chloroquinoline | AG000PNW | 10g |
| 1198-37-4 | CC1=CC(C)=NC2=CC=CC=C12 | 2,4-Dimethylquinoline | AG000PNY | 50g |
| 1198-30-7 | C(#N)c1c2c(ccn1)cccc2 | Isoquinoline-1-carbonitrile | AG000PO1 | 300g |
| 1198-27-2 | Cl.Nc1c(O)ccc2ccccc12 | 1-Amino-2-naphthol, HCl | AG000PO2 | 125g |
| 1198-14-7 | OC1=C2N=CC=CC2=C(Br)C=C1 | 5-Bromoquinolin-8-ol | AG000PO3 | 20g |
| 1198095-99-6 | O=C(C1=CNC2=NC=C(C)C=C21)O | 5-Methyl-1h-pyrrolo[2,3-b]pyridine-3-carboxylic acid | AG000PO7 | 3g |
| 1198080-04-4 | C#CCOCCOCCOCCOCCOCCOCCN | 3,6,9,12,15,18-Hexaoxaheneicos-20-yn-1-amine | AG000PO9 | 30g |
| 119807-84-0 | O=C(O)C[C@@H](CC1=CC=CC=C1)C(OC)=O | (R)-3-Benzyl-4-methoxy-4-oxobutanoic acid | AG000POA | 2g |
| 1198-98-7 | CC1=NC(=NO1)C1=CC=CC=C1 | 5-Methyl-3-phenyl-1,2,4-oxadiazole | AG000POI | 3g |
| 1198-97-6 | C2=C(C1CC(=O)NC1)C=CC=C2 | 4-Phenyl-2-pyrrolidone | AG000POJ | 1500g |
| 1198-96-5 | CC1(C)CCC2=CC=CC=C2O1 | 2,2-Dimethylchroman | AG000POK | 1.002g |
| 1198-84-1 | O=C(O)C(O)C1=CC=C(O)C=C1 | 2-Hydroxy-2-(4-hydroxyphenyl)acetic acid | AG000POM | 100g |
| 1198-77-2 | [Na].O=c1c2c([nH]c(=O)[nH]2)[nH]c(=O)[nH]1 | 1H-Purine-2,6,8(3H)-trione, 7,9-dihydro-, sodium salt (1:1) | AG000PON | 100g |
| 1198-71-6 | CN1C(=CC(=C1Br)Br)C(=O)OC | Methyl 4,5-Dibromo-1-methylpyrrole-2-carboxylate | AG000POO | 10g |
| 1198-66-9 | CC(=O)C1=C(O)C(C)=CC(C)=C1 | 3′,5′-Dimethyl-2′-hydroxyacetophenone | AG000POQ | 200g |
| 1198-64-7 | Nc1c(F)c(F)c(N)c(F)c1F | 2,3,5,6-Tetrafluoro-1,4-phenylenediamine | AG000POR | 35g |
| 1198-62-5 | Fc1c(Cl)c(F)c(c(c1F)Cl)F | 1,4-Dichloro-2,3,5,6-Tetrafluoro-Benzene | AG000POT | 25g |
| 1198166-01-6 | O=CC1=NC=C(OC(C)C)C=C1 | 5-Isopropoxypicolinaldehyde | AG000POU | 3g |
| 1196151-53-7 | O=C(C1=NC(Br)=CN=C1)O | 6-broMopyrazine-2-carboxylic acid | AG000PAI | 125g |
| 1196151-51-5 | O=C(C1=NC=C(F)C=N1)O | 5-Fluoropyrimidine-2-carboxylic acid | AG000PAJ | 5g |
| 1196151-36-6 | O=Cc1cnc(C(F)(F)F)cn1 | 5-(Trifluoromethyl)pyrazine-2-carbaldehyde | AG000PAK | 5g |
| 1196147-56-4 | O=C(O)C1=NC(OC)=CC=C1Br | 3-Bromo-6-methoxypicolinic acid | AG000PAM | 7.65g |
| 1196146-98-1 | COC1=C(O)C=CC(Cl)=N1 | 6-Chloro-2-methoxypyridin-3-ol | AG000PAO | 3g |
| 1196146-82-3 | OC1=CC(Cl)=NC=C1Br | 5-Bromo-2-Chloropyridin-4-Ol | AG000PAR | 50g |
| 1196146-35-6 | O=C(OCC)C1=CN=C(C(F)(F)F)C=C1Cl | Ethyl 4-chloro-6-(trifluoromethyl)nicotinate | AG000PAV | 15g |
| 1196145-66-0 | OC1=CC(Br)=NC=C1Cl | 2-Bromo-5-chloro-4-hydroxypyridine | AG000PAY | 8g |
| 3034-22-8 | NC1SC(Br)=CN=1 | 5-Bromo-thiazol-2-ylamine trifluoroacetate | AG000PAZ | 1646.3g |
| 1196153-86-2 | NC1=C(Cl)C=C(C(F)(F)F)N=C1 | 4-Chloro-6-(trifluoromethyl)pyridin-3-amine | AG000PB1 | 10g |
| 1196153-82-8 | OC1=CC(C(F)(F)F)=NC=C1N | 5-Amino-2-(trifluoromethyl)pyridin-4-ol | AG000PB2 | 0.5g |
| 1196153-79-3 | Cl.N=1(NC=C(C=1)CN) | (1H-Pyrazol-4-yl)methanamine hydrochloride | AG000PB3 | 2g |
| 1196153-48-6 | O=C(OCC)C1=C(C(F)(F)F)N=CC(Br)=C1 | Ethyl 5-bromo-2-(trifluoromethyl)nicotinate | AG000PB6 | 3g |
| 1196153-33-9 | ClC1=CN=C(C=C1)C#C | 5-Chloro-2-ethynylpyridine | AG000PB7 | 200g |
| 1196153-31-7 | CCC1N(Cc2c1[nH]nc2N)C(=O)OC(C)(C)C | Pyrrolo[3,4-c]pyrazole-5(1H)-carboxylic acid, 3-amino-6-ethyl-4,6-dihydro-, 1, | AG000PB9 | 25g |
| 1197943-49-9 | CCOC(=O)c1cc(O)c2c(cnn2C2CCCCO2)c1 | ETHYL 7-HYDROXY-1-TETRAHYDROPYRAN-2-YL-INDAZOLE-5-CARBOXYLATE | AG000PMX | 1g |
| 1197943-43-3 | O1C(CCCC1)N1N=CC(=C1)C=O | 1-(Tetrahydro-2H-pyran-2-yl)-1H-pyrazole-4-carboxaldehyde | AG000PMY | 2g |
| 1197922-04-5 | [Br-].OC(C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)(C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)C1 | (11bS)-2，6-Bis[bis[3，5-bis(trifluoromethyl)phenyl]hydroxymethyl]-3，5- | AG000PN0 | 0.05g |
| 119793-66-7 | CCC(O[C@H](CC(O)=O)C[N+](C)(C)C)=O.[Cl-] | (2R)-3-carboxy-N,N,N-trimethyl-2-(1-oxopropoxy)-1-propanaminium chlorid | AG000PN7 | 1500g |
| 119779-12-3 | FC1=C(CCCl)C=CC=C1 | 1-(2-Chloroethyl)-2-fluorobenzene | AG000PNC | 25g |
| 119778-64-2 | O=C(C1=CC(C2CC2)=NC3=CC=CC=C13)O | 2-Cyclopropyl-quinoline-4-carboxylic acid | AG000PNF | 8g |
| 1197996-80-7 | CC(NCCN1C2=C(C3=C1C=CC(C(C)=O)=C3)C=C(C(C)=O)C=C2)C | Cbl-0137 | AG000PNG | 0.95g |
| 1197958-12-5 | CP(C)(C1=CC=CC=C1NC2=NC(NC3=CC=C(N4CCC(N(C)C)CC4)C=C3OC)=NC=C2Cl)= | AP26113 | AG000PNH | 3g |
| 1197957-18-8 | CC1=CN=C(Cl)C=C1I | 2-Chloro-4-iodo-5-methylpyridine | AG000PNI | 200g |
| 1197953-49-3 | CP(C)(C1=CC=CC=C1NC2=NC(Cl)=NC=C2Cl)=O | 2,5-dichloro-N-(2-(diMethylphosphoryl)phenyl)pyriMidin-4-aMine | AG000PNK | 15g |
| 1197953-47-1 | CP(C)(=O)C1=C(N)C=CC=C1 | (2-Aminophenyl)dimethylphosphine oxide | AG000PNL | 200g |
| 119798-44-6 | CC/C=CC/C=CC/C=CC/C=CCCCCC(=O)OCC | Ethyl (6Z,9Z,12Z,15Z)-6,9,12,15-octadecatetraenoate | AG000PNN | 0.6g |
| 119798-08-2 | O=C(O)[C@@H](N(C(OC(C)(C)C)=O)CCCNC(OC(C)(C)C)=O)CCCN(C(OC(C)(C)C)= | (S)-2,5-Bis((tert-Butoxycarbonyl)(3-((tert-butoxycarbonyl)amino)propyl)ami | AG000PNO | 5g |
| 1198-55-6 | OC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1O | 3,4,5,6-Tetrachlorobenzene-1,2-diol | AG000PNQ | 125g |
| 1198-47-6 | CSC1=C2NC=NC2=NC(N)=N1 | 6-(Methylthio)-7H-purin-2-amine | AG000PNT | 3g |
| 1198-46-5 | COC1=C2NC=NC2=NC(Cl)=N1 | 2-chloro-6-methoxypurine | AG000PNU | 4g |
| 1198-44-3 | O=C(C1CSCCC1=O)OCC | Ethyl 4-oxo-tetrahydro-3-thiopyrancarboxylate | AG000PNV | 7.9g |
| 119-94-8 | CCN(Cc1ccccc1)c1cccc(C)c1 | N-Benzyl-N-ethyl-4-methylaniline | AG000P0S | 10g |
| 119-91-5 | c1(nc2c(cc1)cccc2)c1nc2c(cc1)cccc2 | 2,2′-Biquinoline | AG000P0U | 600g |
| 1190044-27-9 | Cl.CS(N1CC(N)CC1)(=O)=O | 1-Methanesulfonylpyrrolidin-3-amine hydrochloride | AG000P0V | 5g |
| 119006-77-8 | FC1=CC=C(C(N2C=CN=C2)(C3=CC=CC=C3F)C4=CC=CC=C4)C=C1 | Flutrimazole | AG000P11 | 0.5g |
| 119004-72-7 | C1(C(OC)=O)C2CCC(CC=2SC=1N)C1C=CC=CC=1 | methyl 2-amino-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylat | AG000P19 | 40g |
| 119001-43-3 | C(=O)C1=CC=C(C=C1)N(C1=CC=C(C=C1)C=O)C1=CC=C(C=C1)C=O | Tris(4-formylphenyl)amine | AG000P1D | 50g |
| 1190-93-8 | O=C(O)CSC(C)=O | S-ACETYLTHIOACETIC ACID | AG000P1E | 200g |
| 1190-92-7 | O=[N+](C=CN(C)C)[O-] | 1-Dimethylamino-2-nitroethylene | AG000P1F | 978.5g |
| 1190-91-6 | CN(C=CC(C)=O)C | 4-(Dimethylamino)but-3-en-2-one | AG000P1G | 10g |
| 1190129-83-9 | CC1(C)C(C)(C)OB(C2=CC(OC)=CC=C2F)O1 | 2-(2-Fluoro-5-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane | AG000P1L | 25g |
| 1190129-77-1 | CC1(C)OB(OC1(C)C)C1=C(F)C=CC(Cl)=C1 | 5-Chloro-2-fluorophenylboronic acid, pinacol ester | AG000P1M | 50g |
| 1190095-10-3 | O=C(N1CCN(CC2=CC=C(B(O)O)C=C2)CC1)OC(C)(C)C | 4-(4-t-BOC-Piperazinomethyl)phenylboronic acid | AG000P1P | 10g |
| 1190095-06-7 | F[B-](F)(F)C1=CC=C(CN2CCOCC2)C=C1.[K+] | Potassium 4-((morpholino)methyl) phenyltrifluoroborate | AG000P1Q | 5g |
| 1190070-91-7 | Oc1ccc(cc1)[C@H]1Oc2c(C[C@H]1O)c(O)cc1c2[C@]2(C(=O)O1)[C@H](Oc1c2c(O) | Abiesinol F | AG000P1R | 0.005g |
| 1197193-38-6 | Nc1ccc(cc1)c1ccncc1.Cl.Cl | 4-(4-Pyridyl)aniline DiHCl | AG000PJV | 7g |
| 1197193-37-5 | CN1CCN(CC1)C1=C(C=O)C=CC(=C1)S(C)(=O)=O | 2-(4-Methyl-1-piperazinyl)-4-(methylsulfonyl)benzaldehyde | AG000PJW | 2g |
| 1197300-24-5 | O=C(C1=C(C)ON=C1C2=CC=CC=C2Cl)N(C3=CC=C(Cl)C=C3)C | 3-(2-Chlorophenyl)-N-(4-chlorophenyl)-N,5-dimethyl-1,2-oxazole-4-carboxa | AG000PK2 | 0.5g |
| 1197294-80-6 | O=C(N1CCN(C2=NC=CC(Br)=C2)CC1)OC(C)(C)C | Tert-butyl 4-(4-bromopyridin-2-YL)piperazine-1-carboxylate | AG000PK3 | 75g |
| 1197239-47-6 | OC1=CC(OC(F)(F)F)=CC(Br)=C1 | 3-Bromo-5-(trifluoromethoxy)phenol | AG000PK5 | 10g |
| 1197239-37-4 | O=C(OC(C)(C)C)NC1CC(N)CC1.[H]Cl | tert-Butyl (3-aminocyclopentyl)carbamate hydrochloride | AG000PK7 | 75g |
| 1197239-04-5 | CNC1=CC(Cl)=CC(Cl)=C1.[H]Cl | N-Methyl 3,5-dichloroaniline, HCl | AG000PK8 | 25g |
| 1197237-95-8 | FC(C1=CN=CC(Br)=N1)(F)F | 2-Bromo-6-trifluoromethylpyrazine | AG000PKB | 5g |
| 1197237-46-9 | CC(C1=NC(Cl)=CN=C1)=O | 1-(6-Chloropyrazin-2-yl)ethanone | AG000PKD | 0.5g |
| 119736-16-2 | O=C(C1=C(OCC2=CC=CC=C2)C(C=CO1)=O)O | 3-(benzyloxy)-4-oxo-4H-pyran-2-carboxylic acid | AG000PKF | 2000g |
| 119730-06-2 | O=C(C1=CC=C(/C2=C3C=CC(/C(C4=CC=CC=C4)=C5C=C/C(N/5)=C(C6=CC=CC=C6)/ | 5-(4-Methoxycarbonylphenyl)-10,15,20-triphenylporphyrin | AG000PKK | 2g |
| 119725-20-1 | C(O)(=O)[C@]12[C@](C=3[C@@](C)(CC1)[C@@]4(C)[C@](CC3)([C@]5(C)[C@@ | 2,19-Dihydroxy-3-oxoursa-1,12-dien-28-oic acid | AG000PKN | 0.005g |
| 119725-19-8 | O[C@H]1C[C@@]2(C)[C@H](C([C@H]1O)(C)C)CC[C@@]1([C@@H]2CC=C2[C@ | 2-Epitormentic acid | AG000PKO | 0.005g |
| 1197398-99-4 | N(C(=O)OC(C)(C)C)C1CC(CC1)N | Carbamic acid, N-(3-aminocyclopentyl)-, 1,1-dimethylethyl ester | AG000PKQ | 25g |
| 1197391-19-7 | Oc1c(Br)c2ccccc2nc1-c1ccccc1 | 4-Bromo-2-phenylquinolin-3-ol | AG000PKS | 0.2g |
| 1197377-47-1 | N#CC1=CC=C(C2=CN=C(N)N=N2)C=C1F | 4-(3-Amino-1,2,4-triazin-6-yl)-2-fluorobenzonitrile | AG000PKT | 10g |
| 1197376-85-4 | Cl.Cl.CNC(=O)c1ccc(cc1F)-c1cnc2ncc(Cc3ccc4ncccc4c3)n2n1 | Capmatinib 2HCl | AG000PKV | 20g |
| 119650-44-1 | OCC1=CC(C)=CC(OC)=C1 | (3-Methoxy-5-methylphenyl)methanol | AG000PER | 5g |
| 119647-69-7 | O=C(C1=CC(C(C)=O)=CN1)OCC | Ethyl 4-acetyl-1H-pyrrole-2-carboxylate | AG000PF0 | 2g |
| 119646-68-3 | [Br]C1(=C(O)C(=CC(=C1)C(C)(C)C)C=O) | 3-Bromo-5-(tert-butyl)-2-hydroxybenzaldehyde | AG000PF2 | 3g |
| 119645-65-7 | O=C(OCC1(=CC=CC=C1))NC(C(=O)NC(C(=O)O)CC=3(C2(=C(C=CC=C2)NC=3)))C | Z-Ala-Trp-OH | AG000PF5 | 45g |
| 1196732-52-1 | C#CCOCCOCCOCCOCCOCCOCCOCCOCCN | 3,6,9,12,15,18,21,24-Octaoxaheptacos-26-yn-1-amine | AG000PF6 | 13g |
| 1196702-79-0 | Cl.NCC1=CC(=C(N)C=C1)C(F)(F)F | 4-(Aminomethyl)-2-(trifluoromethyl)aniline hydrochloride | AG000PF9 | 10g |
| 1196507-66-0 | FC1=CN=C(NC=C2)C2=C1F | 4,5-Difluoro-1H-pyrrolo[2,3-b]pyridine | AG000PFB | 3g |
| 1196507-58-0 | FC(C1=CN=C(NC=C2)C2=C1Cl)(F)F | 4-Chloro-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine | AG000PFC | 3g |
| 1196507-57-9 | FC(F)(F)C1=CN=C2N(C=CC2=C1Cl)S(=O)(=O)C1=CC=CC=C1 | 4-Chloro-1-(phenylsulfonyl)-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine | AG000PFD | 0.3g |
| 119677-21-3 | C(=O)(O)[C@H]1[C@H](O)CCN1 | trans-3-Hydroxy-D-proline | AG000PFG | 10g |
| 119671-47-5 | ClC1=CC(=O)C=C(O1)N2CCOCC2 | 2-Chloro-6-Morpholinopyran-4-One | AG000PFL | 5g |
| 119670-11-0 | O=C(NC[C@H]1N(CC)CCC1)C2=C(O)C(Cl)=CC(Cl)=C2O | Desmethylraclopride | AG000PFN | 15g |
| 119660-45-6 | C(C)(C)(C)OC(=O)N[C@H](C(=O)O)CC1=C(C=CC=C1)O | (S)-2-((tert-Butoxycarbonyl)amino)-3-(2-hydroxyphenyl)propanoic acid | AG000PFS | 3g |
| 105365-76-2 | N1=CN=C2C(O)CCC2=C1NC1C=CC(C#N)=CC=1 | 4-(4-Cyanoanilino)-5,6-dihydro-7-hydroxy-7H-cyclopenta[d]pyrimidine | AG000PFU | 0.001g |
| 119692-59-0 | C=CC(OCCCCOCC1CO1)=O | 4-(Oxiran-2-ylmethoxy)butyl acrylate | AG000PGD | 600g |
| 1196154-55-8 | CC(OC(N1CC2=C(C=C(C=C2)CN)CC1)=O)(C)C | tert-Butyl 6-(aminomethyl)-3,4-dihydroisoquinoline-2(1h)-carboxylate | AG000PC3 | 1g |
| 1196154-43-4 | O=C(C1=CC(Cl)=NC(C(F)(F)F)=C1)OCC | Ethyl 2-chloro-6-(trifluoromethyl)isonicotinate | AG000PC4 | 1.5g |
| 1196154-13-8 | O=C(C1=NC(Br)=CN2C1=NC=C2)O | 6-Bromoimidazo[1,2-a]pyrazine-8-carboxylic acid | AG000PC8 | 9g |
| 1196154-03-6 | O=C(O)C1=C(N)N=CC(F)=C1 | 2-Amino-5-fluoronicotinic acid | AG000PC9 | 4g |
| 1196154-02-5 | Clc1nccc2c1cc(cc2)C(F)(F)F | 1-Chloro-7-(trifluoromethyl)isoquinoline | AG000PCA | 3g |
| 1196154-00-3 | O=C1CC2=C(NN=C2)CC1 | 1,4,6,7-tetrahydro-5H-indazol-5-one | AG000PCB | 0.5g |
| 1196153-98-6 | OC1=CC(C(F)(F)F)=CN=C1Cl | 2-Chloro-5-(trifluoromethyl)pyridin-3-ol | AG000PCC | 50g |
| 1196153-96-4 | Oc1c(F)cnc(c1)Cl | 2-Chloro-5-fluoropyridin-4-ol | AG000PCD | 12.98g |
| 1196156-95-2 | C#CC1=NC=C(Cl)C=N1 | 5-Chloro-2-ethynylpyrimidine | AG000PCF | 5g |
| 1196156-84-9 | O=C(O)C1=C(N)N=C(OC)C=C1 | 2-Amino-6-methoxynicotinic acid | AG000PCH | 5g |
| 1196156-66-7 | C#CC1=C(C(=O)OC)N=CC=C1 | Methyl 3-ethynylpyridine-2-carboxylate | AG000PCL | 5g |
| 1196156-63-4 | NC1=NC=C(N=C1C=O)Br | 3-Amino-6-bromopyrazine-2-carbaldehyde | AG000PCN | 25g |
| 1196156-59-8 | Clc1cc(Br)nc(c1)Br | Pyridine, 2,6-dibromo-4-chloro- | AG000PCQ | 2500g |
| 1196156-45-2 | NCC1=CN=CO1.[H]Cl | Oxazol-5-yl-methylamine, HCl | AG000PCS | 10g |
| 1199782-93-8 | NC1CCCC2=C1C=C(Br)C=C2.[H]Cl | 7-Bromo-1,2,3,4-tetrahydronaphthalen-1-amine hydrochloride | AG000PYQ | 0.25g |
| 1199782-88-1 | NC1CCC2=C1C=C(F)C=C2F.[H]Cl | 4,6-Difluoro-2,3-dihydro-1h-inden-1-amine hydrochloride | AG000PYS | 4g |
| 119999-22-3 | CC1=CC2=C(C=C1Br)C(C)(C)CCC2(C)C | 6-Bromo-1,1,4,4,7-pentamethyl-1,2,3,4-tetrahydronaphthalene | AG000PZA | 184g |
| 119993-55-4 | O=C([C@H]1[C@@H](N)CCC1)OC.[H]Cl | (1R,2S);-rel-Methyl 2-aminocyclopentanecarboxylate hydrochloride | AG000PZD | 1g |
| 120-32-1 | OC1=CC=C(Cl)C=C1CC2=CC=CC=C2 | 2-Benzyl-4-chlorophenol | AG000PZY | 625g |
| 120-29-6 | CN1[C@H]2C[C@@H](C[C@@H]1CC2)O | 8-Azabicyclo[3.2.1]octan-3-ol, 8-methyl-, (3-endo)- | AG000PZZ | 1000g |
| 120-25-2 | O(CC)c1c(OC)cc(cc1)C=O | Benzaldehyde, 4-ethoxy-3-methoxy- | AG000Q01 | 200g |
| 120-23-0 | O=C(O)COC1=CC=C2C=CC=CC2=C1 | 2-Naphthoxyacetic Acid | AG000Q02 | 242.5g |
| 120-21-8 | O=CC1=CC=C(N(CC)CC)C=C1 | 4-(Diethylamino)benzaldehyde | AG000Q04 | 11000g |
| 120-20-7 | COC1=C(OC)C=C(CCN)C=C1 | 2-(3,4-dimethoxyphenyl)ethan-1-amine | AG000Q05 | 2000g |
| 120-18-3 | O=S(C1=CC=C2C=CC=CC2=C1)(O)=O | Naphthalene-2-sulfonic acid | AG000Q06 | 1030.8g |
| 120-15-0 | COC1=CC2=C(NCCC2)C=C1 | 6-Methoxy-1,2,3,4-tetrahydroquinoline | AG000Q07 | 200g |
| 120-14-9 | C1=C(C=C(C(=C1)OC)OC)C=O | 3,4-Dimethoxybenzaldehyde | AG000Q08 | 11500g |
| 120-13-8 | CCOC1=C(OC)C=C(CC(O)=O)C=C1 | 4-Ethoxy-3-methoxyphenylacetic acid | AG000Q09 | 10g |
| 120-11-6 | CC=CC1=CC=C(C(OC)=C1)OCC2=CC=CC=C2 | 1-Benzyloxy-2-methoxy-4-(1-propenyl)benzene | AG000Q0B | 150g |
| 120-05-8 | O=C1C2=CC=C(O)C=C2O/C1=CC3=CC(O)=C(C=C3)O | Sulfuretin | AG000Q0E | 1.25g |
| 120-03-6 | CC1=CC=C(C2=NC3=CC=CC=C3N2)C=C1 | 2-(p-Tolyl)-1H-benzo[d]imidazole | AG000Q0G | 50g |
| 120-00-3 | O=C(NC1=CC(OCC)=C(N)C=C1OCC)C2=CC=CC=C2 | 4′-Amino-2′,5′-diethoxybenzanilide | AG000Q0J | 225g |
| 120-66-1 | CC(=O)NC1=C(C)C=CC=C1 | N-(o-Tolyl)acetamide | AG000Q0L | 2500g |
| 120-61-6 | O=C(OC)C1=CC=C(C(OC)=O)C=C1 | Dimethyl terephthalate | AG000Q0O | 33500g |
| 120-53-6 | CCOc1ccc2[nH]c(=S)sc2c1 | 6-Ethoxy-2-mercaptobenzothiazole | AG000Q0R | 25g |
| 120-52-5 | O=C(ON=C1C=CC(C=C1)=NOC(=O)c1ccccc1)c1ccccc1 | [(1E,4E)-4-[(benzoyloxy)imino]cyclohexa-2,5-dien-1-ylidene]amino benzoate | AG000Q0S | 275g |
| 120-50-3 | O=C(OCC(C)C)C1=CC=CC=C1 | isobutyl benzoate | AG000Q0U | 9500g |
| 120-48-9 | [N+](=O)([O-])C1=CC=C(C(=O)OCCCC)C=C1 | Butyl 4-nitrobenzoate | AG000Q0V | 300g |
| 120-46-7 | O=C(C1=CC=CC=C1)CC(C2=CC=CC=C2)=O | Dibenzoylmethane | AG000Q0W | 4000g |
| 120-45-6 | CCC(OC(C1=CC=CC=C1)C)=O | 1-Phenylethyl propionate | AG000Q0X | 25000g |
| 120-44-5 | COC1=CC=C(CC(C2=CC=C(OC)C=C2)=O)C=C1 | Desoxyanisoin | AG000Q0Y | 200g |
| 120-43-4 | O=C(N1CCNCC1)OCC | Ethyl piperazine-1-carboxylate | AG000Q0Z | 50g |
| 120-37-6 | OC1=CC=C(C)C(NCC)=C1 | 3-Ethylamino-4-methylphenol | AG000Q11 | 700g |
| 120-35-4 | O=C(NC1=CC=CC=C1)C2=CC=C(OC)C(N)=C2 | 3-Amino-4-Methoxybenzanilide | AG000Q13 | 23500g |
| 120-33-2 | CCOC(=O)C1=CC(C)=CC=C1 | Ethyl 3-methylbenzoate | AG000Q14 | 200g |
| 1200-05-1 | NCC1=CC=C(CC(O)=O)C=C1 | 4-AMINOMETHYLPHENYLACETIC ACID | AG000Q15 | 1g |
| 1200-03-9 | BrCCCCOC1=CC=CC=C1 | 4-Phenoxybutyl bromide | AG000Q16 | 100g |
| 120-97-8 | O=S(C1=C(Cl)C(Cl)=CC(S(=O)(N)=O)=C1)(N)=O | Dichlorphenamide | AG000Q1A | 3g |
| 120013-45-8 | COc1cc2CC(=Cc2cc1OC)CC3CCN(Cc4ccccc4)CC3 | Dehydrodeoxy donepezil | AG000Q2P | 0.5g |
| 120013-39-0 | Cl.COC2=C(C=C1C(C(CC1=C2)CC3CCNCC3)=O)OC | 5,6-Dimethoxy-2-(4-piperidinylmethyl)-1-indanone, HCl | AG000Q2Q | 500g |
| 120012-04-6 | COc1cc2CC(CC3CCN(Cc4ccccc4)CC3)C(O)c2cc1OC | Dihydro Donepezil | AG000Q2R | 0.5g |
| 120011-70-3 | O=C1C(CC2CCN(CC3=CC=CC=C3)CC2)CC4=C1C=C(OC)C(OC)=C4.[H]Cl | 2-((1-Benzylpiperidin-4-yl)methyl)-5,6-dimethoxy-2,3-dihydro-1H-inden-1-o | AG000Q2S | 200g |
| 120004-79-7 | ClCCCCOC1=CC2=C(CCC(=O)N2)C=C1 | 3,4-DIHYDRO-7-(4-CHLOROBUTOXY)-2(1H)-QUINOLINONE | AG000Q2Y | 25g |
| 1200131-18-5 | Brc1ccc(c(c1)F)CN1CCCCC1 | 4-Bromo-2-fluorophenyl-1-(piperidinomethyl)benzene | AG000Q37 | 4.9g |
| 120014-30-4 | O=C1C(CC2CCNCC2)CC3=C1C=C(OC)C(OC)=C3 | 5,6-Dimethoxy-2-(piperidin-4-ylmethyl)-2,3-dihydro-1H-inden-1-one | AG000Q3J | 800g |
| 120014-07-5 | O=C1/C(CC2=C1C=C(OC)C(OC)=C2)=C/C3CCN(CC4=CC=CC=C4)CC3 | 1-Benzyl-4-(5,6-dimethoxy-1-oxoindan-2-ylindenemethyl)piperidine | AG000Q3M | 30g |
| 120014-06-4 | C1=C2C(=CC(=C1OC)OC)CC(C2=O)CC4CCN(CC3=CC=CC=C3)CC4 | 2-[(1-benzylpiperidin-4-yl)methyl]-5,6-dimethoxy-2,3-dihydro-1H-inden-1-o | AG000Q3N | 400g |
| 120022-63-1 | NS(=O)(=O)C1=C(F)C=CC(F)=C1 | 2,5-Difluorobenzenesulfonamide | AG000Q3W | 700g |
| 120021-39-8 | O=C(O)C[C@@H](O)CNC(OC(C)(C)C)=O | (R)-4-(Boc-Amino)-3-hydroxybutanoic acid | AG000Q3X | 0.5g |
| 120034-05-1 | COC(=O)C1=CC(Br)=CNC1=O | Methyl 5-Bromo-2-hydroxynicotinate | AG000Q59 | 100g |
| 120040-42-8 | NC1=NC2=C(C(N1)=O)C=C(C=N2)Br | 2-AMINO-6-BROMOPYRIDO[2,3-D]PYRIMIDIN-4(3H)-ONE | AG000Q5V | 250g |
| 1200498-40-3 | O=C(C1=NC=C(Cl)C=C1F)OC | Methyl 5-chloro-3-fluoropyridine-2-carboxylate | AG000Q6K | 8g |
| 1200497-81-9 | OC(C1=C(Cl)C=C(C#N)C=N1)=O | 3-Chloro-5-cyanopicolinic acid | AG000Q6L | 2g |
| 1200434-84-9 | OB(C1=CC=C(CN2CCCCC2)C=C1)O | 4-(1-Piperidylmethyl)phenylboronic acid | AG000Q6Q | 20g |
| 119740-95-3 | O=C(OC)CCN(C(OC(C)(C)C)=O)C | Methyl 3-(tert-butoxycarbonyl(methyl)-amino)propanoate | AG000PL0 | 10g |
| 119757-51-6 | FC(C1=CC=C(C#CC2=CC=C(C(F)(F)F)C=C2)C=C1)(F)F | 1,2-Bis(4-(trifluoromethyl)phenyl)ethyne | AG000PLI | 50g |
| 119754-17-5 | C#Cc1ccc(cc1)C(=O)c1ccccc1 | (4-Ethynylphenyl)phenylmethanone | AG000PLL | 1g |
| 119754-15-3 | CNC1=CC=C(C#C)C=C1 | 4-ethynyl-N-methylaniline | AG000PLM | 1g |
| 119752-83-9 | O=S([N+]1(CC2)CC[N+]2(S([O-])=O)CC1)[O-] | 1,4-Diazabicyclo[2.2.2]octane bis(sulfur dioxide) adduct | AG000PLR | 25g |
| 1197668-23-7 | NC1CCC2=C1C=CC(Cl)=C2.[H]Cl | 5-Chloro-2,3-dihydro-1H-inden-1-amine hydrochloride | AG000PM3 | 30g |
| 1197631-00-7 | ClC1=C(C=CC=C1)C2=CC(=N[NH]2)C(=O)O | 3-(2-Chlorophenyl)-1h-pyrazole-5-carboxylic acid | AG000PM4 | 15g |
| 119778-44-8 | C1(C(O)=O)SC(=NC=1CC)C | 4-ETHYL-2-METHYL-1,3-THIAZOLE-5-CARBOXYLIC ACID | AG000PM6 | 15g |
| 119777-51-4 | CO[Si](CCCNC(=O)Nc1ccccc1)(OC)OC | N-Phenyl-N’-[3-(trimethoxysilyl)propyl]urea | AG000PMD | 2g |
| 119771-23-2 | O=C(O)[C@@H](NC(OC(C)(C)C)=O)CC1=CC=C(B(O)O)C=C1 | (S)-3-(4-Boronophenyl)-2-((tert-butoxycarbonyl)amino)propanoic acid | AG000PMI | 200g |
| 119770-60-4 | Cl.CN1CCC(CC1)C(=O)C1=NC=CC=C1CCC1=CC(=CC=C1)Cl | (1-Methyl-4-piperidinyl)[3-[2-(3-chlorophenyl)ethyl]pyridinyl]methanone hy | AG000PMK | 50g |
| 119768-45-5 | CC(OC(N[C@H](C(O)=O)CC1C2=C(C=CC(=C2)O)NC=1)=O)(C)C | Boc-5-Hydroxy-L-tryptophan | AG000PML | 25g |
| 1197944-23-2 | FC1=C2NC=NC2=CC(Br)=C1 | 5-Bromo-7-fluoro-1h-benzimidazole | AG000PMR | 45g |
| 1197944-17-4 | O=C(C1=CC2=C(SN=C2)C=C1)O | Benzo[d]isothiazole-5-carboxylic acid | AG000PMS | 0.5g |
| 1197943-94-4 | O=C(C1=CC2=CN(C)N=C2C=C1)O | 2-METHYL-2H-INDAZOLE-5-CARBOXYLIC ACID | AG000PMT | 25g |
| 1197943-64-8 | CCC(c1cc(Br)ccc1F)O | 1-(5-Bromo-2-fluorophenyl)propan-1-ol | AG000PMU | 5.4g |
| 1260017-17-1 | O=C1CCC2=C1C=C(Br)C=C2Cl | 6-Bromo-4-chloro-2,3-dihydro-1H-inden-1-one | AG000QPU | 20g |
| 1260016-95-2 | O=C1CCC2=C1C(Br)=CC(F)=C2 | 7-BROMO-5-FLUORO-1-INDANONE | AG000QPV | 5g |
| 1260013-71-5 | O=C1CCC2=C1C=C(Br)C(Cl)=C2 | 6-Bromo-5-chloro-2,3-dihydro-1H-inden-1-one | AG000QQ0 | 5g |
| 1260013-11-3 | O=C1CCC2=C1C=CC(Cl)=C2F | 5-Chloro-4-fluoro-2,3-dihydro-1H-inden-1-one | AG000QQ7 | 25g |
| 1260013-03-3 | O=C1CCC2=C1C(Cl)=CC=C2Br | 4-BROMO-7-CHLORO-1-INDANONE | AG000QQ9 | 150g |
| 1260012-96-1 | O=C1CCC2=C1C(Br)=C(C)C=C2 | 7-Bromo-6-methyl-2,3-dihydro-1H-inden-1-one | AG000QQA | 0.25g |
| 1260012-83-6 | O=C1CCC2=C1C(F)=C(Br)C=C2 | 6-Bromo-7-fluoro-2,3-dihydro-1H-inden-1-one | AG000QQB | 15g |
| 1260019-45-1 | O=C1CCCC2=C1C=CC(OC(F)(F)F)=C2 | 6-(TRIFLUOROMETHOXY)-3,4-DIHYDRONAPHTHALEN-1(2H)-ONE | AG000QQF | 0.5g |
| 1260018-98-1 | FC1=C2CCC(C2=CC(=C1)C)=O | 4-Fluoro-6-methyl-2,3-dihydro-1H-inden-1-one | AG000QQG | 1g |
| 1260018-63-0 | O=C1CCC2=C1C(F)=CC=C2Cl | 4-Chloro-7-fluoro-1-indanone | AG000QQI | 10g |
| 1260018-37-8 | O=C1CCCC2=C1C=C(F)C=C2Br | 5-Bromo-7-fluoro-3,4-dihydronaphthalen-1(2H)-one | AG000QQJ | 2g |
| 1260018-10-7 | O=C1c2c(CC1)cc(c(c2)Cl)Br | 1H-Inden-1-one, 5-bromo-6-chloro-2,3-dihydro- | AG000QQM | 125g |
| 1260169-02-5 | O=C(C1=C2N=CC=CN2N=C1N)OCC | ethyl 2-aminopyrazolo[1,5-a]pyrimidine-3-carboxylate | AG000QR6 | 35g |
| 1260150-04-6 | O=C(N1CCCC2=C1C=CC(B(O)O)=C2)OC(C)(C)C | 1-BOC-1,2,3,4-Tetrahydroquinoline-6-boronic acid | AG000QR7 | 30g |
| 1260141-27-2 | OC(=O)C=CC(O)=O.CNCC1=CN(C(=C1)C1=CC=CC=C1F)S(=O)(=O)C1=CN=CC=C1 | TAK-438 | AG000QR8 | 12g |
| 1260139-70-5 | C(ON1C(=O)CCC1=O)(=O)CCOCCOCCOCCOCCNC(=O)CBr | 4,7,10,13-Tetraoxa-16-azaoctadecanoic acid, 18-bromo-17-oxo-, 2,5-dioxo-1-p | AG000QR9 | 5g |
| 1260092-50-9 | O=C(ON1C(CCC1=O)=O)CCOCCNC(CCN2C(C=CC2=O)=O)=O | Mal-peg-nhs | AG000QRC | 3g |
| 1260092-44-1 | C(C)(C)(C)OC(=O)NCCOCCC(=O)O | 3-(2-((tert-Butoxycarbonyl)amino)ethoxy)propanoic acid | AG000QRD | 200g |
| 1260091-04-0 | NC1=NC2=CC=C(B3OC(C)(C)C(C)(C)O3)C=C2O1 | 6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[d]oxazol-2-amine | AG000QRE | 30g |
| 120-95-6 | OC1=CC=C(C(C)(C)CC)C=C1C(C)(C)CC | 2,4-Di-Tert-Pentylphenol | AG000Q1C | 2500g |
| 120-93-4 | O=C1NCCN1 | 2-Imidazolidone | AG000Q1E | 1000g |
| 120-89-8 | O=C(NC1=O)NC1=O | Parabanic acid | AG000Q1G | 300g |
| 120-88-7 | C(=S)(C(=S)NCCCCCCCCCCCC)NCCCCCCCCCCCC | Ethanedithioamide, N1,N2-didodecyl- | AG000Q1H | 5g |
| 120-75-2 | CC1=NC2=C(S1)C=CC=C2 | 2-Methylbenzothiazole | AG000Q1M | 3000g |
| 120-74-1 | C(=O)(O)C1C2CC(C1)C=C2 | Bicyclo[2.2.1]hept-5-ene-2-carboxylic acid | AG000Q1N | 250g |
| 120-73-0 | C12=NC=NC1=CNC=N2 | Purine | AG000Q1O | 150g |
| 120-72-9 | C12=C(NC=C2)C=CC=C1 | Indole | AG000Q1P | 104.09g |
| 120003-75-0 | C1(C(O)=O)=CC(C)=C(N=C1Cl)C | 2-Chloro-5,6-dimethylnicotinic acid | AG000Q1X | 1g |
| 1200-67-5 | CC1([C@@]2([C@@H](C[C@]1(CC2)[H])OC=O)C)C | rel-(1R,2R,4R)-1,7,7-Trimethylbicyclo[2.2.1]heptan-2-yl formate | AG000Q24 | 2g |
| 1200-27-7 | CC(C)(N)CC1=CC=C(F)C=C1 | 1-(4-Fluorophenyl)-2-methyl-2-propylamine | AG000Q27 | 10g |
| 1200-22-2 | O=C(O)CCCC[C@H]1SSCC1 | (R)-(+)-1,2-Dithiolane-3-pentanoic acid | AG000Q29 | 1000g |
| 1200-14-2 | CCCCC1=CC=C(C=O)C=C1 | 4-Butylbenzaldehyde | AG000Q2C | 75g |
| 1200-07-3 | OC(=O)C=CC1=CC=C(Br)C=C1 | trans-4-Bromocinnamic acid | AG000Q2F | 3000g |
| 1200131-07-2 | N#CC1=C(CC)C=C(Br)C=C1CC | 4-Bromo-2,6-diethylbenzonitrile | AG000Q2G | 18g |
| 1200130-82-0 | O=C(O)C1=CN=C(Br)C=C1I | 6-Bromo-4-iodonicotinic acid | AG000Q2H | 0.75g |
| 1200114-01-7 | CC(N1C2=CC=C(Br)C=C2N=C1)C | 5-Bromo-1-isopropylbenzoimidazole | AG000Q2I | 6g |
| 120013-84-5 | O=C1C(CC2CCN(CC2)(CC3=CC=CC=C3)=O)CC4=CC(OC)=C(OC)C=C41 | Donepezil N-oxide | AG000Q2L | 0.15g |
| 1201644-33-8 | CC1(C)C(C)(C)OB(C2=CN=CC(N3CCOCC3)=C2)O1 | 4-(5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-yl)morpholine | AG000QFN | 10g |
| 1201643-90-4 | CC(N1N=CC(B(O)O)=C1)C | (1-Isopropyl-1H-pyrazol-4-yl)boronic acid | AG000QFO | 48g |
| 1201643-73-3 | CC(C)(C1=CC=C(CBr)C=C1)C#N | 2-(4-(Bromomethyl)phenyl)-2-methylpropanenitrile | AG000QFP | 0.5g |
| 1201643-70-0 | OB(C1=CN(C2=CC=CC=C2)N=C1)O | 1-Phenylpyrazole-4-boronic acid | AG000QFR | 9g |
| 1201643-59-5 | C1=CN=C(C=C1Br)N2CCNCC2 | 4-Bromo-2-piperazinopyridine | AG000QFS | 175g |
| 1201633-72-8 | O=C1CCCC2=C1SC(Br)=N2 | 2-Bromo-5,6-dihydro-4H-benzothiazol-7-one | AG000QFT | 15g |
| 1201657-89-7 | BrC=1C=NN(C1)C1CN(CC1)C(=O)OC(C)(C)C | TERT-BUTYL 3-(4-BROMO-1H-PYRAZOL-1-YL)PYRROLIDINE-1-CARBOXYLATE | AG000QG6 | 25g |
| 1201657-32-0 | CC(N1N=CC(B2OC(C)(C)C(C)(C)O2)=C1)(C)C(OCC)=O | Ethyl 2-methyl-2-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazol | AG000QG7 | 45g |
| 1201657-24-0 | NC1=NC=C(C(F)(F)F)C(Cl)=N1 | 4-Chloro-5-(trifluoromethyl)pyrimidin-2-amine | AG000QG9 | 10g |
| 1201657-09-1 | C[Si](C#CC1=CN(C)N=C1)(C)C | 1-methyl-4-((trimethylsilyl)ethynyl)-1H-pyrazole | AG000QGA | 8g |
| 1201645-46-6 | CC(=O)NC1=CC(=CN=C1)B1OC(C)(C)C(C)(C)O1 | N-(5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-yl)acetamide | AG000QGB | 20g |
| 120166-69-0 | Fc1ccc(cc1)C(=C1CCN(CC1)CCn1c(=S)[nH]c2c(c1=O)cccc2)c1ccc(cc1)F | 3-(2-(4-(Bis(4-fluorophenyl)methylene)piperidin-1-yl)ethyl)-2-thioxo-2,3-dih | AG000QGF | 0.05g |
| 1201785-07-0 | Oc1cc2ncccc2c(=O)[nH]1 | 1,6-Naphthyridine-5,7-diol | AG000QHP | 3g |
| 1201784-97-5 | O=c1[nH]cnn2cc(I)cc12 | 6-Iodopyrrolo[2,1-f][1,2,4]triazin-4(1H)-one | AG000QHR | 1g |
| 1201784-87-3 | NC1=C2C(Br)=CC=CC2=NC=N1 | 5-Bromoquinazolin-4-amine | AG000QHT | 3g |
| 120173-57-1 | CC(=O)OC[C@H]1O[C@H](OC[C@@H](C(=O)O)NC(=O)OCC2c3ccccc3c3c2cccc3)[ | Fmoc-L-Ser(alpha-D-GalNAc(Ac)3)-OH | AG000QHY | 1.25g |
| 120173-41-3 | O=CC1=CC(Br)=CC(C=O)=C1 | 5-Bromoisophthalaldehyde | AG000QHZ | 208g |
| 1201844-77-0 | COC1=CC2=CC(Br)=CC=C2N=C1 | 6-Bromo-3-methoxyquinoline | AG000QI8 | 0.5g |
| 120095-64-9 | O=[N+](C1=CN(C)C(C(C(Cl)(Cl)Cl)=O)=N1)[O-] | 2,2,2-Trichloro-1-(1-methyl-4-nitro-1H-imidazol-2-yl)ethanone | AG000Q9Z | 30g |
| 120088-53-1 | NC1CCN(C)CC1.[H]Cl | 1-methylpiperidin-4-amine HCl | AG000QAF | 800g |
| 89226-50-6 | O=C(C1=C(C)NC(C)=C(C(OC)=O)C1C2=CC=CC([N+]([O-])=O)=C2)OCCN3CCN(C(C4 | Manidipine | AG000QAH | 10g |
| 120099-61-8 | CO[C@@H]1CNCC1 | (S)-3-Methoxypyrrolidine | AG000QAM | 50g |
| 120099-60-7 | CO[C@H]1CNCC1 | (R)-3-METHOXYPYRROLIDINE | AG000QAN | 75g |
| 1201-99-6 | O=C(O)/C=C/C1=CC=C(Cl)C=C1Cl | 2,4-Dichlorocinnamic acid | AG000QAQ | 200g |
| 1201-93-0 | CN(C)C=CC(=O)C1=CC=CC=C1 | (E)-3-(dimethylamino)-1-phenylprop-2-en-1-one | AG000QAR | 43.75g |
| 1201-91-8 | N(CCO)(C)c1ccc(cc1)C=O | Benzaldehyde, 4-[(2-hydroxyethyl)methylamino]- | AG000QAS | 200g |
| 1201-90-7 | O=C(OCC)C1=CC=C(CCl)C=C1 | Ethyl 4-(chloromethyl)benzoate | AG000QAT | 50g |
| 1201-74-7 | CC(N)C1=CC=C2C=CC=CC2=C1 | 1-(Naphthalen-2-yl)ethanamine | AG000QAV | 50g |
| 1201-68-9 | ClCC1=NOC(C2=CC=CC=C2)=N1 | 3-(Chloromethyl)-5-phenyl-1,2,4-oxadiazole | AG000QAY | 15g |
| 1201-38-3 | C(=O)(C)c1c(OC)ccc(c1)OC | Ethanone, 1-(2,5-dimethoxyphenyl)- | AG000QB2 | 5500g |
| 1201-31-6 | C1=C(C(=C(C(=C1F)F)F)F)C(O)=O | 2,3,4,5-Tetrafluorobenzoic acid | AG000QB3 | 5000g |
| 1201-26-9 | CC(=O)Cc1c[nH]c2c1cccc2 | 2-Propanone,1-(1H-indol-3-yl)- | AG000QB5 | 1200g |
| 1201-24-7 | C1=C(C=CC2=C1C(=N[NH]2)C(=O)O)C | 5-Methyl-1h-indazole-3-carboxylic acid | AG000QB7 | 20g |
| 1201-08-7 | Cc1cc(O)c2c(n1)c(Br)ccc2 | 8-Bromo-4-hydroxy-2-methylquinoline | AG000QB9 | 50g |
| 1201-07-6 | CC1=NC2=C(C=CC=C2Br)C(Cl)=C1 | 8-Bromo-4-chloro-2-methylquinoline | AG000QBA | 50g |
| 120103-19-7 | Fc1c(N)cc(c(c1)O)F | Phenol, 4-amino-2,5-difluoro- | AG000QBF | 10g |
| 1198156-69-2 | C(CC(C)C)OC1=CC=C(C=C1)B(O)O | 4-(Isopentyloxy)phenylboronic acid | AG000POV | 50g |
| 1198154-99-2 | BrC1SC(C#N)=NC=1 | 5-BroMothiazole-2-carbonitrile | AG000POW | 10g |
| 1198154-67-4 | ClC1=NC=CC2=C1NCCO2 | 5-Chloro-3,4-dihydro-2H-pyrido[4,3-b][1,4]oxazine | AG000POX | 2g |
| 1198103-43-3 | NCC1=CC=C(OC(F)F)N=C1 | (6-(Difluoromethoxy)pyridin-3-yl)methanamine | AG000PP6 | 2g |
| 1198103-42-2 | C1=CC(=NC=C1C#N)OC(F)F | 6-(Difluoromethoxy)nicotinonitrile | AG000PP7 | 2g |
| 1198097-37-8 | COc1cnc2n(ccc2c1)[Si](C(C)C)(C(C)C)C(C)C | 5-Methoxy-1-(triisopropylsilyl)-1H-pyrrolo[2,3-b]pyridine | AG000PP9 | 0.75g |
| 119812-51-0 | O=C1NC(=O)C2=C1C=CC=C2.C1CN=C2CCCCCN2C1 | Phthalimide DBU salt | AG000PPF | 800g |
| 119812-29-2 | CN(C)CC1CCC2=C(C3=CC=CC=C3N2C)C1=O.Cl | 3-[(Dimethylamino)methyl]-1,2,3,9-tetrahydro-9-methyl-4h-carbazol-4-one | AG000PPG | 20g |
| 1198283-55-4 | O=C(C1=CC=CC2=NC=CN12)O.[H]Cl | Imidazo[1,2-a]pyridine-5-carboxylic acid, HCl | AG000PPJ | 15g |
| 1198171-18-4 | FC(F)C1=C(Br)C=CC(F)=C1 | 1-Bromo-2-(difluoromethyl)-4-fluorobenzene | AG000PPR | 100g |
| 1198166-10-7 | CC(C1=CC=C(OC(F)F)N=C1)=O | 1-(6-(difluoroMethoxy)pyridin-3-yl)ethanone | AG000PPS | 5g |
| 1198166-03-8 | CC(C1=NC=C(OC(C)C)C=C1)=O | 1-(5-Isopropoxypyridin-2-yl)ethanone | AG000PPT | 23g |
| 119818-40-5 | CC/C=CC/C=CC/C=CC/C=CC/C=CCCCCCC(OCC)=O | (7Z,10Z,13Z,16Z,19Z)-Ethyl docosa-7,10,13,16,19-pentaenoate | AG000PQ5 | 0.6g |
| 119817-90-2 | CCCCCN(CCCOC)C([C@@H](CCC(O)=O)NC(C1=CC(Cl)=C(C=C1)Cl)=O)=O | (R)-4-(3,4-Dichlorobenzamido)-5-((3-methoxypropyl)(pentyl)amino)-5-oxop | AG000PQ7 | 0.05g |
| 1198321-33-3 | O=C(O)[C@@H](NC(OCC1C2=C(C3=C1C=CC=C3)C=CC=C2)=O)CCCNC(CC(C)C)=C4 | Fmoc-Orn(ivDde)-OH | AG000PQ8 | 35g |
| 1198319-39-9 | Nc1oc2c(n1)cc(cn2)Br | Oxazolo[5,4-b]pyridin-2-amine, 6-bromo- | AG000PQ9 | 2g |
| 1199-59-3 | CN(C1=CC(C)=C(C=O)C=C1)C | 4-(Dimethylamino)-2-methylbenzaldehyde | AG000PUT | 15g |
| 1199-49-1 | CC(C)C1=NOC(=N1)C(Cl)(Cl)Cl | 3-Isopropyl-5-(trichloromethyl)-1,2,4-oxadiazole | AG000PUV | 10g |
| 1199-46-8 | CC(C)(C)C1=CC(N)=C(O)C=C1 | 2-Amino-4-tert-butylphenol | AG000PUX | 10000g |
| 1199-28-6 | NCCOc1ccc(cc1Cl)Cl | 2-(2,4-Dichlorophenoxy)ethanamine | AG000PV1 | 2g |
| 119934-12-2 | C1C2(CC1(C2)I)C(F)(F)F | 3-Iodo-1-(trifluoromethyl)bicyclo[1.1.1]pentane | AG000PV9 | 10g |
| 119929-87-2 | C(C1=CC=CC=C1)N1CCN(CC1)CC(=O)O | (4-Benzylpiperazin-1-yl)acetic acid | AG000PVH | 10g |
| 1199557-04-4 | N(C(=O)OC(C)(C)C)c1c(C=O)nc(cc1)Cl | tert-Butyl (6-chloro-2-formylpyridin-3-yl)carbamate | AG000PVS | 20g |
| 1199556-68-7 | O=C(OC(C)(C)C)NC1(C2=CC=C(Br)C=C2)CC(C1)=O | Tert-Butyl (1-(4-Bromophenyl)-3-Oxocyclobutyl)Carbamate | AG000PVX | 10g |
| 1199556-64-3 | O[C@@H]1C[C@](C2=CC=C(Br)C=C2)(C(O)=O)C1 | 1-(4-Bromophenyl)-3-hydroxycyclobutanecarboxylic acid | AG000PVY | 76g |
| 119951-96-1 | ClC=1C=C(C=CC1F)NC(OC(C)(C)C)=O | tert-Butyl (3-chloro-4-fluorophenyl)carbamate | AG000PW5 | 2g |
| 119942-99-3 | C([C@H](NC([C@@H](NP(O[C@H]1[C@H](O)[C@H](O)[C@@H](O)[C@H](C)O1 | N-[N-[[(6-Deoxy-α-L-mannopyranosyl)oxy]hydroxyphosphinyl]-L-leucyl]-L-tr | AG000PWC | 0.025g |
| 16156-54-0 | CCC(C)OS(=O)(=O)C | Methanesulfonic acid, 1-methylpropyl ester | AG000PWE | 0.75g |
| 1199773-09-5 | ClC1=CC(Br)=CN=C1N2CCOCC2 | 4-(5-Bromo-3-chloropyridin-2-yl)morpholine | AG000PWJ | 30g |
| 1199631-29-2 | OC1=C(C2=CC=C(OC)C=C2)C=C3C=CC=CC3=C1C4=C5C=CC=CC5=CC(C6=CC=C(OC) | (S)-3,3′-Bis(4-methoxyphenyl)-[1,1′-binaphthalene]-2,2′-diol | AG000PWP | 6g |
| 1199616-66-4 | C1(NC2=C3C=CC=C2)=C3C(OC4=CC=CC=C45)=C5C=C1 | 5H-Benzofuro[3,2-c]carbazole | AG000PWQ | 50g |
| 119975-64-3 | [C@@H](CC1=CN=CN1)(NC([C@H](CC2=CC=CC=C2)NC([C@H](NC([C@H](CC3=C | (3S)-3-[(2S)-2-[(2S)-2-[(2S)-2-[(2S)-2-[(2R)-2-[(2S)-2-amino-3-(4-hydroxyphen | AG000PWR | 0.5g |
| 120136-28-9 | C#CC1=CC(=C(C=C1)OC)F | 4-Ethynyl-2-fluoro-1-methoxybenzene | AG000QDK | 5g |
| 120131-72-8 | NCCN(C(=O)OC(C)(C)C)CCNC(=O)OC(C)(C)C | 1,4-Bis-Boc-1,4,7-triazaheptane | AG000QDN | 15g |
| 1201438-56-3 | O=C1N(C2=CC=CC=C2)C([C@@H](NC3=C4N=CNC4=NC=N3)C)=CC5=C1C(Cl)=CC= | Duvelisib | AG000QE2 | 2g |
| 120153-08-4 | B(O)(O)c1cc(F)c(cc1)C(=O)O | 4-Borono-2-fluorobenzoic acid | AG000QE8 | 200g |
| 120145-22-4 | CC(C1=CC=CC(Cl)=N1)C | 2-Chloro-6-isopropylpyridine | AG000QEA | 25g |
| 1201597-23-0 | CC1=CC(F)=C(C(O)=O)C(F)=C1 | 2,6-difluoro-4-methylbenzoic acid | AG000QET | 600g |
| 1201597-22-9 | CC1=CC(F)=C(C=O)C(F)=C1 | 2,6-Difluoro-4-methylbenzaldehyde | AG000QEU | 3g |
| 1201593-65-8 | N[C@H](C(O)=O)CC1CCC1 | (S)-2-Amino-3-cyclobutylpropanoic acid | AG000QEV | 25g |
| 1201566-80-4 | O=C(OC)C1=CC(OC)=C(OC)C=C1B2OC(C)(C)C(C)(C)O2 | 4,5-Dimethoxy-2-(methoxycarbonyl)phenylboronic acid pinacol ester | AG000QEW | 8g |
| 120157-98-4 | CC(=O)NC(=O)OC(C)(C)C | Carbamic acid, acetyl-, 1,1-dimethylethyl ester | AG000QF1 | 10g |
| 120157-97-3 | CC(C)(C)OC(=O)NCCC1=CC=C(Br)C=C1 | N-Boc-2-(4-Bromophenyl)ethylamine | AG000QF2 | 158.3g |
| 120157-96-2 | O=C(OC)C1=CC=C(CNC(OC(C)(C)C)=O)C=C1 | Methyl 4-((tert-butoxycarbonylamino) methyl)benzoate | AG000QF3 | 25g |
| 120155-43-3 | O=C(OCC)CC1=CSC=N1 | 4-Thiazoleacetic acid ethyl ester | AG000QF7 | 100g |
| 1201645-45-5 | CC1(C)OB(OC1(C)C)c1cncc(c1)NCc1ccccc1 | N-Benzyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-amine | AG000QFG | 0.6g |
| 1201644-47-4 | O=C(N1CCOCC1)C2=NC=C(B3OC(C)(C)C(C)(C)O3)C=C2 | Morpholino(5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-yl)met | AG000QFI | 3g |
| 1201644-34-9 | CC1(C)C(C)(C)OB(C2=CC(=CN=C2)N3CCN(CC3)S(=O)(=O)C)O1 | 1-(Methylsulfonyl)-4-(5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin- | AG000QFM | 0.75g |
| 125995-13-3 | O=C(OC(C)(C)C)C[C@@H]1OC(C)(C)O[C@H](CCN)C1 | (4R,6R)-tert-Butyl-6-(2-aminoethyl)-2,2-dimethyl-1,3-dioxane-4-acetate | AG000QNK | 1500g |
| 125995-03-1 | O=C(C1=C(C(C)C)N(CC[C@H](C[C@@H](O)C2)OC2=O)C(C3=CC=C(F)C=C3)=C1C4 | Atorvastatin lactone | AG000QNL | 2g |
| 125995-00-8 | O[C@H](C(F)(F)F)C(O)=O | (S)-(-)-3,3,3-TRIFLUORO-2-HYDROXYPROPANOIC ACID | AG000QNM | 10g |
| 126-39-6 | C(C)C1(C)OCCO1 | 2-Ethyl-2-methyl-1,3-dioxolane | AG000QNX | 75g |
| 126-38-5 | CC(OC)(OC)CBr | 1-Bromo-2,2-dimethoxypropane | AG000QNY | 1000g |
| 126-33-0 | O=S1(CCCC1)=O | Sulfolane | AG000QNZ | 125000g |
| 126-30-7 | OCC(C)(C)CO | 2,2-Dimethyl-1,3-propanediol | AG000QO1 | 5000g |
| 126-27-2 | CN(C(CC1=CC=CC=C1)(C)C)C(CN(CC(N(C(CC1=CC=CC=C1)(C)C)C)=O)CCO)=O | 2-[(2-hydroxyethyl)({[methyl(2-methyl-1-phenylpropan-2-yl)carbamoyl]met | AG000QO3 | 1.6g |
| 126-18-1 | C[C@@H]1[C@]2(O[C@@]3([C@]1([C@]4(C)[C@@](C3)([C@]5([C@](CC4)([C | (2aR,4S,5’R,6aS,6bS,8aS,8bR,9S,10R,11aS,12aS,12bR)-5′,6a,8a,9-tetramethyldo | AG000QO6 | 1g |
| 126-17-0 | C[C@H](CC1)CN[C@]21O[C@@]3([H])C[C@@]4([H])[C@]5([H])CC=C6C[C@@H | Solasodine | AG000QO7 | 0.75g |
| 126-14-7 | CC(OC[C@]1(O[C@@H]2[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C | Octa-O-acetyl D-(+)-Sucrose | AG000QO9 | 3500g |
| 126-11-4 | O=[N+](C(CO)(CO)CO)[O-] | 2-(Hydroxymethyl)-2-nitropropane-1,3-diol | AG000QOA | 5000g |
| 126-00-1 | CC(C1=CC=C(O)C=C1)(C2=CC=C(O)C=C2)CCC(O)=O | 4,4-Bis(4-hydroxyphenyl)valeric acid | AG000QOD | 1000g |
| 126-96-5 | CC([O-])=O.CC(O)=O.[Na+] | Acetic acid, sodium salt (2:1) | AG000QOG | 12500g |
| 126-91-0 | CC(C)=CCC[C@@](C)(O)C=C | (-)-Linalool | AG000QOJ | 1500g |
| 126-87-4 | CCCC(C)(O)C#CC(C)(O)CCC | 4,7-Dimethyldec-5-yne-4,7-diol | AG000QOK | 5g |
| 126-86-3 | CC(C)CC(C)(O)C#CC(C)(O)CC(C)C | 2,4,7,9-Tetramethyl-5-Decyne-4,7-Diol | AG000QOL | 9500g |
| 126-84-1 | CCOC(OCC)(C)C | 2,2-Diethoxypropane | AG000QOM | 50g |
| 126-81-8 | O=C1CC(CC(C)(C)C1)=O | Dimedone | AG000QON | 10000g |
| 126-53-4 | CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCC)OC(=O)CCCCCCCC | Trinonanoin | AG000QOY | 10g |
| 1260011-83-3 | O=C1CCC2=C1C(Br)=C(F)C=C2 | 7-BROMO-6-FLUORO-1-INDANONE | AG000QP0 | 15g |
| 1260011-37-7 | O=C1CCC2=C1C(Br)=CC(C)=C2 | 7-BROMO-5-METHYL-2,3-DIHYDRO-1H-INDEN-1-ONE | AG000QP2 | 0.75g |
| 1260011-25-3 | O=C1CCC2=C1C(O)=CC(Cl)=C2 | 5-Chloro-7-hydroxy-2,3-dihydro-1H-inden-1-one | AG000QP3 | 0.5g |
| 1260010-73-8 | BrC1=C2CCCC(C2=C(C=C1)F)=O | 5-Bromo-8-fluoro-3,4-dihydronaphthalen-1(2H)-one | AG000QP6 | 2g |
| 1260010-40-9 | Cc1ccc2C(=O)CCCc2c1Br | 5-BROMO-6-METHYL-1,2,3,4-TETRAHYDRONAPHTHALEN-1-ONE | AG000QP8 | 0.25g |
| 1260010-08-9 | CC1=C(Br)C=NC=C1Cl | 3-Bromo-5-chloro-4-methylpyridine | AG000QP9 | 3g |
| 1260008-48-7 | O=C1CCC2=C1C(Cl)=CC(F)=C2 | 7-Chloro-5-fluoro-2,3-dihydro-1H-inden-1-one | AG000QPE | 15g |
| 1260008-29-4 | O=C1CCOC2=C1C(Br)=CC(F)=C2 | 5-Bromo-7-fluorochroman-4-one | AG000QPF | 5g |
| 1260007-55-3 | C1CC2=C(C(=CC=C2C(=O)C1)F)Br | 5-BROMO-6-FLUORO-1,2,3,4-TETRAHYDRONAPHTHALEN-1-ONE | AG000QPI | 6g |
| 1260017-94-4 | C1CC(=O)C2=C1C(=CC(=C2)Cl)Br | 4-Bromo-6-chloro-2,3-dihydro-1H-inden-1-one | AG000QPQ | 500g |
| 1201935-84-3 | C(#N)c1c(N)cn(n1)C | 4-Amino-1-methyl-1h-pyrazole-3-carbonitrile | AG000QJM | 1g |
| 1201935-36-5 | NC1=CN(C2CCN(C)CC2)N=C1 | 1-(1-Methylpiperidin-4-yl)-1H-pyrazol-4-amine | AG000QJN | 50g |
| 1201924-32-4 | O=C(O)C1=NC(Cl)=CC=C1C | 6-Chloro-3-methylpicolinic acid | AG000QJO | 200g |
| 1201924-31-3 | CC1=C(C#N)N=C(Cl)C=C1 | 6-Chloro-3-methylpicolinonitrile | AG000QJP | 125g |
| 1201916-31-5 | O=C(NO)C1=CC=C(NC(C(CCCC2=CC=CC=C2)=N3)=O)C3=C1 | TCS 2210 | AG000QJR | 0.3g |
| 1201905-61-4 | CC1(C)C(C)(C)OB(/C=C/OCC)O1 | (E)-1-Ethoxyethene-2-boronic acid pinacol ester | AG000QJS | 25g |
| 1201902-80-8 | O=C(C(C1)(CC(O)=O)OB([C@@H](NC(CNC(C2=CC(Cl)=CC=C2Cl)=O)=O)CC(C)C)O | 4-(Carboxymethyl)-2-((R)-1-(2-(2,5-dichlorobenzamido)acetamido)-3-methyl | AG000QJT | 3g |
| 1202-39-7 | O=C(O)/C=C/C1=CC=C(Cl)C(Cl)=C1 | (E)-3-(3,4-Dichlorophenyl)acrylic acid | AG000QK2 | 300g |
| 1202-34-2 | N(c1ccccn1)c1ccccn1 | 2-Pyridinamine, N-2-pyridinyl- | AG000QK3 | 500g |
| 1202-25-1 | O=C(OC)C1=CC=C(N(C)C)C=C1 | Methyl 4-(Dimethylamino)Benzoate | AG000QK5 | 500g |
| 1202-22-8 | CN(C1=NC(N(C)C)=NC(Cl)=C1)C | 6-Chloro-N2,N2,N4,N4-tetramethylpyrimidine-2,4-diamine | AG000QK6 | 2g |
| 1202-04-6 | O=C(C(N1)=CC2=C1C=CC=C2)OC | Methyl Indole-2-carboxylate | AG000QK8 | 914.27g |
| 1259436-59-3 | Cl.N[C@@H]1CC[C@H](O)C1 | (1S,3R)-3-Aminocyclopentanol hydrochloride | AG000QKB | 50g |
| 1259396-11-6 | O=C(C1=C(C)SC(Br)=C1)OC | Methyl 5-broMo-2-Methylthiophene-3-carboxylate | AG000QKD | 50g |
| 1259370-15-4 | FC1=CN=C(OCC)C=C1B(O)O | 2-Ethoxy-5-fluoropyridine-4-boronic acid | AG000QKF | 15g |
| 125942-79-2 | IC[C@H](C(=O)OCc1ccccc1)NC(=O)OC(C)(C)C | (S)-Benzyl 2-((tert-butoxycarbonyl)amino)-3-iodopropanoate | AG000QKP | 10g |
| 125941-87-9 | CN1C[C@H](C2=CC=CC=C2)C3=C(C=C(Cl)C(O)=C3)CC1.Cl | SCH 23390 (hydrochloride) | AG000QKQ | 0.02g |
| 1259519-93-1 | CC1=NC2=C(C=CC=C2F)C=C1N | 8-Fluoro-2-Methylquinolin-3-Amine | AG000QL2 | 7g |
| 1198319-36-6 | NC1=CC(Br)=C(C)N=C1Cl | 5-Bromo-2-chloro-6-methylpyridin-3-amine | AG000PQA | 50g |
| 1198286-24-6 | [H]Cl.[H]Cl.N(CC1)(CC2=CC=CC=C2)CCC31CCCNC3 | 9-Benzyl-2,9-diazaspiro[5.5]undecane dihydrochloride | AG000PQG | 0.75g |
| 1198285-07-2 | Cl.C1CC2(CNCCC2)C1 | 6-Azaspiro[3.5]nonane hydrochloride | AG000PQJ | 10g |
| 1198284-94-4 | O=C(N(CC1)CCC21CCCNC2=O)OC(C)(C)C | Tert-Butyl 1-Oxo-2,9-Diazaspiro[5.5]Undecane-9-Carboxylate | AG000PQL | 45g |
| 1198284-49-9 | CC(OC(N1CCC2(C(=O)CCCC2)CC1)=O)(C)C | Tert-butyl 7-oxo-3-azaspiro[5.5]undecane-3-carboxylate | AG000PQN | 10g |
| 1198284-29-5 | Cl.O=C1NCC(c2ccccc2)C12CCNCC2 | 4-Phenyl-2,8-diazaspiro[4.5]decan-1-one hydrochloride | AG000PQO | 1g |
| 1198283-93-0 | CC(C)(C)OC(=O)N1CCC(CC1)C2=CC=CC=C2Br | 1-Boc-4-(2-bromophenyl)piperidine | AG000PQP | 25g |
| 119830-47-6 | O=C(OCC)C1=NC=C(N)C=C1 | Ethyl 5-aminopicolinate | AG000PQV | 15g |
| 1198408-35-3 | O=C(N1CCC(C2=CC=C(N)N=C2)CC1)OC(C)(C)C | tert-Butyl 4-(6-aminopyridin-3-yl)piperidine-1-carboxylate | AG000PR0 | 100g |
| 1198395-24-2 | CC1(C)C2=C(C3=C1C=CC=C3)C=CC(NC4=CC=CC=C4C5=CC=CC=C5)=C2 | N-[1,1′-Biphenyl]-2-yl-9,9-dimethyl-9H-fluoren-2-amine | AG000PR3 | 125g |
| 119838-44-7 | O=C(N1CC(=O)N([C@H]1C(C)(C)C)C)OC(C)(C)C | (R)-(+)-1-Boc-2-tert-butyl-3-methyl-4-imidazolidinone | AG000PRC | 2g |
| 119838-38-9 | CN1[C@@H](N(CC1=O)C(=O)OC(C)(C)C)C(C)(C)C | (S)-tert-Butyl 2-(tert-butyl)-3-methyl-4-oxoimidazolidine-1-carboxylate | AG000PRD | 7.95g |
| 1198569-35-5 | O=C1NC2=C(Br)C=NN2C=C1 | 3-BROMOPYRAZOLO[1,5-A]PYRIMIDIN-5-OL | AG000PRM | 1.25g |
| 1198475-24-9 | FC(F)(F)c1cc2[nH]ccc2cc1Br | 5-Bromo-6-(trifluoromethyl)-1H-indole | AG000PRR | 5g |
| 1198467-57-0 | O(CCCCCCCCCCCC)c1c(C=O)c(OCCCCCCCCCCCC)ccc1 | 2,6-Bis(dodecyloxy)benzaldehyde | AG000PRS | 30g |
| 119858-52-5 | CC1=CN2C=CC=C(N)C2=N1 | 2-Methylimidazo[1,2-a]pyridin-8-amine | AG000PS1 | 4g |
| 119851-28-4 | CC(=O)C1=C(Cl)C=C(OC2=CC=C(Cl)C=C2)C=C1 | 1-[2-Chloro-4-(4-chlorophenoxy)phenyl]ethan-1-one | AG000PS4 | 1500g |
| 119844-67-6 | O=C1N[C@H](C)COC1 | (R)-5-Methylmorpholin-3-one | AG000PS8 | 15g |
| 119844-66-5 | O=C1N[C@@H](C)COC1 | (5S)-5-Methylmorpholin-3-one | AG000PS9 | 10g |
| 1198759-26-0 | Clc1ccc2c(n1)sc(n2)Br | 2-Bromo-5-chloro-thiazolo[5,4-b]pyridine | AG000PSB | 25g |
| 1198615-87-0 | O=C(OCC)C1=CC=CC(B2OC(C)(C)C(C)(C)O2)=C1C | Ethyl 2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate | AG000PSF | 6g |
| 1198615-70-1 | O=C(OCC)CC1=CC=CC(B2OC(C)(C)C(C)(C)O2)=C1 | (3-Ethoxycarbonylmethyl)phenylboronic acid, pinacol ester | AG000PSG | 45g |
| 1198615-60-9 | O=C(OC)C1=CC=C(B2OC(C)(C)C(C)(C)O2)C=C1N | Methyl 2-amino-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate | AG000PSH | 40g |
| 1198605-53-6 | CC1(OB(OC1(C)C)C=1C=C(NC1)C(=O)OC)C | Methyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrole-2-carboxyl | AG000PSI | 8g |
| 1198791-65-9 | C(OC(=O)N[C@](CC#C)(C(=O)O)C)C1c2c(c3c1cccc3)cccc2 | (R)-2-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-2-methylpent-4-ynoic aci | AG000PT2 | 5g |
| 1198791-58-0 | C#CC[C@](NC(OCC1C2=C(C=CC=C2)C3=C1C=CC=C3)=O)(C(O)=O)C | (S)-2-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-2-methylpent-4-ynoic aci | AG000PT3 | 20g |
| 1198791-56-8 | C(OC(=O)N[C@](CCCC#C)(C(=O)O)C)C1c2c(c3c1cccc3)cccc2 | 6-Heptynoic acid, 2-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-2-methyl-, ( | AG000PT4 | 2g |
| 1198772-66-5 | C=CCCCCCCB(O)O | Oct-7-enylboronic acid | AG000PT6 | 3g |
| 119894-20-1 | O=C(O)[C@@H](NC(OCC1C2=C(C3=C1C=CC=C3)C=CC=C2)=O)CC4=CC=C(OCC)C= | Fmoc-O-ethyl-L-tyrosine | AG000PT9 | 100g |
| 119881-02-6 | O=C(OC(C)(C)C)NC(C(=O)O)C(=O)O | 2-((tert-Butoxycarbonyl)amino)malonic acid | AG000PTH | 25g |
| 119879-90-2 | NC1=CC(OCC2=CC=CC=C2)=CC=C1Br | 5-(Benzyloxy)-2-bromoaniline | AG000PTM | 0.5g |
| 119899-26-2 | O=C(Cl)C1=C(F)N=CC=C1 | 2-Fluoropyridine-3-carbonyl chloride | AG000PTQ | 35g |
| 119898-59-8 | C([C@H]1O[C@@H](N2C=NC3C(=O)NC=NC2=3)[C@@H](O)C1O)OC(C1C=CC(OC | 5′-O-DMT-rI | AG000PTS | 0.1g |
| 119895-68-0 | C(=O)c1c2c(OC(O2)(F)F)ccc1 | 1,3-Benzodioxole-4-carboxaldehyde, 2,2-difluoro- | AG000PU0 | 100g |
| 1199-20-8 | CC(C1=CC=CC=C1)=CC(O)=O | 3-phenylbut-2-enoic acid (E/Z mixture) | AG000PU2 | 40g |
| 1199-07-1 | O=CC1=C(C)C2=CC=CC=C2O1 | 3-Methylbenzofuran-2-carbaldehyde | AG000PU5 | 300g |
| 1199-02-6 | O=C1OC(C2=CC=CC=C2)=NN1 | 5-Phenyl-3H-1,3,4-oxadiazol-2-one | AG000PUA | 10g |
| 1199-01-5 | O=C1OC(C2=CC=CC=C2)=NC1 | 2-Phenyl-5-Oxazolone | AG000PUB | 100g |
| 1199-00-4 | CC1=NOC(=N1)C1=CC=CC=C1 | 3-Methyl-5-phenyl-1,2,4-oxadiazole | AG000PUC | 0.75g |
| 1199-77-5 | O=C(O)/C(C)=C/C1=CC=CC=C1 | alpha-Methylcinnamic acid | AG000PUK | 3000g |
| 1199-69-5 | NCCC1=CC=C(C(O)=O)C=C1 | 4-(2-Aminoethyl)benzoic acid | AG000PUN | 15g |
| 1199-65-1 | [I-].CC[n+]1ccc(cc1)C(=O)OC | 1-Ethyl-4-methoxycarbonylpyridinium iodide | AG000PUP | 5g |
| 120047-51-0 | FC1=CNC=C1F | 3,4-DIFLUORO-1H-PYRROLE | AG000Q6W | 5g |
| 120042-14-0 | N[C@H](C(O)=O)CCN=[N+]=[N-] | (2S)-2-amino-4-azidobutanoic acid | AG000Q72 | 0.1g |
| 120042-11-7 | OCC[C@@H](C(OC)=O)NC(OC(C)(C)C)=O | N-Boc-L-homoserine Methyl Ester | AG000Q74 | 125g |
| 120051-54-9 | O=C1OC[C@@H]([C@@]1(O)Cc1ccc2c(c1)OCO2)Cc1ccc2c(c1)OCO2 | Meridinol | AG000Q7E | 0.005g |
| 120068-79-3 | NC1=CC(=N[N]1C2=C(C=C(C=C2Cl)C(F)(F)F)Cl)C#N | 5-Amino-1-(2,6-dichloro-4-trifluoromethylphenyl)-3-cycano pyrazole | AG000Q7Z | 4000g |
| 120061-96-3 | OC[C@@H]1[C@H]2C[C@H]2[C@]2([C@H]1CC1=C(CO)C(=O)OC1=C2)C | Shizukanolide F | AG000Q81 | 0.005g |
| 120077-69-2 | ClC1=C(Br)C=CC(C=O)=C1 | 4-Bromo-3-chlorobenzaldehyde | AG000Q8J | 209.5g |
| 120077-68-1 | OCC1=CC=C(Br)C(Cl)=C1 | (4-Bromo-3-Chlorophenyl)Methanol | AG000Q8K | 75g |
| 120075-24-3 | COc1cc(C)c(c(C)c1C)S(=O)(=O)NC(=N)NCCC[C@@H](NC(=O)OCC1c2ccccc2-c2ccc | Fmoc-D-Arg(Mtr)-OH | AG000Q8Q | 75g |
| 12007-99-7 | B#[Ca](#B)(#B)(#B)(#B)#B | Calcium boride (CaB6) | AG000Q8V | 5000g |
| 12007-89-5 | [O-]B(OB=O)OB(OB=O)OB=O.[NH4+] | Ammonium Pentaborate | AG000Q8X | 2500g |
| 12007-62-4 | [O-]B([O-])[O-].[O-]B([O-])[O-].[Mg+2].[Mg+2].[Mg+2] | Boron magnesium oxide (B4MgO7) | AG000Q8Y | 75g |
| 12007-60-2 | [O-]B1OB2OB([O-])OB(O2)O1.[Li+].[Li+] | Lithium Tetraborate | AG000Q8Z | 200g |
| 12007-58-8 | [O-]B(O)[O-].OB(O)O.OB(O)O.OB(O)O.[NH4+].[NH4+] | Ammonium boron oxide ((NH4)2B4O7) | AG000Q90 | 500g |
| 1200828-74-5 | O=C(OCC)C(Br)C1CC1 | Ethyl 2-bromo-2-cyclopropylacetate | AG000Q98 | 200g |
| 12008-29-6 | B12B3B4B2[Si]24B1B32 | Boron silicide (B6Si) | AG000Q9U | 114g |
| 119967-49-6 | OCCOC1=CN=CC=C1 | 2-(Pyridin-3-yloxy)ethanol | AG000PWX | 30g |
| 1199773-36-8 | Clc1cnc(c(c1)Br)N1CCOCC1 | 3-Bromo-5-chloro-2-morpholinopyridine | AG000PX6 | 15g |
| 1199773-31-3 | O=C(C1=CC=C2N=CN(CC3=CC=CC=C3)C2=C1)OC | Methyl 1-benzylbenzoimidazole-6-carboxylate | AG000PXB | 2g |
| 1199773-28-8 | NC1=NC=C(Cl)C(C)=C1Br | 2-AMINO-3-BROMO-5-CHLORO-4-METHYLPYRIDINE | AG000PXE | 30g |
| 1199773-24-4 | FC1=CC(Br)=CC(N2CCCC2)=C1 | 1-Bromo-3-fluoro-5-pyrrolidinobenzene | AG000PXI | 40g |
| 1199773-21-1 | Cc1nc(ccc1Br)N1CCOCC1 | 3-Bromo-2-methyl-6-morpholinopyridine | AG000PXL | 5g |
| 1199782-87-0 | IC1=CC=CC2=C1CCCC2=O | 5-Iodo-3,4-dihydronaphthalen-1(2H)-one | AG000PXT | 0.25g |
| 1199782-74-5 | O=C1C(C(F)=CC(OC)=C2)=C2CC1 | 7-Fluoro-5-methoxy-2,3-dihydro-1H-inden-1-one | AG000PXU | 9g |
| 1199782-67-6 | O=C1CCOC2=C1C(Br)=CC=C2 | 5-Bromo-4-chromanone | AG000PXX | 20g |
| 1199773-75-5 | N#CC1CNCCC1.[H]Cl | Piperidine-3-carbonitrile hydrochloride | AG000PY3 | 50g |
| 1199773-43-7 | FC(Sc1ccc(cc1)OS(=O)(=O)C(F)(F)F)(F)F | 4-((Trifluoromethyl)thio)phenyl trifluoromethanesulfonate | AG000PYD | 40g |
| 1199794-51-8 | CC(C)(C)OC(=O)N1CC(=O)NC2(CC2)C1 | tert-Butyl 5-oxo-4,7-diazaspiro[2.5]octane-7-carboxylate | AG000PYI | 0.4g |
| 1199783-16-8 | IC1=C2C(=O)COC2=CC=C1 | 4-Iodobenzofuran-3(2H)-one | AG000PYK | 3g |
| 1199782-98-3 | O=C1CCC2=C1C=C(O)C=C2Cl | 4-Chloro-6-hydroxy-2,3-dihydro-1H-inden-1-one | AG000PYP | 2g |
| 120103-18-6 | OC1=CC(F)=C([N+]([O-])=O)C=C1F | 2,5-Difluoro-4-nitrophenol | AG000QBG | 40g |
| 120100-15-4 | O=C(OC)C1=CC=CC(N)=C1Cl | Methyl 3-amino-2-chlorobenzoate | AG000QBK | 100g |
| 1201192-62-2 | O=C(N1CC(C(OC)=O)C(C)CC1)OC(C)(C)C | 1-tert-Butyl 3-methyl 4-methylpiperidine-1,3-dicarboxylate | AG000QC0 | 15g |
| 1201187-44-1 | O=C(OC(C)(C)C)NC1=CN=C(N(S(=O)(C2=CC=C(C)C=C2)=O)C=C3)C3=N1 | tert-butyl N-[5-(4-methylbenzenesulfonyl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]car | AG000QC2 | 175.9g |
| 1201187-18-9 | N#CC1=CN=C(Cl)C=C1C(F)(F)F | 6-Chloro-4-(trifluoromethyl)nicotinonitrile | AG000QC3 | 15g |
| 1201186-54-0 | [S](=O)(=O)(C1=CC=C(C)C=C1)[N]3C2=NC=C(N=C2C=C3)Br | N-Tosyl-5-bromo-4,7-diazaindole | AG000QC4 | 200g |
| 1201149-19-0 | BrC1=CC(=C(N)C(=C1)I)F | 4-Bromo-2-fluoro-6-iodoaniline | AG000QC5 | 3g |
| 120118-14-1 | N#CC1=NC(Cl)=C(C2=CC=C(C)C=C2)N1 | 4-Chloro-5-(p-tolyl)-1H-imidazole-2-carbonitrile | AG000QC8 | 9.95g |
| 120118-03-8 | BrC1NC(C#N)=NC=1 | 5-Bromo-1H-imidazole-2-carbonitrile | AG000QC9 | 1g |
| 120109-75-3 | NC=1SC=C(C1C(=O)OCC)C1CC1 | Ethyl 2-amino-4-cyclopropylthiophene-3-carboxylate | AG000QCF | 5g |
| 1201194-56-0 | O=C(O)CC1=NC=C(C)C=C1.[H]Cl | 2-(5-Methylpyridin-2-yl)acetic acid hydrochloride | AG000QCQ | 75g |
| 120128-20-3 | N1C2C(=CC=CC=2)C=CC=1COC1=CC=C(OCC2=CC=CC=C2CC2=NN=NN2)C=C1 | RG-12525 | AG000QCS | 0.01g |
| 120122-47-6 | O=[N+](C1=CN(C)C(C(C(Cl)(Cl)Cl)=O)=C1)[O-] | 2,2,2-Trichloro-1-(1-methyl-4-nitro-1H-pyrrol-2-yl)ethanone | AG000QCX | 50g |
| 120121-07-5 | OC(C1=C(S)C=CC(F)=C1)=O | 5-Fluoro-2-mercaptobenzoic acid | AG000QCZ | 0.3g |
| 120121-01-9 | C[C@@H](O)C1=CC=CC(Cl)=C1 | (R)-1-(3-Chlorophenyl)ethanol | AG000QD0 | 200g |
| 120120-26-5 | FC([Si](CC)(CC)CC)(F)F | TRIETHYL(TRIFLUOROMETHYL)SILANE | AG000QD2 | 50g |
| 1260643-15-9 | ClC1OC2=C(C=CC(=C2)Br)N=1 | 6-Bromo-2-chlorobenzoxazole | AG000QXG | 20g |
| 1260641-86-8 | O=C(C1NCCC2=C1C=CC(F)=C2)O | 6-Fluoro-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid | AG000QXJ | 1g |
| 1260641-46-0 | O=C(C(CC1)N(C(OC(C)(C)C)=O)CC1=O)O | 1-(tert-Butoxycarbonyl)-5-oxopiperidine-2-carboxylic acid | AG000QXL | 1g |
| 1260640-88-7 | O=C(NC(C(=O)O)Cc1ccnc2c1cccc2)OCc1ccccc1 | 3-(Benzyloxy)-3-oxo-2-(quinolin-4-ylmethyl)propanoic acid | AG000QXM | 1g |
| 1260639-22-2 | CCOC(=O)C1CCN1C(=O)OC(C)(C)C | 1-TERT-BUTYL 2-ETHYL AZETIDINE-1,2-DICARBOXYLATE | AG000QXT | 1g |
| 1260649-67-9 | FC(F)(F)C1=CC=C(Br)C2=C1C=CN2 | 7-Bromo-4-(Trifluoromethyl)-1H-Indole | AG000QYD | 10g |
| 1260649-54-4 | CC(OC(NC1=CN=C(CC(O)=O)C=C1)=O)(C)C | (5-{[(tert-butoxy)carbonyl]amino}pyridin-2-yl)acetic acid | AG000QYF | 3g |
| 1260648-73-4 | O=C(C1=NNC2=CC=CN=C21)O | 1H-Pyrazolo[4,3-b]pyridine-3-carboxylic acid | AG000QYK | 7g |
| 1260657-31-5 | FC1=C2C(N=CC=C2)=C(C=O)C=C1 | 5-Fluoroquinoline-8-carbaldehyde | AG000QYU | 2g |
| 1260657-19-9 | NC1=C2C=CC=C(Br)C2=NC=N1 | 8-Bromoquinazolin-4-amine | AG000QYV | 25g |
| 1260656-87-8 | FC(F)(F)C1=NC2=C(O1)C=C(Br)C=N2 | 6-Bromo-2-(trifluoromethyl)oxazolo[4,5-b]pyridine | AG000QZ0 | 0.75g |
| 1260656-58-3 | O=C(C1=NN(CC2=CC=C(OC)C=C2)C=C1I)OC | Methyl 4-iodo-1-(4-methoxybenzyl)-1H-pyrazole-3-carboxylate | AG000QZ4 | 10g |
| 1260664-44-5 | O=C(N1CC(S(=O)(Cl)=O)CCC1)OC(C)(C)C | tert-Butyl 3-(chlorosulfonyl)piperidine-1-carboxylate | AG000QZD | 1g |
| 1260664-24-1 | COc1ccc2cn[nH]c2n1 | 6-methoxy-1H-pyrazolo[3,4-b]pyridine | AG000QZH | 5g |
| 1260664-22-9 | O=C(C1=NNC2=C1C=C(Cl)N=C2)O | 5-Chloro-1H-pyrazolo[3,4-c]pyridine-3-carboxylic acid | AG000QZI | 20g |
| 1260663-96-4 | CC1=CN=C(OC)C=C1N | 2-Methoxy-5-methylpyridin-4-amine | AG000QZN | 20g |
| 1260088-72-9 | CC1(C)OCC2=C(Cl)N=C(Cl)N=C21 | 2,4-Dichloro-7,7-dimethyl-5,7-dihydrofuro[3,4-d]pyrimidine | AG000QRF | 2g |
| 1260088-68-3 | O=C(Nc1ccc(cc1)B1OC(C(O1)(C)C)(C)C)NC1COC1 | 1-(Oxetan-3-yl)-3-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)ure | AG000QRH | 0.5g |
| 1260374-05-7 | COCOC1=CC(C)=C(B(O)O)C=C1 | (4-(Methoxymethoxy)-2-methylphenyl)boronic acid | AG000QRU | 10g |
| 1260251-31-7 | FC1=CC2=C(C=C1)C(C[C@H]3N(C([C@@H](NC([C@@H](NC)C)=O)CC)=O)C[C@ | Birinapant | AG000QRV | 0.1g |
| 1260228-95-2 | CC1(C)C2=C(C3=CC(NC4=C5C=CC=C4)=C5C=C31)C=CC=C2 | 11,11-Dimethyl-5,11-dihydroindeno[1,2-b]carbazole | AG000QRY | 75g |
| 126030-73-7 | OC(=O)CC1=CNC2=C1C=C(F)C(F)=C2 | 2-(5,6-Difluoro-1H-indol-3-yl)acetic acid | AG000QS3 | 10g |
| 1260384-77-7 | IC1=CC2=C(NN=C2)C=C1F | 6-Fluoro-5-iodo-1H-indazole | AG000QSH | 500g |
| 1260384-41-5 | FC1=C(F)C=CC2=C1NN=C2 | 6,7-Difluoro-1H-indazole | AG000QSJ | 125g |
| 1260383-51-4 | CC(N1)=CC2=C1C=CC=C2F | 4-Fluoro-2-methyl-1H-indole | AG000QSO | 1g |
| 1260383-16-1 | N#CC1=CNC2=C1C(Cl)=NC=C2 | 4-Chloro-1H-pyrrolo[3,2-c]pyridine-3-carbonitrile | AG000QSR | 2g |
| 1260382-96-4 | N#CC1=CNC2=CC=C(Cl)N=C21 | 5-Chloro-1H-pyrrolo[3,2-b]pyridine-3-carbonitrile | AG000QST | 1.25g |
| 1260382-77-1 | ClC1=CC2=C(C=C1Br)C=NN2 | 5-Bromo-6-chloro-1H-indazole | AG000QSW | 100g |
| 1260381-90-5 | N#CC1=CNC2=C1C=NC(Cl)=C2 | 6-Chloro-1H-pyrrolo[3,2-c]pyridine-3-carbonitrile | AG000QSY | 20g |
| 1260381-83-6 | FC1=CC(Br)=CC2=C1NN=C2 | 5-Bromo-7-Fluoro-1H-Indazole | AG000QSZ | 300g |
| 1260381-68-7 | OC1=CC=C2N=C(Br)C=CC2=C1 | 2-Bromoquinolin-6-Ol | AG000QT2 | 7g |
| 1260665-60-8 | O=C1C2=C(N=CC(Br)=C2)C=CN1 | 3-Bromo-1,6-naphthyridin-5(6H)-one | AG000R0G | 30g |
| 1260665-49-3 | Brc1cnc2cc[nH]c2n1 | 3-Bromo-5H-pyrrolo[2,3-b]pyrazine | AG000R0I | 0.5g |
| 1260665-41-5 | NC1=CC(=NC=C1C)C(=O)OC | Methyl 4-amino-5-methylpicolinate | AG000R0J | 2g |
| 1260665-09-5 | O=C(C1=CN(C(C)(C)C)N=N1)O | 1-tert-butyl-1H-1,2,3-triazole-4-carboxylic acid | AG000R0K | 150g |
| 1260664-94-5 | O=CC1=CC2=C(CNC2=O)C=C1 | 3-Oxoisoindoline-5-carbaldehyde | AG000R0M | 3g |
| 1260664-82-1 | CC1=C(Br)N=CC(Cl)=N1 | 2-Bromo-5-chloro-3-methylpyrazine | AG000R0N | 10g |
| 1260664-81-0 | ClC1=CN=C2C(NN=C2)=N1 | 6-Chloro-1H-pyrazolo[3,4-b]pyrazine | AG000R0O | 200g |
| 1260672-33-0 | O=C(C1=NC(Br)=CN1C)OCC | Ethyl 4-bromo-1-methyl-1H-imidazole-2-carboxylate | AG000R0U | 250g |
| 1260672-03-4 | O=C1COCC(N1)C1=CC=CC=C1 | 5-Phenylmorpholin-3-one | AG000R0V | 15g |
| 1260671-77-9 | ClC1=C2C(CCOC2)=NC=N1 | 4-chloro-5H,7H,8H-pyrano[4,3-d]pyrimidine | AG000R0W | 2g |
| 1260671-39-3 | O=C1NC=CC2=CC(Br)=NC=C12 | 6-Bromo-2,7-naphthyridin-1(2H)-one | AG000R0Z | 2g |
| 1260671-36-0 | ClC1=CN=CC2=C1C=NN2 | 4-Chloro-1H-pyrazolo[3,4-c]pyridine | AG000R10 | 0.85g |
| 1260671-35-9 | C1CNC2=C1N=C(C=C2)Br | 5-Bromo-2,3-dihydro-1H-pyrrolo[3,2-b]pyridine | AG000R11 | 6g |
| 1260671-28-0 | O=C(O)C1=C(F)C=NC(N)=C1 | 2-Amino-5-fluoroisonicotinic acid | AG000R12 | 25g |
| 1260670-03-8 | O=C(C1=CC=C(NN=C2)C2=N1)O | 1H-Pyrazolo[4,3-b]pyridine-5-carboxylic acid | AG000R14 | 10g |
| 1260670-01-6 | ClC1=CN=C2C(NN=C2)=C1 | 6-Chloro-1h-pyrazolo[4,3-b]pyridine | AG000R15 | 100g |
| 1260667-91-1 | O=CC1=C2N(CCC2)N=C1 | 5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole-3-carbaldehyde | AG000R17 | 5g |
| 1260615-87-9 | O=C(O)[C@@H](NC(OCC1C2=C(C3=C1C=CC=C3)C=CC=C2)=O)CC4=CC=CC(Cl)=C4 | N-Fmoc-2,3-dichloro-L-phenylalanine | AG000QW0 | 10g |
| 1260614-80-9 | O=C(O)[C@@H](NC(OCC1C2=CC=CC=C2C3=CC=CC=C13)=O)CC4=CC(Cl)=CC=C4Cl | Fmoc-2,5-dichloro-l-phenylalanine | AG000QW3 | 15g |
| 1260614-79-6 | O=C(N[C@@H](C(=O)O)Cc1cccc(c1Cl)Cl)OCC1c2ccccc2-c2c1cccc2 | D-Phenylalanine, 2,3-dichloro-N-[(9H-fluoren-9-ylmethoxy)carbonyl]- | AG000QW4 | 10g |
| 1260613-92-0 | [H]Cl.[H]Cl.C1(O[C@H]2CNCC2)=NC=CC=C1 | (R)-2-(Pyrrolidin-3-yloxy)pyridine dihydrochloride | AG000QW7 | 2g |
| 1260612-13-2 | O=C1N=C(CC(N2[C@@H](C)CC3=C2C=CC=C3)=O)NC(N4CCOCC4)=C1 | (S)-2-(2-(2-Methylindolin-1-yl)-2-oxoethyl)-6-morpholinopyrimidin-4(3H)-on | AG000QW8 | 0.025g |
| 1260612-08-5 | O=C(N1C[C@@H](F)[C@H](N)CC1)OC(C)(C)C | (3R,4R)-tert-Butyl 4-amino-3-fluoropiperidine-1-carboxylate | AG000QW9 | 10g |
| 1260611-32-2 | ClC[C@H]1OCCN(C1)C(=O)OC(C)(C)C | (S)-tert-Butyl 2-(chloromethyl)morpholine-4-carboxylate | AG000QWA | 15g |
| 1260609-97-9 | N[C@H]1CCOC2=C1C=C(F)C=C2.[H]Cl | (S)-6-Fluorochroman-4-amine HCl | AG000QWD | 10g |
| 1260609-30-0 | OC([C@H](NC(OCC1C2C(=CC=CC=2)C2C1=CC=CC=2)=O)CC1C=CC=C(F)C=1F)=O | Fmoc-D-2,3-difluorophenylalanine | AG000QWF | 1g |
| 1260637-54-4 | O=C(OC)C(N)C1CCOCC1.[H]Cl | Methyl 2-amino-2-(tetrahydro-2H-pyran-4-yl)acetate hydrochloride | AG000QWN | 15g |
| 1260619-38-2 | C[C@H]1NCCN(C(OC(C)(C)C)=O)CC1 | (R)-1-Boc-5-methyl-1,4-diazepane | AG000QWY | 1g |
| 1260619-37-1 | C[C@H]1CCN(C(=O)OC(C)(C)C)CCN1 | (S)-TERT-BUTYL 5-METHYL-1,4-DIAZEPANE-1-CARBOXYLATE | AG000QWZ | 1g |
| 1260616-94-1 | CC(C)(C)OC(=O)N1CC[C@H]1C(=O)CCl | (S)-TERT-BUTYL 2-(2-CHLOROACETYL)AZETIDINE-1-CARBOXYLATE | AG000QX3 | 3g |
| 126063-08-9 | FC(C(=O)NC1=CC=C(C=C1)I)(F)F | 2,2,2-Trifluoro-N-(4-iodophenyl)acetamide | AG000QX6 | 0.75g |
| 126062-63-3 | CC(OC(C1=CC(CBr)=CC=C1)=O)(C)C | tert-Butyl 3-(bromomethyl)benzoate | AG000QX7 | 2g |
| 1260643-32-0 | O=C(C1NCCC2=C1C=CC(Br)=C2)O | 6-Bromo-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid | AG000QXF | 3g |
| 126069-70-3 | FC(C1=CN2C(CNCC2)=N1)(F)F | 2-(trifluoromethyl)-5H,6H,7H,8H-imidazo[1,2-a]pyrazine | AG000R3G | 10g |
| 1260757-41-2 | OB(O)C1=C(Br)C(F)=CC=C1F | 6-Bromo-2,5-difluorophenylboronic acid | AG000R3N | 18g |
| 1260753-02-3 | O=C(C1=NC(Br)=CN1)O | 4-Bromo-1H-imidazole-2-carboxylic acid | AG000R3Q | 5g |
| 1260751-81-2 | BrC1=CC=CC2=C1ON=C2 | 7-bromo-1,2-benzoxazole | AG000R3T | 5g |
| 1260751-65-2 | O=C(OCC)C1=CC(F)=CC=C1C#N | Ethyl 2-cyano-5-fluorobenzoate | AG000R3U | 20g |
| 1260750-63-7 | BrCC1=C(C=C(C(=O)OC(C)(C)C)C=C1)F | tert-Butyl 4-(bromomethyl)-3-fluorobenzoate | AG000R3Z | 0.4g |
| 1260742-02-6 | O=C(OCC)C1=CC=C(N)C(OC(F)(F)F)=C1 | Ethyl 4-amino-3-(trifluoromethoxy)benzoate | AG000R46 | 15g |
| 1260760-86-8 | NC1=CC2=C(C=N1)C=CC(F)=C2 | 6-Fluoroisoquinolin-3-amine | AG000R48 | 1.5g |
| 1260760-22-2 | CON(C)C(=O)CCC(=O)OCC1=CC=CC=C1 | Benzyl 4-(methoxy(methyl)amino)-4-oxobutanoate | AG000R49 | 25g |
| 1260760-06-2 | C1=CC2=CC(=N)NC=C2C(=C1)Br | 8-Bromoisoquinolin-3-amine | AG000R4A | 8.25g |
| 1260760-00-6 | O=C1NC2=C(C=C(I)C=C2)C(O)=C1 | 4-Hydroxy-6-iodo-2-quinolinone | AG000R4B | 4g |
| 1260759-82-7 | C1=CC(=C2C(=CNC2=C1)C#N)F | 4-Fluoro-1H-indole-3-carbonitrile | AG000R4F | 6g |
| 1260759-77-0 | OC1=C2C=CC(OC(F)(F)F)=CC2=NC=N1 | 4-Hydroxy-7-(trifluoromethoxy)quinazoline | AG000R4G | 4g |
| 1260759-38-3 | ClC1=C2C=CC(=CC2=NC=N1)C#N | 4-Chloroquinazoline-7-carbonitrile | AG000R4K | 20g |
| 1260758-52-8 | COC1=CC=CC2=C1NN=C2Cl | 3-Chloro-7-methoxy-1H-indazole | AG000R4T | 2g |
| 126076-76-4 | C1=CC=C(C=C1)S(=O)(=O)C2=CC=CC=C2C=O | 2-(PHENYLSULFONYL)BENZALDEHYDE | AG000R4V | 25g |
| 1260381-52-9 | CC1=CC2=C(NC=C2)C=N1 | 5-Methyl-1H-pyrrolo[2,3-c]pyridine | AG000QT4 | 1g |
| 1260422-99-8 | CC1N(C(OC(C)(C)C)=O)CCCNC1 | tert-Butyl 2-methyl-1,4-diazepane-1-carboxylate | AG000QT7 | 5g |
| 1260387-16-3 | COC1(C(O)=O)CCNCC1.Cl | 4-Methoxypiperidine-4-carboxylic acid hydrochloride | AG000QT9 | 5g |
| 1260387-11-8 | N#CC1=CNC2=C1C=NC=C2Br | 7-Bromo-1H-pyrrolo[3,2-c]pyridine-3-carbonitrile | AG000QTA | 1g |
| 1260386-78-4 | BrC1=CC2=C(N=C1)C(=CN2)C#N | 6-Bromo-1H-pyrrolo[3,2-b]pyridine-3-carbonitrile | AG000QTF | 9g |
| 1260386-69-3 | COC(=O)c1cc2c(cn1)CC(=O)N2 | Methyl 5-aza-2-oxindole-6-carboxylate | AG000QTH | 1g |
| 1260386-47-7 | C(=O)(O)c1cc2c([nH]1)cc(cn2)Br | 6-Bromo-1H-pyrrolo[3,2-b]pyridine-2-carboxylic acid | AG000QTI | 15g |
| 1260385-91-8 | FC1=CNC2=NC=CC(Br)=C21 | 4-BROMO-3-FLUORO-1H-PYRROLO[2,3-B]PYRIDINE | AG000QTN | 1g |
| 1260385-79-2 | CCOC(=O)c1cc2c([nH]1)nccc2C | Ethyl 4-methyl-1H-pyrrolo[2,3-b]pyridine-2-carboxylate | AG000QTO | 5g |
| 1260385-62-3 | Oc1cccc2sc(Br)nc12 | 2-BROMOBENZO[D]THIAZOL-4-OL | AG000QTQ | 1.25g |
| 1260385-57-6 | N#CC1=CNC2=C1C=NC=C2 | 1H-Pyrrolo[3,2-c]pyridine-3-carbonitrile | AG000QTR | 2g |
| 1260385-22-5 | COc1cnc2c(c1F)cc[nH]2 | 1H-Pyrrolo[2,3-b]pyridine, 4-fluoro-5-methoxy- | AG000QTS | 0.2g |
| 1260533-36-5 | C(C)C=1C=C(C(=O)N)C=CC1N1N=C(C=2C1=NC=CC2N2C=NC(=C2)C=2C=NN(C2)C) | 3-Ethyl-4-(3-isopropyl-4-(4-(1-methyl-1H-pyrazol-4-yl)-1H-imidazol-1-yl)-1H- | AG000QTU | 0.1g |
| 1260529-67-6 | C(=O)(O)c1c2c(scn2)ccc1 | Benzo[d]thiazole-4-carboxylic acid | AG000QTW | 20g |
| 1260518-74-8 | FC(C1=CC=C(B(O)O)C(OCC)=C1)(F)F | 2-Ethoxy-4-trifluoromethylphenylboronic acid | AG000QTX | 0.5g |
| 1260494-16-3 | O=C(N1CC2=C(CCC1)NC3=C2C=CC(Br)=C3)OC(C)(C)C | TERT-BUTYL 8-BROMO-3,4,5,6-TETRAHYDROAZEPINO[4,3-B]INDOLE-2(1H)-CAR | AG000QTZ | 0.75g |
| 126053-15-4 | OC1CCC2=C(Cl)C=CN=C21 | 4-CHLORO-6,7-DIHYDRO-5H-CYCLOPENTA[B]PYRIDIN-7-OL | AG000QU2 | 1g |
| 1260593-39-2 | O=C(N1[C@@H](C(OC)=O)CC1)OC(C)(C)C | (R)-1-Boc-azetidine-2-carboxylic acid methyl ester | AG000QUJ | 100g |
| 1260591-66-9 | O=C(N1[C@@H](C(OC(C)(C)C)=O)CC(C1)=O)OC(C)(C)C | (R)-Di-tert-Butyl 4-oxopyrrolidine-1,2-dicarboxylate | AG000QUK | 1400g |
| 1260590-51-9 | C[C@H]1[C@@H](N(C)C2=C3C(NC=C3)=NC=N2)CNCC1.[H]Cl | N-Methyl-N-((3R,4R)-4-methylpiperidin-3-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-a | AG000QUO | 10g |
| 1260589-26-1 | O[C@H]1CN(CCOC1)C(=O)OC(C)(C)C | (S)-tert-butyl 6-hydroxy-1,4-oxazepane-4-carboxylate | AG000QUT | 10g |
| 1260587-51-6 | O=C(N1[C@H](C(OCC)=O)CCC(C1)=O)OC(C)(C)C | (S)-1-Tert-Butyl 2-Ethyl 5-Oxopiperidine-1,2-Dicarboxylate | AG000QUV | 3g |
| 126058-97-7 | OC1=C(F)C=C(N)C=C1F | 4-Amino-2,6-difluorophenol | AG000QUY | 125g |
| 126058-00-2 | O=C(O)/C(C#N)=C/C1=CC=CC(OC)=C1 | 2-Cyano-3-(3-methoxyphenyl)acrylic acid | AG000QUZ | 15g |
| 126055-32-1 | Cl.CN1CCN(CCCl)CC1 | 1-(2-Chloroethyl)-4-methylpiperazine hydrochloride | AG000QV1 | 50g |
| 1260605-95-5 | O=C(N[C@@H](CC1=CC(Cl)=CC(Cl)=C1)C(O)=O)OCC2C3=C(C4=C2C=CC=C4)C=CC | 3,5-Dichloro-N-Fmoc-L-phenylalanine | AG000QV9 | 10g |
| 1260605-30-8 | O=C(O)[C@H](CC1=CC=CC(F)=C1F)NC(OCC2C3=CC=CC=C3C4=CC=CC=C24)=O | (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(2,3-difluorophenyl)pr | AG000QVB | 5g |
| 1260596-66-4 | OC([C@H](NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O)CC1=C(Cl)C=CC(Cl)=C1)= | (2R)-3-(2,5-dichlorophenyl)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)p | AG000QVP | 10g |
| 1261232-32-9 | O=C(N1C(COC2=NC(C)=CC(C)=N2)CCCC1)OC(C)(C)C | tert-Butyl 2-(((4,6-dimethylpyrimidin-2-yl)oxy)methyl)piperidine-1-carboxyl | AG000ROR | 0.2g |
| 1261232-15-8 | O=C(N1C(COC2=NC=C(Cl)C=N2)CCC1)OC(C)(C)C | tert-Butyl 2-(((5-chloropyrimidin-2-yl)oxy)methyl)pyrrolidine-1-carboxylate | AG000ROT | 0.3g |
| 1261231-94-0 | CN(CC1=CC=CC(F)=C1)C2CCNCC2.[H]Cl | N-(3-Fluorobenzyl)-N-methylpiperidin-4-amine hydrochloride | AG000ROU | 0.3g |
| 1261231-92-8 | BrC1=CC=CC(OCC2N(C(OC(C)(C)C)=O)CCC2)=N1 | tert-Butyl 2-(((6-bromopyridin-2-yl)oxy)methyl)pyrrolidine-1-carboxylate | AG000ROV | 0.3g |
| 1261231-33-7 | OC1CCN(C2=NC(SC)=NC(Cl)=C2)CC1 | 1-(6-Chloro-2-(methylthio)pyrimidin-4-yl)piperidin-4-ol | AG000ROW | 5g |
| 1261268-92-1 | FC(Oc1ccccc1c1n[nH]nn1)(F)F | 2H-Tetrazole, 5-[2-(trifluoromethoxy)phenyl]- | AG000RP0 | 25g |
| 1261268-91-0 | CC(N1N=C2C(C=C(C=C2)N)=C1)C | 5-AMino-2-isopropyl-2H-indazole | AG000RP1 | 2g |
| 1261268-85-2 | OC(=O)C(O)=O.CC(=O)CC(=O)OCCN1CCN(CC1)C(C1=CC=CC=C1)C1=CC=CC=C1 | 2-(4-Diphenylmethyl-1-piperazinyl)ethyl Acetoacetate Oxalate | AG000RP6 | 500g |
| 1261268-84-1 | CCOC(=O)c1cccc(c1)-c1cnco1 | ETHYL 3-(5-OXAZOLYL)BENZOATE | AG000RP7 | 10g |
| 1261268-83-0 | CS(=O)(=O)NC1=CC=C(C=C1)C1=NNN=N1 | 5-[4-(METHYLSULFONAMIDO)PHENYL]-2H-TETRAZOLE | AG000RP8 | 125g |
| 1261268-77-2 | N#CC1=C(O)N=CC=C1C(F)(F)F | 2-Hydroxy-4-(trifluoromethyl)nicotinonitrile | AG000RP9 | 20g |
| 1261235-31-7 | O=C(N1C[C@H](OC2=NC=C(C)C(Cl)=N2)CC1)OC(C)(C)C | (R)-tert-Butyl 3-((4-chloro-5-methylpyrimidin-2-yl)oxy)pyrrolidine-1-carboxy | AG000RPJ | 0.3g |
| 1261235-16-8 | O=C(N1CCC(OC2=NN=C(C)C=C2)CC1)OC(C)(C)C | tert-Butyl 4-((6-methylpyridazin-3-yl)oxy)piperidine-1-carboxylate | AG000RPK | 0.75g |
| 1261234-83-6 | ClC1=CC=C(C=C1Cl)CO[C@H]2CNCC2.[H]Cl | (R)-3-((3,4-Dichlorobenzyl)oxy)pyrrolidine hydrochloride | AG000RPL | 0.3g |
| 1261295-10-6 | O=S(C1=CC=CC(B2OC(C)(C)C(C)(C)O2)=C1C)(N)=O | 2-Methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamid | AG000RPQ | 5g |
| 1261269-84-4 | NC1=NC(Cl)=C(Br)C=C1Br | 2-Amino-3,5-dibromo-6-chloropyridine | AG000RPR | 125g |
| 1261269-82-2 | BrC1=C(OC)C(Br)=CN=C1N | 3,5-Dibromo-4-methoxypyridin-2-amine | AG000RPS | 9g |
| 1261269-66-2 | O=CC1=C(Cl)N=C(Cl)C=C1Cl | 2,4,6-Trichloronicotinaldehyde | AG000RPU | 50g |
| 1260771-53-6 | NC1=CC=C(NC=C2)C2=N1.[H]Cl | 1H-Pyrrolo[3,2-b]pyridin-5-amine hydrochloride | AG000R7L | 25g |
| 1260771-44-5 | Clc1cncc2cc[nH]c12 | 7-Chloro-1H-pyrrolo[3,2-c]pyridine | AG000R7M | 5g |
| 1260771-31-0 | ClC1=C(Cl)C(C2CNCC2)=CC=C1 | 3-(2,3-Dichlorophenyl)pyrrolidine | AG000R7N | 0.3g |
| 1260780-23-1 | CC(OC(N1CC(C(F)(F)F)(C(O)=O)CC1)=O)(C)C | 3-Trifluoromethyl-pyrrolidine-1,3-dicarboxylic acid 1-tert-butyl ester | AG000R7W | 394g |
| 1260779-54-1 | NC1=CC=C(Br)C2=C1CNCC2 | 5-Bromo-1,2,3,4-tetrahydroisoquinolin-8-amine | AG000R7X | 10g |
| 1260779-19-8 | NCC1(C)CC1.Cl | (1-methylcyclopropyl)methanamine hydrochloride | AG000R7Y | 15g |
| 1260778-66-2 | O=C1N(C)C2=CC=C(Br)C=C2OC1 | 7-Bromo-4-methyl-2H-benzo[b][1,4]oxazin-3(4H)-one | AG000R85 | 15g |
| 1260777-93-2 | O=C(C1=CC([N+]([O-])=O)=CC=C1C#N)OC | Methyl 2-cyano-5-nitrobenzoate | AG000R8A | 10g |
| 1260785-45-2 | CC(C1=CC=C(O)C(OC)=C1[N+]([O-])=O)=O | 1-(4-Hydroxy-3-Methoxy-2-Nitrophenyl)Ethanone | AG000R8H | 0.75g |
| 1260785-25-8 | NC1=CC=C2N=CC=C(Br)C2=C1 | 4-Bromoquinolin-6-amine | AG000R8K | 6g |
| 1260784-53-9 | O=C(C1=NC=CC(Cl)=C1F)OCC | Ethyl 3-fluoro-2-methylisonicotinate | AG000R8N | 5g |
| 1260787-89-0 | Cl.Cl.NNCC1=CC(Cl)=CC=C1 | (3-Chlorobenzyl)hydrazine dihydrochloride | AG000R9E | 30g |
| 1260787-67-4 | ClC1=C2N=C(Br)C=NC2=NC=N1 | 6-Bromo-4-chloropteridine | AG000R9H | 3g |
| 1260793-40-5 | COC(C1=CC([N+]([O-])=O)=C(N)C(OC)=C1)=O | Methyl 4-Amino-3-methoxy-5-nitrobenzoate | AG000R9S | 15g |
| 1260793-39-2 | ClC1N=C(NC(=O)OC(C)(C)C)C(Br)=CC=1 | tert-Butyl (3-bromo-6-chloropyridin-2-yl)carbamate | AG000R9T | 1g |
| 1260790-92-8 | FC1=C(CCBr)C(F)=CC=C1 | 2-(2-bromoethyl)-1,3-difluorobenzene | AG000RA1 | 5g |
| 1260803-93-7 | CC(C1=CC=C(N2C(=O)COCC2)C=C1)=O | 4-(4-Acetylphenyl)morpholin-3-one | AG000RCG | 0.9g |
| 1260812-97-2 | CC1=NC2=C(C=CN2)N=C1Br | 2-Bromo-3-methyl-5H-pyrrolo[2,3-b]pyrazine | AG000RCI | 25g |
| 1260811-97-9 | NC1=NN2C=CC(C(F)(F)F)=CC2=N1 | 7-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine | AG000RCN | 2g |
| 1260811-82-2 | O=C(C1=CC=C(C2=CC=C(C#N)C(F)=C2)C=C1)O | 4′-Cyano-3′-fluorobiphenyl-4-carboxylic acid | AG000RCO | 1.75g |
| 1260811-66-2 | O=C1NC2=C(C(Cl)=NC=C2)OC1 | 5-Chloro-1h-pyrido[3,4-b][1,4]oxazin-2(3h)-one | AG000RCP | 0.5g |
| 1260811-27-5 | C12=CC=C(CNCC3=CC=C4OCCOC4=C3)C=C1OCCO2 | Bis((2,3-dihydrobenzo[b][1,4]dioxin-6-yl)methyl)amine | AG000RCR | 0.3g |
| 1260810-61-4 | O=C1C(Br)=NC(C)=CN1 | 3-BROMO-5-METHYLPYRAZIN-2(1H)-ONE | AG000RCU | 1.75g |
| 1260810-52-3 | CC1=NC(I)=NC=C1Cl | 5-Chloro-2-iodo-4-methylpyrimidine | AG000RCV | 0.5g |
| 1260810-02-3 | BrC1=CN2C(C=C1)=NN=C2C1=CC=CC=C1 | 6-bromo-3-phenyl-[1,2,4]triazolo[4,3-a]pyridine | AG000RCW | 6g |
| 1260809-91-3 | C1=CC(=C(C=C1CCBr)Cl)F | 4-(2-Bromoethyl)-2-chloro-1-fluorobenzene | AG000RCY | 92g |
| 1260807-99-5 | O=C(C1=NC2=CC(Br)=CC=C2C=C1N)OCC | Ethyl 3-amino-7-bromoquinoline-2-carboxylate | AG000RD4 | 10g |
| 1260817-77-3 | O=C(OC(C)(C)C)NC1C(CC1)=O | tert-Butyl n-(2-oxocyclobutyl)carbamate | AG000RD8 | 5g |
| 1260817-66-0 | FC(C1=C(Br)N2N=CC=CC2=N1)(F)F | 3-Bromo-2-(trifluoromethyl)imidazo[1,2-b]pyridazine | AG000RD9 | 2g |
| 1260813-10-2 | COC1=CC=CC(C(CCl)=O)=N1 | 2-Chloro-1-(6-methoxypyridin-2-yl)ethanone | AG000RDU | 0.2g |
| 1260825-69-1 | ClC1=CC2=NC(Br)=CN2C=C1 | 2-Bromo-7-chloroimidazo[1,2-a]pyridine | AG000REB | 3g |
| 1259489-90-1 | CC(C)(C)OC(=O)N1CCC2(CCOCC2)CC1 | 3-Oxa-9-azaspiro[5.5]undecane-9-carboxylic acid tert-butyl ester | AG000QL5 | 14g |
| 1259479-81-6 | NC1=C(N)N=C(Cl)C=N1 | 5-Chloropyrazine-2,3-diamine | AG000QL6 | 0.3g |
| 1259477-39-8 | Nc1nc(F)c(Br)cc1Br | 3,5-Dibromo-6-fluoropyridin-2-amine | AG000QLA | 72.9g |
| 125962-80-3 | O=C1CCC([C@H]2CC[C@H](C3=CC=C(C)C=C3)CC2)CC1 | trans-4′-(p-tolyl)-[1,1′-Bi(cyclohexan)]-4-one | AG000QLB | 300g |
| 125961-82-2 | CC(C1=CC=C(OCCCSC(C=CC(C(C)=O)=C2O)=C2CCC)C(CCC)=C1OCCCC(O)=O)=O | MN-001 | AG000QLF | 0.001g |
| 125973-56-0 | O=C(O)C1=CC=C(NC(C2=CC([Si](C)(C)C)=CC([Si](C)(C)C)=C2)=O)C=C1 | Amsilarotene | AG000QLS | 1.5g |
| 125971-96-2 | C1(=CC=CC=C1)NC(C(C(C(C)C)=O)C(C(=O)C2=CC=C(C=C2)F)C3=CC=CC=C3)=O | 2-(2-(4-Fluorophenyl)-2-oxo-1-phenylethyl)-4-methyl-3-oxo-N-phenylpenta | AG000QLW | 10000g |
| 125971-95-1 | O=C(OC(C)(C)C)C[C@@H]1OC(C)(C)O[C@H](CCN2C(C3=CC=C(F)C=C3)=C(C4=CC | tert-Butyl 2-((4R,6R)-6-(2-(2-(4-fluorophenyl)-5-isopropyl-3-phenyl-4-(pheny | AG000QLX | 400g |
| 125971-94-0 | O=C(OC(C)(C)C)C[C@@H]1OC(C)(C)O[C@H](CC#N)C1 | (4R,6R)-tert-Butyl-6-cyanomethyl-2,2-dimethyl-1,3-dioxane-4-acetate | AG000QLY | 1000g |
| 125971-57-5 | CC(C)C(/C(C(NC1=CC=CC=C1)=O)=C/C2=CC=CC=C2)=O | 2-Benzylidene isobutyryl acetanilide | AG000QM0 | 4g |
| 125969-54-2 | Cl.CN(C)CC=O | (Dimethylamino)acetaldehyde hydrochloride | AG000QM2 | 50g |
| 1259965-62-2 | CC1=CC(F)=C(CC(C(O)=O)N)C=C1 | 2-Amino-3-(2-fluoro-4-methylphenyl)propanoic acid | AG000QN6 | 10g |
| 1259952-24-3 | CN1CCNC2=C1C=CC=C2.[H]Cl.[H]Cl | 1-Methyl-1,2,3,4-tetrahydro-quinoxaline DiHCl | AG000QNC | 2g |
| 1259933-16-8 | O1C2=CC3[C@@]4(C5=C(N(CC6=CC=C(C(F)(F)F)O6)C4=O)C=CC=C5)COC=3C=C2O | Funapide | AG000QND | 0.01g |
| 543739-84-0 | O=C(C1=C(C(F)(F)F)NN=C1)O | 5-(Trifluoromethyl)-1H-pyrazole-4-carboxylic acid | AG000QNF | 50g |
| 1260667-67-1 | O=C(C1=NC(Br)=CN=C1O)O | 6-Bromo-3-hydroxypyrazine-2-carboxylic acid | AG000R18 | 15g |
| 1260667-65-9 | NC1=NC=C(Cl)C(I)=C1 | 5-Chloro-4-iodopyridin-2-amine | AG000R19 | 25g |
| 1260676-79-6 | N#CC1=CN=CN=C1C(F)(F)F | 4-(Trifluoromethyl)pyrimidine-5-carbonitrile | AG000R1H | 3g |
| 1260676-14-9 | O=C(C1=CC2=C(Cl)C=C(Cl)N=C2C=C1)OC | Methyl 2,4-dichloroquinoline-6-carboxylate | AG000R1M | 8g |
| 1260674-38-1 | OCC1=NOC(C(F)(F)F)=N1 | [5-(Trifluoromethyl)-1,2,4-oxadiazol-3-yl]methanol | AG000R1V | 1.25g |
| 1260672-72-7 | ClC1=CC2=C(C=N1)C(I)=NN2 | 6-Chloro-3-Iodo-1H-Pyrazolo[4,3-C]Pyridine | AG000R24 | 25g |
| 1260682-35-6 | BrC1=CN=C(C2=CC=NC=C2)N1 | 4-(5-Bromo-1H-imidazol-2-yl)pyridine | AG000R25 | 0.25g |
| 1260682-15-2 | OCC1=C(Cl)N=C(Cl)N=C1Cl | (2,4,6-Trichloropyrimidin-5-yl)methanol | AG000R26 | 7g |
| 1260679-52-4 | Cl.NCC(=O)C1=CC(F)=C(Br)C=C1 | 2-Amino-1-(4-bromo-3-fluorophenyl)ethanone hydrochloride | AG000R2E | 0.75g |
| 1260677-91-5 | NC1=CC(C(F)(F)F)=C(C#C)C=C1 | 4-Ethynyl-3-(trifluoromethyl)aniline | AG000R2O | 0.5g |
| 1260677-07-3 | ClC1=NOC2=C(Br)C=CC=C12 | 7-Bromo-3-chlorobenzo[d]isoxazole | AG000R2Q | 10g |
| 1260676-89-8 | O=C(C1=CC=C(C(F)(F)F)C2=C1CC(N2)=O)OC | Methyl 2-oxo-7-(trifluoromethyl)indoline-4-carboxylate | AG000R2R | 0.75g |
| 1260740-53-1 | O=C(C1=CN(C2=CC=C(C(F)(F)F)C=C2)N=C1)O | 1-[4-(Trifluoromethyl)phenyl]pyrazole-4-carboxylic Acid | AG000R2Y | 5g |
| 126070-20-0 | OC1=CC=C(CO[Si](C)(C(C)(C)C)C)C=C1 | 4-(((tert-Butyldimethylsilyl)oxy)methyl)phenol | AG000R3D | 125g |
| 1260825-38-4 | O=C(C1=CC=NC2=CC(O)=CC=C12)OC | Methyl 7-hydroxyquinoline-4-carboxylate | AG000REC | 2g |
| 1260836-58-5 | C(OCCON)(C)(C)C.Cl | O-(2-tert-Butoxyethyl)hydroxylamine hydrochloride | AG000REZ | 6g |
| 1260850-28-9 | NC1=NC(Br)=C(N)C=C1 | 6-Bromopyridine-2,5-diamine | AG000RFA | 9g |
| 1260849-23-7 | O=C(OCC)C1=C(F)C=C(OC)C=C1F | Ethyl 2,6-difluoro-4-methoxybenzoate | AG000RFD | 4g |
| 1260848-51-8 | O=C(OC)C1=CC([N+]([O-])=O)=C(N)C=C1C | Methyl 4-amino-2-methyl-5-nitrobenzoate | AG000RFF | 2g |
| 1260848-49-4 | Ic1[nH]c2c(c1)cc(cn2)Cl | 5-Chloro-2-iodo-1H-pyrrolo[2,3-b]pyridine | AG000RFG | 7g |
| 1260847-61-7 | ClC1=C(Br)C=C2N=CN=C(Cl)C2=C1 | 7-Bromo-4,6-dichloroquinazoline | AG000RFH | 6g |
| 1260847-57-1 | Cc1ccnc2c1NCCN2 | Pyrido[2,3-b]pyrazine, 1,2,3,4-tetrahydro-8-methyl- | AG000RFI | 5g |
| 1260843-59-1 | BrC1=C(C(=CN=C1)F)Br | 3,4-dibromo-5-fluoropyridine | AG000RFP | 5g |
| 1260843-26-2 | O=C(OC(C)(C)C)NCC1=NC=CC=N1 | 2-(BOC-AMINOMETHYL)PYRIMIDINE | AG000RFQ | 50g |
| 1260840-42-3 | O=C(C1=NN=C2C=CC(Br)=CN21)OCC | Ethyl 6-bromo-[1,2,4]triazolo[4,3-a]pyridine-3-carboxylate | AG000RFV | 10g |
| 1260855-51-3 | O=C(C1=CN(C2=CC=CC=C2C(F)(F)F)N=C1)O | 1-(2-(Trifluoromethyl)phenyl)-1H-pyrazole-4-carboxylic acid | AG000RFZ | 45g |
| 1260852-42-3 | O=C(N1CC(F)(F)C(CO)C1)OC(C)(C)C | tert-butyl 3,3-difluoro-4-(hydroxymethyl)pyrrolidine-1-carboxylate | AG000RGA | 5g |
| 1260851-70-4 | CCC(=O)C1=C(Br)C=CC(Cl)=C1 | 1-(2-Bromo-5-chlorophenyl)propan-1-one | AG000RGD | 5g |
| 1260851-42-0 | O=C(C1=CC(Cl)=CC2=C1NN=C2)OC | METHYL 5-CHLORO-1H-INDAZOLE-7-CARBOXYLATE | AG000RGE | 100g |
| 1260850-70-1 | BrC1=CN=C2C=CC(=N[N]12)N | 3-Bromoimidazo[1,2-b]pyridazin-6-ylamine | AG000RGI | 20g |
| 1260663-93-1 | O=C1NC=CC2=CC(Cl)=NC=C12 | 6-Chloro-2,7-naphthyridin-1(2H)-one | AG000QZO | 50g |
| 1260663-92-0 | O=C(OC)C1=CN=C(N)C(O)=C1 | Methyl 6-amino-5-hydroxynicotinate | AG000QZP | 20g |
| 1260663-68-0 | O=C(C1=NC=C(Cl)N=C1N)O | 3-Amino-5-chloropyrazine-2-carboxylic acid | AG000QZS | 485g |
| 1260663-37-3 | Clc1ncnc2c(Cl)nccc12 | 4,8-dichloropyrido[3,4-d]pyrimidine | AG000QZT | 1g |
| 1260663-13-5 | CC(=O)c1ccc(nc1F)Cl | 1-(6-Chloro-2-Fluoropyridin-3-Yl)Ethanone | AG000QZU | 1g |
| 1260667-46-6 | O=CC1=C(Br)C=NC(NC(OC(C)(C)C)=O)=C1 | 2-(Boc-amino)-5-bromoisonicotinaldehyde | AG000R02 | 1g |
| 1260667-24-0 | C#CC1COCCC1 | 3-Ethynyltetrahydro-2h-pyran | AG000R03 | 1g |
| 1260666-80-5 | O=C1NCC2=C1C=CC(F)=C2 | 5-Fluoro-2,3-dihydroisoindol-1-one | AG000R05 | 25g |
| 1260666-60-1 | O=C(OC)C1=CN=C(N)C=C1Cl | Methyl 6-amino-4-chloronicotinate | AG000R07 | 10g |
| 1260666-52-1 | Clc1c2c([nH]c(c2)C(=O)OC)nc(n1)Cl | Methyl 2,4-dichloro-7H-pyrrolo[2,3-d]pyrimidine-6-carboxylate | AG000R09 | 1g |
| 1260666-26-9 | ClC1=NC(Cl)=CC2=C1NN=C2 | 5,7-Dichloro-1H-pyrazolo[3,4-c]pyridine | AG000R0B | 20g |
| 1260665-99-3 | IC1=CC=C(Br)C(F)=N1 | 3-Bromo-2-fluoro-6-iodopyridine | AG000R0D | 20.6g |
| 1260665-77-7 | ClC1=NC=CC2=C1OCCN2 | 5-Chloro-2,3-dihydro-1H-pyrido[3,4-b][1,4]oxazine | AG000R0E | 6g |
| 126115-86-4 | [Br-].CCCCCCCCCCCCCCCCCC[n+]1ccc(C=Cc2ccccc2)cc1 | N-N-Octadecyl-4-stilbazole bromide | AG000RNB | 0.25g |
| 126111-11-3 | C(OC)(=O)[C@@H]1C[C@@H](F)CN1 | Methyl (2S,4R)-4-fluoropyrrolidine-2-carboxylate | AG000RNF | 0.75g |
| 126109-42-0 | N[C@H](C(=O)O)Cc1ccc(cc1)C(=O)O | 4-CARBOXY-L-PHENYLALANINE | AG000RNH | 10g |
| 1261231-02-0 | O=C(N1C(COC2=NC=C(Cl)C=N2)CCCC1)OC(C)(C)C | tert-Butyl 2-(((5-chloropyrimidin-2-yl)oxy)methyl)piperidine-1-carboxylate | AG000RNO | 0.3g |
| 1261230-56-1 | O=C(C1CCN(CC2=CC=C(F)C=C2)CC1)OCC3=CC=C(F)C=C3 | 4-Fluorobenzyl 1-(4-Fluorobenzyl)piperidine-4-carboxylate | AG000RNR | 0.2g |
| 1261229-78-0 | FC1=CC=C(CN2C(CN(CC2)C(=O)OC(C)(C)C)C(=O)OCC2=CC=C(C=C2)F)C=C1 | 1-tert-Butyl 3-(4-fluorobenzyl) 4-(4-fluorobenzyl)piperazine-1,3-dicarboxylat | AG000RNV | 0.75g |
| 1261225-48-2 | CC(C)(C)OC(=O)N[C@H]1CCC[C@@H](NC(=O)OCc2ccccc2)C1 | Benzyl n-[(1r,3s)-3-([(tert-butoxy)carbonyl]amino)cyclohexyl]carbamate | AG000RNY | 25g |
| 1261216-28-7 | COC1=C(Cl)C(F)=CC(Br)=C1 | 5-Bromo-2-chloro-1-fluoro-3-methoxybenzene | AG000RO0 | 125g |
| 1261216-27-6 | BrC1=CC(=C(N)C(=C1)OC)F | Benzenamine, 4-bromo-2-fluoro-6-methoxy- | AG000RO1 | 10g |
| 126120-87-4 | OB(O)C1=CC=CC2=C1OC(F)(F)O2 | 2,2-DIFLUOROBENZO[1,3]DIOXOLE-4-BORONIC ACID | AG000RO6 | 175g |
| 126120-85-2 | OC(=O)C1=CC=CC2=C1OC(F)(F)O2 | 2,2-Difluoro-1,3-benzodioxole-4-carboxylic acid | AG000RO7 | 100g |
| 1261234-26-7 | CC1N(C2=NC=C(C)C(Cl)=N2)CCNC1.[H]Cl | 4-Chloro-5-methyl-2-(2-methylpiperazin-1-yl)pyrimidine hydrochloride | AG000ROB | 0.3g |
| 1261234-05-2 | NCC1N(C2=NC=C(Cl)C=N2)CCCC1.[H]Cl | (1-(5-Chloropyrimidin-2-yl)piperidin-2-yl)methanamine hydrochloride | AG000ROE | 0.3g |
| 1261233-64-0 | O=C(OC(C)(C)C)N(C1CN(C2=NC(C)=CC(Cl)=N2)CCC1)C | tert-Butyl (1-(4-chloro-6-methylpyrimidin-2-yl)piperidin-3-yl)(methyl)carba | AG000ROF | 0.5g |
| 1261233-22-0 | O=C(N1CCC(OC2=NC=C(Cl)C=N2)CC1)OC(C)(C)C | tert-Butyl 4-((5-chloropyrimidin-2-yl)oxy)piperidine-1-carboxylate | AG000ROJ | 0.5g |
| 1261232-82-9 | OCC1CN(C2=NC=C(F)C=N2)CCC1 | (1-(5-Fluoropyrimidin-2-yl)piperidin-3-yl)methanol | AG000ROK | 0.3g |
| 1261232-73-8 | NC1CCN(CC(C2=CC=CO2)=O)CC1.[H]Cl | 2-(4-Aminopiperidin-1-yl)-1-(furan-2-yl)ethanone hydrochloride | AG000ROL | 0.5g |
| 1261269-06-0 | CN1C=NC=C1C2=CC(=CC=C2)C(=O)O | 3-(1-Methyl-5-imidazolyl)benzoic Acid | AG000RPX | 0.5g |
| 1261269-04-8 | Cl.Nc1cccc(c1)-c1ncc[nH]1 | 3-(1H-Imidazol-2-Yl)Aniline Hydrochloride | AG000RPZ | 10g |
| 1261269-01-5 | CCOC(C1=CC(Cl)=CC(N)=C1)=O | Ethyl 3-AMino-5-chlorobenzoate | AG000RQ2 | 2g |
| 1261268-99-8 | O=C(NC1=CC=C2NC(=NC2=C1)C1=CC=C(NC(=O)C2=CC=CC=C2)C=C1)C1CC1 | N-[4-(5-cyclopropanecarboxaMido-1H-benziMidazol-2-yl)phenyl]benzaMide | AG000RQ3 | 5g |
| 1261268-95-4 | O=C(C(C)C)Nc1ccc2c(c1)[nH]c(n2)c1ccc(cc1)NC(=O)c1ccccc1 | Benzamide, N-[4-[6-[(2-methyl-1-oxopropyl)amino]-1H-benzimidazol-2-yl]p | AG000RQ7 | 2g |
| 1261268-94-3 | CCOC(=O)C1=CC=C(C=C1)C1=CN=CO1 | Ethyl 4-(5-oxazolyl)benzoate | AG000RQ8 | 5g |
| 126127-31-9 | OCC(CO)NC(CCCCCCCCCCCCCCC)=O | N-(1,3-Dihydroxypropan-2-yl)palmitamide | AG000RQC | 200g |
| 1261438-69-0 | IC1=CC(Br)=CC=C1CO | 4-Bromo-2-iodobenzyl alcohol | AG000RQF | 25g |
| 1261438-67-8 | O=C(O)CC1=CC=CC(Br)=C1Cl | 3-bromo-2-chlorophenylacetic acid | AG000RQG | 10g |
| 1261438-38-3 | CC(C1=C(Cl)C=CC=C1Br)=O | 1-(2-Bromo-6-chlorophenyl)ethanone | AG000RQH | 25g |
| 1261433-31-1 | FC1=CC=CC2=C1C(NC2)=O | 7-Fluoroisoindolin-1-One | AG000RQJ | 10g |
| 1261454-85-6 | CC1=CC=C(O)C=C1CO | 3-(Hydroxymethyl)-4-methylphenol | AG000RR5 | 50g |
| 1261454-55-0 | OC1=CC2=CC=C(Cl)C=C2N=C1 | 7-Chloroquinolin-3-ol | AG000RR6 | 3g |
| 1261453-50-2 | O=C(OC)C1=CC=CC(C#N)=C1F | Methyl 3-cyano-2-fluorobenzoate | AG000RR8 | 10g |
| 1261449-78-8 | OC(CCC1=C(Cl)C=C(O)C=C1)=O | 3-(2-Chloro-4-hydroxyphenyl)propanoic acid | AG000RR9 | 2g |
| 1260861-76-4 | Brc1cnc2cccn2c1 | 3-Bromopyrrolo[1,2-a]pyrimidine | AG000RGU | 5g |
| 1260860-32-9 | NC1C2=C(C(=CC=C2)Br)ON=1 | 7-Bromobenzo[d]isoxazol-3-amine | AG000RGX | 10g |
| 1260859-19-5 | CC1=NC(I)=NC=C1Br | 5-Bromo-2-iodo-4-methylpyrimidine | AG000RH6 | 50g |
| 1260858-55-6 | O=C(C1=CC2=C(C=C1Cl)C=CN2)O | 5-Chloro-indole-6-carboxylic acid | AG000RH8 | 2g |
| 1260857-14-4 | FC1=C(Br)C=CC(=C1)C(=O)CCl | 1-(4-Bromo-3-fluorophenyl)-2-chloroethanone | AG000RH9 | 0.75g |
| 1260876-51-4 | CC(C)(C)OC(=O)N1CCC(C(O)C1)C(O)=O | 1-(tert-butoxycarbonyl)-3-hydroxypiperidine-4-carboxylic acid | AG000RHG | 3g |
| 1260876-31-0 | O=CC1=NC=C(Br)N1 | 5-Bromo-1H-imidazole-2-carbaldehyde | AG000RHH | 0.2g |
| 1260874-86-9 | CN1C=CC2=CC(=CN=C21)Cl | 5-Chloro-1-methyl-1h-pyrrolo[2,3-b]pyridine | AG000RHL | 40g |
| 1260865-91-5 | CC1(C)C(C)(C)OB(C2=CC=C(C(C3=CC=CC=C3)=C(C4=CC=CC=C4)C5=CC=CC=C5)C=C | 4,4,5,5-Tetramethyl-2-(4-(1,2,2-triphenylvinyl)phenyl)-1,3,2-dioxaborolane | AG000RHQ | 40g |
| 1260863-86-2 | BrC1=CN=C2C(=C1)OC=N2 | 6-Bromooxazolo[4,5-b]pyridine | AG000RHS | 75g |
| 1260862-85-8 | OCC1=C(Cl)N=CN=C1Cl | (4,6-Dichloropyrimidin-5-yl)methanol | AG000RHX | 2g |
| 1260862-42-7 | O=C(OC(C)(C)C)C1=CC=C([N+]([O-])=O)C=C1N | Tert-butyl 2-amino-4-nitrobenzoate | AG000RHY | 3g |
| 1260883-24-6 | Cl.NC1CC(=O)NCC1 | 4-Amino-2-piperidinone, HCl | AG000RI2 | 5g |
| 1260882-75-4 | FC1=C(Cl)C(Br)=C(Cl)C=C1 | 2-Bromo-1,3-dichloro-4-fluorobenzene | AG000RI4 | 30g |
| 1260897-38-8 | C12=C(NN=C2)C=C(C3=CC=CC=C3)C=C1 | 6-Phenyl-1H-indazole | AG000RKA | 0.5g |
| 1260897-35-5 | COC1=C(C(OC(C)(C)C)=O)C=CC(Br)=C1 | Tert-butyl 4-bromo-2-methoxybenzoate | AG000RKB | 310g |
| 1260897-05-9 | O=C(C1CC(F)(F)CC1)O | 3,3-Difluorocyclopentanecarboxylic acid | AG000RKG | 200g |
| 1260903-19-2 | NC1=C(C=O)C=CC(=C1)I | 2-Amino-4-Iodobenzaldehyde | AG000RKX | 5g |
| 1260903-17-0 | FC1=CC2=NC=CN2C=C1 | 7-fluoroimidazo[1,2-a]pyridine | AG000RKY | 100g |
| 1260903-12-5 | ClC1=CC(Br)=C(ON=C2)C2=C1 | 7-Bromo-5-chlorobenzo[d]isoxazole | AG000RKZ | 2g |
| 1260903-05-6 | NCC1=NC=CC=C1F.[H]Cl | 2-(Aminomethyl)-3-fluoropyridine hydrochloride | AG000RL1 | 10g |
| 1260901-96-9 | BrCCn1nccn1 | 2-(2-Bromoethyl)-2H-1,2,3-triazole | AG000RL8 | 75g |
| 1260900-80-8 | O1(C(C(C)(C)OB1C2(=CC(=CC=C2)CN(CC)CC))(C)C) | 3-(N,N-Diethylaminomethyl)phenylboronic acid, pinacol ester | AG000RLC | 1.5g |
| 1260907-17-2 | O=C(NCC)C[C@H]1C2=NN=C(C)N2C3=CC=C(OC)C=C3C(C4=CC=C(Cl)C=C4)=N1 | Molibresib | AG000RLX | 0.15g |
| 126092-98-6 | CN1C=C(NC(=O)C2=CC(NC(=O)OC(C)(C)C)=CN2C)C=C1C(O)=O | 4-(4-((tert-Butoxycarbonyl)amino)-1-methyl-1H-pyrrole-2-carboxamido)-1-m | AG000RM0 | 3g |
| 126092-96-4 | O=C(C1=CC(NC(OC(C)(C)C)=O)=CN1C)OC | Methyl 4-((tert-butoxycarbonyl)amino)-1-methyl-1H-pyrrole-2-carboxylate | AG000RM1 | 50g |
| 126091-24-5 | O=CC1=CC(C2=CC=CC(C(F)(F)F)=C2)=CC=C1 | 3′-TRIFLUOROMETHYLBIPHENYL-3-CARBALDEHYDE | AG000RM7 | 7g |
| 1261169-72-5 | OC1=CC=C(B(O)O)C(F)=C1F | 2,3-Difluoro-4-hydroxyphenylboronic acid | AG000RMY | 25g |
| 1261117-66-1 | BrC1=C(N=C2N1CCN(C2(C)C)C(CNC(OC(C)(C)C)=O)=O)C2=CC=C(C=C2)F | TERT-BUTYL (2-(3-BROMO-2-(4-FLUOROPHENYL)-8,8-DIMETHYL-5,6-DIHYDROI | AG000RN1 | 1.3g |
| 1261114-01-5 | NCC(=O)N1C(C=2N(CC1)C(=C(N2)C2=CC=C(C=C2)F)NC2=CC=C(C=C2)Cl)(C)C | 2-Amino-1-(3-((4-chlorophenyl)amino)-2-(4-fluorophenyl)-8,8-dimethyl-5,6- | AG000RN2 | 0.75g |
| 1260764-27-9 | O=CC1=CC=C(F)C(C)=C1Cl | 2-Chloro-4-fluoro-3-methylbenzaldehyde | AG000R5R | 13g |
| 1260764-09-7 | FC1=C(F)C=C(CCBr)C(F)=C1 | 1-(2-Bromoethyl)-2,4,5-trifluorobenzene | AG000R5T | 5g |
| 1260763-55-0 | CC(OC(N1CC2=C(C(=CC=C2N)Br)CC1)=O)(C)C | 2-Boc-5-bromo-1,2,3,4-tetrahydroisoquinolin-8-amine | AG000R65 | 2g |
| 1260763-32-3 | BrC2=C[N]1C(=NC(=C1)C(=O)OCC)C(=C2)F | Ethyl 6-bromo-8-fluoroimidazo[1,2-a]pyridine-2-carboxylate | AG000R66 | 4g |
| 1260763-03-8 | BrC1=CC(C23CC2)=C(NC3)C=C1 | 5′-Bromospiro[cyclopropane-1,3′-indoline] | AG000R68 | 10g |
| 1260770-82-8 | O=C1CC(c2ccc(Cl)cc2)CCN1 | 4-(4-Chlorophenyl)piperidin-2-one | AG000R6C | 5g |
| 1260769-17-2 | Cc1cc(Br)c2n(c1)cnn2 | 8-Bromo-6-methyl-[1,2,4]triazolo[4,3-a]pyridine | AG000R6K | 5g |
| 1260764-76-8 | O=C(OC)C1=NC=CC(Cl)=C1C | Methyl 4-chloro-3-methylpicolinate | AG000R6V | 75g |
| 1260776-33-7 | O=C(C1=CC=C(F)C2=C1CC(N2)=O)OC | Methyl 7-fluoro-2-oxoindoline-4-carboxylate | AG000R77 | 1g |
| 1260773-60-1 | O=C(C1=NC(Cl)=CN=C1Br)O | 3-Bromo-6-chloropyrazine-2-carboxylic acid | AG000R7G | 5g |
| 1260773-08-7 | O=C(C1=CN(C2=CC=CC(OC(F)(F)F)=C2)N=C1)O | 1-(3-(Trifluoromethoxy)phenyl)-1H-pyrazole-4-carboxylic acid | AG000R7H | 0.2g |
| 1263284-46-3 | OC(=O)C1CC(C1)OC1=CC=CC=C1 | 3-phenoxycyclobutanecarboxylic acid | AG000SMA | 1g |
| 1263284-23-6 | OC[C@@H]1OC2=CC=C(Br)C=C2OC1 | (S)-(6-Bromo-2,3-dihydrobenzo[b][1,4]dioxin-2-yl)methanol | AG000SME | 50g |
| 1263284-04-3 | O=C(OCC)C(F)(F)CN.[H]Cl | Ethyl 2,2-difluoro-3-aminopropanoate hydrochloride | AG000SMH | 50g |
| 1263283-69-7 | O=C(OC)C1=CC(F)=C(CCl)C(F)=C1 | Methyl 4-(chloromethyl)-3,5-difluorobenzoate | AG000SMP | 0.25g |
| 1263283-48-2 | BrC1=NN=C2N1C=C(C=C2)N | 3-Bromo-[1,2,4]triazolo[4,3-a]pyridin-6-amine | AG000SMQ | 2g |
| 1263283-20-0 | COC1(OC)CNCC1.[H]Cl | 3,3-Dimethoxypyrrolidine hydrochloride | AG000SMS | 4.5g |
| 1263283-00-6 | O=C(OC)C1=CC=C(F)C([N+]([O-])=O)=C1O | Methyl 4-fluoro-2-hydroxy-3-nitrobenzoate | AG000SMT | 25g |
| 1263296-81-6 | OC1CCC12CN(C(c1ccccc1)c1ccccc1)C2 | 2-Benzhydryl-2-azaspiro[3.3]heptan-5-ol | AG000SMY | 0.5g |
| 1263296-80-5 | O=C1CCC11CN(C1)C(C1=CC=CC=C1)C1=CC=CC=C1 | 2-Diphenylmethyl-2-azaspiro[3.3]heptan-5-one | AG000SMZ | 2g |
| 126334-84-7 | CCOC(C1=C(C2=CC=CC=C2)C2=C(C=CC=C2)N=C1CCl)=O | Ethyl 2-(chloromethyl)-4-phenylquinoline-3-carboxylate hydrochloride | AG000SN8 | 2g |
| 126330-91-4 | COC([C@@H]1NC(=O)CNC1)=O | (2R)-6-Oxo-2-Piperazinecarboxylic Acid Methyl Ester | AG000SNF | 10g |
| 126330-90-3 | Cl.Cl.N1CCNC[C@@H]1C(=O)O | (R)-Piperazine-2-carboxylic acid DiHCl | AG000SNG | 100g |
| 126330-77-6 | O=C(OC(C)(C)C)N[C@H]1C(OC1)=O | N-(tert-Butoxycarbonyl)-D-serine beta-lactone | AG000SNH | 50g |
| 1263378-05-7 | O=C(C1)CC2C1CNC2.[H]Cl | Hexahydrocyclopenta[c]pyrrol-5(1H)-one hydrochloride | AG000SNK | 5g |
| 1263378-01-3 | O=S(C1=CC=C(C=C1)NC)(C)=O.[H]Cl | N-Methyl-4-(methylsulfonyl)aniline, HCl | AG000SNL | 6g |
| 1263377-74-7 | FC(C1=C(F)C(Br)=CC=C1F)(F)F | 3-Bromo-2,6-difluorobenzotrifluoride | AG000SNO | 8g |
| 1263376-42-6 | C1(C=C(Br)C=C(C)C=1I)C(O)=O | 5-bromo-2-iodo-3-methylbenzoic acid | AG000SNQ | 20g |
| 1263375-23-0 | FC1=CN=C(F)C=C1B(O)O | (2,5-Difluoropyridin-4-yl)boronic acid | AG000SNS | 10g |
| 1263374-42-0 | FC1=C(B(O)O)C=CN=C1F | 2,3-Difluoropyridine-4-boronic acid | AG000SNT | 500g |
| 1260790-53-1 | O=CC1=C(F)C=C(F)C=C1N | 2-Amino-4,6-difluorobenzaldehyde | AG000RA8 | 10g |
| 1260797-60-1 | O=C(C1=CN=C2C=CC(Cl)=CN21)OCC | Ethyl 6-chloroimidazo[1,2-a]pyridine-3-carboxylate | AG000RAH | 200g |
| 1260796-71-1 | COC(=O)C1C2=C(NC(=O)C2)C(Cl)=CC=1 | Methyl 7-chloro-2-oxoindoline-4-carboxylate | AG000RAK | 0.5g |
| 1260794-50-0 | O=C(OC(C)(C)C)Nc1ccc(cn1)F | tert-Butyl 5-fluoropyridin-2-ylcarbamate | AG000RAY | 75g |
| 1260794-25-9 | Cl.O=C1(CCC(NC)CC1) | 4-(Methylamino)cyclohexanone hydrochloride | AG000RB0 | 5g |
| 1260793-84-7 | O=C(C1=CN(C(C)C)C=N1)OCC | Ethyl 1-isopropyl-1H-imidazole-4-carboxylate | AG000RB2 | 9g |
| 1260802-34-3 | CC(C)(OC(N1CCC(N)C2(C1)CC2)=O)C | Tert-Butyl 8-Amino-5-Azaspiro[2.5]Octane-5-Carboxylate | AG000RBE | 3g |
| 1260799-38-9 | NC1=CN=C(Cl)C2=C1C=CC=C2 | 1-Chloroisoquinolin-4-amine | AG000RBR | 0.5g |
| 1260798-62-6 | O=C(C1=CN2C(C(F)(F)F)=CC=CC2=N1)O | 5-(Trifluoromethyl)imidazo[1,2-a]pyridine-2-carboxylic acid | AG000RBS | 40g |
| 1260807-49-5 | O=C(OC(C)(C)C)C1=NC=CC=C1Br | tert-Butyl 3-bromopicolinate | AG000RBV | 100g |
| 1260804-94-1 | CC1=C(Br)C=C(F)C(NC(OC(C)(C)C)=O)=C1 | tert-Butyl (4-bromo-2-fluoro-5-methylphenyl)carbamate | AG000RC6 | 10.7g |
| 1260880-59-8 | NC1=C(CO)N=C(Br)C=N1 | (3-Amino-6-bromopyrazin-2-yl)methanol | AG000RI8 | 15g |
| 1260879-95-5 | ClC1=CC2=C(N=C1)CCNC2.[H]Cl | 3-Chloro-5,6,7,8-tetrahydro-1,6-naphthyridine hydrochloride | AG000RIE | 3g |
| 1260879-70-6 | IC(N1)=CC2=C1N=CC=C2Br | 4-Bromo-2-iodo-7-azaindole | AG000RIH | 2g |
| 1260878-78-1 | O=CC1=NC=CC(Cl)=C1F | 4-Chloro-3-fluoropicolinaldehyde | AG000RIO | 30g |
| 1260886-58-5 | OC1=C(I)C=NC2=CC=C(Br)C=C12 | 6-BROMO-3-IODOQUINOLIN-4-OL | AG000RJ5 | 15g |
| 1260885-52-6 | CCOC(=O)CC1=NN=CC=C1 | Ethyl 2-(Pyridazin-3-Yl)Acetate | AG000RJ8 | 5g |
| 1260885-46-8 | O=C(C1=CN2C(C(F)(F)F)=CC=CC2=N1)OCC | Ethyl 5-(trifluoromethyl)imidazo[1,2-a]pyridine-2-carboxylate | AG000RJ9 | 5.03g |
| 1260893-18-2 | C(F)(F)(F)C1(CO)CCN(CC1)C(=O)OC(C)(C)C | TERT-BUTYL 4-(HYDROXYMETHYL)-4-(TRIFLUOROMETHYL)PIPERIDINE-1-CARBO | AG000RJL | 10g |
| 1260892-91-8 | O=C1NC2=C(C=C(F)C=C2Cl)C1 | 7-Chloro-5-fluoroindolin-2-one | AG000RJP | 10g |
| 1260891-66-4 | COC(C1C2=C(C=CC=N2)NN=1)=O | Methyl 1H-pyrazolo[4,3-b]pyridine-3-carboxylate | AG000RJV | 10g |
| 1260890-50-3 | FC(C1=CC=C(Br)C(Cl)=C1F)(F)F | 1-Bromo-2-chloro-3-fluoro-4-(trifluoromethyl)benzene | AG000RK4 | 10g |
| 1260898-43-8 | ClC1=CN=C2N=C(Cl)C=CC2=C1 | 2,6-Dichloro-1,8-naphthyridine | AG000RK7 | 9g |
| 1262141-51-4 | CC(OC(NC1(C(O)=O)CC(O)C1)=O)(C)C | 1-([(tert-Butoxy)carbonyl]amino)-3-hydroxycyclobutane-1-carboxylic acid | AG000SCJ | 10g |
| 1262046-34-3 | CC(C1=C(C2=C(C)C=CC(OC)=C2P(C(C)(C)C)C(C)(C)C)C(C(C)C)=CC(C(C)C)=C1)C | Di-tert-butyl(2′,4′,6′-triisopropyl-3-methoxy-6-methyl-[1,1′-biphenyl]-2-yl)ph | AG000SCK | 25g |
| 126213-50-1 | C12=CSC=C1OCCO2 | 3,4-Ethylenedioxythiophene | AG000SCW | 2000g |
| 126208-61-5 | CC(C)(C)C1=NN(C(N)=C1)C1=CC=CC=C1 | 3-tert-Butyl-1-phenyl-1H-pyrazol-5-amine | AG000SD3 | 200g |
| 126202-23-1 | O=CC1=CC(F)=CC(F)=C1F | 2,3,5-Trifluorobenzaldehyde | AG000SD5 | 45g |
| 1262278-60-3 | O[C@H]1C[C@H](F)C1 | trans-3-Fluorocyclobutanol | AG000SDC | 5g |
| 126231-22-9 | C1(C(O)=O)=CC2=C(CCC(C(C)(C)C)C2)S1 | 5-tert-Butyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylic acid | AG000SDK | 20g |
| 126223-29-8 | OC1=C2C(=CC(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)=C1)C[C | (3S)-6-(β-D-Glucopyranosyloxy)-3,4-dihydro-8-hydroxy-3-[2-(4-methoxyphen | AG000SDT | 0.005g |
| 1262410-84-3 | CC(C)(C)OC(=O)N1CCC(C1)(CO)F | 1-Boc-3-fluoropyrrolidine-3-Methanol | AG000SDX | 10g |
| 1262410-80-9 | O=C(N1CC(C(OC)=O)(CC)C1)OC(C)(C)C | 1-tert-Butyl 3-methyl 3-ethylazetidine-1,3-dicarboxylate | AG000SDY | 1g |
| 1262410-73-0 | NCCC1CCSCC1 | 2-(Tetrahydrothiopyran-4-yl)ethylamine | AG000SDZ | 0.5g |
| 1262409-80-2 | CC1(CN(C(OCC2=CC=CC=C2)=O)CC1)O | BENZYL 3-HYDROXY-3-METHYLPYRROLIDINE-1-CARBOXYLATE | AG000SE0 | 25g |
| 1262409-63-1 | O=C(C1=CC=CN2C1=NC=C2I)OCC | Ethyl 3-iodoimidazo[1,2-a]pyridine-8-carboxylate | AG000SE1 | 55g |
| 1262409-43-7 | ClS(C1CCC(=O)CC1)(=O)=O | 4-oxocyclohexane-1-sulfonyl chloride | AG000SE3 | 15g |
| 1262408-75-2 | ClC1=CNC2=NC=CC(=C21)Cl | 3,4-DICHLORO-1H-PYRROLO[2,3-B]PYRIDINE | AG000SE5 | 20g |
| 1262407-18-0 | O=C(N1CC2NC2C1)OC(C)(C)C | tert-Butyl 3,6-diazabicyclo[3.1.0]hexane-3-carboxylate | AG000SE6 | 5g |
| 1262396-04-2 | COC(=O)C1=C(C)C=C(F)C=C1Br | Methyl 2-bromo-4-fluoro-6-methylbenzoate | AG000SE7 | 50g |
| 1262526-44-2 | C1=CC(=CC(=C1)F)C[C@@H]2C[C@@H](C(=O)O)NC2 | (2S,4R)-4-(3-Fluorobenzyl)pyrrolidine-2-carboxylic acid | AG000SEM | 1.52g |
| 1262512-81-1 | CC1=C(B(O)O)C2=C(N(C)N=C2)C=C1 | 1,5-Dimethyl-1H-indazole-4-boronic acid | AG000SEN | 10g |
| 1262419-96-4 | O=C(OC)C1=CC=CC(C=O)=C1F | Methyl 2-fluoro-3-formylbenzoate | AG000SEP | 3g |
| 1262415-66-6 | CCOC(=O)C1=NN(CC2=CC=CC=C2)C(C)=C1Br | Ethyl 1-benzyl-4-bromo-5-methyl-1H-pyrazole-3-carboxylate | AG000SET | 0.75g |
| 1262414-75-4 | O=C(C1=NN(CC2=CC=CC=C2)C(C)=C1Br)N | 1-Benzyl-4-bromo-5-methyl-1H-pyrazole-3-carboxamide | AG000SEV | 0.75g |
| 1262414-04-9 | CC1=C(OC[C@@H](O)CO)C(CC)=CC(C2=NOC(C3=CC(C4CCCC4)=NC(OC)=C3)=N2) | Cenerimod | AG000SEW | 0.01g |
| 1262412-13-4 | C(=O)(OC(C)(C)C)N1CC(C1)(C(=O)O)N | 1,3-Azetidinedicarboxylic acid, 3-amino-, 1-(1,1-dimethylethyl) ester | AG000SEY | 15g |
| 1262411-34-6 | CC1(C(O)=O)CCSCC1 | 4-methylthiane-4-carboxylic acid | AG000SEZ | 0.5g |
| 1262411-27-7 | O=C(N1CC(CO)(N)C1)OC(C)(C)C | 1-BOC-3-AMINO-3-(HYDROXYMETHYL)AZETIDINE | AG000SF0 | 15g |
| 1262411-00-6 | CCOC(CC1CCC(NC(OC(C)(C)C)=O)CC1)=O | Ethyl 2-[4-(Boc-aMino)cyclohexyl]acetate | AG000SF1 | 40g |
| 1262618-39-2 | FC(OC1=CC=C(C=C1)C=1C=CC=2N(C1)C(=NN2)C(F)(F)F)(F)F | (6-[4-(trifluoromethoxy)phenyl]-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyri | AG000SFD | 0.2g |
| 126264-49-1 | O=C(C1NCCOC1)OC | 3-Morpholinecarboxylic acid methyl ester | AG000SFF | 50g |
| 126261-84-5 | CCCc1ccc(I)cc1 | 1-iodo-4-propylbenzene | AG000SFH | 2.3g |
| 126253-41-6 | OCCCc1cc2c(c(c1)OC)O[C@@H]([C@H]2CO)c1ccc(c(c1)OC)O | Dihydrodehydrodiconiferyl alcohol | AG000SFR | 0.005g |
| 1262858-97-8 | FC(C(C1=C(F)C=CC(Br)=C1)=O)F | 1-(5-bromo-2-fluorophenyl)-2,2-difluoroethan-1-one | AG000SGQ | 20.4g |
| 1262849-90-0 | Cl.CCOC(=O)[C@@H]1CN(C[C@H]1N)C(=O)OC(C)(C)C | (3R,4S)-4-Amino-1-boc-3-pyrrolidinecarboxylic acid ethyl ester HCl | AG000SGS | 113g |
| 1261500-70-2 | OC1=C(C=O)C(OC(F)(F)F)=CC=C1 | 2-hydroxy-6-(trifluoromethoxy)benzaldehyde | AG000RTH | 0.5g |
| 1261499-71-1 | C1=CC(=C(C(=C1)N)Cl)C(F)F | 2-Chloro-3-(difluoromethyl)aniline | AG000RTJ | 5g |
| 1261499-40-4 | C1=CC(=C(C=C1CN)C#N)Cl | 4-Chloro-3-cyanobenzylamine | AG000RTK | 0.3g |
| 1261499-34-6 | O=C(O)C1=CC=CC(C#N)=C1Cl | 2-Chloro-3-cyanobenzoic acid | AG000RTL | 15g |
| 126150-97-8 | O=C(OCOC(C)=O)CN(CC(OCOC(C)=O)=O)C1=CC=CC=C1OCCOC2=CC=CC=C2N(CC( | BAPTA-AM | AG000RTQ | 3g |
| 1261566-52-2 | OCC1=CC(OC)=CC(N)=C1 | (3-aMino-5-Methoxyphenyl)Methanol | AG000RTU | 0.5g |
| 1261554-90-8 | IC=1C(=C(C=CC1)CC(=O)O)C | 3-Iodo-2-methylphenylacetic acid | AG000RU4 | 0.2g |
| 1261530-52-2 | OC1=CC(Br)=NC2=CC=CC=C12 | 2-Bromoquinolin-4-ol | AG000RUF | 0.75g |
| 1261529-03-6 | OC1=CC2=C(N)C=CC=C2N=C1 | 5-Aminoquinolin-3-ol | AG000RUG | 0.75g |
| 1261583-46-3 | O=S(C1=CC=C(Br)C(C#N)=C1)(Cl)=O | 4-Bromo-3-cyanobenzene-1-sulfonyl chloride | AG000RUJ | 400g |
| 1261581-85-4 | O=C(N)C1=C(OC)C=CC=C1Br | 2-Bromo-6-methoxybenzamide | AG000RUM | 20g |
| 1261576-82-2 | CC1=CC=C(Cl)NC1=O | 6-Chloro-3-methylpyridin-2(1H)-one | AG000RUR | 5g |
| 1261573-04-9 | COC1=CC=C(C#N)C(=C1)S(Cl)(=O)=O | 2-Cyano-5-methoxybenzene-1-sulfonyl chloride | AG000RUV | 9g |
| 1261571-03-2 | OCC1=CC=CC(Br)=C1I | (3-Bromo-2-iodophenyl)methanol | AG000RUY | 0.2g |
| 1261569-73-6 | N#CCC1=CC=CC(I)=C1C | 3-IODO-2-METHYLPHENYLACETONITRILE | AG000RV0 | 5g |
| 1261609-54-4 | OC(=O)CCc1cc(Br)ccc1Cl | Benzenepropanoic acid, 5-bromo-2-chloro- | AG000RVC | 5g |
| 1261606-72-7 | C1(=CC=CC(C)=C1Cl)C(OCC)=O | Ethyl 2-chloro-3-methylbenzoate | AG000RVD | 20g |
| 1261602-78-1 | OC1=C2C=CC=NC2=CC(F)=C1 | 7-FLUOROQUINOLIN-5-OL | AG000RVH | 0.75g |
| 1261598-26-8 | C1=CC(=C(C=C1CO)O)Cl | 2-Chloro-5-(hydroxymethyl)phenol | AG000RVL | 8g |
| 1261598-11-1 | OC1=CC=C2C=C(Cl)C=NC2=C1 | 3-Chloroquinolin-7-ol | AG000RVM | 0.75g |
| 1261589-82-5 | C(C(=O)OC)c1nc(sc1)Br | 4-Thiazoleacetic acid, 2-bromo-, methyl ester | AG000RVQ | 100g |
| 1261588-72-0 | CCOC(=O)C1=C2C=CNC2=NC=C1 | Ethyl 1H-pyrrolo[2,3-b]pyridine-4-carboxylate | AG000RVR | 3g |
| 1261628-71-0 | NC1=NC(OC)=CC(Cl)=C1 | 4-Chloro-6-methoxypyridin-2-amine | AG000RVY | 20g |
| 1261625-77-7 | OC1=C2C=C(N)C=NC2=CC=C1 | 3-Aminoquinolin-5-ol | AG000RW1 | 4g |
| 1262802-59-4 | C1=CC=CC=2C3=CC=CC=C3C(C12)COC(=O)N[C@@H](C(=O)O)CC1CCCC1 | (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-cyclopentylpropanoic | AG000SGT | 100g |
| 1262802-58-3 | N#CCC[C@H](C(O)=O)NC(OCC1C2=CC=CC=C2C3=CC=CC=C31)=O | (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-cyanobutanoic acid | AG000SGU | 5g |
| 1262773-49-8 | O=C1OCCN1CCN.[H]Cl | 3-(2-Aminoethyl)oxazolidin-2-one hydrochloride | AG000SGW | 15g |
| 1262769-75-4 | BrC1CNCC1.[H]Br | 3-Bromopyrrolidine hydrobromide | AG000SH0 | 7.6g |
| 126274-94-0 | CC(C1=C(O)C=CC(C=O)=C1)C | 4-hydroxy-3-(propan-2-yl)benzaldehyde | AG000SH6 | 10g |
| 1262988-77-1 | O=C(C1(O)CCN(CC2=CC=CC=C2)CC1)O.[H]Cl | 1-Benzyl-4-hydroxypiperidine-4-carboxylic acid hydrochloride | AG000SHD | 2g |
| 1262985-23-8 | CCCS(=O)(=O)Nc1ccc(F)c(C(=O)c2cn(C(=O)c3c(Cl)cccc3Cl)c4ncc(cc24)c5ccc(Cl)cc5 | N-(3-(5-(4-Chlorophenyl)-1-(2,6-dichlorobenzoyl)-1H-pyrrolo[2,3-B]pyridine- | AG000SHF | 0.4g |
| 1262892-01-2 | O=C(N1[C@@H](CC(OC)=O)CNCC1)OC(C)(C)C | (S)-tert-Butyl 2-(2-methoxy-2-oxoethyl)piperazine-1-carboxylate | AG000SHG | 20g |
| 1262888-28-7 | FC1=CC=C(C=C1)CNC2=C3C=C(F)C=CC3=NC=N2 | 6-Fluoro-N-(4-fluorobenzyl)quinazolin-4-amine | AG000SHH | 1g |
| 1262886-64-5 | C=CCCCCCC[C@H](NC(OCC1C2=C(C3=C1C=CC=C3)C=CC=C2)=O)C(O)=O | (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)dec-9-enoic acid | AG000SHI | 10g |
| 1262886-63-4 | C=CCCCCC[C@@H](NC(OCC1C2=C(C3=C1C=CC=C3)C=CC=C2)=O)C(O)=O | (2R)-2-(9H-Fluoren-9-ylmethoxycarbonylamino)non-8-enoic acid | AG000SHJ | 3g |
| 1263045-50-6 | O=C(O)[C@@H](NC(OC(C)(C)C)=O)CCNC(C)=C1C(CC(C)(C)CC1=O)=O | Boc-L-Dab(Dde)-OH | AG000SI4 | 3g |
| 1263045-28-8 | O=C(NC[C@@H](NC(OC(C)(C)C)=O)CO)OCC1=CC=CC=C1 | Boc-D-Dap(Z)-ol | AG000SI5 | 15g |
| 1263044-88-7 | O=C1N(C(C=C1)=O)C=1C=C(C=CC1)C(NCCOCCOCCOCCOCCC(=O)ON1C(CCC1=O) | 2,5-dioxopyrrolidin-1-yl 1-(3-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)phenyl)-1 | AG000SI7 | 1.5g |
| 1263001-82-6 | CC1(C2=C(C=CC(NC3=CC=C4C=CC=CC4=C3)=C2)C5=C1C=CC=C5)C | 9,9-dimethyl-N-(naphthalen-2-yl)-9H-fluoren-2-amine | AG000SIA | 45g |
| 1261869-76-4 | N#CC1=CC2=C(C(NC2)=O)C=C1 | 1-Oxoisoindoline-5-carbonitrile | AG000S27 | 10g |
| 1261869-14-0 | COC(=O)C1=C(F)C=C(F)C=C1Cl | Methyl 2-chloro-4,6-difluorobenzoate | AG000S28 | 2g |
| 1261869-07-1 | O=CC1=CC=C(F)C(F)=C1Cl | 2-Chloro-3,4-difluorobenzaldehyde | AG000S29 | 10g |
| 1261862-72-9 | O=C(OCC)CC1=CC=CC(Br)=C1C | Ethyl 2-(3-bromo-2-methylphenyl)acetate | AG000S2D | 3.5g |
| 1261861-91-9 | N#CC1=CC=CC(CO)=C1F | 2-Fluoro-3-(hydroxymethyl)benzonitrile | AG000S2G | 30g |
| 1261885-66-8 | CCOC(=O)C1=CN=C2C=CNC2=C1 | ETHYL 4-AZAINDOLE-6-CARBOXYLATE | AG000S34 | 5.009g |
| 1261883-35-5 | CC1=CC(F)=CN=C1C#N | 5-Fluoro-3-methylpicolinonitrile | AG000S35 | 5g |
| 1261880-87-8 | IC1=C(C=C(C(=O)OC)C=C1)C(F)(F)F | Methyl 4-iodo-3-(trifluoromethyl)benzoate | AG000S36 | 25g |
| 1261877-85-3 | O=C(OC)CC=1C=CC=C(N)C1C | Methyl 2-(3-amino-2-methylphenyl)acetate | AG000S39 | 0.5g |
| 1261874-58-1 | FC=1C=C(C=CC1I)CC(=O)O | 2-(3-Fluoro-4-iodophenyl)acetic acid | AG000S3E | 0.75g |
| 1261895-87-7 | BrC1C=C(C=C(C=1)N1CCCC1)Cl | 1-(3-Bromo-5-chlorophenyl)pyrrolidine | AG000S3T | 10g |
| 1261895-84-4 | NC1=C(OC)C=C(Cl)C=C1Br | 2-Bromo-4-chloro-6-methoxyaniline | AG000S3V | 150g |
| 1261895-63-9 | CCCCOc1ncc(cc1C)Br | 5-Bromo-2-butoxy-3-methylpyridine | AG000S3X | 30g |
| 1261903-47-2 | COC1=CC(=CC=C1)C1=CC(O)=CC(=C1)C(O)=O | 5-Hydroxy-3-(3-methoxyphenyl)benzoic acid | AG000S4A | 0.45g |
| 1261671-72-0 | O=C(O)CC1=C(Br)C=CC=C1N | 2-(2-Amino-6-bromophenyl)acetic acid | AG000RXH | 10g |
| 1261670-97-6 | OC1=CC=C2C=CC=NC2=C1Cl | 8-Chloroquinolin-7-ol | AG000RXK | 0.75g |
| 1261667-41-7 | COC1=CC(C(F)(F)F)=CC(C(F)(F)F)=C1Br | 2-BROMO-3,5-BIS(TRIFLUOROMETHYL)ANISOLE | AG000RXN | 25g |
| 1261666-42-5 | NC1=CC(CO)=CC=C1Br | 2-Bromo-5-hydroxymethylaniline | AG000RXO | 500g |
| 1261653-43-3 | BrC=1C(=C(C(=O)OC)C=CC1)C#N | Methyl 3-bromo-2-cyanobenzoate | AG000RXR | 0.2g |
| 1261649-03-9 | BrCC1=C(Br)C(I)=CC=C1 | 2-bromo-1-(bromomethyl)-3-iodobenzene | AG000RXT | 0.75g |
| 1261648-81-0 | CC(C1=CC(Br)=CC=C1I)=O | 1-(5-Bromo-2-iodophenyl)ethanone | AG000RXV | 600g |
| 1261646-30-3 | O=S(C1=CC=C([N+]([O-])=O)C(OC)=C1)(Cl)=O | 3-Methoxy-4-nitrobenzene-1-sulfonyl chloride | AG000RXX | 10g |
| 1261686-95-6 | BrCC1=C(C#N)C(=CC=C1)F | 2-(Bromomethyl)-6-fluorobenzonitrile | AG000RY1 | 100g |
| 1261686-40-1 | O=C(N)C1=C(I)C=CC=C1Cl | 2-Chloro-6-iodobenzamide | AG000RY2 | 2g |
| 1261683-90-2 | CC1=C(CBr)C(C(F)(F)F)=CC=C1 | 2-Methyl-6-(trifluoromethyl)benzyl bromide | AG000RY5 | 1g |
| 1261929-07-0 | O=C(C1=CC=C(C2=CC=C(C(O)=O)C(F)=C2)C=C1F)O | 3,3′-Difluoro-[1,1′-biphenyl]-4,4′-dicarboxylic acid | AG000S6J | 35g |
| 1261929-04-7 | O=C(C1=CC=C(C2=CC=CC(Cl)=C2)C=C1F)O | 3′-Chloro-3-fluoro-[1,1′-biphenyl]-4-carboxylic acid | AG000S6K | 0.5g |
| 1261944-75-5 | O=C(O)C1=NC=C(C2=CC=CC(C#N)=C2)C=C1 | 5-(3-Cyanophenyl)picolinic acid | AG000S84 | 2g |
| 1261943-47-8 | O=C(C1=CC=C(C2=CC=C(C(O)=O)C=C2F)C=C1)O | 2-Fluoro-[1,1′-biphenyl]-4,4′-dicarboxylic acid | AG000S8A | 20g |
| 1261958-25-1 | OC1=CC=C(C2=CC=CC(NC(OC(C)(C)C)=O)=C2)C=C1 | 4-(3-BOC-Aminophenyl)phenol | AG000S8G | 5g |
| 1261952-79-7 | O=C(C1=CC(C2=CC=CC=C2C)=CC([N+]([O-])=O)=C1)O | 3-(2-Methylphenyl)-5-nitrobenzoic acid | AG000S8Y | 2g |
| 1261964-10-6 | FC=1C=C(C=CC1C(=O)O)C1=C(C=C(C=C1)C(=O)O)C | 3′-Fluoro-2-methyl-[1,1′-biphenyl]-4,4′-dicarboxylic acid | AG000S9G | 0.9g |
| 1261973-55-0 | N#CC1=CC=C(C2=CC=C(C#N)C(O)=C2)C=C1 | 2-Cyano-5-(4-cyanophenyl)phenol | AG000S9Y | 15g |
| 1261972-34-2 | CCCOc1ncc(cc1C)Br | 5-Bromo-3-methyl-2-propoxypyridine | AG000SA2 | 20g |
| 1261970-90-4 | O=C(C1=CC=C(C2=CC=C(C=O)C=C2)C=C1F)O | 2-Fluoro-4-(4-formylphenyl)benzoic acid | AG000SA8 | 5g |
| 1261988-16-2 | O=[N+](C1=C(F)C(F)=CC(Br)=C1)[O-] | 5-Bromo-1,2-difluoro-3-nitrobenzene | AG000SAJ | 200g |
| 1261977-99-4 | O=C(O)C1=NC(C2=CC=C(F)C(OC)=C2)=CC=C1 | 6-(4-Fluoro-3-methoxyphenyl)picolinic acid | AG000SAZ | 2g |
| 1261995-07-6 | BrC1=CC(Br)=CC(N2CCCCC2)=C1 | 1-(3,5-Dibromophenyl)piperidine | AG000SBD | 19g |
| 1262001-75-1 | C1(C=CC(=C(F)C=1)C)C1C=CC(=CC=1)O | 4-(3-Fluoro-4-methylphenyl)phenol | AG000SC9 | 10g |
| 1261822-74-5 | OCC1=CC=C(OC(F)(F)F)C=C1Cl | 2-CHLORO-4-TRIFLUOROMETHOXYBENZYL ALCOHOL | AG000S0T | 20g |
| 1261818-72-7 | C1=CC(=CC(=C1C#N)Br)OC(F)F | 2-Bromo-4-(difluoromethoxy)benzonitrile | AG000S0X | 3g |
| 1261817-10-0 | IC1=CC=C(Br)C=C1CCl | 4-Bromo-2-(chloromethyl)-1-iodobenzene | AG000S0Z | 200g |
| 1261816-95-8 | N#CC1=CC=CC(OC)=C1Br | 2-BroMo-3-Methoxybenzonitrile | AG000S10 | 50g |
| 1261814-91-8 | O=C(O)CCC1=CC=CC(Br)=C1F | 3-(3-Bromo-2-Fluorophenyl)Propanoic Acid | AG000S14 | 10g |
| 1261813-10-8 | C(F)(F)(F)c1c2c(C(=O)NC2)ccc1 | 1H-Isoindol-1-one, 2,3-dihydro-4-(trifluoromethyl)- | AG000S15 | 10g |
| 1261803-34-2 | OC1=C2C=C(C(F)(F)F)C=NC2=CC=C1 | 3-(Trifluoromethyl)quinolin-5-ol | AG000S18 | 0.75g |
| 1261802-94-1 | O=C(OC)C1=CC(Cl)=C(F)C=C1F | Methyl 5-chloro-2,4-difluorobenzoate | AG000S19 | 0.3g |
| 1261797-04-9 | O=C(OC)C1=CC=CC(I)=C1Br | Methyl 2-bromo-3-iodobenzoate | AG000S1B | 30g |
| 1261849-88-0 | O=CC1=CC=CC(I)=C1N | 2-Amino-3-iodobenzaldehyde | AG000S1K | 5g |
| 1261844-48-7 | FC(F)c1cc2cccnc2[nH]1 | 2-(Difluoromethyl)-1h-pyrrolo[2,3-b]pyridine | AG000S1M | 1g |
| 1261827-82-0 | OCC1=CC=CC(F)=C1I | (3-fluoro-2-iodophenyl)methanol | AG000S20 | 0.75g |
| 1261871-20-8 | CCOC(=O)C1=CC=CC2=C1C=NC=C2 | Ethyl isoquinoline-8-carboxylate | AG000S25 | 20g |
| 1261680-57-2 | BrC=1C=C(C=C(C1)F)CCC(=O)O | 3-(3-Bromo-5-fluorophenyl)propanoic acid | AG000RYC | 5g |
| 1261677-80-8 | [Br]C1(=CC(O)=C2(C=CC=NC2(=C1))) | 7-Bromoquinolin-5-ol | AG000RYE | 26g |
| 1261676-68-9 | NC1=C([N+]([O-])=O)C=CC(C)=C1F | 2-Fluoro-3-methyl-6-nitroaniline | AG000RYF | 25g |
| 1261676-58-7 | NC(=O)C1=C(N)C=CC=C1[N+]([O-])=O | Benzamide, 2-amino-6-nitro- | AG000RYG | 2g |
| 1261675-06-2 | COc1cc(Br)ccc1CCC(=O)O | 3-(4-Bromo-2-methoxyphenyl)propanoic acid | AG000RYK | 5g |
| 1261749-95-4 | COC(C1=NC(C)=C(Cl)C=C1)=O | Methyl 5-chloro-6-methylpicolinate | AG000RYP | 0.5g |
| 1261742-22-6 | N#CC1=CC=C(F)C=C1CCl | 2-CYANO-5-FLUOROBENZYL CHLORIDE | AG000RYS | 0.2g |
| 1261739-13-2 | O=C(OCC)C1=NC=C(C)C(Cl)=C1 | Ethyl 4-chloro-5-methylpicolinate | AG000RYW | 25g |
| 1261737-67-0 | Oc1ccc2sc(Cl)nc2c1 | 2-Chlorobenzo[d]thiazol-5-ol | AG000RYZ | 20g |
| 1261737-50-1 | O=Cc1cc(F)c(F)c(Cl)c1 | 3-Chloro-4,5-difluorobenzaldehyde | AG000RZ0 | 10g |
| 1261733-93-0 | OC(=O)CC1=CC=C(Cl)C(=C1)C#N | 4-Chloro-3-cyanophenylacetic acid | AG000RZ2 | 1g |
| 1261733-77-0 | OC1=CC2=C(Br)C=CC=C2N=C1 | 5-Bromoquinolin-3-ol | AG000RZ3 | 0.75g |
| 1261729-67-2 | C1=CC2=C(C=C(C=N2)F)C(=C1)O | 3-Fluoroquinolin-5-ol | AG000RZ6 | 0.75g |
| 1261726-80-0 | N#CC1=CC2=C(CNC2=O)C=C1 | 3-oxoisoindoline-5-carbonitrile | AG000RZ9 | 3g |
| 1261448-82-1 | COC1=C(Br)C=CC(CN)=C1 | (4-Bromo-3-methoxyphenyl)methanamine | AG000RRB | 2g |
| 1261446-05-2 | OC(=O)C1=C(Br)C=CC=C1C#N | 2-Bromo-6-cyanobenzoic acid | AG000RRD | 14.1g |
| 1261442-48-1 | O=CC1=CC=C(Cl)C=C1OC(F)(F)F | 4-Chloro-2-(trifluoromethoxy)benzaldehyde | AG000RRI | 300g |
| 1261478-26-5 | O=C(OC)C1=CC(C(F)(F)F)=CC=C1O | METHYL 2-HYDROXY-5-(TRIFLUOROMETHYL)BENZOATE | AG000RRR | 20g |
| 1261476-54-3 | O=C(C1=CC=CC(F)=C1C#N)OC | Methyl 2-cyano-3-fluorobenzoate | AG000RRS | 7g |
| 1261473-80-6 | ClC1=CC=C(C(=N1)I)C | 6-Chloro-2-iodo-3-methylpyridine | AG000RRX | 5g |
| 1261473-36-2 | COC1=NC(Cl)=CC=C1F | 6-Chloro-3-fluoro-2-methoxypyridine | AG000RRZ | 30g |
| 1261471-96-8 | NCC1=C(Br)C=CC=C1Cl | (2-Bromo-6-chlorophenyl)methanamine | AG000RS2 | 5g |
| 1261471-73-1 | OC1=CC=C2C=C(C(F)(F)F)C=NC2=C1 | 3-(TRIFLUOROMETHYL)QUINOLIN-7-OL | AG000RS3 | 0.75g |
| 1261470-87-4 | O=CC1=CC=C(Br)C=C1I | 4-Bromo-2-iodobenzaldehyde | AG000RS5 | 200g |
| 126147-70-4 | CC(C)[C@H](NC(OC1=CC=CC=C1)=O)C(O)=O | (S)-3-Methyl-2-((phenoxycarbonyl)amino)butanoic acid | AG000RSB | 3g |
| 1261618-25-0 | OCC1=C(Cl)C=C(C#N)C=C1 | 2-Chloro-4-cyanobenzyl alcohol | AG000RW6 | 5g |
| 1261618-03-4 | O=C(O)CC1=CC=CC(Br)=C1C | 2-(3-Bromo-2-Methylphenyl)Acetic Acid | AG000RW7 | 25g |
| 1261615-96-6 | OCC1=CC=C(I)C(F)=C1 | (3-Fluoro-4-iodophenyl)methanol | AG000RW9 | 75g |
| 126163-30-2 | FC1=C(F)C(CCO)=CC=C1 | 2-(2,3-Difluorophenyl)ethanol | AG000RWD | 30g |
| 126162-96-7 | CCOC1=C(F)C(F)=C(C=C1)C#N | 4-Ethoxy-2,3-difluorobenzonitrile | AG000RWG | 175g |
| 126162-95-6 | O=CC1=CC=C(OCC)C(F)=C1F | 4-Ethoxy-2,3-Difluorobenzaldehyde | AG000RWH | 10g |
| 126162-38-7 | FC1=C(C#N)C=CC(=C1F)O | 2,3-Difluoro-4-hydroxybenzonitrile | AG000RWK | 620g |
| 1261645-53-7 | O=C(O)CC1=C(F)C=CC=C1OC(F)F | 2-(2-(Difluoromethoxy)-6-fluorophenyl)acetic acid | AG000RWN | 5g |
| 1261644-21-6 | OCC1=CC=CC(I)=C1Br | (2-Bromo-3-iodophenyl)methanol | AG000RWP | 35g |
| 1261643-24-6 | O=C(O)CC1=CC=C(Br)C(Cl)=C1 | 2-(4-Bromo-3-chlorophenyl)acetic acid | AG000RWQ | 300g |
| 126163-58-4 | N#CC1=CC=C(Br)C(F)=C1F | 4-BROMO-2,3-DIFLUOROBENZONITRILE | AG000RX8 | 200g |
| 126163-56-2 | OC1=CC=C(OCC)C(F)=C1F | 4-Ethoxy-2,3-difluorophenol | AG000RX9 | 1000g |
| 126352-69-0 | C12=CC=NN1CCCN2 | 4,5,6,7-Tetrahydropyrazolo[1,5-a]pyrimidine | AG000SPC | 20g |
| 126378-11-8 | C(OC(=O)CCC#C)c1ccccc1 | 4-Pentynoic acid, phenylmethyl ester | AG000SPY | 1g |
| 126370-67-0 | NC1=CN=C(C2=CC=CC=C2)C=C1 | 6-PHENYL-3-PYRIDINAMINE | AG000SQ0 | 500g |
| 126393-38-2 | CC(C1=CC=C(C2=NNN=N2)C=C1)(C)C | 5-(4-(tert-Butyl)phenyl)-2H-tetrazole | AG000SQG | 15g |
| 13762-14-6 | [O-][Mo](=O)([O-])=O.[Co+2] | Cobalt molybdenum oxide (CoMoO4) | AG000SQM | 200g |
| 1304-76-3 | O=[Bi]O[Bi]=O | Bismuth(Iii) Oxide | AG000SQR | 500g |
| 1264127-92-5 | CC(OC1=NC=C(F)C(B(O)O)=C1)C | (5-Fluoro-2-isopropoxypyridin-4-yl)boronic acid | AG000SQX | 1g |
| 1264097-17-7 | NC1=CN(CC2=CC=CC=C2)N=C1.[H]Cl | 1-Benzyl-1h-pyrazol-4-amine hydrochloride | AG000SQZ | 15g |
| 1264046-99-2 | O=C(C1=NN(C2=CC=C(F)C=C2)C(N)=C1)OCC | Ethyl 5-amino-1-(4-fluorophenyl)-1H-pyrazole-3-carboxylate | AG000SR1 | 3g |
| 1264034-44-7 | O[C@H]1CN(C2=NC(Br)=CC=C2)CC1 | (R)-1-(6-Bromopyridin-2-yl)pyrrolidin-3-ol | AG000SR4 | 0.5g |
| 126411-39-0 | OC1=C(C(C)(C)C)C=C(C=C(P(OCC)(OCC)=O)P(OCC)(OCC)=O)C=C1C(C)(C)C | SR12813 | AG000SR7 | 3g |
| 1264198-72-2 | CC1(C)C(C)(C)OB(C2CCN(C)CC2)O1 | 1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)piperidine | AG000SRP | 20g |
| 1264193-11-4 | BrC1=CN2N=CC=C2C=C1 | 6-Bromopyrazolo[1,5-a]pyridine | AG000SRS | 47.77g |
| 126422-58-0 | C#CCOCCOCCOCCOCC#C | 4,7,10,13-Tetraoxahexadeca-1,15-diyne | AG000SRZ | 100g |
| 126417-84-3 | NC1=CC(C2=CC=C(Br)C=C2)=NN1C | 5-Amino-3-(4-bromophenyl)-1-methylpyrazole | AG000SS3 | 30g |
| 1263046-84-9 | O=C(OCC1c2ccccc2-c2c1cccc2)NCC[C@H](C(=O)O)NC(=C1C(=O)CC(CC1=O)(C)C)C | Dde-D-Dab(Fmoc)-OH | AG000SJB | 5g |
| 1263178-51-3 | FC(C1=CC(CBr)=CC=C1)F | 1-(Bromomethyl)-3-(difluoromethyl)benzene | AG000SJD | 5.75g |
| 1263178-34-2 | BrC1C2=C(C=CC=C2)ON=1 | 3-bromo-1,2-benzoxazole | AG000SJE | 5g |
| 1263132-31-5 | FC1(F)CC12CCNCC2.[H]Cl | 1,1-difluoro-6-azaspiro[2.5]octane hydrochloride | AG000SJG | 34g |
| 1263094-16-1 | C[C@H](N)C1=NC=C(Br)C=C1.[H]Cl | (S)-1-(5-Bromopyridin-2-yl)ethanamine hydrochloride | AG000SJK | 0.5g |
| 126318-27-2 | OC1=CC2=C(OC=C2[N+]([O-])=O)C=C1 | 3-NITROBENZO[B]FURAN-5-OL | AG000SJM | 5g |
| 1263205-97-5 | O=C1C(NC2=CC(C(F)(F)F)=CC(C(F)(F)F)=C2)=C(N[C@@H](C3=CC=CC=C3)[C@H]( | 3-[[3,5-Bis(trifluoromethyl)phenyl]amino]-4-[[(1S,2S)-2-(dimethylamino)-1,2 | AG000SK7 | 2g |
| 1263205-96-4 | O=C1C(C(NC2=CC(C(F)(F)F)=CC(C(F)(F)F)=C2)=C1N[C@@H]3[C@@H](N(C)C)CC | 3-((3,5-Bis(trifluoromethyl)phenyl)amino)-4-(((1S,2S)-2-(dimethylamino)cycl | AG000SK8 | 10g |
| 1263198-93-1 | CC(C)C[C@H](C1=CC=CC=C1)N.[H]Cl | (R)-3-Methyl-1-phenylbutan-1-amine hydrochloride | AG000SK9 | 0.25g |
| 1263187-14-9 | CCOC(C=CB1OC(C)(C)C(C)(C)O1)=O | 3-Ethoxy-3-oxo-1-propene-1-boronic Acid Pinacol Ester | AG000SKA | 5g |
| 1263180-53-5 | Cl.NCC1(CCOCC1)F | (4-Fluorotetrahydro-2H-pyran-4-yl)methanamine hydrochloride | AG000SKC | 50g |
| 1263180-22-8 | O=C(OC(C)(C)C)NC1C(F)(F)CNCC1 | 4-(Boc-amino)-3,3-difluoropiperidine | AG000SKD | 50g |
| 126325-54-0 | CC1=NC=C(Br)C(N)=C1Br | 3,5-Dibromo-2-methylpyridin-4-amine | AG000SKE | 10g |
| 126325-53-9 | CC1=CC=C(N)C(Br)=N1 | 3-Amino-2-Bromo-6-Picoline | AG000SKF | 189.25g |
| 126325-50-6 | CC1=C(N)C(Br)=NC=C1 | 3-Amino-2-bromo-4-picoline | AG000SKH | 487.75g |
| 126325-48-2 | NC1=C(Br)C=CN=C1C | 4-Bromo-2-methylpyridin-3-amine | AG000SKI | 15g |
| 126541-87-5 | C(F)(F)(F)c1c(O)cc(cc1)C(=O)O | 3-Hydroxy-4-(trifluoromethyl)benzoic acid | AG000SWK | 3g |
| 126541-82-0 | O=C(OC)C1=CC=C(C(F)(F)F)C(N)=C1 | Methyl 3-Amino-4-(Trifluoromethyl)Benzoate | AG000SWL | 15g |
| 126541-81-9 | O=C(OC)C1=CC=C(C(F)(F)F)C([N+]([O-])=O)=C1 | Methyl 3-nitro-4-trifluoromethylbenzoate | AG000SWM | 600g |
| 126538-89-4 | O=C1C=C(C(F)F)N=CN1 | 6-(Difluoromethyl)pyrimidin-4(1H)-one | AG000SWO | 10g |
| 126538-81-6 | O=C1N=CNC(C(F)(F)F)=C1Br | 5-Bromo-6-(trifluoromethyl)pyrimidin-4(1H)-one | AG000SWP | 35g |
| 126535-26-0 | O=C(OC)C1=CC=CC(C)=C1S(=O)(Cl)=O | Methyl 2-(chlorosulfonyl)-3-methylbenzoate | AG000SWV | 150g |
| 126534-87-0 | O=C(N)C1=CC=CC(C=O)=C1 | 3-Formylbenzamide | AG000SWY | 30g |
| 126534-43-8 | O[C@@H](CCl)C1=CC=C(F)C=C1 | (R)-2-Chloro-1-(4-fluorophenyl)ethanol | AG000SWZ | 40g |
| 126534-42-7 | FC1=CC=C([C@H](O)CCl)C=C1 | (S)-2-Chloro-1-(4-Fluorophenyl)Ethanol | AG000SX0 | 25g |
| 126534-41-6 | C[C@@H](O)C1C=C(F)C(F)=CC=1 | (1R)-1-(3,4-Difluorophenyl)ethan-1-ol | AG000SX1 | 20g |
| 126534-33-6 | C[C@@H](O)C1=CC=CC(F)=C1 | (R)-1-(3-Fluorophenyl)ethanol | AG000SX2 | 39g |
| 126553-00-2 | NC1=CC=C(CC)N=C1 | 6-Ethylpyridin-3-amine | AG000SXA | 10g |
| 126577-48-8 | C[C@@H](O)C(O)(c1ccccc1)c1ccccc1 | 1,2-Propanediol, 1,1-diphenyl-, (2R)- | AG000SXW | 15g |
| 126572-74-5 | CCCCCCCCCCCCCCCCCCN(C(=O)COCC(=O)N(C1CCCCC1)C1CCCCC1)CCCCCCCCCC | Calcium ionophore IV | AG000SY1 | 1g |
| 1265896-03-4 | O=C(C1=CN=C2C=NC=CN21)O | imidazo[1,2-a]pyrazine-3-carboxylic acid | AG000SYG | 6g |
| 126587-35-7 | [C@H](NC(=O)OC(C)(C)C)(CCC(=O)OC)CO | (S)-Methyl 4-((tert-butoxycarbonyl)amino)-5-hydroxypentanoate | AG000SYM | 50g |
| 1266656-98-7 | IC1=CC2=NC=CN2C(Cl)=C1 | 5-Chloro-7-iodoimidazo[1,2-a]pyridine | AG000T2T | 1.75g |
| 126674-95-1 | O=C(C1=CC(OC)=NN1C)O | 3-Methoxy-1-methyl-1H-pyrazole-5-carboxylic acid | AG000T32 | 8g |
| 126674-94-0 | N#CC1=CC(F)=CC(F)=C1N | 2-Amino-3,5-difluorobenzonitrile | AG000T33 | 10g |
| 126674-93-9 | O=C1c2c(NC1=O)cc(cc2F)F | 4,6-Difluoro-1H-indole-2,3-dione | AG000T34 | 1000g |
| 126674-78-0 | O=C(O)C1=CC(F)=CC(F)=C1N | 2-Amino-3,5-difluorobenzoic acid | AG000T35 | 600g |
| 126674-77-9 | O=C(O)C1=C(F)C=C(F)C=C1N | 2-Amino-4,6-difluorobenzoic acid | AG000T36 | 100g |
| 126689-04-1 | CC1(C)C(C)(C)OB(C2(C)CC2)O1 | 4,4,5,5-Tetramethyl-2-(1-methylcyclopropyl)-1,3,2-dioxaborolane | AG000T3N | 20g |
| 126689-01-8 | CC1(C)C(C)(C)OB(C2CC2)O1 | Cyclopropylboronic acid, pinacol ester | AG000T3O | 200g |
| 126689-00-7 | C/C(C)=CB1OC(C)(C)C(C)(C)O1 | 2,2-Dimethylethenylboronic acid pinacol ester | AG000T3P | 375g |
| 126688-99-1 | CC1(C)C(C)(C)OB(/C=C/[Si](C)(C)C)O1 | Trimethyl[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]silane | AG000T3Q | 30g |
| 126688-97-9 | CC1(C)C(C)(C)OB(/C=C/CCCC)O1 | (E)-2-(Hex-1-en-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane | AG000T3R | 20g |
| 126683-99-6 | ClC5(P=O)(C4(C12(CC3(CC(C1)CC(C2)C3)))(CC6(CC(C4)CC5C6))) | Di-1-adamantylphosphinic chloride | AG000T3X | 2g |
| 1266975-27-2 | C[C@@H]1CCN(CCN1)C1=NC2=CC(Cl)=CC=C2O1 | (R)-5-Chloro-2-(5-methyl-1,4-diazepan-1-yl)benzo[D]oxazole | AG000T4B | 35g |
| 126712-07-0 | O=CC1=C(OC)C=CC=C1Br | 2-Bromo-6-methoxybenzaldehyde | AG000T4E | 125g |
| 126705-22-4 | O=C(C1(NC(OCC2C3=C(C4=C2C=CC=C4)C=CC=C3)=O)CC1)O | Fmoc-Acpc-OH | AG000T4J | 500g |
| 12671-74-8 | O=C1N(CCCCCCCCCCCCCCCCCC)C(C(C2=C1C=CC3=C24)=CC=C4SC5=C3C=CC=C5)= | 2-Octadecyl-1H-thioxantheno[2,1,9-def]isoquinoline-1,3(2H)-dione | AG000T4M | 75g |
| 1267217-46-8 | FC(F)(F)C1=CC2=C(OC=N2)C=C1 | 5-(Trifluoromethyl)benzoxazole | AG000T4Q | 20g |
| 126325-47-1 | CC1=NC(Br)=CC=C1N | 5-Amino-2-bromo-6-picoline | AG000SKJ | 500g |
| 126325-46-0 | CC1=CC=C(Br)C(N)=N1 | 2-Amino-3-bromo-6-methylpyridine | AG000SKK | 500g |
| 126320-57-8 | O=C(OCC)CN1CCN(CC(OCC)=O)CCCN(CC(OCC)=O)CCN(CC(OCC)=O)CCC1 | Tetraethyl 1,4,8,11-Tetraazacyclotetradecane-1,4,8,11-tetraacetate | AG000SKM | 25g |
| 1263280-37-0 | O=C(O)C1=NC(O)=CC=C1Cl | 3-Chloro-6-hydroxypicolinic acid | AG000SKW | 3g |
| 1263280-06-3 | CC1(C)C(=O)NC2=NC=C(Br)C=C12 | 5-Bromo-3,3-dimethyl-1H-pyrrolo[2,3-b]pyridin-2(3H)-one | AG000SL0 | 3g |
| 1263280-02-9 | O=C(C1=CC2=C(F)C=CC=C2S1)OCC | Ethyl 4-fluorobenzo[b]thiophene-2-carboxylate | AG000SL2 | 3g |
| 1263279-55-5 | O=C1NC2=NC=C(Br)C=C2C31CC3 | 5′-Bromospiro[cyclopropane-1,3′-pyrrolo[2,3-b]pyridin]-2′(1’H)-one | AG000SL8 | 0.4g |
| 1263274-67-4 | CC1=C(Cl)C=C(C(O)=O)C(F)=C1 | 5-Chloro-2-fluoro-4-methylbenzoic acid | AG000SLF | 5g |
| 1263282-98-9 | Cc1nn2ccc(Cl)nc2c1I | 5-chloro-3-iodo-2-methylpyrazolo[1,5-a]pyrimidine | AG000SLG | 5g |
| 1263282-57-0 | O=[N+](C1=C(F)N=C(C)C(Br)=C1)[O-] | 3-Bromo-6-fluoro-2-methyl-5-nitropyridine | AG000SLP | 1.25g |
| 1263282-40-1 | CC1=C(F)C=CN=C1.Cl | 4-Fluoro-3-picoline hcl | AG000SLS | 5g |
| 1263281-88-4 | C1=CC=C(C=C1)CN2C[C@@H](C3=CC=C(C=C3)C(F)(F)F)[C@@H](C2)C(=O)O | rel-(3S,4R)-1-Benzyl-4-(4-(trifluoromethyl)phenyl)pyrrolidine-3-carboxylic ac | AG000SLV | 10g |
| 1263281-78-2 | CC(OC(NC1CC(=O)NCC1)=O)(C)C | (2-OXO-PIPERIDIN-4-YL)-CARBAMIC ACID TERT-BUTYL ESTER | AG000SLW | 25g |
| 1263281-72-6 | CC(OC(N1C[C@H](C2=CC=C(C(C)(C)C)C=C2)[C@@H](C(O)=O)C1)=O)(C)C | (3S,4R)-1-(tert-Butoxycarbonyl)-4-(4-tert-butylphenyl)pyrrolidine-3-carboxyl | AG000SLY | 4g |
| 1263281-14-6 | CC(C)(C)OC(=O)C1=C(C=CC(=C1)F)Br | Tert-Butyl 2-Bromo-5-Fluorobenzoate | AG000SM4 | 2g |
| 126146-01-8 | Cc1ccc(C)c(c1)S(=O)(=O)Nc1ccc(cc1)C(O)=O | 4-(2,5-Dimethylphenylsulfonamido)benzoic acid | AG000RSE | 0.5g |
| 1261497-72-6 | O=C(O)CC1=CC=C(Br)C=C1O | 2-(4-bromo-2-hydroxyphenyl)acetic acid | AG000RSI | 20g |
| 1261495-96-8 | FC(C1=CC(Br)=C(Cl)C=C1)F | 2-Bromo-1-chloro-4-(difluoromethyl)benzene | AG000RSJ | 27g |
| 1261493-38-2 | COC1=NC=C(C#N)C(=C1)Cl | 4-Chloro-6-methoxynicotinonitrile | AG000RSL | 25g |
| 1261491-28-4 | COC(=O)C1=C(Cl)C=CN=C1C | Methyl 4-Chloro-2-Methylpyridine-3-Carboxylate | AG000RSN | 1g |
| 1261488-11-2 | CC1=CC(Cl)=NC(F)=C1 | 2-Chloro-6-fluoro-4-methylpyridine | AG000RSR | 3g |
| 1261487-89-1 | OC1=CC2=C(Cl)C=CC=C2N=C1 | 5-Chloroquinolin-3-ol | AG000RST | 0.5g |
| 1261487-49-3 | COC(C1=C(F)N=CC=N1)=O | Methyl 3-fluoropyrazine-2-carboxylate | AG000RSV | 1g |
| 1261524-75-7 | ClC1=C(Br)C=CC=C1CO | (3-Bromo-2-chlorophenyl)methanol | AG000RT6 | 200g |
| 1261513-55-6 | OC1=CC(C(F)F)=C(Br)C=C1 | 4-Bromo-3-(difluoromethyl)phenol | AG000RTD | 0.3g |
| 1261512-49-5 | COC1=CC=C(Br)C=C1C(F)F | 4-Bromo-2-(difluoromethyl)-1-methoxybenzene | AG000RTE | 20g |
| 1261504-50-0 | O=C(OC)C1=C([N+]([O-])=O)C=CC=C1O | Methyl 2-hydroxy-6-nitrobenzoate | AG000RTF | 1.5g |
| 126724-95-6 | O=C1OCC=C1[C@H]1CCc2c(C1)c1[C@@H](OC(=O)c1cc2)c1cocc1 | Tilifodiolide | AG000T4U | 0.005g |
| 126718-04-5 | CCOC(=O)c1cc2c(n1CC#N)cccc2 | Ethyl 1-(cyanomethyl)-1H-indole-2-carboxylate | AG000T4Z | 4g |
| 126717-60-0 | [Br]C2(=C(N=C(OCC1(=CC=CC=C1))C=C2)C) | 6-(Benzyloxy)-3-bromo-2-methylpyridine | AG000T50 | 500g |
| 126717-59-7 | BrC1=CC=C(N=C1C)OC | 3-Bromo-6-methoxy-2-methylpyridine | AG000T51 | 100g |
| 126717-23-5 | C1=CC=C(C=C1)N(C1=CC=CC=C1)C1=CC(=CC(=C1)N(C1=CC=CC=C1)C1=CC=CC=C1) | 1,3,5-Tris(diphenylamino)benzene | AG000T53 | 195g |
| 126716-90-3 | OC1=CC=C(OC2=CC(OC3=CC=C(O)C=C3)=CC=C2)C=C1 | 1,3-Bis(4-hydroxyphenoxy)benzene | AG000T54 | 20g |
| 126714-85-0 | ClC1=C(Cl)SC(S(Cl)(=O)=O)=C1 | 2,3-Dichlorothiophene-5-sulfonyl chloride | AG000T5A | 10g |
| 126728-58-3 | FC(F)(F)COC1=NC=C(Br)C=C1 | 5-bromo-2-(2,2,2-trifluoroethoxy)pyridine | AG000T5P | 600g |
| 126728-20-9 | ClC1=NC2=C(C=CC=N2)C(Cl)=N1 | 2,4-dichloropyrido[2,3-d]pyrimidine | AG000T5R | 50g |
| 126727-04-6 | OC(=O)C(CC1=CC=CC=C1)NC(=O)OCC1C2=CC=CC=C2C2=CC=CC=C12 | Fmoc-DL-Phe-OH | AG000T5U | 300g |
| 126726-62-3 | C=C(B1OC(C)(C)C(C)(C)O1)C | 2-Isopropenylboronic acid, pinacol ester | AG000T5W | 281.25g |
| 126748-58-1 | NC1=NNC(CCC)=C1 | 5-Propyl-1H-pyrazol-3-ylamine | AG000T6C | 75g |
| 126747-14-6 | C1=C(C=CC(=C1)C#N)B(O)O | 4-Cyanophenylboronic acid | AG000T6E | 1000g |
| 126747-13-5 | O=C(O)C1=CC=C(B2OCCCO2)C=C1 | 4-(1,3,2-dioxaborinan-2-yl)benzoic acid | AG000T6F | 75g |
| 126746-20-1 | O=C(O)C(N)C1=CC=C(C(C)C)C=C1 | Amino(4-isopropylphenyl)acetic acid | AG000T6G | 0.75g |
| 1267610-26-3 | O=C1C(N2CCOCC2)=CCCN1C3=CC=C(N)C=C3 | 1-(4-Aminophenyl)-5,6-dihydro-3-(4-morpholinyl)-2(1H)-pyridinone | AG000T6R | 500g |
| 1267502-64-6 | C#CC1=CC=C(C=O)C(F)=C1 | 4-Ethynyl-2-fluorobenzaldehyde | AG000T6U | 1.5g |
| 1261725-56-7 | O=C(O)CCC1=CC=C(Br)C=C1Cl | 3-(4-Bromo-2-chlorophenyl)propanoic acid | AG000RZA | 25g |
| 126174-81-0 | IC1=CC2=C(NC(N2)=S)C=C1 | 5-Iodo-1H-benzo[d]imidazole-2(3H)-thione | AG000RZC | 4g |
| 1261769-34-9 | COC1=C(I)C=CC(Cl)=N1 | 6-Chloro-3-iodo-2-methoxypyridine | AG000RZH | 5g |
| 1261767-18-3 | O=[N+](C1=CN=C(Cl)C=C1Br)[O-] | 4-Bromo-2-chloro-5-nitropyridine | AG000RZJ | 1g |
| 1261759-41-4 | N#CC1=CC(C=O)=CC=C1Cl | 2-Chloro-5-formylbenzonitrile | AG000RZO | 50g |
| 1261758-80-8 | C1=C(C)C=CC(C#N)=C1C(O)=O | 2-Cyano-5-methylbenzoic acid | AG000RZR | 2.35g |
| 1261753-88-1 | NC1=C(OC(F)(F)F)C=C(C=C1)[N+]([O-])=O | 4-Nitro-2-(trifluoromethoxy)aniline | AG000RZW | 225g |
| 1261784-49-9 | OC1=CC2=CC=CC(F)=C2N=C1 | 8-Fluoroquinolin-3-ol | AG000S09 | 1g |
| 1261784-25-1 | O=C(C1=C2C=C(O)C=NC2=CC=C1)O | 3-HYDROXYQUINOLINE-5-CARBOXYLIC ACID | AG000S0A | 0.3g |
| 1261777-86-9 | OCc1ccc(c(c1)C#N)Cl | 2-Chloro-5-(hydroxymethyl)benzonitrile | AG000S0G | 0.59g |
| 1261776-03-7 | C1=CC(=C(C=C1I)Br)C#N | 2-Bromo-4-iodobenzonitrile | AG000S0L | 600g |
| 1261775-55-6 | O=C(O)CC1=CC=CC(Cl)=C1Br | 2-(2-Bromo-3-chlorophenyl)acetic acid | AG000S0O | 6g |
| 1263374-32-8 | N#CC1(CN)CCOCC1 | 4-(Aminomethyl)tetrahydro-2h-pyran-4-carbonitrile HCl | AG000SNV | 6.9g |
| 1263425-79-1 | O=C(OC(C)(C)C)NC1=CC(Cl)=NN2C1=NN=C2 | tert-Butyl (6-chloro-[1,2,4]triazolo[4,3-b]pyridazin-8-yl)carbamate | AG000SO8 | 4g |
| 1263414-46-5 | C=CC1=CC=C(Cl)C(F)=C1 | 4-Chloro-3-fluorostyrene | AG000SO9 | 125g |
| 1263378-94-4 | N1C=CSC=1CBr.Br | 2-(Bromomethyl)Thiazole Hydrobromide | AG000SOE | 5g |
| 1263378-90-0 | BrC1=C2CNCCN2N=C1 | 3-Bromo-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine | AG000SOF | 5g |
| 1263378-68-2 | O=C(OC)C1=CC=CC(C(N)C)=C1.[H]Cl | Methyl 3-(1-Aminoethyl)benzoate Hydrochloride | AG000SOI | 2g |
| 1263378-64-8 | NC(=O)c1cc(Cl)nc(Cl)c1N | 3-Amino-2,6-dichloroisonicotinamide | AG000SOJ | 2g |
| 1263378-44-4 | C1CNCCC1N2C=C(C=N2)Br.Cl | 4-(4-Bromo-1H-pyrazol-1-yl)piperidine hydrochloride | AG000SOL | 5g |
| 1263378-40-0 | COC1=CC=C(F)C(Cl)=C1C=O | 2-Chloro-3-fluoro-6-methoxybenzaldehyde | AG000SOM | 10g |
| 1263378-39-7 | O=C(C1=CN=C(C2CC2)O1)O | 2-Cyclopropyloxazole-5-carboxylic acid | AG000SON | 9g |
| 1263378-30-8 | CC1C(N)CCOC1 | 3-methyltetrahydro-2H-pyran-4-amine | AG000SOP | 25g |
| 1263378-29-5 | OC1CC(N)CCC1.[H]Cl | 3-Aminocyclohexanol hydrochloride | AG000SOQ | 15g |
| 1263378-28-4 | Cl.O=C1CNCC2CCCCN12 | Hexahydro-1H-pyrido[1,2-a]pyrazin-4(6H)-one hydrochloride | AG000SOR | 0.5g |
| 1263506-20-2 | CC(C)(C)OC(=O)N1CCC(C)(CO)C1 | 1-Boc-3-methylpyrrolidine-3-methanol | AG000SOW | 60g |
| 1263475-93-9 | CC(C)c1nc(nc(-c2ccc(F)cc2)c1C(O)=O)N(C)S(C)(=O)=O | 4-(4-fluorophenyl)-2-(N-methylmethanesulfonamido)-6-(propan-2-yl)pyrimi | AG000SOX | 0.17g |
| 126354-83-4 | [Br]C1(=NC([Br])=CC(=C1N)C) | 3-Amino-2,6-dibromo-4-picoline | AG000SP5 | 35g |
| 126416-20-4 | IC12CC(C1)(C2)C12CC(I)(C1)C2 | 3,3′-Diiodo-1,1′-bi(bicyclo[1.1.1]pentane) | AG000SS8 | 1.75g |
| 1264243-44-8 | O=C(OC(C)(C)C)N[C@H]1CN[C@H](CO)C1.[H]Cl | tert-Butyl ((3R,5S)-5-(hydroxymethyl)pyrrolidin-3-yl)carbamate hydrochlorid | AG000SSE | 2g |
| 1264243-41-5 | OC[C@H]1C[C@@H](NC(OC(C)(C)C)=O)CN1 | tert-Butyl ((3R,5S)-5-(hydroxymethyl)pyrrolidin-3-yl)carbamate | AG000SSF | 1.75g |
| 126430-46-4 | O=C(OCC1=CC=CC=C1)CCCBr | Benzyl 4-bromobutanoate | AG000SSQ | 600g |
| 126429-21-8 | CC(N(C(C)C)P(OCC=C)OCC=C)C | Diallyl diisopropylphosphoramidite | AG000SSR | 50g |
| 1264573-23-0 | O=P1(O)OC2=[C@]([C@]3=C(C=CC=C4)C4=CC(C5=CC=C(C(F)(F)F)C=C5)=C3O1)C6 | (11bS)-4-Hydroxy-2,6-bis[4-(trifluoromethyl)phenyl]-4-oxide-dinaphtho[2,1- | AG000ST0 | 4g |
| 1264481-38-0 | N#CC(N1)=CC2=C1C(Cl)=CC=C2 | 7-Chloro-1H-indole-2-carbonitrile | AG000ST2 | 20g |
| 126453-07-4 | OP(CCCN1CCN[C@@H](C(O)=O)C1)(O)=O | (R)-CPP | AG000STA | 0.03g |
| 1264670-41-8 | FC(C1=CC2=C(N(C)C=C2)C=C1)(F)F | 1-Methyl-5-(trifluoromethyl)-1H-indole | AG000STR | 0.75g |
| 1264635-66-6 | FC1(CC2(CN(C2)C(=O)OC(C)(C)C)C1)F | tert-Butyl 6,6-difluoro-2-azaspiro[3.3]heptane-2-carboxylate | AG000STT | 25g |
| 126481-00-3 | COC(=O)c1ccn(c1)C(=O)C | Methyl 1-acetyl-1h-pyrrole-3-carboxylate | AG000STV | 10g |
| 126480-32-8 | O=C(O)C1=CC=C(F)C(OC)=C1N | 2-Amino-3-methoxy-4-fluorobenzoic acid | AG000STX | 15g |
| 126504-85-6 | CC1=CN=C(CCl)N=C1 | 2-(Chloromethyl)-5-methylpyrimidine | AG000SUH | 0.5g |
| 1268163-62-7 | [N+](=O)([O-])C1=C(C=O)C=CC(=C1)B1OC(C(O1)(C)C)(C)C | 2-Nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde | AG000T9I | 40g |
| 1268140-15-3 | COc1ccc(cc1O)[C@@H]1CC(=O)c2c(O1)c(CC=C(C)C)c(cc2O)O | 5,7,3′-Trihydroxy-4′-methoxy-8-prenylflavanone | AG000T9K | 0.005g |
| 126822-71-7 | ICCO[Si](C1=CC=CC=C1)(C(C)(C)C)C2=CC=CC=C2 | tert-Butyl(2-iodoethoxy)diphenylsilane | AG000T9T | 9g |
| 126822-39-7 | O=C1CC(CN1)C1CC1 | 2-Pyrrolidinone, 4-cyclopropyl- | AG000T9V | 7g |
| 126822-37-5 | NCCC1(C(O)=O)CC1 | 1-(2-aminoethyl)cyclopropanecarboxylic acid | AG000T9W | 2g |
| 126811-31-2 | BrC1=CC=C(Br)C2=C1NC=C2 | 4,7-Dibromo-1H-indole | AG000TA3 | 10g |
| 126811-30-1 | ClC1=CC=C(Br)C2=C1NC=C2 | 4-Bromo-7-chloro-1H-indole | AG000TA4 | 100g |
| 126811-29-8 | ClC1=CC=C(Br)C2=C1C=CN2 | 7-Bromo-4-chloro-1H-indole | AG000TA5 | 100g |
| 1268257-44-8 | CC(C(OCC(NS(=O)(C(F)(F)F)=O)(C)C)=O)=C | 2-Methyl-2-(trifluoromethylsulfonamido)propyl methacrylate | AG000TA6 | 50g |
| 1268245-50-6 | ClC1=C(C2=NOC(C3CC3)=C2CCl)C(Cl)=CC=C1 | 4-(chloromethyl)-5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazole | AG000TA7 | 50g |
| 126825-16-9 | O=C(O)C[C@@H](NC(OC(C)(C)C)=O)CC1=CC=C(OCC2=CC=CC=C2)C=C1 | Boc-L-beta-homotyrosine(obzl) | AG000TAT | 8g |
| 126824-24-6 | C(OC1=CC=CC=C1N(CC(O[Na])=O)CC(O[Na])=O)COC1=CC=CC=C1N(CC(O[Na])=O | 1,2-Bis(2-aminophenoxy)ethane-n,n,n’,n’-tetraacetic acid tetrasodium salt | AG000TAU | 25g |
| 1268340-94-8 | F[B-](C[NH+]1CCOCC1)(F)F | [(Morpholin-4-ium-4-yl)methyl]trifluoroborate | AG000TAW | 25g |
| 1268340-93-7 | F[B-](C[NH+]1CCCCC1)(F)F | (Piperidinium-1-ylmethyl)trifluoroborate | AG000TAX | 10g |
| 1268340-21-1 | COC(=O)CC1=CNC2=C1C=CC=C2F | Methyl 7-Fluoroindole-3-acetate | AG000TAY | 10g |
| 1268334-99-1 | C1(Br)=CC=NN1CC | 5-Bromo-1-ethyl-1H-pyrazole | AG000TAZ | 5g |
| 1268261-09-1 | NCc1ccc2ncc(Br)cc2c1 | (3-bromoquinolin-6-yl)methanamine | AG000TB1 | 3g |
| 126833-17-8 | O=C(C1(C)CCCCC1)NC2=CC=C(O)C(Cl)=C2Cl | Fenhexamid | AG000TB4 | 250g |
| 1268519-54-5 | CC(OC(N1CC2(CC2)C(C(O)=O)C1)=O)(C)C | 5-[(Tert-butoxy)carbonyl]-5-azaspiro[2.4]heptane-7-carboxylic acid | AG000TCW | 10g |
| 1268524-71-5 | O=C(OC(C)(C)C)C[C@@H]1C2=NN=C(C)N2C3=C(C(C)=C(C)S3)C(C4=CC=C(Cl)C=C | (R)-(-)-JQ1 Enantiomer | AG000TCY | 2g |
| 1268524-70-4 | O=C(OC(C)(C)C)C[C@H]1C2=NN=C(C)N2C3=C(C(C)=C(C)S3)C(C4=CC=C(Cl)C=C4)= | (+)-JQ-1 | AG000TCZ | 6.525g |
| 1268524-69-1 | CC1N2C(C(N=C(C3=CC=C(Cl)C=C3)C3=C2SC(C)=C3C)CC(OC(C)(C)C)=O)=NN=1 | tert-butyl 2-[7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetraazatric | AG000TD0 | 25g |
| 1268521-85-2 | O=C([C@H]1C[C@H](O)C1)O | trans-3-Hydroxycyclobutanecarboxylic acid | AG000TD4 | 10g |
| 1268521-83-0 | CC(C)(C)OC(=O)N[C@H]1CCNC[C@H]1F | Cis-4-(boc-amino)-3-fluoropiperidine | AG000TD5 | 2g |
| 1268521-56-7 | ClC=1C2=C(N=NC1)N(C=N2)CC | 4-Chloro-7-ethyl-7H-imidazo[4,5-c]pyridazine | AG000TD9 | 755g |
| 1268521-33-0 | NC1=C(Br)C(Cl)=NC=C1[N+]([O-])=O | 3-Bromo-2-chloro-5-nitropyridin-4-amine | AG000TDC | 30g |
| 1268684-41-8 | O=C(C1=CNN=C1I)OC | Methyl 3-Iodo-1H-Pyrazole-4-Carboxylate | AG000TDO | 1g |
| 1268683-45-9 | OCC1=CC(B(O)O)=CS1 | 5-(hydroxymethyl)thiophene-3-boronic acid | AG000TDP | 40g |
| 126866-37-3 | NCC(=O)N(c1ccccc1)C | 2-AMINO-N-METHYL-N-PHENYLACETAMIDE | AG000TDW | 15g |
| 126866-34-0 | ClC1=CC(C2=CC=CC=C2)=CC(C3=CC=CC=C3)=C1 | 5′-Chloro-1,1′:3′,1”-terphenyl | AG000TDX | 15g |
| 126866-15-7 | FC1=CC=C(CC(=O)C2=CC=C(Cl)C=C2)C=C1 | 1-(4-Chlorophenyl)-2-(4-fluorophenyl)ethanone | AG000TE1 | 2g |
| 126872-00-2 | CCSCCC(C(O)=O)NC=O | N-Formyl-DL-ethionine | AG000TEV | 5g |
| 1268882-60-5 | NNC1=CN=C(C=C1)Br | 2-Bromo-5-hydrazinylpyridine | AG000TF1 | 25g |
| 1268836-55-0 | C(N1C(=CC(=O)N(C)C1=O)N2C[C@H](NC=3N(CC4=C(C#N)C=CC=C4)C(=O)N(C)C( | 6-Despiperidinyl-6-(alogliptin-Namino-yl) Alogliptin | AG000TF5 | 2g |
| 1263078-12-1 | O(C(C)(C)C)C(N1CCC[C@H](C1)NC(=O)OC(C)(C)C)=O | (R)-1-Boc-3-n-boc-amino-piperidine | AG000SIU | 2g |
| 1263078-10-9 | O(CC1C=CC=CC=1)C(N1CC[C@@H](C(=O)OCC)C1)=O | (R)-1-CBZ-BETA-PROLINE ETHYL ESTER | AG000SIV | 25g |
| 1263078-06-3 | N[C@@H]1CC2=C(NN=C2)CC1.[H]Cl | (S)-5-AMino-4,5,6,7-tetrahydro-1H-indazole HCl | AG000SIW | 5g |
| 1263061-14-8 | CCOC(C1=CN2C(=CC(=N2)C)N=C1)=O | ETHYL 2-METHYLPYRAZOLO[1,5-A]PYRIMIDINE-6-CARBOXYLATE | AG000SIZ | 500g |
| 1263060-07-6 | O=C(C1=CN2C(N=C1)=C(Br)C=N2)OCC | Ethyl 3-bromopyrazolo[1,5-a]pyrimidine-6-carboxylate | AG000SJ2 | 200g |
| 1263059-66-0 | COC1=CC(Cl)=NC=C1CO | (6-Chloro-4-methoxypyridin-3-yl)methanol | AG000SJ3 | 1g |
| 1263059-24-0 | COc1cccn2c(Br)cnc12 | 3-Bromo-8-methoxyimidazo[1,2-a]pyridine | AG000SJ4 | 2g |
| 1263058-56-5 | Clc1c2n(c(cn2)Br)ccc1 | 3-Bromo-8-chloroimidazo[1,2-a]pyridine | AG000SJ6 | 75g |
| 1263057-86-8 | BrC1=NC=C2C=CC=CN21 | 3-Bromoimidazo[1,5-a]pyridine | AG000SJ7 | 6g |
| 1263047-22-8 | O=C(N[C@H](C(=O)O)CCNc1ccc(cc1[N+](=O)[O-])[N+](=O)[O-])OCC1c2ccccc2-c2 | Fmoc-Dab(Dnp)-OH | AG000SJ9 | 8g |
| 1263046-98-5 | O=C(O)[C@@H](NC(C)=C1C(CC(C)(C)CC1=O)=O)CNC(OCC2C3=C(C4=C2C=CC=C4) | Dde-L-Dap(Fmoc)-OH | AG000SJA | 25g |
| 126501-70-0 | O=C(C1CCN(C(C(F)(F)F)=O)CC1)O | 1-(Trifluoroacetyl)piperidine-4-carboxylic acid | AG000SUJ | 20g |
| 126496-79-5 | O=C(N1[C@H](C(OC)=O)C1)OC(C)(C)C | (S)-1-tert-Butyl 2-methyl aziridine-1,2-dicarboxylate | AG000SUL | 35g |
| 126485-58-3 | COC=1C=C(C=CC1)C1=CC(=CC=C1)C=O | 3′-Methoxy-[1,1′-biphenyl]-3-carbaldehyde | AG000SUQ | 5g |
| 126485-55-0 | OCc1cccc(c1)c1ccc(cc1)C(F)(F)F | (4′-(Trifluoromethyl)-[1,1′-biphenyl]-3-yl)methanol | AG000SUR | 10g |
| 126485-47-0 | COc1c(O)cc2c(c1O)[C@@H]1O[C@H](COC(=O)c3cc(OC)c(c(c3)OC)O)[C@H]([C@ | Benzoic acid, 4-hydroxy-3,5-dimethoxy-, [(2R,3S,4S,4aR,10bS)-2,3,4,4a,6,10b- | AG000SUS | 0.005g |
| 12650-69-0 | O=C(O)CCCCCCCCOC(/C=C(C)/C[C@H]1[C@H](O)[C@H](O)[C@@H](C[C@@H]2 | Mupirocin | AG000SV0 | 300g |
| 1265218-86-7 | CCOc1c(F)cc(cc1Br)Cl | Benzene, 1-bromo-5-chloro-2-ethoxy-3-fluoro- | AG000SV4 | 2.7g |
| 126522-01-8 | COC(=O)c1cc2COc3ccccc3-c2s1 | Methyl 4H-thieno[3,2-c]chromene-2-carboxylate | AG000SVC | 4g |
| 126520-01-2 | NC1=NNC(C2=CC=CC=C2Cl)=C1 | 3-(2-Chlorophenyl)-1H-pyrazol-5-amine | AG000SVF | 10g |
| 126519-80-0 | C(OS(C1=CC=C(C)C=C1)(=O)=O)CCCCCOCC1=CC=CC=C1 | OTs-C6-OBn | AG000SVH | 16.5g |
| 126534-32-5 | C[C@@H](C1=CC(F)=CC=C1)O | (S)-1-(3-Fluorophenyl)ethanol | AG000SVU | 10g |
| 126534-31-4 | ClC1=CC=C([C@H](O)CCl)C(Cl)=C1 | (S)-2-chloro-1-(2,4-dichlorophenyl)ethanol | AG000SVV | 1261g |
| 126533-97-9 | C1COCCN1C2=NC(=CS2)C=O | 2-Morpholinothiazole-4-carbaldehyde | AG000SVY | 5g |
| 126533-76-4 | S1(C(=NC(=C1)C(=O)OCC)NC2(=CC=CC=C2)) | Ethyl 2-(phenylamino)-4-thiazolecarboxylate | AG000SW3 | 5.08g |
| 126531-26-8 | C1=C(C=CC=2OCCOCCOC3=C(OCCOCCOC21)C=CC=C3)N | 6,7,9,10,17,18,20,21-Octahydrodibenzo[b,k][1,4,7,10,13,16]hexaoxacyclooctad | AG000SW6 | 2g |
| 1268816-65-4 | CC(OC(N1CCC(B2OC(C)(C)C(C)(C)O2)=CCC1)=O)(C)C | Tert-Butyl 4-(4,4,5,5-Tetramethyl-1,3,2-Dioxaborolan-2-Yl)-2,3,6,7-Tetrahydro | AG000TF6 | 1g |
| 1268816-61-0 | O=C(N1CC=C(B2OC(C)(C)C(C)(C)O2)C(C)C1)OC(C)(C)C | tert-Butyl 3-methyl-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,3,6-tetrahydr | AG000TF7 | 5g |
| 1268816-55-2 | O=[N+](C1=C(C)C=C(Br)C(Cl)=C1)[O-] | 1-bromo-2-chloro-5-methyl-4-nitro-benzene | AG000TF8 | 200g |
| 1268816-48-3 | CS(=O)(=O)C1=CC=C2NN=CC2=C1 | 5-(Methylsulfonyl)-1H-indazole | AG000TF9 | 10g |
| 1268810-17-8 | NC1(C#C)CC1.[H]Cl | 1-Ethynyl-cyclopropylamine hydrochloride | AG000TFA | 10g |
| 1268810-13-4 | C[Si](C#CC1CCC1)(C)C | (Cyclobutylethynyl)trimethylsilane | AG000TFB | 10g |
| 1268810-09-8 | C(#C)C1(CC1)NC(OC(C)(C)C)=O | tert-Butyl (1-ethynylcyclopropyl)carbamate | AG000TFC | 50g |
| 126889-55-2 | CC[Si](CC)(OS(=O)(=O)C(F)(F)F)C(C)C | Diethylisopropylsilyl Trifluoromethanesulfonate | AG000TFE | 5g |
| 126889-07-4 | O=C(C1=C(CC)N=CS1)O | 4-Ethyl-1,3-thiazole-5-carboxylic acid | AG000TFF | 25g |
| 1269004-46-7 | O=C1N(CC(CC)CCCC)C(C2=CC=C(B3OC(C)(C)C(C)(C)O3)S2)=C4C1=C(C5=CC=C(B6 | 2,5-Bis(2-ethylhexyl)-3,6-bis(5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)t | AG000TFV | 0.75g |
| 126910-68-7 | COC(=O)C1=C(C=C(Cl)S1)S(Cl)(=O)=O | Methyl 5-chloro-3-chlorosulfonyl-2-thiophene carboxylate, tech grade | AG000TFY | 1500g |
| 126909-78-2 | BrC1=CC=CC(OCC2CC2)=C1 | 1-bromo-3-(cyclopropylmethoxy)benzene | AG000TG3 | 0.5g |
| 126909-38-4 | O=C(C1=C(C)N=C(OC)S1)O | 5-Thiazolecarboxylic acid, 2-methoxy-4-methyl-, sodium salt | AG000TG4 | 25g |
| 1269119-14-3 | CSC1=NC(Cl)=C(C(Cl)=O)C(Cl)=N1 | 4,6-Dichloro-2-(Methylthio)pyriMidine-5-carbonyl Chloride | AG000TGF | 25g |
| 126921-19-5 | O=C(Cl)C1=CN(C)C2=C1C=CC=C2 | 1-Methyl-1H-indole-3-carbonyl chloride | AG000TGT | 5.3g |
| 126921-16-2 | C1=CC2=C(C(=C1)F)NC=C2C=O | 7-Fluoro-1H-Indole-3-Carbaldehyde | AG000TGU | 15g |
| 126918-17-0 | C[C@@H](OC1CCCCO1)C(C2=CC=C(F)C=C2F)=O | (2R)-1-(2,4-Difluorophenyl)-2-((tetrahydro-2H-pyran-2-yl)oxy)propan-1-one | AG000TGW | 90g |
| 126581-65-5 | OC1=CC=C(F)C=C1C(CBr)=O | 2-Bromo-1-(5-fluoro-2-hydroxyphenyl)ethanone | AG000SYX | 150g |
| 126579-26-8 | CNCC1CCNCC1 | N-Methyl-1-piperidin-4-ylmethanamine dihydrochloride | AG000SZ2 | 2g |
| 1266119-17-8 | O=C(OC(C)(C)C)CC1=NC(Br)=CC=C1 | tert-Butyl 2-(6-bromopyridin-2-yl)acetate | AG000SZW | 1g |
| 1266119-15-6 | OCC1=CC(Br)=CC(Cl)=N1 | (4-Bromo-6-chloropyridin-2-yl)methanol | AG000SZX | 0.5g |
| 1266114-83-3 | C(=O)(OC)c1[nH]c2c(c1)nc(cc2)Cl | 1H-Pyrrolo[3,2-b]pyridine-2-carboxylic acid, 5-chloro-, methyl ester | AG000T00 | 10g |
| 1266114-75-3 | NC1=NC2=C(N1)C=CC=C2Br | 4-Bromo-1H-benzo[d]imidazol-2-amine | AG000T01 | 20g |
| 1266084-47-2 | OB1OC(C)(C)C2=CC=C([N+]([O-])=O)C=C12 | 3，3-Dimethyl-6-nitrobenzo[c][1，2]oxaborol-1(3H)-ol | AG000T06 | 5g |
| 126613-06-7 | O=S(C(F)(F)F)(OC1=CC=C2C=CC=CC2=[C@]1[C@]3=C4C=CC=CC4=CC=C3OS(C(F)( | (R)-(-)-1,1′-Binaphthol-2,2′-bis(trifluoromethanesulfonate) | AG000T09 | 200g |
| 1266364-46-8 | C(C)(C)(C)n1cc(cc1)C(=O)O | 1-tert-Butyl-1H-pyrrole-3-carboxylic acid | AG000T0J | 7g |
| 1266343-30-9 | CN1C=C(Br)C2=C(Cl)N=CN=C12 | 5-Bromo-4-chloro-7-methyl-7H-pyrrolo[2,3-d]pyrimidine | AG000T0K | 50g |
| 1266339-10-9 | O=C(N1C[C@@H](F)C(CC1)=O)OC(C)(C)C | (R)-tert-Butyl 3-fluoro-4-oxopiperidine-1-carboxylate | AG000T0L | 10g |
| 1266330-18-0 | NC1=CC=C(N2CCC(F)(F)CC2)C=C1 | 4-(4,4-Difluoro-1-piperidyl)aniline | AG000T0M | 10g |
| 1266322-58-0 | NC1=CC2=CC=C(Br)C=C2N=C1 | 7-Bromoquinolin-3-amine | AG000T0N | 10g |
| 1266253-70-6 | CCOc1c(Br)cc(cc1Br)C | 1,3-Dibromo-2-ethoxy-5-methylbenzene | AG000T0P | 25g |
| 1266253-69-3 | ClC1=CC(Br)=CC=C1OCCCC | 4-Bromo-1-butoxy-2-chlorobenzene | AG000T0Q | 20g |
| 126832-82-4 | O=C1CCN(CC2=CC=NC=C2)CC1 | 1-(Pyridin-4-ylmethyl)piperidin-4-one | AG000TB5 | 10g |
| 126832-81-3 | N1=CC=C(C=C1)N2CCC(CC2)=O | 1-Pyridin-4-ylpiperidin-4-one | AG000TB6 | 70g |
| 126829-31-0 | COC1=C(C#C)C(OC)=CC=C1 | 2-Ethynyl-1,3-dimethoxybenzene | AG000TBD | 10g |
| 126828-35-1 | O=C(O)COC1=CC=C(C(NC(OCC2C3=C(C4=C2C=CC=C4)C=CC=C3)=O)C5=CC=C(OC) | Rink amide linker | AG000TBE | 2500g |
| 1268512-14-6 | O=C(OC(C)(C)C)N[C@H]1[C@H](F)C[C@@H](O)CC1 | tert-Butyl ((1R,2R,4S)-rel-2-fluoro-4-hydroxycyclohexyl)carbamate | AG000TBO | 0.5g |
| 1268511-99-4 | C(=O)(OC(C)(C)C)N1CC[C@H]([C@H](N)C1)O | Trans-3-amino-1-boc-4-hydroxypiperidine | AG000TBQ | 10g |
| 1268467-17-9 | FC(F)(F)COC1=NC=C(B2OC(C)(C)C(C)(C)O2)C=C1 | 5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(2,2,2-trifluoroethoxy)pyri | AG000TBV | 30g |
| 1268454-23-4 | NC=1OC2=C(N1)C=C(C=C2)C=2C=CC=1N(C2)C(=CN1)C(=O)N1CCOCC1 | [6-(2-amino-1,3-benzoxazol-5-yl)imidazo[1,2-a]pyridin-3-yl]-morpholin-4-yl | AG000TBZ | 10g |
| 1268449-00-8 | [Cl-].CN1/C(=N/C2N(C)[C@@H](C3=CC=CC=C3)[C@H](C3=CC=CC=C3)[N+]=2C)/ | (4S,5S)-2-{[(4S,5S)-1,3-dimethyl-4,5-diphenylimidazolidin-2-ylidene]amino}- | AG000TC0 | 0.45g |
| 1268392-91-1 | NC1=CC(F)=C(Cl)C=C1OC | 4-CHLORO-5-FLUORO-2-METHOXYANILINE | AG000TC2 | 8g |
| 1268520-95-1 | O=C(OC(C)(C)C)N[C@@H]1[C@@H](F)CNCC1 | Trans-4-(Boc-Amino)-3-Fluoropiperidine | AG000TCH | 2g |
| 1268520-92-8 | CN1N=CC2=C(Cl)C=CN=C21 | 4-Chloro-1-methyl-1H-pyrazolo[3,4-b]pyridine | AG000TCK | 4g |
| 1268520-74-6 | ClC1=CC=C(C#N)N2N=CC=C12 | 4-Chloropyrazolo[1,5-a]pyridine-7-carbonitrile | AG000TCM | 10g |
| 1268520-72-4 | CCOC(=O)C1CN(C(=O)OC(C)(C)C)CC12CC2 | 5-TERT-BUTYL 7-ETHYL 5-AZASPIRO[2.4]HEPTANE-5,7-DICARBOXYLATE | AG000TCN | 5g |
| 1268520-04-2 | C1(C(C2=CC=CC=C2)(C3=CC=CC=C3)C4=C5C=CC=C4)=C5C=CC(NC6=CC=C(C7=CC= | N-([1,1′-BIPHENYL]-4-YL)-9,9-DIPHENYL-9H-FLUOREN-2-AMINE | AG000TCR | 15g |
| 129768-28-1 | O=C(C1=NNC(C(F)(F)F)=C1)O | 5-(Trifluoromethyl)-1H-pyrazole-3-carboxylic acid | AG000TOO | 10g |
| 129768-24-7 | O=C(Cl)C1=CC(C(F)(F)F)=NN1C | 1-Methyl-3-(trifluoromethyl)-1H-pyrazole-5-carbonyl chloride | AG000TOP | 4g |
| 1298032-47-9 | CC1(C)C(C)(C)OB(C2=CN(CC(C)(OC)C)N=C2)O1 | 1-(2-Methoxy-2-Methylpropyl)-4-(4,4,5,5-Tetramethyl-1,3,2-Dioxaborolan-2- | AG000TOU | 2g |
| 129799-15-1 | N1(C(=O)OC(C)(C)C)C(C(=O)OC)CNCC1 | 1-tert-butyl 2-methyl piperazine-1,2-dicarboxylate | AG000TP1 | 145g |
| 129799-14-0 | O=C(N1C(C(OC)=O)CN(C(OCC2=CC=CC=C2)=O)CC1)OC(C)(C)C | 4-Benzyl 1-tert-butyl 2-methyl piperazine-1,2,4-tricarboxylate | AG000TP2 | 415g |
| 129799-11-7 | O=C(N1CC(C(OC)=O)NCC1)OCC2=CC=CC=C2 | 1-Benzyl 3-methyl piperazine-1,3-dicarboxylate | AG000TP3 | 150g |
| 129799-08-2 | O=C(N1CC(C(OC)=O)NCC1)OC(C)(C)C | Methyl 4-boc-piperazine-2-carboxylate | AG000TP4 | 1000g |
| 129798-91-0 | O=C(C1NCCNC1)OCC.[H]Cl.[H]Cl | Ethyl piperazine-2-carboxylate diHCl | AG000TP5 | 400g |
| 1298101-47-9 | O=C(OC(C)(C)C)N[C@@H]1C[C@H](N)CCC1 | (1S,3R)-3-Amino-1-(Boc-amino)cyclohexane | AG000TPF | 20g |
| 129822-49-7 | CC=1C=C2C=CN(C2=CC1)C(=O)OC(C)(C)C | Tert-Butyl 5-Methyl-1H-Indole-1-Carboxylate | AG000TPI | 20g |
| 129822-48-6 | O=C(N1C=CC2=C1C=CC(Cl)=C2)OC(C)(C)C | 1-Boc-5-chloroindole | AG000TPJ | 200g |
| 129822-46-4 | O=C(N1C=CC2=C1C=CC=C2Cl)OC(C)(C)C | 1-BOC-4-Chloroindole | AG000TPK | 250g |
| 129822-43-1 | O=C(OC(C)(C)C)Nc1ccc(cc1C)C | tert-Butyl (2,4-dimethylphenyl)carbamate | AG000TPL | 14.4g |
| 129822-42-0 | O=C(OC(C)(C)C)NC1=CC=C(OC)C=C1C | tert-Butyl (4-methoxy-2-methylphenyl)carbamate | AG000TPM | 2g |
| 129812-23-3 | Cc1oc2ccc3ccccc3c2c1C | 1,2-dimethylnaphtho[2,1-b]furan | AG000TQ2 | 0.875g |
| 129850-62-0 | CCCCCCCCCCCCC(NC(OC(C)(C)C)=O)C(O)=O | (R,S)-Boc-2-amino-tetradecanoic acid | AG000TQ5 | 5g |
| 129844-69-5 | Cc1cc2cccnc2cc1N | 6-Methylquinolin-7-amine | AG000TQA | 5g |
| 129833-54-1 | BrC1=CC=C2C(C(NC2=C1C)=O)=O | 6-Bromo-7-methylindoline-2,3-dione | AG000TQH | 2g |
| 129833-31-4 | CC1=C(C)C(I)=C(C=C1)C(O)=O | 2-Iodo-3,4-dimethylbenzoic acid | AG000TQI | 2g |
| 129833-29-0 | O=C(O)C1=CC=C(Br)C(C)=C1N | 2-Amino-4-bromo-3-methylbenzoic acid | AG000TQJ | 200g |
| 126759-48-6 | CC1=CC(NC(C)=O)=C(C=C1)Br | N-(2-Bromo-5-methylphenyl)acetamide | AG000T71 | 75g |
| 126759-30-6 | COC(=O)C1=CC(Br)=C(C=C1)[N+]([O-])=O | Methyl 3-bromo-4-nitrobenzoate | AG000T75 | 50g |
| 1267618-58-5 | COC1=CC(CC2CC(=O)NC2=O)=CC=C1 | 3-(3-Methoxybenzyl)pyrrolidine-2,5-dione | AG000T7H | 20g |
| 126766-32-3 | C(/C(=O)O)=CC(=O)O.C(N1CCN(C(=O)OC)CC1CN1CCCC1)(=O)CC1C=CC(Cl)=C(Cl) | GR 89696 | AG000T7X | 0.2g |
| 126764-17-8 | CC(C)(C#CC=CCCl)C | 1-Chloro-6,6-dimethyl-2-heptene-4-yne | AG000T82 | 2500g |
| 1267944-44-4 | NN=Cc1ccc(cc1)N1CCC(CC1)C(=O)O.Cl | 4-Piperidinecarboxylic acid, 1-[4-(aminoiminomethyl)phenyl]-, hydrochlorid | AG000T86 | 0.2g |
| 1267904-60-8 | CC(NC1=NC(CC)=C(Br)S1)=O | 2-Acetamido-5-bromo-4-ethylthiazole | AG000T88 | 0.2g |
| 126784-39-2 | CCCCC(CC(=O)OCC)O | Heptanoic acid, 3-hydroxy-, ethyl ester | AG000T8K | 25g |
| 1268060-76-9 | CCCCCCCCCCC(CC1=CSC=C1)CCCCCCCC | 3-(2-Octyldodecyl)Thiophene | AG000T8U | 75g |
| 126807-09-8 | Brc1c2c([nH]c1)cc(cc2)N(=O)=O | 1H-Indole, 3-bromo-6-nitro- | AG000T94 | 3g |
| 126807-08-7 | O=[N+](C1=CC=CC2=C1C(Br)=CN2)[O-] | 3-Bromo-4-nitroindole | AG000T95 | 4g |
| 126802-52-6 | CC(C1=CC=CC=C1[N+]([O-])=O)(C)C(O)=O | 2-Methyl-2-(2-nitrophenyl)propanoic acid | AG000T99 | 1g |
| 1268167-84-5 | O=C(N1C=C(I)C2=C1C=C(OC)C=C2)OC(C)(C)C | tert-Butyl 3-iodo-6-methoxy-1H-indole-1-carboxylate | AG000T9H | 0.5g |
| 126633-02-1 | O=[N+]([O-])C1=CC(C2=CC=NO2)=CC=C1 | 5-(3-Nitrophenyl)isoxazole | AG000T10 | 5g |
| 126631-93-4 | OC(=O)CCCCCCCNC(=O)OCC1C2=CC=CC=C2C2=C1C=CC=C2 | N-Fmoc-8-aminooctanoic acid | AG000T12 | 200g |
| 126629-81-0 | O=C(OC)CC(C1=CC=C(Br)C=C1)=O | Methyl 3-(4-bromophenyl)-3-oxopropanoate | AG000T14 | 10g |
| 1266558-20-6 | O=CC1=CC2=CN(C)N=C2C=C1 | 2-Methyl-2H-indazole-5-carbaldehyde | AG000T1B | 40g |
| 126656-88-0 | O=C(C1C(C2=CC=C(S(=O)(C)=O)C=C2Cl)=O)C(C3)CCC3C1=O | 3-[2-Chloro-4-(methylsulfonyl)benzoyl]bicyclo[3.2.1]octane-2,4-dione | AG000T1S | 0.002g |
| 126653-00-7 | C1CN(CCN1)C1=NC=CC2=C1C=CC=C2 | 1-Piperazin-1-yl-isoquinoline | AG000T1W | 15g |
| 126651-85-2 | S=C1NN=C(C2=CC=CC(Br)=C2)N1 | 3-(3-Bromophenyl)-1H-1,2,4-triazole-5(4H)-thione | AG000T25 | 0.05g |
| 126645-75-8 | CNCC1OCCN(CC2=CC=CC=C2)C1 | (4-Benzyl-morpholin-2-ylmethyl)-methyl-amine | AG000T2C | 1g |
| 126645-52-1 | N#CC1CN(CC2=CC=CC=C2)CCO1 | 4-Benzylmorpholine-2-Carbonitrile | AG000T2D | 34g |
| 126640-98-0 | C/C=C1/CN2[C@@H]3[C@H]([C@H]1C[C@H]2c1c(C3)c2c([nH]1)cccc2)CO | 16-Epinormacusine B | AG000T2J | 0.005g |
| 1266728-34-0 | O=C(C1=C2N=CC=CC2=CC(Br)=C1)OC | Methyl 6-bromoquinoline-8-carboxylate | AG000T2P | 15g |
| 1266692-14-1 | NCC1=CNC2=C1C=CC=C2.[H]Cl | 1H-Indol-3-ylmethanamine hydrochloride | AG000T2Q | 2g |
| 1266664-66-7 | C[C@H]1NCCN(C2=NC3=CC(Cl)=CC=C3O2)CC1.[H]Cl | (R)-5-Chloro-2-(5-methyl-1,4-diazepan-1-yl)benzo[d]oxazole hydrochloride | AG000T2S | 50g |
| 129743-47-1 | C(N)(CC1=CC=CC(N)=C1)=O | 2-(3-Aminophenyl)acetamide | AG000TN4 | 20g |
| 129741-57-7 | C(O[C@@H]1O[C@H](CO[C@@H]2O[C@H](CO)[C@@H](O[C@H]3[C@H](O)[C | 3-O-[α-L-rhamnopyranosyl-(1→2)-α-L-arabinopyranosyl]-28-O-[α-L-rhamnop | AG000TN5 | 0.2g |
| 129740-14-3 | C(=O)(OC(C)(C)C)[C@@H]1CCN1 | (S)-tert-Butyl azetidine-2-carboxylate | AG000TN7 | 1g |
| 129738-42-7 | CC1=CC=C([C@H]2CC[C@H]([C@H]3CC[C@H](CCC=C)CC3)CC2)C=C1 | trans，trans-4-But-3-enyl-4′-p-tolyl-bicyclohexyl | AG000TN8 | 75g |
| 129738-34-7 | C=C[C@H]1CC[C@H]([C@H]2CC[C@H](CCCCC)CC2)CC1 | Trans,trans-4-pentyl-4′-vinylbicyclohexyl | AG000TN9 | 1500g |
| 1297613-77-4 | O=P1(O)OC2=C(C3=CC=C(C4=CC=CC=C4)C=C3)C=CC5=C2C6(CCC7=C6C(O1)=C(C8 | (11aR)-10,11,12,13-Tetrahydro-5-hydroxy-3,7-bis([1,1′-biphenyl]-4-yl)-diinde | AG000TND | 1.25g |
| 1297613-76-3 | OP1(=O)Oc2c(ccc3c2C2(c4c(O1)c(ccc4CC2)c1cc(cc(c1)C(F)(F)F)C(F)(F)F)CC3)c1cc( | (11aR)-3,7-Bis[3,5-bis(trifluoromethyl)phenyl]-10,11,12,13-tetrahydro-5-hydr | AG000TNE | 2g |
| 1297613-75-2 | CC1=CC(C)=CC(C2=CC=C(O3)C4=C2CCC4(CC(C5=CC=C6)C7=CC(C)=CC(C)=C7)C5=C | (11aR)-3,7-Bis(3,5-dimethylphenyl)-10,11,12,13-tetrahydro-5-hydroxy-diinde | AG000TNF | 1.25g |
| 1297613-74-1 | O=P1(O)OC2=C(C3=CC(C=CC=C4)=C4C=C3)C=CC5=C2C6(CCC7=C6C(O1)=C(C8=CC | (11aR)-10,11,12,13-Tetrahydro-5-hydroxy-3,7-di-2-naphthalenyl-5-oxide-diin | AG000TNG | 3g |
| 1297613-73-0 | O=P1(O)OC=2C(=CC=C3C2C4(C5=C(O1)C(=CC=C5CC4)C6=CC=CC=7C=CC=CC76)CC | (11aR)-12-Hydroxy-1,10-di(naphthalen-1-yl)-4,5,6,7-tetrahydrodiindeno[7,1- | AG000TNH | 5g |
| 1297613-72-9 | O=P1(O)OC2=C(C3=CC=CC=C3)C=CC4=C2C5(CCC6=C5C(O1)=C(C7=CC=CC=C7)C=C | (11aR)-10,11,12,13-Tetrahydro-5-hydroxy-3,7-diphenyldiindeno[7,1-de:1′,7′-f | AG000TNI | 1.25g |
| 129765-95-3 | CC(C)(NC(OC(C)(C)C)=O)CC(O)=O | 3-(tert-Butoxycarbonylamino)-3-methylbutanoic acid | AG000TNM | 300g |
| 129757-67-1 | O=C(OC1CC(C)(C)NC(C1)(C)C)CCCCCCCCC(=O)OC1CC(C)(C)NC(C1)(C)C.OOC(C)( | Decanedioic acid, 1,10-bis(2,2,6,6-tetramethyl-4-piperidinyl) ester, reaction p | AG000TNZ | 1600g |
| 129787-66-2 | OC[C@H]1O[C@@H](Oc2ccc3c(Oc4cc(O[C@@H]5O[C@H](CO)[C@@H](O)[C@ | 3′,6′-Bis(((2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H- | AG000TO2 | 0.01g |
| 129779-30-2 | O=C(N1C[C@@H](C)N[C@@H](C)C1)OC(C)(C)C | 1-Boc-cis-3,5-dimethyl-piperazine | AG000TOB | 25g |
| 129768-95-2 | CC1=CC(CN)=NC=C1 | (4-METHYLPYRIDIN-2-YL)METHYLAMINE | AG000TOI | 20g |
| 129768-30-5 | O=C(C1=CC(C(F)(F)F)=NN1)OCC | ethyl 5-(trifluoromethyl)-2H-pyrazole-3-carboxylate | AG000TOM | 200g |
| 1300-61-4 | O.O.[Na+].Oc1ccc(cc1C([O-])=O)S(O)(=O)=O | Sodium 5-sulphosalicylate dihydrate | AG000TVX | 3700g |
| 1300031-52-0 | O=C(O)C1=CC=C(C2=CC3=C(N(C(C)=O)[C@@H](C)C[C@H]3NC4=CC=C(Cl)C=C4)C | GSK1324726A | AG000TW8 | 5g |
| 1300031-49-5 | O=C(N1[C@@H](C2=NC=CC=C2)C)NC3=C1C4=CC(OC)=C(C5=C(C)ON=C5C)C=C4N | I-BET151 | AG000TW9 | 0.1g |
| 13001-46-2 | CC(COC(=S)[S-])C.[K+] | Carbonodithioic acid, O-(2-methylpropyl) ester, potassium salt (1:1) | AG000TWL | 1000g |
| 13001-40-6 | N#CC1=CC=C(/C=C/C2=CC=C(/C=C/C3=CC=C(C=C3)C#N)C=C2)C=C1 | 1,4-Bis(4-cyanostyryl)benzene | AG000TWM | 3000g |
| 13001-39-3 | N#Cc1ccccc1C=Cc2ccc(C=Cc3ccccc3C#N)cc2 | 1,4-Bis(2-cyanostyryl)benzene | AG000TWN | 2000g |
| 13001-38-2 | N#CC1=CC=CC=C1/C=C/C2=CC=C(/C=C/C3=CC=C(C#N)C=C3)C=C2 | 1-(2-Cyanostyryl)-4-(4-cyanostyryl)benzene | AG000TWO | 2500g |
| 13001-29-1 | ClCCOC1=C(Cl)C=C(Cl)C=C1Cl | 1,3,5-Trichloro-2-(2-chloroethoxy)benzene | AG000TWP | 300g |
| 13001-28-0 | ClCCOC1=CC=C(Cl)C=C1 | 1-Chloro-4-(2-chloroethoxy)benzene | AG000TWQ | 2g |
| 300543-56-0 | [C@H](c1ccc(cc1)Cl)(c1ccccc1)N1CCNCC1 | Piperazine, 1-[(R)-(4-chlorophenyl)phenylmethyl]- | AG000TWT | 1000g |
| 130025-33-1 | ClC1=CC(=C(C=C1F)F)C(=O)O | 5-Chloro-2,4-difluorobenzoic acid | AG000TWV | 1500g |
| 130018-87-0 | O=C(O)COCCN1CCN([C@@H](C2=CC=C(Cl)C=C2)C3=CC=CC=C3)CC1.[H]Cl.[H]Cl | 2-(2-{4-[(R)-(4-chlorophenyl)(phenyl)methyl]piperazin-1-yl}ethoxy)acetic aci | AG000TX3 | 150g |
| 130018-77-8 | OC(COCCN1CCN([C@@H](C2=CC=C(Cl)C=C2)C2=CC=CC=C2)CC1)=O | (R)-Cetirizine | AG000TX4 | 4g |
| 13002-15-8 | CCCC(OC(C)C)OC(C)C | 1,1-Bis(1-methylethoxy)butane | AG000TXD | 2g |
| 130047-19-7 | OC1=CC=C(F)C=C1C(F)(F)F | 4-Fluoro-2-(trifluoromethyl)phenol | AG000TXI | 200g |
| 130047-14-2 | O=C(OC)C1=CC=C(CS(=O)(Cl)=O)C=C1 | Methyl 4-[(chlorosulfonyl)methyl]benzoate | AG000TXK | 15g |
| 130046-91-2 | O=C(O)C1=CC(F)=CC([N+]([O-])=O)=C1O | 5-Fluoro-2-hydroxy-3-nitrobenzoic acid | AG000TXL | 30g |
| 129714-97-2 | O=C(Cl)C1=CC(F)=CC(F)=C1 | 3,5-Difluorobenzoyl chloride | AG000TLF | 200g |
| 129706-08-7 | CCCCCCCCCCCC[C@@H](C(=O)O)N | Tetradecanoic acid, 2-amino-, (2S)- | AG000TLH | 10g |
| 129705-30-2 | CC(C)[C@@H](O)CC[C@H](O)C(C)C | (3S,6S)-2,7-Dimethyloctane-3,6-diol | AG000TLJ | 15g |
| 129704-13-8 | N[C@H](C(O)(C1=CC=CC=C1)C1=CC=CC=C1)C1=CC=CC=C1 | (S)-2-Amino-1,1,2-triphenylethanol | AG000TLK | 5g |
| 129692-13-3 | CC1=NC(Cl)=CC=C1OC | 6-Chloro-3-methoxy-2-methylpyridine | AG000TLT | 2g |
| 129689-88-9 | O=C(C(N1)=C(C)C2=C1CC(C)(C)CC2=O)O | 3,6,6-Trimethyl-4-oxo-4,5,6,7-tetrahydro-1H-indole-2-carboxylic acid | AG000TLV | 2.25g |
| 129728-87-6 | CC(=O)N[C@H]1[C@@H](O)O[C@H](CO)[C@@H](F)[C@@H]1O | N-((2S,3R,4R,5S,6R)-5-Fluoro-2,4-dihydroxy-6-(hydroxymethyl)tetrahydro-2H | AG000TM1 | 0.25g |
| 129725-48-0 | NC(C)C=1C=C(N)C=CC1 | 3-(1-Aminoethyl)aniline | AG000TM6 | 6g |
| 129724-83-0 | C[C@@H]([C@H]1CC[C@@]2([C@]1(C)CC=C1[C@H]2CCC2[C@]1(C)CCC(C2(C)C | Lanosta-9(11),24-dien-26-oic acid, 3-hydroxy-, (3β,24Z)- | AG000TM7 | 0.005g |
| 129724-43-2 | COc1cc(O)c(OC)c(O)c1C(=O)C=Cc1ccccc1 | 2′,4′-Dihydroxy-3′,6′-dimethoxychalcone | AG000TM8 | 0.005g |
| 129722-34-5 | BrCCCCOC1=CC=C2C(=C1)NC(CC2)=O | 3,4-Dihydro-7-(4-bromobutoxy)-2(1h)-quinolinone | AG000TMD | 600g |
| 129722-25-4 | O(CCCCN1CCN(CC1)c1c(Cl)c(Cl)ccc1)c1cc2c(cc1)ccc(=O)[nH]2 | 7-[4-[4-(2,3-Dichlorophenyl)-1-piperazinyl]butoxy]-2(1H)-quinolinone | AG000TME | 10g |
| 129722-12-9 | ClC1=CC=CC(N2CCN(CCCCOC3=CC=C(CCC(N4)=O)C4=C3)CC2)=C1Cl | 7-{4-[4-(2,3-Dichloro-phenyl)-piperazin-1-yl]-butoxy}-3,4-dihydro-1H-quinol i | AG000TMF | 500g |
| 1297538-32-9 | O=C(C1=NNC(C(O)C)=C1)N[C@@H](C)CN2N=C(C3=CC=C(C#N)C(Cl)=C3)C=C2 | ODM-201 | AG000TMO | 10g |
| 1297537-45-1 | O=C(C1=NNC(C(C)=O)=C1)O | 3-Acetyl-1H-pyrazole-5-carboxylic acid | AG000TMP | 700g |
| 129749-43-5 | Cc1cc(cc(c1O)C(=O)O)C(c1cc(C)c(c(c1)C(=O)O)O)c1cc(C)c(c(c1)C(=O)O)O | Benzoic acid, 3,3′,3”-methylidynetris[6-hydroxy-5-methyl- | AG000TMV | 5g |
| 129747-52-0 | O=C(OC)C1=CN=CC(CO)=C1 | Methyl 5-(hydroxymethyl)nicotinate | AG000TMZ | 50g |
| 129746-42-5 | O=CC1=CC(=CC=C1)C1=CSC=C1 | 3-THIEN-3-YLBENZALDEHYDE | AG000TN1 | 10g |
| 129911-04-2 | N#CC1=CC(F)=C(N)C=C1O | 4-Amino-5-fluoro-2-hydroxybenzonitrile | AG000TSS | 0.5g |
| 129946-88-9 | [O-]S(=O)(=O)C(F)(F)F.FC(F)(F)[S+]1C2=CC=CC=C2C2=CC=CC=C12 | S-(Trifluoromethyl)dibenzothiophenium trifluoromethanesulfonate | AG000TT3 | 25g |
| 129940-69-8 | COC1=CC([C@@H](O)C)=CC=C1 | (S)-1-(3-methoxyphenyl)ethanol | AG000TTE | 5g |
| 129940-50-7 | C(OC(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1)[C@@H]1CO1 | (S)-(-)-Trityl glycidyl ether | AG000TTF | 1000g |
| 1299607-83-2 | Clc1cc(Br)c(c(n1)Br)N | 2,4-Dibromo-6-chloropyridin-3-amine | AG000TTK | 0.75g |
| 1299607-72-9 | NC1=C2C(C=C(Br)C=N2)=NC=N1 | 7-Bromopyrido[3,2-d]pyrimidin-4-amine | AG000TTL | 3g |
| 1299607-55-8 | O=C(N1N=CC2=CC(Br)=CN=C21)OC(C)(C)C | 1-Boc-5-bromo-1H-pyrazolo[3,4-b]pyridine | AG000TTM | 25g |
| 129976-33-6 | COc1c(Br)cccc1C(C)C | Benzene, 1-bromo-2-methoxy-3-(1-methylethyl)- | AG000TTO | 105g |
| 129973-51-9 | OCC(C1=CC=CC=C1)(F)F | 2,2-Difluoro-2-phenylethan-1-ol | AG000TTP | 2g |
| 129972-45-8 | CC(=O)NCSC(C)(C)[C@H](NC(=O)OC(C)(C)C)C(O)=O | BOC-PEN(ACM)-OH | AG000TTS | 15g |
| 129968-11-2 | NC1=CC(OC)=CC=C1Br.[H]Cl | 2-Bromo-5-methoxyaniline, HCl | AG000TTW | 1025g |
| 129967-42-6 | Cc1cc(C)c(c(O)c1)C(C)(C)CCO | 2-(4-hydroxy-2-methylbutan-2-yl)-3,5-dimethylphenol | AG000TTX | 5g |
| 129954-34-3 | C(N[C@H](C(=O)N1[C@H](C(NCC(=O)N2[C@H](C(O)=O)CCC2)=O)CCC1)CCCNC( | L-Threonyl-L-lysyl-L-prolyl-L-arginyl-L-prolylglycyl-L-proline | AG000TU2 | 0.1g |
| 129952-14-3 | COCC(=O)N1[C@@H](CC2=CC=CC=C2)COC1=O | (S)-4-benzyl-3-(2-methoxyacetyl)oxazolidin-2-one | AG000TU4 | 210g |
| 129951-45-7 | O=C(O)C1=CC(F)=C(Cl)C=C1[N+]([O-])=O | 4-Chloro-5-fluoro-2-nitrobenzoic acid | AG000TU5 | 40g |
| 129999-62-8 | N1(CCN)CCC(CC1)CO | [1-(2-Aminoethyl)piperidin-4-yl]methanol | AG000TU9 | 3g |
| 129999-60-6 | C(CN)N1CCC(CC1)O | 1-(2-Aminoethyl)piperidin-4-ol | AG000TUA | 11g |
| 129986-67-0 | O=C(N(OC)C)C=P(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3 | N-Methoxy-N-methyl-2-(triphenylphosphoranylidene)acetamide | AG000TUJ | 50g |
| 129979-57-3 | OC(=O)C(F)(F)F.NC(=O)C[C@@H]1NC(=O)[C@H](CCC(=O)N)NC(=O)[C@H](Cc2c | [Arg8]Vasopressin TFA | AG000TUQ | 0.35g |
| 130-16-5 | Clc1c2c(c(cc1)O)nccc2 | 8-Quinolinol, 5-chloro- | AG000TUR | 2500g |
| 130-14-3 | O=S(C1=C2C=CC=CC2=CC=C1)([O-])=O.[Na+] | 1-Naphthalenesulfonic acid sodium salt | AG000TUT | 8000g |
| 130-13-2 | O=S(C1=C2C=CC=CC2=C(N)C=C1)([O-])=O.[Na+] | Sodium 4-amino-1-naphthalenesulfonate tetrahydrate | AG000TUU | 6000g |
| 130-03-0 | O=C1C2=CC=CC=C2SC1 | 2H-1-benzothiophen-3-one | AG000TUV | 25g |
| 130-01-8 | O=C/1O[C@]2([C@@]3(N(CC2)CC=C3COC(=O)[C@](C)(O)[C@H](C)C\C1=C\C)[H | (5R,6R,9a1R,14aR,Z)-3-Ethylidene-6-hydroxy-5,6-dimethyl-3,4,5,6,9,9a1,11,13, | AG000TUW | 0.01g |
| 130-00-7 | O=C1NC2=C3C1=CC=CC3=CC=C2 | Benz[cd]indol-2(1H)-one | AG000TUX | 8500g |
| 130-95-0 | [C@@H](O)(c1c2c(ccc(c2)OC)ncc1)[C@H]1N2C[C@@H]([C@H](C1)CC2)C=C | Cinchonan-9-ol, 6′-methoxy-, (8α,9R)- | AG000TUZ | 2000g |
| 130-89-2 | O[C@H](C1=CC=NC2=CC=C(OC)C=C12)[C@H]3[N@@]4C[C@H](C=C)[C@](CC4)( | (R)-[(2S，4S，5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl](6-methoxyquinol | AG000TV0 | 125g |
| 130-86-9 | O=C1C2=CC=3OCOC3C=C2CCN(C)CC4=C5OCOC5=CC=C4C1 | 4,6,7,14-Tetrahydro-5-methylbis[1,3]benzodioxolo[4,5-c:5′,6′-g]azecin-13(5H) | AG000TV1 | 5g |
| 130-85-8 | O=C(O)C1=C(O)C(CC2=C3C=CC=CC3=CC(C(O)=O)=C2O)=C4C=CC=CC4=C1 | Pamoic Acid | AG000TV2 | 2000g |
| 130-49-4 | O([C@@H]1[C@@H]([C@H](O[C@@]1([H])N1C=NC2=C(N=CN=C12)N)CO)O)P( | Adenosine-2′-monophosphate | AG000TVA | 0.5g |
| 130-24-5 | C1(O)=C2C(C=CC=C2)=C(N)C=C1C.[H]Cl | 4-Amino-2-methylnaphthalen-1-ol hydrochloride | AG000TVD | 0.75g |
| 130000-32-7 | CCCC(C(C)=O)C(OC)=O | Methyl 2-acetylpentanoate | AG000TVQ | 4g |
| 1300-94-3 | OC1=CC(C)=CC=C1CCCCC | 5-Methyl-2-N-Pentylphenol | AG000TVT | 100g |
| 1300-72-7 | c1ccc(cc1)N2C(=O)C(N)=C(C)N2C | Sodium xylenesulfonate | AG000TVV | 2250g |
| 126917-10-0 | O=C(Cl)C1=CC=C(C(F)(F)F)C=C1F | 2-Fluoro-4-(Trifluoromethyl)Benzoyl Chloride | AG000TH1 | 175g |
| 1269258-08-3 | N1(C=NC=C1)C1=CC=C2C=CNC(C2=C1)=O | 7-(1H-Imidazol-1-yl)isoquinolin-1(2H)-one | AG000THF | 0.5g |
| 1269232-99-6 | NC1=CC(F)=CC(Br)=C1F | 3-Bromo-2,5-difluoroaniline | AG000THG | 50g |
| 1269232-95-2 | NC1=CC(Cl)=CC(Br)=C1F | 3-Bromo-5-chloro-2-fluoroaniline | AG000THH | 500g |
| 1269232-94-1 | FC1=C(Br)C=C(Cl)C=C1NC(OC(C)(C)C)=O | tert-Butyl (3-bromo-5-chloro-2-fluorophenyl)carbamate | AG000THI | 3g |
| 1269232-93-0 | O=C(O)C1=CC(Cl)=CC(Br)=C1F | 3-Bromo-5-chloro-2-fluorobenzoic acid | AG000THJ | 50g |
| 126926-34-9 | OCC=1C=C(C(=O)N)C=CC1 | 3-(Hydroxymethyl)benzamide | AG000THO | 0.3g |
| 1269291-41-9 | O=C(O)C1=C(Br)N=CC=C1Br | 2,4-Dibromonicotinic acid | AG000THZ | 6g |
| 1269292-28-5 | O=C(OCC)C1=CN=C(C(F)(F)F)C=C1O | Ethyl 4-hydroxy-6-(trifluoromethyl)nicotinate | AG000TJL | 15g |
| 1269292-58-1 | OC1=CC(N)=NN1C(C)(C)C | 3-Amino-1-(tert-butyl)-1H-pyrazol-5-ol | AG000TKI | 3g |
| 129686-16-4 | BrC2=CN=C1NC(CCC1=C2)=O | 6-Bromo-3,4-dihydro-1H-[1,8]naphthyridin-2-one | AG000TKS | 200g |
| 129676-67-1 | OC1=CC=C(OC(F)(F)F)C=C1C | 2-Methyl-4-(trifluoromethoxy)phenol | AG000TL1 | 25g |
| 1296950-66-7 | O=C(C1=CC2=CC=C(Br)C=C2N=C1)N | 7-BROMOQUINOLINE-3-CARBOXAMIDE | AG000TLB | 0.75g |
| 129716-11-6 | CC1=C(CO)C=CC(Cl)=C1 | 4-Chloro-2-methylbenzyl Alcohol | AG000TLD | 80g |
| 1303588-27-3 | ClC1=NC2=C(C=C1)CCCN2 | 7-Chloro-1,2,3,4-tetrahydro-1,8-naphthyridine | AG000UAO | 5.102g |
| 1303533-81-4 | COC(N[C@@H](C(C)C)C(N1[C@@H](CCC1)C2=NC3=CC=C(C4=CC5=C(C=C(C6=CN | Ravidasvir dihydrochloride | AG000UAR | 2g |
| 13036-81-2 | N1(CN(CN(C1)CCC)CCC)(CCC) | 1,3,5-Tripropyl-1,3,5-triazinane | AG000UB2 | 30g |
| 13036-57-2 | CC1=NC(Cl)=NC=C1 | 2-Chloro-4-methylpyrimidine | AG000UB3 | 3500g |
| 13036-50-5 | ClC1=NC=CC(C2=CC=CC=C2)=N1 | 2-Chloro-4-phenylpyrimidine | AG000UB5 | 50g |
| 13036-02-7 | C(=O)(OC)c1cc(C(=O)OC)cc(c1)O | Dimethyl 5-hydroxyisophthalate | AG000UB7 | 6000g |
| 130369-36-7 | O=C(OCC1=CC=CC=C1)NC2CC(C2)=O | Benzyl 3-Oxocyclobutylcarbamate | AG000UB9 | 194g |
| 130369-33-4 | C(O)C1(CO)CC(C1)(OC)OC | (3,3-Dimethoxycyclobutane-1,1-diyl)dimethanol | AG000UBA | 20g |
| 130369-10-7 | CC(OC(NC1CC(CN)C1)=O)(C)C | Tert-Butyl (3-(aminomethyl)cyclobutyl)carbamate | AG000UBB | 0.1g |
| 130369-09-4 | O=C(OC(C)(C)C)NCC1CC(C1)=O | tert-Butyl ((3-oxocyclobutyl)methyl)carbamate | AG000UBC | 50g |
| 130369-06-1 | Cl.C(O)C1CC(C1)N | (3-aminocyclobutyl)methanol hydrochloride | AG000UBD | 10g |
| 130369-05-0 | O=C(OC(C)(C)C)NC1CC(CO)C1 | Tert-Butyl (3-(Hydroxymethyl)Cyclobutyl)Carbamate | AG000UBE | 175g |
| 130369-04-9 | CC(OC(NC1CC(=C)C1)=O)(C)C | tert-Butyl (3-methylenecyclobutyl)carbamate | AG000UBF | 125g |
| 130368-99-9 | OCC1CC(NC(OCC2=CC=CC=C2)=O)C1 | 3-(CBZ-AMINO)-CYCLOBUTANEMETHANOL | AG000UBG | 5g |
| 130368-69-3 | S(O[C@@H](C(O)=O)C)(=O)(=O)C1=CC=C(C)C=C1 | (2R)-2-[[(4-Methylphenyl)sulfonyl]oxy]propanoic acid | AG000UBI | 2g |
| 130365-87-6 | FC(C1=CC=C(CCBr)C=C1)(F)F | 1-(2-Bromoethyl)-4-(trifluoromethyl)benzene | AG000UBO | 50g |
| 13037-60-0 | S=C=NC1=CC=CC=C1Br | 2-Bromophenylisothiocyanate | AG000UBS | 75g |
| 130370-60-4 | O=C(NO)[C@@H](CSC1=CC=CS1)[C@@H](CC(C)C)C(N[C@@H](CC2=CC=CC=C2) | Batimastat | AG000UC7 | 0.3g |
| 130408-15-0 | O=C(O)CCC1=CC(F)=CC=C1F | 3-(2,5-Difluorophenyl)propanoic acid | AG000UDD | 50g |
| 130406-30-3 | OC[C@H](NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O)CC1=CC=CC=C1 | Fmoc-d-Phenylalaninol | AG000UDF | 25g |
| 130405-40-2 | OC1=CC(O)=C2C[C@@H](OC(=O)C3=CC(O)=C(O)C(O)=C3)[C@@H](OC2=C1)C1= | (-)-Catechin Gallate | AG000UDI | 0.075g |
| 13040-89-6 | NC1=NC=NC(C)=C1Cl | 5-Chloro-6-methylpyrimidin-4-amine | AG000UDW | 1.5g |
| 13040-77-2 | ClC1=CC=CC(C2=NC=CC=C2)=N1 | 6-Chloro-2,2′-bipyridine | AG000UDX | 200g |
| 1304129-94-9 | Brc1c2ccccc2c(-c2cccc(c2)-c2cccc3ccccc23)c2ccccc12 | 9-Bromo-10-(3-(naphthalen-1-yl)phenyl)anthracene | AG000UE0 | 1g |
| 130418-90-5 | CC(C)(C)OC(=O)N1CCC[C@@H]1C#C | (R)-1-Boc-2-Ethynylpyrrolidine | AG000UE1 | 1g |
| 130416-73-8 | IC=1C=C(C=CC1)SC | 3-Iodothioanisole | AG000UE2 | 2g |
| 130408-89-8 | FC(F)(F)C(C1=CNC=C1)=O | 2,2,2-Trifluoro-1-(1h-pyrrol-3-yl)-1-ethanone | AG000UEA | 10g |
| 130408-77-4 | C(C1=CNC2=CC=CC=C12)[C@H](NC(=O)OC(C)(C)C)C(=O)N[C@@H](CCCCNC(=O) | A71623 | AG000UEB | 0.005g |
| 13041-79-7 | N#CC1=CC=C(C=C1)/C=C/C2=CC=CC=C2 | 4-Cyanostilbene | AG000UEE | 25g |
| 13041-70-8 | BrC1=CC=C(C=C1)/C=C/C2=CC=CC=C2 | trans-4-Bromostilbene | AG000UEG | 10g |
| 13041-64-0 | COC(=O)c1ccc(OC)c2ccccc12 | Methyl 4-methoxy-1-naphthoate | AG000UEI | 5.06g |
| 13041-63-9 | O=C(C1=C2C=CC=CC2=C(O)C=C1)OC | Methyl 4-Hydroxy-1-Naphthoate | AG000UEJ | 5g |
| 13041-62-8 | O=C(O)C1=C2C=CC=CC2=C(OC)C=C1 | 4-METHOXY-1-NAPHTHOIC ACID | AG000UEK | 1000g |
| 13041-60-6 | O=C(OC)C1=C(OC)C=C2C=CC=CC2=C1 | Methyl 3-Methoxy-2-naphthoate | AG000UEL | 50g |
| 130420-78-9 | COC1=C(Br)C=C2C(C(C(N2)=O)=O)=C1 | 6-BROMO-5-METHOXYINDOLINE-2,3-DIONE | AG000UEZ | 0.45g |
| 13043-98-6 | O=C(NN)CCCCCC(NN)=O | Heptanedihydrazide | AG000UF3 | 25g |
| 129833-28-9 | O=C(O)C1=CC=C(F)C(C)=C1N | 2-Amino-4-fluoro-3-methylbenzoic acid | AG000TQK | 50g |
| 129832-03-7 | O=P(O)(O)O[C@@H]1[C@@H](OP(O)(O)=O)[C@H](OP(O)(O)=O)[C@@H](OP( | INOSITOL HEXAPHOSPHORIC ACID DIPOTASSIUM SALT | AG000TQL | 5000g |
| 129830-38-2 | O=C([C@H]1CC[C@H]([C@H](N)C)CC1)NC2=CC=NC=C2.[H]Cl.[H]Cl | (1R,4r)-4-((R)-1-aminoethyl)-N-(pyridin-4-yl)cyclohexanecarboxamide dihydr | AG000TQM | 25g |
| 129825-11-2 | C1=CC(=C(C=C1C(C)=O)C(F)(F)F)Cl | 4′-Chloro-3′-(trifluoromethyl)acetophenone | AG000TQR | 300g |
| 129872-84-0 | Cn1ccc2[nH]c(Cl)nc(=O)c21 | 2-Chloro-5-methyl-1h,4h,5h-pyrrolo[3,2-d]pyrimidin-4-one | AG000TR1 | 1g |
| 129872-81-7 | CN1C=CC2=NC(Cl)=NC(Cl)=C12 | 2,4-Dichloro-5-methyl-5H-pyrrolo[3,2-d]pyrimidine | AG000TR4 | 20g |
| 129888-60-4 | CC(C)(C)OC(=O)N1CCCC(C1)OS(C)(=O)=O | N-BOC-3-MESYLOXYPIPERIDINE | AG000TRV | 180g |
| 1299312-97-2 | COC1=C(Br)C=C(O)C=N1 | 5-bromo-6-methoxypyridin-3-ol | AG000TS7 | 3g |
| 129931-47-1 | N#CC1=CC(C(F)(F)F)=CC(Cl)=C1F | 3-Chloro-2-fluoro-5-(trifluoromethyl)benzonitrile | AG000TSB | 30g |
| 129931-45-9 | OC(=O)C1=C(F)C(Cl)=CC(=C1)C(F)(F)F | 3-Chloro-2-fluoro-5-(trifluoromethyl)benzoic acid | AG000TSC | 50g |
| 129922-58-3 | CN1N=C(C=C1O)C(F)F | 3-(Difluoromethyl)-1-methyl-1H-pyrazol-5-ol | AG000TSE | 125g |
| 129922-49-2 | O=S(C1=CC=CC=C1C2=CC=CC=C2)C(F)(F)F | 2-((Trifluoromethyl)sulfinyl)-1,1′-biphenyl | AG000TSI | 5g |
| 129912-22-7 | CC1=CN2C=C(C=CC2=N1)C(=O)O | 2-Methylimidazo[1,2-a]pyridine-6-carboxylic acid | AG000TSP | 1g |
| 129912-15-8 | O=C(C1=CN2C=CC(OC)=CC2=N1)O | 7-Methoxyimidazo[1,2-a]pyridine-2-carboxylic acid | AG000TSQ | 15g |
| 13042-33-6 | C[C@@]12[C@@]3([C@]([C@]4([C@](C)(CC3)[C@@]([C@@H](CCC(NCC(O)=O) | N-[(3α,5β,6α)-3,6-Dihydroxy-24-oxocholan-24-yl]glycine | AG000UFC | 20g |
| 130433-68-0 | F[N+]1=C(Cl)C=CC=C1Cl.O=S(C(F)(F)F)([O-])=O | 2,6-Dichloro-1-fluoropyridin-1-ium trifluoromethanesulfonate | AG000UFP | 20g |
| 13045-13-1 | CC(=O)C(CCO)Cl | 3-Chloro-5-hydroxypentan-2-one | AG000UFS | 25g |
| 130465-39-3 | [C@H]1(C2=CC=CC=C2)O[C@@H](CN)C2=CC=C(O)C(O)=C2C1.[H]Cl | A68930 (hydrochloride) | AG000UGA | 0.06g |
| 130464-05-0 | C1CN[C@H](C1)c1ccccn1 | (R)-2-(Pyrrolidin-2-yl)pyridine | AG000UGC | 1g |
| 130451-86-4 | C(=CC(=O)OC)/c1c(C)cccc1 | Methyl (2E)-3-(2-methylphenyl)-2-propenoate | AG000UGH | 2g |
| 1304771-27-4 | Cl[H].COC1=CC(=CC=C1)[C@H](C)N | (S)-1-(3-Methoxyphenyl)ethylamine-hcl | AG000UGU | 2g |
| 130477-52-0 | COC1=CC(C(N2[C@@]3([H])CCC2)=O)=C(C=C1)N4C3=C(C(OCC)=O)N=C4 | L-655708 | AG000UGV | 0.1g |
| 130473-27-7 | OC(=O)C1=CC2=C(NC=C2)C=N1 | 1H-Pyrrolo[2,3-c]pyridine-5-carboxylic acid | AG000UH1 | 25g |
| 130473-26-6 | O=CC1=CC2=C(NC=C2)C=N1 | 1H-Pyrrolo[2,3-c]pyridine-5-carbaldehyde | AG000UH2 | 6g |
| 13047-13-7 | O=C1NN(C2=CC=CC=C2)CC1(CO)C | 4-(Hydroxymethyl)-4-methyl-1-phenylpyrazolidin-3-one | AG000UHA | 225g |
| 13047-06-8 | O=C(C1=CC=CC=C1Br)C2=CC=CC=C2 | 2-Bromobenzophenone | AG000UHE | 175g |
| 13049-77-9 | C1(CN(C)CCC1=O)C(OC)=O.Cl | N-Methyl-3-carbomethoxy-4-piperidone HCl | AG000UHQ | 75g |
| 13049-40-6 | CCc1ccc(cc1)c2ccc(CC)cc2 | 4,4′-Diethylbiphenyl | AG000UHR | 75g |
| 13049-16-6 | O=C(O)C1=CC=CC(C(O)=O)=C1Cl | 2-Chloroisophthalic acid | AG000UHW | 50g |
| 13049-01-9 | Cl.CCCOC(=O)CN | Glycine n-propyl ester hydrochloride | AG000UHX | 600g |
| 13048-95-8 | O=C1N=C(NC)C=CN1[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2OC | N4-Methyl-2’-O-methyl-cytidine | AG000UHY | 1.25g |
| 130194-42-2 | NCC[C@H](O)C1=CC=CC=C1 | (S)-3-Amino-1-phenylpropan-1-ol | AG000U3R | 1.5g |
| 130191-91-2 | OC1=CC(F)=C(Br)C(F)=C1 | 4-Bromo-3,5-difluorophenol | AG000U3W | 125g |
| 13019-32-4 | OC1=C2N=CC=CC2=CC=C1Br | 7-Bromoquinolin-8-ol | AG000U49 | 10g |
| 13019-22-2 | C(CCCC=C)CCCCO | 9-Decen-1-ol | AG000U4A | 2500g |
| 13019-20-0 | C(=O)(C(C)C)CCCC | 2-Methylheptan-3-One | AG000U4B | 50g |
| 13019-16-4 | CCCCCC=C(CCCC)C=O | 2-Butyloct-2-enal | AG000U4D | 15g |
| 130200-58-7 | N#CC1=CC=C2C=CC(O)=CC2=C1 | 7-Hydroxy-2-naphthonitrile | AG000U4H | 7g |
| 130200-02-1 | CC1(C)CC(=O)C2=C(O1)C=C(C=C2)C#N | 2,2-Dimethyl-4-oxochroman-7-carbonitrile | AG000U4J | 10g |
| 130199-65-4 | N[C@H](C1=NC=CS1)CC2=CC=CC=C2 | (S)-2-Phenyl-1-(thiazol-2-yl)ethanamine | AG000U4K | 9g |
| 130198-05-9 | COC1=CC=C(C=C1)C(CN)C2(CCCCC2)O.Cl | 1-(4-Methoxyphenyl)-2-aminoethyl cyclohexanol HCl | AG000U4L | 1000g |
| 13020-57-0 | OC1=CC=CC(=C1)C(=O)C1=CC=CC=C1 | 3-HYDROXYBENZOPHENONE | AG000U4Q | 200g |
| 1302-93-8 | [O-][Si]([O-])([O-])[O-].[O-][Si]([O-])([O-])[O-].[O-][Si]([O-])([O-])[O-].[Al+3].[ | Mullite | AG000U4S | 100g |
| 1302-82-5 | [SeH2-2].[SeH2-2].[SeH2-2].[AlH3+3].[AlH3+3] | ALUMINUM SELENIDE (AL2SE3) | AG000U4V | 75g |
| 1302-81-4 | [SH2-2].[SH2-2].[SH2-2].[AlH3+3].[AlH3+3] | Aluminum sulfide (Al2S3) | AG000U4W | 25g |
| 130209-82-4 | O=C(CCC/C=CC[C@@H]1[C@H]([C@@H](C[C@@H]1O)O)CC[C@H](CCC2=CC=C | Latanoprost | AG000U58 | 25g |
| 13030-09-6 | [H][C@](N)(CCC(O)=O)C(=O)OCC1=CC=CC=C1 | H-Glu-OBzl | AG000U9O | 200g |
| 1303-86-2 | O=BOB=O | Boron oxide | AG000U9Q | 21675g |
| 1303-58-8 | [Au+3].[Au+3].[O-2].[O-2].[O-2] | Gold(Iii) Oxide | AG000U9T | 10g |
| 1303-52-2 | [Au+3].[OH-].[OH-].[OH-] | Gold(III) hydroxide | AG000U9U | 5g |
| 130316-46-0 | O=C(OC(C)(C)C)[C@@H](N)CCC1=CC=CC=C1.[H]Cl | L-Homophenylalanine tert-butyl ester, HCl | AG000UA1 | 25g |
| 130312-10-6 | O=CCC1CCN(CC1)C(=O)OCC1=CC=CC=C1 | 4-(2-Oxo-ethyl)-piperidine-1-carboxylic acid benzyl ester | AG000UA6 | 2g |
| 130312-02-6 | O=C(N1CC(CC1)=O)OCC2=CC=CC=C2 | 1-N-Cbz-3-Pyrrolidinone | AG000UA7 | 725g |
| 130312-01-5 | O=C(O)/C=C1CCOCC1 | (Tetrahydropyran-4-ylidene)-acetic acid | AG000UA8 | 20g |
| 130312-00-4 | O=C(OCC)/C=C1CCOCC/1 | Ethyl (tetrahydropyran-4-ylidene)acetate | AG000UA9 | 50g |
| 13032-41-2 | O=C(C1CC2CCCCC2CC1)O | Decahydronaphthalene-2-carboxylic acid | AG000UAA | 7g |
| 13031-76-0 | O=S1(CC(O)CC1)=O | 3-Hydroxytetrahydro-1h-1lambda6-thiophene-1,1-dione | AG000UAC | 500g |
| 13031-62-4 | Cl.NCCCC(N)=O | 4-Aminobutanamide hydrochloride | AG000UAD | 10g |
| 13031-60-2 | O=C(OC)CCCN.[H]Cl | Methyl 4-aminobutyrate, HCl | AG000UAE | 2500g |
| 13031-43-1 | CC(=O)OC1=CC=C(C=C1)C(C)=O | 4-Acetylphenyl acetate | AG000UAI | 4500g |
| 13031-39-5 | CC(OC1=CC=CC(Cl)=C1)=O | 3-Chlorophenyl acetate | AG000UAJ | 25g |
| 13031-04-4 | O=C1OCC(C)(C)C1=O | Dihydro-4,4-dimethyl-2,3-furandione | AG000UAK | 200g |
| 1300582-52-8 | CC1(C)OB(C2=CC3=C(C=C2)C(C)=CN3)OC1(C)C | 3-Methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole | AG000TY8 | 15g |
| 130049-82-0 | O=c1n2c(nc(c1CCCl)C)C(O)CCC2 | 4H-Pyrido[1,2-a]pyrimidin-4-one, 3-(2-chloroethyl)-6,7,8,9-tetrahydro-9-hydr | AG000TYG | 200g |
| 13006-59-2 | CC1=C(NC2=C1C=CC=C2)C#N | 3-Methyl-1H-indole-2-carbonitrile | AG000TYK | 10g |
| 13005-11-3 | CN1CCC(CN)C1 | (1-Methylpyrrolidin-3-yl)methanamine | AG000TYS | 5g |
| 13005-09-9 | [N+](=O)([O-])[O-].COC=1C(=CC=2CC[N+]3=C(C2C1)C(=C1C=CC(=C(C1=C3)OC)OC | 2,3,9,10-Tetramethoxy-13-methyl-5,6-dihydroisoquinolino[3,2-a]isoquinolin- | AG000TYT | 0.02g |
| 1300750-79-1 | NC1=C(Cl)C=NC=C1I | 3-Chloro-5-iodopyridin-4-amine | AG000TYU | 300g |
| 1300750-78-0 | C1=C(C(=CN=C1Br)I)N | 2-bromo-5-iodopyridin-4-amine | AG000TYV | 25g |
| 1300750-77-9 | NC1=C(I)C(Br)=NC=C1 | 2-bromo-3-iodopyridin-4-amine | AG000TYW | 15g |
| 1300750-50-8 | FC(F)OC1=NC=CC=C1B(O)O | (2-(Difluoromethoxy)pyridin-3-yl)boronic acid | AG000TYX | 3g |
| 1300690-48-5 | O=C(O)C1=CC=C(C)C(C#CC2=CN=C3C=CC=NN32)=C1 | 3-(2-(Imidazo[1,2-b]pyridazin-3-yl)ethynyl)-4-methylbenzoic acid | AG000TYZ | 10g |
| 130066-24-9 | C1=C(C=CC(=C1)NC(=N)N)C(F)(F)F | N-[4-(Trifluoromethyl)phenyl]guanidine | AG000TZ4 | 1.25g |
| 13007-85-7 | OC[C@H]([C@H]([C@@H]([C@H]([C@H](C(=O)[O-])O)O)O)O)O.[Na+] | Glucoheptonic acid sodium salt dihydrate | AG000TZG | 2000g |
| 130098-90-7 | Cc1cnn(c1)C(C)C | 1H-Pyrazole, 4-methyl-1-(1-methylethyl)- | AG000TZL | 3.9g |
| 13010-19-0 | ClCCCN=C=O | 3-Chloropropyl isocyanate | AG000TZW | 300g |
| 13009-99-9 | O=S(C1=CC=C(CN)C=C1)(N)=O.CC(O)=O | Benzenesulfonamide, 4-(aminomethyl)-, acetate (1:1) | AG000U00 | 500g |
| 13008-17-8 | CC1=NC(O)=NC=C1C(O)=O | 2-Hydroxy-4-methylpyrimidine-5-carboxylic acid | AG000U03 | 5g |
| 1301-96-8 | [O-2].[Ag+2] | Silver oxide (AgO) | AG000U04 | 125g |
| 130137-40-5 | O=C1N(C)C2=CC=C(N)C=C2OC1C | 7-Amino-2,4-Dimethyl-2H-Benzo[B][1,4]Oxazin-3(4H)-One | AG000U1Q | 15g |
| 130137-05-2 | O=C(O)C1=CC(F)=C(F)C=C1I | 4,5-Difluoro-2-iodobenzoic acid | AG000U1R | 200g |
| 130129-58-7 | CCc1ncnc(O)c1Cl | 5-Chloro-6-ethylpyrimidin-4-ol | AG000U1W | 1g |
| 13014-90-9 | [I-].[NH2+]1N(N(N=C1c1ccccc1)c1ccccc1)c1ccccc1 | 2,3,5-triphenyl-2,3-dihydro-1H-1,2,3,4-tetrazol-1-ium iodide | AG000U20 | 0.75g |
| 13014-24-9 | Clc1ccc(cc1Cl)C(Cl)(Cl)Cl | 3,4-Dichlorobenzotrichloride | AG000U26 | 100g |
| 13014-18-1 | Clc1ccc(c(Cl)c1)C(Cl)(Cl)Cl | 2,4-Dichlorobenzotrichloride | AG000U27 | 25g |
| 13013-02-0 | O=C(OC)CCC[N+]([O-])=O | Methyl 4-nitrobutanoate | AG000U2A | 700g |
| 130161-46-5 | O=CC1=CN=C(C2=CC=CC=C2)N=C1 | 2-Phenylpyrimidine-5-carbaldehyde | AG000U2H | 4g |
| 130148-53-7 | O=c1c2c([nH]c(n1)N)ccc(c2)Br | 2-Amino-6-bromoquinazolin-4-ol | AG000U2S | 35g |
| 13016-17-6 | CC1N=C(S)OC=1 | 4-METHYL-1,3-OXAZOLE-2-THIOL | AG000U2Y | 10g |
| 1301739-25-2 | NC1=C(I)C=C(I)C=C1F | 2-Fluoro-4,6-diiodoaniline | AG000U33 | 25g |
| 1301714-24-8 | ClC1=NC=C2N=CC=C(Cl)C2=C1 | 4,6-dichloro-1,7-naphthyridine | AG000U35 | 1g |
| 1301706-71-7 | CC(N[C@H](CCCCNC(=O)OCC1c2ccccc2-c2ccccc12)C(O)=O)=C1C(=O)CC(C)(C)CC1 | Dde-D-Lys(Fmoc)-OH | AG000U36 | 100g |
| 13018-10-5 | C/C=C(C(=O)O[C@@H]1C[C@H](C)[C@@H]2C(=C(C(=O)C2)C)C[C@@H]1C(OC(= | Torilin | AG000U3I | 0.005g |
| 13017-64-6 | N#C/C(C#N)=C1C(C)CCCC/1 | 2-(2-Methylcyclohexylidene)propanedinitrile | AG000U3L | 15g |
| 13052-92-1 | C(=O)(OCC)c1cc(N)c(cc1)O | Benzoic acid, 3-amino-4-hydroxy-, ethyl ester | AG000UJZ | 30g |
| 1305287-88-0 | CCOC(=O)C1(CC)COCCN1 | Ethyl 3-Ethylmorpholine-3-carboxylate | AG000UK4 | 15g |
| 1305208-47-2 | NCC1(O)COC1 | 3-(Aminomethyl)oxetan-3-ol | AG000UK6 | 25g |
| 1305208-37-0 | OCC1(N)COC1 | (3-Aminooxetan-3-yl)methanol | AG000UK8 | 125g |
| 130525-58-5 | CC(OC[C@@H](OC(C)=O)[C@H]([C@@]1([H])[C@@H]([C@H](C=C(C(OC)=O)O1 | (1S,2R)-1-((2R,3R,4S)-3-Acetamido-4-azido-6-(methoxycarbonyl)-3,4-dihydro- | AG000UKD | 100g |
| 130525-43-8 | CC(C)(C)c1cc(Br)c2Oc3c(Br)cc(cc3C(C)(C)c2c1)C(C)(C)C | 9H-Xanthene, 4,5-dibromo-2,7-bis(1,1-dimethylethyl)-9,9-dimethyl- | AG000UKE | 50g |
| 130525-41-6 | CC(C)(C)C1=CC2C(C)(C)C3C(=CC=C(C(C)(C)C)C=3)OC=2C=C1 | 2,7-DI-TERT-BUTYL-9,9-DIMETHYLXANTHENE | AG000UKF | 150g |
| 130523-30-7 | Cc1c2c(cccc2N)ccc1 | 8-Methylnaphthalen-1-amine | AG000UKI | 5.27g |
| 13053-88-8 | CC(NC1=NC=CC=N1)=O | 2-Acetamidopyrimidine | AG000UKM | 50g |
| 13053-75-3 | CCCC[N+](CCCC)(CCCC)CCCC.Cl[Br-]Cl | Tetra-N-Butylammonium Dichlorobromide | AG000UKR | 50g |
| 1305322-89-7 | CN(C)C(=O)N1CC[C@H](O)C1 | (S)-3-Hydroxy-N,N-dimethylpyrrolidine-1-carboxamide | AG000UKW | 10g |
| 1305320-69-7 | CC(NC1CN(CCC1CO)C(=O)OC(C)(C)C)C1=CC=CC=C1 | 1-Boc-3-(1-phenylethylamino)-4-piperidinemethanol | AG000UKY | 15g |
| 1305320-67-5 | O=C(OC(C)(C)C)N1N=CC2=C1C=C(C(Br)=C2)C | 1-Boc-5-bromo-6-methyl-1H-indazole | AG000UL0 | 15g |
| 1305320-65-3 | Fc1cccc2c1cnn2C(=O)OC(C)(C)C | 1-Boc-4-fluoro-1H-indazole | AG000UL2 | 1g |
| 1305320-63-1 | O=C(O)C1=CC=C(N2CCN(CC3=C(C4=CC=C(Cl)C=C4)CCC(C)(C)C3)CC2)C=C1.[H]Cl | 4-[4-[[2-(4-Chlorophenyl)-5,5-dimethyl-1-cyclohexenyl]methyl]-1-piperaziny | AG000UL4 | 30g |
| 1305320-61-9 | O(c1c(cccc1)c1[nH]nnn1)c1cc2c(cc1)cccc2 | 2H-Tetrazole, 5-[2-(2-naphthalenyloxy)phenyl]- | AG000UL6 | 5g |
| 1305320-59-5 | CC(C)(C)OC(=O)N1N=CC2=CC=CC(F)=C12 | 1-Boc-7-fluoro-1H-indazole | AG000UL8 | 15g |
| 130110-09-7 | CNC(CN1CCCC1)C1=CC=CC=C1 | (1-PHENYL-2-PYRROLIDINYLETHYL)METHYLAMINE | AG000U0D | 1g |
| 130104-32-4 | ClC1=C(C(N2C=CN=C2)C3=CC=CC=C3CC4)C4=CC(Cl)=C1.O[N+]([O-])=O | 1-(2,4-dichloro-10,11-dihydro-5H-dibenzo[a,d][7]annulen-5-yl)-1H-imidazole | AG000U0L | 0.1g |
| 13011-54-6 | [O-]P([O-])(O)=O.[NH4+].[Na+] | Ammonium sodium hydrogen phosphate | AG000U0R | 3500g |
| 13010-47-4 | O=C(NC1CCCCC1)N(CCCl)N=O | Lomustine | AG000U0T | 30g |
| 13010-20-3 | O=NNC(=O)N | Urea， N-nitroso- | AG000U0W | 0.2g |
| 1301215-20-2 | O=C1CC2(CCNCC2)CC3=C1N(C(C)C)N=C3.[H]Cl | 1-Isopropyl-1,4-dihydrospiro[indazole-5,4′-piperidin]-7(6H)-one hydrochlorid | AG000U0X | 0.3g |
| 1301214-72-1 | O=C(C1=CN=C2C(NN=C2)=C1)OC | Methyl 1h-pyrazolo[4,3-b]pyridine-6-carboxylate | AG000U0Z | 25g |
| 1301214-71-0 | CC(NC1=C(C)N=CC(Br)=C1)=O | N-(5-Bromo-2-methylpyridin-3-yl)acetamide | AG000U10 | 3g |
| 1301214-62-9 | OC(=O)c1ccc2c(c1)c(=O)[nH]cc2 | 1-Hydroxyisoquinoline-7-carboxylic acid | AG000U12 | 0.5g |
| 1301214-60-7 | O=C(C1=CC2=C(C(O)=NC=C2)C=C1)O | 1-Hydroxyisoquinoline-6-carboxylic acid | AG000U13 | 2g |
| 1301147-34-1 | Cc1c(OCOC)ccc(c1C)Br | 3-Bromo-6-(methoxymethoxy)-o-xylene | AG000U14 | 80g |
| 130120-68-2 | NC1=NC(Cl)=C2NC(Cl)=NC2=N1 | 6,8-DICHLORO-7H-PURIN-2-YLAMINE | AG000U18 | 2g |
| 130120-57-9 | CC(=O)O.CC(=O)O.NCCCCC(C(=O)[O-])NC(=O)C(Cc1[nH]cnc1)NC(=O)CN.NCCCC | Cuprate(1-), (glycyl-L-histidyl-κN1-L-lysinato)[glycyl-κN-L-histidyl-κN,κN3-L-l | AG000U19 | 15g |
| 130115-85-4 | OC1=CC(Br)=C(Cl)N=C1 | 5-Bromo-6-chloropyridin-3-ol | AG000U1C | 150g |
| 13012-59-4 | CSCCCCl | 1-chloro-3-(methylsulfanyl)propane | AG000U1H | 5g |
| 13012-38-9 | O=C([C@H]1CC(CC1)=O)O | (R)-3-Oxocyclopentanecarboxylic acid | AG000U1J | 100g |
| 13038-26-1 | C(F)(F)(C(F)(F)C(OC)=O)C(F)(F)C(F)(F)F | Methyl nonafluorovalerate | AG000UCA | 400g |
| 13038-21-6 | OCCCCCCCC=C | 8-Nonen-1-ol | AG000UCC | 50g |
| 13038-13-6 | OCC/C=C/C(=O)OCC | (E)-Ethyl 5-hydroxypent-2-enoate | AG000UCF | 5g |
| 1303972-81-7 | O=C(C1C(F)(F)CN(C(OC(C)(C)C)=O)CC1)O | 1-(tert-Butoxycarbonyl)-3,3-difluoropiperidine-4-carboxylic acid | AG000UCN | 6.5g |
| 1303968-52-6 | O=S(C1=NC=CC=C1)(NC2CC2)=O | N-Cyclopropylpyridine-2-sulfonamide | AG000UCO | 1.614g |
| 1303968-47-9 | O=S(C1=NC=CC=C1)(NC(C)C)=O | N-Isopropylpyridine-2-sulfonamide | AG000UCR | 1.25g |
| 1303968-41-3 | Cl.Cl.NCC1=NC=CC(C(F)(F)F)=C1 | (4-(Trifluoromethyl)Pyridin-2-Yl)Methanamine Dihydrochloride | AG000UCT | 1.75g |
| 1303968-37-7 | O=C1CC(C)(C)NCC1.[H]Cl | 2,2-Dimethylpiperidin-4-one hydrochloride | AG000UCU | 4g |
| 1303968-15-1 | CC1CCN(Cc2ccccc2)CC1=O.Cl | 1-Benzyl-4-methyl-piperidin-3-one hydrochloride | AG000UCW | 25g |
| 1303968-12-8 | N#CC1CCC(CC1)NC(=O)OC(C)(C)C | tert-Butyl (4-cyanocyclohexyl)carbamate | AG000UCX | 10g |
| 1303931-49-8 | CC1=C(C(O)=O)C=CC(NC(OC(C)(C)C)=O)=C1 | 4-{[(tert-butoxy)carbonyl]amino}-2-methylbenzoic acid | AG000UD1 | 10g |
| 130396-60-0 | OC1CC(NC(OCC2=CC=CC=C2)=O)C1 | Benzyl 3-hydroxycyclobutylcarbamate | AG000UD2 | 25g |
| 13039-75-3 | O=C[C@H](O)[C@H](O)[C@H](O)C | 5-Deoxy-D-ribose | AG000UD6 | 1g |
| 13039-63-9 | O[C@@H]1[C@@H](CO)OC(OC)[C@@H]1O | Methyl D-ribofuranoside(α and β mixture) | AG000UD7 | 600g |
| 13039-56-0 | C[C@H](O)[C@H](O)[C@@H](O)C=O | 5-Deoxy-L-arabinose | AG000UD9 | 0.5g |
| 130408-16-1 | O=C1CCC2=C1C(F)=CC=C2F | 4,7-DIFLUOROINDAN-1-ONE | AG000UDC | 75g |
| 130284-56-9 | BrC1=NC=C(C=C1Cl)O | 2-Bromo-3-chloro-5-hydroxypyridine | AG000U82 | 25g |
| 130284-53-6 | NC1=CC(Br)=C(Cl)N=C1 | 5-Amino-3-bromo-2-chloropyridine | AG000U83 | 125g |
| 130284-52-5 | NC1=CC(Cl)=C(Br)N=C1 | 5-Amino-2-bromo-3-chloropyridine | AG000U84 | 175g |
| 130290-79-8 | NCC1CCOCC1 | 4-Aminomethyltetrahydropyran | AG000U8U | 406.9g |
| 13029-73-7 | OC(CNS(C1=CC=C(Br)C=C1)(=O)=O)=O | 2-(4-Bromophenylsulfonamido)acetic acid | AG000U8Y | 0.75g |
| 130309-46-5 | CC(C)(C)OC(=O)NC1CCC(CC1)C(O)=O | 4-(Boc-amino)cyclohexanecarboxylic Acid | AG000U97 | 500g |
| 130309-37-4 | O=C([C@H]1N(C(OCC2C3=C(C4=C2C=CC=C4)C=CC=C3)=O)[C@@]5([H])CCCC[C@ | Fmoc-(2S,3aS,7aS)-Octahydro-1H-indole-2-carboxylic acid | AG000U98 | 187g |
| 130309-35-2 | O=C(O)[C@@H](NC(OCC1C2=C(C3=C1C=CC=C3)C=CC=C2)=O)CC4=CC=CS4 | Fmoc-L-2-thienylalanine | AG000U99 | 500g |
| 130309-33-0 | O=C(N1CC2=C(C=CC=C2)C[C@@H]1C(O)=O)OCC3C4=C(C5=C3C=CC=C5)C=CC=C4 | Fmoc-D-Tic-OH | AG000U9A | 65g |
| 130308-48-4 | N[C@@H](C(N[C@H](C(N1[C@H](C(N2[C@H](C(NCC(N[C@H](C(N[C@H](C(N3 | Icatibant | AG000U9B | 0.3g |
| 130307-08-3 | CN1CCN(C2=CC=C(Br)C=C2)CC1 | 1-(4-Bromophenyl)-4-Methylpiperazine | AG000U9E | 400g |
| 130304-80-2 | O=C(O)[C@@H](NC(OCC1C2=C(C3=C1C=CC=C3)C=CC=C2)=O)CC(OC4CCCCC4)=O | Fmoc-Asp(OcHex)-OH | AG000U9F | 200g |
| 13030-62-1 | OC(=O)OC[C@H]1O[C@H](C[C@@H]1OC(=O)O)N2C=CC(=O)NC2=O | ((2R,3S,5R)-3-Acetoxy-5-(2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)tetrahydro | AG000U9K | 2g |
| 13048-34-5 | C=CC(OCCCCCCCCCCOC(C=C)=O)=O | Decane-1,10-diyl diacrylate | AG000UI4 | 5500g |
| 130495-35-1 | COC1=CC=C(CCCOC(C2=CC=C(OC)C=C2)CN3C=CN=C3)C=C1.[H]Cl | SKF-96365 hydrochloride | AG000UI8 | 0.2g |
| 130495-08-8 | CC(OC(N1[C@H](C#C)CCC1)=O)(C)C | (S)-tert-Butyl 2-ethynylpyrrolidine-1-carboxylate | AG000UIA | 3g |
| 130493-03-7 | ClC(=NOCC(O)CN1CCCCC1)C=2C=NC=CC2 | N-[2-Hydroxy-3-(1-piperidinyl)propoxy]-3-pyridinecarboximidoyl chloride | AG000UID | 0.01g |
| 13050-56-1 | COC1=CC=C(N(C2=CC=C(OC)C=C2)C3=CC=C(OC)C=C3)C=C1 | Tris(4-methoxyphenyl)amine | AG000UIJ | 50g |
| 13050-47-0 | O=C(NN)C1=CC=CC(C)=C1 | M-Toluic acid hydrazide | AG000UIK | 700g |
| 13050-38-9 | NNC(C(C1=CC=CC=C1)(O)C2=CC=CC=C2)=O | 2-Hydroxy-2,2-diphenylacetohydrazide | AG000UIL | 100g |
| 1305-84-6 | [Ca]=[Se] | Calcium selenide (CaSe) | AG000UIQ | 75g |
| 1305053-43-3 | O=C(ON1C(CCC1=O)=O)CCOCCOCCOCCOCCSSC2=NC=CC=C2 | 2,5-Dioxopyrrolidin-1-yl 1-(pyridin-2-yldisulfaneyl)-3,6,9,12-tetraoxapentade | AG000UIS | 1.25g |
| 13051-49-5 | CC(=O)OCCC(Cl)C(=O)C | 3-CHLORO-5-HYDROXY-2-PENTANON ACETATE | AG000UJ2 | 50g |
| 13051-32-6 | O=C(OC)C(C)(C)CCC(OC)=O | Dimethyl 2,2-dimethylpentanedioate | AG000UJ5 | 2g |
| 13051-21-3 | COC(=O)C(C)(C)C(O)=O | 3-Methoxy-2,2-dimethyl-3-oxopropanoic acid | AG000UJ7 | 100g |
| 13051-19-9 | CC(OC(N1N(C(OC(C)(C)C)=O)CC=CC1)=O)(C)C | 1,2-di-tert-butyl 1,2,3,6-tetrahydropyridazine-1,2-dicarboxylate | AG000UJ8 | 0.5g |
| 1305208-17-6 | BrC1=CC2=C(N=C1)C(I)=NN2 | 6-Bromo-3-iodo-1H-pyrazolo[4,3-b]pyridine | AG000UJH | 2g |
| 1305208-02-9 | ClC1=CC2=C(NN=C2)C=C1Br | 6-bromo-5-chloro-1H-indazole | AG000UJI | 20.1g |
| 1305207-52-6 | O=CC1COC1 | Oxetane-3-carbaldehyde | AG000UJM | 34g |
| 130518-34-2 | O=C(C1C2=C(N=C(OC)C=C2)CCC1=O)OC | Methyl 6-hydroxy-2-methoxy-7,8-dihydroquinoline-5-carboxylate | AG000UJQ | 0.75g |
| 130717-51-0 | O=C(N1CCN(C)CC1)C2=NC(C3=CC=C(OC)C=C3)=C(S2)C4=CC=C(OC)C=C4.Cl | FR122047 (hydrochloride) | AG000UUW | 0.05g |
| 130714-47-5 | C1(CCCCC1)NC1=C2N=CN(C2=NC=N1)[C@H]1[C@@H]([C@@H]([C@H](O1)CO) | SDZ-WAG994 | AG000UV0 | 0.25g |
| 1307248-48-1 | CC(C)(C)OC(=O)N1CCC2(CC1)OCC(F)(F)c1cc(Cl)sc12 | tert-butyl 2′-chloro-4′,4′-difluoro-4′,5′-dihydrospiro[piperidine-4,7′-thieno[2, | AG000UV7 | 10g |
| 1307248-45-8 | O=C(N1CCC2(CC1)C3=C(C=C(Cl)S3)CCO2)OC(C)(C)C | tert-Butyl 2′-chloro-4′,5′-dihydrospiro[piperidine-4,7′-thieno[2,3-c]pyran]-1-c | AG000UV8 | 5g |
| 130727-48-9 | OCCOCCOCCOCCOCCOCCOCCCCCCCCCC=C | Hexaethylene glycol o-undec-1-ene | AG000UVH | 1g |
| 130727-44-5 | OCCOCCOCCOCCOCCOCCOCCCCCCCCCCCS | 29-Mercapto-3,6,9,12,15,18-hexaoxanonacosan-1-ol | AG000UVK | 1g |
| 130726-68-0 | CS/C=C(C1=C(C=CC=C1)OCCCCC)/N1C=NC=C1 | Neticonazole | AG000UVP | 0.5g |
| 1307316-93-3 | BrC1=CC=CC2=C1C=NC=C2.[H]Cl | 8-Bromoisoquinoline hydrochloride | AG000UVU | 5g |
| 1307316-83-1 | ClC1=CC2=C(C=NC=C2)C=C1Br | 7-Bromo-6-chloroisoquinoline | AG000UVV | 2g |
| 13074-65-2 | CCCCCCC1CCCC1=O | 2-Hexylcyclopentanone | AG000UW4 | 10g |
| 13074-39-0 | NC1C2CC3CC(C2)CC1C3 | 2-AMINOADAMANTANE | AG000UW6 | 125g |
| 13074-06-1 | OC[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)C | (2R,3S,4R,5S)-Hexane-1,2,3,4,5-pentaol | AG000UW9 | 7g |
| 13073-96-6 | OCCOCCN1CCN(C(C2=CC=CC=C2)C3=CC=CC=C3)CC1.[H]Cl.[H]Cl | 2-(2-(4-Benzhydrylpiperazin-1-yl)ethoxy)ethanol dihydrochloride | AG000UWA | 2g |
| 13073-35-3 | [C@H](CCSCC)(C(=O)O)N | L-Homocysteine, S-ethyl- | AG000UWC | 28g |
| 13073-29-5 | C1=CC=C(C(=C1[N+]([O-])=O)O)C | 2-Methyl-6-nitrophenol | AG000UWD | 119g |
| 13073-28-4 | N#CC1=CC=CC(Br)=C1O | 3-Bromo-2-hydroxybenzonitrile | AG000UWE | 500g |
| 13073-27-3 | N#CC1=CC=CC(Cl)=C1O | 3-Chloro-2-hydroxybenzonitrile | AG000UWF | 15g |
| 13073-26-2 | OC1=C([N+]([O-])=O)C=CC=C1I | 2-Iodo-6-nitrophenol | AG000UWG | 5g |
| 13062-76-5 | OC1=CC=C(CCNC)C=C1.Cl | N-Methyltyramine HCl | AG000UPB | 100g |
| 13061-96-6 | CB(O)O | METHYLBORONIC ACID | AG000UPH | 2000g |
| 13061-28-4 | CC(C1=CC(Cl)=C(Cl)C=C1Cl)=O | 1-(2,4,5-Trichlorophenyl)ethanone | AG000UPK | 17g |
| 130634-09-2 | O=[N+](C1=CC=C(CCCNCCO)C=C1)[O-] | 2-((3-(4-Nitrophenyl)propyl)amino)ethanol | AG000UPN | 5g |
| 130631-49-1 | NC1=NC(Cl)=NN1 | 5-Chloro-1H-1,2,4-triazol-3-amine | AG000UPT | 5g |
| 130628-75-0 | BrCC1=NOC(C)=C1 | 3-(Bromomethyl)-5-methylisoxazole | AG000UPV | 50g |
| 130623-81-3 | CN(C1=C(N)C(Cl)=NC=N1)C | 6-Chloro-N4,N4-dimethylpyrimidine-4,5-diamine | AG000UQ4 | 5g |
| 27313-86-6 | C12=CC(OC)=C(O)C=C1CCN1C2CC2=CC=C(OC)C(OC)=C2C1 | (±)-Corypalmine | AG000UQ6 | 0.2g |
| 13063-60-0 | CCCCCCCCN1CCOCC1 | 4-Octylmorpholine | AG000UQ7 | 0.2g |
| 13063-09-7 | COc1cc(OC)cc(c1C=CC(=O)O)OC | 2-Propenoic acid, 3-(2,4,6-trimethoxyphenyl)- | AG000UQ9 | 15g |
| 13063-04-2 | C[N+]1=CC2=CC(OC)=C(OC)C=C2C3=C1C4=CC5=C(OCO5)C=C4C=C3.[Cl-] | 2,3-Dimethoxy-12-methyl-[1,3]dioxolo[4′,5′:4,5]benzo[1,2-c]phenanthridin-1 | AG000UQA | 0.5g |
| 130645-48-6 | BrC1=NC=CC(=N1)C | 2-Bromo-4-methylpyrimidine | AG000UQH | 12g |
| 130641-38-2 | OC(C(C)(C)OCC1=NN(CC2=CC=CC=C2)C3=CC=CC=C31)=O | Bindarit | AG000UQK | 10g |
| 130636-61-2 | C(=O)(OC(C)(C)C)N1CCN(CC1)CC2=CC=C(C=C2)[N+](=O)[O-] | 4-(4-Nitrobenzyl)piperazine-1-carboxylic acid tert-butyl ester | AG000UQL | 75g |
| 13064-83-0 | C[C@H]1CC[C@@H](CC1)C(O)=O | trans-4-Methylcyclohexanecarboxylic acid | AG000UQW | 2500g |
| 13064-64-7 | Oc1cc(I)c(cc1I)O | 1,4-Benzenediol, 2,5-diiodo- | AG000UQX | 50g |
| 13021-40-4 | [KH].[KH].OC1=C(O)C(=O)C(=O)C(=O)C1=O | Potassium Rhodizonate | AG000U5K | 20g |
| 13021-18-6 | CC(C1=CC=C(C2=CC=C(OC)C=C2)C=C1)=O | 1-(4′-Methoxy-[1,1′-biphenyl]-4-yl)ethanone | AG000U5L | 5g |
| 13021-15-3 | CN(C)c1c(C)cc(C)cc1C | N,N,2,4,6-Pentamethylaniline | AG000U5M | 500g |
| 13021-14-2 | CNC1=C(C)C=C(C)C=C1C | N,2,4,6-Tetramethylaniline | AG000U5N | 5g |
| 130225-27-3 | [cH-]1cccc1.Cc1ccc(cc1)[S@](=O)[c-]1cccc1.[Fe+2] | (R)-Ferrocenyl p-tolyl sulfoxide | AG000U5S | 5g |
| 130224-95-2 | CC(=C)C(=O)OC1COC(=O)C1 | 5-oxooxolan-3-yl 2-methylprop-2-enoate | AG000U5T | 100g |
| 13022-85-0 | [Na+].O=C(C(=O)[O-])CCCC | 2-Ketohexanoic acid sodium salt | AG000U69 | 3g |
| 130232-98-3 | C(C)(C)(C)OC[C@@H]1OC1 | (2R)-2-(tert-Butoxymethyl)oxirane | AG000U6P | 49g |
| 13025-99-5 | N1=CC=C(C=C1)C=NNC(C1=CC=NC=C1)=O | N’-(Pyridin-4-ylmethylene)isonicotinohydrazide | AG000U6T | 2.15g |
| 13024-90-3 | O=C1N(N=C(C1)C)c1ccc(cc1)Cl | 3H-Pyrazol-3-one, 2-(4-chlorophenyl)-2,4-dihydro-5-methyl- | AG000U6X | 6000g |
| 13024-17-4 | CNC1=CC=CC(OC2=CC=CC=C2)=C1 | Methyl-(3-phenoxy-phenyl)-amine | AG000U71 | 8g |
| 13028-71-2 | CCCCCC[N+](CC)(CC)CC.[Br-] | Triethylhexylammonium bromide | AG000U7E | 200g |
| 13028-69-8 | [Br-].CCCC[N+](CC)(CC)CC | (1-Butyl)Triethylammonium Bromide | AG000U7G | 500g |
| 13027-88-8 | C(C(=O)N)(C)(C)O | Propanamide, 2-hydroxy-2-methyl- | AG000U7K | 800g |
| 1306763-31-4 | N#CC1=CC=CC2=C1CC[C@@H]2NC(OC(C)(C)C)=O | (S)-1-(Boc-amino)-2,3-dihydro-1H-indene-4-carbonitrile | AG000USI | 100g |
| 1306763-29-0 | N#CC1=CC=CC2=C1CC[C@H]2N.[H]Cl | (R)-1-Amino-2,3-dihydro-1H-indene-4-carbonitrile hydrochloride | AG000USJ | 0.75g |
| 1306760-87-1 | N#CC1=CC(C2=NC(C3=CC=CC4=C3CC[C@@H]4NCCO)=NO2)=CC=C1OC(C)C | (S)-5-(3-(1-((2-hydroxyethyl)amino)-2,3-dihydro-1h-inden-4-yl)-1,2,4-oxadiaz | AG000USL | 2g |
| 130676-64-1 | O=C1C(CCCCCC)=CC[C@H](CCCCCCCCCCC)O1 | 2H-Pyran-2-one, 3-hexyl-5,6-dihydro-6-undecyl-, (S)- | AG000USQ | 0.025g |
| 1306829-95-7 | CSC1=NC=C2C(NN=C2Br)=N1 | 3-BroMo-6-(Methylthio)-1H-pyrazolo[3,4-d]pyriMidine | AG000UT5 | 25g |
| 13071-60-8 | OCC(OCCCCCCCCCCCCCCCC)COCCCCCCCCCCCCCCCC | 2,3-Bis(hexadecyloxy)propan-1-ol | AG000UU0 | 10g |
| 13070-45-6 | COC1=CC2=C(NC3=C2CCCC3)C=C1 | 6-Methoxy-1,2,3,4-tetrahydrocarbazole | AG000UU4 | 20g |
| 13070-01-4 | S=C1NCCCC1 | Piperidine-2-thione | AG000UUB | 3g |
| 4799-67-1 | OCC(O)COCC1=CC=CC=C1 | 3-(Benzyloxy)propane-1,2-diol | AG000UUC | 465g |
| 1307-96-6 | [Co]=O | Cobalt(II)oxide | AG000UUE | 5200g |
| 1307233-94-8 | O=C(OCC)CCN(C(=O)C=1C=CC2=C(N=C(N2C)CCl)C1)C3=NC=CC=C3 | N-[[2-(Chloromethyl)-1-methyl-1H-benzimidazol-5-yl]carbonyl]-N-2-pyridiny | AG000UUJ | 2g |
| 1307231-02-2 | N[C@@H]1CCC2=C1C=CC=C2Br.[H]Cl | (R)-4-Bromo-2,3-dihydro-1H-inden-1-amine hydrochloride | AG000UUL | 3g |
| 130723-54-5 | IC1=CC=CC(CC#N)=C1 | 3-Iodophenylacetonitrile | AG000UUM | 150g |
| 130723-13-6 | C(F)(F)(F)c1cc(Br)cc(c1)F | 1-Bromo-3-fluoro-5-(trifluoromethyl)benzene | AG000UUO | 225g |
| 130722-95-1 | BrC1=CN=CC(OCC2=CC=CC=C2)=C1 | 3-(Benzyloxy)-5-bromopyridine | AG000UUP | 200g |
| 130722-44-0 | C1(OCC2C=CC=CC=2)C=C(Br)C=C(F)C=1 | 1-(Benzyloxy)-3-bromo-5-fluorobenzene | AG000UUQ | 82.9g |
| 130721-78-7 | N(C(=O)OC(C)(C)C)c1cc(Cl)ccn1 | tert-Butyl (4-chloropyridin-2-yl)carbamate | AG000UUT | 122.8g |
| 1309981-45-0 | CC1(C)C(C)(C)OB(C2=CN=CC(OC3=CC=CC=C3)=C2)O1 | 5-Phenoxy-3-pyridyl boronic acid pinacol ester | AG000VA2 | 10g |
| 131-58-8 | O=C(C1=CC=CC=C1)C2=CC=CC=C2C | Methanone, (2-methylphenyl)phenyl- | AG000VA5 | 131000g |
| 131-27-1 | O=S(C1=C2C=CC=C(S(=O)(O)=O)C2=CC(N)=C1)(O)=O | 3-Aminonaphthalene-1,5-disulfonic acid | AG000VAC | 11000g |
| 131-22-6 | NC1=CC=C(N=NC2=CC=CC=C2)C2=CC=CC=C12 | 4-Phenylazo-1-naphthylamine | AG000VAD | 250g |
| 131-18-0 | O=C(OCCCCC)C1=CC=CC=C1C(OCCCCC)=O | Dipentyl Phthalate | AG000VAF | 125g |
| 131-17-9 | O=C(OCC=C)C1=CC=CC=C1C(OCC=C)=O | Diallyl phthalate | AG000VAG | 179350g |
| 131-16-8 | O=C(OCCC)C1=CC=CC=C1C(OCCC)=O | Dipropyl phthalate | AG000VAH | 200g |
| 131-14-6 | NC1=CC2=C(C=C1)C(=O)C1=C(C=CC(N)=C1)C2=O | 2,6-Diaminoanthraquinone | AG000VAI | 3500g |
| 131-12-4 | COC1=C2C=CC(OC2=C2C(=C1OC)OC=C2)=O | 5,6-Dimethoxy-2H-furo[2,3-h]chromen-2-one | AG000VAJ | 0.5g |
| 131-09-9 | ClC1=CC2=C(C=C1)C(=O)C1=CC=CC=C1C2=O | 2-Chloroanthraquinone | AG000VAM | 7500g |
| 131-08-8 | O=C(C1=C2C=CC=C1)C3=CC=C(S(=O)([O-])=O)C=C3C2=O.[Na+] | Sodium 9,10-dioxo-9,10-dihydroanthracene-2-sulfonate | AG000VAN | 1500g |
| 131-03-3 | [H][C@@]12[C@H](C(OC)=O)[C@H](CC[C@@]1(CN1CCC3=C([C@@]1(C2)[H])N | Rauwolscine | AG000VAP | 0.005g |
| 131-99-7 | C(OP(O)(O)=O)[C@H]1O[C@@H](N2C=NC3C(=O)N=CNC=32)[C@@H](O)C1O | 5′-Inosinate | AG000VB1 | 10g |
| 131-91-9 | N(=O)c1c2c(ccc1O)cccc2 | 1-NITROSO-2-NAPHTHOL | AG000VB2 | 300g |
| 13057-17-5 | COCBr | Bromomethyl methyl ether | AG000UNI | 200g |
| 1305712-21-3 | Cl.FC1(F)C[C@@H]2N(C1)CCNC2 | (S)-7,7-Difluorooctahydropyrrolo[1,2-a]pyrazine dihydrochloride | AG000UNL | 1g |
| 1305711-40-3 | COC(=O)C1=CC2=C(C=C1)N=CO2 | Methyl 1,3-benzoxazole-6-carboxylate | AG000UNN | 25g |
| 13058-73-6 | O=[N+](C1=CC2=C(C=C1)C=CN=C2)[O-] | 7-Nitroisoquinoline | AG000UNX | 4g |
| 13058-24-7 | CC(O[Si](C)(C)C)(C)C | tert-Butoxytrimethylsilane | AG000UO3 | 75g |
| 13058-16-7 | C(C(NC(=O)OCc1ccccc1)C(=O)O)c1c2c([nH]c1)cccc2 | Z-DL-Trp-OH | AG000UO4 | 1500g |
| 13058-04-3 | O=P(O)(O)OP(=O)(O)OCC=C(C)CCC=C(C)CCC=C(C)C | Farnesyl pyrophosphate | AG000UO7 | 0.05g |
| 130597-31-8 | OC(=O)C[C@@H]([C@@H](NC(=O)OCC1c2ccccc2-c2c1cccc2)CC1CCCCC1)O | FMOC-ACHPA | AG000UOC | 2g |
| 130596-62-2 | C[Si]1(C)CCNCC1.[H]Cl | 4,4-dimethyl-1,4-azasilinane hydrochloride | AG000UOD | 45g |
| 13059-63-7 | Cl.Cl.NC(CSSCC(N)C(O)=O)C(O)=O | 2-amino-3-[(2-amino-2-carboxyethyl)disulfanyl]propanoic acid dihydrochlori | AG000UOT | 3000g |
| 13059-60-4 | Cl.NCC(NCC(O)=O)=O | Glycylglycine Hydrochloride Monohydrate | AG000UOU | 50g |
| 13058-77-0 | ClC1=NC=CC2=CC=CN=C12 | 8-Chloro-1,7-naphthyridine | AG000UOW | 1g |
| 1306120-26-2 | OCC1CCCN1C1=NC=C(C=C1Cl)C(F)(F)F | (1-(3-Chloro-5-(trifluoromethyl)pyridin-2-yl)pyrrolidin-2-yl)methanol | AG000UOX | 0.403g |
| 130613-19-3 | ClC1=C2C(=CC(=NC2=CC(=C1)Cl)C(=O)OC)O | Methyl 5,7-dichloro-4-hydroxyquinoline-2-carboxylate | AG000UP2 | 10g |
| 130612-84-9 | FC(C#N)SC1=CC=CC=C1 | Fluoro(phenylthio)acetonitrile | AG000UP5 | 0.1g |
| 13073-25-1 | C1=C([N+]([O-])=O)C(=C(Br)C=C1)O | 2-BROMO-6-NITROPHENOL | AG000UWH | 4000g |
| 130753-13-8 | O=C(N2C3CC(CC2CC3)=O)OCC1=CC=CC=C1 | N-Cbz-Nortropinone | AG000UWL | 100g |
| 130752-32-8 | O=C(O)[C@H](NC(OCC1C2=C(C3=C1C=CC=C3)C=CC=C2)=O)CCCNC(N)=N | Fmoc-D-Arg-OH | AG000UWM | 500g |
| 130747-60-3 | COC=1NC(C=CC1C#N)=O | 2-Methoxy-6-oxo-1,6-dihydropyridine-3-carbonitrile | AG000UWQ | 50g |
| 130745-59-4 | [Si](OC1(CCC(=O)CC1))(C2(=CC=CC=C2))(C3(=CC=CC=C3))C(C)(C)C | 4-[(tert-Butyldiphenylsilyl)oxy]cyclohexan-1-one | AG000UWX | 10g |
| 1307683-81-3 | C1=CC=C(C=C1)CN2CC(C2)N.Cl.Cl | 1-Benzylazetidin-3-amine dihydrochloride | AG000UX7 | 0.75g |
| 130766-91-5 | CC(C1=C([N+]([O-])=O)C=C(C=O)C=C1)C | 4-Isopropyl-3-nitrobenzaldehyde | AG000UXG | 2g |
| 13076-43-2 | NC(=O)c1ccc[n+](c1)Cc1ccccc1.[Br-] | 3-(Aminocarbonyl)-1-(phenylmethyl)pyridinium bromide | AG000UXR | 1g |
| 13076-17-0 | O=C([C@@H](C)O1)O[C@H](C)C1=O | (3R-Cis)-3,6-dimethyl-1,4-dioxane-2,5-dione | AG000UXU | 1500g |
| 1307873-37-5 | N[C@H]1CCC2=C1C=CC=C2Br.[H]Cl | (S)-4-Bromo-2,3-dihydro-1H-inden-1-amine hydrochloride | AG000UXX | 3g |
| 1307859-67-1 | OB(C1=CC=CC(C2=C3C(C4=CC=CC=C4S3)=CC=C2)=C1)O | (3-(Dibenzo[b,d]thiophen-4-yl)phenyl)boronic acid | AG000UXY | 20g |
| 1307837-71-3 | C1=CC(=CC(=C1)O)C2(CCC2)C(=O)O | 1-(3-Hydroxyphenyl)cyclobutanecarboxylic acid | AG000UXZ | 10g |
| 130798-51-5 | O=C(C(N1)=C(CCC(O)=O)C2=C1C=C(Cl)C=C2Cl)O | MDL 29951 | AG000UY3 | 0.04g |
| 130798-48-0 | OC(C1=CC=C2C=CC=CC2=C1)([C@@H]3NCCC3)C4=CC=C5C=CC=CC5=C4 | (R)-Di-2-Naphthylprolinol | AG000UY5 | 2g |
| 13079-20-4 | CC(C)CC(C(=O)N)N | 2-Amino-4-methylpentanamide | AG000UYH | 20g |
| 13085-50-2 | O=P([O-])([O-])OC[C@H]1O[C@@H](N2C=CC(N)=NC2=O)C[C@@H]1O.[Na+].[N | 2′-Deoxycytidine-5′-monophosphate disodium salt | AG000V09 | 15g |
| 13083-96-0 | C[Si](CCCCCC[Si](C)(C)C)(C)C | Silane, 1,6-hexanediylbis[trimethyl- (9CI) | AG000V0H | 20g |
| 1308644-71-4 | O=S(C1=CC=C(C)C=C1)(OCC2(F)COC2)=O | (3-fluorooxetan-3-yl)methyl 4-methylbenzenesulfonate | AG000V0M | 250g |
| 13086-84-5 | O=P(OC(C)(C)C)OC(C)(C)C | Di-tert-butyl Phosphite | AG000V16 | 25g |
| 1308672-74-3 | O=S(CC1=CC=CC(NC2=NC=CC(OC3=CC4=C(NC(C)=C4)C=C3)=N2)=C1)(NCCN(C)C) | N-(2-(diMethylaMino)ethyl)-1-(3-((4-((2-Methyl-1H-indol-5-yl)oxy)pyriMidin | AG000V1D | 0.5g |
| 1308671-90-0 | O=C1N(CC(CC)CCCC)C(C2=CC=C(Br)S2)=C3C1=C(C4=CC=CS4)N(CC(CC)CCCC)C3= | 3-(5-Bromothiophen-2-yl)-2,5-bis(2-ethylhexyl)-6-(thiophen-2-yl)pyrrolo[3,4 | AG000V1E | 5g |
| 1308669-76-2 | CC(=O)C1=C(Br)C=NC=C1F | 1-(3-bromo-5-fluoropyridin-4-yl)ethanone | AG000V1F | 3.3g |
| 1308669-74-0 | Fc1ccc2c(c1)ccc(c2)B1OC(C(O1)(C)C)(C)C | 2-(6-Fluoronaphthalen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane | AG000V1H | 4g |
| 130870-00-7 | CC1=C(Br)C=C(C)C(B(O)O)=C1 | 4-Bromo-2,5-dimethylphenylboronic acid | AG000V1Q | 125g |
| 13087-49-5 | CN1C(=O)NC(=O)C2=C1NC(=O)N2C | 3,7-Dimethyluric acid | AG000V1W | 0.5g |
| 130879-62-8 | O=C1C(Cl)=NC(Cl)=CN1 | 3,5-Dichloropyrazin-2(1H)-one | AG000V23 | 100g |
| 130878-68-1 | CC(C)[C@@H](C(ON4C(CCC4=O)=O)=O)NC(OCC2C1=CC=CC=C1C3=CC=CC=C23)= | Fmoc-Val-OSu | AG000V25 | 1500g |
| 13089-48-0 | O[C@H]1[C@@](N2C(N=C(C=C2)NC(C3=CC=CC=C3)=O)=O)([H])O[C@@H]([C@ | N-Benzoylcytidine | AG000V2B | 500g |
| 13089-11-7 | COC(=O)C(=O)C(F)(F)F | Methyl 3,3,3-trifluoro-2-oxopropanoate | AG000V2G | 325g |
| 1309-33-7 | O[Fe](O)O | Iron hydroxide (Fe(OH)3) | AG000V37 | 17500g |
| 130914-24-8 | ClP(C1CCCC1)C1CCCC1 | Phosphinous chloride, P,P-dicyclopentyl- | AG000V3C | 40g |
| 13092-86-9 | O=C1NCCNC1=O | Piperazine-2,3-dione | AG000V3H | 40g |
| 13091-43-5 | O=C(O)C1=CC(C)=CC(Br)=C1N | 2-Amino-3-bromo-5-methylbenzoic acid | AG000V3P | 1000g |
| 13091-23-1 | C1=NC=CC(=C1[N+]([O-])=O)Cl | 4-Chloro-3-nitropyridine | AG000V3Q | 1000g |
| 130931-83-8 | O=C1N[C@]2([H])C=C[C@@]1([H])C2 | (1S)-(+)-2-Azabicyclo[2.2.1]hept-5-en-3-one | AG000V3X | 500g |
| 130930-49-3 | N[C@H](CC1=CC=CC=C1C(F)(F)F)C(O)=O | (R)-2-Amino-3-(2-(trifluoromethyl)phenyl)propanoic acid | AG000V3Z | 75g |
| 130930-25-5 | O[C@H]1CN(C(OCC2=CC=CC=C2)=O)[C@@H](C(O)=O)C1 | Z-D-Cis-Hyp-OH | AG000V43 | 25g |
| 130927-83-2 | O=C(O)CC1CCN(CC2=CC=CC=C2)CC1 | 2-(1-Benzylpiperidin-4-yl)acetic acid | AG000V46 | 20g |
| 130922-41-7 | C1(F)C(F)=CC=C(SC)C=1 | 3,4-DIFLUOROTHIOANISOLE | AG000V4A | 105g |
| 130922-40-6 | C1=CC(F)=CC(F)=C1SC | 2,4-Difluorothioanisole | AG000V4B | 10g |
| 130922-38-2 | CSC1=C(F)C(F)=CC=C1 | 1,2-difluoro-3-(methylsulfanyl)benzene | AG000V4D | 95g |
| 13093-65-7 | OC(C#N)c1ccc(O)cc1 | DL-4-Hydroxymandelonitrile | AG000V4F | 2g |
| 13093-05-5 | CCNCCCCCCNCC | N，N’-Diethyl-1，6-diaminohexane | AG000V4J | 50g |
| 13093-04-4 | CNCCCCCCNC | N,N’-Dimethyl-1,6-hexanediamine | AG000V4K | 700g |
| 1309371-71-8 | N#CC1=C(Cl)N=C(F)C(F)=C1 | 2-Chloro-5,6-difluoronicotinonitrile | AG000V4N | 0.4g |
| 1309362-77-3 | O[C@@H](C(=O)O)Cc1cccc(c1)C(=O)O | Cerberic acid B | AG000V4P | 0.005g |
| 130931-85-0 | N[C@@H]1C=C[C@@H](C1)C(O)=O.[H]Cl | (1R,4S)-4-Aminocyclopentane-2-encarboxylic acid hydrochloride | AG000V53 | 10g |
| 1310383-43-7 | Cc1c2c(B3OC(C)(C)C(C)(C)O3)cccc2nn1C | 2,3-Dimethyl-2h-indazole-4-boronic acid, pinacol ester | AG000VCW | 1g |
| 1310383-42-6 | CC1=CC2=C(NN=C2)C=C1B(O)O | 5-methyl-1H-indazole-6-boronic acid | AG000VCX | 2g |
| 1310383-25-5 | FC(C1=CC(B(O)O)=CC=C1Br)(F)F | 4-Bromo-3-(trifluoromethyl)phenylboronic acid | AG000VD0 | 8g |
| 1310381-54-4 | O=C(O)CC1COC1 | 2-(Oxetan-3-yl)acetic acid | AG000VD6 | 50g |
| 1310349-62-2 | CC(C1=CC([N+]([O-])=O)=CC(F)=C1F)=O | 1-(2,3-Difluoro-5-nitrophenyl)ethanone | AG000VD8 | 50g |
| 1310327-18-4 | OC(CCOCCOCCOCCNC(OCC1=CC=CC=C1)=O)=O | 5,8,11-Trioxa-2-azatetradecanedioic acid, 1-(phenylmethyl) ester | AG000VD9 | 100g |
| 131036-39-0 | CC1=NC=C(Cl)C=C1Br | 3-BROMO-5-CHLORO-2-METHYLPYRIDINE | AG000VDA | 40g |
| 1310384-35-0 | CC1(C)C(C)(C)OB(C2=CN=C(OC)C(F)=C2)O1 | 3-Fluoro-2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine | AG000VDI | 25g |
| 1310384-34-9 | Cl.OB(C1C=NC=C(C=1)N)O | 5-Aminopyridine-3-boronic acid-hcl | AG000VDJ | 2g |
| 1310384-28-1 | ClC1=CC2=C(C=C1Cl)C=C(B(O)O)N2C(OC(C)(C)C)=O | 1-Boc-5,6-dichloro-1H-indole-2-boronic acid | AG000VDN | 20g |
| 1310384-24-7 | CC1(C)C(C)(C)OB(C2=CCC(O)CC2)O1 | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-enol | AG000VDO | 50g |
| 1310384-23-6 | CC1=C(F)C(C=O)=CC(B(O)O)=C1 | 4-Fluoro-3-formyl-5-methylphenylboronic acid | AG000VDP | 50g |
| 1310384-22-5 | OB(C1=CC(C=O)=CC=C1OCC2=CC=CC=C2)O | 2-Benzyloxy-5-formylphenylboronic acid | AG000VDQ | 50g |
| 1310384-20-3 | CC1(C)C(C)(C)OB(C2=CCC(C#N)CC2)O1 | 4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-enecarbonitrile | AG000VDR | 20g |
| 1310384-19-0 | OB(C1=C(C(F)(F)F)C=CC=C1OC)O | 2-Methoxy-6-(trifluoromethyl)-phenylboronic acid | AG000VDS | 15g |
| 1310384-18-9 | FC1=CC=C(B(O)O)C(F)=C1Cl | 3-Chloro-2,4-difluorophenylboronic acid | AG000VDT | 21g |
| 1310384-07-6 | CC1(C)C(C)(C)OB(C2=CC(F)=NC(C)=C2)O1 | 2-FLUORO-6-METHYLPYRIDINE-4-BORONIC ACID PINACOL ESTER | AG000VDU | 2g |
| 1310384-02-1 | CCC1=NC=CC=C1B(O)O | 2-Ethyl-3-pyridinylboronic acid | AG000VDY | 0.75g |
| 1306605-84-4 | O=C(C1=C2N=CC=CC2=CC(F)=C1)O | 6-Fluoroquinoline-8-carboxylic acid | AG000UR2 | 125g |
| 1306603-98-4 | NC(C1CC1)CO.[H]Cl | 2-Amino-2-cyclopropylethanol hydrochloride | AG000UR4 | 5g |
| 130658-65-0 | OC1CCN(CC1)C1=CC=NC=C1 | 1-(Pyridin-4-yl)piperidin-4-ol | AG000UR8 | 5g |
| 130658-14-9 | CC(C)(C)OC(=O)N1C[C@H]2CCC(=O)[C@H]2C1 | cis-tert-Butyl 4-oxohexahydrocyclopenta[c]pyrrole-2(1H)-carboxylate | AG000UR9 | 1g |
| 130658-13-8 | CC(OC(N1CC2C(CCC2O)C1)=O)(C)C | TERT-BUTYL 6-HYDROXY-HEXAHYDROCYCLOPENTA[C]PYRROLE-2(1H)-CARBOX | AG000URA | 2g |
| 130657-47-5 | O[C@H]1CC[C@@]2([H])CNC[C@]21[H].[H]Cl | (3aS,4S,6aR)-rel-Octahydrocyclopenta[c]pyrrol-4-ol hydrochloride | AG000URB | 22g |
| 130656-51-8 | OCCN(CCNC1=CC(N(C)C(N1C)=O)=O)CCCC2=CC=C([N+]([O-])=O)C=C2.Cl | Nifekalant (hydrochloride) | AG000URC | 0.2g |
| 13066-95-0 | NC1=C(O)C=C(O)C=C1 | 4-Aminobenzene-1,3-Diol | AG000URI | 0.8g |
| 13066-01-8 | COC1=C(OC2=CC=C(N)C=C2)C=CC=C1 | 4-(2-Methoxyphenoxy)aniline | AG000URO | 50g |
| 130674-54-3 | C[C@@H](O)[C@@H](NC(OCC1C2=C(C3=C1C=CC=C3)C=CC=C2)=O)C(O)=O | Fmoc-D-Allo-Thr-OH | AG000URT | 30g |
| 130663-39-7 | C(N1C2=C(CN(C(C(C3=CC=CC=C3)C4=CC=CC=C4)=O)[C@H](C(O)=O)C2)N=C1)C5= | (6S)-1-[[4-(Dimethylamino)-3-methylphenyl]methyl]-5-(2,2-diphenylacetyl)- | AG000US2 | 0.3g |
| 13067-94-2 | [O-][N+](=O)C1=CC=CC2=C1C=CC(Cl)=N2 | 2-Chloro-5-nitroquinoline | AG000US6 | 30g |
| 13067-27-1 | CCC1=NC(CC)=CN=C1 | 2,6-Diethylpyrazine | AG000USC | 0.25g |
| 1306763-57-4 | N#CC1=CC=CC2=C1CC[C@@H]2N.[H]Cl | (S)-1-amino-2,3-dihydro-1H-indene-4-carbonitrile hydrochloride | AG000USF | 10g |
| 1306763-54-1 | O=C(OC)C1=CC(OC(F)(F)F)=CC(C#N)=C1 | Methyl 3-cyano-5-(trifluoromethoxy)benzoate | AG000USG | 25g |
| 1306763-53-0 | O=C(OC)C1=CC(OC(F)(F)F)=CC(Br)=C1 | Methyl 3-bromo-5-(trifluoromethoxy)benzoate | AG000USH | 125g |
| 130931-84-9 | N[C@H]1C=C[C@@H](C(O)=O)C1.[H]Cl | (1S,4R)-4-Aminocyclopent-2-enecarboxylic acid hydrochloride | AG000V54 | 1.25g |
| 13094-51-4 | O=C(OC(CBr)=O)CBr | 2-Bromoacetic anhydride | AG000V55 | 50g |
| 1309460-27-2 | C(O)(=O)CCOCCOCCOCCOCCNC(C1=CC=C(C=O)C=C1)=O | Propanoic acid, 3-[[13-(4-formylphenyl)-13-oxo-3,6,9-trioxa-12-azatridec-1-yl | AG000V5D | 1g |
| 130953-14-9 | COc1ccc(cc1)C(=O)Oc1ccc(cc1)OCCCCCCOC(=O)C=C | 4-((6-(Acryloyloxy)hexyl)oxy)phenyl 4-methoxybenzoate | AG000V5I | 50g |
| 130952-46-4 | [O-]C(=O)C=Cc1ccc(cc1)Cn1ccnc1.[Na+] | 2-Propenoic acid, 3-[4-(1H-imidazol-1-ylmethyl)phenyl]-, sodium salt (1:1) | AG000V5J | 0.5g |
| 13095-73-3 | OC(CCCS)=O | 4-Sulfanylbutanoic acid | AG000V5R | 125g |
| 13095-67-5 | [O-]C(=O)CC(=O)[O-].[K+].[K+] | Propanedioic acid, potassium salt (1:2) | AG000V5S | 200g |
| 13095-48-2 | C(CC(=O)O)[C@@H](C(=O)O)O | L-2-Hydroxyglutaric acid | AG000V5U | 0.04g |
| 13095-41-5 | [O-]P(=O)(Oc1ccc2c(c1)cccc2)[O-] | 2-Naphthalenol, 2-(dihydrogen phosphate) | AG000V5V | 50g |
| 1309598-72-8 | C[C@@H](N)C1=C(F)C=CC=C1F.[H]Cl | (R)-1-(2,6-Difluorophenyl)ethanamine HCl | AG000V60 | 50g |
| 1309598-68-2 | C[C@H](N)C1=C(F)C=CC=C1F.[H]Cl | (S)-1-(2,6-Difluorophenyl)ethanamine hydrochloride | AG000V61 | 10g |
| 1309598-55-7 | C[C@@H](N)C1=CC=C(OC)C=C1F.[H]Cl | (R)-1-(2-Fluoro-4-methoxyphenyl)ethanamine hydrochloride | AG000V62 | 2g |
| 1309581-43-8 | C(=O)(OC(C)(C)C)N1CC(CC1)N(=O)=O | TERT-BUTYL 3-NITROPYRROLIDINE-1-CARBOXYLATE | AG000V68 | 125g |
| 13096-98-5 | COc1cc2cn[nH]c2cc1Cl | 6-Chloro-5-methoxy-1h-indazole | AG000V6A | 25g |
| 13096-96-3 | C1=N[NH]C2=CC=CC(=C12)Cl | 4-Chloro-1H-indazole | AG000V6B | 200g |
| 13096-62-3 | O=C(O5)[C@@H]([C@H]([C@@H]([C@H]5COCC4=CC=CC=C4)OCC3=CC=CC=C3) | 2,3,4,6-Tetra-O-benzyl-D-glucono-1,5-lactone | AG000V6E | 200g |
| 13096-31-6 | O=C(C1NCC(O)CC1)O | 5-Hydroxypiperidine-2-carboxylic acid | AG000V6H | 35g |
| 130995-12-9 | C[Si](C)(C)C#CC1=CC=C(C=C1)F | (4-Fluorophenylethynyl)Trimethylsilane | AG000V8H | 25g |
| 13099-95-1 | O=C(C1OC2=CC=CC=C2C1=O)OCC | 2-Ethoxycarbonyl-3-coumaranone | AG000V8M | 10g |
| 13099-73-5 | CC1(C(=O)C2=C(C=CC(=C2)Cl)C1)C | 6-Chloro-2,2-dimethyl-2,3-dihydro-1H-inden-1-one | AG000V8N | 0.5g |
| 1309981-28-9 | CC1(C)C(C)(C)OB(C2=CN=C(N3C=CC=C3)C=C2)O1 | 2-(1H-Pyrrol-1-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine | AG000V91 | 3g |
| 1309981-00-7 | COC1=C(C(=C(C=C1)Br)Cl)B(O)O | 3-Bromo-2-chloro-6-methoxyphenylboronic acid | AG000V95 | 9g |
| 1309980-99-1 | OB(c1c(Br)ccc(c1F)O)O | 6-Bromo-2-fluoro-3-hydroxyphenylboronic acid | AG000V96 | 10g |
| 1309980-95-7 | FC1=C(F)C(B(O)O)=C(OCC)C=C1 | 2,3-Difluoro-6-ethoxyphenylboronic acid | AG000V97 | 2g |
| 1309980-91-3 | COC1=C(B(O)O)C(F)=C(Br)C=C1 | 3-Bromo-2-fluoro-6-methoxyphenylboronic acid | AG000V98 | 40g |
| 1309980-72-0 | OB(c1cnc(nc1OCc1ccccc1)N1CCCCC1)O | (4-(Benzyloxy)-2-(piperidin-1-yl)pyrimidin-5-yl)boronic acid | AG000V9A | 10g |
| 1309980-11-7 | CC(O)(C1=CC=CC(B2OC(C)(C)C(C)(C)O2)=C1)C | 3-(2-Hydroxypropan-2-yl)phenylboronic acid pinacol ester | AG000V9B | 10g |
| 1309976-14-4 | NC1=CC2=C(CCCN2)C=C1.[H]Cl.[H]Cl | 1,2,3,4-Tetrahydroquinolin-7-amine hydrochloride | AG000V9E | 10g |
| 1309982-61-3 | CCOC1=C(B(O)O)C(C)=CC=N1 | 2-Ethoxy-4-Methylpyridine-3-Boronic Acid | AG000V9K | 1.25g |
| 1309982-38-4 | O=C(OC(C)(C)C)C1=CN=CC(B2OC(C)(C)C(C)(C)O2)=C1 | tert-Butyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)nicotinate | AG000V9N | 1.75g |
| 1309982-33-9 | ClC1=CN=C(B(O)O)C(Cl)=C1 | (3,5-Dichloropyridin-2-yl)boronic acid | AG000V9R | 0.5g |
| 1309982-17-9 | NC1=C(B2OC(C)(C)C(C)(C)O2)C=CC=C1Cl | 2-CHLORO-6-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)ANILINE | AG000V9Y | 50g |
| 1309982-16-8 | NC1=CC(F)=CC=C1B2OC(C)(C)C(C)(C)O2 | Benzenamine, 5-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)- | AG000V9Z | 7g |
| 1309982-15-7 | NC1=CC=C(B(O)O)C=N1.[H]Cl | (6-Aminopyridin-3-Yl)Boronic Acid Hydrochloride | AG000VA0 | 125g |
| 1310405-36-7 | OB(C1=C(C)C2=C(N(C)N=C2)C=C1)O | 1,4-Dimethyl-1h-indazole-5-boronic acid | AG000VFO | 25g |
| 1310405-35-6 | CC1=CC2=C(C=C1B(O)O)C=NN2 | 6-Methyl-1H-indazolyl-5-boronic acid | AG000VFP | 20g |
| 1310405-33-4 | CC1(C)C(C)(C)OB(C2=CC3=C(C)N(C)N=C3C=C2)O1 | 2，3-Dimethyl-5-(4，4，5，5-tetramethyl-1，3，2-dioxaborolan-2-yl)-2H-i | AG000VFQ | 2g |
| 1310405-07-2 | CC(C)(C)OC(=O)NC1=CC(=CN=C1F)B1OC(C)(C)C(C)(C)O1 | 3-tert-butyloxycarbonylamino-2-fluoropyridine-5-boronic acid pinacol ester | AG000VFT | 5g |
| 1310405-06-1 | FC(C1=C(B2OC(C)(C)C(C)(C)O2)C=NC=C1)(F)F | 4-(Trifluoromethyl)pyridine-3-boronic acid pinacol ester | AG000VFU | 40g |
| 1310405-04-9 | CC1(C)OB(OC1(C)C)C1=CC=CC(=O)N1 | 6-Hydroxypyridine-2-boronic acid pinacol ester | AG000VFW | 30g |
| 1310405-00-5 | CCOc1ccc(cc1B(O)O)OC(F)(F)F | (2-Ethoxy-5-(trifluoromethoxy)phenyl)boronic acid | AG000VFZ | 3g |
| 131042-78-9 | [Cl-].C1C2CC3CC1CC(C2)(C3)N1C=C[N+](=C1)C12CC3CC(CC(C3)C1)C2 | 1,3-Di(adamantan-1-yl)-1H-imidazol-3-ium chloride | AG000VG7 | 2g |
| 131060-14-5 | CCN(C/C=C/C#CC(C)(C)C)CC1=CC=CC(OCC2=CC(C3=CSC=C3)=CS2)=C1 | NB-598 | AG000VGJ | 0.3g |
| 13106-85-9 | COC1=CC(OC)=NC(OC)=N1 | 2,4,6-Trimethoxypyrimidine | AG000VGQ | 20g |
| 13106-76-8 | [NH4+].[NH4+].O=[Mo-2](=O)(=O)=O | Ammonium molybdate | AG000VGR | 150g |
| 13106-53-1 | [Cl-].CCCCCCCCCCCCCCCC[n+]1ccc(C)cc1 | 1-Hexadecyl-4-methylpyridinium Chloride Hydrate | AG000VGT | 35g |
| 13106-24-6 | COS([O-])(=O)=O.CCCC[N+](C)(CCCC)CCCC | 1-Butanaminium, N,N-dibutyl-N-methyl-, methyl sulfate (1:1) | AG000VGV | 5g |
| 1310726-59-0 | CC[C@H]1CN(C[C@H]1C1=CN=C2C=NC3=C(C=CN3)N12)C(=O)NCC(F)(F)F | (3R,4S)-3-Ethyl-4-(3H-imidazo[1,2-a]pyrrolo[2,3-e]pyrazin-8-yl)-N-(2,2,2-triflu | AG000VGZ | 0.15g |
| 1310705-15-7 | CN1N=C(Br)C2=C1C=CC(OC)=C2 | 3-Bromo-5-methoxy-1-methyl-1H-indazole | AG000VH0 | 2g |
| 1310693-92-5 | O=C(NO)C1=CC=C(CN2C3=C(CN(C)CC3)C4=C2C=CC=C4)C=C1.[H]Cl | Tubastatin A hydrochloride | AG000VH3 | 0.5g |
| 1310680-37-5 | O=C(OCC1c2ccccc2-c2c1cccc2)NCC(c1cccc2c1cccc2)C(=O)O | (R,S)-Fmoc-3-amino-2-(naphthalen-1-yl)-propionic acid | AG000VH4 | 1g |
| 1310680-10-4 | BrC1=CN2N=CN=C2C(Br)=C1 | 6,8-Dibromo-[1,2,4]triazolo[1,5-a]pyridine | AG000VH5 | 18.8g |
| 13107-39-6 | CC1=CC=C(C2OC2)C=C1 | 2-(4-Methylphenyl)oxirane | AG000VHJ | 3g |
| 1305317-30-9 | NC1=C([N+]([O-])=O)N=CC=C1Br | 4-Bromo-2-nitropyridin-3-amine | AG000ULB | 2g |
| 1305322-97-7 | OC1=CC(Br)=CC(Cl)=C1F | 5-Bromo-3-chloro-2-fluorophenol | AG000ULN | 75g |
| 130536-69-5 | ICCOCCO | Ethanol, 2-(2-iodoethoxy)- | AG000ULS | 125g |
| 13054-02-9 | O=C(O)C1=CN=C(I)C=C1 | 6-Iodonicotinic Acid | AG000UM5 | 300g |
| 130562-97-9 | CCOC(=O)C1=CC(Cl)=C(Cl)S1 | Ethyl 4,5-dichlorothiophene-2-carboxylate | AG000UM6 | 0.75g |
| 130551-92-7 | OCC1=NC=CO1 | 2-Oxazolemethanol | AG000UME | 125g |
| 13055-63-5 | CC1=C(C=C(C=C1)C(F)(F)F)C(O)=O | 2-Methyl-5-(trifluoromethyl)benzoic acid | AG000UMS | 50g |
| 13055-62-4 | C1(C(F)(F)F)=CC=C(C)C(I)=C1 | 2-Iodo-1-methyl-4-(trifluoromethyl)benzene | AG000UMT | 2.2g |
| 13055-06-6 | OC(=O)CN(CC(O)=O)C1C(=O)NC(=O)NC1=O | 2,2′-((2,4,6-Trioxohexahydropyrimidin-5-yl)azanediyl)diacetic acid | AG000UMU | 2g |
| 130566-58-4 | N1(CCCCC1)CCOC1=CC=C(C(=O)C2=C(C(=O)O)C=CC=C2)C=C1 | 2-[4-[2-(1-Piperidinyl)ethoxy]benzoyl]benzoic acid | AG000UN7 | 2g |
| 13057-72-2 | O=C1C(C2=CC=CC=C2)=COC3=C1C=CC(O)=C3 | 7-Hydroxy-3-phenyl-4H-chromen-4-one | AG000UNE | 20g |
| 13057-65-3 | COC1=C(OCC(C(=O)O)O)C=CC=C1 | 3-(2-Methoxyphenoxy) lactic Acid | AG000UNF | 0.2g |
| 13107-13-6 | C[Si](C=C)(C1=CC=CC=C1)C1=CC=CC=C1 | Methyldiphenyl(vinyl)silane | AG000VHK | 15g |
| 1310746-10-1 | O=C(NC=1C(Cl)=C(OC)C=C(OC)C1Cl)N(C=2N=CN=C(C2)NC3=CC=C(C=C3)N4CCN( | NVP BGJ398 phosphate | AG000VHN | 0.05g |
| 1310734-08-7 | ClS(N1CC(C#N)C1)(=O)=O | 3-CYANO-1-AZETIDINESULFONYLCHLORIDE | AG000VHO | 25g |
| 1310732-23-0 | CNC1(COC1)C | N,3-Dimethyloxetan-3-amine | AG000VHP | 10g |
| 1310732-18-3 | CC(OC(N1CC(S(Cl)(=O)=O)C1)=O)(C)C | Tert-butyl 3-(chlorosulfonyl)azetidine-1-carboxylate | AG000VHQ | 20g |
| 1310729-91-9 | FC1(F)CC(Br)C1 | 3-BROMO-1,1-DIFLUORO-CYCLOBUTANE | AG000VHR | 25g |
| 131076-14-7 | Cl.Cl.COC1=CC(N)=C(N)C=C1OC | 4,5-Dimethoxybenzene-1,2-diamine | AG000VI0 | 50g |
| 131074-55-0 | C[C@H](N=C=S)c1cccc2ccccc12 | Naphthalene, 1-[(1S)-1-isothiocyanatoethyl]- | AG000VI2 | 0.2g |
| 13108-52-6 | O=S(C1=C(Cl)C(Cl)=NC(Cl)=C1Cl)(C)=O | 2,3,5,6-Tetrachloro-4-(methylsulfonyl)pyridine | AG000VI8 | 250g |
| 13108-19-5 | O=C(O)CCCCCCCCCN | 10-Aminodecanoic Acid | AG000VIA | 32.8g |
| 1310923-37-5 | CC[C@@H](C1=CC=C(Cl)C=C1)N.[H]Cl | (S)-1-(4-Chlorophenyl)propan-1-amine hydrochloride | AG000VIC | 15g |
| 1310923-31-9 | CC[C@@H](C1=CC=CC(F)=C1)N.[H]Cl | (S)-1-(3-Fluorophenyl)propan-1-amine hydrochloride | AG000VID | 0.25g |
| 1310923-28-4 | CC[C@@H](C1=CC=CC=C1F)N.[H]Cl | (S)-1-(2-Fluorophenyl)propan-1-amine hydrochloride | AG000VIE | 2g |
| 1310918-28-5 | N#CC1=CC(F)=C([N+]([O-])=O)C(Br)=C1 | 3-Bromo-5-fluoro-4-nitrobenzonitrile | AG000VIF | 9g |
| 131088-02-3 | O=CC1=CC(Cl)=C(O)C=C1O | 5-Chloro-2,4-dihydroxybenzaldehyde | AG000VIK | 200g |
| 131084-55-4 | ClC1=NC=C2C(=C1)C=C[NH]2 | 5-Chloro-1H-Pyrrolo[2,3-C]Pyridine | AG000VIR | 200g |
| 1311197-81-5 | BrC1=CC=C(C=C1Cl)N1CCCCC1 | 1-(4-Bromo-3-chlorophenyl)piperidine | AG000VJ1 | 5g |
| 1311159-02-0 | OB(C1=CC=CC=C1OC2CCCC2)O | 2-(Cyclopentyloxy)phenylboronic acid | AG000VJ6 | 3g |
| 131110-76-4 | O=C(OC)[C@H](NCC1=CC=CC=C1)CO | N-Benzyl-D-serine methyl ester | AG000VJM | 20g |
| 131-70-4 | O=C(O)C1=CC=CC=C1C(OCCCC)=O | 2-(Butoxycarbonyl)benzoic acid | AG000VB9 | 200g |
| 131-62-4 | O=C1OI(O)C2=CC=CC=C12 | 1-Hydroxy-3-oxo-1,3-dihydro-1,2-benzoiodoxole | AG000VBD | 146g |
| 131002-10-3 | O=C1NC=CC2=C1C=CC(C)=C2 | 6-Methylisoquinolin-1(2H)-one | AG000VBI | 30g |
| 131002-09-0 | O=C1NC=CC2=C1C=CC(Cl)=C2 | 6-Chloroisoquinolin-1-ol | AG000VBJ | 13.65g |
| 131002-01-2 | O=C(N)C1=CC=C(Cl)C=C1Br | 2-Bromo-4-chlorobenzamide | AG000VBM | 125g |
| 131001-86-0 | BrC1=C(C(=O)OC)C=CC=C1C | Methyl 2-Bromo-3-methylbenzoate | AG000VBO | 785g |
| 13101-92-3 | COC1=CC=C2C=CC=CC2=C1Cl | 1-Chloro-2-methoxynaphthalene | AG000VBR | 1.75g |
| 13101-83-2 | OC1=CC=C2C=C(F)C=CC2=C1 | 6-Fluoronaphthalen-2-ol | AG000VBT | 10g |
| 13101-54-7 | O([C@@H]1[C@H](O)[C@@H](O)[C@H](O[C@@H]2[C@H](O)[C@@H](O)[C@ | Erlose | AG000VBU | 0.45g |
| 13101-40-1 | BrC1=CC(=CC(=C1)I)Cl | 1-Bromo-3-chloro-5-iodobenzene | AG000VBW | 709.04g |
| 13100-82-8 | NC(C(O)=O)CS(O)(=O)=O | Dl-cysteic acid | AG000VC0 | 25g |
| 13100-46-4 | OC[C@@H]1[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC( | 1,2,3,4-Tetra-o-acetyl-beta-d-glucopyranose | AG000VC2 | 250g |
| 131023-37-5 | ClC1=CC2=C(C=C1)C3=C(C=C(Cl)C=C3C(CCl)=O)C2 | 2-Chloro-1-(2,7-dichloro-9H-fluoren-4-yl)ethanone | AG000VC5 | 10g |
| 131020-57-0 | Cl.[NH]1C2=C(N=C1)CC(CC2)C(=O)O | 4,5,6,7-Tetrahydro-1H-benzo[d]imidazole-5-carboxylic acid hydrochloride | AG000VCA | 50g |
| 131020-36-5 | O=C(C1=CC=C2N(C)C=NC2=C1)OC | Methyl 1-methylbenzimidazole-5-carboxylate | AG000VCG | 40g |
| 131019-87-9 | NC1=CC=C(C)C=C1NC | N1,5-Dimethylbenzene-1,2-diamine | AG000VCH | 25g |
| 1313593-59-7 | C[C@H](N)C1=CC=CC(Cl)=C1F.Cl | (S)-1-(3-Chloro-2-fluorophenyl)ethanamine hydrochloride | AG000VZO | 7g |
| 1313584-92-7 | OC[C@@H]1CNCCO1.[H]Cl | (S)-2-Hydroxymethylmorpholine, HCl | AG000VZP | 125g |
| 1313519-78-6 | CC1(C)C(C)(C)OB(C2=CC=CN=C2C3=CC=CC=C3)O1 | 2-phenyl-3-(tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine | AG000VZR | 30g |
| 131356-53-1 | BrC(=Cc1ccc(cc1)C(F)(F)F)Br | 1-(2,2-Dibromoethenyl)-4-(trifluoromethyl)-benzene | AG000W02 | 2g |
| 1313712-29-6 | O=C(C1=C(Br)N2C=CC=C(C)C2=N1)O | 3-Bromo-8-methyl-imidazo[1,2-a]pyridine-2-carboxylic acid | AG000W09 | 5g |
| 1313712-23-0 | O=C(N1CCCC2=C1SC(N)=N2)OC(C)(C)C | 2-Amino-6,7-dihydro-5H-thiazolo[5,4-b]pyridine-4-carboxylic acid tert-butyl | AG000W0C | 0.3g |
| 1313710-31-4 | C[C@H]1N(C(=O)OC(C)(C)C)C(=O)CC1=O | (R)-2-Methyl-3,5-dioxo-pyrrolidine-1-carboxylic acid tert-butyl ester | AG000W0M | 49g |
| 13137-64-9 | O=C1OCC([C@H]2CC[C@]3(O)[C@]4([H])CC[C@]5(O)C[C@@H](O[C@H]6C[C@ | Periplocin | AG000W0U | 2g |
| 13137-43-4 | OC(C(CCCCBr)Br)=O | 2,6-Dibromohexanoic acid | AG000W0W | 2g |
| 1313738-80-5 | CC1(C)OB(OC1(C)C)C1=CCCN(CC2=CC=CC=C2)C1 | 1-Benzyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,3,6-tetrahydrop | AG000W0X | 5g |
| 1313738-72-5 | Fc1ccccc1Cn1nc(I)c2cccnc21 | 1-(2-Fluorobenzyl)-3-iodo-1H-pyrazolo[3,4-b]pyridine | AG000W0Z | 10g |
| 1313738-71-4 | Nc1ccnn2cccc12 | PYRROLO[1,2-B]PYRIDAZIN-4-YLAMINE | AG000W10 | 1g |
| 1313738-70-3 | N#CC1=NN=C(F)C=C1 | 6-Fluoropyridazine-3-carbonitrile | AG000W11 | 1g |
| 1313738-69-0 | CC1(C)OB(C2=CC(F)=C(N3CCOCC3)C(F)=C2)OC1(C)C | 3，5-Difluoro-4-morpholinophenylboronic Acid Pinacol Ester | AG000W12 | 2g |
| 1313738-67-8 | CC(C)OC(=O)c1ncc(Br)cc1N | 3-Amino-5-bromo-pyridine-2-carboxylic acid isopropyl ester | AG000W13 | 0.5g |
| 1313738-64-5 | Cn1c2c(cccc2cn1)B1OC(C(O1)(C)C)(C)C | 1-Methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole | AG000W16 | 10g |
| 1313738-62-3 | O=C(OC)CC1CNC1.O=C(O)C(F)(F)F | Methyl 2-(azetidin-3-yl)acetate 2,2,2-trifluoroacetate | AG000W18 | 100g |
| 1313726-12-3 | ClC1=CC=C2C(SC=N2)=N1 | 5-Chlorothiazolo[5,4-b]pyridine | AG000W1D | 25g |
| 1313726-01-0 | O=C(C(S1)=CC2=C1C=NN2)O | 1H-Thieno[3,2-c]pyrazole-5-carboxylic acid | AG000W1E | 5g |
| 131184-73-1 | OCC1=CN=C(N)S1 | (2-Amino-1,3-thiazol-5-yl)methanol | AG000VO3 | 25g |
| 131182-68-8 | [Si](OC)(C1(=CC=C([Si](OC)(C)C)C=C1))(C)C | methoxy[4-(methoxydimethylsilyl)phenyl]dimethylsilane | AG000VO7 | 25g |
| 131180-63-7 | CC1=CC(C(O)(C2=CC(C)=CC(C)=C2)[C@H]3NCCC3)=CC(C)=C1 | (S)-Alpha,alpha-bis(3,5-dimethylphenyl)-2-pyrrolidinemethanol | AG000VO9 | 5g |
| 131180-57-9 | OC(C1=CC=C(C=C1)OC)([C@H]2NCCC2)C3=CC=C(C=C3)OC | (S)-Bis(4-Methoxyphenyl)(Pyrrolidin-2-Yl)Methanol | AG000VOA | 10g |
| 131180-52-4 | OC(C1=CC=C(C)C=C1)(C2=CC=C(C)C=C2)[C@H]3NCCC3 | (S)-Pyrrolidin-2-yldi-p-tolylmethanol | AG000VOB | 2g |
| 13118-91-7 | COC1=CC=C(C=C1)OC2=CC(=CC=C2)OC3=CC=C(C=C3)OC | 1,3-Bis(4-methoxyphenoxy)benzene | AG000VOF | 20g |
| 1311933-84-2 | C=CCCCCC[C@@](C)(NC(OCC1C2=C(C3=C1C=CC=C3)C=CC=C2)=O)C(O)=O | (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-methylnon-8-enoic aci | AG000VOJ | 2g |
| 1311933-83-1 | C=CCCCCC[C@](C)(NC(OCC1C2=C(C3=C1C=CC=C3)C=CC=C2)=O)C(O)=O | (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-methylnon-8-enoic aci | AG000VOK | 5g |
| 1311933-82-0 | C=CCC[C@@](C)(NC(OCC1C2=C(C3=C1C=CC=C3)C=CC=C2)=O)C(O)=O | (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-methylhex-5-enoic aci | AG000VOL | 5g |
| 131190-82-4 | CC1=NC2=C(C=C1)C(F)=C(F)C=C2Br | 8-Bromo-5,6-difluoro-2-methylquinoline | AG000VOU | 75g |
| 1311992-98-9 | C=CCCC(CCC=C)(NC(OCC1C2=C(C3=C1C=CC=C3)C=CC=C2)=O)C(O)=O | 2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-(but-3-en-1-yl)hex-5-enoi | AG000VP8 | 2g |
| 1311992-97-8 | C=CCC(CC=C)(NC(OCC1C2=C(C3=C1C=CC=C3)C=CC=C2)=O)C(O)=O | 2-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-2-allylpent-4-enoic acid | AG000VP9 | 15g |
| 13120-77-9 | C1=C(C=CC(=C1OC)C)[N+](=O)[O-] | 2-Methyl-5-nitroanisole | AG000VPJ | 2500g |
| 1312095-44-5 | NCC1=NC(SC)=NC=C1 | (2-(Methylthio)pyrimidin-4-yl)methanamine | AG000VPV | 0.3g |
| 1312008-67-5 | N#CC1=CC2=C(NN=C2)C=C1Cl | 6-chloro-1H-indazole-5-carbonitrile | AG000VPY | 2g |
| 1312201-00-5 | FC1=CC=C(C=C1)CN1C(SC(C1=O)=C/C1=CC=C(OCC2=CC=C(C=C2)B(O)O)C=C1)=O | HA155 | AG000VQJ | 0.2g |
| 1312118-15-2 | CCCCCCCCC(N1N=C(C(Br)=CC=C2Br)C2=N1)CCCCCCCC | 4,7-Dibromo-2-(heptadecan-9-yl)-2H-benzo[d][1,2,3]triazole | AG000VQO | 10g |
| 131215-92-4 | OCCCCCCCCCS | 9-Mercapto-1-nonanol | AG000VQX | 15g |
| 1310383-98-2 | OB(C1=CC2=C(C=C1C)C=NN2C)O | 1,5-Dimethyl-1H-indazole-6-boronic acid | AG000VE2 | 25g |
| 1310383-91-5 | FC(F)(F)OC1=CC=C(B(O)O)C=C1C=O | 3-Formyl-4-(trifluoromethoxy)phenylboronic acid | AG000VE3 | 5g |
| 1310383-57-3 | CC1=C(B2OC(C)(C)C(C)(C)O2)C=CN=C1F | 2-Fluoro-3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine | AG000VE5 | 3g |
| 1310383-56-2 | FC=1C(=NC=CC1B(O)O)C | (3-Fluoro-2-methylpyridin-4-yl)boronic acid | AG000VE6 | 2g |
| 1310404-04-6 | CC1(C)OB(OC1(C)C)C1=CC=C(Br)N=C1F | 6-Bromo-2-fluoropyridine-3-boronic acid pinacol ester | AG000VE7 | 0.8g |
| 1310404-00-2 | CC(C)(C)OC(=O)N1CCN(CCOC2=CC=C(C=C2)B2OC(C)(C)C(C)(C)O2)CC1 | tert-Butyl 4-(2-[4-(4,4,5,5-tetramethyl[1,3,2]dioxaborolan-2-yl)phenoxy]ethy | AG000VE9 | 0.75g |
| 1310403-98-5 | FC1=C(OCC)C(B(O)O)=C(Br)C=C1 | 6-Bromo-2-ethoxy-3-fluorophenylboronic acid | AG000VEA | 3g |
| 1310403-94-1 | FC1=C(B(O)O)C(F)=CC(OCC)=C1 | 2,6-Difluoro-4-ethoxyphenylboronic acid | AG000VEB | 20g |
| 1310384-85-0 | CC1=CN(C2=CC=CC(B(O)O)=N2)N=C1 | (6-(4-Methyl-1H-pyrazol-1-yl)pyridin-2-yl)boronic acid | AG000VEP | 1.25g |
| 1310384-43-0 | CC1(C)OB(OC1(C)C)C1=C(CO)C=CS1 | (2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-3-yl)methanol | AG000VES | 10g |
| 13104-56-8 | COC1=CC=C(C2=CC(C3=NC=CC=C3)=NC(C4=NC=CC=C4)=C2)C=C1 | 4′-(4-Methoxyphenyl)-2，2′:6’，2”-terpyridine | AG000VEU | 225g |
| 1310404-57-9 | O=Cc1cc(cnc1OC)B1OC(C(O1)(C)C)(C)C | 2-Methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)nicotinaldehyde | AG000VEX | 5g |
| 1310404-48-8 | CC1=NN(C)C2=C1C=C(B(O)O)C=C2 | 1,3-Dimethyl-1h-indazole-5-boronic acid | AG000VF4 | 10g |
| 1310404-47-7 | CC1=NNC2=C1C=CC=C2B(O)O | (3-Methyl-1H-indazol-7-yl)boronic acid | AG000VF5 | 5g |
| 1310404-31-9 | CC1(C(C)(C)OB(C2C(Br)=CSC=2)O1)C | 4-Bromothiophene-3-boronic acid pinacol ester | AG000VF6 | 50g |
| 1310404-23-9 | CC1=NC=C(F)C(B(O)O)=C1 | (5-Fluoro-2-methylpyridin-4-YL)boronic acid | AG000VF7 | 125g |
| 1310411-24-5 | OC[C@H]1N(C)CC1 | (S)-(1-Methylazetidin-2-Yl)Methanol | AG000VFM | 20g |
| 1310405-37-8 | CC1=NN(C)C2=C1C=CC(B(O)O)=C2 | 1,3-DIMETHYL-1H-INDAZOLE-6-BORONIC ACID | AG000VFN | 2g |
| 130800-90-7 | ClC1=CC(Cl)=C(C(C2=C(N)N=C(N3CCN(CC3)C)N=C2)=C1)Cl | 2-(4-Methylpiperazin-1-yl)-5-(2,3,5-trichlorophenyl)pyrimidin-4-amine | AG000UYO | 0.005g |
| 13080-96-1 | CCC(=O)OC(=O)C | Acetic Propionic Anhydride | AG000UYU | 25g |
| 13080-90-5 | OC1C2CC(C1)C=C2 | Bicyclo[2.2.1]hept-5-en-2-ol | AG000UYV | 200g |
| 13080-89-2 | Nc1ccc(cc1)Oc1ccc(cc1)S(=O)(=O)c1ccc(cc1)Oc1ccc(cc1)N | Bis[4-(4-Aminophenoxy)Phenyl]Sulfone | AG000UYW | 200g |
| 13080-85-8 | NC1=CC=C(OC2=CC=C(C3=CC=C(OC4=CC=C(N)C=C4)C=C3)C=C2)C=C1 | 4,4′-Bis(4-aminophenoxy)biphenyl | AG000UYX | 200g |
| 13080-65-4 | CC(NCC1OC1)(C)C | 2-METHYL-N-((OXIRAN-2-YL)METHYL)PROPAN-2-AMINE | AG000UYZ | 3g |
| 13080-21-2 | S=C1NC2=C(C=CC=C2)N=C1NN | 3-Hydrazinylquinoxaline-2(1H)-thione | AG000UZ1 | 1.25g |
| 1308298-23-8 | FC(C1=NC=C(B(O)O)C=N1)(F)F | (2-(Trifluoromethyl)pyrimidin-5-yl)boronic acid | AG000UZ8 | 75g |
| 1308256-94-1 | CCOC(=O)[C@H](C)N[C@@H](CC1=CC=C(C=C1)C1=CC(Cl)=CC=C1)C(O)=O | (S)-3-(3′-Chloro-[1,1′-biphenyl]-4-yl)-2-(((S)-1-ethoxy-1-oxopropan-2-yl)amin | AG000UZ9 | 0.05g |
| 130825-13-7 | IC1=CC(Cl)=NN=C1Cl | 3,6-Dichloro-4-iodopyridazine | AG000UZE | 15g |
| 1308384-31-7 | C(=O)(OC(C)(C)C)N1CCCC(CN)(O)C1 | 1-Boc-3-aMinoMethyl-3-hydroxypiperidine | AG000UZY | 30g |
| 1308319-51-8 | O=C(OCC)CCCC1=CC=C(C#N)C=C1N | 4-(2-Amino-4-cyano-phenyl)-butyric acid ethyl ester | AG000UZZ | 5g |
| 130837-92-2 | O=C1OC[C@@H]([C@H]1C(=O)c1ccc2c(c1)OCO2)Cc1ccc2c(c1)OCO2 | 7-Oxohinokinin | AG000V03 | 0.005g |
| 130837-47-7 | CC(OC1=C(Cl)C(=O)C1=O)C | 3-Chloro-4-isopropoxycyclobutene-1,2-dione | AG000V05 | 2g |
| 1312535-78-6 | CC(=O)C1=CC=NC(Cl)=N1 | 1-(2-Chloropyrimidin-4-yl)ethanone | AG000VSO | 30g |
| 1312535-76-4 | COc1nc(Cl)ncc1C(F)(F)F | 2-chloro-4-methoxy-5-(trifluoromethyl)pyrimidine | AG000VSP | 5g |
| 1312535-32-2 | C(=O)(OC)C1C(C)(C)CC(=O)CC1 | Methyl 2,2-dimethyl-4-oxocyclohexanecarboxylate | AG000VSQ | 2g |
| 13126-39-1 | C(CCCCCCCCCCC\C=C/CCCC)(=O)O | (Z)-Octadec-13-enoic acid | AG000VSX | 0.125g |
| 13126-12-0 | [Rb].N(=O)(=O)O | Rubidium nitrate | AG000VT3 | 100g |
| 1312693-69-8 | O=C1NCC2=C1C(Cl)=NC(Cl)=C2F | 4,6-Dichloro-7-Fluoro-1H-Pyrrolo[3,4-C]Pyridin-3(2H)-One | AG000VTA | 10g |
| 1312693-57-4 | FC(N1N=CC(B(O)O)=C1)F | (1-(Difluoromethyl)-1H-pyrazol-4-yl)boronic acid | AG000VTC | 5g |
| 1312611-18-9 | O=C(OC(C)(C)C)NC1=NC2=CC=C(Br)C=C2C=C1 | Tert-Butyl (6-bromoquinolin-2-yl)carbamate | AG000VTG | 0.5g |
| 1312610-07-3 | O=C(C1=C2OCOC2=C(Br)C=C1)OCC | Ethyl 7-bromobenzo[d][1,3]dioxole-4-carboxylate | AG000VTH | 5g |
| 1312609-83-8 | O=C(OCC)C1=CC=C(Br)C(O)=C1O | Ethyl 4-bromo-2,3-dihydroxybenzoate | AG000VTI | 5g |
| 1312608-46-0 | C([C@@H](NC(OC)=O)C(C)C)(=O)N1[C@H](C=2NC(C3=C4C(=C(C=C3)C5=CC=C(C | Methyl N-[(1S)-1-[[(2S)-2-[5-[4-[7-[2-[(2S)-1-[(2S)-2-[(methoxycarbonyl)amin | AG000VTJ | 0.05g |
| 1312765-94-8 | O=C(N1CC2=C(C=C(B(O)O)C=C2)CC1)OC(C)(C)C | (2-(tert-Butoxycarbonyl)-1,2,3,4-tetrahydroisoquinolin-6-yl)boronic acid | AG000VU1 | 20g |
| 1312765-69-7 | CC1=CC=C(B(O)O)C=C1Br | 3-Bromo-4-methylphenylboronic acid | AG000VU2 | 25g |
| 1312762-44-9 | CN[C@H]1CN(C(=O)OC(C)(C)C)CC[C@H]1C | (3R,4R)-4-METHYL-3-METHYLAMINO-PIPERIDINE-1-CARBOXYLIC ACID TERT-BU | AG000VU4 | 1g |
| 1312760-59-0 | Oc1c2c(ccc(n2)Cl)ncc1 | 6-chloro-1,5-naphthyridin-4-ol | AG000VU5 | 10g |
| 1312756-38-9 | CN1CC[C@@H]2[C@H]1CNC2 | (3aS,6aS)-1-Methyl-hexahydro-2H-pyrrolo[2,3-c]pyrrole | AG000VU7 | 0.75g |
| 1312716-26-9 | CC(=O)O[C@H]([C@]1(C)[C@H]2CCC=C([C@]2(C)[C@H]([C@@H]([C@]1(C)O)O | Scutebarbatine X | AG000VU8 | 0.005g |
| 1312712-22-3 | O=C(N1CC(B2OC(C)(C)C(C)(C)O2)CC1)OC(C)(C)C | 1-Boc-Pyrrolidine-3-boronic acid pinacol ester | AG000VU9 | 50g |
| 131211-27-3 | C1C2CC3(PC45CC6CC(C4)CC(C6)C5)CC(C2)CC1C3 | bis(adamantan-1-yl)phosphane | AG000VR0 | 80g |
| 13122-91-3 | OC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1ccccc1)NC(=O)OCc1ccccc1 | N-Carbobenzoxy-L-phenylalanyl-L-phenylalanine | AG000VR1 | 25g |
| 13122-90-2 | O=C(O)[C@@H](NC([C@@H](NC(OC(C)(C)C)=O)CC1=CC=CC=C1)=O)CC2=CC=CC | Boc-Phe-Phe-OH | AG000VR2 | 50g |
| 13121-99-8 | N#CCC1=CC=NC=C1 | 2-(Pyridin-4-yl)acetonitrile | AG000VR6 | 100g |
| 1312312-78-9 | CC1(C)C(C)(C)OB(C2=CN=C(N(C)N=C3)C3=C2)O1 | 1-Methyl-1H-pyrazolo[3,4-b]pyridine-5-boronic acid pinacol ester | AG000VR7 | 10g |
| 1312309-64-0 | C(ON1C(=O)CCC1=O)(=O)CCOCCOCCN=[N+]=[N-] | Propanoic acid, 3-[2-(2-azidoethoxy)ethoxy]-, 2,5-dioxo-1-pyrrolidinyl ester | AG000VR8 | 9.74g |
| 131231-24-8 | O=CC1=CC(=CC=C1)C1=CC=CN=C1 | 3-Pyrid-3-ylbenzaldehyde | AG000VRB | 3g |
| 131230-76-7 | NC1=CC=C(CO[Si](C)(C(C)(C)C)C)C=C1 | 4-((tert-butyldimethylsilyloxy)methyl)aniline | AG000VRD | 125g |
| 131222-99-6 | BrC1=CC2=C3C=CC=CC3=C(Br)C=C2C4=CC=CC=C14 | 6,12-Dibromochrysene | AG000VRL | 40g |
| 1312412-88-6 | NC=1SC=2C(N(CCC2N1)C(=O)OC(C)(C)C)=O | tert-Butyl 2-amino-4-oxo-6,7-dihydrothiazolo[5,4-c]pyridine-5(4H)-carboxyla | AG000VRX | 2g |
| 1312412-87-5 | CC(C)(C)OC(=O)N1CCC(=O)C(Br)C1=O | tert-Butyl 3-bromo-2，4-dioxopiperidine-1-carboxylate | AG000VRY | 1g |
| 1312368-91-4 | OB(O)c1cncc2cc[nH]c12 | (1H-Pyrrolo[3,2-c]pyridin-7-yl)boronic acid | AG000VRZ | 10g |
| 1312368-90-3 | OB(O)C1=CN=CC2=C1C=CN2 | 6-Azaindole-4-boronic acid | AG000VS0 | 0.15g |
| 131242-36-9 | Sc1ncccn1 | 2-Pyrimidinethiol | AG000VS5 | 1000g |
| 13124-18-0 | NNc1ccc(c(c1)Cl)Cl | (3,4-Dichlorophenyl)Hydrazine | AG000VSH | 50g |
| 13124-17-9 | CC1CC(=O)N(C2=CC(Cl)=C(Cl)C=C2)N=1 | 1-(3,4-Dichlorophenyl)-3-methyl-1H-pyrazol-5(4H)-one | AG000VSI | 15g |
| 1312581-09-1 | Cn1c(I)cc2c(Cl)ccnc21 | 4-Chloro-2-iodo-1-methyl-1h-pyrrolo[2,3-b]pyridine | AG000VSL | 5g |
| 131274-22-1 | CC([PH+](C(C)(C)C)C(C)(C)C)(C)C.F[B-](F)(F)F | Tri-tert-butylphosphonium tetrafluoroborate | AG000VUF | 436.8g |
| 131274-17-4 | O=C(C=C1)N(CCOCCN)C1=O.O=C(O)C(F)(F)F | 1-(2-(2-Aminoethoxy)ethyl)-1H-pyrrole-2,5-dione 2,2,2-trifluoroacetate | AG000VUG | 100g |
| 131271-19-7 | CC1=CC(=CC=C1Cl)CO | (4-Chloro-3-methylphenyl)methanol | AG000VUI | 10g |
| 131270-08-1 | O=C(O)C[C@H](N)CC1=CC=CC=C1 | (R)-3-Amino-4-phenylbutanoic acid | AG000VUJ | 10g |
| 13127-18-9 | CC[C@H]1OC(=O)[C@H](C)[C@@H](O[C@H]2C[C@@](C)(OC)[C@@H](O)[C@H | Erythromycin-9-oxime | AG000VUN | 195g |
| 1312812-78-4 | O=C(N1C[C@H](N)[C@@H](O)CC1)OC(C)(C)C | tert-Butyl (3s,4s)-3-amino-4-hydroxypiperidine-1-carboxylate | AG000VUP | 25g |
| 1312810-39-1 | C[C@@H]1C[C@H](N)CN(C(=O)OC(C)(C)C)C1 | (3S,5R)-tert-Butyl 3-amino-5-methylpiperidine-1-carboxylate | AG000VUQ | 5g |
| 1312798-50-7 | CC(C)(C)OC(=O)N1CC[C@H](O)[C@H](N)C1 | 1-Piperidinecarboxylic acid, 3-amino-4-hydroxy-, 1,1-dimethylethyl ester, (3r | AG000VUS | 10g |
| 131287-39-3 | C(C1C2=CC=CC=C2C2=CC=CC=C12)OC(=O)N[C@H](C(=O)O)CC(=O)N[C@@H]1O[ | FMOC-ASN(AC3ACNH-BETA-GLC)-OH | AG000VUX | 25g |
| 13129-23-2 | COC(=O)C1=COC=C1 | Methyl furan-3-carboxylate | AG000VV9 | 105g |
| 13129-21-0 | OC(C1CS(=O)(=O)C1)=O | thietane-3-carboxylic acid 1,1-dioxide | AG000VVA | 2g |
| 13129-17-4 | C12=C(CCCC2)C=CS1 | 4,5,6,7-Tetrahydrobenzo[B]Thiophene | AG000VVB | 25g |
| 1312991-15-3 | O=C1C(NC2=CC(C(F)(F)F)=CC(C(F)(F)F)=C2)=C(N[C@@H]3[C@@H](N4CCCCC4)C | 3-[[3,5-Bis(trifluoromethyl)phenyl]amino]-4-[[(1S,2S)-2-(1-piperidinyl)cycloh | AG000VVD | 0.25g |
| 1312991-12-0 | O=C1C(C(N[C@@H]2[C@@H](N)CCCC2)=C1NC3=CC(C(F)(F)F)=CC(C(F)(F)F)=C3) | 3-[(1S,2S)-2-Aminocyclohexylamino]-4-[3,5-bis(trifluoromethyl)phenylamino | AG000VVE | 4g |
| 1312991-08-4 | O=C1C(NC2=CC=C(C(F)(F)F)C=C2)=C(N[C@@H]3[C@@H](N4CCCCC4)CCCC3)C1= | 3-(((1S,2S)-2-(Piperidin-1-yl)cyclohexyl)amino)-4-((4-(trifluoromethyl)pheny | AG000VVF | 0.5g |
| 1312942-14-5 | OB(C1=CN=C(NC2CC2)N=C1)O | 2-(Cyclopropylamino)pyrimidine-5-boronic acid | AG000VVI | 3g |
| 13114-64-2 | NC(NC1=CC=CC=N1)=O | 1-(Pyridin-2-Yl)Urea | AG000VMD | 30g |
| 13114-27-7 | CC(=CCNC1=NC=NC2=C1NC=N2)CO | Zeatin | AG000VMG | 5g |
| 1311569-08-0 | CCOC(=O)C1=CC2=CC=C(N=C2N1)C(=O)OCC | Diethyl 1h-pyrrolo[2,3-b]pyridine-2,6-dicarboxylate | AG000VMI | 5g |
| 13116-27-3 | NNC1=CC=C(I)C=C1 | (4-Iodophenyl)hydrazine hydroiodide | AG000VMX | 30g |
| 13115-71-4 | O=C(O)[C@@H](NC(CN)=O)CCC(N)=O | Glycyl-L-glutamine | AG000VMZ | 100g |
| 13115-43-0 | O=C(O)CC1=NC=CC=C1 | 2-Pyridylacetic acid | AG000VN0 | 0.3g |
| 1311776-29-0 | O[C@@H]1CN(C2=NC=C(C(F)(F)F)C=C2Cl)CC1 | (S)-1-(3-Chloro-5-(trifluoromethyl)pyridin-2-yl)pyrrolidin-3-ol | AG000VN5 | 0.5g |
| 131179-95-8 | CC=1C=C(C=C(C1)C)NC(CC1=CC=C(OC(C(=O)O)(C)C)C=C1)=O | 2-(4-(2-((3,5-Dimethylphenyl)amino)-2-oxoethyl)phenoxy)-2-methylpropano | AG000VN6 | 2g |
| 131176-02-8 | O=C(O)[C@@H](C1)NC[C@H]1F | Trans-4-fluoropyrrolidine-2-carboxylic acid hcl | AG000VNE | 5g |
| 131172-64-0 | C1CCC2=C(C1)C=C(C(=O)O)N2 | 4,5,6,7-Tetrahydro-1h-indole-2-carboxylic acid | AG000VNL | 5g |
| 13118-11-1 | O=C(OC1CN(C)CC1)C(O)(C2CCCC2)C3=CC=CC=C3 | 1-Methylpyrrolidin-3-Yl 2-Cyclopentyl-2-Hydroxy-2-Phenylacetate | AG000VNO | 15g |
| 13117-94-7 | NC1=C(C(C)(C)C)C=CC=C1C | 6-TERT-BUTYL-O-TOLUIDINE | AG000VNQ | 2g |
| 131189-57-6 | O=C(C1=COC(C(C1CCOC(C2=CC(O)=C(C(O)=C2)O)=O)C=C)OC3OC(C(C(C3O)O)O) | Comuside | AG000VNU | 0.1g |
| 131395-29-4 | CC(NC1=CC=C(OC(F)(F)F)C=C1Br)=O | 2-Bromo-4-(trifluoromethoxy)acetanilide | AG000W2W | 50g |
| 131395-17-0 | NC1=CC=C(CC(F)(F)F)C=C1 | 4-(2,2,2-Trifluoroethyl)aniline | AG000W2X | 30g |
| 131395-10-3 | CC(C1=CC2=C(N=C(S2)N)C=C1)(C)C | 2-Amino-6-(tert-butyl)benzothiazole | AG000W2Y | 0.1g |
| 13139-52-1 | O=C(N)CC[C@H](C(O)=O)NC(OCC1=CC=CC=C1)=O | Z-D-Gln-OH | AG000W3C | 400g |
| 1314-08-5 | O=[Pd] | Palladium(II) oxide | AG000W3G | 25g |
| 1314-98-3 | [Zn+2].[S-2] | Zinc sulfide | AG000W3O | 6500g |
| 1314-87-0 | [Pb+2].[SH2-2] | Lead sulfide (PbS) | AG000W3S | 1050g |
| 1314036-63-9 | CCN(C[C@H](C(C)(C)C)N)CC | 1,2-Butanediamine, N1,N1-diethyl-3,3-dimethyl-, (2S)- | AG000W45 | 3g |
| 1314012-52-6 | OC1=CC2=CC=C(F)C(F)=C2N=C1 | 7,8-Difluoroquinolin-3-ol | AG000W46 | 0.75g |
| 131401-56-4 | C(C)N(C(C=1C(C(=O)O)=C(C=CC1F)F)=O)CC | N,N-Diethyl-3,6-difluorophthalamic acid | AG000W4G | 2g |
| 1314216-34-6 | CC1NC2=C(C=CC(B3OC(C)(C)C(C)(C)O3)=C2)N=1 | 2-Methyl-1h-benzimidazole-5-boronic acid pinacol ester | AG000W4U | 0.75g |
| 1314216-33-5 | Cl.OB(O)C1=NNC=C1 | Pyrazole-3-boronic acid, HCl | AG000W4V | 5g |
| 1314141-37-1 | OCC1=CC=C(B2OC(C)(C)C(C)(C)O2)C(F)=C1 | 2-Fluoro-4-(hydroxymethyl)phenylboronic acid pinacol ester | AG000W4W | 1.25g |
| 131424-27-6 | O=C(C1=CNC2=C1C=CC(OC)=C2)OC | Methyl 6-methoxy-1H-indole-3-carboxylate | AG000W4Y | 75g |
| 1309774-04-6 | NC1=NC2=CC(Br)=CN=C2C=C1 | 7-Bromo-1,5-naphthyridin-2-amine | AG000V6Q | 15g |
| 1309774-03-5 | BrC1=CN=C2C=CC(=NC2=C1)Cl | 1,5-Naphthyridine, 7-bromo-2-chloro- | AG000V6R | 5g |
| 130973-78-3 | NC(C1NCC1)=O | AZETIDINE-2-CARBOXAMIDE | AG000V6W | 1g |
| 130966-46-0 | O=C(N1[C@H](C(OC)=O)[C@H](O)CC1)OC(C)(C)C | (2S,3R)-1-tert-Butyl 2-methyl 3-hydroxypyrrolidine-1,2-dicarboxylate | AG000V70 | 25g |
| 13097-01-3 | C1(C2=CC=CC=C2)=NNC3=C1C=CC=C3 | 3-Phenyl-1H-indazole | AG000V7B | 4g |
| 130985-42-1 | CC(C)(NC(OC(C)(C)C)=O)CC(OCC)=O | Ethyl 3-((tert-butoxycarbonyl)amino)-3-methylbutanoate | AG000V7M | 1.25g |
| 130981-12-3 | O=C([C@H]1[C@@H](NC(OC(C)(C)C)=O)CCC1)O | (1R,2S)-2-(Boc-amino)cyclopentanecarboxylic acid | AG000V7R | 15g |
| 13099-35-9 | O=C(CCCCCCCCCCCCCCCCBr)O | 17-Bromoheptadecanoic acid | AG000V7S | 50g |
| 13099-34-8 | OCCCCCCCCCCCCCCCCC(=O)O | 17-Hydroxyheptadecanoic acid | AG000V7T | 75g |
| 1309955-14-3 | O=C1NCCC2=C1C=CC(=C2)C1=CC=CC=C1 | 6-Phenyl-3,4-dihydroisoquinolin-1(2H)-one | AG000V87 | 2g |
| 1309920-99-7 | COC1C=C(C(=O)O1)CC[C@@]1(C)[C@H](C)CC[C@@]23[C@@H]1CCC=C3C(=O)O | 15-Methoxymkapwanin | AG000V88 | 0.005g |
| 130996-24-6 | C(C)(C)(C)OC(/C=C/C1=C(C=CC=C1)C1=C(C(=NC(=C1C(=O)OCC)C)C)C(=O)OCC)=O | (E)-Diethyl 4-(2-(3-(tert-butoxy)-3-oxoprop-1-en-1-yl)phenyl)-2,6-dimethylp | AG000V8C | 0.03g |
| 130995-13-0 | C[Si](C)(C)C#CC1=CSC=C1 | Trimethyl(Thiophen-3-Ylethynyl)Silane | AG000V8G | 200g |
| 1269400-04-5 | N#Cc1cc([N+](=O)[O-])c(cc1N=CN(C)C)OC | N’-(2-Cyano-5-methoxy-4-nitrophenyl)-N,N-dimethylformimidamide | AG000WFJ | 50g |
| 126940-10-1 | COCOC1=CC(F)=CC=C1 | 1-Fluoro-3-(methoxymethoxy)benzene | AG000WFK | 75g |
| 126937-43-7 | O=C(N1C(C(OC)=O)CNCC1)OCC2=CC=CC=C2 | (R)-1-N-Cbz-piperazine-2-carboxylic acid methyl ester | AG000WFN | 20g |
| 126937-42-6 | COC(=O)C1N(CCN(C(=O)OC(C)(C)C)C1)C(=O)OCC2=CC=CC=C2 | 4-N-Boc-1-n-cbz-piperazine-2-carboxylic acid methyl ester | AG000WFO | 9g |
| 126937-41-5 | CC(OC(N1CC(C(O)=O)N(C(OCC2=CC=CC=C2)=O)CC1)=O)(C)C | N-4-Boc-N-1-Cbz-2-Piperazine carboxylic acid | AG000WFP | 400g |
| 126931-29-1 | OC1CCC(O[Si](C)(C(C)(C)C)C)CC1 | 4-((tert-Butyldimethylsilyl)oxy)cyclohexanol | AG000WFR | 50g |
| 1269493-35-7 | C[C@H](N)CNC(OC(C)(C)C)=O.[H]Cl | (S)-tert-Butyl (2-aminopropyl)carbamate hydrochloride | AG000WFV | 10g |
| 1269492-17-2 | O=C(OC)C1=CC([N+]([O-])=O)=CC=C1OC2=CC=CC=C2C(OC)=O | Methyl 2-(2-(methoxycarbonyl)phenoxy)-5-nitrobenzoate | AG000WFW | 75g |
| 1269478-85-4 | CCC[C@@H](C1=CC=C(F)C=C1)N.[H]Cl | (S)-1-(4-Fluorophenyl)butan-1-amine hydrochloride | AG000WFZ | 5g |
| 1269470-38-3 | CC(C)C[C@@H](C1=CC=CC=C1)N.[H]Cl | (S)-3-Methyl-1-phenylbutan-1-amine hydrochloride | AG000WG0 | 6g |
| 1269461-73-5 | O=C(OC)C1=CC(I)=CC=C1OC2=CC=CC=C2C(OC)=O | Methyl 5-iodo-2-(2-(methoxycarbonyl)phenoxy)benzoate | AG000WG2 | 25g |
| 1269449-40-2 | Cl[H].COC(=O)C1CNCCN1C(=O)OC(C)(C)C | 1-N-Boc-piperazine-2-carboxylic acid methyl ester-hcl | AG000WG3 | 2g |
| 1269448-82-9 | O=C(OC)C1=CC(N)=CC=C1OC2=CC=CC=C2C(OC)=O | Methyl 5-amino-2-(2-(methoxycarbonyl)phenoxy)benzoate | AG000WG5 | 125g |
| 1269440-73-4 | CC1(C)OB(OC1(C)C)c1ccnc(c1F)N | 2-Pyridinamine, 3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)- | AG000WG8 | 5g |
| 1269440-58-5 | CC(N1N=C(I)C(C2=NC(Cl)=NC=C2)=C1)C | 2-Chloro-4-[3-iodo-1-(1-methylethyl)-1H-pyrazol-4-yl]pyrimidine | AG000WG9 | 2g |
| 1269524-76-6 | Nc1ccc2c(c1)cnc(n2)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C | Imidodicarbonic acid, 2-(6-amino-2-quinazolinyl)-, 1,3-bis(1,1-dimethylethyl) | AG000WGO | 0.2g |
| 1269493-45-9 | N#CC1=CC(Br)=C(C)C=C1F | 5-bromo-2-fluoro-4-methylbenzonitrile | AG000WGV | 70g |
| 127-06-0 | C/C(C)=N/O | Propan-2-one oxime | AG000WIK | 96g |
| 127-71-9 | O=C(NS(=O)(=O)c1ccc(N)cc1)c2ccccc2 | N-(4-aminophenyl)sulfonylbenzamide | AG000WIM | 5g |
| 127-68-4 | O=S(C1=CC=CC([N+]([O-])=O)=C1)([O-])=O.[Na+] | 3-Nitrobenzenesulfonic acid sodium salt | AG000WIN | 3000g |
| 127-66-2 | C(C#C)(C)(O)c1ccccc1 | Benzenemethanol, α-ethynyl-α-methyl- | AG000WIO | 200g |
| 127-63-9 | O=S(C1=CC=CC=C1)(C2=CC=CC=C2)=O | Sulfonyldibenzene | AG000WIP | 6500g |
| 127-58-2 | NC1=CC=C(S([N-]C2=NC(C)=CC=N2)(=O)=O)C=C1.[Na+] | Sulfamerazine Sodium | AG000WIQ | 1000g |
| 127-54-8 | CC(C1=CC=C(O)C(C(C)C)=C1)(C2=CC=C(O)C(C(C)C)=C2)C | 4,4′-(Propane-2,2-diyl)bis(2-isopropylphenol) | AG000WIR | 10g |
| 127-48-0 | O=C(N1C)OC(C)(C)C1=O | Trimethadione | AG000WIU | 20g |
| 127-22-0 | CC1([C@H](CC[C@@]2([C@H]3CC[C@]4([C@@H]5CC(CC[C@@]5(CC=C4[C@@] | (3S,4aR,6aR,8aR,12aR,12bS,14aR,14bR)-4,4,6a,8a,11,11,12b,14b-Octamethyl-1, | AG000WJ1 | 0.075g |
| 1270019-92-5 | C[C@@H]1CNC[C@H](NC(=O)OC(C)(C)C)C1 | tert-butyl N-[(3R,5S)-5-methylpiperidin-3-yl]carbamate | AG000WJ6 | 25g |
| 1270019-87-8 | NC(C(O)=O)C1COC1 | 2-amino-2-(oxetan-3-yl)acetic acid | AG000WJ7 | 5g |
| 127000-90-2 | C[C@H]1[C@](CN2N=CN=C2)(C3=CC=C(F)C=C3F)O1 | 1-{[(2R,3S)-2-(2,4-Difluorophenyl)-3-methyloxiran-2-yl]methyl}-1H-1,2,4-tria | AG000WJD | 125g |
| 127-95-7 | O=C([O-])C(O)=O.[K+] | Potassium Carboxyformate | AG000WJF | 6000g |
| 127-88-8 | ClCCN(CCCl)P(=O)(Cl)Cl | Bis(2-chloroethyl)aminophosphoric Dichloride | AG000WJI | 5g |
| 1313254-92-0 | C1=CC=C(OC[C@H]2CCCN2)C=C1.Cl | (R)-2-(Phenoxymethyl)pyrrolidine hydrochloride | AG000VXM | 1g |
| 1313219-33-8 | O=C(O)[C@@H](N)C1=CC=CC=C1Br.[H]Cl | (S)-2-Amino-2-(2-bromophenyl)acetic acid hydrochloride | AG000VXO | 0.75g |
| 131326-39-1 | C[Si](C(C)(C)C)(OCCOCCO)C | Ethanol, 2-[2-[[(1,1-dimethylethyl)dimethylsilyl]oxy]ethoxy]- | AG000VXT | 2500g |
| 131323-10-9 | CC1=CC=C(C(C(O)=O)(F)F)C=C1 | 2,2-Difluoro-2-p-tolylacetic acid | AG000VXW | 0.4g |
| 131322-08-2 | c1ccc(cc1)[B-](c1ccccc1)(c1ccccc1)c1ccccc1.CC([PH+](C(C)(C)C)C(C)(C)C)(C)C | TRI-TERT-BUTYLPHOSPHONIUM TETRAPHENYLBORATE | AG000VXY | 3g |
| 1313366-29-8 | O(C(C)C)c1cc2C(NC(=O)Cc2cc1OC)c1ccc(cc1)Cl | 1-(4-Chlorophenyl)-1,4-dihydro-6-methoxy-7-(1-methylethoxy)-3(2H)-isoqui | AG000VY9 | 3g |
| 1313359-04-4 | COc1cccc(n1)c1cccc(c1)[N+](=O)[O-] | 2-Methoxy-6-(3-nitrophenyl)pyridine | AG000VYA | 2g |
| 131328-27-3 | CC(=O)[C@@H]1CCCO1 | (S)-1-(Tetrahydrofuran-2-yl)ethanone | AG000VYO | 975g |
| 13133-07-8 | C([C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)O[C@]2([C@H]([C@@H]([C@H] | Nistose trihydrate | AG000VYT | 2g |
| 1313395-18-4 | c1ccc2c(c1)[nH]c1c3sc4ccccc4c3c3ccccc3c21 | 3-thia-24-azahexacyclo[15.7.0.0²,¹⁰.0⁴,⁹.0¹¹,¹⁶.0¹⁸,²³]tetracosa-1(17),2(10),4(9),5 | AG000VYY | 45g |
| 131347-76-7 | CC[C@@H](N)CC(O)=O | (R)-3-Aminopentanoic acid | AG000VZ1 | 2g |
| 13135-69-8 | O=C(OC)[C@H]1N(C)C[C@H](O)C1 | (R)-1-Methyl-4-hydroxy-L-proline methyl ester | AG000VZ5 | 36.5g |
| 13134-76-4 | OC=1C2=C(SC1C(=O)OC)C=CC=C2 | Methyl 3-hydroxybenzo[b]thiophene-2-carboxylate | AG000VZ9 | 0.75g |
| 13134-38-8 | NC1=NC(C)=CN=C1C | 3,6-Dimethylpyrazin-2-Amine | AG000VZC | 100g |
| 13134-31-1 | C1=CN=C(N)C(=N1)N | Pyrazine-2,3-diamine | AG000VZD | 600g |
| 1313617-76-3 | B(O)(O)c1c(C)c(OC)ccc1 | (3-Methoxy-2-methylphenyl)boronic acid | AG000VZJ | 25g |
| 1313617-51-4 | ClC1=CC=C(C(N)=O)C(B(O)O)=C1 | 2-Carbamoyl-5-chlorophenylboronic acid | AG000VZL | 15g |
| 1313714-59-8 | O=C(OCC)/C(C#N)=C(C)/CC1=CC=C([N+]([O-])=O)C=C1 | 2-Cyano-3-methyl-4-(4-nitro-phenyl)-but-2-enoic acid ethyl ester | AG000W1H | 3g |
| 1313761-97-5 | OB(O)C1=CC=C(OCC2CCCCO2)C=C1 | 4-(Tetrahydro-2H-pyran-2-yl)methoxyphenylboronic acid | AG000W1L | 0.75g |
| 1313760-77-8 | OB(C1=C(OC2CCCCC2)C=CC=C1)O | 2-(Cyclohexyloxy)phenylboronic acid | AG000W1M | 3.9g |
| 1313760-59-6 | OB(C1=CC=CC=C1OCCN(C)C)O | (2-(2-(dimethylamino)ethoxy)phenyl)boronic acid | AG000W1N | 5g |
| 1313738-90-7 | C1=C2C(C(=O)C3=C(C2=O)C=CC=C3)=C(O)C(O)=C1S(NC1=CC=C(C(F)(F)F)C=C1)(= | PGMI-004A | AG000W1P | 0.01g |
| 13138-33-5 | C([P](O)(O)=O)CCN | 3-Aminopropylphosphonic acid | AG000W27 | 150g |
| 13138-25-5 | C/C=C/C[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Cl-] | PHOSPHONIUM, 2-BUTEN-1-YLTRIPHENYL-, CHLORIDE (1:1) | AG000W28 | 5g |
| 1313876-00-4 | CCCCCCCCCCCCOC1=C(Br)C2=NSN=C2C(Br)=C1OCCCCCCCCCCCC | 4,7-Dibromo-5,6-bis(dodecyloxy)benzo[c][1,2,5]thiadiazole | AG000W2B | 20g |
| 131380-91-1 | OC1=CC=CC=C1C2=N[C@@H](C(C)C)CO2 | (S)-2-(4-Isopropyl-4,5-dihydrooxazol-2-yl)phenol | AG000W2E | 2g |
| 13139-28-1 | O=C(OCC1=CC=CC=C1)N[C@@H](C(C)C)C(N)=O | Z-Val-NH2 | AG000W2H | 600g |
| 13139-12-3 | O=C(OC(C)(C)C)ON1C(CCC1=O)=O | tert-Butyl (2,5-dioxopyrrolidin-1-yl) carbonate | AG000W2I | 3500g |
| 13138-76-6 | COC(=O)C1=CC(=CN1C)[N+]([O-])=O | Methyl 1-methyl-4-nitro-1H-pyrrole-2-carboxylate | AG000W2K | 200g |
| 13138-75-5 | O=C(C1=CC=C([N+]([O-])=O)N1C)OC | 1H-PYRROLE-2-CARBOXYLIC ACID, 1-METHYL-5-NITRO-, METHYL ESTER | AG000W2L | 35g |
| 13138-74-4 | COC(=O)C1=CC(=CN1)[N+]([O-])=O | methyl 4-nitro-1H-pyrrole-2-carboxylate | AG000W2M | 25g |
| 13138-73-3 | O=C(C1=CC=C([N+]([O-])=O)N1)OC | Methyl 5-nitro-1H-pyrrole-2-carboxylate | AG000W2N | 15g |
| 13138-70-0 | O=C(C1=CC([N+]([O-])=O)=CS1)O | 4-Nitro-2-thiophenecarboxylic acid | AG000W2O | 5g |
| 13138-53-9 | [O-][N+](C1=CC=C(C(C(N)=O)=C1)C(N)=O)=O | 4-Nitrophthalamide | AG000W2Q | 200g |
| 1314987-50-2 | OB(c1cncc(c1)S(=O)(=O)NC(C)(C)C)O | (5-(N-(tert-Butyl)sulfamoyl)pyridin-3-yl)boronic acid | AG000WD1 | 0.1g |
| 1269293-53-9 | O=Cc1ccnn1c1ccc(cc1)Br | 1-(4-Bromophenyl)-1H-pyrazole-5-carbaldehyde | AG000WD6 | 2g |
| 1269293-48-2 | O=C(C1=NN(C)C(Br)=C1)OCC | Ethyl 5-bromo-1-methyl-1H-pyrazole-3-carboxylate | AG000WDA | 100g |
| 1269293-86-8 | O=Cc1ccnn1c1cnccn1 | 1-(Pyrazin-2-yl)-1H-pyrazole-5-carbaldehyde | AG000WE5 | 2g |
| 1269293-80-2 | N#CC1=C(Br)N(C)N=C1 | 5-Bromo-1-methyl-1H-pyrazole-4-carbonitrile | AG000WE8 | 400g |
| 1269293-73-3 | O=C1NCC2=C1C=C([N+]([O-])=O)C=C2Br | 4-Bromo-6-nitroisoindolin-1-one | AG000WEA | 0.2g |
| 1269294-20-3 | O=CC1N(C2=NC=CC=C2)N=CC=1 | 1-(Pyridin-2-yl)-1H-pyrazole-5-carbaldehyde | AG000WES | 1.25g |
| 1269294-14-5 | O=C(C1=NN(C2=CC=CC=C2Br)C(N)=C1)OCC | Ethyl 5-amino-1-(2-bromophenyl)-1H-pyrazole-3-carboxylate | AG000WEY | 0.75g |
| 126930-72-1 | CCCCCCCCCCCCC1=CC=C(Br)C=C1 | 1-Bromo-4-dodecylbenzene | AG000WF2 | 500g |
| 1269440-49-4 | IC1=NN(C=C1C(C)=O)C(C)C | 1-(3-Iodo-1-isopropyl-1H-pyrazol-4-yl)ethanone | AG000WF6 | 10g |
| 1269440-17-6 | O=C(OC)N[C@@H](C)CNC1=NC=CC(C2=CN(C(C)C)N=C2C3=CC(Cl)=CC(NS(=O)(C) | LGX818 | AG000WF7 | 1g |
| 1269437-75-3 | NC1=CC=C([C@H](N)C)C=C1.[H]Cl.[H]Cl | (R)-4-(1-Aminoethyl)aniline dihydrochloride | AG000WF8 | 0.2g |
| 1269437-73-1 | N[C@H](C1CC1)C2=CC=C(F)C=C2.[H]Cl | (R)-Cyclopropyl(4-fluorophenyl)methanamine hydrochloride | AG000WFA | 0.5g |
| 1269437-72-0 | C[C@H](N)C1=C(C)C=CC=C1C.[H]Cl | (S)-1-(2,6-Dimethylphenyl)ethanamine hydrochloride | AG000WFB | 5g |
| 1269437-70-8 | C[C@@H](N)C1=C(C)C=CC=C1C.[H]Cl | (R)-1-(2,6-Dimethylphenyl)ethanamine hydrochloride | AG000WFC | 0.75g |
| 1269429-29-9 | O=C(N1CCC(N2N=CC=C2)CC1)OC(C)(C)C | tert-Butyl 4-(1H-pyrazol-1-yl)piperidine-1-carboxylate | AG000WFE | 1g |
| 1271810-27-5 | C(=O)(OC(C)(C)C)N1C[C@@H](N)[C@@H](CC1)C | trans-tert-Butyl 3-amino-4-methylpiperidine-1-carboxylate | AG000WQK | 10g |
| 1271738-62-5 | CCCC1=CC2=C(N3CCN(C4=NCC(C)(C)S4)CC3)N=CN=C2S1 | 4-(4-(5,5-Dimethyl-4,5-dihydrothiazol-2-yl)piperazin-1-yl)-6-propylthieno[2,3 | AG000WQL | 1.25g |
| 127199-14-8 | O=C([C@H]1[C@@H](F)C1)O | (1S,2S)-2-fluorocyclopropanecarboxylic acid | AG000WQN | 200g |
| 127199-13-7 | O=C([C@@H]1[C@H](F)C1)O | (1R,2R)-2-fluorocyclopropanecarboxylic acid | AG000WQO | 100g |
| 127192-72-7 | OCCOc1ccc(cc1)-c1cc(nc(c1)-c1ccccn1)-c1ccccn1 | 2-(4-([2,2′:6′,2”-Terpyridin]-4′-yl)phenoxy)ethanol | AG000WQU | 0.2g |
| 127191-97-3 | CN([C@@H](CC1=CC=C(OS(=O)(C2=C3C(C=NC=C3)=CC=C2)=O)C=C1)C(N4CCN(C | KN-62 | AG000WQW | 0.075g |
| 127188-33-4 | CC1=CC=CC(=N1)N1CCN(CC1)C(=O)OC(C)(C)C | tert-Butyl 4-(6-methylpyridin-2-yl)piperazine-1-carboxylate | AG000WQZ | 10g |
| 127184-05-8 | CC1(C)[C@@](C2)(CC[C@]1([H])C3(Cl)Cl)[C@@]43N(O4)S2(=O)=O | (+)-(8,8-Dichlorocamphorylsulfonyl)oxaziridine | AG000WR0 | 275g |
| 127222-69-9 | NNC(=O)C(c1ccc(cc1)CC(C)C)C | 2-(4-Isobutylphenyl)propanohydrazide | AG000WR9 | 15g |
| 127199-55-7 | C[C@@H]1CNC[C@@H]1NC(=O)OC(C)(C)C | tert-Butyl ((3R,4R)-4-methylpyrrolidin-3-yl)carbamate | AG000WRL | 0.2g |
| 127199-45-5 | O=C(OC(C)(C)C)N[C@@H]1CNCC21CC2 | (S)-7-tert-Butoxycarbonylamino-5-azaspiro[2.4]heptane | AG000WRN | 50g |
| 127199-44-4 | O=C(OC(C)(C)C)N[C@H]1CNCC21CC2 | (R)-tert-Butyl 5-azaspiro[2.4]heptan-7-ylcarbamate | AG000WRO | 10g |
| 127199-27-3 | ClC1(=C(F)C(F)=CC2(=C1N(C=C(C(=O)O)C2=O)C3(C(F)C3))) | 8-Chloro-6,7-difluoro-1-((1R,2S)-2-fluorocyclopropyl)-4-oxo-1,4-dihydroquin | AG000WRP | 5g |
| 1272-44-2 | O=C([C-]12[CH]3=[CH]4[CH]5=[CH]1[Fe+2]45326789[CH]%10=[CH]6[CH-]7[CH]8= | Benzoylferrocene | AG000WRR | 700g |
| 127232-41-1 | OCC1=CN=CO1 | Oxazole-5-methanol | AG000WS5 | 5.3g |
| 127223-93-2 | CN(C)/C=C/C(=O)C(F)(F)F | (3e)-4-(Dimethylamino)-1,1,1-trifluorobut-3-en-2-one | AG000WSJ | 10g |
| 1272412-72-2 | O=C(N(C1)CC21CCN2)OC(C)(C)C | 3,6-Diazaspiro[3.3]heptane-6-carboxylic acid tert-butyl ester hemioxylate | AG000WSM | 6g |
| 1272412-70-0 | O=C(OC(C)(C)C)N1CC2(CSC2)C1 | 6-thia-2-azaspiro[3.3]heptane-2-carboxylic acid tert-butyl ester | AG000WSN | 1g |
| 1272412-69-7 | CC(C)(C)OC(=O)N1CCOC2(COC2)C1 | TERT-BUTYL 2,5-DIOXA-8-AZASPIRO[3.5]NONANE-8-CARBOXYLATE | AG000WSO | 1g |
| 1270497-54-5 | O=CC1=NC(Br)=CN=C1Br | 3,6-DIBROMOPYRAZINE-2-CARBALDEHYDE | AG000WMP | 15g |
| 1270497-22-7 | O=C(N1CC[C@@H](O)[C@H](N)C1)OCC2=CC=CC=C2 | Benzyl (3r,4r)-3-amino-4-hydroxypiperidine-1-carboxylate | AG000WMQ | 5g |
| 127049-87-0 | CC1=C(Cl)C(Br)=CC=C1Cl | 1-Bromo-2,4-dichloro-3-methylbenzene | AG000WMY | 75g |
| 127049-50-7 | CC(C)(C)[C@@H](O)C1=CC=CC(C2=NC([C@H](O)C(C)(C)C)=CC=C2)=N1 | Bolm’s ligand | AG000WN1 | 0.75g |
| 1270921-80-6 | OB(C1=CC=C(OC2=CC=CC=C2)N=C1)O | 6-Phenoxypyridine-3-boronic acid | AG000WN4 | 20g |
| 127094-58-0 | CCOC(=O)c1cnc2c(c1O)nc(cc2)Cl | 1,5-Naphthyridine-3-carboxylic acid, 6-chloro-4-hydroxy-, ethyl ester | AG000WN6 | 5g |
| 127087-87-0 | CCCCCCCCCC1=CC=C(C=C1)OCCO | Tergitol 4-Nonylphenol branched ethoxylated | AG000WNB | 0.2g |
| 1271022-90-2 | CN1C=NC2=C1C(C=C(C(N(C3CC3)C4CC4)=O)N5CC)=C5N=C2NC6=NN(C)C(C)=C6 | BMS-911543 | AG000WNT | 0.2g |
| 1270982-05-2 | O=C(N1CC(COC)NCC1)OC(C)(C)C | tert-butyl 3-(methoxymethyl)piperazine-1-carboxylate | AG000WNU | 15g |
| 127095-97-0 | COC1=C(OC)C=C(C[C@@H](C(O)=O)NC(OC(C)(C)C)=O)C=C1 | Boc-3,4-dimethoxy-l-phenylalanine | AG000WNW | 5g |
| 127095-92-5 | O=C(O)[C@H](NC(OC(C)(C)C)=O)CC1CCCCC1 | Boc-D-Cha-OH | AG000WNX | 25g |
| 1271-86-9 | CN(C)C[C-]1C=CC=C1.C2=CC=C[CH-]2.[Fe+2] | N,N-Dimethylaminomethylferrocene | AG000WO2 | 75g |
| 1271-51-8 | C=C[C-]1C=CC=C1.C2=CC=C[CH-]2.[Fe+2] | Vinylferrocene | AG000WO6 | 24.5g |
| 1271-48-3 | O=CC1=CC=CC1[Fe]C2C=CC=C2C=O | 1,1′-FERROCENEDICARBOXALDEHYDE | AG000WO7 | 125g |
| 1271-47-2 | [CH]1[CH][CH][CH][CH]1.C#C[C]1[CH][CH][CH][CH]1.[Fe] | Ethynylferrocene | AG000WO8 | 225g |
| 1271-42-7 | C(=O)(O)[C-]12[Fe+2]3456789(C1=C5C4=C23)[C-]1C8=C7C6=C91 | Ferrocene, carboxy- (9CI) | AG000WO9 | 6000g |
| 127119-09-9 | O=C(OC(C)(C)C)NCC(OC)OC | tert-Butyl N-(2,2-dimethoxyethyl)carbamate | AG000WON | 200g |
| 127108-66-1 | O=CC1=C(C)N=NS1 | 4-Methyl-1,2,3-thiadiazole-5-carbaldehyde | AG000WOV | 10g |
| 127107-23-7 | NC1=CN(C)N=C1.[H]Cl | 1-Methylpyrazol-4-amine HCl | AG000WOW | 200g |
| 127106-71-2 | O=C(O)C[C@@H](NC(OC(C)(C)C)=O)CC1=CC=C([N+]([O-])=O)C=C1 | Boc-(s)-3-amino-4-(4-nitrophenyl)butanoic acid | AG000WOY | 2g |
| 1272412-68-6 | CC(C)(C)OC(=O)N1CCCC2(CCO2)C1 | 3-Oxa-8-azaspiro[3.5]nonane-8-carboxylic acid tert-butyl ester | AG000WSP | 27g |
| 1272412-66-4 | CCOC(=O)C1CC2(CC(C2)NC(=O)OC(C)(C)C)C1 | Ethyl 6-((tert-butoxycarbonyl)amino)spiro[3.3]heptane-2-carboxylate | AG000WSQ | 5g |
| 127243-85-0 | C1C2=C(C(S(NCCNC/C=C/C3=CC=C(Br)C=C3)(=O)=O)=CC=C2)C=CN=1 | H-89 Dihydrochloride | AG000WT2 | 5g |
| 1272755-33-5 | O=C(O)[C@H](NC(OCC1C2=C(C3=C1C=CC=C3)C=CC=C2)=O)CCCCNC(CC(C)C)=C4 | Fmoc-D-Lys(Ivdde)-OH | AG000WTC | 50g |
| 127274-91-3 | Cl(=O)(=O)(=O)[O-].CC1(C(N(C2=CC=CC=C12)CCCCCCCCCCCCCCCCCC)=CC=CC=C | 2-[5-(1,3-Dihydro-3,3-dimethyl-1-octadecyl-2H-indol-2-ylidene)-1,3-pentadie | AG000WTH | 0.075g |
| 127273-06-7 | O=C(O)[C@@H](NC(OCC1C2=C(C3=C1C=CC=C3)C=CC=C2)=O)CC#N | Fmoc-beta-cyano-l-alanine | AG000WTL | 75g |
| 127271-65-2 | FC(F)(F)C1=CC(OC)=CC=C1F | 2-Fluoro-5-methoxybenzotrifluoride | AG000WTM | 125g |
| 127267-57-6 | CC1(C2=C(C=C(C(O)=O)C=C2)NC1=O)C | 3,3-dimethyl-2-oxo-2,3-dihydro-1H-indole-6-carboxylic acid | AG000WTP | 10g |
| 127264-14-6 | BrCCC1=CC=C(OCC2)C2=C1 | 5-(2-Bromoethyl)-2,3-dihydrobenzofuran | AG000WTS | 800g |
| 127257-87-8 | BrC1=CC=CC(=C1)N1C(C)=CC=C1C | 1-(3-Bromophenyl)-2,5-dimethylpyrrole | AG000WTU | 30g |
| 127254-12-0 | FC1=C(N2C[C@@H](N)C3(CC3)C2)C(Cl)=C4C(C(C(C(O)=O)=CN4[C@H]5[C@@H]( | Sitafloxacin | AG000WTZ | 0.02g |
| 1272756-00-9 | CCOC(=O)C1CC(O)CN(C1)C(=O)OC(C)(C)C | Ethyl N-Boc-5-hydroxypiperidine-3-carboxylate | AG000WU1 | 50g |
| 1272755-99-3 | COCCN1CC(CC1=O)C(=O)OC | Methyl 1-(2-methoxyethyl)-2-oxopyrrolidine-4-carboxylate | AG000WU2 | 25g |
| 1272755-68-6 | O=C(OCC2(C1(=C(C=CC=C1)C3(=C2C=CC=C3))))NC(C(=O)O)CO.O | (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-hydroxypropanoic acid | AG000WUO | 300g |
| 1272756-23-6 | O=C(N1CCC(C2=NC(C3=CC=C(S(=O)(C)=O)C=C3)=NO2)CC1)OC(C)(C)C | 3-[4-(Methylsulfonyl)phenyl]-5-(1-Boc-4-piperidyl)-1,2,4-oxadiazole | AG000WUS | 25g |
| 1272756-20-3 | CN(C(N1CC(N)CCC1)=O)C | 3-AMino-N,N-diMethylpiperidine-1-carboxaMide | AG000WUV | 10g |
| 1272756-18-9 | Cl.CN1CC(CC1=O)C(N)=N | 1-Methyl-2-oxopyrrolidine-4-carboxamidine, HCl | AG000WUX | 20g |
| 1272756-16-7 | O=C1NC2(CCCC2)NC2=CC=CC(C#N)=C12 | 4-Oxospiro[1,2,3,4-tetrahydroquinazoline-2,1′-cyclopentane]-5-carbonitrile | AG000WUZ | 2g |
| 131290-01-2 | O=S(C1=CC2=C(C=C1)C=NN2)(Cl)=O | 1H-Indazole-6-sulfonyl chloride | AG000VVZ | 2g |
| 1313-22-0 | [Mn]=[Se] | Manganese selenide (MnSe) | AG000VW0 | 25g |
| 1313026-86-6 | Cc1nc2c(Cl)nc(Cl)nc2n1C(C)C | 2,6-Dichloro-9-isopropyl-8-methyl-9H-purine | AG000VW2 | 100g |
| 1313012-28-0 | NC1=CC=C(SC(F)(F)F)C=C1N.[H]Cl.[H]Cl | 4-((Trifluoromethyl)thio)benzene-1,2-diamine dihydrochloride | AG000VW5 | 5g |
| 13130-79-5 | NC1=CC2=C(C=CC=C2)C(Br)=N1 | 1-Bromoisoquinolin-3-amine | AG000VWA | 75g |
| 13130-50-2 | O=CC1=CC=C(C2=CC=C(C3=CC=C(C=O)S3)S2)S1 | 2,2′:5′,2”-Terthiophene-5,5”-dicarboxaldehyde | AG000VWB | 2g |
| 13130-13-7 | OC(=O)C1=CC=C(O1)C1=CC(=CC=C1)[N+]([O-])=O | 5-(3-Nitro-phenyl)-furan-2-carboxylic acid | AG000VWF | 50g |
| 1313-85-5 | [Na+].[Na+].[Se-2] | Disodium selenide | AG000VWL | 10g |
| 1313-27-5 | O=[Mo](=O)=O | Molybdenum trioxide | AG000VWQ | 10500g |
| 1313176-45-2 | CC[C@@H]1CNCCO1 | (R)-2-Ethylmorpholine | AG000VWT | 0.75g |
| 1313279-47-8 | O=C(OC(C)(C)C)N[C@H]1CC[C@H](CC#N)CC1 | Carbamic acid, n-[trans-4-(cyanomethyl)cyclohexyl]-, 1,1-dimethylethyl ester | AG000VXG | 2g |
| 1313277-24-5 | O=C([C@H]1NCC(C)(C)OC1)O.[H]Cl | (S)-6,6-Dimethyl-morpholine-3-carboxylic acid hcl | AG000VXK | 1.25g |
| 127299-93-8 | ClC1=CC([C@H](O)CN[C@@H](C)CC2=CC=C(OCC([O-])=O)C=C2)=CC=C1.[Na+] | BRL 37344 (sodium salt) | AG000WW8 | 0.001g |
| 127294-77-3 | Cl.Cl.CNC1CCCNC1 | N-methylpiperidin-3-amine DiHCl | AG000WWB | 800g |
| 127294-73-9 | N[C@H]1CNCCC1 | (R)-3-Aminopiperidine | AG000WWD | 75g |
| 127294-70-6 | O=C(C1=CN(C2CC2)C3=C(C=C(F)C(N4CC(NC)CCC4)=C3OC)C1=O)O | 1-cyclopropyl-6-fluoro-8-methoxy-7-[3-(methylamino)piperidin-1-yl]-4-oxo- | AG000WWF | 5.6g |
| 1273-86-5 | OC[C-]12[CH]3=[CH]4[CH]5=[CH]1[Fe+2]67894532[CH]=%10[CH]9=[CH]8[CH-]7[C | Ferrocenemethanol | AG000WWM | 600g |
| 1273-82-1 | N[C-]12[CH]3=[CH]4[CH]5=[CH]1[Fe+2]67894532[CH]=%10[CH]9=[CH]8[CH-]7[CH | Aminoferrocene | AG000WWN | 25g |
| 1273-73-0 | Br[C-]12[CH]3=[CH]4[CH]5=[CH]1[Fe+2]67894532[CH]=%10[CH]9=[CH]8[CH-]7[C | Bromoferrocene | AG000WWQ | 75g |
| 349-43-9 | CCOC(C(F)C)=O | Ethyl 2-fluoropropionate | AG000WWR | 200g |
| 1273315-11-9 | O=C1NC2=CN=C(Cl)N=C2N1C | 2-Chloro-9-methyl-7H-purin-8(9H)-one | AG000WWU | 0.2g |
| 127338-44-7 | CCOC(=O)C1=CC2=C(C=CC(Br)=C2)C=C1O | Ethyl 7-bromo-3-hydroxy-2-naphthoate | AG000WWX | 3g |
| 127337-60-4 | FC(F)(F)COC1=C(C)C(CCl)=NC=C1.[H]Cl | 2-(Chloromethyl)-3-methyl-4-(2,2,2-trifluoroethoxy)pyridine, HCl | AG000WWY | 4500g |
| 127326-77-6 | C1(F)C(OCCC)=CC=C(Br)C=1 | 4-Bromo-2-fluoro-1-propoxybenzene | AG000WX2 | 90g |
| 127320-83-6 | C1CNC(CO1)CN1CCCC1 | 3-(Pyrrolidin-1-ylmethyl)morpholine | AG000WX8 | 1g |
| 127312-04-3 | NOCc1cc(cc(c1)[N+](=O)[O-])[N+](=O)[O-].Cl | 3,5-Dinitrobenzyloxyamine hydrochloride | AG000WXA | 2g |
| 127310-66-1 | OC[C@H]1N(CC2=CC=CC=C2)[C@@H](CO)C1 | (1-Benzylazetidine-2,4-diyl)dimethanol | AG000WXD | 100g |
| 127308-98-9 | O=C(O)/C=C/C(O)=O.N1(CCC2=CC=C(OCO3)C3=C2)C[C@H](OC(C4=CC=CC=C4)C5 | Zamifenacin fumarate | AG000WXF | 0.5g |
| 1273562-74-5 | CC(C)(C)OC(=O)N1C2CNC(=O)C1C2 | 6-Boc-2-oxo-3,6-diaza-bicyclo[3.1.1]heptane | AG000WXI | 10g |
| 127356-40-5 | CC(C1=CC([N+]([O-])=O)=C(Cl)N=C1)=O | 1-(6-Chloro-5-nitropyridin-3-yl)ethanone | AG000WXM | 1g |
| 127356-38-1 | NC1=CC(OC)=NC=C1[N+]([O-])=O | 2-METHOXY-5-NITROPYRIDIN-4-AMINE | AG000WXO | 50g |
| 127356-26-7 | COC1=CC(N)=C(N)C=N1 | 6-Methoxypyridine-3,4-diamine | AG000WXR | 7g |
| 1311197-93-9 | CCCC(C1=CC=C(Br)C=C1F)=O | 1-(4-Bromo-2-fluorophenyl)butan-1-one | AG000VJQ | 15g |
| 1311197-88-2 | O=[N+](C1=C(Cl)C=C(F)C(Br)=C1)[O-] | 1-Bromo-4-chloro-2-fluoro-5-nitrobenzene | AG000VJV | 200g |
| 1311197-87-1 | CCCOc1cc(C)ccc1F | 1-Fluoro-4-methyl-2-propoxybenzene | AG000VJW | 124g |
| 1311197-82-6 | IC1=CC=NN1C2CCCCO2 | 5-Iodo-1-(tetrahydropyran-2-yl)pyrazole | AG000VK1 | 125g |
| 131123-76-7 | O=C(C1=NC2=CC(Cl)=CC(Cl)=C2C(O)=C1)O | 5,7-Dichlorokynurenic Acid | AG000VK7 | 0.2g |
| 131123-44-9 | N[C@H](C(=O)O)Cc1ccc(cc1)OC(F)(F)F | (2S)-2-Amino-3-[4-(trifluoromethoxy)phenyl]propanoic acid | AG000VK9 | 2g |
| 13112-69-1 | CCCCOC(CC(C)C)OCCCC | 1,1-dibutoxy-3-methylbutane | AG000VKC | 0.5g |
| 1311275-33-8 | Nc1ncnc2c(Br)c[nH]c12 | 7-Bromo-5H-pyrrolo[3,2-d]pyrimidin-4-amine | AG000VKG | 500g |
| 1311275-27-0 | ClC1=NC2=C(NC=C2Br)C(Cl)=N1 | 7-Bromo-2,4-dichloro-5H-pyrrolo[3,2-d]pyrimidine | AG000VKI | 2g |
| 1311254-85-9 | C[C@H](N)C1=CC=C(Br)C=C1F.[H]Cl | (S)-1-(4-Bromo-2-fluorophenyl)ethanamine hcl | AG000VKQ | 10g |
| 1311254-63-3 | CC(C)CC(NC(OCC1=CC=CC=C1)=O)CC(O)=O | 3-Cbz-amino-5-methyl-hexanoic acid | AG000VKS | 2g |
| 1311254-57-5 | O=C(C1=CC=CC2=C1CNC2)OCC.[H]Cl | Ethyl isoindoline-4-carboxylate hcl | AG000VKU | 0.5g |
| 131418-11-6 | O=C(NC)C1=CC=NC(Cl)=C1 | N-Methyl 2-chloroisonicotinamide | AG000W55 | 50g |
| 131417-49-7 | CC(N1CCC(CCC(O)=O)CC1)=O | 3-(1-Acetylpiperidin-4-yl)propanoic acid | AG000W56 | 1g |
| 13142-61-5 | [N+](=O)([O-])C=1C=C(C=CC1)NC(=O)N | N-(3-Nitrophenyl)urea | AG000W5D | 30g |
| 1314264-61-3 | OB(c1cccc(c1C)C(=O)O)O | (2-Methyl-3-carboxyphenyl)boronic acid | AG000W5K | 2.1g |
| 1314264-58-8 | OB(c1cccc(c1Cl)C(=O)O)O | 3-Carboxy-2-chlorophenylboronic acid | AG000W5L | 3g |
| 131435-06-8 | O[C@@H]1C[C@H](O)[C@@H]([C@@H]([C@H]1O)O)O | D-epi-Inositol, 2-deoxy- | AG000W5M | 0.2g |
| 131427-22-0 | ClCC1=NN(CC2=CC=CC=C2)C3=C1C=CC=C3 | 1-Benzyl-3-(chloromethyl)-1H-indazole | AG000W5R | 10g |
| 13143-47-0 | O=C1C=CC=CN1C2=CC=C(N)C=C2 | 1-(4-Aminophenyl)-1H-pyridin-2-one | AG000W62 | 10g |
| 1314401-24-5 | ClC1=NC(=NC(Cl)=C1Cl)C1=CC=CN=C1 | 4,5,6-Trichloro-2-(pyridin-3-yl)pyrimidine | AG000W68 | 5g |
| 1314398-25-8 | CC1(OC(C)(C)CC(CO)C1)C | (2,2,6,6-TETRAMETHYL-TETRAHYDRO-2H-PYRAN-4-YL)METHANOL | AG000W69 | 1g |
| 1314398-21-4 | O=C(OC(C)(C)C)NCC(F)(F)CO | Tert-Butyl (2,2-Difluoro-3-Hydroxypropyl)Carbamate | AG000W6A | 20g |
| 1314395-95-3 | OCC(F)(F)CN.[H]Cl | 3-Amino-2,2-difluoro-propan-1-ol hcl | AG000W6C | 0.75g |
| 1314390-34-5 | O=C(OC(C)(C)C)NC1=CN=C(Br)N=C1 | tert-Butyl (2-bromopyrimidin-5-yl)carbamate | AG000W6F | 5g |
| 1314378-16-9 | O(CCOCCC(ON1C(=O)CCC1=O)=O)CCOCCC(ON1C(=O)CCC1=O)=O | Propanoic acid, 3,3′-[oxybis(2,1-ethanediyloxy)]bis-, 1,1′-bis(2,5-dioxo-1-pyrr | AG000W6G | 5g |
| 1314378-11-4 | O=C(ON1C(CCC1=O)=O)CCOCCOCCOCCOCCC(ON2C(CCC2=O)=O)=O | 4,7,10,13-Tetraoxahexadecanedioic acid, 1,16-bis(2,5-dioxo-1-pyrrolidinyl) es | AG000W6H | 10g |
| 13144-62-2 | O=C(C(=O)O)NC1CCCCC1 | 2-(Cyclohexylamino)-2-oxoacetic acid | AG000W6S | 1.25g |
| 1314419-67-4 | FC1=CC=C(O[C@H]2CNCC2)C=C1.[H]Cl | (3R)-(4-Fluorophenoxy)-pyrrolidine, HCl | AG000W6V | 0.5g |
| 1314419-65-2 | CCOC(=O)[C@@H]1CCN(C1)C(=O)OC(C)(C)C | Ethyl (R)-1-Boc-3-pyrrolidinecarboxylate | AG000W6X | 1.25g |
| 1314406-40-0 | CCOC(=O)C1=NC=C(C=C1)S(=O)(=O)CC | Ethyl 5-(ethylsulfonyl)pyridine-2-carboxylate | AG000W7C | 10g |
| 1314538-55-0 | F[B-](F)(CNC(OC(C)(C)C)=O)F.[K+] | Potassium N-boc-aminomethyltrifluoroborate | AG000W7K | 200g |
| 131457-46-0 | CC(C1=N[C@@H](C2=CC=CC=C2)CO1)(C3=N[C@@H](C4=CC=CC=C4)CO3)C | (S,S)-2,2′-Isopropylidene-bis(4-phenyl-2-oxazoline) | AG000W7O | 200g |
| 131454-80-3 | BrCC1=C2N=CC=NC2=CC=C1 | 5-(Bromomethyl)quinoxaline | AG000W7T | 5g |
| 13146-23-1 | C(#C[Cu])c1ccccc1 | (Phenylethynyl)copper | AG000W81 | 50g |
| 1314687-82-5 | N#CC1=CC2=CC(Br)=CC=C2N=C1 | 6-Bromoquinoline-3-carbonitrile | AG000W89 | 2g |
| 1314667-39-4 | CC(C1=CC=CC=C1N)(C#N)C | 2-(2-Aminophenyl)-2-methylpropanenitrile | AG000W8B | 0.75g |
| 1314657-40-3 | C(C)(C)c1c(c(C(C)C)ccc1)N1C(F)(F)N(C=C1)c1c(C(C)C)cccc1C(C)C | 1,3-Bis(2,6-diisopropylphenyl)-2,2-difluoro-2,3-dihydro-1H-imidazole | AG000W8C | 1g |
| 131469-67-5 | COC(=O)C(=C)C(c1ccc(cc1)Cl)O | 2-[(4-Chloro-phenyl)-hydroxy-methyl]-acrylic acid methyl ester | AG000W8I | 6.1g |
| 131467-87-3 | O=N(C1=CC=C(C2=NON=C21)NN)=O.NN | 4-Hydrazino-7-nitro-benzofurazan hydrazine adduct | AG000W8N | 0.1g |
| 131467-86-2 | NNc1ccc(c2c1non2)S(=O)(=O)N(C)C | 7-Hydrazinyl-N,N-dimethylbenzo[c][1,2,5]oxadiazole-4-sulfonamide | AG000W8O | 0.6g |
| 131467-06-6 | C=CC1=CN=C(Cl)N=C1 | 2-Chloro-5-vinylpyrimidine | AG000W8Q | 10g |
| 13146-72-0 | OC1=C2N=CN([C@@H]3O[C@H](CO)C[C@H]3O)C2=NC=N1 | 3′-Deoxyinosine | AG000W8X | 0.2g |
| 1314916-25-0 | ClC1=NC2=C(NCCN2C)C=N1 | 2-Chloro-8-methyl-5,6,7,8-tetrahydropteridine | AG000WAN | 0.3g |
| 1314902-85-6 | S=C(C1=CC=NN1)N | 1H-Pyrazole-5-carbothioamide | AG000WAS | 2g |
| 1314977-20-2 | OCC1=C(C(F)(F)F)N=C(N)S1 | (2-Amino-4-(trifluoromethyl)thiazol-5-yl)methanol | AG000WB1 | 1.75g |
| 1314974-91-8 | N#CC1=NC(N)=C(Br)C=C1 | 6-Amino-5-bromopicolinonitrile | AG000WB2 | 5g |
| 1314971-48-6 | OC(C1=C(F)C(C#N)=CC=C1F)=O | 3-Cyano-2,6-difluorobenzoic acid | AG000WB4 | 4.7g |
| 1314961-80-2 | O[C@H]1C[C@@H](F)C1 | cis-3-Fluorocyclobutanol | AG000WB5 | 5g |
| 1314961-56-2 | O=C1OC2(CNCCC2)CC1.[H]Cl | 1-oxa-7-azaspiro[4.5]decan-2-one hydrochloride | AG000WB6 | 25g |
| 1314957-11-3 | [K+].F[B-](F)(F)C2(=CC=C(C(=O)N1(CCOCC1))C=C2) | Potassium 4-(morpholine-4-carbonyl)phenyltrifluoroborate | AG000WBC | 3g |
| 1314937-87-5 | C#CC1NCCC1.[H]Cl | 2-Ethynylpyrrolidine hydrochloride | AG000WBD | 5g |
| 1314936-85-0 | Fc1cc(Cl)c(c(c1N)Cl)F | Benzenamine, 2,4-dichloro-3,6-difluoro- | AG000WBG | 0.7g |
| 1314936-23-6 | COC(=O)c1ccc(NC=O)c(F)c1 | Methyl 3-fluoro-4-formamidobenzoate | AG000WBH | 1.75g |
| 1314936-02-1 | CCC1=NC=C(Cl)N=C1Cl | 3,5-Dichloro-2-ethylpyrazine | AG000WBJ | 5g |
| 1314931-66-2 | O=C(OC(C)(C)C)NC1=COC=N1 | tert-Butyl n-(1,3-oxazol-4-yl)carbamate | AG000WBM | 125g |
| 1314987-34-2 | O=C(OC)C1=CC(Br)=C(F)C=C1N | Methyl 2-amino-5-bromo-4-fluorobenzoate | AG000WBT | 500g |
| 1314987-31-9 | CSc1cc(F)c(cc1Br)Br | 2,4-Dibromo-5-fluorothioanisole | AG000WBV | 4.2g |
| 1314978-36-3 | NC1=NN=CC(Cl)=C1 | 5-Chloropyridazin-3-amine | AG000WCE | 20g |
| 1314987-55-7 | Brc1ccc(c(c1)OCc1ccccc1)C(F)(F)F | 2-Benzyloxy-4-bromobenzotrifluoride | AG000WCY | 22.5g |
| 127349-56-8 | O=[N+](C1=CC=C(CBr)C(F)=C1)[O-] | 1-(Bromomethyl)-2-fluoro-4-nitrobenzene | AG000WXY | 50g |
| 127346-48-9 | O=C(OC(C)(C)C)NCCCN.[H]Cl | N-Boc-1,3-diaminopropane, HCl | AG000WY3 | 200g |
| 1273595-77-9 | FC1=C2CCC(C2=CC=C1C)=O | 4-Fluoro-5-methyl-2,3-dihydro-1H-inden-1-one | AG000WY6 | 1g |
| 1273577-71-1 | O=C(C1=CN2C(N=C1)=C(Br)C=N2)O | 3-BroMopyrazolo[1,5-a]pyriMidine-6-carboxylic acid | AG000WY8 | 20g |
| 1273577-45-9 | CC(O)([C@@H]1CNCC1)C.[H]Cl | (S)-2-(3-Pyrrolidinyl)-2-propanol Hydrochloride | AG000WYC | 5g |
| 1273577-42-6 | Cl.NC(=O)[C@@H]1CCNC1 | (R)-Pyrrolidine-3-carboxamide, HCl | AG000WYD | 10g |
| 1273577-24-4 | OS(O)(=O)=O.NC(=O)C1=C(N)ON=C1 | 5-Aminoisoxazole-4-carboxamide Hydrogensulfate | AG000WYE | 75g |
| 1273577-20-0 | CCOC(=O)c1c[nH]c2nccc(Cl)c12 | Ethyl 4-chloro-1h-pyrrolo[2,3-b]pyridine-3-carboxylate | AG000WYF | 25g |
| 1273577-17-5 | NC1=CC=NC2=C(Br)C=NN12 | 3-Bromopyrazolo[1,5-a]pyrimidin-7-amine | AG000WYG | 2g |
| 1273577-14-2 | O=C([C@H]1CNCCO1)O.[H]Cl | (R)-Morpholine-2-carboxylic acid hydrochloride | AG000WYH | 20g |
| 1273567-44-4 | O=C([C@H]1OCCCN(C(OC(C)(C)C)=O)C1)O | (S)-4-(tert-Butoxycarbonyl)-1,4-oxazepane-2-carboxylic acid | AG000WYK | 25g |
| 1273567-30-8 | CC(C)(C)OC(=O)N1CC[C@@H](F)[C@H](N)C1 | (3R,4R)-Rel-3-amino-1-boc-4-fluoropiperidine | AG000WYL | 5g |
| 1273565-75-5 | O=C(C1(CF)CC1)O | 1-(fluoromethyl)cyclopropanecarboxylic acid | AG000WYO | 2g |
| 1273565-65-3 | O=C(N1C[C@@H](N)[C@@H](F)CC1)OC(C)(C)C | (3,4)-cis-tert-Butyl 3-amino-4-fluoropiperidine-1-carboxylate | AG000WYP | 2g |
| 1273564-99-0 | O=C1CC(F)(F)C1 | 3，3-Difluorocyclobutanone | AG000WYQ | 75g |
| 1273655-83-6 | O=C1CCC2=C1C=C(C)C(Br)=C2 | 5-Bromo-6-methyl-2,3-dihydro-1H-inden-1-one | AG000WYY | 15g |
| 1273651-21-0 | O=C1CCC2=C1C(Br)=CC(Cl)=C2 | 7-Bromo-5-chloro-2,3-dihydro-1H-inden-1-one | AG000WYZ | 1.75g |
| 1314776-50-5 | N#CC1(CC1)c1ccc(c(c1)Cl)Br | 1-(4-Bromo-3-chlorophenyl)cyclopropane-1-carbonitrile | AG000W8Y | 2g |
| 1314763-76-2 | COC1=C(C=CC(=C1)OC)C1(CC1)C(=O)O | 1-(2,4-Dimethoxyphenyl)cyclopropanecarboxylic Acid | AG000W92 | 4g |
| 1314760-71-8 | CC1=C(C=CC(C2(C#N)CC2)=C1)Br | 1-(4-Bromo-3-methylphenyl)cyclopropane-1-carbonitrile | AG000W93 | 20g |
| 1314743-49-1 | S=C(NC1=CC(C(F)(F)F)=CC(C(F)(F)F)=C1)N[C@H]2[C@@H](CCCC2)N3CCCC3 | 1-[3,5-Bis(trifluoromethyl)phenyl]-3-[(1R,2R)-2-(pyrrolidin-1-yl)cyclohexyl]th | AG000W96 | 0.75g |
| 1314723-39-1 | Cl.ClC1=NC2=C(CNCC2)C=N1 | 2-Chloro-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine HCl | AG000W97 | 25g |
| 131477-20-8 | O=C([C@@H]1NCCC1)OCC.[H]Cl | H-D-Pro-OEt HCl | AG000W99 | 350g |
| 131472-28-1 | N=C(N)C1=CC=C(C(F)(F)F)C=C1 | 4-(Trifluoromethyl)benzenecarboximidamide | AG000W9G | 6g |
| 13147-25-6 | CCN(N=O)CCO | N-Ethyl-N-(2-hydroxyethyl)nitrosamine | AG000W9K | 20g |
| 1314790-85-6 | ClC1=NC=C2C(CNC2)=N1.[H]Cl | 2-Chloro-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine hydrochloride | AG000W9Q | 10g |
| 13148-83-9 | COC(=O)C1CCCC(=O)C1 | Methyl 3-oxocyclohexanecarboxylate | AG000WA0 | 200g |
| 13148-65-7 | CC1OC(C)=NN=1 | 2,5-Dimethyl-1,3,4-oxadiazole | AG000WA1 | 25g |
| 13148-61-3 | CCC1=NN=CO1 | 2-Ethyl-1,3,4-oxadiazole | AG000WA4 | 10g |
| 13148-05-5 | CCOC(=O)CC(=O)C=P(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 | Ethyl 3-Oxo-4-(Triphenylphosphoranylidene)Butyrate | AG000WAB | 40g |
| 127-82-2 | OC1=CC=C(S(=O)([O-])=O)C=C1.OC2=CC=C(S(=O)([O-])=O)C=C2.[Zn+2] | Zinc p-phenolsulfonate | AG000WJL | 1500g |
| 127-77-5 | C1=CC=C(C=C1)NS(=O)(=O)C2=CC=C(C=C2)N | 4-Amino-n-phenyl-benzenesulfonamide | AG000WJM | 10g |
| 127-76-4 | CC(NC1=CC=C(S(=O)(NC2=NC=CS2)=O)C=C1)=O | N-(4-(N-(Thiazol-2-yl)sulfamoyl)phenyl)acetamide | AG000WJN | 2g |
| 127-73-1 | CC(NC1=CC=C(S(=O)(NC2=NC=CC(C)=N2)=O)C=C1)=O | N-Acetylsulfamerazine | AG000WJP | 0.75g |
| 1270138-40-3 | O=C(N1CCN(CC2=CC=CC=C2)CC1)C3=CC=CN=C3NCCC(C)C | (4-Benzylpiperazin-1-yl)(2-(isopentylamino)pyridin-3-yl)methanone | AG000WJV | 50g |
| 127024-28-6 | CC(C)(C)C1=CC(N)=NS1 | 5-TERT-BUTYL-3-ISOTHIAZOLAMINE | AG000WK3 | 1g |
| 127022-77-9 | C(C1=CC=CC=C1)SC1=C(C(=C(C(=C1SCC1=CC=CC=C1)SCC1=CC=CC=C1)SCC1=CC=C | Hexakis(benzylthio)benzene | AG000WK4 | 25g |
| 1270292-81-3 | O=C(O)[C@H](CC1=CC=C(C(C)(C)C)C=C1)NC(OCC2=CC=CC=C2)=O | Cbz-L-4-tButylphenylalanine | AG000WKM | 5g |
| 1270289-34-3 | [C@@H]1(C2CCCCC2)NCCOC1 | (S)-3-Cyclohexylmorpholine | AG000WKT | 10g |
| 1270482-67-1 | CC(N)C1=CC=CC(F)=C1Cl | 1-(2-Chloro-3-fluorophenyl)ethanamine | AG000WLU | 9g |
| 127047-71-6 | CC(C)(C)[Si](OCCCO)(c1ccccc1)c1ccccc1 | 3-[(tert-butyldiphenylsilyl)oxy]propan-1-ol | AG000WM2 | 25g |
| 127033-74-3 | O=C(NC1=CC=CC(OC)=C1)/C=C/C2=CC=CC=C2 | N-(3-Methoxyphenyl)cinnamamide | AG000WME | 500g |
| 1270506-12-1 | NC(C1=CC=NC=C1)C1CC1 | 1-Cyclopropyl-1-(4-pyridyl)methylamine | AG000WMN | 4g |
| 1311254-39-3 | CCOC(=O)C1=CC=CC2=C1CN(C2)C(=O)OC(C)(C)C | Ethyl n-boc-isoindoline-4-carboxylate | AG000VL1 | 10g |
| 13113-08-1 | N1C=C(C2=CC=CC=C12)CC(=O)NCC(=O)O | 2-(2-(1H-Indol-3-yl)acetamido)acetic acid | AG000VL3 | 2g |
| 1311391-25-9 | CC(OC(N1C2C(CC(CC2)C1)O)=O)(C)C | 2-Boc-6-hydroxy-2-azabicyclo[2.2.2]octane | AG000VL4 | 1g |
| 1311390-85-8 | CC(OC(N1C2C(CC(CC2)C1)=O)=O)(C)C | 2-Boc-2-azabicyclo[2.2.2]octane-6-one | AG000VL5 | 1g |
| 1311369-72-8 | NC1=CN(C2COCC2)N=C1 | 1-(Oxolan-3-yl)-1h-pyrazol-4-amine | AG000VL6 | 10g |
| 1311318-21-4 | CC(C)(C)OC(=O)NCC1(N)CCCC1 | tert-Butyl n-[(1-aminocyclopentyl)methyl]carbamate | AG000VL7 | 15g |
| 1311315-20-4 | Cl.NC1(C(F)(F)F)CCCCC1 | 1-(Trifluoromethyl)cyclohexan-1-amine hydrochloride | AG000VL8 | 312g |
| 1311312-00-1 | COC(C1CC(Br)CC1)=O | Methyl 3-bromocyclopentanecarboxylate | AG000VLD | 1g |
| 1311473-28-5 | O([C@@H]1[C@@H](C)O[C@@]([H])(O[C@@H]2[C@@H](C)O[C@@H](O[C@] | Perisesaccharide C | AG000VLU | 0.001g |
| 13114-90-4 | NC(=O)NC1=C(Br)C=CC=C1 | (2-Bromophenyl)urea | AG000VM6 | 50g |
| 13114-87-9 | C1=CC(=CC(=C1)NC(=N)O)C(F)(F)F | N-[3-(Trifluoromethyl)phenyl]urea | AG000VM8 | 200g |
| 1276056-68-8 | CC1=CN=CC2=NC=C(Br)N21 | 3-Bromo-5-methylimidazo[1,2-a]pyrazine | AG000X77 | 10g |
| 1276056-66-6 | OC1=CC=C(CN)N=C1.[H]Cl | 2-(Aminomethyl)-5-hydroxypyridine HCl | AG000X78 | 15g |
| 1276055-51-6 | O=C(O)[C@H](CC1=CC=CC=C1)CN.[H]Cl | (R)-3-Amino-2-benzylpropanoic acid hydrochloride | AG000X79 | 2g |
| 1276055-45-8 | CC(C)[C@H](CN)C(O)=O.[H]Cl | (R)-2-(Aminomethyl)-3-methylbutanoic acid hydrochloride | AG000X7A | 10g |
| 127604-16-4 | C[C@H](O)CC([O-])=O.[Na+] | SODIUM (S)-3-HYDROXYBUTANOATE | AG000X7H | 10g |
| 1276121-88-0 | O=C1N[C@H](C)CNC2=C1SC3=CC=C4N=C(C5=CC=C(C)N=C5)C=CC4=C32 | PF-3644022 | AG000X7V | 0.2g |
| 1276110-38-3 | O=C(N1C[C@H](N2N=C(I)C3=C(N)N=CN=C32)CCC1)OC(C)(C)C | (3R)-1-Boc-3-(4-aMino-3-iodo-1H-pyrazolo[3,4-d]pyriMidin-1-yl)piperidine | AG000X7Y | 50g |
| 1276110-06-5 | O=C(C1=CN=C2C=CC(C3=CC(NS(=O)(C4=CC=CC=C4)=O)=CN=C3)=CN21)OCC | HS-173 | AG000X80 | 0.3g |
| 1276076-00-6 | COC(CC1=CNN=C1)=O | Methyl 2-(1H-pyrazol-4-yl)acetate | AG000X81 | 0.75g |
| 1276075-40-1 | CC(C1=NNC2=C1C=C(Br)C=C2)C | 5-Bromo-3-isopropyl-1H-indazole | AG000X82 | 75g |
| 127625-29-0 | S1(=O)(=O)C2=CC=CC3=C2C(=CC=C3)N1CCCN1CCN(C2=CC=C(F)C=C2)CC1 | Fananserin | AG000X89 | 0.275g |
| 127607-71-0 | Cl[H].COC(=O)C1=CN=CN1 | Methyl 1H-imidazole-5-carboxylate hydrochloride | AG000X8H | 200g |
| 1276477-91-8 | OC(COc1cccc2[nH]c3ccccc3c12)COc4cccc5[nH]c6ccccc6c45 | 1,3-Bis(9H-carbazol-4-yloxy)-2-propanol(Carvedilol Impurity) | AG000X8J | 0.005g |
| 127653-16-1 | C(#CC#CC1=CC=C(C=O)C=C1)C1=CC=C(C=O)C=C1 | 4,4′-(Buta-1,3-diyne-1,4-diyl)dibenzaldehyde | AG000X8N | 10g |
| 127641-25-2 | C[C@H](N1CCCC1)[C@@H](C1=CC=CC=C1)O | (1R,2S)-1-Phenyl-2-(1-pyrrolidinyl)propan-1-ol | AG000X8U | 300g |
| 1276666-14-8 | C[C@@H]1CCN(CCN1)C1=NC2=C(O1)C=CC(Cl)=C2.OC(=O)[C@@H](OC(=O)C1=C | (R)-5-Chloro-2-(5-methyl-1,4-diazepan-1-yl)benzo[d]oxazole (2S,3S)-2,3-bis( | AG000X98 | 23g |
| 126959-88-4 | CNCC(=O)N[C@H](C(=O)N1CCC[C@H]1C(=O)N1CCC[C@H]1C(=O)NCC(=O)N[C@ | 1-8-Bradykinin, N2-(N-methylglycyl)-8-D-phenylalanine- | AG000WGZ | 0.05g |
| 126954-66-3 | N#CC1=C(Cl)N=CC(Cl)=C1 | 2,5-Dichloronicotinonitrile | AG000WH5 | 500g |
| 1269839-26-0 | CC(=O)O[C@@H](C[C@H](OC(=O)C)CCc1ccc(c(c1)O)O)CCc1ccc(cc1)O | 1,2-Benzenediol, 4-[(3R,5R)-3,5-bis(acetyloxy)-7-(4-hydroxyphenyl)heptyl]- | AG000WH9 | 0.005g |
| 1269839-24-8 | O[C@@H](C[C@H](OC(=O)C)CCc1ccc(cc1)O)CCc1ccc(cc1)O | 5-Hydroxy-1，7-bis(4-hydroxyphenyl)heptan-3-yl acetate | AG000WHA | 0.005g |
| 1269773-22-9 | FC1=CC=CC=C1[C@H](N)CO.[H]Cl | (2S)-2-Amino-2-(2-fluorophenyl)ethan-1-ol hcl | AG000WHC | 0.25g |
| 1269773-21-8 | FC1=CC=C([C@H](N)CO)C=C1.[H]Cl | (S)-2-AMino-2-(4-fluorophenyl)ethanol hydrochloride | AG000WHD | 1.5g |
| 1269755-11-4 | O=C([C@H]1CN(C(OCC2=CC=CC=C2)=O)C[C@H]1F)O | Cis-1-(benzyloxycarbonyl)-4-fluoropyrrolidine-3-carboxylic acid | AG000WHG | 1g |
| 126985-97-5 | C(N)(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](C(C)C)NC(=O)CNC(=O)[C@H](CC1= | Locustatachykinin I | AG000WHL | 0.01g |
| 1269969-36-9 | [C@H]1(C2CCCCC2)NCCOC1 | (R)-3-Cyclohexylmorpholine | AG000WHZ | 6g |
| 1269926-90-0 | C[C@](N)(CC1=CC=C(OC(F)(F)F)C=C1)C(O)=O | (S)-2-Amino-2-methyl-3-(4-(trifluoromethoxy)phenyl)propanoic acid | AG000WI0 | 1.25g |
| 126990-35-0 | CO[Si](C1CCCC1)(C2CCCC2)OC | DICYCLOPENTYLDIMETHOXYSILANE | AG000WI7 | 2500g |
| 127-19-5 | CC(N(C)C)=O | N,N-Dimethylacetamide | AG000WIF | 25000g |
| 127-17-3 | OC(=O)C(=O)C | Pyruvic acid | AG000WIG | 500g |
| 127-08-2 | CC([O-])=O.[K+] | Potassium Acetate | AG000WII | 125000g |
| 127-07-1 | O=C(N)NO | 1-Hydroxyurea | AG000WIJ | 6500g |
| 127852-31-7 | N#CC1=CC=CC([C@@H](C)N)=C1 | (R)-3-(1-Aminoethyl)benzonitrile | AG000XGV | 8g |
| 127852-29-3 | C[C@@H](O)C1=CC=CC=C1C(F)(F)F | (R)-1-[2-(TRIFLUOROMETHYL)PHENYL]ETHANOL | AG000XGW | 34g |
| 127852-28-2 | C[C@H](C1=CC(C(F)(F)F)=CC(C(F)(F)F)=C1)O | (R)-1-(3,5-Bis(trifluoromethyl)phenyl)ethanol | AG000XGX | 4000g |
| 127852-27-1 | C[C@H](O)C1=C(C=CC=C1)C(F)(F)F | (S)-1-[(2-Trifluoromethyl)phenyl]ethanol | AG000XGY | 35g |
| 127852-22-6 | N#CC1=CC=CC([C@H](C)N)=C1 | (S)-3-(1-Aminoethyl)benzonitrile | AG000XH0 | 3g |
| 127852-21-5 | C[C@H](N)C1=CC=CC(C(F)(F)F)=C1 | (S)-1-[3-(Trifluoromethyl)phenyl]ethylamine | AG000XH1 | 5g |
| 127862-89-9 | O=C(O)[C@@H](NC(OCC1=CC=CC=C1)=O)CCC2=CC=CC=C2 | Z-Homophe-OH | AG000XHT | 700g |
| 127862-88-8 | O=C(O)[C@@H](NC(OCC1=CC=CC=C1)=O)CC2=CC=CC=C2F | (S)-2-(((Benzyloxy)carbonyl)amino)-3-(2-fluorophenyl)propanoic acid | AG000XHU | 10g |
| 127892-62-0 | CCC1=NN(C)C(C(O)=O)=C1Cl | 4-Chloro-3-ethyl-1-methyl-1H-pyrazole-5-carboxylic acid | AG000XI7 | 1000g |
| 1279034-86-4 | O=C([C@H]1NC[C@@H](NC(OCC2=CC=CC=C2)=O)C1)O | (2S,4S)-4-(((Benzyloxy)carbonyl)amino)pyrrolidine-2-carboxylic acid | AG000XIU | 3g |
| 1279034-78-4 | O=C([C@H]1NC[C@@H](NC(OC(C)(C)C)=O)C1)O | (2S,4S)-4-Boc-amino pyrrolidine-2-carboxylic acid | AG000XIV | 10g |
| 1279032-67-5 | O=C([C@@H]1NC[C@@H](NC(OC(C)(C)C)=O)C1)OC.[H]Cl | (2R,4S)-Methyl 4-((tert-butoxycarbonyl)aMino)pyrrolidine-2-carboxylate hyd | AG000XIW | 10g |
| 1279032-31-3 | O[C@H]1C[C@@H](N)CC1.[H]Cl | Cyclopentanol, 3-amino-, hydrochloride (1:1), (1R,3S)- | AG000XIX | 200g |
| 1279032-06-2 | CC1=CC(Br)=CC=C1N2CCOCC2 | 4-(4-bromo-2-methylphenyl)morpholine | AG000XIY | 10g |
| 1279030-48-6 | O=C([C@@H]1NC[C@@H](NC(OC(C)(C)C)=O)C1)O | (2R,4S)-4-Boc-amino pyrrolidine-2-carboxylic acid | AG000XIZ | 10g |
| 1279026-90-2 | O=C(N[C@H]1C[C@@H](CO)NC1)OCC2=CC=CC=C2.[H]Cl | (2S,4S)-2-Hydroxymethyl-4-Cbz-aminopyrrolidine hydrochloride | AG000XJ1 | 1.25g |
| 1279026-43-5 | N[C@@H]1C[C@H](CO)N(C(OCC2=CC=CC=C2)=O)C1.[H]Cl | (2R,4R)-Benzyl 4-amino-2-(hydroxymethyl)pyrrolidine-1-carboxylate hydroch | AG000XJ5 | 3g |
| 127903-20-2 | OCCCCCCNC(OCC1C2=CC=CC=C2C3=CC=CC=C13)=O | 6-(Fmoc-amino)-1-hexanol | AG000XJA | 75g |
| 12738-64-6 | O([C@]1(CO)O[C@H](CO)[C@@H](O)[C@@H]1O)[C@H]2O[C@H](CO)[C@@H] | Saccharose benzoate | AG000X0W | 903g |
| 127406-08-0 | O=CC1=CC=C(C=C1)C1=CN=CC=N1 | 4-(Pyrazin-2-yl)benzaldehyde | AG000X10 | 10g |
| 127404-22-2 | O=CC1=CC=CC(N2C=CN=C2)=C1 | 3-(1H-Imidazol-1-yl)benzaldehyde | AG000X13 | 75g |
| 127399-78-4 | O=C1CCC2=C1C=C(OC)C(O)=C2 | 5-Hydroxy-6-Methoxy-1-Indanone | AG000X16 | 5g |
| 127389-09-7 | O=C(O)C1=CC=CC(OC2=CC=CC(C(F)(F)F)=C2)=C1 | 3-[3-(trifluoromethyl)phenoxy]benzoic acid | AG000X1I | 0.3g |
| 1274-06-2 | O=C(CCC)[C-]12[CH]3=[CH]4[CH]5=[CH]1[Fe+2]45678932[CH]=%10[CH]9=[CH]8[ | 1,1′-Bis(1-oxobutyl)ferrocene | AG000X1M | 125g |
| 127413-59-6 | CC(=O)C1=CC(=CC(Br)=C1)[N+]([O-])=O | 1-(3-Bromo-5-nitrophenyl)ethanone | AG000X1U | 10g |
| 127408-31-5 | O[C@H]1[C@H](N(C(C)=O)O)C2=CC(C#N)=CC=C2OC1(C)C | N-((3S,4R)-6-Cyano-3-hydroxy-2,2-dimethylchroman-4-yl)-N-hydroxyacetami | AG000X21 | 0.01g |
| 127408-30-4 | C(C1=CC=CC=C1)ON(C(C)=O)[C@H]1[C@@H](C(OC2=CC=C(C=C12)C#N)(C)C)O | N-(Benzyloxy)-N-((3S,4R)-6-cyano-3-hydroxy-2,2-dimethylchroman-4-yl)acet | AG000X22 | 2g |
| 127408-03-1 | NC1=CC=C(Br)C(F)=C1C | 4-Bromo-3-fluoro-2-methylaniline | AG000X23 | 40g |
| 127406-56-8 | O=CC1=CC=C(C2=NC=CC=C2)C=C1 | 2-(4-Formylphenyl)Pyridine | AG000X26 | 1500g |
| 127406-55-7 | O=CC1=CC=C(C2=CC=CN=C2)C=C1 | 4-(Pyridin-3-yl)benzaldehyde | AG000X27 | 50g |
| 127437-44-9 | O=C(C1=NC(Cl)=CC=C1C(O)=O)O | 6-Chloropyridine-2,3-dicarboxylic acid | AG000X2C | 10g |
| 127437-29-0 | CCOC(=O)C1=CC(=CC(=C1)Br)C(=O)OCC | Diethyl 5-bromoisophthalate | AG000X2D | 125g |
| 127428-62-0 | ClC1=CC=CC=C1C(N)CO | 2-Amino-2-(2-chlorophenyl)ethanol | AG000X2K | 10g |
| 127426-30-6 | ClC1=NC(=C(S1)Cl)C(=O)O | 2,5-DICHLOROTHIAZOLE-4-CARBOXYLIC ACID | AG000X2P | 20g |
| 127426-26-0 | N#CC1=C(Cl)SC(Cl)=N1 | 2,5-Dichlorothiazole-4-carbonitrile | AG000X2R | 2g |
| 127425-80-3 | O=C(O)CCC1=CC=C(Br)C(F)=C1 | 3-(4-Bromo-3-fluorophenyl)propanoic acid | AG000X2S | 25g |
| 127425-74-5 | O=C1CCC2=C1C=CC(Br)=C2F | 5-Bromo-4-fluoro-2,3-dihydro-1H-inden-1-one | AG000X2T | 30g |
| 127425-73-4 | FC1=CC(CBr)=CC=C1Br | 4-Bromo-3-fluorobenzyl bromide | AG000X2U | 25g |
| 127472-41-7 | O=C(C1=NN(CC)C2=C1C=CC=C2)O | 1-Ethyl-1H-indazole-3-carboxylic acid | AG000X31 | 75g |
| 127464-43-1 | OC1=CC=C(C)N=C1CC.O=C(O)CCC(O)=O | 2-Ethyl-6-methylpyridin-3-ol succinate | AG000X34 | 1000g |
| 127457-63-0 | O=C(O)CCOCCOCCOCC1=CC=CC=C1 | Propanoic acid, 3-[2-[2-(phenylmethoxy)ethoxy]ethoxy]- | AG000X37 | 12g |
| 127446-42-8 | O=C1NC2=C(C=C(Cl)C=N2)C=C1 | 6-Chloro-1,8-naphthyridin-2(1H)-one | AG000X3H | 20g |
| 127446-35-9 | O=Cc1ccncc1NC(=O)C(C)(C)C | N-(4-Formyl-pyridin-3-yl)-2,2-dimethyl-propionamide | AG000X3I | 1g |
| 127446-34-8 | ClC1=CC=C(C(=N1)NC(C(C)(C)C)=O)C=O | N-(6-Chloro-3-formylpyridin-2-yl)pivalamide | AG000X3J | 40g |
| 127446-31-5 | Cc1cnc(NC(=O)C(C)(C)C)c(C=O)c1 | N-(3-formyl-5-methylpyridin-2-yl)pivalamide | AG000X3K | 2g |
| 1274892-48-6 | S(=O)(=O)(O)O.OC1(=CC(NCC)=CC=C1).OC2(=CC(NCC)=CC=C2) | 3-(Ethylamino)phenol Hemisulfate | AG000X3Q | 5g |
| 127474-54-8 | C=CC[C@@H](NC(OCC1=CC=CC=C1)=O)C(O)=O | (R)-2-(((Benzyloxy)carbonyl)amino)pent-4-enoic acid | AG000X4C | 100g |
| 1274904-48-1 | N#CCC(CC#N)(C#N)C#N | 1,2,2,3-Propanetetracarbonitrile | AG000X4F | 0.25g |
| 127510-96-7 | C(=O)(OC)c1c(C#N)cc(cc1)F | Methyl 2-cyano-4-fluorobenzoate | AG000X4H | 1500g |
| 127510-95-6 | O=C(OC)C1=CC(OC)=CC=C1C#N | 2-Cyano-5-methoxy-benzoic acid methyl ester | AG000X4I | 40g |
| 1277178-00-3 | FC(C1=CN2C(C(Br)=C1)=NC=C2)(F)F | 8-Bromo-6-(trifluoromethyl)imidazo[1,2-a]pyridine | AG000XC0 | 4g |
| 1277168-52-1 | CC(C)(C)OC(=O)N1CCC[C@H]2NCC[C@H]21 | (3Ar,7ar)-rel-tert-butyl hexahydro-1h-pyrrolo[3,2-b]pyridine-4(2H)-carboxyla | AG000XC5 | 1g |
| 127717-19-5 | O=C(C1=C2C(C)=CC=CN2N=C1)OC | Methyl 4-methylpyrazolo[1,5-a]pyridine-3-carboxylate | AG000XCG | 4g |
| 12772-57-5 | ClC1=C(C=C(C2=C1CC(/C=C/C=C\[C@@H]1[C@@H](C[C@H](OC2=O)C)O1)=O)O) | (1aR,2Z,4E,14R,15aR)-8-Chloro-1a,14,15,15a-tetrahydro-9,11-dihydroxy-14-me | AG000XCJ | 0.005g |
| 127733-46-4 | C[C@@H](N)C1=CC=CC=C1C(F)(F)F | (R)-1-[2-(Trifluoromethyl)phenyl]ethylamine | AG000XCS | 15g |
| 127733-42-0 | C[C@@H](N)C1=CC=CC=C1Cl | (R)-1-(2-Chlorophenyl)ethanamine | AG000XCT | 8g |
| 127733-40-8 | C[C@H](N)C1=CC(C(F)(F)F)=CC(C(F)(F)F)=C1 | (S)-1-[3,5-Bis(trifluoromethyl)phenyl]ethylamine | AG000XCU | 5g |
| 127724-75-8 | O=C1C2=C(N=CC(Cl)=C2)CCC1 | 3-Chloro-7,8-dihydroquinolin-5(6H)-one | AG000XD1 | 6.7g |
| 127723-77-7 | C1=CC=C(C(=C1)[N+](=O)[O-])F | Benzene， 1-fluoro-2-nitro-， labeled with carbon-14 (9CI) | AG000XD4 | 200g |
| 127762-22-5 | OC(=O)/C=C/OCc1ccccc1 | (E)-3-(Benzyloxy)acrylic acid | AG000XDD | 50g |
| 127744-28-9 | O=C(OC)[C@@H](O)COCC1=CC=CC=C1 | (S)-3-BENZYLOXY-2-HYDROXY-PROPIONIC ACID METHYL ESTER | AG000XDU | 25g |
| 127744-27-8 | O[C@H](C(=O)O)COCc1ccccc1 | (S)-3-(Benzyloxy)-2-hydroxypropanoic acid | AG000XDV | 2g |
| 127785-96-0 | NCC1C2=CC=CC=C2CC3=CC=CC=C3N1.O=C(O)/C=C/C(O)=O | (6,11-Dihydro-5H-dibenzo[b,e]azepin-6-yl)methanamine fumarate | AG000XE4 | 1000g |
| 127783-36-2 | C[Si](C)(C)C#C[I+]C1=CC=CC=C1.[B-](F)(F)(F)F | Trimethylsilylethynyl(phenyl)iodonium tetrafluoroborate | AG000XE8 | 5g |
| 127783-34-0 | F[B-](F)(F)F.C#C[I+2]=c1[cH-]cccc1 | Ethynyl(phenyl)iodonium tetrafluoroborate | AG000XE9 | 1g |
| 127780-16-9 | O=S(C1=NC2=CC=C(OC(F)F)C=C2N1)(CC3=NC=CC(OC)=C3OC)=O | 6-(Difluoromethoxy)-2-(((3,4-dimethoxypyridin-2-yl)methyl)sulfonyl)-1H-be | AG000XED | 3g |
| 127799-54-6 | CNNC(OC(C)(C)C)=O | tert-Butyl 2-methylhydrazinecarboxylate | AG000XER | 200g |
| 1276666-12-6 | CC(CCN(CCN)C1=NC2=CC(Cl)=CC=C2O1)=O.CS(=O)(O)=O.CS(=O)(O)=O | 4-((2-Aminoethyl)(5-chlorobenzo[d]oxazol-2-yl)amino)butan-2-one dimetha | AG000X99 | 225g |
| 127667-01-0 | N#CC1=CC(OC)=CC=C1F | 2-Fluoro-5-methoxybenzonitrile | AG000X9D | 150g |
| 127667-00-9 | COC1=CC(C#N)=C(Cl)C=C1 | 2-Chloro-5-methoxybenzonitrile | AG000X9E | 50g |
| 127666-99-3 | N#CC1=CC=C(OC)C=C1Cl | 2-Chloro-4-methoxybenzonitrile | AG000X9F | 200g |
| 127657-97-0 | COC(OC)COCC1=CC=CC=C1 | Benzyloxyacetaldehyde dimethyl acetal | AG000X9O | 200g |
| 127657-29-8 | O=C(C1N(C(OCC)=O)CSC1)O | 3-Ethyl (-)-Thiazolidine-3,4-dicarboxylate | AG000X9Q | 25g |
| 127654-70-0 | IC1=C(F)C=CC=C1Cl | 1-Chloro-3-fluoro-2-iodobenzene | AG000X9U | 150g |
| 1276694-30-4 | O=C([C@@H]1N(C(OCC2C3=C(C4=C2C=CC=C4)C=CC=C3)=O)C[C@H](OC(C)(C)C) | (2R,4R)-1-(((9H-Fluoren-9-yl)methoxy)carbonyl)-4-(tert-butoxy)pyrrolidine-2 | AG000X9X | 10g |
| 127682-08-0 | N[C@@H](CC1=CC=CO1)C(O)=O | (S)-2-Amino-3-(furan-2-yl)propanoic acid hydrochloride | AG000XA1 | 3g |
| 127680-91-5 | N#CC1=CC=NC(N2CCOCC2)=C1 | 2-Morpholinoisonicotinonitrile | AG000XA2 | 15g |
| 127680-86-8 | N#CC1=NC=CC(N2CCCC2)=C1 | 4-(Pyrrolidin-1-yl)pyridine-2-carbonitrile | AG000XA5 | 20g |
| 127675-46-1 | O=CC1=CC=C(F)C(Cl)=C1F | 3-Chloro-2,4-difluorobenzaldehyde | AG000XAE | 150g |
| 127667-44-1 | CC(C1=CC(C(C)(C2=CC=C(OC#N)C=C2)C)=CC=C1)(C3=CC=C(OC#N)C=C3)C | 1,3-Bis(2-(4-cyanatophenyl)propan-2-yl)benzene | AG000XAF | 600g |
| 12769-16-3 | O=C1C2C(=C(C=CC=2NC)NC2C=CC=CC=2)C(=O)C2C=CC=CC1=2 | Oracet Blue B, for microscopy | AG000XB8 | 8g |
| 1277-49-2 | OC(C)[C-]12[CH]3=[CH]4[CH]5=[CH]1[Fe+2]67894532[CH]=%10[CH]9=[CH]8[CH-] | 1-Hydroxyethylferrocene | AG000XBW | 300g |
| 1277179-33-5 | N#CC1=C(Cl)N=C(N)N=C1Cl | 2-Amino-4,6-dichloropyrimidine-5-carbonitrile | AG000XBZ | 30g |
| 127559-33-5 | O=C(OC(C)(C)C)N[C@H](CO)COCC1=CC=CC=C1 | Boc-D-Serinol(Bzl) | AG000X53 | 100g |
| 127544-88-1 | CC1=CC(N(CCCCS(=O)(O)=O)CCCCS(=O)(O)=O)=CC=C1 | Sodium 4,4′-(m-tolylazanediyl)bis(butane-1-sulfonate) | AG000X59 | 10g |
| 127531-11-7 | O=C(O)[C@H](N)CCN.[H]Cl.[H]Cl | D-2,4-Diaminobutyric acid DiHCl | AG000X5F | 10g |
| 127527-24-6 | O=C(C1=NC=C(C(O)=O)C=N1)O | Pyrimidine-2,5-dicarboxylic acid | AG000X5H | 5g |
| 127519-17-9 | CCCCCCCCOC(=O)CCc1cc(c(O)c(c1)C(C)(C)C)n2nc3ccccc3n2 | Octyl 3-(3-(2H-benzo[d][1,2,3]triazol-2-yl)-5-(tert-butyl)-4-hydroxyphenyl)pr | AG000X5M | 200g |
| 127512-29-2 | C(OC(=O)CCCCCCC/C=CCCCCCCCC)(COC(=O)CCCCCCC/C=CCCCCCCCC)CN(C)C | 1,2-Dioleoyloxy-3-(dimethylamino)propane | AG000X5P | 2g |
| 127510-98-9 | O=C(C1C(C#N)=CC=CC=1C)OC | Methyl 2-cyano-6-methylbenzoate | AG000X5Q | 50g |
| 1275608-17-7 | CCC1=CC2=C(Cl)N=C(Cl)N=C2N1 | 2,4-dichloro-6-ethyl-7H-pyrrolo[2,3-d]pyrimidine | AG000X5R | 1g |
| 127561-71-1 | COc1cc(Cl)cnc1Br | 2-bromo-5-chloro-3-methoxypyridine | AG000X6B | 4g |
| 127561-70-0 | OC1=CC(Cl)=CN=C1Br | 2-Bromo-5-chloro-3-hydroxypyridine | AG000X6C | 10g |
| 127589-93-9 | CC(C)(C)OC(=O)N1C(COC1(C)C)C=O | tert-Butyl 4-formyl-2,2-dimethyloxazolidine-3-carboxylate | AG000X6H | 75g |
| 127589-63-3 | COC(=O)C(F)(F)C(F)(F)Cl | Propanoic acid, 3-chloro-2,2,3,3-tetrafluoro-, methyl ester | AG000X6J | 175g |
| 127582-76-7 | OC(=O)CCCCCCNC(=O)OCC1C2=CC=CC=C2C2=CC=CC=C12 | Fmoc-7-amino-heptanoic acid | AG000X6N | 200g |
| 127580-92-1 | C(=O)(c1ccc(cc1)Br)N1CCOCC1 | (4-Bromophenyl)-4-morpholinylmethanone | AG000X6V | 15g |
| 1276056-88-2 | NCC1=CC=C2N=CC=NC2=C1.[H]Cl | Quinoxalin-6-ylmethanamine hydrochloride | AG000X75 | 75g |
| 1273651-10-7 | O=C(C1=CC2=C(CCC2=O)C=C1F)OC | Methyl 6-fluoro-3-oxo-2,3-dihydro-1H-indene-5-carboxylate | AG000WZ0 | 8g |
| 1273613-81-2 | O=C1CCC2=C1C(F)=CC(Cl)=C2 | 5-CHLORO-7-FLUORO-1-INDANONE | AG000WZ2 | 75g |
| 1273611-01-0 | O=C1CCC2=C1C(Cl)=CC(Br)=C2 | 5-Bromo-7-chloro-1-indanone | AG000WZ4 | 5g |
| 1273609-67-8 | O=C1CCC2=C1C(C)=CC(Br)=C2 | 5-Bromo-7-methyl-2,3-dihydro-1H-inden-1-one | AG000WZ6 | 20g |
| 1273609-10-1 | BrC=1C=C2CCC(C2=C(C1)O)=O | 5-Bromo-7-hydroxy-2,3-dihydro-1H-inden-1-one | AG000WZ8 | 5g |
| 1273608-49-3 | O=C1CCC2=C1C=CC(Br)=C2Cl | 5-Bromo-4-chloro-1-indanone | AG000WZA | 0.25g |
| 1273597-02-6 | O=C1CCCC2=C1C=C(C)C(Br)=C2 | 6-Bromo-7-methyl-1,2,3,4-tetrahydronaphthalen-1-one | AG000WZG | 0.25g |
| 1273595-81-5 | O=C1CCC2=C1C=C(Br)C(F)=C2 | 6-Bromo-5-fluoro-1-indanone | AG000WZH | 125g |
| 1273676-14-4 | O=C1CCC2=C1C(OC)=CC(Cl)=C2 | 5-Chloro-7-methoxy-2,3-dihydro-1H-inden-1-one | AG000WZM | 0.75g |
| 127373-66-4 | O=C(O)CNC(C1=CC=CC=C1NS(=O)(C2=CC=C(OC(C(C)(C)C)=O)C=C2)=O)=O | Sivelestat | AG000WZW | 10g |
| 127371-55-5 | CC(C1=CC(F)=C(F)C=C1Br)=O | 1-(2-bromo-4,5-difluorophenyl)ethanone | AG000WZX | 75g |
| 127371-50-0 | O=[N+](C1=C(C)C=C(F)C(F)=C1)[O-] | 4,5-Difluoro-2-nitrotoluene | AG000WZY | 250g |
| 127369-30-6 | O=C(OC)[C@@H](N)C1=CC=C(O)C=C1.[H]Cl | (S)-METHYL 2-AMINO-2-(4-HYDROXYPHENYL)ACETATE HYDROCHLORIDE | AG000WZZ | 700g |
| 1272756-12-3 | O=C(O)C1=CC=C(F)C=C1OCC(O)=O | 2-(Carboxymethoxy)-4-fluorobenzoic acid | AG000WV3 | 25g |
| 1272756-11-2 | NCC1CCC(=O)N(CC2=CC=CC=C2)C1 | 1-Benzyl-5-(aminomethyl)piperidin-2-one | AG000WV4 | 20g |
| 1272756-10-1 | [O-][N+](=O)C1=CC2=C(NC3(CCC3)NC2=O)C=C1 | 6-NITROSPIRO[1,2,3,4-TETRAHYDROQUINAZOLINE-2,1′-CYCLOBUTANE]-4-ONE | AG000WV5 | 25g |
| 1272756-07-6 | C1(=CC=C(C=C1Cl)Br)N1CCOCC1 | 4-(4-Bromo-2-chlorophenyl)morpholine | AG000WV8 | 15g |
| 1272756-05-4 | CNC(CS(=O)(C)=O)=O | N-Methyl-2-(methylsulfonyl)acetamide | AG000WVA | 20g |
| 1272756-03-2 | COC(=O)c1c(cc(Br)cc1[N+]([O-])=O)[N+]([O-])=O | methyl 4-bromo-2,6-dinitrobenzoate | AG000WVC | 0.75g |
| 1272758-41-4 | O=C(N1CCC2(CCC(N)CC2)CC1)OC(C)(C)C | 9-AMino-3-Boc-3-azaspiro[5.5]undecane | AG000WVE | 25g |
| 1272758-40-3 | O=C(N1CCOCC(O)C1)OC(C)(C)C | N-Boc-6-hydroxy-1,4-oxazepane | AG000WVF | 100g |
| 1272758-17-4 | O=C(N1CC2(CCC(CC2)=O)CC1)OC(C)(C)C | 2-Boc-8-oxo-2-azaspiro[4.5]decane | AG000WVJ | 50g |
| 127285-54-5 | O=C1C=CNC2=C1C=C(OC)C(OC)=C2 | 6,7-Dimethoxy-1H-Quinolin-4-One | AG000WVU | 300g |
| 127285-08-9 | C(C)(C)N1CCC(CC1)N | 1-Isopropylpiperidin-4-amine | AG000WVX | 1000g |
| 1272966-06-9 | O1C2=CC=CC=C2OCC1C(N1CCC(C1)O)=O | (2,3-Dihydro-benzo[1,4]dioxin-2-yl)-(3-hydroxy-pyrrolidin-1-yl)-methanone | AG000WW4 | 1.5g |
| 127792-49-8 | ClC1=CC(CC#N)=C(Br)C=C1 | 2-BROMO-5-CHLOROPHENYLACETONITRILE | AG000XF5 | 125g |
| 127791-53-1 | OC(=O)/C=C/c1cccc(c1)N | (2E)-3-(3-Aminophenyl)-2-propenoic acid | AG000XFC | 10g |
| 127820-38-6 | [O-]S(=O)(=O)C(F)(F)F.Cc1ccc(cc1)[S+](c1ccc(C)cc1)c1ccc(C)cc1 | Tri-p-tolylsulfonium Trifluoromethanesulfonate | AG000XFG | 3g |
| 127818-58-0 | OC1=CC([N+]([O-])=O)=CC(C)=C1 | 3-Methyl-5-nitrophenol | AG000XFI | 10g |
| 127817-85-0 | COC1=CC(=C(C=C1)C(O)=O)C(F)(F)F | 4-Methoxy-2-(trifluoromethyl)benzoic acid | AG000XFJ | 20g |
| 127812-08-2 | O=C(O)COC1=CC=C(/C2=C3C=CC(/C(C4=CC=C(OCC(O)=O)C=C4)=C5C=C/C(N/5)=C | 5,10,15,20-Tetrakis(4-carboxymethyloxyphenyl)-21h,23h-porphine | AG000XFP | 2g |
| 127811-93-2 | COC(CCCCN=[N+]=[N-])=O | methyl 5-azidopentanoate | AG000XFR | 10g |
| 1278407-54-7 | Nc1ccn2c(c1)nc(c2)c1ccccc1 | Imidazo[1,2-a]pyridin-7-amine, 2-phenyl- | AG000XG3 | 5g |
| 127842-55-1 | CC(C1=CC=CC=C1OC(F)F)=O | 1-(2-(Difluoromethoxy)Phenyl)Ethanone | AG000XG4 | 75g |
| 127842-54-0 | O=CC1=CC=C(OC(F)F)C(OC(F)F)=C1 | 3,4-BIS-DIFLUOROMETHOXY-BENZALDEHYDE | AG000XG5 | 50g |
| 127838-58-8 | OCC1=CC(=O)NC=C1 | 4-(Hydroxymethyl)-2(1H)-pyridinone | AG000XGD | 75g |
| 127833-53-8 | c1ccc(cc1)CCc1ccc(cc1)Cc1cccc2c1cccc2 | 1-[4-(2-Phenylethyl)benzyl]naphthalene | AG000XGF | 50g |
| 127828-22-2 | O=C(OC(C)(C)C)NCCOCCN | N-Boc-2-(2-amino-ethoxy)ethylamine | AG000XGJ | 147g |
| 127827-54-7 | Brc1cc2cccnc2cc1Cl | 6-Bromo-7-chloroquinoline | AG000XGK | 2g |
| 127827-52-5 | FC1=C(Br)C=C2C=CC=NC2=C1 | 6-Bromo-7-fluoroquinoline | AG000XGL | 1000g |
| 1289388-63-1 | ClC1=NC=C(CNC2CC2)S1 | (2-Chloro-thiazol-5-ylmethyl)-cyclopropyl-amine | AG000YOH | 5g |
| 1289388-61-9 | N(C1=NC=CC(C)=N1)[C@@H]1CC[C@H](CC1)NC1=NC=CC(C)=N1 | trans-N1,N4-Bis(4-methylpyrimidin-2-yl)cyclohexane-1,4-diamine | AG000YOJ | 0.2g |
| 128947-19-3 | CCC(N([C@]1([H])[C@@](CC[C@@]2([H])C1)(C2(C)C)C3)S3(=O)=O)=O | N-Propionyl-(2S)-bornane-10，2-sultam | AG000YOR | 25g |
| 128942-39-2 | O=C(C1=CC(C2=C(O1)C=C(F)C=C2)=O)O | 7-Fluoro-4-oxo-4H-chromene-2-carboxylic acid | AG000YOX | 25g |
| 75899-68-2 | CCCCCC(O)C=CC=O | 4-hydroxy Nonenal | AG000YP4 | 0.1g |
| 1289585-20-1 | FC1=CC=C(S[C@H]2CN(C(OC(C)(C)C)=O)CC2)C=C1 | (R)-tert-Butyl 3-((4-fluorophenyl)thio)pyrrolidine-1-carboxylate | AG000YP5 | 11g |
| 1289585-18-7 | CC1=CC=C(C=C1)CN[C@@H]2CNCC2.[H]Cl | (S)-N-(4-Methylbenzyl)pyrrolidin-3-amine hydrochloride | AG000YP6 | 0.5g |
| 1289585-03-0 | ClC1=CC=C(S[C@@H]2CN(C(OC(C)(C)C)=O)CC2)C=C1 | (S)-tert-Butyl 3-((4-chlorophenyl)thio)pyrrolidine-1-carboxylate | AG000YPB | 10g |
| 1289585-02-9 | CC1=CC=CC=C1CN[C@@H]2CNCC2.[H]Cl | (S)-N-(2-Methylbenzyl)pyrrolidin-3-amine hydrochloride | AG000YPC | 0.5g |
| 1289584-92-4 | C1=C(C=CC(=C1)S[C@@H]2CCNC2)F.Cl | (R)-3-((4-Fluorophenyl)thio)pyrrolidine hydrochloride | AG000YPG | 10g |
| 1289584-88-8 | FC1=CC=C(S[C@@H]2CN(C(OC(C)(C)C)=O)CC2)C=C1 | (S)-tert-Butyl 3-((4-fluorophenyl)thio)pyrrolidine-1-carboxylate | AG000YPH | 9g |
| 1289584-82-2 | CC(C)(C)OC(=O)N1CC[C@H](Cl)C1 | (S)-tert-Butyl 3-chloropyrrolidine-1-carboxylate | AG000YPI | 25g |
| 1289514-24-4 | S=C(N[C@H]1[C@H](N2CCCCC2)CCCC1)NC3=CC(C(F)(F)F)=CC(C(F)(F)F)=C3 | N-[3,5-Bis(trifluoromethyl)phenyl]-N’-[(1R,2R)-2-(1-piperidinyl)cyclohexyl]th | AG000YPL | 2g |
| 128958-65-6 | O=C(NN)C1=CC=C(OCC2=CC=CC=C2)C=C1 | 4-Benzyloxybenzhydrazide | AG000YPN | 150g |
| 1289689-32-2 | C[C@H]1CN(CC1)C(=O)OC(C)(C)C | (R)-tert-Butyl 3-methylpyrrolidine-1-carboxylate | AG000YPW | 2g |
| 1289585-49-4 | CC1=CC=C(C=C1)CO[C@H]2CNCC2.[H]Cl | (R)-3-((4-Methylbenzyl)oxy)pyrrolidine hydrochloride | AG000YPZ | 0.3g |
| 1289585-46-1 | O=S([C@@H]1CN(C(OC(C)(C)C)=O)CC1)(C2=CC=C(Cl)C=C2)=O | (S)-tert-Butyl 3-((4-chlorophenyl)sulfonyl)pyrrolidine-1-carboxylate | AG000YQ0 | 0.5g |
| 1289585-33-6 | ClC1=CC=C(S[C@H]2CN(C(OC(C)(C)C)=O)CC2)C=C1 | (R)-tert-Butyl 3-((4-chlorophenyl)thio)pyrrolidine-1-carboxylate | AG000YQ3 | 11g |
| 1289585-27-8 | Cl[C@H]1CN(C(OC(C)(C)C)=O)CC1 | (R)-tert-Butyl 3-chloropyrrolidine-1-carboxylate | AG000YQ4 | 25g |
| 1289585-25-6 | CC(C)(C)OC(=O)N1CC[C@@H](C1)S(=O)(=O)C2=CC=C(C=C2)F | (S)-tert-Butyl 3-((4-fluorophenyl)sulfonyl)pyrrolidine-1-carboxylate | AG000YQ5 | 10g |
| 127985-74-4 | N1(CC(O)=O)CCN(CC(O)=O)CCN(CC(O)=O)CCN(CC(O)=O)CC1CC1=CC=C(N=C=S) | p-SCN-Bn-DOTA | AG000XNK | 0.5g |
| 15768-18-0 | [O-]C(=O)C(O)C.[Ag+].O | Silver, [2-(hydroxy-κO)propanoato-κO]- | AG000XNQ | 25g |
| 128-59-6 | O=C8(C=4(C7(=C3(C(C=6(C5(=C2(C(C1(=C(C=CC=C1)C(C2=CC=C5(C3=CC=4))=O))= | DIHYDROXYDIBENZANTHRONE | AG000XNS | 375g |
| 128-56-3 | O=S(C(C=CC=C1C(C2=C3C=CC=C2)=O)=C1C3=O)([O-])=O.[Na+] | Sodium 9,10-dioxo-9,10-dihydroanthracene-1-sulfonate | AG000XNU | 2000g |
| 128-53-0 | O=C(N1CC)C=CC1=O | 1-Ethyl-1H-pyrrole-2,5-dione | AG000XNW | 17g |
| 128-51-8 | O=C(OCCC1=CCC2CC1C2(C)C)C | Nopol acetate | AG000XNX | 4g |
| 128-39-2 | OC1=C(C(C)(C)C)C=CC=C1C(C)(C)C | 2,6-Di-tert-butylphenol | AG000XNZ | 1611g |
| 128-23-4 | C[C@@]12[C@@]3([C@]([C@]4([C@](C)(CC3)[C@@H](C(C)=O)CC4)[H])(CC[C | 5β-Pregnan-3,20-dione | AG000XO0 | 2g |
| 128-20-1 | C[C@@]12[C@@]3([C@]([C@]4([C@](C)(CC3)[C@@H](C(C)=O)CC4)[H])(CC[C | 3α-Hydroxy-5β-tetrahydroprogesterone | AG000XO1 | 0.3g |
| 128-09-6 | ClN1C(=O)CCC1=O | N-Chlorosuccinimide | AG000XO2 | 500g |
| 128-97-2 | O=C(C1=C2C(C(O)=O)=CC=C(C(O)=O)C2=C(C(O)=O)C=C1)O | Naphthalene-1,4,5,8-tetracarboxylic acid | AG000XO6 | 1300g |
| 128-94-9 | NC1=CC=C(C=2C(C3=C(C=CC(=C3C(C12)=O)N)O)=O)O | 1,8-Diamino-4,5-dihydroxyanthracene-9,10-dione | AG000XO8 | 0.2g |
| 128-93-8 | CNC1=C2C(C(C3=C(C2=O)C=CC=C3)=O)=C(Br)C=C1 | 1-Bromo-4-(methylamino)anthracene-9,10-dione | AG000XO9 | 1000g |
| 128-67-6 | C1=CC=C2C(=C1)C(=O)C3=C(C(=C(C=C3)C(=O)O)[N+](=O)[O-])C2=O | 1-Nitro-9,10-dioxo-9,10-dihydroanthracene-2-carboxylic acid | AG000XOI | 0.5g |
| 128-65-4 | O=C1N(C2=CC=CC=C2)C(C3=CC=C(C4=CC=C5C(N(C6=CC=CC=C6)C(C7=CC=C8C4=C | 2,9-Diphenylanthra[2,1,9-def:6,5,10-d’e’f’]diisoquinoline-1,3,8,10(2H,9H)-tetr | AG000XOJ | 3g |
| 1289386-00-0 | CC1=CC=CC=C1CN(CC2=CC=CC=C2C)CC3NCCCC3.[H]Cl | N,N-Bis(2-methylbenzyl)-1-(piperidin-2-yl)methanamine hydrochloride | AG000YL5 | 0.3g |
| 1289385-98-3 | O=C(C1CN(CC2=CC=C(Cl)N=C2)C1)O | 1-((6-CHLOROPYRIDIN-3-YL)METHYL)AZETIDINE-3-CARBOXYLIC ACID | AG000YL6 | 0.5g |
| 1289385-93-8 | O=C(N1CC(NC2=NC=C(F)C=N2)CC1)OC(C)(C)C | tert-Butyl 3-((5-fluoropyrimidin-2-yl)amino)pyrrolidine-1-carboxylate | AG000YL7 | 0.5g |
| 1289385-78-9 | C1CC(CNC1)CSC2=CC=C(C=C2)F.Cl | 3-(((4-Fluorophenyl)thio)methyl)piperidine hydrochloride | AG000YLC | 13g |
| 1289385-74-5 | Cl.CC1=CC=C(CNC2CCNCC2)C=C1 | N-(4-Methylbenzyl);piperidin-4-amine hydrochloride | AG000YLE | 0.5g |
| 1289385-66-5 | OCC1CN(C(C2=NC=CC=C2)C)CCC1 | (1-(1-(Pyridin-2-yl)ethyl)piperidin-3-yl)methanol | AG000YLJ | 0.5g |
| 1289385-58-5 | N#CC1=CC=CC=C1CN2CC(NC)CCC2.[H]Cl | 2-((3-(Methylamino)piperidin-1-yl)methyl)benzonitrile hydrochloride | AG000YLM | 1.25g |
| 1289387-03-6 | O=C(N1CCC(OC2=NC(C)=CC(Cl)=N2)CC1)OC(C)(C)C | tert-Butyl 4-((4-chloro-6-methylpyrimidin-2-yl)oxy)piperidine-1-carboxylate | AG000YLP | 1.25g |
| 1289386-94-2 | O=C(N1CCC(OC2=NC(Cl)=NC(C)=C2)CC1)OC(C)(C)C | tert-Butyl 4-((2-chloro-6-methylpyrimidin-4-yl)oxy)piperidine-1-carboxylate | AG000YLR | 0.75g |
| 1289386-88-4 | O=C(N1CC(Cl)CC1)OC(C)(C)C | tert-Butyl 3-chloropyrrolidine-1-carboxylate | AG000YLS | 0.1g |
| 1289386-75-9 | O=C(OC(C)(C)C)NC1C(NC2=NC=NC(Cl)=C2)CCCC1 | tert-Butyl (2-((6-chloropyrimidin-4-yl)amino)cyclohexyl)carbamate | AG000YLV | 0.5g |
| 1289386-69-1 | O=C(C1CN(C2=NC(Br)=CC=C2)C1)O | 1-(6-Bromopyridin-2-yl)azetidine-3-carboxylic acid | AG000YLW | 3g |
| 1289386-62-4 | Brc1nccc(c1)CNC1CC1 | (2-Bromo-pyridin-4-ylmethyl)-cyclopropyl-amine | AG000YLX | 2g |
| 1289386-57-7 | CC(NC1CCNCC1)C2=NC=CS2.[H]Cl | N-(1-(Thiazol-2-yl)ethyl)piperidin-4-amine hydrochloride | AG000YLY | 0.2g |
| 1289386-50-0 | Cl.N(CC1=CC=CC=C1C)C1CCNCC1 | N-(2-Methylbenzyl)piperidin-4-amine hydrochloride | AG000YM2 | 0.5g |
| 1289386-29-3 | N#CC1=CC=CC=C1CN(C)C2CCNCC2.[H]Cl | 2-((Methyl(piperidin-4-yl)amino)methyl)benzonitrile hydrochloride | AG000YM8 | 25g |
| 1289386-28-2 | O=S(C1=NC(OCC)=CC(Cl)=N1)C | 4-Chloro-6-ethoxy-2-(methylsulfinyl)pyrimidine | AG000YM9 | 2g |
| 1289386-27-1 | O=C(N1C(C)CN(C(C2=NC=CC=C2)C)CC1)OC(C)(C)C | tert-Butyl 2-methyl-4-(1-(pyridin-2-yl)ethyl)piperazine-1-carboxylate | AG000YMA | 0.5g |
| 1289386-23-7 | CC(N(C)C1CNCCC1)C2=NC=CS2.[H]Cl | N-Methyl-N-(1-(thiazol-2-yl)ethyl)piperidin-3-amine hydrochloride | AG000YMC | 0.15g |
| 1279106-02-3 | O=S(C1=NC=C(Br)C(C)=C1)(C)=O | 5-Bromo-4-methyl-2-(methylsulfonyl)pyridine | AG000XJJ | 2g |
| 1279088-80-0 | CC1(C)C(C)(C)OB(C2=NN(C3CCCCO3)C=C2)O1 | 1-(oxan-2-yl)-3-(tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole | AG000XJK | 125g |
| 1279048-81-5 | Cl.NC(=O)[C@H]1CCNC1 | (S)-Pyrrolidine-3-carboxaMide hydrochloride | AG000XJN | 10g |
| 1279039-34-7 | N[C@H]1C[C@H](CO)N(C(OC(C)(C)C)=O)C1.[H]Cl | (2R,4S)-tert-Butyl 4-amino-2-(hydroxymethyl)pyrrolidine-1-carboxylate hydr | AG000XJO | 6g |
| 1279038-54-8 | N[C@H]1C[C@@H](CO)N(C(OCC2=CC=CC=C2)=O)C1.[H]Cl | (2S,4S)-1-Cbz-2-Hydroxymethyl-4-aminopyrrolidine hydrochloride | AG000XJR | 2g |
| 1279038-36-6 | O=C([C@@H]1NC[C@H](NC(OC(C)(C)C)=O)C1)OC.[H]Cl | (2R,4R)-Methyl 4-((tert-butoxycarbonyl)amino)pyrrolidine-2-carboxylate hyd | AG000XJT | 5g |
| 1279038-32-2 | Cl.CC(C)(C)OC(=O)N1C[C@H](N)C[C@H]1CO | (2S,4R)-1-Boc-2-Hydroxymethyl-4-aminopyrrolidine hydrochloride | AG000XJV | 0.6g |
| 1279038-29-7 | O=C(OC(C)(C)C)N[C@H]1CN[C@H](C1)C(=O)O | (2R,4R)-4-((tert-Butoxycarbonyl)amino)pyrrolidine-2-carboxylic acid | AG000XJW | 2g |
| 1279037-14-7 | O=C(N1[C@H](CO)C[C@H](N)C1)OC(C)(C)C.[H]Cl | (2S,4S)-tert-Butyl 4-amino-2-(hydroxymethyl)pyrrolidine-1-carboxylate hydr | AG000XJY | 100g |
| 1279037-03-4 | Cl.F[C@H]1[C@H](F)CNC1 | (3R,4R)-3,4-difluoroPyrrolidine hydrochloride | AG000XJZ | 1g |
| 1279034-98-8 | CC(C)(C)OC(=O)N[C@H]1CN[C@@H](C1)C(O)=O | (2S,4R)-4-((tert-Butoxycarbonyl)amino)pyrrolidine-2-carboxylic acid | AG000XK0 | 1g |
| 1279200-14-4 | O=C(N1[C@@H](CO)C[C@H](N)C1)OCC2=CC=CC=C2 | (2R,4S)-Benzyl 4-Amino-2-(Hydroxymethyl)Pyrrolidine-1-Carboxylate | AG000XK7 | 5g |
| 1279123-64-6 | F[B-](F)(CCl)F.[K+] | Potassium chloromethyltrifluoroborate | AG000XK8 | 30g |
| 127923-85-7 | OC[C@H]([C@H]([C@@H]([C@H](C=O)O)O)O[C@@H]1O[C@H](CO)[C@@H]([ | Sialyl Lewis X-Lactose | AG000XKE | 0.005g |
| 127913-44-4 | N#CC[C@H](O)CCl | (S)-4-Chloro-3-hydroxybutyronitrile | AG000XKP | 7500g |
| 127956-27-8 | FC(C1=CC=C2C=CNC2=C1)F | 6-(Difluoromethyl)-1H-indole | AG000XL0 | 1g |
| 127162-96-3 | FC(C1=CC(CS(Cl)(=O)=O)=CC=C1)(F)F | 3-Trifluoromethylbenzylsulfonyl chloride | AG000WP9 | 5g |
| 127152-64-1 | BrC1=CC=C(CC2=NNN=N2)C=C1 | 5-(4-Bromobenzyl)-2H-tetrazole | AG000WPE | 20g |
| 127132-38-1 | O=C(O)[C@H](CC1=CC=C(C=C1)OCC=C)NC(OC(C)(C)C)=O | Boc-l-tyr(all)-oh | AG000WPP | 45.02g |
| 127132-32-5 | O=C(OCC)[C@@H](NC(OC(C)(C)C)=O)CC1=CC=C(OCC2=CC=CC=C2)C=C1 | (S)-Ethyl 3-(4-(benzyloxy)phenyl)-2-(tert-butoxycarbonylamino)propanoate | AG000WPQ | 20g |
| 127169-82-8 | O=C1CC2=C(C=CC=C2F)CC1 | 8-fluoro-3,4-dihydronaphthalen-2(1H)-one | AG000WPZ | 4g |
| 127169-17-9 | C(=O)(O)c1c2c(CN(C2)Cc2ccccc2)ccc1 | 1H-Isoindole-4-carboxylic acid, 2,3-dihydro-2-(phenylmethyl)- | AG000WQ0 | 4g |
| 127168-93-8 | O=C(C1=CC2=C(CNC2)C=C1)OC.[H]Cl | Methyl isoindoline-5-carboxylate hydrochloride | AG000WQ4 | 50g |
| 127168-90-5 | O=C(C1=CC=CC2=C1CNC2)OC.[H]Cl | METHYL ISOINDOLINE-4-CARBOXYLATE HCL | AG000WQ7 | 75g |
| 127168-84-7 | BrC1=CC2=C(CNC2)C=C1 | 5-bromo-2,3-dihydro-1H-isoindole | AG000WQA | 75g |
| 127168-82-5 | BrCC1=C(CBr)C(Br)=CC=C1 | 1-Bromo-2,3-bis(bromomethyl)benzene | AG000WQB | 10g |
| 128071-77-2 | O=CC1=C(Br)C=CN=C1F | 4-Bromo-2-fluoro-3-formylpyridine | AG000XQB | 150g |
| 128071-75-0 | BrC1=NC=CC=C1C=O | 2-Bromo-3-formylpyridine | AG000XQC | 2500g |
| 128055-74-3 | BrC6=CC2=C(C1=CC=C(C=C1C23C5=C(C4=CC=C(C=C34)Br)C=CC(=C5)Br)Br)C=C6 | 2,2′,7,7′-Tetrabromo-9,9′-spirobifluorene | AG000XQK | 1500g |
| 1280786-59-5 | O=C(OC(C)(C)C)C1=NC(Cl)=CC=C1 | tert-Butyl 6-chloropicolinate | AG000XQP | 125g |
| 128076-63-1 | O=C(C(C=C1)=C(C=C1OC)N2)OC2=O | 7-METHOXY-1H-BENZO[D][1,3] OXAZINE-2,4-DIONE | AG000XQW | 20g |
| 128073-50-7 | Cl.CCOC(=O)C1NCCC2=C1C=CC(O)=C2 | 6-Hydroxy-1,2,3,4-tetrahydro-isoquinoline-1-carboxylic acid ethyl ester, HCl | AG000XQZ | 1.25g |
| 128073-39-2 | Cl.CCOC(=O)C1CC2=CC(O)=CC=C2CN1 | Ethyl 6-hydroxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylate hydrochloride | AG000XR0 | 20g |
| 128073-33-6 | CC1(CC1(F)F)C(O)=O | 2,2-Difluoro-1-methylcyclopropanecarboxylic acid | AG000XR1 | 25g |
| 128073-16-5 | O=C(OCC)C1=NC=C(C(F)(F)F)C=C1Cl | 2-Pyridinecarboxylic acid, 3-chloro-5-(trifluoromethyl)-, ethyl ester | AG000XR3 | 70g |
| 128073-09-6 | O=C(O)C1=NC=C(OC)C=C1Cl | 3-CHLORO-5-METHOXYPICOLINIC ACID | AG000XR6 | 25g |
| 128073-03-0 | ClC(C1=NC=C(Cl)C=C1)=O | 5-Chloropicolinoyl chloride | AG000XRB | 5g |
| 128073-01-8 | OC(=O)C1=NC=C(F)C=C1Cl | 3-Chloro-5-fluoropicolinic acid | AG000XRC | 25g |
| 1280786-83-5 | Brc1ccc2c(c1)cnn2C(C)C | 5-Bromo-1-isopropylindazole | AG000XRF | 19.1g |
| 1280786-80-2 | O=CC1=CC(Br)=CC(Cl)=C1F | 5-Bromo-3-chloro-2-fluorobenzaldehyde | AG000XRI | 200g |
| 1280786-77-7 | CCCn1cc2c(n1)ccc(c2)Br | 5-Bromo-2-propyl-2H-indazole | AG000XRL | 5g |
| 1280786-76-6 | CCCn1ncc2c1ccc(c2)Br | 5-Bromo-1-propylindazole | AG000XRM | 5g |
| 1280786-61-9 | Brc1ccc2c(c1)cn(n2)C(C)C | 5-Bromo-2-isopropyl-2H-indazole | AG000XS1 | 2g |
| 128094-82-6 | COC(C1CCSCC1)=O | Methyl tetrahydro-2H-thiopyran-4-carboxylate | AG000XSJ | 75g |
| 128092-72-8 | OC(C1=CC=C(F)C=C1)(C2=CC=CC=C2F)C3=CC=CC=C3 | (2-Fluorophenyl)(4-fluorophenyl)(phenyl)methanol | AG000XSL | 20g |
| 127956-11-0 | COC(=O)C1COCCC1=O | Methyl 4-oxotetrahydro-2H-pyran-3-carboxylate | AG000XL3 | 200g |
| 127949-06-8 | CC(N1N=CC(C=O)=C1)(C)C | 1-tert-Butylpyrazole-4-carbaldehyde | AG000XL8 | 25g |
| 127946-77-4 | Cl.NC1(CC1)C#N | 1-Amino-1-cyclopropanecarbonitrile, HCl | AG000XLC | 751g |
| 1279691-35-8 | O[C@@]1(C2=CC=C(Cl)C(CC3=CC=C(O[C@@H]4COCC4)C=C3)=C2)[C@@H]([C@ | 1-Chloro-4-(β-D-glucopyranos-1-yl)-2-[4-((S)-tetrahydrofuran-3-yloxy)benzyl | AG000XLM | 0.25g |
| 127971-53-3 | CCC(NC1=C([N+]([O-])=O)C(C)=C(C(O)=O)C=C1[N+]([O-])=O)CC | 2-methyl-3,5-dinitro-4-[(pentan-3-yl)amino]benzoic acid | AG000XLO | 2g |
| 127958-63-8 | CC1CNC(CO1)=O | 6-Methylmorpholin-3-one | AG000XLX | 15g |
| 127958-60-5 | O=C1N[C@@H](C(C)C)COC1 | (S)-5-Isopropylmorpholin-3-one | AG000XLZ | 30g |
| 127958-23-0 | COCC(=O)C(=C/N(C)C)C(=O)OC | Methyl 4-Methoxy-2-dimethylaminomethylene-3-oxobutanoate | AG000XM1 | 3g |
| 127958-10-5 | O=C(O)C1(=C(N=C(C)N=C1)C2(=CC=CC=C2)) | 2-Methyl-4-phenyl-5-pyrimidinecarboxylic acid | AG000XM3 | 2g |
| 127958-08-1 | O=C(C1=CN=C(C)N=C1C(C)C)O | 2-Methyl-4-(propan-2-yl)pyrimidine-5-carboxylic acid | AG000XM4 | 3g |
| 1279821-55-4 | NC(=O)c1nc(Cl)ccc1Br | 3-bromo-6-chloropicolinamide | AG000XMA | 1g |
| 1279815-93-8 | FC(F)(F)C1CN(CCN1)C(=O)OCc1ccccc1 | Benzyl 3-(trifluoromethyl)piperazine-1-carboxylate | AG000XMD | 1g |
| 127980-46-5 | NC1=NC(OC)=C(OC)C=C1 | 2-Amino-5,6-dimethoxypyridine | AG000XMI | 30g |
| 127978-70-5 | OCC1=NC=C(OC)C=C1 | (5-Methoxypyridin-2-yl)methanol | AG000XML | 100g |
| 127972-27-4 | C1(C=CC(=CC=1)O)C1C=CC(=CC=1)OCC | 4′-Ethoxy-[1,1′-biphenyl]-4-ol | AG000XMS | 10g |
| 1289384-70-8 | O=C(C1CN(C2=NC(SC)=NC(Cl)=C2)C1)O | 1-(6-CHLORO-2-(METHYLTHIO)PYRIMIDIN-4-YL)AZETIDINE-3-CARBOXYLIC ACID | AG000YJM | 0.3g |
| 1289271-27-7 | BrC=1C=NC=CC1OC(C)C | 3-Bromo-4-isopropoxypyridine | AG000YJQ | 7g |
| 1289270-73-0 | Brc1cnc(c(c1)C)OCc1ccccc1 | 2-(benzyloxy)-5-bromo-3-methylpyridine | AG000YJR | 30g |
| 1289267-53-3 | Nc1nc2n(c1)ccnc2 | Imidazo[1,2-a]pyrazin-2-amine | AG000YJS | 5g |
| 1289215-25-3 | CC(OC1=NC(Cl)=NC=C1Br)C | 5-Bromo-2-chloro-4-(propan-2-yloxy)pyrimidine | AG000YJV | 25g |
| 1289207-30-2 | N#CC1=CC(Br)=CN1C | 4-Bromo-1-methyl-1H-pyrrole-2-carbonitrile | AG000YJY | 1g |
| 128924-01-6 | C(C1=CC=CC=C1)OC1=CC(=CC(=C1)Br)Br | 1-(Benzyloxy)-3,5-dibromobenzene | AG000YK8 | 20g |
| 1289385-49-4 | CC(N1CCC(NC)CC1)C2=NC=CC=C2.[H]Cl | N-Methyl-1-(1-(pyridin-2-yl)ethyl)piperidin-4-amine hydrochloride | AG000YKE | 0.3g |
| 1289385-42-7 | O=C(C1CN(CC2=C(F)C=CC=C2Cl)C1)OCC3=C(F)C=CC=C3Cl | 2-Chloro-6-fluorobenzyl 1-(2-chloro-6-fluorobenzyl)azetidine-3-carboxylate | AG000YKI | 0.5g |
| 1289385-41-6 | CC1=CN=C(OC)N=C1Cl | 4-Chloro-2-methoxy-5-methylpyrimidine | AG000YKJ | 5g |
| 1289385-30-3 | O=S(C1=NC(OC)=CC(Cl)=N1)C | 4-Chloro-6-methoxy-2-(methylsulfinyl)pyrimidine | AG000YKO | 2g |
| 1289385-24-5 | CC1=CN=C(NC2CC2)N=C1Cl | (4-Chloro-5-methyl-pyrimidin-2-yl)-cyclopropyl-amine | AG000YKP | 1.165g |
| 1289385-19-8 | ClC1=CN=C(NC2CC2)N=C1 | (5-Chloro-pyrimidin-2-yl)-cyclopropyl-amine | AG000YKQ | 27g |
| 1289384-88-8 | CC1=CC=CC=C1COCC2CCNCC2.[H]Cl | 4-(2-Methyl-benzyloxymethyl)-piperidine hydrochloride | AG000YKS | 1.756g |
| 1289384-85-5 | O=C(OC(C)(C)C)NC1CCC(NC2=NC(SC)=NC=C2)CC1 | tert-Butyl (4-((2-(methylthio)pyrimidin-4-yl)amino)cyclohexyl)carbamate | AG000YKT | 0.5g |
| 1289384-77-5 | CC1=CC=CC=C1CNC2CNCC2.[H]Cl | N-(2-Methylbenzyl)pyrrolidin-3-amine hydrochloride | AG000YKV | 0.5g |
| 1289384-74-2 | CC1=CC=CC=C1CNC2CNCCC2.[H]Cl | N-(2-Methylbenzyl)piperidin-3-amine hydrochloride | AG000YKX | 0.5g |
| 1289384-72-0 | FC1=CC=C(SCC2CCNCC2)C=C1.[H]Cl | 4-(((4-Fluorophenyl)thio)methyl)piperidine hydrochloride | AG000YKY | 2g |
| 1289384-71-9 | O=C(OC(C)(C)C)NC1CCN(CC1)C(c1ccccn1)C | tert-Butyl (1-(1-(pyridin-2-yl)ethyl)piperidin-4-yl)carbamate | AG000YKZ | 0.5g |
| 1289386-08-8 | CC1=CC=CC=C1CN(CC2=CC=CC=C2C)CC3CNCCC3.[H]Cl | N,N-Bis(2-methylbenzyl)-1-(piperidin-3-yl)methanamine hydrochloride | AG000YL3 | 0.3g |
| 127972-17-2 | CC1=CC(B(O)O)=C(OCC2=CC=CC=C2)C=C1 | 2-(benzyloxy)-5-methylphenylboronic acid | AG000XMT | 50g |
| 127972-02-5 | COC1=C(C=C(C=O)C=C1)B(O)O | 5-Formyl-2-methoxyphenylboronic acid | AG000XMU | 350g |
| 127972-00-3 | OB(C1=CC(C)=CC=C1OC)O | 2-Methoxy-5-methylphenylboronic acid | AG000XMV | 500g |
| 127971-97-5 | O=C(O)C1=C(Br)C=CC(OC)=C1[N+]([O-])=O | 6-Bromo-3-methoxy-2-nitrobenzoic acid | AG000XMW | 0.5g |
| 1279894-03-9 | ClC1=C2N=CC=C(Cl)C2=CC=N1 | 4,8-dichloro-1,7-naphthyridine | AG000XMZ | 10g |
| 1279893-97-8 | O=C(C1C(C2=CC=CN=C2O1)=O)OCC | Ethyl 3-oxo-2,3-dihydrofuro[2,3-b]pyridine-2-carboxylate | AG000XN1 | 15g |
| 1279872-89-7 | O=S(=O)(c1ccccc1)n1ccc2cncnc21 | 7-(Phenylsulfonyl)-7h-pyrrolo[2,3-d]pyrimidine | AG000XN2 | 25g |
| 1279866-58-8 | O=C(N(CC1)CCC21CCCNC2)OC(C)(C)C.[H]Cl | tert-Butyl 2,9-diazaspiro[5.5]undecane-9-carboxylate hydrochloride | AG000XN5 | 100g |
| 1279865-14-3 | C(#N)c1c(F)cc(cc1N)Br | 2-Amino-4-bromo-6-fluorobenzonitrile | AG000XN6 | 2500g |
| 1279863-38-5 | O=C(C1=CC2=C(NN=C2I)C=C1)OCC | Ethyl 3-Iodo-1H-Indazole-5-Carboxylate | AG000XN7 | 50g |
| 1279856-08-4 | O=C(N(CCC1)CC21CCNC2)OC(C)(C)C.[H]Cl | tert-Butyl 2,7-diazaspiro[4.5]decane-7-carboxylate hydrochloride | AG000XN8 | 40g |
| 1279844-25-5 | Cl.CC(OC(N1CC2(CNC2)CCC1)=O)(C)C | tert-Butyl 2,6-diazaspiro[3.5]nonane-6-carboxylate hydrochloride | AG000XNA | 55g |
| 1279822-69-3 | O=C(OC(C)(C)C)NC1=NC=CN1C | tert-Butyl (1-methyl-1H-imidazol-2-yl)carbamate | AG000XNB | 0.2g |
| 1279822-48-8 | CC(C1=CN=C(Cl)N=C1)O | 1-(2-Chloropyrimidin-5-yl)ethanol | AG000XNC | 1g |
| 127986-84-9 | OC(c1ccc2c(c1)cccc2)(c1ccc2c(c1)cccc2)[C@@H]1CCCN1 | (S)-Di(naphthalen-2-yl)(pyrrolidin-2-yl)methanol | AG000XNJ | 15g |
| 128-63-2 | BrC1=CC(Br)=C2C=CC3=C(Br)C=C(Br)C4=C3C2=C1C=C4 | 1,3,6,8-tetrabromopyrene | AG000XOL | 2500g |
| 128019-59-0 | O=C(C1NCCN(C(OC(C)(C)C)=O)C1)O | 4-N-Boc-Piperazine-2-carboxylic acid | AG000XON | 200g |
| 128019-31-8 | O=C(O)C1=C(OCC2=CC=CC=C2)C=C3C=CC=CC3=C1 | 3-(Phenylmethoxy)-2-naphthalenecarboxylic acid | AG000XOO | 101g |
| 128009-32-5 | O=C(C1=CC=C(C(F)(F)F)S1)O | 5-(Trifluoromethyl)Thiophene-2-Carboxylic Acid | AG000XOZ | 10g |
| 1280210-80-1 | O=S(N1N=C(CNC2)C2=C1)(C)=O.O=S(C3=CC=CC=C3)(O)=O | 2-(methylsulfonyl)-2,4,5,6-tetrahydropyrrolo[3,4-c]pyrazole benzenesulfonat | AG000XPB | 50g |
| 1280210-79-8 | O=C(N1CC2=NNC=C2C1)OC(C)(C)C | tert-Butyl 4,6-dihydropyrrolo[3,4-c]pyrazole-5(2H)-carboxylate | AG000XPC | 51g |
| 1280197-11-6 | CCOC(=O)C(=O)C1=CC=C(OC)N=C1 | Ethyl 2-(6-methoxy-3-pyridyl)-2-oxoacetate | AG000XPE | 3.5g |
| 128052-92-6 | N[C@@H]1CCC[C@@H]1C(=O)O.Cl | Cis-2-amino-cyclopentanecarboxylic acid hydrochloride | AG000XPF | 1g |
| 1280665-90-8 | NC=1C=CC(=C2CC(OC21)(C)C)C(=O)OC | Methyl 7-amino-2,2-dimethyl-2,3-dihydrobenzofuran-4-carboxylate | AG000XQ0 | 0.5g |
| 128072-94-6 | O=C(OCC)C1=NC=C(C(F)(F)F)C=C1 | Ethyl 5-(trifluoromethyl)picolinate | AG000XQ2 | 125g |
| 128072-93-5 | O=C(OCC)C1=NC=C(Cl)C=C1 | Ethyl 5-chloropicolinate | AG000XQ3 | 10g |
| 128071-98-7 | C1=CN=C(C=C1Br)F | 4-BROMO-2-FLUOROPYRIDINE | AG000XQ5 | 801.4g |
| 128071-93-2 | CC1=C(Br)C=CN=C1Br | 2,4-Dibromo-3-Methylpyridine | AG000XQ6 | 15g |
| 128071-91-0 | O=CC1=C(Br)N=CC=C1Br | 2,4-Dibromonicotinaldehyde | AG000XQ7 | 125g |
| 128071-86-3 | CC1=C(Br)C=CN=C1Cl | 4-Bromo-2-chloro-3-methylpyridine | AG000XQ8 | 75g |
| 128071-84-1 | O=CC1=C(Br)C=CN=C1Cl | 4-Bromo-2-chloropyridine-3-carbaldehyde | AG000XQ9 | 30g |
| 128071-79-4 | CC1=C(Br)C=CN=C1F | 4-bromo-2-fluoro-3-methylpyridine | AG000XQA | 200g |
| 1283717-69-0 | CC1=C(F)C=CC(CO)=N1 | (5-FLUORO-6-METHYLPYRIDIN-2-YL)METHANOL | AG000Y0J | 5g |
| 1283717-58-7 | FC(C1CCNCC1)F.[H]Cl | 4-(Difluoromethyl)piperidine hydrochloride | AG000Y0K | 10g |
| 1283658-79-6 | BrCC(NCCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)ON1C(CCC1=O)=O)=O | 4,7,10,13,16,19,22,25-Octaoxa-28-azatriacontanoic acid, 30-bromo-29-oxo-, 2, | AG000Y0M | 0.5g |
| 128372-89-4 | O=C(N1CCC=CC1=O)OC(C)(C)C | Tert-butyl 2-oxo-5,6-dihydropyridine-1(2H)-carboxylate | AG000Y0N | 25g |
| 128363-76-8 | CC(PC(C)(C)C)(C)C.B | Boron, [bis(1,1-dimethylethyl)phosphine]trihydro-, (T-4)- | AG000Y0Y | 80g |
| 128389-81-1 | C1CC2(COCC2)NC1 | 7-Oxa-1-azaspiro[4.4]nonane hemioxalate | AG000Y17 | 1g |
| 128388-54-5 | OB(O)C1=CC(=CC(=C1)C1=CC=CC=C1)C1=CC=CC=C1 | (3,5-Diphenylphenyl)boronic acid | AG000Y18 | 200g |
| 128388-53-4 | C[Si](C)(C)C1=CC(C2=CC=CC=C2)=CC(C3=CC=CC=C3)=C1 | (M-TERPHENYL-5′-YL)TRIMETHYLSILANE | AG000Y19 | 15g |
| 128376-66-9 | O=Cc1ccc(cc1)B1OCCN(CCO1)C | Benzaldehyde, 4-(tetrahydro-6-methyl-4H-1,3,6,2-dioxazaborocin-2-yl)- | AG000Y1H | 2g |
| 128376-65-8 | CC1(C)COB(OC1)C1=CC=C(C=O)C=C1 | 4-(5,5-Dimethyl-1,3,2-dioxaborinan-2-yl)benzaldehyde | AG000Y1I | 100g |
| 128376-64-7 | CC1(C)OB(OC1(C)C)C1=CC=C(C=O)C=C1 | 4-Formylphenylboronic acid pinacol cyclic ester | AG000Y1J | 1000g |
| 128406-10-0 | BrC1=CC=C(C2(C3=CC=C(Br)C=C3)C4=C(C5=C2C=CC=C5)C=CC=C4)C=C1 | 9,9-Bis(4-bromophenyl)-9H-fluorene | AG000Y1V | 10g |
| 128404-37-5 | FC(F)(F)[C@@H](N)C1=CC=CC=C1.[H]Cl | (S)-2,2,2-TRIFLUORO-1-PHENYLETHYLAMINE HCL | AG000Y1X | 0.75g |
| 128403-22-5 | CC(C1=CC=C(C(F)(F)F)C=C1[N+]([O-])=O)=O | 1-(2-Nitro-4-(trifluoromethyl)phenyl)ethanone | AG000Y1Z | 2g |
| 128397-41-1 | OC12CC3=C(C[N+]2(CCC2=C1C=C1C(OCO1)=C2)C)C2=C(OCO2)C=C3 | 6,7,12b,13-Tetrahydro-12b-hydroxy-5-methyl-4H-bis[1,3]benzodioxolo[5,6-a: | AG000Y26 | 0.3g |
| 14753-05-0 | CCCC(CCl)C | 1-Chloro-2-methylpentane | AG000Y2B | 75g |
| 128184-01-0 | BrC1=CC(=NC(=C1)C=O)C=O | 4-Bromopyridine-2,6-dicarbaldehyde | AG000XUB | 6g |
| 128173-50-2 | N#CCCCCN(OCC1=CC=CC=C1)C(OC(C)(C)C)=O | tert-Butyl benzyloxy(4-cyanobutyl)carbamate | AG000XUI | 10g |
| 128156-54-7 | COC(=O)C1=CC=CC2=C1N=CO2 | Methyl benzo[d]oxazole-4-carboxylate | AG000XUO | 3g |
| 1282042-79-8 | O=C(OC(C)(C)C)N[C@H](C(=O)O)Cc1ccc(cc1)c1cccc(c1)Cl | [1,1′-Biphenyl]-4-propanoic acid, 3′-chloro-α-[[(1,1-dimethylethoxy)carbonyl | AG000XUS | 2g |
| 1282041-94-4 | CC1=NC2=NC(C(F)(F)C)=NN2C(NC3=CC=C(C=C3)S(F)(F)(F)(F)F)=C1 | DSM 265 | AG000XUT | 0.1g |
| 128208-00-4 | C(C1CNCCO1)N1CCCC1 | 2-((PYRROLIDIN-1-YL)METHYL) MORPHOLINE | AG000XV3 | 10g |
| 128201-89-8 | O=C(CCCC=C/CC=C/CC=C/CC=C/CCCCC)NCCCC(=O)O | 4-[[(5Z,8Z,11Z,14Z)-1-Oxo-5,8,11,14-eicosatetraen-1-yl]amino]butanoic acid | AG000XVA | 0.2g |
| 128200-32-8 | NC(=O)C1=CNC2=C1C=C(C=C2)[N+]([O-])=O | 5-Nitro-1H-indole-3-carboxamide | AG000XVC | 1g |
| 128231-55-0 | NNC1=CC=C(C(C)(C)C)C=C1.[H]Cl | (4-(tert-Butyl)phenyl)hydrazine hydrochloride | AG000XVV | 1000g |
| 128229-06-1 | CC1=CN=C(CCl)C=N1.[H]Cl | 2-(Chloromethyl)-5-methylpyrazine hydrochloride | AG000XVW | 10g |
| 128228-96-6 | S1C(=CC=C1)C1=NNC(=C1)C(F)(F)F | 3-(Thiophen-2-yl)-5-(trifluoromethyl)-1H-pyrazole | AG000XVX | 2g |
| 128225-66-1 | O=CC1=CN(C)N=C1C(F)(F)F | 1-Methyl-3-(trifluoromethyl)pyrazole-4-carbaldehyde | AG000XW0 | 90g |
| 1282532-00-6 | Cl.FC1(F)CNCCC12CC2 | 4,4-Difluoro-6-azaspiro[2.5]octane, HCl | AG000XW5 | 10g |
| 1282530-99-7 | CC1(C)OB(OC1(C)C)C1=CN(CS(C)(=O)=O)N=C1 | 1-(methanesulfonylmethyl)-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyra | AG000XW6 | 10g |
| 1282518-60-8 | CC1(C)C(C)(C)OB(C2=CC=NN2C(C)C)O1 | 1-Isopropyl-1H-pyrazole-5-boronic acid, pinacol ester | AG000XW8 | 150.15g |
| 1282516-69-1 | Brc1ccc2c(c1)OCCn1cc(I)nc1-2 | 9-BROMO-2-IODO-5,6-DIHYDROBENZO[F]IMIDAZO[1,2-D][1,4]OXAZEPINE | AG000XWC | 325g |
| 1282516-66-8 | OC1=CC(Br)=CC=C1C2=NC=CN2 | 5-bromo-2-(1H-imidazol-2-yl)phenol | AG000XWD | 20g |
| 128270-60-0 | N[C@@H](C(N1[C@H](C(N[C@@H](CCCNC(N)=N)C(N2[C@H](C(NCC(NCC(NCC | Bivalirudin | AG000XXZ | 0.2g |
| 128263-66-1 | Cl.CS(=O)(=O)NC1=CC=C(CN)C=C1 | 4-(Methylsulfonylamino)benzylamine, HCl | AG000XY6 | 10g |
| 1283095-48-6 | C(=O)(OC(C)(C)C)N1CCC2(CC1)c1c(CCO2)ccs1 | Spiro[piperidine-4,7′-[7H]thieno[2,3-c]pyran]-1-carboxylic acid, 4′,5′-dihydro- | AG000XYB | 7g |
| 128312-11-8 | CSC1=CC=CC(=C1)B(O)O | 3-Methylthiophenylboronic acid | AG000XYI | 50g |
| 128311-06-8 | Cl.Cl.C[C@@H](N[C@@H]1CN2CCC1CC2)C1=CC=CC=C1 | (R)-N-((S)-1-Phenylethyl)quinuclidin-3-amine dihydrochloride | AG000XYK | 4g |
| 1283176-45-3 | O=C(OC(C)(C)C)NC1=CC=CC(Cl)=C1[N+]([O-])=O | tert-Butyl (3-chloro-2-nitrophenyl)carbamate | AG000XYY | 0.5g |
| 128345-57-3 | N[C@@H]1CNCC1 | (3S)-pyrrolidin-3-amine | AG000XZ3 | 1g |
| 128327-59-3 | O=C(C)C1=CC=C(N)S1 | 1-(5-Aminothiophen-2-yl)ethanone | AG000XZA | 0.2g |
| 128322-44-1 | COC1=CC=C(C2=CN3C(N=C(C)C3=O)=CN2)C=C1.Cl | MCLA (hydrochloride) | AG000XZD | 0.05g |
| 128312-69-6 | BrCC(C1CCC1)=O | 2-Bromo-1-Cyclobutylethanone | AG000XZK | 50g |
| 128349-50-8 | NC(C1=CC(Cl)=C(Cl)C=C1)C(O)=O | 2-Amino-2-(3,4-dichlorophenyl)acetic Acid | AG000Y01 | 25g |
| 2873-74-7 | O=C(Cl)CCCC(Cl)=O | Glutaryl chloride | AG000Y0A | 375g |
| 1283720-60-4 | NCc1sc(nc1C(F)(F)F)C | (2-Methyl-4-(trifluoromethyl)thiazol-5-yl)methanamine | AG000Y0B | 2g |
| 1283719-92-5 | FC(C1=CC=CC2=C1C(Cl)=NC=C2)(F)F | 1-Chloro-8-(trifluoromethyl)isoquinoline | AG000Y0C | 5g |
| 1283719-51-6 | OCC12CC3C(F)(F)C(C2)CC(C3)C1 | (4,4-difluoroadamantan-1-yl)methanol | AG000Y0F | 0.5g |
| 1286734-85-7 | FC1=C(Br)C=C2NN=CC2=C1 | 6-bromo-5-fluoro-1H-indazole | AG000YA9 | 200g |
| 1286734-84-6 | O=C(C1=CN=C(C(F)(F)F)S1)O | 2-(Trifluoromethyl)-1,3-thiazole-5-carboxylic acid | AG000YAA | 75g |
| 1286734-82-4 | O=[N+](C1=C(C)C(F)=CC=C1Br)[O-] | 1-Bromo-4-fluoro-3-methyl-2-nitrobenzene | AG000YAB | 200g |
| 1286734-78-8 | C1=C2C(=CC(=C1F)Br)NN=C2Cl | 6-Bromo-3-chloro-5-fluoro-1H-indazole | AG000YAE | 1g |
| 1286734-77-7 | IC1=NNC2=C1C=C(F)C(Br)=C2 | 6-Bromo-5-fluoro-3-iodo-1H-indazole | AG000YAF | 20g |
| 1286734-76-6 | FC1=CC2=C(N(C3CCCCO3)N=C2)C=C1Br | 6-Bromo-5-fluoro-1-(tetrahydro-2H-pyran-2-yl)-1H-indazole | AG000YAG | 1g |
| 1286693-23-9 | N#CC1=CC=CC([C@H](N)C)=C1.[H]Cl | (R)-3-(1-Aminoethyl)benzonitrile-HCl | AG000YAH | 2g |
| 128670-46-2 | O=C(O)C1=CC(N)=CC(OC)=C1OC | 5-Amino-2,3-dimethoxybenzoic acid | AG000YAI | 3g |
| 128666-05-7 | COc1cnc([nH]1)c1ccccc1 | 1H-Imidazole, 5-methoxy-2-phenyl- | AG000YAM | 2g |
| 1286776-82-6 | C[Si](CCOCN1C(B(O)O)=CC2=CC=CN=C21)(C)C | (1-((2-(Trimethylsilyl)ethoxy)methyl)-1H-pyrrolo[2,3-b]pyridin-2-yl)boronic a | AG000YAS | 5g |
| 1286770-55-5 | C[C@@]1(c2cc(NC(=O)c3ccc(cn3)F)ccc2F)CS(=O)(=O)N(C(=N1)N)C | N-[3-[(5R)-3-Amino-5,6-dihydro-2,5-dimethyl-1,1-dioxido-2H-1,2,4-thiadiazin | AG000YAT | 0.2g |
| 1286768-73-7 | O=C(OCc1ccccc1)NC[C@H]1CNCCO1 | (R)-Benzyl (morpholin-2-ylmethyl)carbamate oxalate | AG000YAW | 0.5g |
| 1286768-32-8 | O=C([C@@]1(NCCC1)C)OC.Cl | (R)-Methyl 2-methylpyrrolidine-2-carboxylate hydrochloride | AG000YAY | 15g |
| 1286768-31-7 | CC([C@H]1CNCCO1)C | (S)-2-Isopropylmorpholine | AG000YAZ | 10g |
| 1286754-61-7 | O=C(N1N=CC2=C(Br)C=CN=C21)OC(C)(C)C | tert-Butyl 4-bromo-1H-pyrazolo[3,4-b]pyridine-1-carboxylate | AG000YB2 | 13g |
| 1286754-47-9 | O=C(O)c1n[nH]c2nccnc12 | 1H-PYRAZOLO[3,4-B]PYRAZINE-3-CARBOXYLIC ACID | AG000YB3 | 1g |
| 128562-95-8 | FC(C1=CC=CC2=C1C=CN2)(F)F | 4-(Trifluoromethyl)-1H-indole | AG000Y6P | 15g |
| 128562-25-4 | C1(C2NCCC2)=CC=NC=C1 | 4-Pyrrolidin-2-ylpyridine | AG000Y6Q | 25g |
| 1285718-21-9 | C1CC2=C(C1)C(=CC=C2)I | 4-Iodo-2,3-dihydro-1H-indene | AG000Y77 | 8g |
| 128593-40-8 | CCOC(=O)c1[nH]c2c(c1)cc(c(c2)Br)OC | Ethyl 6-bromo-5-methoxyindole-2-carboxylate | AG000Y7C | 1.25g |
| 128577-48-0 | O=C(OC)C1=CC=C(CBr)C=C1Br | METHYL-2-BROMO-4-BROMOMETHYLBENZOATE | AG000Y7J | 191g |
| 128577-47-9 | O=C(OC)C1=CC=C(CBr)C(F)=C1 | Methyl 4-(bromomethyl)-3-fluorobenzoate | AG000Y7K | 120g |
| 128575-34-8 | C1=CC=C2C(=C1)C=CC(=C2C3=C(C=CC4=CC=CC=C43)OS(=O)(=O)C(F)(F)F)OS(=O)( | [1,1′-Binaphthalene]-2,2′-diyl bis(trifluoromethanesulfonate) | AG000Y7M | 400g |
| 128573-76-2 | Cl.C12NCC(CC1O)CC2 | 2-Azabicyclo[2.2.2]Octan-6-Ol Hydrochloride | AG000Y7P | 1g |
| 128573-13-7 | OC(=O)[C@@H](Cc1ccc(cc1C)O)N | D-Tyrosine, 2-methyl- | AG000Y7S | 2g |
| 128564-66-9 | BrC=1C=C2C=CN(C2=CC1)[Si](C(C)C)(C(C)C)C(C)C | 5-Bromo-1-(triisopropylsilyl)-1H-indole | AG000Y7U | 10g |
| 1286189-16-9 | Oc1c(ccc2c1C1(CC2)CCc2c1c(O)c(cc2)c1cc(cc(c1)C(F)(F)F)C(F)(F)F)c1cc(cc(c1)C(F) | (1R)-6,6′-Bis[3,5-bis(trifluoromethyl)phenyl]-2,2′,3,3′-tetrahydro-1,1′-spirobi[ | AG000Y7W | 0.75g |
| 128620-82-6 | CC1(C(N[C@@H](CSSC1)C(=O)O)=O)C | (R)-7,7-Dimethyl-6-oxo-1,2,5-dithiazocane-4-carboxylic acid | AG000Y81 | 0.2g |
| 128619-83-0 | CCCCc1ccc(Br)s1 | 2-Bromo-5-butylThiophene | AG000Y82 | 50g |
| 128619-01-2 | N(C(=O)OC(C)(C)C)c1cc(N)ncc1 | tert-Butyl (2-aminopyridin-4-yl)carbamate | AG000Y83 | 35g |
| 128611-93-8 | O=C(N1OC(OCC2=CC=CC=C2Br)=O)CCC1=O | N-(2-Bromobenzyloxycarbonyloxy)succinimide | AG000Y8A | 50g |
| 128595-07-3 | O=C(OC1CCCC1)ON1C(=O)CCC1=O | N-(Cyclopentyloxycarbonyloxy)succinimide | AG000Y8J | 500g |
| 1286281-32-0 | O=C(OC(C)(C)C)CCOCCOCCOCCOCCOCCOCCN | 4,7,10,13,16,19-Hexaoxaheneicosanoic acid, 21-amino-, 1,1-dimethylethyl est | AG000Y8L | 7.95g |
| 1289387-43-4 | O=C(N1CC(C)NCC1)C2=C(C)C=CS2.[H]Cl | (3-Methylpiperazin-1-yl)(3-methylthiophen-2-yl)methanone hydrochloride | AG000YMF | 0.3g |
| 1289387-38-7 | O=C(C1CN(CC2=CC=CC=C2F)C1)O | 1-(2-FLUOROBENZYL)AZETIDINE-3-CARBOXYLIC ACID | AG000YMJ | 0.5g |
| 1289387-32-1 | FC1=CN=C(NC2CC2)N=C1 | N-Cyclopropyl-5-fluoropyrimidin-2-amine | AG000YMM | 0.5g |
| 1289387-30-9 | COCC1=NC(Cl)=NC=C1 | 2-Chloro-4-(methoxymethyl)pyrimidine | AG000YMO | 15g |
| 1289388-13-1 | N#CC1=CC=CC=C1CN2CCC(N)CC2.[H]Cl | 2-((4-Aminopiperidin-1-yl)methyl)benzonitrile hydrochloride | AG000YN2 | 0.2g |
| 1289387-96-7 | COCC1=CC(Br)=NC=C1 | 2-Bromo-4-(methoxymethyl)pyridine | AG000YN7 | 5g |
| 1289387-80-9 | CC1=CC=CC=C1CNCC2NCCC2.Cl | N-(2-Methylbenzyl)-1-(pyrrolidin-2-yl)methanamine hydrochloride | AG000YNE | 0.5g |
| 1289387-79-6 | O=C(OC(C)(C)C)NC1C(NC2=NC=C(C)C(Cl)=N2)CCCC1 | tert-Butyl (2-((4-chloro-5-methylpyrimidin-2-yl)amino)cyclohexyl)carbamate | AG000YNF | 0.5g |
| 1289387-75-2 | O=C(OC(C)(C)C)NCC1CCN(C(C2=NC=CS2)C)CC1 | tert-Butyl ((1-(1-(thiazol-2-yl)ethyl)piperidin-4-yl)methyl)carbamate | AG000YNH | 0.5g |
| 1289387-58-1 | CC1=CC=C(C=C1)CNCC2NCCCC2.[H]Cl | N-(4-Methylbenzyl)-1-(piperidin-2-yl)methanamine hydrochloride | AG000YNK | 0.5g |
| 1289387-56-9 | Cl.CC1=C(CN2CC(CCC2)CN)C=CC=C1 | (1-(2-Methylbenzyl)Piperidin-3-Yl)Methanamine Hydrochloride | AG000YNL | 0.5g |
| 1289387-50-3 | BrC1=CC=C(CNC2CC2)C=N1 | (6-Bromo-pyridin-3-ylmethyl)-cyclopropyl-amine hydrochloride | AG000YNO | 0.2g |
| 1289388-57-3 | O=C(N1CC(C)N(C2=NC(Br)=CC=C2)CC1)OC(C)(C)C | tert-Butyl 4-(6-bromopyridin-2-yl)-3-methylpiperazine-1-carboxylate | AG000YNR | 0.5g |
| 1289388-55-1 | O=C(N1C(CNC(C2=NC=CC=C2)C)CCC1)OC(C)(C)C | tert-Butyl 2-(((1-(pyridin-2-yl)ethyl)amino)methyl)pyrrolidine-1-carboxylate | AG000YNT | 1.25g |
| 1289388-37-9 | O=C(N1CC(CSC2=CC=C(F)C=C2)CCC1)OC(C)(C)C | 3-(4-Fluoro-phenylsulfanylmethyl)-piperidine-1-carboxylic acid tert-butyl est | AG000YO2 | 11g |
| 1289388-32-4 | N#CC1=CC=CC=C1CN2CC(N)CCC2.[H]Cl | 2-((3-Aminopiperidin-1-yl)methyl)benzonitrile hydrochloride | AG000YO7 | 2g |
| 1289388-17-5 | O=C(N1CC(CSC2=CC=C(Cl)C=C2)CCC1)OC(C)(C)C | tert-Butyl 3-(((4-chlorophenyl)thio)methyl)piperidine-1-carboxylate | AG000YOC | 0.5g |
| 128446-34-4 | Cc1ccc(c(c1)F)[N+](=O)[O-] | γ-Cyclodextrin, 2-hydroxypropyl ethers | AG000Y46 | 400g |
| 128446-32-2 | C(CO[C@H]1[C@@H]([C@H]2[C@H](O[C@@H]1O[C@@H]3[C@H](O[C@@H]([ | (2-Hydroxyethyl)-β-cyclodextrin | AG000Y48 | 250g |
| 128495-46-5 | O(C)c1cc(C=O)ccc1F | Benzaldehyde, 4-fluoro-3-methoxy- | AG000Y4N | 2000g |
| 128495-45-4 | OCC1=CC=C(F)C(OC)=C1 | 4-Fluoro-3-methoxybenzyl alcohol | AG000Y4O | 200g |
| 128486-09-9 | CC(CC(C1=CC=CC(Cl)=C1)=O)=O | 1-(3-Chlorophenyl)butane-1,3-dione | AG000Y4R | 2g |
| 128470-16-6 | O[C@H](C1=CC(O)=C(O)C=C1)CNCCCCC1=CC=C(O)C=C1 | 4-[(1R)-1-hydroxy-2-{[4-(4-hydroxyphenyl)butyl]amino}ethyl]benzene-1,2-di | AG000Y4Z | 0.001g |
| 128459-09-6 | CON(C(C)=O)C(C)=O | N-Methoxydiacetamide | AG000Y52 | 2g |
| 128517-07-7 | C/C=C(NC([C@@H](CSSCC/C=C/[C@@H](O1)CC2=O)NC([C@@H](C(C)C)N2)=O) | Romidepsin | AG000Y5C | 0.2g |
| 128507-76-6 | COC(OC)c1cccc(Br)n1 | 2-Bromo-6-(dimethoxymethyl)pyridine | AG000Y5G | 25.9g |
| 128544-05-8 | O=S(C(F)(F)F)(OC1=CC=C2C=CC=CC2=[C@@]1[C@@]3=C4C=CC=CC4=CC=C3OS(C | (S)-[1,1-Binaphthalene]-2,2-diyl bis(trifluoromethanesulfonate) | AG000Y5U | 200g |
| 128542-75-6 | CC(C)(C)OC(=O)N1CCC[C@H]1CBr | (S)-tert-Butyl 2-(bromomethyl)pyrrolidine-1-carboxylate | AG000Y5V | 25g |
| 128537-26-8 | CCOC(=O)c1cc(nn1C)CC | Ethyl 3-ethyl-1-methyl-1H-pyrazole-5-carboxylate | AG000Y66 | 10g |
| 128533-02-8 | COc1c(O)cc2c3c1c1ccccc1cc3N(C2=O)C | Dibenz[cd,f]indol-4(5H)-one, 2-hydroxy-1-methoxy-5-methyl- | AG000Y6C | 0.04g |
| 1285603-68-0 | NC1=NC(Cl)=CC(=C1)N1CCOCC1 | 2-Amino-6-chloro-4-morpholinopyridine | AG000Y6I | 5g |
| 1285573-82-1 | N#CC1=CC(C(OC)=O)=CC(Cl)=C1O | Methyl 3-chloro-5-cyano-4-hydroxybenzoate | AG000Y6J | 1g |
| 1285515-21-0 | O=C(NC1=CC=CN=C1)C2=CC(C3=CC(F)=NC=C3)=CC=C2OCC4=CC=CC=C4 | GSK2578215A | AG000Y6K | 1g |
| 1282516-32-8 | COCOc1cnc(cc1C=O)Cl | 4-Pyridinecarboxaldehyde, 2-chloro-5-(methoxymethoxy)- | AG000XWG | 10g |
| 1282512-48-4 | O=C(N)C(C)(C)N1N=CC(C2=CC=C3C4=NC(C5=NC(C)=NN5C(C)C)=CN4CCOC3=C2)= | GDC-0032 | AG000XWI | 0.2g |
| 128253-31-6 | C1=CC=C2N=C(COC3C=CC([C@H](C(O)=O)C4CCCC4)=CC=3)C=CC2=C1 | 2-Cyclopentyl-2-(2-((4-formylquinolin-2-yl)methoxy)phenyl)acetic acid | AG000XWK | 0.025g |
| 128249-70-7 | C1(=N[C@@H](CO1)c1ccccc1)c1nc(ccc1)C1=N[C@@H](CO1)c1ccccc1 | Pyridine, 2,6-bis[(4R)-4,5-dihydro-4-phenyl-2-oxazolyl]- | AG000XWO | 150g |
| 128244-01-9 | C(N1C2(CCNC2)CCC1)c1ccccc1 | 1,7-Diazaspiro[4.4]nonane, 1-(phenylmethyl)- | AG000XWS | 2g |
| 128244-00-8 | O=C1NCCC21CCCN2C(=O)c1ccccc1 | 1-Benzoyl-1,7-diazaspiro[4.4]nonan-6-one | AG000XWT | 0.5g |
| 128261-84-7 | O=C(N1CCCCC1)/C=C/C2=CC=C(OC)C(OC)=C2 | 1-(3,4-Dimethoxycinnamoyl)piperidine | AG000XWY | 0.005g |
| 128259-68-7 | FC1=CC(Br)=C(F)C(Br)=C1 | 1,3-Dibromo-2,5-difluorobenzene | AG000XX5 | 200g |
| 128259-63-2 | N#CC1=CC2=CC=C(OC)C=C2N=C1Cl | 2-Chloro-7-Methoxyquinoline-3-Carbonitrile | AG000XX6 | 2g |
| 128259-47-2 | CCOC(=O)c1ccn(Cc2ccccc2)c1 | 1-Benzylpyrrole-3-Carboxylic Acid Ethyl Ester | AG000XX9 | 5g |
| 128255-16-3 | CN([C@H]([C@H]1CC[C@@H]2[C@]1(C)CC[C@H]1[C@H]2CC[C@@H]2[C@]1(C | Axillaridine A | AG000XXH | 0.005g |
| 128293-64-1 | CN1C=C(NC(=O)OC(C)(C)C)N=C1C(O)=O | 4-{[(tert-butoxy)carbonyl]amino}-1-methylimidazole-2-carboxylic acid | AG000XXM | 10g |
| 128293-63-0 | O=C(C1=NC(NC(OC(C)(C)C)=O)=CN1C)OCC | Ethyl 4-((tert-butoxycarbonyl)amino)-1-methyl-1H-imidazole-2-carboxylate | AG000XXN | 25g |
| 128276-50-6 | COC1=NC(C(O)=O)=NC(OC)=C1 | 4，6-Dimethoxypyrimidine-2-carboxylic acid | AG000XXS | 125g |
| 128273-56-3 | NCC1=CC=C(SC(F)(F)F)C=C1 | (4-((Trifluoromethyl)thio)phenyl)methanamine | AG000XXX | 25g |
| 128272-26-4 | O=C(OC)C1=CC=C(OC)C=C1F | Methyl 2-fluoro-4-methoxybenzoate | AG000XXY | 50g |
| 1284-72-6 | [C-]1=CC=CC1.[C-]1=CC=CC1.[Mg+2] | Magnesocene | AG000Y2C | 5g |
| 1284250-10-7 | Cl.N[C@@H]1C[C@@H](CO)C1 | trans-3-amino-cyclobutanemethanol hydrochloride | AG000Y2D | 25g |
| 1284248-73-2 | O[C@H]1C[C@@H](N)CC1.[H]Cl | Rac-cis-3-aminocyclopentan-1-ol hydrochloride | AG000Y2E | 5g |
| 1284247-23-9 | NC1CC(C)(C)C1.[H]Cl | 3,3-Dimethylcyclobutanamine hydrochloride | AG000Y2F | 10g |
| 1284245-36-8 | NC1CC(F)C1.[H]Cl | 3-Fluorocyclobutanamine hydrochloride | AG000Y2G | 10g |
| 1284220-49-0 | NC1=NNC(C(F)F)=C1 | 5-(difluoroMethyl)-1H-pyrazol-3-aMine | AG000Y2N | 25g |
| 1284180-11-5 | O=C(O)C1=CC=CC(NC2=CC=C(C(F)(F)F)C=C2)=C1 | 3-((4-(Trifluoromethyl)phenyl)amino)benzoic acid | AG000Y2P | 2g |
| 128427-10-1 | N([C@@H](CCO)CO)C(=O)OC(C)(C)C | Carbamic acid, N-[(1S)-3-hydroxy-1-(hydroxymethyl)propyl]-, 1,1-dimethylet | AG000Y3F | 20g |
| 128427-07-6 | Cl.Cl.CC1(C)CNCCN1 | 2,2-Dimethyl-piperazine dihydrochloride | AG000Y3G | 50g |
| 128427-05-4 | Cl.Cl.N1CCNC[C@@H]1CC | (S)-2-Ethyl-piperazine | AG000Y3I | 35g |
| 98320-39-9 | C(=C1/C2C=CC=CC=2C=C(OC)C2SC=CC/1=2)C(=O)O | Ix 207-887 | AG000Y3Q | 0.05g |
| 128455-63-0 | CN1C(Cl)=C(C(O)=O)C(C(F)(F)F)=N1 | 5-Chloro-1-methyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid | AG000Y3R | 5g |
| 128455-62-9 | CN1N=C(C(C=O)=C1Cl)C(F)(F)F | 5-Chloro-1-methyl-3-(trifluoromethyl)-1H-pyrazole-4-carbaldehyde | AG000Y3S | 200g |
| 128454-20-6 | CN(CC1NCCOC1)C | N,N-Dimethyl-1-(morpholin-3-yl)methanamine | AG000Y3X | 1g |
| 128453-98-5 | O=C(C1N(C(OC(C)(C)C)=O)CCSC1)O | 4-(tert-Butoxycarbonyl)thiomorpholine-3-carboxylic acid | AG000Y3Z | 10g |
| 128446-36-6 | C1(CO%91)O[C@H](OC)C(O%92)[C@H](O%93)[C@H]1C.[*]%93.[*]%91.[*]%92. | Methylated-β-Cyclodextrin | AG000Y44 | 2500g |
| 128446-35-5 | O[C@@H]1[C@@H](O[C@@H]2O[C@@H](COCC(O)C)[C@H](O[C@@H]3O[C@ | 2-Hydroxypropyl-β-cyclodextrin | AG000Y45 | 6448.6g |
| 1286264-78-5 | O=[N+](C1=CC=CC=C1NCC2CCNCC2)[O-].[H]Cl | 2-Nitro-N-(piperidin-4-ylmethyl)aniline hydrochloride | AG000Y8S | 0.3g |
| 1286230-78-1 | FC1=CC=C(C=C1)C1=NN(C=C1B1OC(C(O1)(C)C)(C)C)C | 3-(4-Fluorophenyl)-1-methyl-4-(4，4，5，5-tetramethyl-1，3，2-dioxabor | AG000Y8V | 3g |
| 128625-52-5 | F[P-](F)(F)(F)(F)F.N1([P+](N2CCCC2)(ON3N=NC4=CC=CC=C43)N5CCCC5)CCCC1 | PyBOP | AG000Y92 | 125g |
| 128648-99-7 | N=C(N)CCO | 3-Hydroxypropanimidamide | AG000Y9M | 0.75g |
| 1286739-19-2 | O=C1C(C2=CC=C(C3=CN=CS3)C=C2Cl)=CC4=CN=C(NC5=CC=C(N6CCN(C)CC6)C=C5 | FRAX597 | AG000YA0 | 0.075g |
| 1286734-96-0 | CN1N=C(I)C2=C1C=C(Br)C(F)=C2 | 6-Bromo-5-fluoro-3-iodo-1-methyl-1H-indazole | AG000YA1 | 5g |
| 1286734-93-7 | CN1N=C(Cl)C2=C1C=C(Br)C(F)=C2 | 6-Bromo-3-chloro-5-fluoro-1-methyl-1H-indazole | AG000YA2 | 0.75g |
| 1286734-91-5 | CN1N=C(Br)C2=C1C=C(Br)C(F)=C2 | 3,6-Dibromo-5-fluoro-1-methyl-1H-indazole | AG000YA3 | 1g |
| 1286734-90-4 | N[C@H]1CCC2=C1C=CC=C2F.[H]Cl | (S)-4-Fluoro-2,3-dihydro-1H-inden-1-amine hydrochloride | AG000YA4 | 0.75g |
| 1286734-89-1 | CC(=O)C1=C(F)C=C(Cl)C(Cl)=C1 | 1-(4,5-Dichloro-2-fluorophenyl)ethan-1-one | AG000YA5 | 2.3g |
| 1286734-88-0 | FC=1C=C2C=NN(C2=CC1C=O)C | 5-Fluoro-1-methyl-1H-indazole-6-carbaldehyde | AG000YA6 | 2g |
| 1286734-87-9 | CN1N=C2C=C(Br)C(F)=CC2=C1 | 6-Bromo-5-fluoro-2-methyl-2H-indazole | AG000YA7 | 10g |
| 1286734-86-8 | CN1N=CC2=C1C=C(Br)C(F)=C2 | 6-BROMO-5-FLUORO-1-METHYL-1H-INDAZOLE | AG000YA8 | 1g |
| 1281025-81-7 | O=C(N1CCC(N)CC1)C2COC3=CC=CC=C3O2.[H]Cl | (4-Aminopiperidin-1-yl)(2,3-dihydrobenzo[b][1,4]dioxin-2-yl)methanone hy | AG000XSR | 5g |
| 128117-22-6 | OC1CN(C(OCC2=CC=CC=C2)=O)C1 | 1-Cbz-3-Hydroxyazetidine | AG000XSX | 10500g |
| 128107-47-1 | C(OC(N[C@H](COC(C)(C)C)C(O)=O)=O)C1C=2C(C=3C1=CC=CC3)=CC=CC2 | Fmoc-D-Ser(tBu)-OH | AG000XT4 | 2500g |
| 128102-16-9 | O=C(N1C[C@@H](C)N(C(OC(C)(C)C)=O)CC1)OCC2=CC=CC=C2 | (R)-1-Boc-4-cbz-2-methylpiperazine | AG000XT8 | 1.25g |
| 128101-19-9 | FC1=CC=C(C2=CN=CO2)C=C1 | 5-(4-Fluorophenyl)oxazole | AG000XTB | 1.75g |
| 128143-89-5 | ClC1=CC(C2=NC=CC=C2)=NC(C3=NC=CC=C3)=C1 | 4′-Chloro-2,2′:6′,2”-terpyridine | AG000XTS | 50g |
| 128143-88-4 | O=C1C=C(C2=NC=CC=C2)NC(C3=NC=CC=C3)=C1 | 2,6-Bis(2-pyridyl)-4(1H)-pyridone | AG000XTT | 10g |
| 128140-82-9 | IC1=CC=C(OC(F)F)C=C1 | 1-(Difluoromethoxy)-4-iodobenzene | AG000XTV | 400g |
| 128133-59-5 | C(C1=CC=CC=C1)OC1=CC(=CC=C1)C#C | 1-(Benzyloxy)-3-ethynylbenzene | AG000XU0 | 5g |
| 1281674-64-3 | CC1NCCC(NC(OC(C)(C)C)=O)C1 | (2-Methyl-piperidin-4-yl)-carbamic acid tert-butyl ester | AG000XU6 | 1g |
| 128196-01-0 | CN(C)CCC[C@@]1(C2=CC=C(F)C=C2)OCC3=CC(C#N)=CC=C31 | Escitalopram | AG000XU8 | 2g |